Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C18H14O3
Formula: C13H13NaO4S
Formula: C16H14
Formula: C8H14
Formula: C8H10N4
Formula: C12H12
Formula: C18H14
Formula: C7H9NO
Formula: #
Formula: C9H12
Formula: #
Formula: C14H6N2O6
Formula: C20H10N2O4
Formula: C12H7N3O4
Formula: C14H8N2O4
Formula: C12H6N4O4
Formula: C16H8N2O4
Formula: C10H16O4
Formula: C14H24O4
Formula: C14H8O2
Formula: C9H16O3
Formula: C6H10O2
Formula: C9H13NO2
Formula: C7H12O2
Formula: C7H8O4
Formula: C11H18O4
Formula: C11H20O4
Formula: C18H14O2
Formula: C18H14O2
Formula: C21H20O2
Formula: C18H18O2
Formula: #
Formula: #
Formula: C18H18O2
Formula: C18H12P2
Formula: C20H18OS2
Formula: C7H12
Formula: C11H14
Formula: C8H12O2
Formula: C9H13N
Formula: C7H8
Formula: #
Formula: #
Formula: (C8H12N2O2)m.(C6H14O3)n
Formula: #
Formula: C7H14N2O
Formula: C6H16N2
Formula: C8H12N2S2
Formula: C6H16O6P2
Formula: C6H18Cl2N2
Formula: #
Formula: #
Formula: #
Formula: C11H28ClN3O
Formula: C14H32Cl2N2O3
Formula: #
Formula: C21H42N6O3
Formula: C29H44N2O6
Formula: C6H16N2
Formula: C12H22O4
Formula: C14H22O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H34N2O7
Formula: #
Formula: C39H62N2O13
Formula: #
Formula: C6H14O2
Formula: C6H14S2
Formula: C8H18O4S4
Formula: C8H14N2Na2S4
Formula: C10H18Cl2N2O2
Formula: C18H30O8
Formula: C42H42Br2P2
Formula: C36H36N2O4
Formula: #
Formula: C10H15NO
Formula: C11H17NO
Formula: #
Formula: C10H7FO2
Formula: C10H8O6S2
Formula: C10H6Na2O6S2
Formula: C10H6Na2O6S2
Formula: C8H6N2O
Formula: C8H7N3
Formula: #
Formula: C8H10N2O
Formula: C8H6N2O
Formula: C8H8N2O
Formula: C8H6N2
Formula: C8H8N2
Formula: C10H11N3
Formula: C9H5N2O2
Formula: C14H17N3O2S
Formula: #
Formula: #
Formula: C12H8N2O2
Formula: C12H8N2O4
Formula: #
Formula: #
Formula: #
Formula: C13H14O6S
Formula: #
Formula: C8H11NO2
Formula: #
Formula: C20H40
Formula: C20H26
Formula: C20H40S4
Formula: #
Formula: C11H24N2OS3
Formula: C12H20O2
Formula: C11H18
Formula: C11H21NO
Formula: C12H20O2
Formula: C13H19NO
Formula: C10H17NO
Formula: C13H19NO
Formula: C20H28NiS4
Formula: C15H23NO3
Formula: C13H22O3
Formula: #
Formula: C10H20ClN
Formula: C10H16O
Formula: C10H18O
Formula: #
Formula: C10H18S
Formula: C10H14O2
Formula: C11H10ClNO
Formula: C12H10ClNO3
Formula: C13H11NO5
Formula: C12H13NO3
Formula: C12H13NO2
Formula: C5H4N4OS
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C12H5Cl3O2
Formula: C5H4N2O3S2
Formula: C32H57N9O5S
Formula: C21H24O6
Formula: C19H20O3
Formula: C19H22O3
Formula: C33H30N2
Formula: C4H16B10O2
