| |  C/D/N Isotopes Inc. |

Country: Canada
C/D/N Isotopes Inc. 88 Leacock Street Pointe-Claire, Quebec Canada H9R 1H1
|
http://www.cdnisotopes.com |
|
Since 1993, C/D/N Isotopes has been a leading manufacturer of deuterium stable labeled compounds, providing our customers with superior quality and exceptional service. Researchers in all branches of science and medicine, from around the world, depend on us as the company for deuterium labeled compounds.We have more than 3000 products in stock. As a result, we are able to ship most products within 24 to 48 hours after receipt of order. In fact, 98% of our orders are filled from stock. The majority of the products listed on our website are manufactured exclusively by C/D/N Isotopes. Over the years, we have developed and expanded our expertise in the preparation of deuterated compounds, and we are continuously adding new products. Most new products are the direct result of inquiries from our customers. Our extensive Custom Synthesis capabilities allow us to develop the products that our customers need, in a timely manner and at a reasonable price. Our Quality Control ensures that the isotopic enrichment and chemical purity of our products meet the highest standards. Our courteous and helpful Customer Service professionals are available to assist you with all your stable labeled product requirements. |
Product List: 3,033
PON:Page:1 | 2 | 3 |
|
| |
Products for C/D/N Isotopes Inc. | Δ8,9-DEHYDRO-17β-ESTRADIOL-16,16,17-D3 D-5175 MW: 273.39 97 atom % D | Δ8,9-DEHYDROESTRONE-16,16-D2 D-5174 MW: 270.37 96 atom % D | α,α′-DIBROMO- P -XYLENE-D8 CAS:74903-77-8 Formula: C6D4(CD2Br)2 D-6542 MW: 272.01 98 atom % D | α,α,α-TRICHLOROTOLUENE-D5 CAS:93232-45-2 Formula: C6D5CCl3 D-6533 MW: 200.51 99 atom % D | α,α,α-TRIFLUOROTOLUENE-D5 CAS:164112-72-5 Formula: C6D5CF3 D-5716 MW: 151.14 99 atom % D | α-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6 CAS:86194-41-4 Formula: C6Cl6D6 D-3009 MW: 296.87 99 atom % D | α-AMINO- ISO -BUTYRIC-D6 ACID (DIMETHYL-D6) CAS:50348-93-1 Formula: (CD3)2C(NH2)COOH D-6773 MW: 109.16 99 atom % D | α-HYDROXYMETOPROLOL (UNLABELLED) (MIXTURE OF STEREOISOMERS) CAS:56392-16-6 X-5681 MW: 283.37 -- | α-HYDROXYMETOPROLOL-D7 ( ISO -PROPYL-D7) (MIXTURE OF STEREOISOMERS) CAS:1276197-39-7 D-7159 MW: 290.41 99 atom % D | α-METHYLSTYRENE-D10 (STABILIZED WITH HYDROQUINONE) CAS:10362-82-0 Formula: C6D5C(CD3)=CD2 D-5333 MW: 128.24 98 atom % D | α-TERPINEOL-D3 (PROPYL METHYL-D3) CAS:203633-12-9 D-2707 MW: 157.27 98 atom % D | β-ALANINE-2,2,3,3-D4 CAS:116173-67-2 Formula: H2NCD2CD2COOH D-6498 MW: 93.12 98 atom % D | β-IMINODI(PROPIONIC-2,2,3,3-D4 ACID) CAS:1219803-81-2 Formula: HN(CD2CD2COOH)2 D-6861 MW: 169.21 98 atom % D | γ-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6 CAS:60556-82-3 Formula: C6Cl6D6 D-3010 MW: 296.87 99 atom % D | δ-VALEROLACTONE-3,3,4,4-D4 CAS:42932-61-6 D-5271 MW: 104.14 98 atom % D | ε-CAPROLACTAM-D10 CAS:169297-53-4 D-5253 MW: 123.22 98 atom % D | ε-CAPROLACTONE-3,3,4,4,5,5-D6 CAS:1219802-08-0 D-6111 MW: 120.18 99 atom % D | ( E )-MYCOPHENOLATE MOFETIL-D4 (MORPHOLINYLETHYL-D4) CAS:1132748-21-0 D-7150 MW: 437.52 99 atom % D | ( E , Z )-METHOMYL-D3 (N-METHYL-D3) CAS:1398109-07-3 D-7454 MW: 165.22 99 atom % D | ( R )-(-)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7 D-7569 MW: 134.23 98 atom % D | ( R )-(-)-ATOMOXETINE-D5 HCL (PHENYL-D5) D-7502 MW: 296.85 98 atom % D | ( R )-(-)-METALAXYL-D6 (2,6-DIMETHYL-D6) CAS:1398112-32-7 D-7345 MW: 285.37 99 atom % D | ( R )-(-)-PHENYLEPHRINE-2,4,6-D3 HCL CAS:1276197-50-2 D-6658 MW: 206.69 97 atom % D | ( R )-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL D-7495 MW: 165.6 96 atom % D | ( RS )-MALIC-2,3,3-D3 ACID CAS:104596-63-6 Formula: HOOCCD2CD(OH)COOH D-2122 MW: 137.11 98 atom % D | ( S )-(+)-2-AMINO-1-PROPANOL-3,3,3-D3 CAS:352438-84-7 Formula: CD3CH(NH2)CH2OH D-5164 MW: 78.13 99 atom % D | ( S )-(+)-PREGABALIN-D4 (AMINOMETHYL-D2; HEXANOIC-2,2-D2 ACID) CAS:1276197-54-6 D-6921 MW: 163.25 98 atom % D | ( S )-(+)-REPAGLINIDE-D5 (ETHOXY-D5) CAS:1217709-85-7 D-7124 MW: 457.62 99 atom % D | ( S )-(-)-CARBIDOPA-D3 H2O (RING-D3) Formula: (HO)2C6D3CH2C(CH3)(NHNH2)COOH D-6406 MW: 247.27 98 atom % D | ( S )-(-)-MALIC-2,3,3-D3 ACID CAS:59652-74-3 Formula: HOOCCD2CD(OH)COOH D-6626 MW: 137.11 98 atom % D | ( S )-(-)-OFLOXACIN-D3 (N-METHYL-D3) D-7516 MW: 364.39 99 atom % D | ( S )-(-)-VALSARTAN-D8 (VALINE-D8) CAS:1089736-72-0 D-6842 MW: 443.57 98 atom % D | ( S )-(-)-VERAPAMIL-D3 HCL (N-METHYL-D3) CAS:1398112-33-8 D-7403 MW: 494.09 99 atom % D | ( S )-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL CAS:1398112-31-6 D-7459 MW: 165.6 94 atom % D | ( S )-PRAMIPEXOLE-D7 2HCL (N-PROPYL-D7) D-7499 MW: 291.29 99 atom % D | (±)- CIS -SERTRALINE-D3 HCL (N-METHYL-D3) CAS:1217741-83-7 D-7402 MW: 345.71 99 atom % D | (±)- P -OCTOPAMINE-α,β,β-D3 HCL CAS:1219803-62-9 Formula: HOC6H4CD(OH)CD2NH2 D-1774 MW: 192.66 98 atom % D | (±)- SEC -BUTYL-1,1,1-D3 ALCOHOL CAS:53716-61-3 Formula: CH3CH2CH(OH)CD3 D-1064 MW: 77.14 99 atom % D | (±)- SEC -BUTYL-3,3,4,4,4-D5 ALCOHOL CAS:75749-92-7 Formula: CD3CD2CH(OH)CH3 D-1063 MW: 79.15 99 atom % D | (±)- SEC -BUTYL-D9 ALCOHOL CAS:1202864-22-9 Formula: CD3CD2CD(OH)CD3 D-5841 MW: 83.18 98 atom % D | (±)- TRANS -SERTRALINE-D3 HCL (N-METHYL-D3) CAS:1330180-66-9 D-7473 MW: 345.71 99 atom % D | (±)-(1-BROMOETHYL-2,2,2-D3)BENZENE CAS:23088-42-8 Formula: C6H5CH(Br)CD3 D-6134 MW: 188.08 98 atom % D | (±)-1,2-BIS-HEXADECANOYL-3-CHLOROPROPANE-D5-DIOL CAS:1185057-55-9 D-7429 MW: 592.4 98 atom % D | (±)-1,2-DIBROMOPROPANE-D6 CAS:51209-47-3 Formula: CD3CD(Br)CD2Br D-1712 MW: 207.93 98 atom % D | (±)-1,2-DICHLOROPROPANE-D6 CAS:93952-08-0 Formula: CD3CDClCD2Cl D-2363 MW: 119.02 98 atom % D | (±)-1,2-ISOPROPYLIDENEGLYCEROL-1,1,2,3,3-D5 CAS:74300-14-4 D-7596 MW: 137.19 98 atom % D | (±)-1,2-PROPANE-1,1,2-D3-DIAMINE Formula: CH3CD(NH2)CD2NH2 D-7562 MW: 77.14 99 atom % D | (±)-1,2-PROPANE-D6-DIOL CAS:52910-80-2 Formula: CD3CD(OH)CD2OH D-1507 MW: 82.13 98 atom % D | (±)-1,2-PROPANEDIOL-(OD)2 CAS:58161-11-8 Formula: CH3CH(OD)CH2OD D-386 MW: 78.11 98 atom % D | (±)-1,2-PROPANEDIOL-D8 CAS:80156-55-4 Formula: CD3CD(OD)CD2OD D-1656 MW: 84.14 98 atom % D | (±)-1,2-PROPYLENE-3,3,3-D3 OXIDE (STABILIZED WITH HYDROQUINONE) CAS:2245-32-1 D-83 MW: 61.1 99 atom % D | (±)-1,2-PROPYLENE-D6 CARBONATE CAS:202480-74-8 D-5545 MW: 108.13 98 atom % D | (±)-1,2-PROPYLENE-D6 OXIDE (STABILIZED WITH HYDROQUINONE) CAS:202468-69-7 D-1915 MW: 64.12 98 atom % D | (±)-1,4-DITHIOTHREITOL-1,1,2,3,4,4-D6 Formula: HSCD2CD(OH)CD(OH)CD2SH D-6631 MW: 160.27 98 atom % D | (±)-1,4-DITHIOTHREITOL-D10 CAS:302912-05-6 Formula: DSCD2CD(OD)CD(OD)CD2SD D-3931 MW: 164.3 97 atom % D | (±)-1-AMINO-2-PHENYL-D5-PROPANE-2,3,3,3-D4 D-7595 MW: 144.26 98 atom % D | (±)-1-AMINO-2-PROPANOL-1,1,2,3,3,3-D6 CAS:1219795-13-7 Formula: CD3CD(OH)CD2NH2 D-6277 MW: 81.15 98 atom % D | (±)-1-BROMO-2-ETHYL-3-METHYL-D3-BUTANE-3,4,4,4-D4 CAS:1219805-84-1 Formula: (CD3)2CDCH(CH2CH3)CH2Br D-6383 MW: 186.14 99 atom % D | (±)-1-PHENYL-D5-ETHANOL CAS:90162-45-1 Formula: C6D5CH(OH)CH3 D-737 MW: 127.19 98 atom % D | (±)-1-PHENYLETHAN-1,2,2,2-D4-OL CAS:90162-44-0 Formula: C6H5CD(OH)CD3 D-739 MW: 126.19 98 atom % D | (±)-1-PHENYLETHAN-1-D1-OL CAS:3101-96-0 Formula: C6H5CD(OH)CH3 D-2124 MW: 123.17 98 atom % D | (±)-1-PHENYLETHAN-2,2,2-D3-OL CAS:17537-32-5 Formula: C6H5CH(OH)CD3 D-627 MW: 125.18 98 atom % D | (±)-1-PHENYLETHANOL-D10 CAS:219586-41-1 Formula: C6D5CD(OD)CD3 D-1912 MW: 132.23 98 atom % D | (±)-18-METHYL-D3-EICOSANOIC ACID Formula: CH3CH2CH(CD3)(CH2)16COOH D-7533 MW: 329.58 99 atom % D | (±)-2-(2,4-DICHLOROPHENOXY-D3)PROPIONIC ACID CAS:1219803-66-3 D-7117 MW: 238.08 98 atom % D | (±)-2-(4-CHLORO-2-METHYLPHENOXY-D3)PROPIONIC ACID CAS:352431-15-3 D-5321 MW: 217.67 98 atom % D | (±)-2-(ETHYL-D5-AMINO)PROPIOPHENONE HCL CAS:1189879-32-0 Formula: C6H5COCH(CH3)NHCD2CD3HCl D-7094 MW: 218.74 99 atom % D | (±)-2-AMINOHEXANE-1,1,1,2,3,3-D6 CAS:1219802-28-4 Formula: CH3CH2CH2CD2CD(NH2)CD3 D-6783 MW: 107.23 98 atom % D | (±)-2-BROMOBUTANE-D9 CAS:202392-72-1 Formula: CD3CD2CD(Br)CD3 D-5906 MW: 146.07 99 atom % D | (±)-2-BROMOBUTYRIC-2,3,3,4,4,4-D6 ACID CAS:1219799-08-2 Formula: CD3CD2CD(Br)COOH D-5580 MW: 173.04 98 atom % D | (±)-2-BROMOPROPIONIC-2,3,3,3-D4 ACID CAS:60153-93-7 Formula: CD3CD(Br)COOH D-5598 MW: 157 98 atom % D | (±)-2-BROMOPROPIONIC-3,3,3-D3 ACID Formula: CD3CH(Br)COOH D-7676 MW: 155.99 98 atom % D | (±)-2-CHLOROBUTANE-D9 CAS:175540-77-9 Formula: CD3CD2CD(Cl)CD3 D-6683 MW: 101.62 98 atom % D | (±)-2-CHLOROBUTYRIC-2,3,3,4,4,4-D6 ACID CAS:1219802-13-7 Formula: CD3CD2CD(Cl)COOH D-5600 MW: 128.59 98 atom % D | (±)-2-CHLOROPROPIONYL-2,3,3,3-D4 CHLORIDE CAS:1219794-98-5 Formula: CD3CD(Cl)COCl D-6198 MW: 130.99 98 atom % D | (±)-2-ETHYLHEXANOIC-D15 ACID CAS:352431-38-0 Formula: CD3(CD2)3CD(CD2CD3)COOH D-5246 MW: 159.3 98 atom % D | (±)-2-ETHYLHEXYL-D17 ACETATE CAS:1219802-70-6 Formula: CD3(CD2)3CD(CD2CD3)CD2OCOCH3< D-6583 MW: 189.37 98 atom % D | (±)-2-ETHYLHEXYL-D17 ALCOHOL CAS:202480-75-9 Formula: CD3(CD2)3CD(CD2CD3)CD2OH D-5247 MW: 147.33 98 atom % D | (±)-2-HYDROXYHEXANOIC-6,6,6-D3 ACID CAS:1219798-84-1 Formula: CD3CH2CH2CH2CH(OH)COOH D-6443 MW: 135.18 99 atom % D | (±)-2-IODOBUTANE-D9 (STABILIZED WITH COPPER) CAS:1219795-41-1 Formula: CD3CD2CD(l)CD3 D-5900 MW: 193.07 99 atom % D | (±)-2-METHYL-2,4-PENTANE-D12-DIOL CAS:284474-72-2 Formula: CD3CD(OH)CD2C(CD3)2OH D-5825 MW: 130.25 98 atom % D | (±)-2-METHYL-D3-BUTYRIC ACID CAS:95926-92-4 Formula: CH3CH2CH(CD3)COOH D-7535 MW: 105.15 99 atom % D | (±)-2-METHYL-D3-PIPERAZINE-2,3,3,5,5,6,6-D7 D-6622 MW: 110.22 99 atom % D | (±)-2-METHYL-D3-SUCCINIC-2,3,3-D3 ACID CAS:347840-08-8 Formula: HOOCCD(CD3)CD2COOH D-3588 MW: 138.15 98 atom % D | (±)-2-METHYLBUTYRIC-D9 ACID CAS:352431-44-8 Formula: CD3CD2CD(CD3)COOH D-5267 MW: 111.19 98 atom % D | (±)-2-METHYLBUTYRYL-D9 CHLORIDE CAS:1219795-10-4 Formula: CD3CD2CD(CD3)COCl D-5463 MW: 129.63 98 atom % D | (±)-2-METHYLPIPERAZINE-2,3,3,5,5,6,6-D7 CAS:1219802-98-8 D-6609 MW: 107.21 98 atom % D | (±)-2-PENTYL-1,1,1,3,3-D5 ALCOHOL CAS:14629-70-0 Formula: CH3CH2CD2CH(OH)CD3 D-5139 MW: 93.18 98 atom % D | (±)-3-(2-METHOXY-D3-PHENOXY)-1,2-PROPANEDIOL CAS:1189924-85-3 D-5793 MW: 201.24 99 atom % D | (±)-3-(4-METHYLBENZYLIDINE-D4)CAMPHOR CAS:1219806-41-3 D-6964 MW: 258.4 98 atom % D | (±)-3-AMINO- ISO -BUTYRIC-2,3,3-D3 ACID CAS:1219803-65-2 Formula: H2NCD2CD(CH3)COOH D-7229 MW: 106.14 98 atom % D | (±)-3-CHLORO-1,2-PROPANE-D5-DIOL CAS:342611-01-2 Formula: ClCD2CD(OH)CD2OH D-1842 MW: 115.57 98 atom % D | (±)-3-METHYLOCTANE-D20 CAS:345909-08-2 Formula: CD3(CD2)4CD(CD3)CD2CD3 D-3024 MW: 148.38 98 atom % D | (±)-3-METHYLPENTANOIC-D11 ACID Formula: CD3CD2CD(CD3)CD2COOH D-7619 MW: 127.23 99 atom % D | (±)-3-PYRROLIDINOL-2,2,3,4,4-D5 CAS:1219805-52-3 D-5661 MW: 92.15 97 atom % D | (±)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7 D-7560 MW: 134.23 99 atom % D | (±)-4-HYDROXY-3-METHOXY-D3-MANDELIC ACID CAS:74495-70-8 D-3919 MW: 201.19 99 atom % D | (±)-4-HYDROXY-3-METHOXYMANDELIC-α-D1 ACID CAS:53587-34-1 Formula: HO(CH3O)C6H3CD(OH)COOH D-1845 MW: 199.18 93 atom % D | (±)-4-HYDROXYPROPRANOLOL HCL (UNLABELLED) CAS:14133-90-5 X-4329 MW: 311.81 -- | (±)-4-HYDROXYPROPRANOLOL-D7 HCL ( ISO -PROPYL-D7) CAS:1219804-03-1 D-5579 MW: 318.85 99 atom % D | (±)-7-METHYL-D3-NONANOIC ACID Formula: CH3CH2CH(CD3)(CH2)5COOH D-7534 MW: 175.29 99 atom % D | (±)-ACEBUTOLOL-D7 ( ISO -PROPYL-D7) D-7506 MW: 343.47 99 atom % D | (±)-ALBUTEROL-D3 (3-HYDROXYMETHYL-D2; α-D1) CAS:1219798-60-3 D-5921 MW: 242.33 98 atom % D | (±)-ALFUZOSIN-D7 HCL (TETRAHYDROFUROYL-D7) CAS:1276197-14-8 D-7228 MW: 432.96 98 atom % D | (±)-AMBRISENTAN-D3 (METHOXY-D3) CAS:1189479-60-4 D-7366 MW: 381.45 99 atom % D | (±)-AMLODIPINE-D4 MALEATE (2-CHLOROPHENYL-D4) D-7346 MW: 528.98 98 atom % D | (±)-ATENOLOL-D7 ( ISO -PROPYL-D7) CAS:29122-68-7 Formula: (CD3)2CDNHCH2CH(OH)CH2OC6H4CH D-6202 MW: 273.38 98 atom % D | (±)-ATOMOXETINE-D5 HCL (PHENYL-D5) CAS:1398065-95-6 D-7503 MW: 296.85 98 atom % D | (±)-ATROPINE-D3 (N-METHYL-D3) CAS:1276197-36-4 D-1861 MW: 292.39 99 atom % D | (±)-BENZOIN-D10 (DIPHENYL-D10) CAS:56830-64-9 Formula: C6D5COCH(OH)C6D5 D-5839 MW: 222.31 98 atom % D | (±)-BETAXOLOL-D7 HCL (N- ISO -PROPYL-D7) CAS:1219802-92-2 D-7097 MW: 350.94 99 atom % D | (±)-BISOPROLOL-D7 HEMIFUMARATE ( ISO -PROPYL-D7) D-7507 MW: 390.52 99 atom % D | (±)-BUPIVACAINE-D9 (BUTYL-D9) CAS:474668-57-0 D-6933 MW: 297.49 98 atom % D | (±)-BUPROPION-D9 HCL ( TERT -BUTYL-D9) CAS:1189725-26-5 D-6834 MW: 285.26 99 atom % D | (±)-CARAZOLOL-D7 ( ISO -PROPYL-D7) CAS:1173021-02-7 D-7525 MW: 305.43 99 atom % D | (±)-CARAZOLOL-D7 HCL ( ISO -PROPYL-D7) CAS:1276197-44-4 D-7327 MW: 341.89 99 atom % D | (±)-CARBINOXAMINE-D6 MALEATE (N,N-DIMETHYL-D6) D-7564 MW: 412.9 98 atom % D | (±)-CARVEDILOL-D4 (ETHYL-D4) CAS:1133705-56-2 D-6828 MW: 410.5 99 atom % D | (±)-CETIRIZINE-D4 (ETHOXY-D4) CAS:1219803-84-5 D-6100 MW: 392.92 99 atom % D | (±)-CHLOROPHACINONE-D4 (INDANEDIONE-4,5,6,7-D4) CAS:1219805-75-0 D-7082 MW: 378.85 99 atom % D | (±)-CHLORPHENIRAMINE-D6 MALEATE (N,N-DIMETHYL-D6) CAS:1219806-45-7 D-6639 MW: 396.9 98 atom % D | (±)-CITALOPRAM-D4 HBR (4-FLUOROPHENYL-D4) CAS:1219803-58-3 D-6822 MW: 409.33 98 atom % D | (±)-CLENBUTEROL-D9 (TRIMETHYL-D9) CAS:129138-58-5 D-4287 MW: 286.25 99 atom % D | (±)-COTININE-2,4,5,6-D4 (PYRIDINE-D4) CAS:350818-68-7 D-5097 MW: 180.24 98 atom % D | (±)-COTININE-D3 (N-METHYL-D3) CAS:110952-70-0 D-3518 MW: 179.24 98 atom % D | (±)-DESVENLAFAXINE-D6 SUCCINATE HYDRATE (N,N-DIMETHYL-D6) D-7379 MW: 405.52 99 atom % D | (±)-DONEPEZIL-D4 HCL (BIS-METHYLENE-D4) CAS:1219798-88-5 D-6365 MW: 419.98 99 atom % D | (±)-DULOXETINE-D5 OXALATE (N-METHYL-D3; PROPANAMINE-D2) D-7125 MW: 392.48 99 atom % D | (±)-EPICHLOROHYDRIN-2-D1 (STABILIZED WITH HYDROQUINONE) CAS:70735-27-2 D-5370 MW: 93.53 98 atom % D | (±)-EPICHLOROHYDRIN-D5 (STABILIZED WITH HYDROQUINONE) CAS:69533-54-6 D-1194 MW: 97.56 98 atom % D | (±)-EPINEPHRINE-2,5,6,α,β,β-D6 CAS:1219803-77-6 D-6632 MW: 189.24 98 atom % D | (±)-EPINEPHRINE-D3 (N-METHYL-D3) CAS:1189977-29-4 D-6633 MW: 186.22 99 atom % D | (±)-ETODOLAC-D3 (1-ETHYL-2,2,2-D3) CAS:1276197-46-6 D-7296 MW: 290.38 99 atom % D | (±)-FELODIPINE-D3 (2,3-DICHLOROPHENYL-D3) CAS:1219795-30-8 D-7175 MW: 387.28 99 atom % D | (±)-FENBUCONAZOLE-D5 (PHENYL-D5) CAS:1398066-06-2 D-7388 MW: 341.85 99 atom % D | (±)-FLUOXETINE-D5 HCL (PHENYL-D5) CAS:1173020-43-3 D-5749 MW: 350.82 99 atom % D | (±)-FLUOXETINE-D5 OXALATE (PHENYL-D5) CAS:1219804-82-6 D-5740 MW: 404.4 99 atom % D | (±)-FLURBIPROFEN-D5 (PHENYL-D5) CAS:215175-76-1 D-7405 MW: 249.3 99 atom % D | (±)-GLYCERYL-1,1,2,3,3-D5 1-MONOOLEATE CAS:565183-24-6 D-7610 MW: 361.58 98 atom % D | (±)-GLYCIDOL-1,1,2,3,3-D5 CAS:1246819-20-4 D-7483 MW: 79.11 98 atom % D | (±)-IBUPROFEN-D3 (α-METHYL-D3) CAS:121662-14-4 D-6119 MW: 209.3 99 atom % D | (±)-IBUPROFEN-D3, SODIUM SALT (α-METHYL-D3) CAS:1219805-09-0 D-6873 MW: 231.28 99 atom % D | (±)-IMAZALIL-D5 SULFATE (ALLYLOXY-D5) CAS:1398065-92-3 D-7406 MW: 400.29 98 atom % D | (±)-IPRATROPIUM-D3 BROMIDE (N-METHYL-D3) Formula: 97% chemical purity D-6923 MW: 415.38 99 atom % D | (±)-KETOCONAZOLE-D4 (PIPERAZINE-3,3,5,5-D4) ( CIS -ISOMERS) D-7488 MW: 535.46 98 atom % D | (±)-KETOPROFEN-D3 (α-METHYL-D3) CAS:159490-55-8 D-6887 MW: 257.3 98 atom % D | (±)-KETOPROFEN-D4 (PROPIONIC-D4 ACID) CAS:1219805-29-4 D-6837 MW: 258.31 99 atom % D | (±)-LINALOOL-D3 (VINYL-D3) CAS:1216673-02-7 D-6961 MW: 157.27 99 atom % D | (±)-MANDELIC-2,3,4,5,6-D5 ACID CAS:70838-71-0 Formula: C6D5CH(OH)COOH D-6354 MW: 157.18 98 atom % D | (±)-METANEPHRINE-α,β,β-D3 HCL CAS:1085333-94-3 D-1841 MW: 236.71 98 atom % D | (±)-METANEPHRINE-D3 HCL (N-METHYL-D3) CAS:1215507-88-2 D-6688 MW: 236.71 99 atom % D | (±)-METHOCARBAMOL-D3 (METHOXY-D3) CAS:1346600-86-9 D-7508 MW: 244.26 99 atom % D | (±)-METOLACHLOR-D6 (PROPYL-D6) CAS:1219803-97-0 D-5647 MW: 289.83 98 atom % D | (±)-METOPROLOL-D7 HCL ( ISO -PROPYL-D7) CAS:1219798-61-4 D-6682 MW: 310.87 99 atom % D | (±)-MEVALONOLACTONE-4,4,5,5,6,6,6-D7 CAS:347840-19-1 D-3743 MW: 137.19 98 atom % D | (±)-MEVALONOLACTONE-4,4,5,5-D4 CAS:349553-98-6 D-4130 MW: 134.17 98 atom % D | (±)-MEVALONOLACTONE-D3 (METHYL-D3) CAS:61219-76-9 D-3050 MW: 133.16 99 atom % D | (±)-MIANSERIN-D3 HCL (METHYL-D3) CAS:1219804-97-3 D-7162 MW: 303.85 99 atom % D | (±)-MICONAZOLE-D5 NITRATE (2,4-DICHLOROBENZYLOXY-D5) CAS:1398065-80-9 D-7343 MW: 484.14 98 atom % D | (±)-MYCLOBUTANIL-D9 (BUTYL-D9) D-7682 MW: 297.83 99 atom % D | (±)-N′-NITROSONORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4) CAS:66148-19-4 D-4141 MW: 181.23 98 atom % D | (±)-N-(2,6-DIMETHYLPHENYL)-1- ISO -PROPYL-D7-2-PIPERIDINECARBOXAMIDE CAS:1276197-11-5 D-6992 MW: 281.45 99 atom % D | (±)-N-2-METHYLBUTYRYL-D9-GLYCINE CAS:1219798-77-2 Formula: CD3CD2CD(CD3)CONHCH2COOH D-6709 MW: 168.24 98 atom % D | (±)-N-2-METHYLBUTYRYLGLYCINE-2,2-D2 Formula: CH3CH2CH(CH3)CONHCD2COOH D-6708 MW: 161.2 98 atom % D | (±)-NAPROXEN-D3 (α-METHYL-D3) CAS:958293-77-1 D-6523 MW: 233.28 99 atom % D | (±)-NICOTINE-2,4,5,6-D4 (PYRIDINE-D4) CAS:350818-69-8 D-5098 MW: 166.26 98 atom % D | (±)-NICOTINE-D3 (N-METHYL-D3) CAS:69980-24-1 D-3519 MW: 165.25 99 atom % D | (±)-NICOTINE-D7 (N-METHYL-D3; PYRIDINE-D4) CAS:1219805-86-3 D-6500 MW: 169.28 98 atom % D | (±)-NISOLDIPINE-D4 (2-NITROPHENYL-D4) CAS:1219795-47-7 D-6186 MW: 392.44 99 atom % D | (±)-NOREPINEPHRINE-2,5,6,α,β,β-D6 HCL CAS:1219803-04-9 D-6634 MW: 211.67 99 atom % D | (±)-NORFLUOXETINE-D5 HCL (PROPYL-1,1,2,2,3-D5) CAS:1185132-92-6 D-6023 MW: 336.8 98 atom % D | (±)-NORMETANEPHRINE-α,β,β-D3 HCL CAS:1085333-97-6 D-1640 MW: 222.68 98 atom % D | (±)-NORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4) CAS:66148-18-3 D-4174 MW: 152.23 98 atom % D | (±)-O-DESMETHYLNAPROXEN-D3 (α-METHYL-D3) CAS:1122399-99-8 D-7674 MW: 219.25 99 atom % D | (±)-ONDANSETRON-D5 (METHYLIMIDAZOLE-D5) CAS:1219798-86-3 D-6623 MW: 298.4 97 atom % D | (±)-OXYBUTYNIN-D11 HCL (CYCLOHEXYL-D11) CAS:1185151-95-4 D-6104 MW: 405.02 99 atom % D | (±)-OXYPHENBUTAZONE-D9 ( N -BUTYL-D9) CAS:1189693-23-9 D-7297 MW: 333.43 99 atom % D | (±)-PENCONAZOLE-D7 (PENTYL-3,3,4,4,5,5,5-D7) D-7681 MW: 291.23 98 atom % D | (±)-PHENOXYBENZAMINE-D5 HCL (BENZYL-2,3,4,5,6-D5) CAS:1398065-71-8 D-7367 MW: 345.32 99 atom % D | (±)-PINDOLOL-D7 ( ISO -PROPYL-D7) CAS:1185031-19-9 D-7538 MW: 255.37 99 atom % D | (±)-PIOGLITAZONE-D4 (PHENYL-D4) CAS:1134163-29-3 D-7378 MW: 360.46 98 atom % D | (±)-PRASUGREL-D3 (ACETATE-D3) CAS:1127253-02-4 D-7536 MW: 376.46 99 atom % D | (±)-PROMETHAZINE-D4 HCL (PHENOTHIAZINE-1,3,7,9-D4) CAS:1173018-74-0 D-7144 MW: 324.9 98 atom % D | (±)-PROPAFENONE-D5 HCL (PROPYL-2,2,3,3,3-D5) CAS:1398066-02-8 D-7463 MW: 382.94 98 atom % D | (±)-PROPAFENONE-D7 HCL (PROPYL-D7) CAS:1219799-06-0 D-7013 MW: 384.95 99 atom % D | (±)-PROPRANOLOL-D7 (RING-D7) CAS:344298-99-3 D-2386 MW: 266.39 97 atom % D | (±)-PYRIPROXYFEN-D4 (PYRIDYL-D4) D-7693 MW: 325.4 99 atom % D | (±)-QUIZALOFOP-ETHYL-D3 (PROPIONATE-3,3,3-D3) CAS:1398065-84-3 D-7391 MW: 375.83 98 atom % D | (±)-RACTOPAMINE-D3 HCL (2-HYDROXYETHYL-1,1,2-D3) CAS:1219794-72-5 D-6839 MW: 340.86 97 atom % D | (±)-RACTOPAMINE-D6 HCL (1-METHYL-D3;PROPYL-1,2,2-D3) CAS:1276197-17-1 D-7295 MW: 343.88 99 atom % D | (±)-RANOLAZINE-D8 2HCL (PIPERAZINE-D8) CAS:1219802-60-4 D-7014 MW: 508.51 98 atom % D | (±)-ROPIVACAINE-D7 (PROPYL-D7) CAS:1392208-04-6 D-6934 MW: 281.45 98 atom % D | (±)-SALMETEROL-D3 (3-HYDROXYMETHYL-D2; α-D1) CAS:497063-94-2 D-6187 MW: 418.59 98 atom % D | (±)-SOTALOL-D7 HCL ( ISO -PROPYL-D7) CAS:1398065-65-0 D-7411 MW: 315.87 99 atom % D | (±)-TARTARIC-2,3-D2 ACID CAS:91469-46-4 Formula: HOOCCD(OH)CD(OH)COOH D-5343 MW: 152.1 98 atom % D | (±)-TEBUCONAZOLE-D4 (4-CHLOROPHENYL-D4) D-7563 MW: 311.85 98 atom % D | (±)-TERCONAZOLE-D4 (PIPERAZINE-2,2,6,6-D4) ( CIS -ISOMERS) D-7517 MW: 536.49 98 atom % D | (±)-TETRAHYDRO-2-FUROIC-D7 ACID CAS:1219798-42-1 D-6662 MW: 123.16 98 atom % D | (±)-THALIDOMIDE-D4 (PHENYL-D4) CAS:1219177-18-0 D-6840 MW: 262.26 98 atom % D | (±)-THIORIDAZINE-D3 HCL (N-METHYL-D3) CAS:1189928-36-6 D-7643 MW: 410.05 98 atom % D | (±)-TOLTERODINE-D14 TARTRATE [N,N-DI( ISO -PROPYL-D7)] D-7006 MW: 489.67 98 atom % D | (±)-TRAMADOL-D6 HCL (N,N-DIMETHYL-D6) ( CIS/TRANS MIXTURE) CAS:1189374-50-2 D-6990 MW: 305.88 99 atom % D | (±)-TRANYLCYPROMINE-D5 HCL (PHENYL-D5) CAS:107077-98-5 D-6824 MW: 174.68 98 atom % D | (±)-TRIADIMEFON-D4 (4-CHLOROPHENYL-D4) D-7683 MW: 297.78 98 atom % D | (±)-TRIMIPRAMINE-D3 MALEATE (N-METHYL-D3) CAS:1185245-93-5 D-6762 MW: 413.53 99 atom % D | (±)-VELNACRINE-1,2,2-D3 MALEATE CAS:1219806-48-0 D-7200 MW: 333.36 99 atom % D (also 12%-4,4-d2) | (±)-VENLAFAXINE-D6 HCL (N,N-DIMETHYL-D6) CAS:1062606-12-5 D-6826 MW: 319.9 99 atom % D | (±)-VERAPAMIL-D3 HCL (N-METHYL-D3) D-7546 MW: 494.09 99 atom % D | (±)-WARFARIN-D5 (PHENYL-D5) CAS:75472-93-4 D-7080 MW: 313.36 99 atom % D | (+)- CIS -DILTIAZEM-D3 HCL (ACETOXY-D3) CAS:1217860-13-3 D-7375 MW: 454 99 atom % D | (-)-2-METHYL-D3-ISOBORNEOL CAS:135441-89-3 D-6241 MW: 171.3 99 atom % D | (-)-NORELGESTROMIN-2,2,4,6,6,10-D6 CAS:1263184-13-9 D-6942 MW: 333.5 99 atom % D | (-)-NORGESTREL-2,2,4,6,6,10-D6 D-6159 MW: 318.49 98 atom % D | (1 S ,3′ R )-SOLIFENACIN-D7 HCL (2′,2′,3′,6′,6′,7′,7′-D7) D-7570 MW: 405.97 98 atom % D | (2 R )-LACOSAMIDE-D3 (O-METHYL-D3) CAS:1217689-95-6 D-7271 MW: 253.32 99 atom % D | (2 S ,2′ S )-ETHAMBUTOL-D10 (1,1,1′,1′,2,2′-D6; ETHYLENE-D4) CAS:1129526-24-4 D-7356 MW: 214.37 99 atom % D | (2 S ,2′ S )-ETHAMBUTOL-D4 (ETHYLENE-D4) CAS:1129526-19-7 D-7365 MW: 208.34 99 atom % D | (2,4,5-TRICHLOROPHENOXY-D2) ACETIC-2,2-D2 ACID CAS:358731-37-0 D-5553 MW: 259.51 99 atom % D | (2,4-DICHLOROPHENOXY-D3) ACETIC ACID CAS:202480-67-9 D-5750 MW: 224.06 98 atom % D | (2,4-DICHLOROPHENOXY-D3) ACETIC-2,2-D2 ACID CAS:352438-69-8 D-5121 MW: 226.07 98 atom % D | (2,6-DICHLOROPHENYL)ACETIC-2,2-D2 ACID CAS:1219803-63-0 D-7141 MW: 207.05 98 atom % D | (2-BROMOETHYL)BENZENE-D5 CAS:35845-64-8 Formula: C6D5CH2CH2Br D-4317 MW: 190.09 99 atom % D | (2-CHLOROPHENYL)DIPHENYL-D5-METHANOL CAS:1219802-30-8 D-6582 MW: 299.81 99 atom % D | (2-ETHOXY-D5-PHENOXY) ACETIC ACID D-7542 MW: 201.23 99 atom % D | (25 RS )-26-HYDROXYCHOLESTEROL-24,24,26,26-D4 D-6879 MW: 406.68 98 atom % D | (3,4,5-TRIMETHOXYPHENYL) ACETIC-2,2-D2 ACID CAS:344299-45-2 Formula: (CH3O)3C6H2CD2COOH D-2144 MW: 228.24 97 atom % D | (3,4-DIHYDROXYPHENYL-D3) ACETIC-2,2-D2 ACID CAS:60696-39-1 D-1642 MW: 173.18 98 atom % D | (3,4-DIMETHOXYPHENYL) ACETIC-2,2-D2 ACID CAS:19031-58-4 Formula: (CH3O)2C6H3CD2COOH D-1941 MW: 198.21 98 atom % D | (4-,N,-NONYLPHENOXY) ACETIC-2,2-D2 ACID CAS:1219798-75-0 Formula: CH3(CH2)8C6H4OCD2COOH D-6492 MW: 280.4 98 atom % D | (4-CARBOXYBUTYL-2,2,3,3-D4) TRIPHENYLPHOSPHONIUM BROMIDE CAS:42932-63-8 Formula: HOOCCH2(CD2)2CH2P(C6H5)3D-2192 MW: 447.34 98 atom % D | (4-CHLORO-2-METHYLPHENOXY-D3) ACETIC ACID CAS:352431-14-2 D-5320 MW: 203.64 98 atom % D | (4-FLUOROPHENYL)ACETIC-2,2-D2 ACID CAS:113715-48-3 Formula: FC6H4CD2COOH D-7230 MW: 156.15 98 atom % D (also 10% 3,5-d2) | (4-HYDROXY-3-METHOXYPHENYL) ACETIC-2,2-D2 ACID CAS:53587-33-0 Formula: HO(CH3O)C6H3CD2COOH D-1543 MW: 184.19 98 atom % D | (4-HYDROXY-3-METHOXYPHENYL-D3) ACETIC-2,2-D2 ACID CAS:53587-32-9 Formula: HO(CH3O)C6D3CD2COOH D-7304 MW: 187.21 99 atom % D | (5-CARBOXYPENTYL-2,2,3,3,4,4-D6) TRIPHENYLPHOSPHONIUM BROMIDE Formula: HOOCCH2(CD23CH2P(C6H5)3Br D-7311 MW: 463.38 99 atom % D | (6 R ,12A R )-TADALAFIL-D3 (N-METHYL-D3) CAS:960226-55-5 D-7476 MW: 392.43 99 atom % D | (BROMOMETHYL)CYCLOHEXANE-D11 CAS:1219794-79-2 Formula: C6D11CH2Br D-5903 MW: 188.15 98 atom % D | (BROMOMETHYL)CYCLOPROPANE-2,2,3,3-D4 CAS:1219805-93-2 D-7222 MW: 139.03 99 atom % D | (BROMOMETHYL-D2)CYCLOPROPANE-1-D1 CAS:1219799-17-3 Formula: C3H4DCD2Br D-5982 MW: 138.02 98 atom % D | 1,1,1,2-TETRACHLOROETHANE-D2 CAS:117164-18-8 Formula: ClCD2CCl3 D-5059 MW: 169.86 98 atom % D | 1,1,1-TRICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE CAS:93952-18-2 Formula: (ClC6D4)2CHCCl3 D-3006 MW: 362.54 99 atom % D (also 20% deuterated at the 2-position) | 1,1,1-TRICHLORO-2-(2-CHLOROPHENYL-D4)-2-(4-CHLOROPHENYL-D4)ETHANE CAS:221899-88-3 Formula: ClC6D4CH(CCl3)C6D4Cl D-6380 MW: 362.54 98 atom % D | 