Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C5H6O2.Li
Formula: C10H14MnO4
Formula: C15H21O6Tl
Formula: C36H49NO12
Formula: C6H8O3
Formula: C29H45N9O9
Formula: C10H10FNO3
Formula: #
Formula: C47H74O17
Formula: C2H4O2.x(H3PO4).x(C6H10O5)
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H15BrN2O3
Formula: C7H13NO3
Formula: C3H6N2O2
Formula: C26H23FeO2P
Formula: C9H17NO4
Formula: C20H23NO5
Formula: C7H16NO2.Br
Formula: C7H16NO2.Cl
Formula: C7H16INO2
Formula: C7H16NO2.I
Formula: C7H16NO2.ClO4
Formula: C124H188N30O38S2
Formula: C90H136N22O28S2
Formula: C7H16ClNO2
Formula: C7H12ClD4NO2
Formula: C7BrD16NO2
Formula: C7H7ClD9NO2
Formula: C18H18N2O5S
Formula: C33H38O12
Formula: C17H16O7
Formula: #
Formula: #
Formula: C16H23ClN4O2S3
Formula: C14H16N4O5S2
Formula: #
Formula: C2H2
Formula: C12H16O
Formula: C2H2
Formula: C4H4N2O2
Formula: C4HKO4
Formula: C4H2O4
Formula: C24H24O9
Formula: C12H16N4O10S
Formula: C21H26N2O
Formula: C12H12FeO
Formula: C21H29NO8
Formula: #
Formula: C8H10N2O5
Formula: #
Formula: C22H34O4
Formula: C17H22O4
Formula: C46H58N2O13
Formula: #
Formula: C8H15NO3
Formula: C26H38O6
Formula: C5H4N2O
Formula: #
Formula: C9H14O
Formula: C21H36N4O11
Formula: C8H7HgNO5
Formula: C12H16HgO2
Formula: C8H10HgN2O4S
Formula: C5H10HgO3
Formula: C12H17HgNO2
Formula: C9H10HgO2
Formula: C9H10HgO2
Formula: C16H17HgN3O2
Formula: C3H6HgO2
Formula: C8H11HgNO2
Formula: C4H6O3
Formula: C13H16N2O8S
Formula: C17H21NO9
Formula: C35H42N2O18
Formula: C41H44N4O20S
Formula: C29H24O15
Formula: #
Formula: #
Formula: C2H5O5P
Formula: C2H5O4P
Formula: C6H6N2O
Formula: #
Formula: C10H10O4
Formula: C9H8O4
Formula: C16H12O6
Formula: C18H18O6
Formula: C27H40O6
Formula: C45H76N2O15
Formula: C11H12N4O4S2
Formula: C22H32O4
Formula: C34H48O11
Formula: C10H10O2S
Formula: C7H16NOS.Cl
Formula: C7H16ClNO5S
Formula: C7H16NOS+
Formula: C15H18BOPS
Formula: #
Formula: C5H12O2Si
Formula: #
Formula: C11H11ClO3
Formula: C24H32O10
Formula: #
Formula: #
Formula: C6H11NO2
Formula: C37H35N2NaO6S2
Formula: #
Formula: C8H6N2OS2
Formula: C8H11N5NaO3
Formula: C23H15N3Na2O6S
Formula: C22H14N6Na2O9S2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C40H20CrN6Na3O14S2
Formula: #
Formula: C34H25K2N11O11S3
Formula: #
Formula: #
Formula: C34H26N10Na2O9S3
Formula: C36H23N5O6S2.2Na
Formula: C34H25N11Na2O11S3
Formula: #
Formula: C60H36Cr2N9Na3O21S3
Formula: #
Formula: C38H32CrN8O10S2.H
Formula: #
Formula: #
Formula: C22H14N6O9S2.C16H11N2O4S.3Na
Formula: C27H31N2NaO6S2
Formula: C47H39N2NaO6S2
Formula: C43H48N3NaO6S2
Formula: C32H21N5Na2O6S2
ACID BLUE 117 (C.I. 17055)
Formula: #
Formula: C38H31N4NaO3S
Formula: C37H30N3NaO4S
Formula: C33H23N5Na2O6S2
Formula: C41H26N4Na2O10S2
Formula: C41H26N4O10S2.2Na
Formula: C23H19N2NaO5S