Formula: C15H18N2O4
Formula: C20H40N4O4
Formula: #
Formula: C14H29N3O4
Formula: C23H24O5
Formula: C12H16
Formula: #
Formula: C9H12O2
Formula: C13H18
Formula: C34H41N3O7
Formula: C9H20N4
Formula: C4H5N7O
Formula: C7H18N2
Formula: #
Formula: #
Formula: C6H10N2O
Formula: C7H13N3O
Formula: C6H8N2O
Formula: C7H10N2O
Formula: C6H8N2O
Formula: C7H10N2O
Formula: C6H10N2O
Formula: C10H20N2
Formula: C12H22N2O2
Formula: C7H14N2.2(HCl)
Formula: C12H22N2O2
Formula: C7H14N2
Formula: C7H10N2O3
Formula: C7H10N2O3
Formula: C14H16N2O2
Formula: C22H32N4
Formula: C7H14Br2
Formula: C10H6Br2
Formula: C10H8Cl4F8O3
Formula: C9H7Cl4F8NO3
Formula: #
Formula: C10H6Cl2
Formula: C7H12Cl2O
Formula: C7H14Cl2
Formula: C9H5Cl2N
Formula: C8H24Cl2O3Si4
Formula: #
Formula: C15H26O2
Formula: C10H28O4Si3
Formula: C10H14N4O2
Formula: C10H15N5O2S
Formula: C5H6F2N6O11
Formula: C7H12F2O
Formula: C7H14F2
Formula: C12H18N4OS2
Formula: C14H13N3O2
Formula: C5H7N5O4S2
Formula: C7H6N4O3
Formula: C7H6N2O
Formula: #
Formula: C15H12O6
Formula: C19H18O5
Formula: C16H12O5
Formula: C10H8O2
Formula: C7H14I2
Formula: C16H20
Formula: C10H30O5Si4
Formula: C9H18N2O2
Formula: C12H12O2
Formula: #
Formula: C12H16N2
Formula: #
Formula: C10H14O2
Formula: C11H16N4O2
Formula: #
Formula: #
Formula: C15H22O
Formula: C13H16N2O2
Formula: C15H13N5O2
Formula: C15H14
Formula: #
Formula: #
Formula: C12H12
Formula: C16H14
Formula: C7H8N4O
Formula: C7H8N4O3
Formula: C7H8N4O2
Formula: C14H6N2O6
Formula: C10H6N2O4
Formula: C12H6N4O4
Formula: C5H4N2O4S2
Formula: C5H4N2O2S2
Formula: C8H20N2O2
Formula: C10H8O4
Formula: C9H14O5
Formula: C9H16O2
1,7-DIOXASPIRO[5.5]UNDECANE-3,4-DIOL, 9-ETHYL-, (3R,4S,6R,9S)- (9CI)
Formula: C11H20O4
1,7-DIOXASPIRO[5.5]UNDECANE-3,4-DIOL, 9-ETHYL-, (3R,4S,6S,9S)- (9CI)
Formula: C11H20O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C22H16
Formula: C11H6O
Formula: C7H16O2
Formula: C11H20O4
Formula: C16H30
Formula: C9H9N3
Formula: C8H7NO
Formula: C10H10N2
Formula: #
Formula: C8H6N2O
Formula: #
Formula: C8H7N3
Formula: C26H34F3NO4S
Formula: C8H8N2O
Formula: C8H6N2O
Formula: C8H7N3
Formula: C8H6N2
Formula: C9H8N2
Formula: C9H6N2O2
Formula: C11H10N2O2
Formula: C9H6N2O2
Formula: C8H14O
Formula: #
Formula: C9H12F2O
Formula: C8H14
Formula: #
Formula: C8H14O2
Formula: C8H10
Formula: #
Formula: #
Formula: C12H6N2O2
Formula: C12H8N2
Formula: C14H26
Formula: C17H28
Formula: C24H44N4O4
Formula: C16H22
Formula: C11H22ClNO
Formula: #
Formula: C10H14O3
Formula: #
Formula: #
Formula: C7H11N3S