1,1,1-TRICHLOROETHANE-D3 CAS:2747-58-2 Formula: CD3CCl3 D-1150 MW: 136.42 98 atom % D | 1,1,2,2-TETRACHLOROETHANE-D2 CAS:33685-54-0 Formula: Cl2CDCDCl2 D-1416 MW: 169.86 99.6 atom % D | 1,1,2-TRICHLOROETHANE-D3 CAS:171086-93-4 Formula: ClCD2CDCl2 D-2409 MW: 136.42 99 atom % D | 1,1-CYCLOPROPANE-2,2,3,3-D4-DICARBOXYLIC ACID CAS:136503-99-6 D-6439 MW: 134.12 99 atom % D | 1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE CAS:93952-20-6 Formula: (ClC6D4)2CHCHCl2 D-3004 MW: 328.09 99 atom % D | 1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHYLENE CAS:93952-19-3 Formula: (ClC6D4)2C=CCl2 D-3005 MW: 326.08 99 atom % D | 1,1-DICHLOROETHANE-2,2,2-D3 CAS:56912-77-7 Formula: CD3CHCl2 D-1152 MW: 101.98 98 atom % D | 1,1-DICHLOROETHYLENE-D2 (STABILIZED WITH HYDROQUINONE) CAS:22280-73-5 Formula: CD2=CCl2 D-2201 MW: 98.96 98 atom % D | 1,1-DIMETHYL-D6-HYDRAZINE HCL CAS:1219804-14-4 Formula: (CD3)2NNH2HCl D-6677 MW: 102.6 98 atom % D | 1,1-DIMETHYL-D6-SULFAMIDE CAS:1189689-95-9 Formula: H2NSO2N(CD3)2 D-6849 MW: 130.19 99 atom % D | 1,1-DIMETHYL-D6-UREA CAS:1219802-32-0 Formula: H2NCON(CD3)2 D-6218 MW: 94.15 99 atom % D | 1,1-DIMETHYLHYDRAZINE-D8 DCL CAS:1219802-85-3 Formula: (CD3)2NND2DCl D-6600 MW: 105.61 98 atom % D | 1,10-DECANE-D20-DIOL CAS:347841-78-5 Formula: HO(CD2)10OH D-3250 MW: 194.4 98 atom % D | 1,10-DECANEDIOIC-2,2,9,9-D4 ACID CAS:339080-77-2 Formula: HOOCCD2(CH2)6CD2COOH D-1065 MW: 206.27 98 atom % D | 1,10-DECANEDIOIC-D16 ACID CAS:73351-71-0 Formula: HOOC(CD2)8COOH D-3449 MW: 218.35 98 atom % D | 1,10-DIBROMODECANE-D20 CAS:150017-88-2 Formula: Br(CD2)10Br D-2659 MW: 320.2 98 atom % D | 1,10-PHENANTHROLINE-D8 CAS:90412-47-8 D-2799 MW: 188.26 97 atom % D | 1,12-DIBROMODODECANE-D24 CAS:1044544-84-4 Formula: Br(CD2)12Br D-5873 MW: 352.28 98 atom % D | 1,12-DODECANE-D24-DIOL CAS:1219802-88-6 Formula: HO(CD2)12OH D-6571 MW: 226.48 98 atom % D | 1,12-DODECANEDIOIC-2,2,11,11-D4 ACID CAS:97543-02-7 Formula: HOOCCD2(CH2)8CD2COOH D-5089 MW: 234.33 98 atom % D | 1,12-DODECANEDIOIC-D20 ACID CAS:89613-32-1 Formula: HOOC(CD2)10COOH D-2537 MW: 250.43 98 atom % D | 1,14-TETRADECANEDIOIC-D24 ACID CAS:130348-88-8 Formula: HOOC(CD2)12COOH D-5074 MW: 282.5 98 atom % D | 1,16-HEXADECANEDIOIC-D28 ACID CAS:130348-90-2 Formula: HOOC(CD2)14COOH D-5186 MW: 314.58 99 atom % D | 1,2,3,4-TETRACHLOROBENZENE-D2 CAS:2199-73-7 Formula: C6D2Cl4 D-5869 MW: 217.91 98 atom % D | 1,2,3,4-TETRAMETHYLBENZENE-D14 CAS:350818-60-9 Formula: C6D2(CD3)4 D-5061 MW: 148.31 98 atom % D | 1,2,3,5-TETRACHLOROBENZENE-D2 CAS:2199-74-8 Formula: C6D2Cl4 D-5870 MW: 217.91 98 atom % D | 1,2,3,5-TETRAMETHYLBENZENE-D14 CAS:1219795-11-5 Formula: C6D2(CD3)4 D-938 MW: 148.31 98 atom % D | 1,2,3-TRICHLOROBENZENE-D3 CAS:3907-98-0 Formula: C6D3Cl3 D-2511 MW: 184.47 98 atom % D | 1,2,3-TRICHLOROPROPANE-D5 CAS:203578-27-2 Formula: ClCD2CD(Cl)CD2Cl D-6044 MW: 152.46 98 atom % D | 1,2,4,5-BENZENETETRACARBOXYLIC ACID-D6 CAS:344298-79-9 D-2440 MW: 260.19 98 atom % D | 1,2,4,5-BENZENETETRACARBOXYLIC DIANHYDRIDE-D2 CAS:106426-63-5 D-3393 MW: 220.13 98 atom % D | 1,2,4,5-TETRACHLOROBENZENE-D2 CAS:1198-57-8 Formula: C6D2Cl4 D-1290 MW: 217.91 98 atom % D | 1,2,4,5-TETRAMETHYLBENZENE-3,6-D2 CAS:1859-01-4 Formula: C6D2(CH3)4 D-2269 MW: 136.23 98 atom % D | 1,2,4,5-TETRAMETHYLBENZENE-D14 CAS:15502-50-8 Formula: C6D2(CD3)4 D-269 MW: 148.31 98 atom % D | 1,2,4-TRIAZOLE-D3 CAS:43088-92-2 D-5453 MW: 72.08 98 atom % D | 1,2,4-TRICHLOROBENZENE-D3 CAS:2199-72-6 Formula: C6D3Cl3 D-2706 MW: 184.47 98 atom % D | 1,2,4-TRIMETHYLBENZENE-D12 CAS:350818-61-0 Formula: (CD3)3C6D3 D-5062 MW: 132.27 98 atom % D | 1,2-BENZENE-D4-DIAMINE CAS:291765-93-0 Formula: C6D4(NH2)2 D-5981 MW: 112.17 98 atom % D | 1,2-BENZENEDIAMINE-D8 CAS:1219798-78-3 Formula: C6D4(ND2)2 D-5965 MW: 116.19 98 atom % D | 1,2-CYCLOHEXANE-D10-DIAMINE(CIS/TRANS,MIXTURE) D-6058 MW: 124.25 98 atom % D | 1,2-DICHLOROBENZENE-D4 CAS:2199-69-1 Formula: C6D4Cl2 D-1191 MW: 151.03 99 atom % D | 1,2-DICHLOROETHANE-D4 CAS:17060-07-0 Formula: ClCD2CD2Cl D-103 MW: 102.98 99 atom % D | 1,2-DICHLOROETHYLENE-D2(CIS/TRANS,MIXTURE) CAS:15075-90-8 Formula: CDCl=CDCl D-2526 MW: 98.96 98 atom % D | 1,2-DIHYDROXYBENZENE-D6 CAS:202656-22-2 Formula: C6D4(OD)2 D-5290 MW: 116.15 98 atom % D | 1,2-DIMETHOXY-D6-BENZENE CAS:24658-24-0 Formula: C6H4(OCD3)2 D-5427 MW: 144.2 99 atom % D | 1,2-DIMETHOXYBENZENE-3,4,5,6-D4 CAS:126840-15-1 Formula: C6D4(OCH3)2 D-1193 MW: 142.19 98 atom % D | 1,2-DIMETHOXYBENZENE-4,5-D2 CAS:203645-56-1 Formula: C6H2D2(OCH3)2 D-4086 MW: 140.18 98 atom % D | 1,2-DIMETHOXYBENZENE-D10 CAS:362049-43-2 Formula: C6D4(OCD3)2 D-5428 MW: 148.23 99 atom % D | 1,2-DIPHENYLETHANE-D14 CAS:94371-89-8 Formula: C6D5(CD2)2C6D5 D-1233 MW: 196.35 98 atom % D | 1,2-ETHANE-D4-DITHIOL CAS:100189-81-9 Formula: HSCD2CD2SH D-5163 MW: 98.21 99 atom % D | 1,3,5(10)-ESTRATRIENE-17α-ETHYL-D5-3,17β-DIOL 3-METHYL ETHER D-6742 MW: 319.5 98 atom % D | 1,3,5-BENZENE-2,4,6-D3-TRICARBOXYLIC ACID CAS:62790-27-6 Formula: C6D3(COOH)3 D-6597 MW: 213.16 98 atom % D | 1,3,5-TRIBROMOBENZENE-D3 CAS:52921-77-4 Formula: C6D3Br3 D-6980 MW: 317.82 99 atom % D | 1,3,5-TRICHLOROBENZENE-D3 CAS:1198-60-3 Formula: C6D3Cl3 D-687 MW: 184.47 98 atom % D | 1,3,5-TRIMETHYLBENZENE-2,4,6-D3 CAS:38574-14-0 Formula: (CH3)3C6D3 D-1140 MW: 123.21 98 atom % D | 1,3,5-TRIMETHYLBENZENE-D12 CAS:69441-16-3 Formula: (CD3)3C6D3 D-2911 MW: 132.27 98 atom % D | 1,3-BENZENEDIAMINE-D8 CAS:770735-58-5 Formula: C6D4(ND)2 D-3914 MW: 116.19 97 atom % D | 1,3-BUTADIENE-1,1,4,4-D4 (GAS) (STABILIZED WITH HYDROQUINONE) CAS:10545-58-1 Formula: CD2=CHCH=CD2 D-232 MW: 58.11 98 atom % D | 1,3-BUTADIENE-2,3-D2 (GAS) (STABILIZED WITH HYDROQUINONE) Formula: CH2=CDCD=CH2 D-3482 MW: 56.1 98 atom % D | 1,3-BUTADIENE-D6 (GAS) (STABILIZED WITH HYDROQUINONE) CAS:1441-56-1 Formula: CD2=CDCD=CD2 D-97 MW: 60.13 98 atom % D | 1,3-DI- ISO -PROPYLBENZENE-D18 CAS:1398065-59-2 Formula: [(CD3)2CD]2C6D4 D-7363 MW: 180.38 99 atom % D | 1,3-DIBROMO-5-FLUOROBENZENE-D3 CAS:1219805-87-4 Formula: Br2C6D3F D-7217 MW: 256.91 98 atom % D | 1,3-DIBROMOPROPANE-1,1,3,3-D4 CAS:64528-94-5 Formula: BrCD2CH2CD2Br D-999 MW: 205.91 98 atom % D | 1,3-DIBROMOPROPANE-D6 CAS:120404-22-0 Formula: BrCD2CD2CD2Br D-1818 MW: 207.92 99 atom % D | 1,3-DICHLORO- ISO -PROPYL-D5 ALCOHOL CAS:1173020-20-6 Formula: ClCD2CD(OH)CD2Cl D-5033 MW: 134.02 98 atom % D | 1,3-DICHLOROACETONE-D4 CAS:350818-52-9 Formula: ClCD2COCD2Cl D-5030 MW: 130.99 98 atom % D | 1,3-DICHLOROBENZENE-D4 CAS:2199-70-4 Formula: C6D4Cl2 D-2405 MW: 151.03 98 atom % D | 1,3-DICHLOROPROPENE-D4(CIS/TRANS,MIXTURE) CAS:202656-23-3 Formula: ClCD2CD=CDCl D-2669 MW: 115 98 atom % D | 1,3-DIETHYLBENZENE-2,4,5,6-D4 CAS:1219803-29-8 Formula: C6D4(CH2CH3)2 D-6307 MW: 138.25 98 atom % D | 1,3-DIETHYLBENZENE-D14 CAS:1219803-40-3 Formula: C6D4(CD2CD3)2 D-6308 MW: 148.31 98 atom % D | 1,3-DIFLUOROBENZENE-D4 CAS:1173022-08-6 Formula: C6D4F2 D-7612 MW: 118.18 98 atom % D | 1,3-DIHYDROXYBENZENE-D6 CAS:70938-00-0 Formula: C6D4(OD)2 D-1792 MW: 116.15 98 atom % D | 1,3-DIMETHOXY-D6-BENZENE CAS:16469-85-5 Formula: C6H4(OCD3)2 D-5430 MW: 144.2 99 atom % D | 1,3-DIMETHOXYBENZENE-2,4,5,6-D4 CAS:362049-44-3 Formula: C6D4(OCH3)2 D-5429 MW: 142.19 98 atom % D | 1,3-DIMETHOXYBENZENE-D10 CAS:340257-57-0 Formula: C6D4(OCD3)2 D-1421 MW: 148.23 99 atom % D | 1,3-DINITROBENZENE-D4 CAS:54247-05-1 Formula: C6D4(NO2)2 D-1937 MW: 172.13 98 atom % D | 1,3-DIPHENYL-D10-UREA CAS:108009-46-7 Formula: (C6D5NH)2CO D-7664 MW: 222.31 99 atom % D | 1,3-PROPANE-1,1,3,3-D4-DIAMINE CAS:347840-13-5 Formula: H2NCD2CH2CD2NH2 D-3731 MW: 78.15 99 atom % D | 1,3-PROPANE-1,1,3,3-D4-DIAMINE 2HCL CAS:193945-44-7 Formula: H2NCD2CH2CD2NH22HCl D-5663 MW: 151.07 99 atom % D | 1,3-PROPANE-2,2-D2-DIAMINE CAS:352438-78-9 Formula: H2NCH2CD2CH2NH2 D-5148 MW: 76.14 98 atom % D | 1,3-PROPANE-2,2-D2-DIAMINE 2HCL CAS:352438-79-0 Formula: H2NCH2CD2CH2NH22HCl D-5150 MW: 149.06 99 atom % D | 1,3-PROPANE-2,2-D2-DIOL CAS:38645-14-6 Formula: HOCH2CD2CH2OH D-5651 MW: 78.11 98 atom % D | 1,3-PROPANE-D6-DIAMINE CAS:90375-98-7 Formula: H2NCD2CD2CD2NH2 D-5960 MW: 80.16 98 atom % D | 1,3-PROPANE-D6-DIAMINE 2HCL CAS:65898-86-4 Formula: H2NCD2CD2CD2NH22HCl D-5964 MW: 153.08 98 atom % D | 1,3-PROPANE-D6-DIOL CAS:284474-77-7 Formula: HOCD2CD2CD2OH D-253 MW: 82.13 98 atom % D | 1,3-PROPANE-D6-DITHIOL CAS:1219803-51-6 Formula: HSCD2CD2CD2SH D-6043 MW: 114.25 98 atom % D | 1,3-PROPANEDIOL-D8 CAS:285978-25-8 Formula: DOCD2CD2CD2OD D-2150 MW: 84.14 98 atom % D | 1,3-PROPYLENE-D6 THIOUREA CAS:1219802-05-7 D-5959 MW: 122.22 98 atom % D | 1,4-ANDROSTADIEN-3,17-DIONE-6-METHYLENE-16,16-D2 D-7050 MW: 298.42 98 atom % D | 1,4-BENZENE-D4-DIAMINE CAS:119516-83-5 Formula: C6D4(NH2)2 D-3789 MW: 112.17 98 atom % D | 1,4-BENZENEDIAMINE-D8 CAS:153200-73-8 Formula: C6D4(ND2)2 D-3394 MW: 116.19 98 atom % D | 1,4-BENZOQUINONE-D4 CAS:2237-14-1 D-5194 MW: 112.12 98 atom % D | 1,4-BUTANE-2,2,3,3-D4-DIAMINE 2HCL CAS:88972-24-1 Formula: H2NCH2CD2CD2CH2NH22HCl D-5401 MW: 165.1 98 atom % D | 1,4-BUTANE-D8-DIAMINE CAS:709608-92-4 Formula: H2NCD2CD2CD2CD2NH2 D-6360 MW: 96.2 98 atom % D | 1,4-BUTANE-D8-DIAMINE 2HCL CAS:284665-22-1 Formula: H2NCD2CD2CD2CD2NH22HCl D-3980 MW: 169.12 98 atom % D | 1,4-BUTANE-D8-DITHIOL CAS:1219805-46-5 Formula: HS(CD2)4SH D-6208 MW: 130.29 99 atom % D | 1,4-CYCLOHEXANE-D10-DIAMINE(CIS/TRANS,MIXTURE) CAS:1219802-80-8 D-6137 MW: 124.25 98 atom % D | 1,4-DIAZABICYCLO[2.2.2]OCTANE-D12 CAS:119451-78-4 D-6858 MW: 124.25 98 atom % D | 1,4-DIBROMOBENZENE-D4 CAS:4165-56-4 Formula: C6D4Br2 D-634 MW: 239.93 99 atom % D | 1,4-DIBROMOBUTANE-1,1,4,4-D4 CAS:36684-45-4 Formula: BrCD2(CH2)2CD2Br D-6504 MW: 219.94 98 atom % D | 1,4-DIBROMOBUTANE-2,2,3,3-D4 CAS:52089-63-1 Formula: BrCH2(CD2)2CH2Br D-1232 MW: 219.94 98 atom % D | 1,4-DIBROMOBUTANE-D8 CAS:68375-92-8 Formula: Br(CD2)4Br D-52 MW: 223.96 99 atom % D | 1,4-DICHLOROBENZENE-D4 CAS:3855-82-1 Formula: C6D4Cl2 D-1034 MW: 151.03 98 atom % D | 1,4-DICHLOROBUTANE-D8 CAS:83547-96-0 Formula: Cl(CD2)4Cl D-942 MW: 135.06 99 atom % D | 1,4-DIETHYLBENZENE-2,3,5,6-D4 CAS:923561-79-9 Formula: C6D4(CH2CH3)2 D-6309 MW: 138.25 98 atom % D | 1,4-DIETHYLBENZENE-D14 CAS:1219803-64-1 Formula: C6D4(CD2CD3)2 D-6310 MW: 148.31 98 atom % D | 1,4-DIMETHOXYBENZENE-D10 CAS:74079-00-8 Formula: C6D4(OCD3)2 D-5177 MW: 148.23 98 atom % D | 1,4-NAPHTHOQUINONE-D6 CAS:26473-08-5 D-5803 MW: 164.19 98 atom % D | 1,4-PREGNADIEN-11β,17α,21-TRIOL-3,20-DIONE-2,4,6,6,21,21-D6 D-6447 MW: 366.48 98 atom % D | 1,4-PREGNADIEN-17α,21-DIOL-3,11,20-TRIONE-2,4,6α,9,12,12,21,21-D8 D-7418 MW: 366.48 98 atom % D | 1,4-PREGNADIEN-6α-METHYL-11β,17α,21-TRIOL-3,20-DIONE-21,21-D2 D-6007 MW: 376.49 95 atom % D | 1,5-DIBROMOPENTANE-1,1,5,5-D4 CAS:1219803-90-3 Formula: BrCD2(CH2)3CD2Br D-6071 MW: 233.97 99 atom % D | 1,5-DIBROMOPENTANE-D10 CAS:1219802-90-0 Formula: Br(CD2)5Br D-6113 MW: 240 98 atom % D | 1,5-DINITRONAPHTHALENE-D6 CAS:1219804-48-4 D-5813 MW: 224.21 99 atom % D | 1,5-PENTANE-1,1,5,5-D4-DIAMINE CAS:95596-35-3 Formula: H2NCD2(CH2)3CD2NH2 D-6025 MW: 106.2 98 atom % D | 1,5-PENTANE-D10-DIOL CAS:1219804-42-8 Formula: HO(CD2)5OH D-5584 MW: 114.21 98 atom % D | 1,6-DIBROMOHEXANE-D12 CAS:169397-96-0 Formula: Br(CD2)6Br D-3766 MW: 256.04 98 atom % D | 1,6-HEXANE-1,1,6,6-D4-DIAMINE CAS:115797-49-4 Formula: H2NCD2(CH2)4CD2NH2 D-323 MW: 120.23 98 atom % D | 1,6-HEXANE-1,1,6,6-D4-DIOL CAS:6843-76-1 Formula: HOCD2(CH2)4CD2OH D-6321 MW: 122.2 98 atom % D | 1,8-DIMETHYLNAPHTHALENE-D12 CAS:104489-29-4 D-4117 MW: 168.3 98 atom % D | 1,8-OCTANEDIOIC-2,2,7,7-D4 ACID CAS:19031-57-3 Formula: HOOCCD2(CH2)4CD2COOH D-2008 MW: 178.22 98 atom % D | 1,8-OCTANEDIOIC-D12 ACID CAS:169397-99-3 Formula: HOOC(CD2)6COOH D-5338 MW: 186.27 98 atom % D | 1,9-DIBROMONONANE-D18 CAS:150017-89-3 Formula: Br(CD2)9Br D-2868 MW: 304.16 98 atom % D | 1,9-NONANE-2,2,3,3,4,4,5,5,6,6,7,7,8,8-D14-DIOL CAS:1219805-89-6 Formula: HOCH2(CD2)7CH2OH D-7223 MW: 174.34 98 atom % D | 1,9-NONANEDIOIC-D14 ACID CAS:119176-67-9 Formula: HOOC(CD2)7COOH D-3280 MW: 202.31 98 atom % D | 1-(2-METHOXY-D3-PHENYLAZO) -2-NAPHTHOL CAS:1398109-09-5 D-7361 MW: 281.33 99 atom % D | 1-AMINOADAMANTANE-2,2,2′,2′,2″,2″-D6 