Formula: C32H34N3NaO6S2
Formula: C32H36N2Na2O8S2
Formula: #
Formula: C47H39N2NaO6S2
Formula: C40H22CrN4Na2O10S2
Formula: C40H20CrN4O10S2.H.2Na
Formula: #
Formula: C40H40N2Na2O9S2
Formula: #
Formula: #
Formula: #
Formula: C24H21N2NaO5S
Formula: #
Formula: C20H13N2NaO5S
Formula: C20H14N2O5S.Na
Formula: C24H22N3NaO8S2
Formula: C22H14N6Na2O9S2
Formula: C54H62CaN4O14S4
Formula: #
Formula: C22H17N3O6S.Na
Formula: C23H18N3NaO6S
Formula: C14H9N2NaO7S
Formula: C22H17N2NaO5S
Formula: C20H19N2O5S.Na
Formula: C37H35N2O6S2.Na
Formula: C16H8N2Na2O8S2
Formula: #
Formula: C32H28N2O8S2.2Na
Formula: C45H44N3NaO7S2
Formula: C37H42N4O9S3
Formula: C37H34N2Na2O9S3
Formula: C47H48N3NaO7S2
Formula: C26H16N3O10S3.3Na
Formula: C37H27N3Na2O9S3
Formula: C41H38N5NaO6S2
Formula: C26H16N4Na2O8S2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C30H20N8O12S2.2Na
Formula: C16H12N3O4S.Na
Formula: #
Formula: C18H10FeN5NaO8S
Formula: #
Formula: C18H11CuN6NaO8S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C11H11BrN4O2
Formula: C20H17N3O9S3Ca
Formula: C30H15FeN3Na3O15S3
Formula: C36H29N9O12S3.3Na
Formula: C16H10CrN4O7S.Na
Formula: C37H34ClN2O6S2.Na
Formula: C22H16N6O7S2.2Na
Formula: C39H38ClN2NaO6S2
Formula: C28H20N2Na2O8S2
Formula: C34H32N2O8S2.2Na
Formula: C30H15FeN3Na3O15S3
Formula: C28H20N2Na2O10S2
Formula: C27H25N2NaO7S2
Formula: #
Formula: C37H34ClN2O6S2.Na
Formula: C16H10N3NaO7S
Formula: C14H7NO6
Formula: C20H16N4Na2O9S2
Formula: C16H10N2Na2O7S2
Formula: C24H19N4NaO4S
Formula: C21H19N4O5S.Na
ACID ORANGE 16 (C.I. 16011)
Formula: #
Formula: #
Formula: C23H19N3O6S2.Na
Formula: C16H11N2NaO4S
Formula: C20H17N4NaO5S
Formula: C18H13N4NaO7S
Formula: C34H30N4O8S2.2Na
Formula: C36H28N6O11S3.2Na
Formula: C32H22N6O8S2.2Na
Formula: C32H26CrN10O8S2.H
Formula: C26H22N4O8S2.Na
Formula: C16H11N2NaO4S
Formula: C16H11CrN5NaO8S
Formula: C17H13N2NaO4S
Formula: C18H13N3Na2O8S2
Formula: C23H17N3O9S3.2Na
Formula: C37H28N4Na2O10S3
Formula: C37H28N4O10S3.2Na
Formula: C24H18N4Na2O7S2
Formula: C25H24N4O6S2
Formula: C25H24N4O6S2
Formula: C31H25N5Na2O6S2
Formula: C37H28N4Na2O12S3
Formula: C20H12N2O7S2.2Na
Formula: C40H34N4Na2O12S2
Formula: C30H37N3O8S2.2Na
Formula: C22H16N4O7S2
Formula: C37H27N4Na3O13S4
Formula: C22H14N4Na2O7S2
Formula: C22H15N4O4S.Na
Formula: C40H34N4Na2O10S2
Formula: C30H22ClN3Na2O10S3
Formula: C20H11N2Na3O10S3
Formula: C32H22CoN6O8S2.H
Formula: C16H10ClCrN4O9S2.2Na
Formula: C16H9CrN3NaO8S
Formula: C20H12CrN4NaO8S2
Formula: #
Formula: #
Formula: C18H14N2Na2O7S2
Formula: C24H19N3Na2O10S3
Formula: C24H19N3Na2O9S3
Formula: C17H10ClF3N3O4S.Na
Formula: C20H11N2Na3O10S3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C17H11F3N3O4S.Na
Formula: C19H15N3O8S2.2Na
Formula: #
Formula: C38H29N4O11S3.3Na
Formula: C17H14N2O5S.Na