Formula: C14H10O3
Formula: C13H9NO2
Formula: #
Formula: C14H6Na2O8S2
Formula: C12H10B2O4
Formula: C26H36N4O2
Formula: C32H56Cl2N4
Formula: C12H10Br2
Formula: C12H28Cl2Si2
Formula: #
Formula: C14H18N2
Formula: C18H28I2N4
Formula: C32H36P2
Formula: C16H14O2
Formula: C12H12O2
Formula: C16H14N2O2
Formula: C26H18N2O2
Formula: C26H16O2S2
Formula: C26H16O2S2
Formula: C8H16Cl6Si2
Formula: C12H8Cl6F16Si2
Formula: C20H46Cl6Si2
Formula: #
Formula: #
Formula: #
Formula: C14H16N2O6
Formula: C28H22N2O2
Formula: #
Formula: #
Formula: C46H40O2S4
Formula: C30H26N2O6
Formula: C15H22
Formula: C14H12
Formula: C16H12
Formula: C16H20
Formula: #
Formula: #
Formula: #
Formula: C10H22N4O2
Formula: C14H6Cl4N2O2
Formula: C14H8Br2N2O4
Formula: C28H22Cl2N4O2
Formula: C14H9BrN2O4
Formula: C11H12N5O2
Formula: C6H16N2O2
Formula: C14H10N2O4
Formula: C14H9ClN2O3
Formula: #
Formula: C10H22N2
Formula: C14H10N2O2
Formula: C14H10N2O2
Formula: C10H10N2
Formula: C8H22Cl2N2
Formula: C8H20N2
Formula: C16H12N2
Formula: C9H16N2.C8H16O2
Formula: C9H16N2.CH2O2
Formula: C9H16N2.C6H6O
Formula: C9H16N2
Formula: C9H16N2
Formula: C9H16N2
Formula: C9H17Br3N2
Formula: C10H20N2
Formula: C12H24N2
Formula: C13H26N2
Formula: C14H28N2
Formula: C12H22N2O2
Formula: C11H6N2O
Formula: C14H26N2O2
Formula: C6H12N6O2
Formula: C24H36N4
Formula: C10H6Br2
Formula: C8H16Br2
Formula: C8Br2F16
Formula: #
Formula: C16H8Br2
Formula: #
Formula: #
Formula: C14H4Cl2N2O6
Formula: C30H16Cl2
Formula: #
Formula: C14H6Cl2O2
Formula: C10H6Cl2
Formula: C8H16Cl2
Formula: #
Formula: C15H16O5
Formula: #
Formula: #
Formula: C18H21NO4
Formula: C14H8
Formula: C8H16F2
Formula: C27H19N3
Formula: C14H13NO2
Formula: C6H4N4O3
Formula: C18H16O4
Formula: C19H16O4
Formula: C19H18O4
Formula: C17H14O4
Formula: C17H16O8
Formula: C14H6N2O8
Formula: C14H4N4O12
Formula: C14H5N3O10
Formula: C14H6N2O8
Formula: C12H20O2S2
Formula: C16H12O5
Formula: #
Formula: #
Formula: C15H12O6
Formula: C16H12O6
Formula: C21H16O8
Formula: C17H15NO5
Formula: C16H14O4
Formula: C30H24O7
Formula: C20H18O4
Formula: #
Formula: #
Formula: C15H12O3
Formula: C14H10N2O6
Formula: C16H14N2O4
Formula: C26H18N2O4
Formula: C16H14N2O8
Formula: C14H6N2O14S2
Formula: C14H6N2O8
Formula: C21H14N2O7
Formula: C22H16N2O7
Formula: C22H16N2O7
Formula: #
Formula: #
Formula: C14H8O4
Formula: C20H12N2O2
Formula: C10H8O8S2
Formula: C8H16I2
Formula: C8F16I2
Formula: C10H16N2O2
Formula: C10H16N2
Formula: #
Formula: #
Formula: C16H12O4
Formula: C10H20N2O2
Formula: C12H16
Formula: C11H18N2O
