Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C8H8KNO5S
Formula: #
Formula: C3H6O3X2
Formula: (CH2O)n
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H12O3
Formula: C7H11NO3
Formula: C22H29FO5
Formula: C21H26BrNO3
Formula: #
Formula: #
Formula: C12H14Cl2N2
Formula: C14H20N2O8S2
Formula: C12Cl2H14N2
Formula: C12H14N2
Formula: C61H54N6O8
Formula: C19H18ClN3
Formula: C21H21N3O2
Formula: C19H19N3O
Formula: C8H10NO5PS
Formula: C10H14NO5PS
Formula: C147H234N46O39S2
Formula: C416H677N125O126S2
Formula: #
Formula: C97H150N28O32
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C94H162N26O36
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C142H228N42O58
Formula: #
Formula: #
Formula: #
Formula: C7H5D3N4O2
Formula: C13H17N3O2
Formula: C19H17N2NaO4S
Formula: C19H17N2O4S.Na
Formula: C19H18N2O4S
Formula: #
Formula: C14H26N4O3
Formula: C28H54N8O10S
Formula: C15H24ClNO3
Formula: C16H23NO3
Formula: C22H33BrO5
Formula: C11H13N
Formula: C11H13N.HCl
Formula: C27H44O3
Formula: C17H26N2O2
Formula: C85H120N2O25
Formula: C32H40O19
Formula: C32H40O19
Formula: C45H56O25
Formula: #
Formula: C19H18BrClN4O2
Formula: C23H45N5O14.H2SO4
Formula: #
Formula: #
Formula: C19H20FNO3
Formula: C19H20FNO3.HCl
Formula: C19H20NO3F.C4H4O4
Formula: C19H20FNO3
Formula: C14H18N2O2
Formula: #
Formula: C39H50Cl2F3N5O4S2
Formula: C15H20O3
Formula: C15H20O3
Formula: #
Formula: #
Formula: #
Formula: C16H16O3
Formula: C16H8F8
Formula: #
Formula: #
Formula: C17H16O5
Formula: C7H7NO3.C6H7N3O
Formula: C58H66N10O9
Formula: C27H31NO4
Formula: #
Formula: #
Formula: #
Formula: C15H26
Formula: C15H26O
Formula: C35H50N8O6S2
Formula: C37H46N8O6S2
Formula: C38H48N8O6S2
Formula: C39H50N8O6S2
Formula: C8H6O4
Formula: #
Formula: C7H6O4
Formula: C12H18O3
Formula: #
Formula: C27H41NO6S
Formula: C29H43NO16
Formula: C28H41NO16
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C27H33NO4
Formula: C23H29NO4
Formula: C23H29NO5
Formula: #
Formula: C25H23CIN4O4
Formula: C25H23ClN4O4
Formula: C21H23N7O2S.HCl
Formula: C21H23N7O2S
Formula: #
Formula: C16H15FN2O4.HCl
Formula: C16H15FN2O4.CH4O3S
Formula: C16H15FN2O4.CH4O3S
Formula: C16H15FN2O4
Formula: #
Formula: C24H40Cl2N2O
Formula: C12H19O10P1
Formula: C58H62N2O24
Formula: #
Formula: #
Formula: #
Formula: #
Formula: (C43H47N3S3)n
Formula: #
Formula: C21H23N3O5
Formula: C17H16N2O3
Formula: C25H24N6O2
Formula: C16H14F3IN2O4
Formula: C24H29N7O2
Formula: C31H32N4O3
Formula: C14H19NO3HCl
Formula: C16H14BrN3O2.HCl
Formula: C26H27Cl2N5O2.2(HCl)
Formula: C17H18BrNO4S
Formula: C20H13FN4O2
Formula: C28H41N7O3
Formula: C17H14ClF2IN2O2
Formula: C16H13BrF3IN2O4
Formula: C16H13NO3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C22H27N5O2
Formula: #
Formula: C28H22F2N4O4
Formula: #