Formula: C36H22CrN9Na2O9S
Formula: #
Formula: #
Formula: C22H16N3O6S2.Na
Formula: #
Formula: C25H25N2O7S2.Na
Formula: C20H6I4Na2O5
Formula: C24H22N4O6S2
Formula: C20H14N2O11S3
Formula: C22H14N4Na2O7S2
Formula: C22H14N4Na2O7S2
Formula: C18H14N2Na2O7S2
Formula: C24H17N2NaO5S
Formula: C35H24N4Na2O10S3
Formula: C20H8Br4O5
Formula: C20H6Br4Na2O5
Formula: C20H13N2O4S.Na
Formula: C20H13N2NaO4S
Formula: C20H2Br4Cl4Na2O5
Formula: C20H2Cl4I4Na2O5
Formula: C32H20N4O8S2.2Na
Formula: C18H14N2Na2O7S2
Formula: C16H10N4Na2O9S2
Formula: C41H44N3NaO6S2
Formula: C20H17N3Na2O9S3
Formula: C28H20N2Na2O8S2
Formula: C21H14NNaO6S
Formula: C37H38N2Na2O9S2
Formula: C39H40N3NaO6S2
Formula: C29H22N4O7S2.Na
Formula: #
Formula: C32H34N3NaO7S2
Formula: C20H16N4Na2O9S2
ACID VIOLET 78 (C.I. 12205)
Formula: #
Formula: C34H25N2NaO6S
Formula: C40H27CrN8Na2O10S2
Formula: #
Formula: #
Formula: C16H13N4O4S.Na
Formula: C39H30N8O8S2.2Na
Formula: C26H20Cl2N9NaO4S
Formula: C16H16N4O5S
Formula: #
Formula: C32H28CoN8O10S2.2H
Formula: #
Formula: C34H25CrN8O6
Formula: C16H10Cl2N4Na2O7S2
Formula: C19H15N4NaO6S
Formula: C19H15N4O6S.Na
Formula: C46H32Cl2CoN8Na4O14S2
Formula: C46H32Cl2CoN8Na4O14S2
Formula: C16H9N4Na3O9S2
Formula: C22H17ClN5NaO6S2
Formula: C18H15N3O3S.Na
Formula: C23H18ClN4NaO7S2
Formula: C32H24N8Na2O8S2
Formula: C34H30N6Na2O10S2
Formula: C16H13Cl2N5O3S
Formula: C18H13CrN4Na2O10S2
Formula: C41H32Cl2N8Na2O8S2
Formula: C24H20Cl2N5NaO6S2
Formula: #
Formula: C25H19N4NaO8S2
Formula: C36H28ClN6NaO7S2
Formula: C16H12CrN4NaO9S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H11O8
Formula: C14H6ClF3NNaO5
Formula: C14H7ClF3NO5
Formula: C6H6N2O3
Formula: C9H7N5O3
Formula: C21H26O3
Formula: C5H7ClN2O3
Formula: #
Formula: C42H54ClNO15
Formula: C42H53NO15
Formula: C30H44N2O14S2
Formula: C26H30NO4S2.Br
Formula: C12H9ClN2O3
Formula: C28H38O7
Formula: C7H14O5
Formula: #
Formula: C5H4O4
Formula: #
Formula: C34H47NO12
Formula: C25H41NO9
Formula: C34H47NO8
Formula: C34H48N2O9
Formula: C22H35NO4
Formula: C26H39NO6
Formula: C35H49NO8
Formula: C34H47NO11
Formula: C34H47NO11
Formula: #
Formula: C15H26O
Formula: #
Formula: C15H24O2
Formula: C15H22O2
Formula: C6H13NO3
Formula: C21H30N4O5S.HCL
Formula: C30H46O9
Formula: C23H28N2O3
Formula: #
Formula: C23H37NO
Formula: C8H11NO6
Formula: C8H11NO6
Formula: #
Formula: C20H22ClN3O.2(HCl)
Formula: C13H10N2
Formula: #
Formula: C13H10N2
Formula: C13H10N2.HCl
Formula: C18H23Cl2N3
Formula: C13H8N4
Formula: C14H11NO
Formula: #
Formula: C13H9N.HCl
Formula: C26H38N3.Br
Formula: C60H67Cl3N10O4
Formula: C63H82Cl10N10O3
Formula: C15H15N
Formula: C13H11N3
Formula: C13H11N3
Formula: C13H11N3
Formula: C13H11N3
Formula: C13H11N3
Formula: C14H9NO2
Formula: C65H76ClN8O8S2
Formula: C13H9NO2
Formula: C13H11N3