Formula: C11H16N4O2
Formula: #
Formula: #
Formula: C14H13N
Formula: C15H12O
Formula: C12H12
Formula: #
Formula: C16H14
Formula: #
Formula: C26H10N6O16
Formula: C20H14N2O4
Formula: C20H10N2O4
Formula: C14H6N2O6
Formula: C10H6N2O4
Formula: C16H8N2O4
Formula: C9H15NO3
Formula: C15H28O3
Formula: C26H16O4
Formula: C20H18
Formula: C8H20O6P2
Formula: C12H6F16
Formula: C12H14N2O
Formula: C12H5KO6S *
Formula: C12H12O2
Formula: C12H8O4
Formula: C12H6O3
Formula: C12H7NO2
Formula: C10H6O3S
Formula: C10H10N2O
Formula: C24H16N4O6
Formula: C18H11Cl3N4O4
Formula: C21H14N4O5
Formula: C19H14N4O4
Formula: C23H16N4O4
Formula: C23H14Cl2N4O4
Formula: C23H15N5O6
Formula: C23H16N4O6
Formula: C24H18N4O4
Formula: C25H21N5O4
Formula: C19H16N4O4
Formula: C16H10N4O4S
Formula: #
Formula: #
Formula: C22H15N5O5
Formula: C17H12N2O3
Formula: C18H14N2O3
Formula: C14H10N4O2
Formula: C11H11N3O3
Formula: #
Formula: C17H12N2O4
Formula: #
Formula: #
Formula: #
Formula: C8H5IN2O2
Formula: C9H8N2O2
Formula: C10H6F6N4
Formula: C8H7N3
Formula: C17H8F9N3
Formula: C16H7Cl2F6N3
Formula: C16H8ClF6N3
Formula: C17H11F6N3O
Formula: C22H13F6N3O
Formula: C17H10ClF6N3
Formula: C16H9F6N3
Formula: C10H13N3O2
Formula: C10H13N3O2
Formula: C8H7N3
Formula: C8H6N2O
Formula: C12H14N2O2
Formula: C12H14N2O2
Formula: C11H12N2O2
Formula: C8H6N2
Formula: C11H14N2O
Formula: C9H12N2
Formula: C9H12N2
Formula: C26H10F12N4O2
Formula: C17H7F9N2O
Formula: C14H9FN2
Formula: C20H16N4O
Formula: C11H8F6N4
Formula: C12H5F6N5S
Formula: C14H7F6N3
Formula: C16H6Cl2F6N2O
Formula: C16H11F6N3
Formula: C15H10F6N4
Formula: C16H7F7N2O
Formula: C17H10F6N2O2
Formula: C16H7ClF6N2O
Formula: C16H7F6IN2O
Formula: C14H11F6N3O
Formula: C16H7F6N3O3
Formula: C20H16F6N4
Formula: C16H8F6N2S
Formula: C17H9ClF6N2
Formula: C16H7ClF6N2S
Formula: C18H14F6N8S
Formula: C17H7F6N7O2S
Formula: C18H6ClF9N6S
Formula: C22H7F12N7S
Formula: #
Formula: C12H8F6N2O
Formula: C16H8F6N2O
Formula: C8H6N2O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C18H8ClF6N3
Formula: #
Formula: #
Formula: #
Formula: C14H8F6N4O
Formula: C18H9F6N3
Formula: C9H7N3O
Formula: C17H12F3N3O
Formula: C16H10F3N3O
Formula: C12H11N3O
Formula: C14H10N4O
Formula: C15H11N3O
Formula: C9H6N2O2
Formula: C11H10N2O2
Formula: C10H11N3
Formula: C9H5N3O2
Formula: C12H11ClN2O2
Formula: C9H6N2O3
Formula: C15H12N4O2
Formula: C9H7N3O3
Formula: C18H11F6N3O
Formula: C16H14N4O
Formula: C16H14N4O
Formula: C18H14F3N3O
Formula: C16H13N3O
Formula: C11H11N3O
Formula: C12H13N3O
Formula: C12H10F3N3O