Formula: #
Formula: C13H14N2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H23ClN2S
Formula: C17H25NO3
Formula: C29H35N3O10
Formula: #
Formula: #
Formula: C47H70O15
Formula: #
Formula: C17H14O6
Formula: C29H34O15
Formula: C29H34O15
Formula: #
Formula: C16H12O7
Formula: C9H14N2O4
Formula: C18H18O6
Formula: C17H26O11
Formula: #
Formula: C196H297N61O60S5
Formula: #
Formula: #
Formula: #
Formula: C36H58O10
Formula: #
Formula: [OC6H4OC6H4COC6H4]n
Formula: C24H38N8O8S1
Formula: C26H34N8O6
Formula: C17H20FN3O3.CH4O3S.2(H2O)
Formula: C17H20FN3O3.CH4O3S
Formula: C17H20FN3O4
Formula: C17H20FN3O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H38O6
Formula: #
Formula: #
Formula: C28H60ClNO5
Formula: #
Formula: #
Formula: C20H38O4
Formula: C17H28N2O4
Formula: C34H68O10
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C27H45NO3
Formula: C27H43NO3
Formula: C27H41NO3
Formula: #
Formula: C21H25ClN4O2
Formula: C15H11ClO5
Formula: C21H21O10.Cl
Formula: #
Formula: C30H30N2O7
Formula: C24H23ClFN5O2
Formula: C20H25N5O6S
Formula: C8H15NO
Formula: C39H48N2O6
Formula: C14H25NO
Formula: C13H19NO3
Formula: C23H28O2
Formula: C12H11N5O
Formula: #
Formula: #
Formula: C16H18O3
Formula: C15H32N2O
Formula: C20H19N5Na2O6.7(H2O)
Formula: 2(C20H19N5Na2O6).5(H2O)
Formula: C20H19N5Na2O6
Formula: C22H25N5O6
Formula: C10H7KN6O
Formula: C9H8N2O2
Formula: #
Formula: #
Formula: C11H12N2O5
Formula: C19H22N2O6S
Formula: C18H29NO2
Formula: C36H60N2O8S
Formula: C57H80ClN13O15
Formula: C10H15N5O3
Formula: C13H15Cl2N3
Formula: C19H21ClN2O
Formula: C23H46N2O3
Formula: C13H19N3O4
Formula: C18H16O7
Formula: #
Formula: C22H31N3O4S.HI
Formula: C22H32IN3O4S
Formula: C15H9F5N2O2
Formula: C28H27ClF5NO
Formula: C51H74O19
Formula: C5H12ClNO2S
Formula: #
Formula: C15H26N4O8S
Formula: C21H24O6
Formula: C14H21N3O6S
Formula: C14H22N2O4S2
Formula: C16H18CaN2O4S
Formula: C16H17N2NaO4S
Formula: C16H18N2O4S
Formula: C13H18KN2O4S2
Formula: #
Formula: C16H20N2.2(C16H18N2O5S).8(H2O)
Formula: C58H82N4O5S
Formula: C16H17KN2O5S
Formula: C24H26N2O6S
Formula: #
Formula: #
Formula: C39H43N5O12S
Formula: C15H22N2O2
Formula: C37H44ClNO6
Formula: C37H45NO5
Formula: C4H4O2
Formula: C16H18N2O2
Formula: #
Formula: C51H82O21
Formula: C16H14F5N5O5S
Formula: C21H32O5
Formula: C17H26O10
Formula: C11H14
Formula: C5H10O5
Formula: C7H8O4
Formula: C5H10O
Formula: C5H10
Formula: C5H6O4
Formula: C5H6O4
Formula: C5H7N
Formula: C5H8O2
Formula: C5H10O
Formula: C5H8O
Formula: C5H8O
Formula: C5H6O
Formula: C5H6O2
Formula: C12H14O3S
Formula: C5H6O
Formula: C5H8O
Formula: C10H16O5
Formula: C18H23N3O4
Formula: C7H12O2
Formula: C19H28O10
Formula: C39H44O6
Formula: C32H32O9
Formula: C32H38O6
Formula: C39H44O6
Formula: C47H48O9Si
Formula: C27H38O6Si