CAS:1219805-53-4 D-7085 MW: 157.29 98 atom % D (also 9% 3,3',3''-d3 and 17% 4,4,4',4',4'',4''-d6) | 1-AMINOCYCLOPROPANE-2,2,3,3-D4-CARBOXYLIC ACID CAS:84392-07-4 D-6292 MW: 105.13 98 atom % D | 1-AMINONAPHTHALENE-D7 CAS:78832-53-8 D-5835 MW: 150.23 98 atom % D | 1-AMINONAPHTHALENE-D9 CAS:78832-56-1 D-6685 MW: 152.24 98 atom % D | 1-BOC-4-(2-HYDROXYETHYL-D4) PIPERAZINE CAS:1219802-10-4 D-7109 MW: 234.33 99 atom % D | 1-BROMO-2,3,5-TRICHLOROBENZENE-D2 CAS:1219803-86-7 Formula: C6D2BrCl3 D-6847 MW: 262.36 98 atom % D | 1-BROMO-2,3-DICHLOROBENZENE-D3 CAS:1219805-59-0 Formula: BrC6D3Cl2 D-7176 MW: 228.92 99 atom % D | 1-BROMO-2,4-DIFLUOROBENZENE-D3 CAS:1219803-87-8 Formula: BrC6D3F2 D-6946 MW: 196.01 98 atom % D | 1-BROMO-2,5-DIFLUOROBENZENE-D3 CAS:1219795-54-6 Formula: BrC6D3F2 D-6473 MW: 196.01 98 atom % D | 1-BROMO-2,6-DIFLUOROBENZENE-D3 CAS:1219803-73-2 Formula: BrC6D3F2 D-6064 MW: 196.01 98 atom % D | 1-BROMO-2-CHLOROETHANE-D4 CAS:1219795-52-4 Formula: ClCD2CD2Br D-6445 MW: 147.44 98 atom % D | 1-BROMO-2-ETHYLHEXANE-D17 CAS:1398065-97-8 Formula: CD3(CD2)3CD(CD2CD3)CD2Br D-7471 MW: 210.23 98 atom % D | 1-BROMO-2-METHYL-D3-PROPANE-2,3,3,3-D4 CAS:344299-41-8 Formula: (CD3)2CDCH2Br D-2119 MW: 144.06 98 atom % D | 1-BROMO-2-METHYLPROPANE-3,3,3-D3 CAS:344299-42-9 Formula: CD3CH(CH3)CH2Br D-2120 MW: 140.04 99 atom % D | 1-BROMO-2-METHYLPROPANE-D9 CAS:1080497-35-3 Formula: (CD3)2CDCD2Br D-5927 MW: 146.07 98 atom % D | 1-BROMO-3,4-DIFLUOROBENZENE-D3 CAS:1219799-14-0 Formula: BrC6D3F2 D-6474 MW: 196.01 98 atom % D | 1-BROMO-3,5-DICHLOROBENZENE-D3 CAS:1219803-83-4 Formula: BrC6D3Cl2 D-6060 MW: 228.92 98 atom % D | 1-BROMO-3,5-DIFLUOROBENZENE-D3 CAS:1219798-73-8 Formula: BrC6D3F2 D-6475 MW: 196.01 98 atom % D | 1-BROMO-3-CHLORO-5-FLUOROBENZENE-D3 CAS:1219805-00-1 Formula: BrC6D3(Cl)F D-7220 MW: 212.46 98 atom % D | 1-BROMO-3-CHLOROPROPANE-D6 CAS:1173018-46-6 Formula: Cl(CD2)3Br D-2519 MW: 163.47 98 atom % D | 1-BROMO-4-CHLOROBUTANE-D8 CAS:1219803-72-1 Formula: Cl(CD2)4Br D-6809 MW: 179.51 99 atom % D | 1-BROMOBUTANE-1,1,2,2-D4 CAS:1219805-80-7 Formula: CH3CH2CD2CD2Br D-6294 MW: 141.04 99 atom % D | 1-BROMOBUTANE-2,2,3,3,4,4,4-D7 CAS:223487-53-4 Formula: CD3CD2CD2CH2Br D-6881 MW: 144.06 98 atom % D | 1-BROMOBUTANE-2,2-D2 CAS:55724-40-8 Formula: CH3CH2CD2CH2Br D-6572 MW: 139.03 99 atom % D | 1-BROMOBUTANE-3,3,4,4,4-D5 CAS:1219805-37-4 Formula: CD3CD2CH2CH2Br D-5889 MW: 142.05 98 atom % D | 1-BROMOBUTANE-4,4,4-D3 CAS:55724-42-0 Formula: CD3CH2CH2CH2Br D-1872 MW: 140.04 99 atom % D | 1-BROMOBUTANE-D9 CAS:98195-36-9 Formula: CD3CD2CD2CD2Br D-1172 MW: 146.07 98 atom % D | 1-BROMODECANE-1,1,2,2-D4 CAS:1219805-58-9 Formula: CH3(CH2)7CD2CD2Br D-6295 MW: 225.2 98 atom % D | 1-BROMODECANE-10,10,10-D3 CAS:284474-47-1 Formula: CD3(CH2)9Br D-3972 MW: 224.2 99 atom % D | 1-BROMODECANE-9,9,10,10,10-D5 CAS:1219802-02-4 Formula: CD3CD2(CH2)8Br D-5890 MW: 226.21 98 atom % D | 1-BROMODECANE-D21 CAS:98195-39-2 Formula: CD3(CD2)9Br D-517 MW: 242.31 98 atom % D | 1-BROMODODECANE-12,12,12-D3 CAS:204259-68-7 Formula: CD3(CH2)11Br D-3973 MW: 252.25 99 atom % D | 1-BROMODODECANE-D25 CAS:204259-66-5 Formula: CD3(CD2)11Br D-3979 MW: 274.39 98 atom % D | 1-BROMOEICOSANE-20,20,20-D3 CAS:202480-72-6 Formula: CD3(CH2)19Br D-5252 MW: 364.47 99 atom % D | 1-BROMOEICOSANE-D41 CAS:202480-71-5 Formula: CD3(CD2)19Br D-4016 MW: 402.7 98 atom % D | 1-BROMOHEPTANE-1-D1 CAS:38007-40-8 Formula: CH3(CH2)5CHDBr D-7219 MW: 180.11 99 atom % D | 1-BROMOHEPTANE-5,5,6,6,7,7,7-D7 CAS:1219802-55-7 Formula: CD3(CD2)2(CH2)4Br D-6781 MW: 186.14 98 atom % D | 1-BROMOHEPTANE-6,6,7,7,7-D5 CAS:1219805-66-9 Formula: CD3CD2(CH2)5Br D-5754 MW: 184.13 99 atom % D | 1-BROMOHEPTANE-7,7,7-D3 CAS:344253-18-5 Formula: CD3(CH2)6Br D-5215 MW: 182.12 99 atom % D | 1-BROMOHEPTANE-D15 CAS:98195-42-7 Formula: CD3(CD2)6Br D-1724 MW: 194.19 98 atom % D | 1-BROMOHEXADECANE-1,1,2,2-D4 CAS:1219805-65-8 Formula: CH3(CH2)13CD2CD2Br D-6402 MW: 309.37 98 atom % D | 1-BROMOHEXADECANE-16,16,16-D3 CAS:284474-40-4 Formula: CD3(CH2)15Br D-3986 MW: 308.36 99 atom % D | 1-BROMOHEXADECANE-D33 CAS:284474-41-5 Formula: CD3(CD2)15Br D-4000 MW: 338.54 98 atom % D | 1-BROMOHEXANE-1,1,2,2-D4 CAS:1219802-83-1 Formula: CH3(CH2)3CD2CD2Br D-7121 MW: 169.1 98 atom % D | 1-BROMOHEXANE-1,1-D2 CAS:78904-38-8 Formula: CH3(CH2)4CD2Br D-7164 MW: 167.08 99 atom % D | 1-BROMOHEXANE-2,2,3,3,4,4,5,5,6,6,6-D11 CAS:2159-17-3 Formula: CD3(CD2)4CH2Br D-6509 MW: 176.14 98 atom % D | 1-BROMOHEXANE-4,4,5,5,6,6,6-D7 CAS:1276197-43-3 Formula: CD3CD2CD2(CH2)3Br D-7332 MW: 172.12 98 atom % D | 1-BROMOHEXANE-6,6,6-D3 CAS:350818-70-1 Formula: CD3(CH2)5Br D-5100 MW: 168.09 99 atom % D | 1-BROMOHEXANE-D13 CAS:130131-94-1 Formula: CD3(CD2)5Br D-1723 MW: 178.15 98 atom % D | 1-BROMONAPHTHALENE-D7 CAS:37621-57-1 D-7254 MW: 214.11 99 atom % D | 1-BROMONONANE-6,6,7,7-D4 CAS:1219805-44-3 Formula: CH3CH2(CD2)2(CH2)5Br D-6296 MW: 211.18 98 atom % D | 1-BROMONONANE-9,9,9-D3 CAS:1219799-20-8 Formula: CD3(CH2)8Br D-5387 MW: 210.17 99 atom % D | 1-BROMONONANE-D19 CAS:1219805-90-9 Formula: CD3(CD2)8Br D-1726 MW: 226.27 98 atom % D | 1-BROMOOCTADECANE-18,18,18-D3 CAS:349553-85-1 Formula: CD3(CH2)17Br D-3997 MW: 336.41 99 atom % D | 1-BROMOOCTADECANE-D37 CAS:187826-28-4 Formula: CD3(CD2)17Br D-3945 MW: 370.62 98 atom % D | 1-BROMOOCTANE-1,1-D2 CAS:86423-34-9 Formula: CH3(CH2)6CD2Br D-3476 MW: 195.14 99 atom % D | 1-BROMOOCTANE-3,3,4,4-D4 CAS:1219803-37-8 Formula: CH3(CH2)3(CD2)2(CH2)2Br D-7133 MW: 197.15 98 atom % D | 1-BROMOOCTANE-8,8,8-D3 CAS:69373-25-7 Formula: CD3(CH2)7Br D-5101 MW: 196.14 99 atom % D | 1-BROMOOCTANE-D17 CAS:126840-36-6 Formula: CD3(CD2)7Br D-1725 MW: 210.23 98 atom % D | 1-BROMOPENTADECANE-1,1,2,2-D4 CAS:1219798-87-4 Formula: CH3(CH2)12CD2CD2Br D-6459 MW: 295.34 98 atom % D | 1-BROMOPENTADECANE-15,15,15-D3 CAS:1219805-83-0 Formula: CD3(CH2)14Br D-5705 MW: 294.33 99 atom % D | 1-BROMOPENTADECANE-D31 CAS:349553-93-1 Formula: CD3(CD2)14Br D-4019 MW: 322.5 98 atom % D | 1-BROMOPENTANE-1,1,2,2-D4 CAS:1219803-61-8 Formula: CH3(CH2)2(CD2)2Br D-6638 MW: 155.07 99 atom % D | 1-BROMOPENTANE-1,1-D2 CAS:77734-75-9 Formula: CH3(CH2)3CD2Br D-6065 MW: 153.06 99 atom % D | 1-BROMOPENTANE-1-D1 CAS:148404-92-6 Formula: CH3(CH2)3CHDBr D-6932 MW: 152.05 98 atom % D | 1-BROMOPENTANE-2,2,3,3,4,4,5,5,5-D9 CAS:156673-70-0 Formula: CD3(CD2)3CH2Br D-6767 MW: 160.1 98 atom % D | 1-BROMOPENTANE-4,4,5,5,5-D5 CAS:83418-34-2 Formula: CD3CD2(CH2)3Br D-6629 MW: 156.07 99 atom % D | 1-BROMOPENTANE-5,5,5-D3 CAS:75736-50-4 Formula: CD3(CH2)4Br D-3977 MW: 154.06 99 atom % D | 1-BROMOPENTANE-D11 CAS:126840-21-9 Formula: CD3(CD2)4Br D-1722 MW: 162.11 98 atom % D | 1-BROMOPROPANE-1,1,2,2-D4 CAS:163400-21-3 Formula: CH3CD2CD2Br D-403 MW: 127.02 98 atom % D | 1-BROMOPROPANE-1,1,3,3,3-D5 CAS:163400-20-2 Formula: CD3CH2CD2Br D-343 MW: 128.02 98 atom % D | 1-BROMOPROPANE-1,1-D2 CAS:40422-05-7 Formula: CH3CH2CD2Br D-158 MW: 125 99 atom % D | 1-BROMOPROPANE-1-D1 CAS:43217-00-1 Formula: CH3CH2CDHBr D-7257 MW: 124 99 atom % D | 1-BROMOPROPANE-2,2,3,3,3-D5 CAS:61066-67-9 Formula: CD3CD2CH2Br D-225 MW: 128.02 98 atom % D | 1-BROMOPROPANE-2,2-D2 CAS:40422-15-9 Formula: CH3CD2CH2Br D-82 MW: 125 98 atom % D | 1-BROMOPROPANE-3,3,3-D3 CAS:61809-88-9 Formula: CD3CH2CH2Br D-256 MW: 126.01 99 atom % D | 1-BROMOPROPANE-D7 CAS:61909-26-0 Formula: CD3CD2CD2Br D-310 MW: 130.03 98 atom % D | 1-BROMOTETRADECANE-1,1,2,2-D4 CAS:1219798-81-8 Formula: CH3(CH2)11CD2CD2Br D-6510 MW: 281.31 98 atom % D | 1-BROMOTETRADECANE-14,14,14-D3 CAS:347840-09-9 Formula: CD3(CH2)13Br D-3603 MW: 280.31 99 atom % D | 1-BROMOTETRADECANE-D29 CAS:347841-80-9 Formula: CD3(CD2)13Br D-3297 MW: 306.46 98 atom % D | 1-BROMOTRIDECANE-1,1,2,2-D4 CAS:284474-45-9 Formula: CH3(CH2)10CD2CD2Br D-6460 MW: 267.28 98 atom % D | 1-BROMOTRIDECANE-D27 CAS:349553-91-9 Formula: CD3(CD2)12Br D-4011 MW: 290.43 98 atom % D | 1-BROMOUNDECANE-1,1,2,2-D4 CAS:1219802-82-0 Formula: CH3(CH2)8(CD2)2Br D-6751 MW: 239.23 98 atom % D | 1-BROMOUNDECANE-11,11,11-D3 CAS:1219805-63-6 Formula: CD3(CH2)10Br D-6357 MW: 238.23 98 atom % D | 1-BROMOUNDECANE-D23 CAS:349553-92-0 Formula: CD3(CD2)10Br D-4014 MW: 258.35 98 atom % D | 1-BUTANE-D9-SULFONYL CHLORIDE CAS:1219794-70-3 Formula: CD3(CD2)3SO2Cl D-6021 MW: 165.68 98 atom % D | 1-BUTANE-D9-THIOL CAS:352431-09-5 Formula: CD3(CD2)3SH D-5311 MW: 99.24 98 atom % D | 1-BUTENE-1,1-D2 (GAS) CAS:26119-76-6 Formula: CH3CH2CH=CD2 D-567 MW: 58.12 98 atom % D | 1-BUTENE-4,4,4-D3 (GAS) CAS:23086-03-5 Formula: CD3CH2CH=CH2 D-1452 MW: 59.13 99 atom % D | 1-BUTYNE-3,3,4,4,4-D5 (GAS) CAS:60173-50-4 Formula: CD3CD2C≡CH D-7555 MW: 59.12 99 atom % D | 1-CHLORO-2,4-DINITROBENZENE-D3 CAS:347840-12-4 Formula: ClC6D3(NO2)2 D-3702 MW: 205.57 98 atom % D | 1-CHLOROADAMANTANE-D15 CAS:352431-55-1 D-5303 MW: 185.77 98 atom % D | 1-CHLOROBUTANE-D9 CAS:175540-76-8 Formula: CD3CD2CD2CD2Cl D-1085 MW: 101.62 98 atom % D | 1-CHLOROHEXADECANE-D33 CAS:352431-13-1 Formula: CD3(CD2)15Cl D-5319 MW: 294.09 98 atom % D | 1-CHLOROHEXANE-D13 CAS:1219798-45-4 Formula: CD3(CD2)5Cl D-6476 MW: 133.7 98 atom % D | 1-CHLOROOCTANE-D17 CAS:1219803-93-6 Formula: CD3(CD2)7Cl D-6697 MW: 165.78 98 atom % D | 1-CHLOROPROPANE-1,1-D2 CAS:125640-23-5 Formula: CH3CH2CD2Cl D-5931 MW: 80.55 98 atom % D | 1-CHLOROPROPANE-D7 CAS:761374-88-3 Formula: CD3CD2CD2Cl D-6477 MW: 85.58 98 atom % D | 1-DODECANE-D25-THIOL CAS:869563-00-8 Formula: CD3(CD2)11SH D-6743 MW: 227.55 98 atom % D | 1-HEPTYNE-6,6,7,7,7-D5 CAS:83418-35-3 Formula: CD3CD2CH2CH2CH2C≡CH D-6628 MW: 101.2 99 atom % D | 1-HEXADECANE-D33-THIOL CAS:218956-22-0 Formula: CD3(CD2)15SH D-6820 MW: 291.71 98 atom % D | 1-HEXANE-D13-THIOL CAS:1142922-50-6 Formula: CD3(CD2)5SH D-6419 MW: 131.32 98 atom % D | 1-HYDROXYPYRENE-D9 CAS:132603-37-3 D-6040 MW: 227.31 98 atom % D | 1-IODOBUTANE-2,2,3,3,4,4,4-D7 Formula: CD3CD2CD2CH2I D-7652 MW: 191.06 98 atom % D | 1-IODOBUTANE-D9 (STABILIZED WITH COPPER) CAS:59012-24-7 Formula: CD3(CD2)3I D-1230 MW: 193.07 98 atom % D | 1-IODOOCTANE-1,1-D2 (STABILIZED WITH COPPER) CAS:89232-08-6 Formula: CH3(CH2)6CD2I D-5831 MW: 242.14 98 atom % D | 1-IODOOCTANE-D17 (STABILIZED WITH COPPER) CAS:340256-37-3 Formula: CD3(CD2)7I D-1235 MW: 257.23 98 atom % D | 1-IODOPENTANE-5,5,5-D3 CAS:920502-31-4 Formula: CD3(CH2)4I D-6490 MW: 201.06 98 atom % D | 1-IODOPROPANE-1,1,2,2-D4 (STABILIZED WITH COPPER) CAS:1219804-45-1 Formula: CH3CD2CD2l D-4228 MW: 174.02 98 atom % D | 1-IODOPROPANE-1,1,3,3,3-D5 (STABILIZED WITH COPPER) CAS:1219794-94-1 Formula: CD3CH2CD2I D-4229 MW: 175.02 98 atom % D | 1-IODOPROPANE-1,1-D2 (STABILIZED WITH COPPER) CAS:25493-14-5 Formula: CH3CH2CD2I D-36 MW: 172.01 99 atom % D | 1-IODOPROPANE-2,2,3,3,3-D5 (STABILIZED WITH COPPER) CAS:1095269-04-7 Formula: CD3CD2CH2l D-196 MW: 175.02 98 atom % D | 1-IODOPROPANE-2,2-D2 (STABILIZED WITH COPPER) CAS:25493-15-6 Formula: CH3CD2CH2I D-328 MW: 172.01 98 atom % D | 1-IODOPROPANE-3,3,3-D3 (STABILIZED WITH COPPER) CAS:25493-16-7 Formula: CD3CH2CH2I D-4198 MW: 173.01 99 atom % D | 1-IODOPROPANE-D7 (STABILIZED WITH COPPER) CAS:59012-23-6 Formula: CD3(CD2)2I D-1237 MW: 177.04 98 atom % D | 1-METHYL-D3- L -TRYPTOPHAN D-6971 MW: 221.27 99 atom % D | 1-METHYL-D3-5-MERCAPTO-1,2,3,4-TETRAZOLE CAS:345909-96-8 D-2797 MW: 119.16 99 atom % D | 1-METHYL-D3-IMIDAZOLE CAS:16650-76-3 D-6925 MW: 85.12 99 atom % D | 1-METHYLIMIDAZOLE-D3 (RING-D3) CAS:4166-68-1 D-6425 MW: 85.12 98 atom % D | 1-METHYLIMIDAZOLE-D6 CAS:285978-27-0 D-6926 MW: 88.14 98 atom % D | 1-METHYLNAPHTHALENE-D10 CAS:38072-94-5 D-1300 MW: 152.26 98 atom % D | 1-NAPHTHOL-2,3,4,5,6,7,8-D7 CAS:124251-84-9 Formula: C10D7OH D-5050 MW: 151.22 98 atom % D | 1-NAPHTHOL-D8 CAS:207569-03-7 Formula: C10D7OD D-2391 MW: 152.22 98 atom % D | 1-NITRONAPHTHALENE-D7 CAS:80789-77-1 D-5797 MW: 180.21 98 atom % D | 1-NITROPYRENE-D9 CAS:93487-20-8 D-5234 MW: 256.31 98 atom % D | 1-O-OCTYL-D17-β- D -GLUCOPYRANOSIDE CAS:129522-81-2 D-5260 MW: 309.48 98 atom % D | 1-OCTADECANE-D37-THIOL CAS:668433-57-6 Formula: CD3(CD2)17SH D-6744 MW: 323.78 98 atom % D | 1-OCTANE-D17-THIOL CAS:226999-68-4 Formula: CD3(CD2)7SH D-6581 MW: 163.39 98 atom % D | 1-PENTENE-4,4,5,5,5-D5 