Formula: C16H11F3N4O
Formula: C16H11F3N4O
Formula: C19H16F3N3O2
Formula: C19H16F3N3O2
Formula: C12H10F3N3O2
Formula: C16H10F3N3O
Formula: C9H6N2O2
Formula: C9H6N2O3
Formula: #
Formula: C12H9F3N2O2
Formula: C9H7N3O2
Formula: C12H12N2O3
Formula: C9H7N3O3
Formula: C11H9ClN2O3
Formula: C9H16
Formula: C9H12
Formula: C10H22O4S4
Formula: C10H16N2S2
Formula: C12H26O4
Formula: C8H10D4O4
Formula: C8H2D12O4
Formula: C12H22O4
Formula: C8H18O2
Formula: C12H22O2S2
Formula: C8H18S2
Formula: C32H70Br2P2
Formula: C28H22N2O2
Formula: C20H10N2O6
Formula: C15H28
Formula: C15H24
Formula: #
Formula: #
Formula: C21H18O3
Formula: C10H15NO4
Formula: C15H26N2O2
Formula: C13H22N2O2
Formula: C17H22N2O4
Formula: #
Formula: C10H18
Formula: (C10H18)x.(C4H2O3)x.(C3H6O)x
Formula: C10H14
Formula: #
Formula: C9H24N2
Formula: C14H26N2O2
Formula: #
Formula: C9H18Br2
Formula: C10H30Cl2O4Si5
Formula: C13H7Cl2N
Formula: C9H18Cl2
Formula: C11H18N2
Formula: C22H34O5
Formula: C10H14N5NaO3
Formula: C12H10N4S
Formula: C6H6N4O
Formula: C6H6N4S
Formula: C11H8N2O
Formula: C9H18I2
Formula: #
Formula: C7H8N4O3
Formula: C15H14
Formula: #
Formula: C16H14
Formula: #
Formula: C16H14
Formula: C7H8N4O2
Formula: C12H6N4O4
Formula: C8H8N4O2
Formula: C21H18O
Formula: C9H2D14O4
Formula: C13H24O4
Formula: C15H24O4
Formula: C9H20O2
Formula: #
Formula: C9H20S2
Formula: #
Formula: C17H22O3
Formula: C14H8N2O
Formula: C20H38O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C12H13N5O5
Formula: C12H16N5O12P3
Formula: C11H15N6O13P3
Formula: C11H11N6O6P
Formula: C21H25N11O14P2
Formula: C8H9N5O3
Formula: C12H12N5Na2O6P
Formula: C12H13N5NaO7P
Formula: C12H14ClN5O4
Formula: C12H12N5Na3O10P2
Formula: C30H43ClN5O8.Cl
Formula: C10H17NO5Si
Formula: C14H24ClN5O4
Formula: C11H9F2N3O
Formula: C15H19F2NO3
Formula: C33H19NO9
Formula: C27H26N4O3S
Formula: C26H24N4O2S
Formula: C20H25I2N3O3
Formula: C8H8N4O3
Formula: C18H23I2N3O3
Formula: C13H15Cl2N3O2
Formula: C11H14BrNO2S
Formula: C14H14N5O3S.I
Formula: C22H23NO4
Formula: C13H19BrO
Formula: C12H19NO5
Formula: C18H19NO7
Formula: C18H18NNaO7
Formula: C16H20N2O4
Formula: C16H20N2O4
Formula: C26H27N3O6
Formula: C37H29F5N2O6
Formula: C32H32N2O6
Formula: C24H26N2O6.C12H23N
Formula: C38H52N4O8
Formula: C14H10N4O2
Formula: C8H16N2O3
Formula: C5H8N4OS
Formula: C26H26N2O
Formula: C7H14N2O3
Formula: C32H42N2O7
Formula: C27H24N4O5
Formula: C26H22N4O5
Formula: C13H21N3O5
Formula: C10H14Cl3NO3S
Formula: C17H25N3O2S
Formula: C13H15Cl2NO2
Formula: C13H15Cl2NO2
Formula: C25H39NO6Sn