Formula: C11H20O6
Formula: C5H12ClN
Formula: C12H14O3S
Formula: C24H34O10S2
Formula: C5H6
Formula: C8H8
Formula: C5H8
Formula: #
Formula: C40H67N5O26
Formula: C41H32O11
Formula: C25H30O7
Formula: C27H34O15
Formula: C16H22O10S
Formula: C16H22O11
Formula: Al5NaO8
Formula: C3H15F9N5O9OsS3
Formula: Cl3H15N5Ru
Formula: Cl3H15IrN5
Formula: C6H24N8O2Ru
Formula: H20N5O10P3
Formula: #
Formula: C8H16N2O4
Formula: #
Formula: C12HBr9O
Formula: C14H4Br9ClO2
Formula: C14H5Br9O2
Formula: C12HBr10N
Formula: C3HBr5O
Formula: C10H5Br5O2
Formula: C7H2Br6
Formula: #
Formula: C12H3Br5O
Formula: C12H5Br5O
Formula: C6HBr5O
Formula: C9H3Br5O2
Formula: #
Formula: Ca5O20P6
Formula: C5H10ClMnO5
Formula: C42H48N4O10
Formula: C22H14
Formula: #
Formula: C9H5Br2Cl5O
Formula: C4Cl6O
Formula: Cl5H8N2Ru
Formula: C7H2Cl6S
Formula: C6H2Cl5N
Formula: C6HCl5
Formula: C7Cl5N
Formula: #
Formula: C3HCl5
Formula: #
Formula: #
Formula: C12H5Cl5O
Formula: Cl5HSi2
Formula: C3H2FCl5
Formula: C6HCl5O
Formula: C18H23Cl5O2
Formula: C6HCl5O
Formula: C9H3Cl5O2
Formula: C8HCl7O2
Formula: C10H5Cl5O2
Formula: C22H31Cl5O2
Formula: C8Cl8O2
Formula: #
Formula: C11H8Cl5NO3S
Formula: C7H3Cl5OS
Formula: C3Cl5N
Formula: C5Cl5N
Formula: C8H3Cl5
Formula: C6H12Cl2S
Formula: C6HCl5S
Formula: Cl5W
Formula: #
Formula: C50H102
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C25H50O
Formula: #
Formula: C25H50O2
Formula: Na2NH4[Fe(CN)5NH3]xH2O
Formula: C5H3FeN6Na3
Formula: C10H25N5
Formula: C18H16
Formula: #
Formula: C24H20
Formula: #
Formula: #
Formula: C8H8
Formula: C10H8
Formula: C10H8O2
Formula: C9H6FN
Formula: C9H6ClFO
Formula: C9H9NO
Formula: C9H8O2
Formula: C9H9FO
Formula: #
Formula: C9H10
Formula: C9H12N2
Formula: C10H10O
Formula: C10H11NO
Formula: #
Formula: C9H9NO
Formula: C11H10O2
Formula: C11H12O
PENTACYCLO[6,4,0,0] 2,7 [0]4,11,[0]5,10 DODECANE
Formula: #
Formula: C12H16
Formula: #
Formula: C15H22O2
Formula: #
Formula: C7F16O2S
Formula: C8HF15O2
Formula: C8ClF15O
Formula: C15H33N
Formula: C15H32O
Formula: C15H32O
Formula: C15H30O
Formula: C15H32O
Formula: C15H30O
Formula: C17H36O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C15H32O2
Formula: C15H34N2
Formula: C17H32O4
Formula: #
Formula: C15H28O4
Formula: C15H29N
Formula: R-SO3Na
Formula: C15H30O2
Formula: C19H38O2
Formula: C15H29O2Sr
Formula: #
Formula: C15HD29O2
Formula: #
Formula: C15H29ClO
Formula: C36H62N7O17P3S
Formula: C30H58O3
Formula: C17H34O2
Formula: C41H17Na15O71S15
Formula: H3Na2O4P
Formula: #
Formula: #
Formula: C18H34O2
Formula: C15H33O4P
Formula: C16H31NO
Formula: C21H36
Formula: C21H36O3S
Formula: #
Formula: #
Formula: C77H148O8
Formula: C49H96O6
Formula: C5H10N2O8
Formula: C30H62O10
Formula: C17H28O8
Formula: C11H15NO5
Formula: C24H48O4
Formula: C22H48O12