CAS:80820-43-5 Formula: CD3CD2CH2CH=CH2 D-5747 MW: 75.16 99 atom % D | 1-PHENYL-1-BUTYNE-3,3,4,4,4-D5 CAS:1219803-38-9 Formula: C6H5C≡CCD2CD3 D-6806 MW: 135.22 99 atom % D | 1-PHENYL-D5-AZO-2-NAPHTHOL CAS:752211-63-5 D-6611 MW: 253.31 98 atom % D | 1-PHENYLDODECANE-D30 CAS:352431-29-9 Formula: C6D5(CD2)11CD3 D-5230 MW: 276.62 98 atom % D | 1-PHENYLPENTADECANE-D36 CAS:352431-31-3 Formula: C6D5(CD2)14CD3 D-5231 MW: 324.74 98 atom % D | 1-PROPANE-D7-THIOL CAS:1219803-52-7 Formula: CD3CD2CD2SH D-6804 MW: 83.2 98 atom % D | 1-PROPANETHIOL-SD CAS:64071-73-4 Formula: CH3CH2CH2SD D-222 MW: 77.16 98 atom % D | 16α-HYDROXY-17β-ESTRADIOL-2,4,17-D3 CAS:79037-36-8 D-5384 MW: 291.4 98 atom % D | 16α-HYDROXY-17β-ESTRADIOL-2,4-D2 CAS:53866-32-3 D-5279 MW: 290.4 98 atom % D | 16β-HYDROXY-17β-ESTRADIOL-2,4-D2 CAS:366495-94-5 D-5551 MW: 290.4 98 atom % D | 16-(5α)-ANDROSTEN-3-ONE-2,2,4,4-D4 D-7051 MW: 276.45 98 atom % D | 16-KETO-17β-ESTRADIOL-2,4,15,15,17-D5 D-5809 MW: 291.4 95 atom % D | 17α-ESTRADIOL-2,4-D2 CAS:81586-94-9 D-5431 MW: 274.4 98 atom % D | 17α-ETHYNYL-13C2-ESTRADIOL C-4277 MW: 298.43 99 atom % 13C | 17α-ETHYNYLESTRADIOL-16,16-D2 3-METHYL ETHER D-5990 MW: 312.45 97 atom % D | 17α-ETHYNYLESTRADIOL-2,4,16,16-D4 CAS:350820-06-3 D-4319 MW: 300.43 98 atom % D | 17α-ETHYNYLESTRADIOL-2,4,16,16-D4 3-METHYL ETHER D-6142 MW: 314.46 98 atom % D | 17α-HYDROXYPREGNENOLONE-21,21,21-D3 CAS:105078-92-0 D-5329 MW: 335.5 97 atom % D | 17β-DIHYDROEQUILENIN-4,16,16-D3 D-5659 MW: 271.37 96 atom % D | 17β-DIHYDROEQUILIN-16,16,17-D3 CAS:350820-03-0 D-4260 MW: 273.4 98 atom % D | 17β-DIHYDROEQUILIN-2,4,16,16,17-D5 D-5833 MW: 275.4 98 atom % D | 17β-DIHYDROEQUILIN-2,4,16,16-D4 CAS:350819-99-7 D-4187 MW: 274.39 98 atom % D | 17β-ESTRADIOL-16,16,17-D3 CAS:79037-37-9 D-2325 MW: 275.4 98 atom % D | 17β-ESTRADIOL-16,16,17-D3 3-BENZOATE CAS:1192354-74-7 D-7054 MW: 379.51 98 atom % D | 17β-ESTRADIOL-16,16-D2 CAS:3188-46-3 D-5433 MW: 274.4 98 atom % D | 17β-ESTRADIOL-2,4,16,16,17-D5 CAS:221093-45-4 D-5403 MW: 277.42 98 atom % D | 17β-ESTRADIOL-2,4,16,16-D4 CAS:66789-03-5 D-4318 MW: 276.41 98 atom % D | 17β-ESTRADIOL-2,4,16,16-D4 17-PENTANOATE D-7189 MW: 360.53 98 atom % D | 17β-ESTRADIOL-2,4-D2 CAS:53866-33-4 D-5432 MW: 274.4 98 atom % D | 1H-BENZOTRIAZOLE-4,5,6,7-D4 CAS:1185072-03-0 D-7358 MW: 123.15 99 atom % D | 2′,3,4-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4 D-7042 MW: 261.57 98 atom % D | 2′,3,5-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4 D-7043 MW: 261.57 98 atom % D | 2′-DEOXYURIDINE-5,6-D2 CAS:40632-23-3 D-5352 MW: 230.22 98 atom % D | 2′-FLUORODEOXYURIDINE-5,6-D2 CAS:362049-50-1 D-5455 MW: 248.21 98 atom % D | 2,2′,3,4,5,5′-HEXACHLOROBIPHENYL-3′,4′,6′-D3 CAS:1219798-51-2 D-6913 MW: 363.9 99 atom % D | 2,2′,4,5,5′-PENTACHLOROBIPHENYL-3′,4′,6′-D3 CAS:1219794-68-9 D-6901 MW: 329.45 98 atom % D | 2,2′,4,6,6′-PENTACHLOROBIPHENYL-3′,4′,5′-D3 CAS:1219794-64-5 D-6902 MW: 329.45 98 atom % D | 2,2′,5,5′-TETRACHLOROBIPHENYL-3,4,6-D3 CAS:1219794-74-7 Formula: C6D3Cl2C6H3Cl2 D-6896 MW: 295.01 98 atom % D | 2,2′,5-TRICHLOROBIPHENYL-3,4,4′,6,6′-D5 D-7036 MW: 262.58 98 atom % D | 2,2′-DINAPHTHYL-D14 CAS:210487-05-1 D-5746 MW: 268.42 99 atom % D | 2,2′-DIPYRIDYL-D8 CAS:32190-42-4 D-1467 MW: 164.24 98 atom % D | 2,2,4-TRIMETHYLPENTANE-D18 CAS:51685-57-5 Formula: (CD3)3CCD2CD(CD3)2 D-2010 MW: 132.34 98 atom % D | 2,2,6,6-TETRAMETHYLPIPERIDINE-D18-1-OXYL CAS:205679-68-1 D-7184 MW: 174.36 98 atom % D | 2,2-BIS(HYDROXYMETHYL-D2) PROPIONIC-3,3,3-D3 ACID CAS:1219802-03-5 Formula: (HOCD2)2C(CD3)COOH D-5483 MW: 141.17 99 atom % D | 2,2-DIMETHYLBUTYRIC-D11 ACID CAS:1219804-04-2 Formula: CD3CD2C(CD3)2COOH D-5843 MW: 127.23 98 atom % D | 2,2-DIMETHYLPROPANE-D12 (GAS) CAS:5152-54-5 Formula: (CD3)4C D-105 MW: 84.22 98 atom % D | 2,3′,4′,5-TETRACHLOROBIPHENYL-3,4,6-D3 CAS:1219794-77-0 Formula: Cl2C6D3C6H3Cl2 D-6897 MW: 295.01 98 atom % D | 2,3′,5-TRICHLOROBIPHENYL-2′,3,4,4′,6,6′-D6 D-7039 MW: 263.58 99 atom % D | 2,3,3′,4,4′,5-HEXACHLOROBIPHENYL-2′,6,6′-D3 CAS:1219798-44-3 D-6914 MW: 363.9 98 atom % D | 2,3,3′,4,5,5′-HEXACHLOROBIPHENYL-2′,4′,6′-D3 CAS:1219798-69-2 D-6915 MW: 363.9 98 atom % D | 2,3,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4 D-7038 MW: 261.57 98 atom % D | 2,3,4,4′,5-PENTACHLOROBIPHENYL-2′,3′,5′,6′-D4 CAS:1219799-24-2 D-6912 MW: 330.46 98 atom % D | 2,3,4,5,6-PENTACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1219798-92-1 Formula: C6Cl5C6D5 D-6493 MW: 331.47 98 atom % D | 2,3,4-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1219805-70-5 D-7037 MW: 262.58 99 atom % D | 2,3,4-TRIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5 Formula: (HO)3C6H2COC6D5 D-7646 MW: 235.25 98 atom % D | 2,3,5,6-TETRACHLOROANILINE-D3 CAS:1219806-05-9 Formula: Cl4C6DND2 D-6911 MW: 233.93 99 atom % D | 2,3,5,6-TETRACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1219794-80-5 Formula: C6HCl4C6D5 D-6941 MW: 297.02 98 atom % D | 2,3,5-TRIMETHYLPHENOL-D11 CAS:362049-46-5 Formula: (CD3)3C6D2OH D-5441 MW: 147.26 98 atom % D | 2,3,6-TRICHLOROANISOLE-D3(METHOXY-D3) CAS:1219798-64-7 Formula: Cl3C6H2OCD3 D-5951 MW: 214.49 99 atom % D | 2,3,6-TRICHLOROPHENOL-4,5-D2 CAS:93951-81-6 Formula: Cl3C6D2OH D-2934 MW: 199.46 97 atom % D | 2,3,6-TRIMETHYLPHENOL-D11 CAS:347841-83-2 Formula: (CD3)3C6D2OH D-3384 MW: 147.26 98 atom % D | 2,3-BUTANE-1,1,1,4,4,4-D6-DIOL(MIXTURE,OF,STEREOISOMERS) CAS:344750-80-7 Formula: CD3CH(OH)CH(OH)CD3 D-3233 MW: 96.16 98 atom % D | 2,3-BUTANE-D8-DIOL(MIXTURE,OF,STEREOISOMERS) CAS:347841-77-4 Formula: CD3CD(OH)CD(OH)CD3 D-3234 MW: 98.17 98 atom % D | 2,3-BUTANEDIONE-D6 CAS:22026-37-5 Formula: CD3COCOCD3 D-3232 MW: 92.13 98 atom % D | 2,3-DICHLOROBENZOIC-D3 ACID CAS:1126107-18-3 Formula: Cl2C6D3COOH D-6480 MW: 194.03 98 atom % D | 2,3-DICHLOROTOLUENE-4,5,6-D3 CAS:1219798-57-8 Formula: Cl2C6D3CH3 D-6481 MW: 164.05 98 atom % D | 2,3-DIMETHYLPENTANE-D16 CAS:1219795-08-0 Formula: CD3CD2CD(CD3)CD(CD3)2 D-6997 MW: 116.3 99 atom % D | 2,3-DIMETHYLPYRIDINE-D9 CAS:350818-65-4 D-5078 MW: 116.21 98 atom % D | 2,3-PENTANEDIONE-1,1,1,4,4-D5 CAS:352431-46-0 Formula: CH3CD2COCOCD3 D-5268 MW: 105.15 98 atom % D | 2,4′,5-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4 Formula: Cl2C6H3C6ClD4 D-6892 MW: 261.57 98 atom % D | 2,4′-DICHLOROBIPHENYL-D8 CAS:1219795-19-3 D-6917 MW: 231.15 98 atom % D | 2,4,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4 D-6994 MW: 261.57 98 atom % D | 2,4,5-TRICHLOROANILINE-D4 CAS:1219804-61-1 Formula: Cl3C6D2ND2 D-6996 MW: 200.49 98 atom % D | 2,4,5-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1276197-33-1 D-7040 MW: 262.58 99 atom % D | 2,4,5-TRICHLOROPHENOL-3,6-D2 CAS:93951-82-7 Formula: Cl3C6D2OH D-2935 MW: 199.46 98 atom % D | 2,4,6-TRIBROMOANISOLE-D5 CAS:1219795-33-1 Formula: Br3C6D2OCD3 D-5678 MW: 349.86 99 atom % D | 2,4,6-TRIBROMOPHENOL-3,5-D2 CAS:1219795-42-2 Formula: Br3C6D2OH D-5656 MW: 332.81 99 atom % D | 2,4,6-TRICHLOROANISOLE-D5 CAS:352439-08-8 Formula: Cl3C6D2OCD3 D-5216 MW: 216.51 98 atom % D | 2,4,6-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1219794-85-0 Formula: Cl3C6H2C6D5 D-6938 MW: 262.58 98 atom % D | 2,4,6-TRICHLOROPHENOL-3,5-D2 CAS:93951-80-5 Formula: Cl3C6D2OH D-2279 MW: 199.46 98 atom % D | 2,4,6-TRIMETHYLPHENOL-D11 CAS:362049-45-4 Formula: (CD3)3C6D2OH D-5443 MW: 147.26 98 atom % D | 2,4,6-TRIMETHYLPYRIDINE-D11 CAS:1219805-54-5 Formula: (CD3)3C5D2N D-6254 MW: 132.25 98 atom % D | 2,4-DIAMINOTOLUENE-α,α,α-D3 CAS:71111-08-5 Formula: CD3C6H3(NH2)2 D-5472 MW: 125.19 98 atom % D | 2,4-DIBROMOPHENOL-3,5,6-D3 CAS:1219805-97-6 Formula: Br2C6D3OH D-5640 MW: 254.92 98 atom % D | 2,4-DICHLOROBENZOIC-D3 ACID CAS:1398065-99-0 Formula: Cl2C6D3COOH D-7342 MW: 194.03 98 atom % D | 2,4-DICHLOROPHENOL-3,5,6-D3 CAS:93951-74-7 Formula: Cl2C6D3OH D-2281 MW: 166.02 98 atom % D | 2,4-DICHLOROTOLUENE-3,5,6-D3 CAS:1398065-47-8 Formula: Cl2C6D3CH3 D-7341 MW: 164.05 98 atom % D | 2,4-DIFLUOROBENZOIC-D3 ACID CAS:1219804-63-3 Formula: F2C6D3COOH D-6953 MW: 161.12 98 atom % D | 2,4-DIFLUOROTOLUENE-3,5,6-D3 CAS:1219798-79-4 Formula: CH3C6D3F2 D-7172 MW: 131.14 99 atom % D | 2,4-DIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5 CAS:91586-06-0 Formula: (HO)2C6H3COC6D5 D-7645 MW: 219.25 98 atom % D | 2,4-DIMETHYL-D6-ANILINE CAS:1071170-27-8 Formula: (CD3)2C6H3NH2 D-7387 MW: 127.22 98 atom % D | 2,4-DIMETHYL-D6-ANILINE HCL CAS:1219805-38-5 Formula: (CD3)2C6H3NH2HCl D-5684 MW: 163.68 99 atom % D | 2,4-DIMETHYL-D6-NITROBENZENE CAS:1398065-58-1 Formula: (CD3)2C6H3NO2 D-7386 MW: 157.2 98 atom % D | 2,4-DIMETHYLANILINE-D11 CAS:1398065-83-2 Formula: (CD3)2C6D3ND2 D-7355 MW: 132.25 99 atom % D | 2,4-DIMETHYLPHENOL-3,5,6-D3 CAS:93951-75-8 Formula: (CH3)2C6D3OH D-2284 MW: 125.18 98 atom % D | 2,4-DIMETHYLPHENOL-D10 CAS:1219794-86-1 Formula: (CD3)2C6D3OD D-6311 MW: 132.23 98 atom % D | 2,4-DINITROTOLUENE-α,α,α-D3 CAS:70786-68-4 Formula: (NO2)2C6H3CD3 D-5093 MW: 185.15 98 atom % D | 2,4-DINITROTOLUENE-3,5,6-D3 CAS:93951-68-9 Formula: (NO2)2C6D3CH3 D-2407 MW: 185.15 98 atom % D | 2,5-DI-( TERT -BUTYL-D9)-4-METHOXYPHENOL-3,6-D2 CAS:1219802-07-9 D-6274 MW: 256.48 98 atom % D | 2,5-DICHLOROANILINE-3,4,6-D3 CAS:783321-80-2 Formula: Cl2C6D3NH2 D-6479 MW: 165.04 98 atom % D | 2,5-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1219804-50-8 Formula: Cl2C6H3C6D5 D-6895 MW: 228.13 99 atom % D | 2,5-DICHLOROPHENOL-3,4,6-D3 CAS:1219803-68-5 Formula: Cl2C6D3OH D-6641 MW: 166.02 98 atom % D | 2,5-DIFLUOROBENZOIC-D3 ACID CAS:1219798-63-6 Formula: F2C6D3COOH D-6484 MW: 161.12 98 atom % D | 2,5-HEXANEDIONE-D10 CAS:97135-07-4 Formula: CD3COCD2CD2COCD3 D-2296 MW: 124.2 98 atom % D | 2,6,10,14-TETRAMETHYLPENTADECANE-D40 CAS:16416-35-6 Formula: C19D40 D-909 MW: 308.77 98 atom % D | 2,6,10,15,19,23-HEXAMETHYLTETRACOSANE-D62 CAS:16514-83-3 Formula: C30D62 D-958 MW: 485.2 98 atom % D | 2,6-DI- ISO -PROPYLPHENOL-D18 CAS:1189467-93-3 Formula: [(CD3)2CD]2C6D3OD D-6546 MW: 196.38 98 atom % D | 2,6-DI- TERT -BUTYL-4-METHYLPHENOL-D24 CAS:1219805-92-1 D-5751 MW: 244.5 98 atom % D | 2,6-DI-( TERT -BUTYL-D1)-4-METHYL-D3-PHENOL-3,5-D2 CAS:1219805-62-5 D-5566 MW: 227.4 95 atom % D | 2,6-DI-( TERT -BUTYL-D9)-4-METHOXYPHENOL-3,5-D2 CAS:1219799-34-4 D-6748 MW: 256.48 98 atom % D | 2,6-DI-( TERT -BUTYL-D9)-4-METHYLPHENOL-3,5-D2,OD CAS:64502-99-4 D-1765 MW: 241.48 98 atom % D | 2,6-DIAMINOTOLUENE-α,α,α-D3 CAS:362049-58-9 Formula: CD3C6H3(NH2)2 D-5473 MW: 125.19 97 atom % D | 2,6-DIBROMOPHENOL-3,4,5-D3 CAS:1219803-14-1 Formula: Br2C6D3OH D-4349 MW: 254.92 98 atom % D | 2,6-DICHLOROANILINE-3,4,5-D3 CAS:77435-48-4 Formula: Cl2C6D3NH2 D-3311 MW: 165.04 98 atom % D | 2,6-DICHLOROBENZAMIDE-3,4,5-D3 CAS:1219804-28-0 D-6700 MW: 193.05 98 atom % D | 2,6-DICHLOROBENZOIC-D3 ACID CAS:1219805-50-1 Formula: Cl2C6D3COOH D-5707 MW: 194.03 98 atom % D | 2,6-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1276197-38-6 D-7033 MW: 228.13 99 atom % D | 2,6-DICHLOROTOLUENE-3,4,5-D3 CAS:358731-95-0 Formula: Cl2C6D3CH3 D-5567 MW: 164.05 98 atom % D | 2,6-DIETHYLANILINE-D15 CAS:285132-89-0 Formula: (CD3CD2)2C6D3ND2 D-3023 MW: 164.33 97 atom % D | 2,6-DIFLUOROBENZOIC-D3 ACID CAS:1219804-21-3 Formula: F2C6D3COOH D-6073 MW: 161.12 98 atom % D | 2,6-DIMETHYL-D6-ANILINE CAS:919785-81-2 Formula: (CD3)2C6H3NH2 D-6578 MW: 127.22 98 atom % D | 2,6-DIMETHYL-D6-NITROBENZENE CAS:285138-83-2 Formula: (CD3)2C6H3NO2 D-3380 MW: 157.2 98 atom % D | 2,6-DIMETHYLANILINE-D11 CAS:1092805-08-7 Formula: (CD3)2C6D3ND2 D-6757 MW: 132.25 98 atom % D | 2,6-DIMETHYLNAPHTHALENE-D12 CAS:350820-12-1 D-4362 MW: 168.3 98 atom % D | 2,6-DIMETHYLPHENOL-3,4,5-D3,OD CAS:285132-85-6 Formula: (CH3)2C6D3OD D-5367 MW: 126.19 98 atom % D | 2,6-DIMETHYLPYRIDINE-D9 CAS:135742-47-1 D-5540 MW: 116.21 98 atom % D | 2,6-DINITROTOLUENE-α,α,α-D3 CAS:93951-90-7 Formula: (NO2)2C6H3CD3 D-2359 MW: 185.15 98 atom % D | 2- ISO -PROPYL-D7-5-METHYL-D3-PHENOL-3,4,6-D3 CAS:1219798-93-2 D-6717 MW: 163.3 98 atom % D | 2- TERT -BUTYLAMINO-D9-4-CHLORO-6-CYCLOPROPYLAMINO-1,3,5-TRIAZINE CAS:1189419-70-2 D-7151 MW: 250.78 99 atom % D | 2-(3,4-DIHYDROXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:203633-19-6 Formula: (HO)2C6H3CD2CD2NH2HCl D-1540 MW: 193.67 98 atom % D | 2-(3,4-DIHYDROXYPHENYL) ETHYL-1,1-D2-AMINE HCL CAS:83008-33-7 Formula: (HO)2C6H3CH2CD2NH2HCl D-1492 MW: 191.65 98 atom % D | 2-(3,4-DIHYDROXYPHENYL) ETHYL-1-13C-AMINE HCL CAS:335081-04-4 Formula: (HO)2C6H3CH213CH2NH2 C-4095 MW: 190.65 99 atom % 13C | 2-(3,4-DIHYDROXYPHENYL) ETHYL-1-13C-AMINE-15N HCL CAS:369656-74-6 Formula: (HO)2C6H3CH213CH215NHM-4221 MW: 191.66 99 atom % 13C; 99 atom % 15N | 2-(3,4-DIHYDROXYPHENYL) ETHYL-2,2-D2-AMINE HCL CAS:27160-01-6 Formula: (HO)2C6H3CD2CH2NH2HCl D-1493 MW: 191.65 98 atom % D | 2-(3,4-DIHYDROXYPHENYL-13C6) ETHYLAMINE HCL CAS:335080-94-9 Formula: (HO)213C6H3CH2CH2NH2 C-3334 MW: 195.7 99 atom % 13C | 2-(3,4-DIHYDROXYPHENYL-D3) ETHYLAMINE HCL CAS:53587-30-7 Formula: (HO)2C6D3CH2CH2NH2HCl D-1702 MW: 192.66 98 atom % D | 2-(3,4-DIMETHOXY-D6-PHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:1398065-73-0 Formula: (CD3O)2C6H3CD2CD2NH2 HC D-7423 MW: 227.76 99 atom % D | 2-(3,4-DIMETHOXYPHENYL) -N-METHYL-D3-ETHYLAMINE CAS:152561-88-1 Formula: (CH3O)2C6H4CH2CH2NHCD3 D-7530 MW: 198.28 99 atom % D | 2-(3,4-DIMETHOXYPHENYL) ETHYL-1,1-D2-AMINE CAS:37699-47-1 Formula: (CH3O)2C6H3CH2CD2NH2 D-1563 MW: 183.25 98 atom % D | 2-(3-ETHOXY-4-METHOXY-D3-PHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:1398065-60-5 D-7377 MW: 238.76 99 atom % D | 2-(3-ETHOXY-4-METHOXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:1398066-01-7 D-7376 MW: 235.75 99 atom % D | 2-(4-HYDROXY-3-METHOXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:1216788-76-9 D-2210 MW: 207.69 98 atom % D | 2-(4-HYDROXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL CAS:1189884-47-6 Formula: HOC6H4CD2CD2NH2HCl D-1651 MW: 177.67 98 atom % D | 2-(4-METHYLPHENYL)PROPANE-D14 CAS:93952-03-5 Formula: CD3C6D4CD(CD3)2 D-2709 MW: 148.31 98 atom % D | 2-(4-NITROPHENYL-D4)PROPANE CAS:1219803-36-7 Formula: O2NC6D4CH(CH3)2 D-6574 MW: 169.22 98 atom % D | 2-(N-BENZYL-N-METHYL)AMINOETHANOL-1,1,2,2-D4 CAS:1219803-10-7 Formula: C6H5CH2N(CH3)CD2CD2OH D-7166 MW: 169.26 99 atom % D | 2-(N-MORPHOLINO)ETHANESULFONIC ACID-D13 CAS:352534-94-2 D-6122 MW: 208.31 98 atom % D | 2-(PROPYL-1,1-D2)PENTANOIC-3,3-D2 ACID CAS:87745-17-3 Formula: (CH3CH2CD2)2CHCOOH D-2546 MW: 148.24 99 atom % D | 2-(PROPYL-2,2-D2)PENTANOIC-4,4-D2 ACID CAS:345909-03-7 Formula: (CH3CD2CH2)2CHCOOH D-2884 MW: 148.24 99 atom % D | 2-(PROPYL-3,3,3-D3)PENTANOIC-5,5,5-D3 ACID CAS:87745-18-4 Formula: (CD3CH2CH2)2CHCOOH D-2538 MW: 150.25 99 atom % D | 2-ACETOXYBENZOIC-3,4,5,6-D4 ACID CAS:97781-16-3 Formula: CH3COOC6D4COOH D-6290 MW: 184.18 98 atom % D | 2-AMINO-2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 Formula: (CD3)3CNH2 D-355 MW: 82.19 99 atom % D | 2-AMINO-2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 HBR CAS:134071-63-9 Formula: (CD3)3CNH2HBr D-6886 MW: 163.1 99 atom % D | 2-AMINO-4,6-DIMETHOXY-D6-PYRIMIDINE CAS:1219803-92-5 D-7135 MW: 161.19 99 atom % D | 2-AMINO-5-CHLOROPYRIDINE-3,4,6-D3 CAS:1093384-99-6 D-6691 MW: 131.58 98 atom % D | 2-AMINOBIPHENYL-D9 CAS:344298-97-1 Formula: C6D5C6D4NH2 D-2331 MW: 178.28 98 atom % D | 2-AMINOETHANE-D4-SULFINIC ACID CAS:352438-83-6 Formula: H2NCD2CD2SO2H D-5158 MW: 113.17 95 atom % D | 2-AMINOETHANE-D4-SULFONIC ACID CAS:342611-14-7 Formula: H2NCD2CD2SO3H D-1971 MW: 129.17 99 atom % D | 2-AMINOETHANE-D4-THIOL HCL CAS:1219805-04-5 Formula: HSCD2CD2NH2HCl D-6501 MW: 117.63 99 atom % D | 2-AMINOFLUORENE-D11 CAS:347841-44-5 D-3804 MW: 192.3 98 atom % D | 2-AMINONAPHTHALENE-D7 CAS:93951-94-1 D-191 MW: 150.23 98 atom % D | 2-AMINOPYRIDINE-D6 CAS:203784-57-0 Formula: D2NC5D4N D-3508 MW: 100.15 98 atom % D | 2-BROMO-2-METHYL-D3-PROPIONIC-D3 ACID CAS:1219795-23-9 Formula: (CD3)2C(Br)COOH D-5923 MW: 173.04 99 atom % D | 2-BROMO-2-METHYLPROPANE-D9 CAS:42310-83-8 Formula: (CD3)3CBr D-2199 MW: 146.07 98 atom % D | 2-BROMO-4′-FLUOROACETOPHENONE-2′,3′,5′,6′-D4 CAS:1219803-30-1 Formula: FC6D4COCH2Br D-7031 MW: 221.06 94 atom % D | 2-BROMOCHLOROBENZENE-D4 CAS:1219795-51-3 Formula: BrC6D4Cl D-6444 MW: 195.48 98 atom % D | 2-BROMOETHANOL-1,1,2,2-D4 CAS:81764-55-8 Formula: BrCD2CD2OH D-1913 MW: 128.99 99 atom % D | 2-BROMOETHYL-D4-AMINE HBR CAS:918633-70-2 Formula: BrCD2CD2NH2HBr D-6671 MW: 208.92 98 atom % D | 2-BROMOFLUOROBENZENE-D4 CAS:50592-35-3 Formula: BrC6D4F D-5926 MW: 179.02 98 atom % D | 2-BROMONITROBENZENE-D4 CAS:1020720-09-5 Formula: BrC6D4NO2 D-6130 MW: 206.03 98 atom % D | 2-BROMOPROPANE-1,1,1,2-D4 CAS:1219799-22-0 Formula: CH3CD(Br)CD3 D-5983 MW: 127.02 99 atom % D | 2-BROMOPROPANE-1,1,1,3,3,3-D6 CAS:52809-76-4 Formula: (CD3)2CHBr D-793 MW: 129.03 99 atom % D | 2-BROMOPROPANE-1,1,1-D3 CAS:688361-45-7 Formula: CD3CH(Br)CH3 D-5928 MW: 126.01 98 atom % D | 2-BROMOPROPANE-2-D1 CAS:4067-80-5 Formula: (CH3)2CDBr D-1890 MW: 124 98 atom % D | 2-BROMOPROPANE-D7 CAS:39091-63-9 Formula: (CD3)2CDBr D-751 MW: 130.04 99 atom % D | 2-BROMOPYRIDINE-D4 CAS:70766-71-1 D-6032 MW: 162.02 98 atom % D | 2-BROMOTOLUENE-3,4,5,6-D4 CAS:56444-57-6 Formula: BrC6D4CH3 D-6403 MW: 175.06 98 atom % D | 2-BROMOTOLUENE-D7 CAS:1185306-95-9 Formula: BrC6D4CD3 D-6404 MW: 178.08 98 atom % D | 2-BUTANONE 2,4-DINITROPHENYLHYDRAZONE-3,5,6-D3 CAS:259824-58-3 Formula: CH3CH2C(CH3)=NNHC6D3(NO2)2D-7602 MW: 255.25 99 atom % D | 2-BUTANONE-1,1,1,3,3-D5 CAS:24313-50-6 Formula: CH3CD2COCD3 D-293 MW: 77.14 98 atom % D | 2-BUTANONE-4,4,4-D3 CAS:53389-26-7 Formula: CD3CH2COCH3 D-2402 MW: 75.12 99 atom % D | 2-BUTANONE-D8 CAS:350820-09-6 Formula: CD3CD2COCD3 D-4331 MW: 80.16 98 atom % D | 2-BUTENE-1,1,1-D3 (GAS) ( CIS/TRANS MIXTURE) CAS:116008-90-3 Formula: CH3CH=CHCD3 D-5156 MW: 59.13 99 atom % D | 2-BUTENE-D8 (GAS) ( CIS/TRANS MIXTURE) CAS:6157-20-6 Formula: CD3CD=CDCD3 D-98 MW: 64.16 98 atom % D | 2-BUTOXYETHANOL-1,1,2,2-D4 CAS:1219803-96-9 Formula: CH3CH2CH2CH2OCD2CD2OH D-6947 MW: 122.2 99 atom % D | 2-CHLORO-2-METHYLPROPANE-D9 CAS:918-20-7 Formula: (CD3)3CCl D-99 MW: 101.62 99 atom % D | 2-CHLORO-N,N-DIETHYLETHYL-D4-AMINE HCL CAS:1219805-94-3 Formula: (CH3CH2)2NCD2CD2ClHCl D-6193 MW: 176.12 99 atom % D | 2-CHLORO-N,N-DIMETHYL-D6-ETHYLAMINE HCL CAS:97941-91-8 Formula: ClCH2CH2N(CD3)2HCl D-6526 MW: 150.08 98 atom % D | 2-CHLOROACETAMIDE-D4 CAS:122775-20-6 Formula: ClCD2COND2 D-135 MW: 97.54 99 atom % D | 2-CHLOROANILINE-4,6-D2 CAS:347840-10-2 Formula: ClC6H2D2NH2 D-3700 MW: 129.59 98 atom % D | 2-CHLOROANILINE-D6 CAS:1276197-37-5 Formula: ClC6D4ND2 D-7280 MW: 133.61 98 atom % D | 2-CHLOROANISOLE-D3 (METHYL-D3) CAS:1398065-46-7 Formula: ClC6H4OCD3 D-7374 MW: 145.6 99 atom % D | 2-CHLOROBENZALDEHYDE-3,4,5,6-D4 CAS:1093351-46-2 Formula: ClC6D4CHO D-7308 MW: 144.59 98 atom % D | 2-CHLOROBENZOIC-D4 ACID CAS:1219795-28-4 Formula: ClC6D4COOH D-5955 MW: 160.59 98 atom % D | 2-CHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:51624-35-2 Formula: ClC6H4C6D5 D-3011 MW: 193.69 98 atom % D | 2-CHLOROETHYL-D4-AMINE HCL CAS:172333-26-5 Formula: ClCD2CD2NH2HCl D-6877 MW: 120.01 98 atom % D | 2-CHLORONAPHTHALENE-D7 CAS:93951-84-9 D-2462 MW: 169.66 98 atom % D | 2-CHLOROPHENOL-3,4,5,6-D4 CAS:93951-73-6 Formula: ClC6D4OH D-2280 MW: 132.58 98 atom % D | 2-CHLOROPROPANE-1,1,1,3,3,3-D6 CAS:23197-02-6 Formula: (CD3)2CHCl D-4252 MW: 84.58 98 atom % D | 2-CHLOROPROPANE-1,1,1-D3 CAS:137832-55-4 Formula: CH3CH(Cl)CD3 D-5634 MW: 81.56 98 atom % D | 2-CHLOROPROPANE-2-D1 CAS:53778-42-0 Formula: (CH3)2CDCl D-4253 MW: 79.55 98 atom % D | 2-CHLOROPROPANE-D7 CAS:55956-02-0 Formula: (CD3)2CDCl D-5106 MW: 85.58 99 atom % D | 2-CHLOROPYRIDINE-D4 CAS:1001003-94-6 Formula: C5D4NCl D-6213 MW: 117.57 99 atom % D | 2-CHLOROTOLUENE-3,4,5,6-D4 CAS:362049-57-8 Formula: ClC6D4CH3 D-5470 MW: 130.61 98 atom % D | 2-CHLOROTOLUENE-D7 CAS:84344-05-8 Formula: ClC6D4CD3 D-6408 MW: 133.63 98 atom % D | 2-CYANOPYRIDINE-D4 CAS:1219795-17-1 Formula: C5D4NCN D-6376 MW: 108.14 99 atom % D | 2-CYCLOPROPYLETHYL-1,1,2,2-D4-AMINE CAS:1219795-00-2 D-7001 MW: 89.17 98 atom % D | 2-ETHOXY-D5-PHENOL CAS:117320-30-6 Formula: CD3CD2OC6H4OH D-7541 MW: 143.2 99 atom % D | 2-ETHOXYETHANOL-1,1,2,2-D4 CAS:1219805-07-8 Formula: CH3CH2OCD2CD2OH D-6139 MW: 94.15 98 atom % D | 2-ETHYL-α,α-D2-PYRAZINE-3,5,6-D3 CAS:1276197-45-5 D-7325 MW: 113.17 98 atom % D | 2-ETHYL-6-METHYLANILINE-D13 CAS:1219794-93-0 D-5919 MW: 148.29 98 atom % D | 2-ETHYL-D5-NAPHTHALENE CAS:1219805-14-7 D-7199 MW: 161.26 99 atom % D | 2-ETHYLPHENOL-D10 CAS:721429-63-6 Formula: CD3CD2C6D4OD D-7181 MW: 132.23 99 atom % D | 2-FLUOROANILINE-4,6-D2,ND2 CAS:1219804-77-9 Formula: FC6H2D2ND2 D-6903 MW: 115.14 98 atom % D | 2-FLUOROBENZOIC-D4 ACID CAS:646502-89-8 Formula: FC6D4COOH D-5991 MW: 144.14 98 atom % D | 2-FLUOROTOLUENE-α,α,α-D3 CAS:25319-49-7 Formula: CD3C6H4F D-1673 MW: 113.15 98 atom % D | 2-FLUOROTOLUENE-α-D1 CAS:17359-78-3 Formula: CH2DC6H4F D-7625 MW: 111.14 98 atom % D | 2-FUROIC-D3 ACID CAS:40073-83-4 D-5791 MW: 115.1 98 atom % D | 2-HEPTANONE-1,1,1,3,3-D5 CAS:24588-56-5 Formula: CH3(CH2)3CD2COCD3 D-2516 MW: 119.22 98 atom % D | 2-HEXANONE-1,1,1,3,3-D5 CAS:4840-82-8 Formula: CH3(CH2)2CD2COCD3 D-1632 MW: 105.19 98 atom % D | 2-HYDROXY-1,4-NAPHTHOQUINONE-5,6,7,8-D4 D-7550 MW: 178.18 98 atom % D | 2-HYDROXY-17β-ESTRADIOL-1,4,16,16,17-D5 CAS:221093-33-0 D-5552 MW: 293.42 98 atom % D | 2-HYDROXY-2-METHYL-D3-PROPIONIC-3,3,3-D3 ACID CAS:40662-45-1 Formula: (CD3)2C(OH)COOH D-6605 MW: 110.14 98 atom % D | 2-HYDROXY-4-METHOXYBENZOPHENONE-2′,3′,4′,5′,6′-D5 CAS:1219798-54-5 D-7066 MW: 233.28 99 atom % D | 2-HYDROXYATRAZINE-D5 (ETHYL-D5) CAS:1276197-25-1 D-7318 MW: 202.27 99 atom % D | 2-HYDROXYBENZOIC ACID-D6 CAS:285979-87-5 Formula: DOC6D4COOD D-1156 MW: 144.16 98 atom % D | 2-HYDROXYBENZOIC-3,4,5,6-D4 ACID CAS:78646-17-0 Formula: HOC6D4COOH D-6322 MW: 142.15 98 atom % D | 2-HYDROXYESTRONE-1,4,16,16-D4 CAS:81586-97-2 D-5806 MW: 290.39 98 atom % D | 2-IODO-2-METHYLPROPANE-D9 (STABILIZED WITH COPPER) CAS:61207-61-2 Formula: (CD3)3CI D-1225 MW: 193.07 98 atom % D | 2-IODOPROPANE-1,1,1,3,3,3-D6 (STABILIZED WITH COPPER) CAS:39091-64-0 Formula: (CD3)2CHI D-369 MW: 176.03 98 atom % D | 2-IODOPROPANE-2-D1 (STABILIZED WITH COPPER) CAS:95927-03-0 Formula: (CH3)2CDI D-4194 MW: 171 98 atom % D | 2-IODOPROPANE-D7 (STABILIZED WITH COPPER) CAS:101927-33-7 Formula: (CD3)2CDI D-5250 MW: 177.04 98 atom % D | 2-ISOBUTYL-3-METHOXY-D3-PYRAZINE CAS:588732-63-2 D-5975 MW: 169.24 99 atom % D | 2-ISOPROPYL-3-METHOXY-D3-PYRAZINE CAS:588732-60-9 D-6905 MW: 155.21 99 atom % D | 2-MERCAPTO-5-METHOXYBENZIMIDAZOLE-4,6,7-D3 CAS:1219804-80-4 D-6263 MW: 183.24 98 atom % D | 2-MERCAPTOBENZIMIDAZOLE-4,5,6,7-D4 CAS:931581-17-8 D-6097 MW: 154.22 98 atom % D | 2-MERCAPTOETHANOL-1,1,2,2-D4 CAS:284474-53-9 Formula: HSCD2CD2OH D-5330 MW: 82.15 98 atom % D | 2-MERCAPTOETHANOL-D6 CAS:203645-37-8 Formula: DSCD2CD2OD D-4213 MW: 84.17 98 atom % D | 2-METHOXY-17β-ESTRADIOL-1,4,16,16,17-D5 CAS:358731-34-7 D-5550 MW: 307.44 98 atom % D | 2-METHOXY-4,5-DIHYDRO-1 H -IMIDAZOLE (UNLABELLED) CAS:28118-54-9 X-6491 MW: 100.12 -- | 2-METHOXY-4,5-DIHYDRO-1 H -IMIDAZOLE-4,4,5,5-D4 CAS:402788-68-5 D-6120 MW: 104.14 99 atom % D | 2-METHOXY-4-METHYLPHENOL-3,5,6-D3,OD CAS:20189-08-6 D-6963 MW: 142.19 98 atom % D | 2-METHOXY-D3-ACETIC ACID CAS:345910-00-1 Formula: CD3OCH2COOH D-2854 MW: 93.1 98 atom % D | 2-METHOXY-D3-ANILINE CAS:1398066-00-6 Formula: CD3OC6H4NH2 D-7362 MW: 126.17 99 atom % D | 2-METHOXY-D3-ANILINE-3,4,5,6-D4 CAS:1219803-70-9 Formula: CD3OC6D4NH2 D-6174 MW: 130.2 99 atom % D | 2-METHOXY-D3-BENZALDEHYDE CAS:56248-49-8 Formula: CD3OC6H4CHO D-5966 MW: 139.17 99 atom % D | 2-METHOXY-D3-ETHANOL CAS:97840-77-2 Formula: CD3OCH2CH2OH D-2855 MW: 79.11 98 atom % D | 2-METHOXY-D3-ETHANOL-1,1,2,2-D4 CAS:108152-85-8 Formula: CD3OCD2CD2OH D-3396 MW: 83.14 98 atom % D | 2-METHOXY-D3-PHENOL CAS:74495-69-5 Formula: CD3OC6H4OH D-5968 MW: 127.16 99 atom % D | 2-METHOXY-D3-PHENOL-3,4,5,6-D4 CAS:1065473-05-3 Formula: CD3OC6D4OH D-6154 MW: 131.18 98 atom % D | 2-METHOXY-D3-PYRAZINE CAS:32046-21-2 D-7324 MW: 113.13 99 atom % D | 2-METHOXYESTRONE-1,4,16,16-D4 CAS:949885-90-9 D-5804 MW: 304.42 99 atom % D | 2-METHOXYETHANOL-1,1,2,2-D4 CAS:138667-25-1 Formula: CH3OCD2CD2OH D-2856 MW: 80.12 98 atom % D | 2-METHOXYNAPHTHALENE-1,3,4,5,6,7,8-D7 