Formula: C13H15Cl2NO2
Formula: C13H15Cl2NO2
Formula: C13H15Cl2NO2
Formula: C13H15Cl2NO2
Formula: C10H7F2N3O2
Formula: C13H19N3
Formula: C21H20ClN3O3
Formula: C15H16ClN3O3
Formula: C16H16N2O3
Formula: C27H32O4
Formula: C25H27ClO3
Formula: C25H23Cl3O3
Formula: C25H26F2O3
Formula: C26H30O3
Formula: C26H28O2
Formula: C27H32O3
Formula: C25H27ClO3
Formula: C27H30O2
Formula: C24H23F3O3
Formula: C26H30O3
Formula: C23H22ClFO2
Formula: C23H22Cl2O2
Formula: C24H25ClO2
Formula: C23H22ClFO2
Formula: C24H25ClO3
Formula: C23H23ClOS
Formula: C11H15Cl2N.HCl
Formula: C11H16ClNO
Formula: C11H16ClNO.HCl
Formula: C25H24O2
Formula: C15H13Cl2N3O3
Formula: C16H15Cl2N3O3
Formula: C17H17Cl2N3O3
Formula: C16H17N3O5
Formula: C15H13ClN2O3
Formula: C27H31N3O4S
Formula: C15H29BN2O3Si
Formula: C11H16ClN3O3
Formula: C14H13BrS
Formula: C9H14ClN3S.2(HCl)
Formula: C10H15ClN2OS
Formula: C9H13ClN2OS
Formula: C9H14ClN3S.2(HCl)
Formula: C10H13ClN2O2S
Formula: C9H13ClN2OS
Formula: C8H12ClN3S.2(HCl)
Formula: C13H16ClNO.HCl
Formula: C13H16ClNO2
Formula: C9H9ClOS
Formula: CH3OC6H4OCH2CH(C2H5)(CH2)3CH3
Formula: C15H13FN4O
Formula: C13H16FNO2
Formula: C13H16FNO2
Formula: C15H19N3O4
Formula: C15H18N2O5
Formula: C23H24O2
Formula: C12H11NO2
Formula: C14H19NO2
Formula: C14H19NO2
Formula: C14H19NO2
Formula: C12H18N2.HCl
Formula: C23H35N3O4S
Formula: C17H21N3O2S
Formula: C14H18O4
Formula: C6H10O2
Formula: C29H28N2O7
Formula: C6H10O2
Formula: C15H24Cl2N2O
Formula: C15H22ClNO
Formula: C12H12F6N2O2S.HCL
Formula: C13H15Cl2NO2
Formula: #
Formula: C24H30N4O
Formula: C23H28N4O
Formula: C24H30N4O
Formula: C23H35NO4Sn
Formula: C13H16ClNO2
Formula: C13H16ClNO2
Formula: C13H16FNO2
Formula: C13H16FNO2
Formula: C12H16BrN3O3
Formula: C20H21NO3
Formula: C21H24N2O3
Formula: C21H23NO3
Formula: C15H23N3
Formula: C31H32N2O7
Formula: C32H34N2O7
Formula: C15H23N3
Formula: C31H32N2O7
Formula: C15H19ClN2OS
Formula: C23H25N3O5S
Formula: C22H28ClN3O6S2
Formula: C21H30N4O3S
Formula: C15H15IO
Formula: C16H17BrO
Formula: C16H17IO
Formula: C29H36N4O5S
Formula: C23H28N2O3
Formula: C23H28N2O2
Formula: C11H8FNO4
Formula: C23H35NO4Sn
Formula: C12H14F3N3
Formula: C11H12F3N3
Formula: C11H14BrNO2S
Formula: C13H15BrO3
Formula: C9H7BrN2O4S
Formula: C14H18ClN3O4
Formula: C17H19ClN2.2(HCl)
Formula: C26H32ClNO3S
Formula: C27H34ClNO3S
Formula: C16H25ClN2O
Formula: C12H8ClNO3
Formula: C18H21ClN2.x(ClH)
Formula: C25H30O
Formula: C25H30
Formula: C13H16FNO2
Formula: C13H16FNO2
Formula: C13H16FNO2
Formula: C12H16FNO3S
Formula: C11H14FNO3S