Formula: [H2C=CHCO2(C3H6O)nCH2]3CCH2(OC3H6)nOH
Formula: C37H68O8
Formula: C17H28O8S4
Formula: C13H20O8
Formula: C17H20O8
Formula: C33H28O8
Formula: C13H20O8S4
Formula: C73H108O12
Formula: #
Formula: C5H16O16P4
Formula: C21H28O8
Formula: C77H140O8
Formula: C14H18O7
Formula: C17H24O7
Formula: C20H33N3O7
Formula: C59H114O7
Formula: C23H48O8
Formula: C5H12O4
Formula: #
Formula: C41H80O6
Formula: C29H24N4O8
Formula: C17H28O8
Formula: C5H8Cl2O3
Formula: C23H48O8
Formula: C5H8Cl4
Formula: C77H148O8
Formula: C5H12S4
Formula: #
Formula: C10H25O5P
Formula: #
Formula: C16H26
Formula: C22H46O6
Formula: C17H28O6
Formula: C11H24O6
Formula: C10H22O6
Formula: C10H28N6
Formula: C3H5F5OS
Formula: C9H3F9O
Formula: C3H3F5O
Formula: AsF5
Formula: F5P
Formula: C11H21F5SSi
Formula: C4H6F5OP
Formula: C3HF5O
Formula: C6H2F5N.CHF3O3S
Formula: C6HF5
Formula: C6HF5O3S
Formula: C6ClF5O2S
Formula: C6HF5S
Formula: C7HF5O2
Formula: C7F5N
Formula: C7ClF5O
Formula: C11H4F5N3O2
Formula: C7H2ClF5
Formula: C11H7F5O2
Formula: C14H9F5O3S
Formula: C10H7F5O2
Formula: C2HF5O
Formula: C2HF5O3S
Formula: C2HF5
Formula: C4H2F8O
Formula: C4H5F5O
Formula: C5H5F5O
Formula: C3H3F5O
Formula: C9H5F5O
Formula: C4F8O
Formula: C2F5I
Formula: CHF5OTe
Formula: F5Mo
Formula: C6F5NO2
Formula: C6DF5O
Formula: C6HF5O
Formula: C7ClF5OS
Formula: C18H10F5O2P
Formula: C7F5NS
Formula: C10H5F5O2
Formula: C12H4F5NO2
Formula: C12F10S
Formula: C8F8O2
Formula: #
Formula: C8H3F5O2
Formula: C8H2F5N
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C12H16F5NSi
Formula: C6H3F5N2
Formula: C10H7F5O3
Formula: C9H6Cl3F5Si
Formula: C12H3F5NO2-
Formula: #
Formula: C6Cl3F5Si
Formula: #
Formula: C5H7F5O2
Formula: C3HF5O
Formula: C4H5F5O2
Formula: #
Formula: #
Formula: C21H37F5O2
Formula: #
Formula: C6F10O3
Formula: C3F5N
Formula: C3ClF5O
Formula: C3F6O
Formula: C3H3F5N2
Formula: C5F5N
Formula: #
Formula: F5W
Formula: F5U
Formula: C17H15F5O2
Formula: C37H49N7O9S
Formula: C26H38O3
Formula: C10H17N5O6
Formula: I5Ta
Formula: #
Formula: #
Formula: C12H17NO2
Formula: C10H15NO
Formula: C11H18
Formula: C10H14O
Formula: C10H14O
Formula: C10H18O2
Formula: C10H18O2
Formula: C10H18O2
Formula: C11H20
Formula: C11H20
Formula: C8H12N2O4
Formula: C8H12N2O4
Formula: C8H12N2O4
Formula: C8H12N2O4
Formula: C11H20
Formula: #
Formula: C9H10O2
Formula: C9H13NO
PENTALENO[2,1-C]ISOXAZOLE, 3,3A,3B,4,5,6,6A,7-OCTAHYDRO-, (3A-ALPHA-,3B-BA-,6A-BA-)- (9CI)
Formula: C9H13NO
Formula: C15H18O6
Formula: C15H16O5
Formula: F5I
Formula: Li5O12P3
Formula: C11H28Br2N2
Formula: C11H28I2N2
Formula: #
Formula: #
Formula: C5H15O5P
Formula: C15H16O10
Formula: C25H42N2O8
Formula: C17H19N
Formula: (CH3)5C6NH2
Formula: C11H16
Formula: C11H15ClO2S
Formula: C11H15S
Formula: C12H16O2
Formula: C12H15N