CAS:1219795-25-1 D-6271 MW: 165.24 98 atom % D | 2-METHOXYPHENOL-3,4,5,6-D4 CAS:7329-52-4 Formula: CH3OC6D4OH D-6153 MW: 128.16 98 atom % D | 2-METHOXYPHENOL-3,4,5,6-D4,OD CAS:20189-11-1 Formula: CH3OC6D4OD D-6184 MW: 129.17 98 atom % D | 2-METHOXYTOLUENE-α,α,α-D3 CAS:258832-47-2 Formula: CH3OC6H4CD3 D-6985 MW: 125.18 99 atom % D | 2-METHYL-1,4-NAPHTHOQUINONE-D8 CAS:478171-80-1 D-5421 MW: 180.23 98 atom % D | 2-METHYL-1-PHENYLPROPANE-D14 CAS:350818-58-5 Formula: C6D5CD2CD(CD3)2 D-5049 MW: 148.31 98 atom % D | 2-METHYL-2-PROPANE-D9-THIOL CAS:99224-24-5 Formula: (CD3)3CSH D-2644 MW: 99.24 99 atom % D | 2-METHYL-D3-1,4-NAPHTHOQUINONE CAS:5172-16-7 D-5116 MW: 175.2 98 atom % D | 2-METHYL-D3-2-PROPYL-1,3-PROPANEDIOL CAS:1185023-23-7 Formula: CD3C(CH2OH)2CH2CH2CH3 D-7152 MW: 135.22 99 atom % D | 2-METHYL-D3-3-BUTYN-1,1,1-D3-2-OL CAS:57444-27-6 Formula: HC≡CC(CD3)2OH D-6586 MW: 90.15 98 atom % D | 2-METHYL-D3-CITRIC ACID (RACEMATE) CAS:146764-58-1 Formula: HOOCCH2C(OH)(COOH)CH(CD3)COOH D-4162 MW: 209.17 99 atom % D | 2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 (GAS) CAS:13275-39-3 Formula: (CD3)3CH D-281 MW: 67.18 98 atom % D | 2-METHYL-D3-PROPENE (GAS) CAS:110597-10-9 Formula: (CD3)(CH3)C=CH2 D-5332 MW: 59.13 99 atom % D | 2-METHYL-D3-PROPENE-3,3,3-D3 (GAS) CAS:1560-62-9 Formula: (CD3)2C=CH2 D-71 MW: 62.14 98 atom % D | 2-METHYL-D3-PROPIONIC ACID CAS:95926-99-1 Formula: CH3CH(CD3)COOH D-5897 MW: 91.12 99 atom % D | 2-METHYL-D3-PROPIONIC-3,3,3-D3 ACID CAS:29054-08-8 Formula: (CD3)2CHCOOH D-5228 MW: 94.14 98 atom % D | 2-METHYL-D3-PROPIONITRILE-3,3,3-D3 CAS:174736-88-0 Formula: CD3CH(CD3)CN D-7519 MW: 75.14 99 atom % D | 2-METHYL-D3-PROPYL ALCOHOL CAS:95927-04-1 Formula: CH3CH(CD3)CH2OH D-5902 MW: 77.14 99 atom % D | 2-METHYL-D3-PROPYL-2,3,3,3-D4 ALCOHOL CAS:1219804-53-1 Formula: (CD3)2CDCH2OH D-5739 MW: 81.17 98 atom % D | 2-METHYL-D3-PROPYL-3,3,3-D3 ALCOHOL CAS:72182-69-5 Formula: (CD3)2CHCH2OH D-151 MW: 80.16 98 atom % D | 2-METHYL-D3-PYRIDINE CAS:10259-19-5 Formula: C5H4NCD3 D-5795 MW: 96.15 98 atom % D | 2-METHYLADENINE HEMISULFATE (UNLABELLED) CAS:74873-18-0 X-6289 MW: 198.19 -- | 2-METHYLBUTANE-D12 CAS:13351-96-7 Formula: CD3CD2CD(CD3)2 D-630 MW: 84.22 98 atom % D | 2-METHYLCITRIC ACID (RACEMATE) (UNLABELLED) CAS:6061-96-7 Formula: HOOCCH2C(OH)(COOH)CH(CH3)COOH X-4176 MW: 206.15 -- | 2-METHYLFURAN-D6 (STABILIZED WITH BHT) CAS:1398065-93-4 D-7512 MW: 88.14 98 atom % D | 2-METHYLIMIDAZOLE-D6 CAS:1173022-19-9 D-5386 MW: 88.14 98 atom % D | 2-METHYLNAPHTHALENE-D10 CAS:7297-45-2 D-354 MW: 152.26 98 atom % D | 2-METHYLPENTANE-D14 CAS:284487-65-6 Formula: CD3CD2CD2CD(CD3)2 D-5435 MW: 100.26 98 atom % D | 2-METHYLPROPANE-2-D1 (GAS) CAS:13183-68-1 Formula: (CH3)3CD D-25 MW: 59.13 98 atom % D | 2-METHYLPROPANE-D10 (GAS) CAS:19170-96-8 Formula: (CD3)3CD D-190 MW: 68.18 98 atom % D | 2-METHYLPROPENE-1,1-D2 (GAS) CAS:1560-59-4 Formula: (CH3)2C=CD2 D-414 MW: 58.12 98 atom % D | 2-METHYLPROPENE-D8 (GAS) CAS:20762-54-3 Formula: (CD3)2C=CD2 D-217 MW: 64.16 99 atom % D | 2-METHYLPROPIONIC-2-D1 ACID CAS:19136-93-7 Formula: (CH3)2CDCOOH D-6426 MW: 89.11 99 atom % D | 2-METHYLPROPIONIC-D7 ACID CAS:223134-74-5 Formula: (CD3)2CDCOOH D-1969 MW: 95.15 98 atom % D | 2-METHYLPROPYL ALCOHOL-OD CAS:14848-63-6 Formula: (CH3)2CH2OD D-7241 MW: 75.13 98 atom % D | 2-METHYLPROPYL-2-D1 ALCOHOL CAS:20440-13-5 Formula: (CH3)2CDCH2OH D-6427 MW: 75.13 98 atom % D | 2-METHYLPROPYL-D9 ALCOHOL CAS:850209-54-0 Formula: (CD3)2CDCD2OH D-1675 MW: 83.18 98 atom % D | 2-METHYLPROPYL-D9-AMINE CAS:1146967-64-7 Formula: (CD3)2CDCD2NH2 D-5938 MW: 82.19 98 atom % D | 2-METHYLPROPYL-D9-AMINE HCL CAS:1219799-03-7 Formula: (CD3)2CDCD2NH2HCl D-5963 MW: 118.65 98 atom % D | 2-METHYLPYRAZINE-D6 CAS:1219804-84-8 D-7246 MW: 100.15 99 atom % D | 2-METHYLPYRIDINE-D7 CAS:93951-93-0 Formula: CD3C5D4N D-2320 MW: 100.17 98 atom % D | 2-NAPHTHOL-1,3,4,5,6,7,8-D7 CAS:78832-54-9 Formula: C10D7OH D-5051 MW: 151.22 98 atom % D | 2-NAPHTHOL-D8 CAS:78832-61-8 Formula: C10D7OD D-5648 MW: 152.22 98 atom % D | 2-NITROANILINE-3,4,5,6-D4 CAS:204244-80-4 Formula: O2NC6D4NH2 D-5437 MW: 142.15 98 atom % D | 2-NITROANILINE-4,6-D2 CAS:1276197-41-1 D-7284 MW: 140.14 99 atom % D | 2-NITROBENZOIC-D4 ACID CAS:855997-63-6 Formula: O2NC6D4COOH D-7316 MW: 171.15 98 atom % D | 2-NITROBENZONITRILE-D4 CAS:1219795-50-2 Formula: O2NC6D4CN D-5895 MW: 152.15 99 atom % D | 2-NITROBIPHENYL-D9 CAS:38537-53-0 Formula: C6D5C6D4NO2 D-5052 MW: 208.26 98 atom % D | 2-NITROFLUORENE-D9 CAS:128008-87-7 D-5233 MW: 220.27 98 atom % D | 2-NITROPHENOL-3,4,5,6-D4 CAS:93951-78-1 Formula: O2NC6D4OH D-2290 MW: 143.13 98 atom % D | 2-NITROPROPANE-1,1,1,3,3,3-D6 CAS:52809-86-6 Formula: (CD3)2CHNO2 D-5393 MW: 95.13 98 atom % D | 2-NITROTOLUENE-α,α,α-D3 CAS:70786-67-3 Formula: CD3C6H4NO2 D-6507 MW: 140.16 99 atom % D | 2-NITROTOLUENE-3,4,5,6-D4 CAS:115049-76-8 Formula: CH3C6D4NO2 D-7313 MW: 141.16 99 atom % D | 2-NITROTOLUENE-D7 CAS:84344-04-7 Formula: CD3C6D4NO2 D-7689 MW: 144.18 99 atom % D | 2-NONANONE-1,1,1,3,3-D5 CAS:1398065-76-3 Formula: CH3(CH2)5CD2COCD3 D-7439 MW: 147.27 98 atom % D | 2-OXOPIPERAZINE-3,3,5,5,6,6-D6 CAS:1219803-71-0 D-6904 MW: 106.16 98 atom % D | 2-PENTANONE-1,1,1,3,3-D5 CAS:24313-49-3 Formula: CH3CH2CD2COCD3 D-219 MW: 91.16 98 atom % D | 2-PHENOXYETHYL-1,1,2,2-D4 ALCOHOL CAS:1219804-65-5 Formula: C6H5OCD2CD2OH D-5605 MW: 142.19 98 atom % D | 2-PHENOXYETHYL-1,1-D2 ALCOHOL CAS:21273-38-1 Formula: C6H5OCH2CD2OH D-5603 MW: 140.18 98 atom % D | 2-PHENYL-D5-ETHAN-1,1,2,2-D4-OL CAS:42950-74-3 Formula: C6D5CD2CD2OH D-5480 MW: 131.22 98 atom % D | 2-PHENYL-D5-ETHANOL CAS:35845-63-7 Formula: C6D5CH2CH2OH D-5479 MW: 127.2 98 atom % D | 2-PHENYL-D5-ETHYL ISOTHIOCYANATE CAS:912627-98-6 Formula: C6D5CH2CH2NCS D-7251 MW: 168.27 98 atom % D | 2-PHENYL-D5-ETHYLAMINE CAS:912627-99-7 Formula: C6D5CH2CH2NH2 D-5798 MW: 126.21 99 atom % D | 2-PHENYL-D5-PROPANE CAS:97095-85-7 Formula: C6D5CH(CH3)2 D-6570 MW: 125.22 98 atom % D | 2-PHENYLETHAN-1,1,2,2-D4-OL CAS:107473-33-6 Formula: C6H5CD2CD2OH D-5478 MW: 126.19 98 atom % D | 2-PHENYLETHYL ACETATE-D3 CAS:1219805-43-2 Formula: C6H5CH2CH2OCOCD3 D-7233 MW: 167.22 99 atom % D | 2-PHENYLETHYL-1,1,2,2-D4-AMINE CAS:87620-08-4 Formula: C6H5CD2CD2NH2 D-1518 MW: 125.21 98 atom % D | 2-PHENYLETHYL-D9-AMINE CAS:342611-05-6 Formula: C6D5CD2CD2NH2 D-1919 MW: 130.24 98 atom % D | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 CAS:20201-28-9 Formula: C6H5CD(CD3)2 D-681 MW: 127.24 98 atom % D | 2-PHENYLPROPANE-1,1,1,3,3,3-D6 CAS:20201-29-0 Formula: C6H5CH(CD3)2 D-680 MW: 126.23 98 atom % D | 2-PHENYLPROPANE-2-D1 CAS:4019-54-9 Formula: C6H5CD(CH3)2 D-679 MW: 121.2 97 atom % D | 2-PHENYLPROPANE-D12 CAS:97732-82-6 Formula: C6D5CD(CD3)2 D-3574 MW: 132.27 98 atom % D | 2-PICOLINIC-D4 ACID CAS:284487-61-2 D-5289 MW: 127.14 98 atom % D | 2-PROPANE-D7-THIOL CAS:1219803-56-1 Formula: (CD3)2CDSH D-6042 MW: 83.2 98 atom % D | 2-PROPYLPENTANOIC-D15 ACID CAS:362049-65-8 Formula: (CD3CD2CD2)2CDCOOH D-5491 MW: 159.3 98 atom % D | 2-PYRIDYLACETIC-α,α-D2 ACID-OD DCL CAS:1219802-51-3 D-7089 MW: 117.62 98 atom % D | 2-PYRROLIDINONE-3,3,4,4,5,5-D6 CAS:70607-84-0 D-2200 MW: 91.14 98 atom % D | 24( RS )-HYDROXYCHOLESTEROL-25,26,26,26,27,27,27-D7 CAS:144154-78-9 D-6878 MW: 409.7 99 atom % D | 25-HYDROXYCHOLESTEROL-26,26,26,27,27,27-D6 CAS:88247-69-2 D-6774 MW: 408.7 99 atom % D | 3′,4′-DIBENZYLOXYACETO-D3-PHENONE CAS:344299-53-2 Formula: (C6H5CH2O)2C6H3COCD3 D-2277 MW: 335.42 97 atom % D | 3′,4′-DICHLOROPROPIONANILIDE-2,2,3,3,3-D5 CAS:1398065-82-1 Formula: Cl2C6H3NHCOCD2CD3 D-7430 MW: 223.11 98 atom % D | 3′,4′-DIMETHOXYACETOPHENONE-D3 (METHYL-D3) CAS:350818-54-1 Formula: (CH3O)2C6H3COCD3 D-5037 MW: 183.22 98 atom % D | 3′-METHOXYACETOPHENONE-2′,4′,5′,6′-D4 CAS:1219798-58-9 Formula: CH3OC6D4COCH3 D-7252 MW: 154.2 99 atom % D | 3,3′,4,4′-TETRACHLOROBIPHENYL-D6 CAS:93952-23-9 D-3013 MW: 298.03 98 atom % D | 3,3′-DICHLOROBENZIDINE-D6 (RINGS-D6) CAS:93951-91-8 Formula: H2N(Cl)C6D3C6D3(Cl)NH2 D-2703 MW: 259.17 98 atom % D | 3,4′,5-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4 D-7045 MW: 261.57 98 atom % D | 3,4,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4 D-7044 MW: 261.57 98 atom % D | 3,4,5-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:93952-22-8 Formula: Cl3C6H2C6D5 D-3012 MW: 262.58 98 atom % D | 3,4,5-TRIHYDROXYBENZOIC-2,6-D2 ACID CAS:294660-92-7 Formula: (HO)3C6D2COOH D-2728 MW: 172.13 98 atom % D | 3,4,5-TRIMETHOXY-D9-BENZOIC ACID CAS:84759-05-7 Formula: (CD3O)3C6H2COOH D-7661 MW: 221.26 99 atom % D | 3,4,5-TRIMETHOXY-D9-BENZYL ALCOHOL CAS:1219805-74-9 Formula: (CD3O)3C6H2CH2OH D-6173 MW: 207.27 99 atom % D | 3,4,5-TRIMETHOXYBENZALDEHYDE-D3(4-METHOXY-D3) CAS:1219805-17-0 D-6560 MW: 199.22 99 atom % D | 3,4-(METHYLENEDIOXY) PHENOL-2,5,6-D3;OD CAS:1219798-37-4 D-7091 MW: 142.15 98 atom % D | 3,4-DICHLOROANILINE-2,6-D2 CAS:1219803-22-1 Formula: Cl2C6HD2NH2 D-5426 MW: 164.03 99 atom % D | 3,4-DICHLOROBENZOIC-D3 ACID CAS:350818-53-0 Formula: Cl2C6D3COOH D-5031 MW: 194.03 98 atom % D | 3,4-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1276197-19-3 D-7034 MW: 228.13 99 atom % D | 3,4-DICHLOROTOLUENE-2,5,6-D3 CAS:1219795-29-5 Formula: Cl2C6D3CH3 D-6358 MW: 164.05 98 atom % D | 3,4-DIFLUOROBENZOIC-D3 ACID CAS:1219798-70-5 Formula: F2C6D3COOH D-6485 MW: 161.12 98 atom % D | 3,4-DIMETHOXYPHENYLACETONITRILE-α,α-D2 CAS:1219803-34-5 Formula: (CH3O)2C6H3CD2CN D-1644 MW: 179.21 98 atom % D | 3,4-DIMETHYLPHENOL-2,5,6-D3,OD CAS:1219803-55-0 Formula: (CH3)2C6D3OD D-5368 MW: 126.19 98 atom % D | 3,5-DIBROMO-4-HYDROXYBENZONITRILE-2,6-D2 CAS:1219798-95-4 Formula: HO(Br2)C6D2CN D-6531 MW: 278.93 98 atom % D | 3,5-DIBROMOPYRIDINE-D3 CAS:1219799-05-9 Formula: C5D3Br2N D-5737 MW: 239.91 98 atom % D | 3,5-DICHLOROANILINE-2,4,6-D3 CAS:1219795-03-5 Formula: Cl2C6D3NH2 D-7015 MW: 165.04 98 atom % D | 3,5-DICHLOROBENZOIC-D3 ACID CAS:1219803-99-2 Formula: Cl2C6D3COOH D-6059 MW: 194.03 98 atom % D | 3,5-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5 CAS:1276197-28-4 D-7035 MW: 228.13 99 atom % D | 3,5-DICHLOROPHENOL-2,4,6-D3 CAS:124286-06-2 Formula: Cl2C6D3OH D-7283 MW: 166.02 99 atom % D | 3,5-DIFLUOROBENZOIC-D3 ACID CAS:934397-71-4 Formula: F2C6D3COOH D-6486 MW: 161.12 98 atom % D | 3,5-DIMETHOXY-D6-4-HYDROXYBENZOIC ACID CAS:84759-06-8 D-7484 MW: 204-21 99 atom % D | 3,5-DIMETHYL-D6-CYCLOHEXANONE-3,4,4,5-D4(MIXTURE,OF,ISOMERS) CAS:1219804-55-3 D-7194 MW: 136.26 98 atom % D | 3,5-DIMETHYL-D6-PHENOL CAS:133604-75-8 Formula: (CD3)2C6H3OH D-5672 MW: 128.2 98 atom % D | 3,5-DIMETHYLBENZOIC-D9 ACID CAS:1335014-65-7 Formula: (CD3)2C6D3COOH D-7436 MW: 159.23 98 atom % D | 3,5-DIMETHYLPHENOL-2,4,6-D3,OD CAS:1219803-59-4 Formula: (CH3)2C6D3OD D-5369 MW: 126.19 98 atom % D | 3,5-DIMETHYLPHENOL-D10 CAS:1192812-51-3 Formula: (CD3)2C6D3OD D-6465 MW: 132.23 98 atom % D | 3,6-DICHLORO-2-METHOXY-D3-BENZOIC ACID CAS:349553-95-3 Formula: Cl2C6H2(OCD3)COOH D-4085 MW: 224.06 99 atom % D | 3- ISO -PROPYLPHENOL-D12 CAS:1219805-35-2 Formula: (CD3)2CDC6D4OD D-5864 MW: 148.27 98 atom % D | 3-(3,4-DIMETHOXY-D6-PHENYL) PROPIONIC-2,2,3,3-D4 ACID CAS:1398065-72-9 D-7441 MW: 220-29 99 atom % D | 3-(3-ETHOXY-4-METHOXYPHENYL) PROPIONIC-2,2,3,3-D4 ACID CAS:1398065-51-4 D-7420 MW: 228.28 98 atom % D | 3-(CYCLOHEXYLAMINO) -1-PROPANESULFONIC-D17 ACID CAS:1219804-15-5 Formula: C6D11NHCD2CD2CD2SO3H D-6875 MW: 238.42 98 atom % D | 3-(DIMETHYL-D6-AMINO)-1-PROPYLAMINE CAS:1219802-71-7 Formula: (CD3)2N(CH2)3NH2 D-6815 MW: 108.22 99 atom % D | 3-(METHYL-D3-NITROSOAMINO)PROPIONITRILE CAS:1276197-15-9 Formula: CD3N(NO2)CH2CH2CN D-7314 MW: 132.14 99 atom % D | 3-(METHYLTHIO)PROPIONALDEHYDE-2,2-D2 Formula: CH3SCH2CD2CHO D-7685 MW: 106.18 98 atom % D | 3-(N-MORPHOLINO)PROPANESULFONIC ACID-D15 CAS:1219799-30-0 D-6627 MW: 224.35 98 atom % D | 3-(TRIFLUOROMETHYL)ANILINE-2,4,5,6-D4 CAS:1219802-14-8 Formula: CF3C6D4NH2 D-6441 MW: 165.15 98 atom % D | 3-(TRIFLUOROMETHYL)PHENOL-2,4,6-D3,OD CAS:1219798-47-6 Formula: CF3C6HD3OD D-6664 MW: 166.14 98 atom % D | 3-AMINOBENZOIC-2,4,5,6-D4 ACID CAS:78399-79-8 Formula: H2NC6D4COOH D-7653 MW: 141.16 99 atom % D | 3-AMINOPENTANE-2,2,3,4,4-D5 