Formula: C11H14FNO3S
Formula: C9H11N5.HCl
Formula: C17H15NO3
Formula: C15H24N2O4S
Formula: C11H13N3O.HCl
Formula: C12H11NO3
Formula: C20H23BN2O4S
Formula: C16H13NO3S
Formula: C18H15F3N2O7S2
Formula: C20H24N4O2S.HCl
Formula: C20H24N4O2S.HCl
Formula: C19H22N4O2S.HCl
Formula: #
Formula: C11H15N3O2
Formula: C10H9N3O2
Formula: C20H27N3O2S2
Formula: C12H8F3NO2
Formula: C23H37NO3Si
Formula: C16H14N4O4
Formula: C12H16ClN3O5S
Formula: C21H23ClN2O3
Formula: C20H21Cl2NO3
Formula: C18H14N4O3S
Formula: C23H29NO4
Formula: C23H27NO4
Formula: C22H34O
Formula: C16H18N4O4S2
Formula: C11H16ClN3.2(HCl)
Formula: C12H17ClN2O.2(HCl)
Formula: C11H15ClN2O.2(HCl)
Formula: C11H16ClN3.2(HCl)
Formula: C10H14ClN3.2(HCl)
Formula: C13H21N3O.2(HCl)
Formula: C12H19N3O.2(HCl)
Formula: C12H19N3O.2(HCl)
Formula: C7H14N2O2.HCl
Formula: #
Formula: C14H17NO4
Formula: C14H17NO4
Formula: C19H19NO
Formula: C7H12ClN3O5
Formula: C19H26O
Formula: C9H9Cl
Formula: C14H21ClN2
Formula: C26H34N2O
Formula: #
Formula: C17H13NO
Formula: C14H17NO4
Formula: C14H17NO4
Formula: C16H21NO4
Formula: C11H11N20O
Formula: C15H16N2O
Formula: C10H9ClF2
Formula: C9H14ClNO3
Formula: C14H25NO4
Formula: C15H20N2O4
Formula: C14H25NO4
Formula: C21H30N2O6
Formula: C23H34
Formula: C21H30
Formula: C5H4F3NO2S
Formula: C10H15N3Si
Formula: #
Formula: #
Formula: C9H9ClO
Formula: C7H12O2
Formula: C10H16ClNO3
Formula: #
Formula: C20H21N3O2
Formula: C17H24BrN3O3
Formula: C24H16
Formula: C19H32N2S
Formula: #
Formula: #
Formula: C9H9F6N3O4
Formula: C9H9F7O3
Formula: C19H21F7INO2
Formula: C19H16F8O2
Formula: C6H10F4O
Formula: C10H18F4O
Formula: C5H8F4O
Formula: C10H8F6S
Formula: C17H24O
Formula: C36H32N2O2
Formula: C14H22O
Formula: C10H22O3
Formula: #
Formula: C9H16N2O2
Formula: C8H18O3
Formula: C9H18N2OS
Formula: #
Formula: C9H16INO
Formula: C42H44N2O2
Formula: C11H15NO
Formula: C9H23NOSi
Formula: #
Formula: #
Formula: #
Formula: C8H7F3O
Formula: C11H16O
Formula: C12H16O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H20O
Formula: #
Formula: C13H18N2O4
Formula: C12H16N2O4
Formula: C16H19N5
Formula: #
Formula: #
Formula: #
Formula: C12H18
Formula: C9H13ClN2O
Formula: C9H14N2O2
Formula: C11H18N2O2
Formula: C11H16
Formula: C11H16S
Formula: C12H14
Formula: C11H13NS
Formula: #
Formula: C14H20O
Formula: #
Formula: C17H28O2
Formula: C17H19NO3
Formula: C6H13NO2S
Formula: C18H24O
Formula: #
Formula: C16H24O
Formula: C21H36
Formula: C12H22O
Formula: #
Formula: C16H26O
Formula: C15H24O
Formula: C16H26O
Formula: C15H24O
Formula: C14H22O