Formula: C10H15Cl3Zr
Formula: C10H15Cl3Hf
Formula: C24H30Fe2O4
Formula: C13H15O3Re 5*
Formula: C10H15Cl4Ta
Formula: C10H15Cl3Ti
Formula: C5H15O5Si5
Formula: C9H23N3
Formula: C5H16Si2
Formula: C11H15I
Formula: C13H17N
Formula: C5H15Sb
Formula: C19H24N4O2.2(C2H6O4S)
Formula: C19H24N4O2
Formula: C13H33Br2N3
Formula: C22H28N2O3
Formula: #
Formula: C5H14ClN
Formula: C5H12O
Formula: C5H10O
Formula: C13H19NO4S
Formula: C12H18O3S
Formula: C6H13NO2
Formula: C5H11NO3
Formula: C8H14O2
Formula: C23H26BrP
Formula: C11H16
Formula: C8H16
Formula: C11H22O3
Formula: C11H22O2
Formula: C19H21ClN2O3
Formula: C5H11NO3
Formula: C11H16
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C5H4O4
Formula: C5H7NO3
Formula: C7H12O2
Formula: C7H12O2
Formula: C7H12O2
Formula: C5H6O4
Formula: C7H10O2
Formula: C6H10O2
Formula: C6H10O2
Formula: C5H8O3
Formula: C6H8O3
Formula: C7H15NO
Formula: C9H18N2O2
Formula: C8H18N2O
Formula: C9H18N2O2
Formula: C8H17NO2
Formula: C9H15NO3
Formula: C5H9NO2
Formula: C8H13NO3
Formula: C8H17NO
Formula: C7H13NO2
Formula: C13H19NO
Formula: C11H18N4O3
Formula: C15H25ClN4O3
Formula: C10H16N2O3
Formula: C14H22N4O3
Formula: C14H22N4O3
Formula: #
Formula: C5H12N2.HCl
Formula: C5H12
Formula: C5H9Cl3
Formula: C5D12
Formula: C5H12O4
Formula: C5H12O3
Formula: C5H12O2
Formula: C5H15ClN2
Formula: C11H18Br2O4
Formula: C5H13O3P
Formula: C5H11O3S
Formula: C5H12O3
Formula: C11H12N2O2
Formula: C5H12O2
Formula: C5H12O2
Formula: C5H8O2
Formula: C5H12S
Formula: C5H8O2
Formula: C5H10N2O2
Formula: C4H10N4
Formula: C5H6N2
Formula: C13H24O4
Formula: C44H67NO8
Formula: C7H12O4
Formula: #
Formula: #
Formula: C7H10Br2O4
Formula: C22H34O5
Formula: C6H11NO4
Formula: C8H13BrO4
Formula: C9H13NO4
Formula: C15H18O6
Formula: C5H9NO5
Formula: C14H18O4
Formula: C13H16O4
Formula: C11H22O6S
Formula: C14H30ClN3O5
Formula: #
Formula: C14H16O4
Formula: C13H14O5
Formula: C5H6D2O4
Formula: C5H6Cl2O2
Formula: C7H10Cl2O2
Formula: C7H9F2NO
Formula: C8H13NO
Formula: C7H9NO
Formula: C6H9NO
Formula: C6H9NO
Formula: C8H16N2
Formula: C8H16N2
Formula: C7H12N2O
Formula: C5H11ClO2S
Formula: C7H16N2S
Formula: C8H17NOS
Formula: C7H15NOS
Formula: C7H13NOS
Formula: C12H17NS
Formula: #
Formula: #
Formula: C6H10ClNO2
Formula: #
Formula: C5H9O2
Formula: C8H16O2
Formula: C11H22O2
Formula: C20H36O6
Formula: #
Formula: #
Formula: C10H18CaO4
Formula: C11H20O2
Formula: C10H18MnO4
Formula: C10H19NO2
Formula: C10H13NO3
Formula: C6H8F2O3
Formula: C6H8F2O3
Formula: C7H13NO3
Formula: C6H9NO4
Formula: C6H14N2O3
Formula: C5H8O4
Formula: C5H8O4
Formula: C5H8O4
Formula: #
Formula: C6H10O3
Formula: C7H12O3
Formula: C7H12O3
Formula: C13H18O2
Formula: C5H6F2O3
Formula: C6H8F2O3
Formula: C5H6O4
Formula: C8H13NO4
Formula: C10H19NO4