CAS:1219802-43-3 Formula: (CH3CD2)2CDNH2 D-6017 MW: 92.19 98 atom % D | 3-AMINOPROPANE-D6-SULFONIC ACID CAS:1131576-06-1 Formula: H2NCD2CD2CD2SO3H D-5159 MW: 145.21 98 atom % D | 3-AMINOPROPIONAMIDE-2,2,3,3-D4 HCL CAS:1276197-35-3 Formula: H2NCD2CD2CONH2HCl D-7282 MW: 128.59 98 atom % D | 3-AMINOPYRIDINE-D6 CAS:1219805-61-4 Formula: D2NC5D4N D-5702 MW: 100.15 98 atom % D | 3-BENZYLOXYBENZALDEHYDE-α-D1 CAS:1219805-34-1 Formula: C6H5CH2OC6H4CDO D-1663 MW: 213.25 98 atom % D | 3-BROMO-1-PROPANOL-1,1,2,2,3,3-D6 CAS:284474-43-7 Formula: BrCD2CD2CD2OH D-6297 MW: 145.03 98 atom % D | 3-BROMOPROPIONIC-2,2,3,3-D4 ACID CAS:1219799-25-3 Formula: BrCD2CD2COOH D-5599 MW: 157 98 atom % D | 3-BROMOPYRIDINE-D4 CAS:66148-14-9 D-6066 MW: 162.02 98 atom % D | 3-BROMOTOLUENE-2,4,6-D3 CAS:1219805-60-3 Formula: BrC6HD3CH3 D-6298 MW: 174.05 98 atom % D | 3-BROMOTOLUENE-D7 CAS:1185318-69-7 Formula: BrC6D4CD3 D-6287 MW: 178.08 98 atom % D | 3-CHLORO-N,N-DIMETHYL-D6-PROPYLAMINE HCL CAS:1219799-04-8 Formula: Cl(CH2)3N(CD3)2HCl D-6540 MW: 164.11 98 atom % D | 3-CHLOROANILINE-2,4,6-D3 CAS:347840-11-3 Formula: ClC6HD3NH2 D-3701 MW: 130.59 98 atom % D | 3-CHLOROBENZOIC-D4 ACID Formula: ClC6D4COOH D-7594 MW: 160.59 98 atom % D | 3-CHLOROPROPIONIC-2,2,3,3-D4 ACID CAS:1219802-17-1 Formula: ClCD2CD2COOH D-5602 MW: 112.55 98 atom % D | 3-CHLOROPYRIDINE-D4 CAS:1001003-95-7 Formula: ClC5D4N D-6899 MW: 117.57 98 atom % D | 3-CHLOROTOLUENE-2,4,6-D3 CAS:1219803-79-8 Formula: ClC6HD3CH3 D-6409 MW: 129.6 98 atom % D | 3-CHLOROTOLUENE-D7 CAS:1219804-88-2 Formula: ClC6D4CD3 D-6410 MW: 133.63 98 atom % D | 3-CYANOBENZYL-D6 BROMIDE CAS:1219802-21-7 Formula: BrCD2C6D4CN D-5568 MW: 202.08 98 atom % D | 3-ETHYL-D5-TOLUENE CAS:1398065-64-9 Formula: CD3CD2C6H4CH3 D-7458 MW: 125.22 99 atom % D | 3-FLUOROANILINE-2,4,6-D3,ND2 CAS:1398065-56-9 Formula: FC6HD3ND2 D-7497 MW: 116.15 99 atom % D | 3-FLUOROBENZALDEHYDE 2,4-DINITROPHENYLHYDRAZONE-3,5,6-D3 Formula: FC6H4CH=NNHC6D3(NO2)2 D-7605 MW: 307.26 99 atom % D | 3-FLUOROTOLUENE-α,α,α-D3 CAS:4202-92-0 Formula: CD3C6H4F D-5879 MW: 113.15 99 atom % D | 3-FLUOROTOLUENE-α-D1 Formula: CH2DC6H4F D-7626 MW: 111.14 98 atom % D | 3-HYDROXY-1,5-PENTANEDIOIC-2,2,3,4,4-D5 ACID CAS:1219805-72-7 Formula: HOOCCD2CD(OH)CD2COOH D-6391 MW: 153.15 98 atom % D | 3-HYDROXY-3-METHYL-D3-PENTANEDIOIC ACID CAS:59060-36-5 Formula: HOOCCH2C(OH)(CD3)CH2COOH D-3772 MW: 165.16 99 atom % D | 3-ISOBUTYL-1-METHYL-D3-2-PYRAZINONE CAS:1219805-28-3 D-6054 MW: 169.24 99 atom % D | 3-METHOXY-D3-BENZALDEHYDE CAS:1219795-07-9 Formula: CD3OC6H4CHO D-6273 MW: 139.17 99 atom % D | 3-METHOXYTOLUENE-α,α,α-D3 CAS:20369-34-0 Formula: CH3OC6H4CD3 D-6686 MW: 125.18 99 atom % D | 3-METHYL-1-BUTYL-1,1,2,2-D4 ALCOHOL CAS:1219795-21-7 Formula: (CH3)2CHCD2CD2OH D-6235 MW: 92.17 98 atom % D | 3-METHYL-1-BUTYL-1,1-D2 ALCOHOL CAS:70907-83-4 Formula: (CH3)2CHCH2CD2OH D-6233 MW: 90.16 98 atom % D | 3-METHYL-1-BUTYL-D11 ALCOHOL CAS:170678-50-9 Formula: (CD3)2CDCD2CD2OH D-6234 MW: 99.22 98 atom % D | 3-METHYL-D3-4-NITROPHENOL-2,5,6-D3 CAS:1219803-89-0 D-6242 MW: 159.17 98 atom % D | 3-METHYL-D3-BUTYRIC-3,4,4,4-D4 ACID CAS:1219805-32-9 Formula: (CD3)2CDCH2COOH D-6966 MW: 109.18 98 atom % D | 3-METHYL-D3-INDOLE CAS:111399-60-1 D-7372 MW: 134.2 99 atom % D | 3-METHYL-D3-PYRIDINE CAS:10259-17-3 Formula: C5H4NCD3 D-5796 MW: 96.15 98 atom % D | 3-METHYL-D3-THIOPHENE CAS:108343-10-8 D-6799 MW: 101.18 99 atom % D | 3-METHYLBUTYL ACETATE-D3 CAS:1219804-75-7 Formula: (CH3)2CHCH2CH2OCOCD3 D-7231 MW: 133.2 99 atom % D | 3-METHYLBUTYRALDEHYDE-2,2-D2 CAS:352431-47-1 Formula: (CH3)2CHCD2CHO D-5269 MW: 88.15 98 atom % D | 3-METHYLBUTYRIC-2,2-D2 ACID CAS:95927-02-9 Formula: (CH3)2CHCD2COOH D-6236 MW: 104.15 98 atom % D | 3-METHYLBUTYRIC-D9 ACID CAS:344298-81-3 Formula: (CD3)2CDCD2COOH D-2454 MW: 111.19 98 atom % D | 3-METHYLBUTYRYL-D9 CHLORIDE CAS:1219803-46-9 Formula: (CD3)2CDCD2COCl D-6608 MW: 129.63 98 atom % D | 3-METHYLINDOLE-D8,NH CAS:697807-03-7 D-7371 MW: 139.23 99 atom % D | 3-METHYLPENTANE-D14 CAS:20586-83-8 Formula: CD3CD2CD(CD3)CD2CD3 D-189 MW: 100.26 98 atom % D | 3-METHYLPENTANEDIOIC-2,2,4,4-D4 ACID CAS:1219798-68-1 Formula: CH3CH(CD2COOH)2 D-6723 MW: 150.17 98 atom % D | 3-METHYLPYRIDINE-D7 CAS:202529-13-3 Formula: CD3C5D4N D-5256 MW: 100.17 98 atom % D | 3-NITROANILINE-2,4,5,6-D4 CAS:115044-52-5 Formula: O2NC6D4NH2 D-5438 MW: 142.15 98 atom % D | 3-NITROBENZOIC-D4 ACID CAS:78399-78-7 Formula: O2NC6D4COOH D-6440 MW: 171.15 98 atom % D | 3-NITROBENZYL ALCOHOL-OD CAS:117897-59-3 Formula: O2NC6H4CH2OD D-3746 MW: 154.14 98 atom % D | 3-NITROBENZYL-D6 ALCOHOL CAS:1219795-18-2 Formula: O2NC6D4CD2OH D-6328 MW: 159.17 99 atom % D | 3-NITROFLUORANTHENE-D9 D-4358 MW: 256.31 98 atom % D | 3-OLEOYLESTRONE-2,4,16,16-D4 CAS:443791-75-1 D-6348 MW: 538.84 98 atom % D | 3-PENTANONE-1,1,1,5,5,5-D6 CAS:53389-25-6 Formula: CD3CH2COCH2CD3 D-6555 MW: 92.17 98 atom % D | 3-PENTANONE-2,2,4,4-D4 CAS:6400-97-1 Formula: CH3CD2COCD2CH3 D-6018 MW: 90.16 98 atom % D | 3-PENTANONE-D10 CAS:54927-77-4 Formula: CD3CD2COCD2CD3 D-74 MW: 96.19 98 atom % D | 3-PENTYL-2,2,3,4,4-D5 ALCOHOL CAS:144032-75-7 Formula: CH3CD2CD(OH)CD2CH3 D-7087 MW: 93.18 98 atom % D | 3-PYRIDYLACETIC-α,α-D2 ACID-OD DCL CAS:1219802-37-5 D-7106 MW: 177.62 98 atom % D | 4′-AMINOACETANILIDE-2′,3′,5′,6′-D4 CAS:1219802-76-2 Formula: H2NC6D4NHCOCH3 D-6617 MW: 154.2 98 atom % D | 4′-BROMOACETOPHENONE-D7 CAS:1219805-88-5 Formula: BrC6D4COCD3 D-5629 MW: 206.09 98 atom % D | 4′-CHLOROACETOPHENONE-2′,3′,5′,6′-D4 CAS:284474-50-6 Formula: ClC6D4COCH3 D-5379 MW: 158.62 98 atom % D | 4′-CHLOROACETOPHENONE-D7 CAS:1174565-85-5 Formula: ClC6D4COCD3 D-5380 MW: 161.64 98 atom % D | 4′-HYDROXYDICLOFENAC-D4 (PHENYL-D4-ACETIC) CAS:254762-27-1 D-7426 MW: 316.18 86 atom % D | 4′-METHYLACETOPHENONE-D10 CAS:358730-83-3 D-5495 MW: 144.24 98 atom % D | 4′-NITROACETANILIDE-2′,3′,5′,6′-D4 CAS:68239-25-8 Formula: O2NC6D4NHCOCH3 D-6621 MW: 184.19 99 atom % D | 4,4′-DIBROMOBIPHENYL-D8 CAS:80523-79-1 Formula: BrC6D4C6D4Br D-5556 MW: 320.05 99 atom % D | 4,4′-DICHLOROBENZOPHENONE-D8 CAS:1219806-01-5 Formula: (ClC6D4)2CO D-5642 MW: 259.16 98 atom % D | 4,4′-DICHLOROBIPHENYL-D8 CAS:1219805-77-2 Formula: ClC6D4C6D4Cl D-6918 MW: 231.15 98 atom % D | 4,4′-DIHYDROXYBIPHENYL-D8 (RINGS-D8) CAS:612480-60-1 Formula: HOC6D4C6D4OH D-5363 MW: 194.26 98 atom % D | 4,4′-DIMETHOXYBENZOPHENONE-D8 (RINGS-D8) CAS:350818-55-2 Formula: (CH3OC6D4)2CO D-5038 MW: 250.32 98 atom % D | 4,4′-DINITROCARBANILIDE-D8 (RINGS-D8) CAS:1156508-87-0 D-7384 MW: 310.29 98 atom % D | 4,4′-DIPYRIDYL-D8 CAS:132125-39-4 D-5073 MW: 164.24 98 atom % D | 4,4′-METHYLENE-D2-DIANILINE CAS:215590-72-0 Formula: H2NC6H4CD2C6H4NH2 D-6239 MW: 200.28 98 atom % D | 4,4′-METHYLENEDIANILINE-2,2′,6,6′,N,N,N′,N′-D8 CAS:1219795-26-2 Formula: D2NC6H2D2CH2C6H2D2 D-6240 MW: 206.32 98 atom % D | 4,6-DINITRO-2-METHYL-D3-PHENOL CAS:1219804-69-9 Formula: (NO2)2(CD3)C6H2OH D-6987 MW: 201.15 98 atom % D | 4,6-DINITRO-2-METHYLPHENOL-3,5-D2 CAS:93951-76-9 Formula: (NO2)2(CH3)C6D2OH D-2357 MW: 200.15 98 atom % D | 4,6-PREGNADIEN-6-METHYL-16-METHYLENE-17-OL-3,20-DIONE-2,2-D2 ACETATE D-7190 MW: 398.54 98 atom % D | 4,6-PREGNADIEN-6-METHYL-17α-OL-3,20-DIONE ACETATE-D3 D-7188 MW: 387.53 99 atom % D | 4,6-PREGNADIEN-6-METHYL-17α-OL-3,20-DIONE-2,2,21,21,21-D5 D-7253 MW: 347.51 99 atom % D | 4- ISO -PROPYLANILINE-2,3,5,6-D4 CAS:1219804-95-1 Formula: (CH3)2CHC6D4NH2 D-5593 MW: 139.23 98 atom % D | 4- ISO -PROPYLPHENOL-D12 CAS:1219805-27-2 Formula: (CD3)2CDC6D4OD D-5865 MW: 148.27 98 atom % D | 4- N -BUTYL-D9-ANILINE CAS:1219794-78-1 Formula: CD3(CD2)3C6H4NH2 D-6210 MW: 158.29 98 atom % D | 4- N -BUTYLANILINE-2,3,5,6-D4,ND2 CAS:1219794-75-8 Formula: CH3(CH2)3C6D4ND2 D-6209 MW: 155.27 98 atom % D | 4- N -BUTYLANILINE-D15 CAS:1219794-89-4 Formula: CD3(CD2)3C6D4ND2 D-6211 MW: 164.33 98 atom % D | 4- N -BUTYLANISOLE-2,3,5,6-D4 CAS:1219804-78-0 Formula: CH3CH2CH2CH2C6D4OCH3 D-6109 MW: 168.27 98 atom % D | 4- N -BUTYLPHENOL-2,3,5,6-D4,OD CAS:1219795-04-6 Formula: CH3CH2CH2CH2C6D4OD D-5930 MW: 155.25 98 atom % D | 4- N -NONYLPHENOL-2,3,5,6-D4,OD CAS:358730-95-7 Formula: CH3(CH2)8C6D4OD D-5510 MW: 225.38 98 atom % D | 4- N -OCTYL-D17-ANISOLE CAS:1219794-56-5 Formula: CD3(CD2)7C6H4OCH3 D-6108 MW: 237.46 98 atom % D | 4- N -OCTYL-D17-PHENOL CAS:1219794-55-4 Formula: CD3(CD2)7C6H4OH D-6102 MW: 223.43 98 atom % D | 4- N -PENTYL-D11-PHENOL CAS:1219805-30-7 Formula: CD3(CD2)4C6H4OH D-5858 MW: 175.31 98 atom % D | 4- N -PENTYLOXYBENZALDEHYDE-α-D1 CAS:342611-09-0 Formula: CH3(CH2)4OC6H4CDO D-1961 MW: 193.26 98 atom % D | 4- N -PENTYLPHENOL-2,3,5,6-D4,OD CAS:126839-95-0 Formula: CH3(CH2)4C6D4OD D-5857 MW: 169.28 98 atom % D | 4- N -PENTYLPHENOL-D16 CAS:1219805-40-9 Formula: CD3(CD2)4C6D4OD D-5859 MW: 180.34 98 atom % D | 4- N -PROPYLPHENOL-D12 CAS:352431-21-1 Formula: CD3(CD2)2C6D4OD D-5342 MW: 148.27 98 atom % D | 4- TERT -BUTYL-D9-PHENOL-2,3,5,6-D4 CAS:225386-58-3 Formula: (CD3)3CC6D4OH D-6069 MW: 163.3 99 atom % D | 4- TERT -BUTYLANILINE-D15 CAS:1219794-71-4 Formula: (CD3)3CC6D4ND2 D-5925 MW: 164.33 98 atom % D | 4- TERT -BUTYLBENZOIC-D13 ACID Formula: (CD3)3CC6D4COOH D-7697 MW: 191.31 99 atom % D | 4-( N -BUTYLAMINO-2,2,3,3,4,4,4-D7)BENZOIC ACID CAS:1219803-44-7 Formula: CD3CD2CD2CH2NHC6H4COOH D-7171 MW: 200.29 95 atom % D | 4-(2,4-DICHLOROPHENOXY-D3) BUTYRIC ACID CAS:1219802-46-6 D-6585 MW: 252.11 98 atom % D | 4-(2-HYDROXYETHYL-D4) MORPHOLINE CAS:1185052-90-7 D-6610 MW: 135.2 99 atom % D | 4-(4-CHLORO-2-METHYLPHENOXY-D3) BUTYRIC ACID CAS:1219803-42-5 D-7118 MW: 231.69 98 atom % D | 4-(ETHOXYMETHYL) ANISOLE-2,3,5,6-D4 CAS:1219799-15-1 Formula: CH3OC6D4CH2OCH2CH3 D-6519 MW: 170.24 98 atom % D | 4-(METHYL-D3-AMINO)BUTYRIC-2,2,3,3,4,4-D6 ACID HCL CAS:1219805-36-3 Formula: CD3NH(CD2)3COOHHCl D-6784 MW: 162.66 99 atom % D | 4-(N-METHYL-N-NITROSOAMINO)-1-(3-PYRIDYL-D4)-1-BUTANONE CAS:764661-24-7 D-4152 MW: 211.26 98 atom % D | 4-(TRIFLUOROMETHYL)ANILINE-2,3,5,6-D4 CAS:1219795-48-8 Formula: CF3C6D4NH2 D-5606 MW: 165.15 98 atom % D | 4-ACETAMIDOBENZENE-D4-SULFONYL CHLORIDE CAS:77435-44-0 Formula: CH3CONHC6D4SO2Cl D-7394 MW: 237.69 98 atom % D | 4-AMINO-2,2,6,6-TETRAMETHYLPIPERIDINE-D17-1-OXYL CAS:70588-04-4 D-2781 MW: 188.37 98 atom % D | 4-AMINO-2,2,6,6-TETRAMETHYLPIPERIDINE-D17;1-15N-1-OXYL CAS:97461-87-5 M-2782 MW: 189.37 99 atom % 15N; 98 atom % D | 4-AMINO-N,N-DIMETHYL-D6-ANILINE CAS:1398066-19-7 Formula: (CD3)2NC6H4NH2 D-7479 MW: 142.23 98 atom % D | 4-AMINOBENZOIC-2,3,5,6-D4 ACID CAS:350820-01-8 Formula: H2NC6D4COOH D-4209 MW: 141.16 98 atom % D | 4-AMINOBIPHENYL-D9 CAS:344298-96-0 Formula: C6D5C6D4NH2 D-2638 MW: 178.28 98 atom % D | 4-AMINOBUTYRIC-2,2,3,3,4,4-D6 ACID CAS:70607-85-1 Formula: H2NCD2CD2CD2COOH D-1828 MW: 109.16 99 atom % D | 4-AMINOBUTYRIC-2,2-D2 ACID CAS:67910-98-9 Formula: H2NCH2CH2CD2COOH D-1731 MW: 105.13 98 atom % D | 4-AMINOBUTYRIC-4,4-D2 ACID CAS:107022-06-0 Formula: H2NCD2CH2CH2COOH D-6846 MW: 105.13 98 atom % D | 4-AMINOPHENOL-D7 CAS:285132-88-9 Formula: D2NC6D4OD D-5022 MW: 116.17 97 atom % D | 4-AMINOPIPERIDINE-3,3,4,5,5-D5 CAS:1219803-60-7 D-6062 MW: 105.19 98 atom % D | 4-AMINOPYRIDINE-D6 CAS:45498-20-2 Formula: D2NC5D4N D-5114 MW: 100.15 98 atom % D | 4-ANDROSTEN-11β-OL-3,17-DIONE-2,2,4,6,6,16,16-D7 D-6128 MW: 309.46 98 atom % D | 4-ANDROSTEN-17α-OL-3-ONE-2,2,4,6,6-D5 CAS:165195-35-7 D-6535 MW: 293.46 98 atom % D | 4-BROMO-α,α,α-TRIFLUOROTOLUENE-D4 CAS:1219799-09-3 Formula: BrC6D4CF3 D-7137 MW: 229.03 98 atom % D | 4-BROMO-1-BUTANOL-1,1,2,2,3,3,4,4-D8 CAS:136091-68-4 Formula: BrCD2CD2CD2CD2OH D-5704 MW: 161.07 99 atom % D | 4-BROMOANILINE-2,3,5,6-D4 CAS:61357-76-4 Formula: BrC6D4NH2 D-5318 MW: 176.05 98 atom % D | 4-BROMOANISOLE-2,3,5,6-D4 CAS:152404-45-0 Formula: BrC6D4OCH3 D-5703 MW: 191.06 98 atom % D | 4-BROMOANISOLE-D3 (METHYL-D3) CAS:100835-59-4 Formula: BrC6H4OCD3 D-7197 MW: 190.05 99 atom % D | 4-BROMOBENZOIC-D4 ACID CAS:787624-24-2 Formula: BrC6D4COOH D-6293 MW: 205.04 99 atom % D | 4-BROMOBENZONITRILE-D4 CAS:771534-56-6 Formula: BrC6D4CN D-6400 MW: 186.04 99 atom % D | 4-BROMOBENZYL-2,3,5,6-D4 BROMIDE Formula: BrC6D4CH2Br D-7540 MW: 253.96 99 atom % D |
|
|
|