Formula: C10H19NO4
Formula: C8H17NO2
Formula: C8H17NO2
Formula: C6H13NO2S
Formula: C7H15NO3
Formula: C8H12ClNO3
Formula: C6H9ClO3
Formula: C7H11ClO3
Formula: C8H13FO3
Formula: C5H8O4
Formula: C6H10O3
Formula: C6H10O3
Formula: C7H12O3
Formula: C7H12O3
Formula: C7H16N2O2
Formula: C10H19NO4
Formula: C10H19NO4
Formula: C6H9ClO3
Formula: C8H13FO3
Formula: #
Formula: #
Formula: C10H19NO2
Formula: C15H28N2O5
Formula: C11H16N4O5
Formula: C17H22N2O4S
Formula: C18H18N2O4
Formula: C5H10N2O4
Formula: C10H17NO3
Formula: C11H14O2
Formula: #
Formula: C5HD9O2
Formula: C13H22O2
Formula: #
Formula: C5H12O
Formula: C5H12O
Formula: C6H11ClO2
Formula: C7H13ClO2
Formula: C6H11ClO2
Formula: #
Formula: C55H112
Formula: C22H14
Formula: NaO20P5-14
Formula: C18H27NO2
Formula: C20H33NO6S
Formula: C3H12NO9P3
Formula: C9H23K5N3O15P5
Formula: K5P3O10
Formula: C18H30N3O5P
Formula: #
Formula: C9H15NO4
Formula: C5H7NO4
Formula: C81H91N7O27
Formula: C42H24N9Na5O18S6
Formula: C40H29N10Na5O19S5
Formula: C31H19ClN7Na5O19S6
Formula: C30H15N4Na5O16S5
Formula: C30H15N4Na5O16S5
Formula: C36H60N5Na5O12
Formula: C12H4Na5O16S4Sb
Formula: C12H18Na5O23S4Sb
Formula: C29H14Cl2N9Na5O16S5
Formula: C29H18N3Na5O20S6
Formula: C30H15ClN7Na5O15S4
Formula: C26H13ClN7Na5O15S4
Formula: C28H18N5Na5O19S6
Formula: C20H13Na5O10P2
Formula: C20H13Na5O11P2
Formula: C7H6Na5O9P
Formula: C39H26ClN10Na5O16S5
Formula: C41H25ClN9Na5O18S6
Formula: C45H21K5N2O20S5
Formula: C26H12ClF2N8Na5O16S5
Formula: C25H12Cl2N9Na5O16S5
Formula: C25H12Cl2N9Na5O16S5
Formula: C29H21ClN9Na5O18S5
Formula: C41H27N8Na5O19S5
Formula: C36H20N7Na5O18S5
Formula: C48H30N9Na5O19S4
Formula: C43H26N9Na5O17S5
Formula: C12H7Na5O12
Formula: C41H24ClN10Na5O18S5
Formula: C39H21ClN9Na5O17S5
Formula: C38H18Cl2CrN16Na5O20S4
Formula: C14H18N3O10Na5
Formula: C9H22N3Na5O15P5
Formula: #
Formula: FO12P3Sr5
Formula: #
Formula: S5
Formula: #
Formula: C35H72O
Formula: Cr2H2O10Zn3
Formula: HO13P3Zn5
Formula: C19H27NO
Formula: C19H28ClNO
Formula: C6H9ClN4O
Formula: C5H10
Formula: #
Formula: C6H8O4
Formula: C11H14
Formula: C10H15Na3O10Zn
Formula: C6H10N4
Formula: C63H87N13O19S2
Formula: #
Formula: #
Formula: C16H20F3N3OS
Formula: C7H11Cl3O4
Formula: C19H33N3O
Formula: C8H16O3
Formula: C7H12O2S
Formula: C5H8O3
Formula: C7H10O2
Formula: C8H12O2
Formula: C6H12O2
Formula: C7H14N2O4
Formula: C6H13NO4
Formula: C6H11NO3
Formula: C6H12O2
Formula: C5H11NO
Formula: C5H10NO
Formula: C8H12N2O3
Formula: #
Formula: C11H17N2NaO3
Formula: C11H18N2O3
Formula: C5H10O5
Formula: #
Formula: C23H42N2O12
Formula: C24H26O5
Formula: C9H15NO4
Formula: C6H6O5
Formula: C8H14O3
Formula: C8H14O3
Formula: C7H12O3
Formula: C9H16O3
Formula: C5H6O3
Formula: C10H17NO4
Formula: C6H13NO4
Formula: C7H10O4
Formula: C5H10FNO3
Formula: #