Formula: C15H7NO4
Formula: #
Formula: C14H11N3O
Formula: C14H10N2O
Formula: C14H9NO2
Formula: C17H17N3O
Formula: C20H23N3O
Formula: C13H9N
Formula: #
Formula: C29H23F3N2O9S
Formula: C25H42Cl5N5
Formula: C13H9P
Formula: C24H24N2
Formula: C27H25ClN6.3(HCl)
Formula: C27H25ClN6
Formula: C16H23NO2
Formula: C29H38O7
Formula: #
Formula: C22H24N2O2
Formula: C7H14O2
Formula: C5H10O2
Formula: C3H4O
Formula: #
ACRONYCINE;COMPOUND 42339; NCI-C 01536; NSC 403169
Formula: C20H19NO3
Formula: C19H23ClO7
Formula: #
Formula: #
Formula: (C5H8O2?C3H5NO?C3H4O2?C3H3N)x
Formula: C10H9N3O
Formula: C12H23ClN2O3
Formula: C3H2D3NO
Formula: C3D5NO
Formula: #
Formula: C11H22N2O7S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C3H7NO2
Formula: #
Formula: C15H20O2
Formula: C10H16O2
Formula: C9H14O2
Formula: #
Formula: #
Formula: #
Formula: C30H38O6
Formula: C3H4O2
Formula: C8H14O2
Formula: (C4H4O4)n.(C3H4O2)n
Formula: C7H7NO4
Formula: #
Formula: C23H12F33NO4S
Formula: C4H4N2OS2
Formula: C6H6NiO4
Formula: C12H16O8Sn
Formula: C3D4O2
Formula: ((C6H10O3).(C3H4O2))x
Formula: (C4H2O3)m.(C3H4O2)n
Formula: #
Formula: #
Formula: C6H6O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: (C3H3N)x
Formula: C11H8N4
Formula: C10H6N2S2
Formula: C10H13NO2
Formula: (C3H3N?C2H3Cl?C2H2Cl2)x
Formula: #
Formula: C3H3N
Formula: C11H11FO
Formula: C10H10FO
Formula: C11H11FO
Formula: C10H9FO
Formula: #
Formula: C21H18O2Sn
Formula: C8H16NO2.Cl
Formula: #
Formula: C3H3ClO
Formula: #
Formula: #
Formula: C10H11NO3
Formula: C37H56O11
ACTH (1-10)
Formula: C59H78N16O16S
ACTH (1-13)
Formula: C75H106N20O19S
ACTH (1-14)
Formula: #
ACTH (1-16)
Formula: C89H133N25O22S
Formula: #
ACTH (17-39)
Formula: #
ACTH (25-39)
Formula: #
ACTH (5-10)
Formula: #
ACTH (5-24)
Formula: #
ACTH (6-24)
Formula: #
ACTH (6-9)
Formula: #
Formula: #
Formula: C89H134N26O21S
Formula: #
Formula: C15H23NO4
Formula: C29H39Cl2N3O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C30H46O5
Formula: C10H13N
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C180H236N56O84P10
Formula: C62H86N12O16
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C28H26N2O10
Formula: C28H25NO10
Formula: C14H24N2O7.H2SO4
Formula: #
Formula: C23H35N3O
Formula: C
Formula: C91H130N22O23
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C51H85N7O16
Formula: C16H18O5
Formula: #
Formula: #
Formula: C18H22Cl NO6
Formula: C19H24ClNO6
Formula: C8H12N5O6P
Formula: C8H11N5O3
Formula: C8H11N5O3
Formula: C47H74N12O16
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C80H102ClN15O14
Formula: C16H21NO3S
Formula: C10H15Cl2NO2
Formula: C20H26ClNO3
Formula: C6428H9912N1694O1987S46
Formula: C16H27NO8
Formula: C18H25NO
Formula: C18H25NO
Formula: #
Formula: C12H19NO
Formula: C10H14N2
Formula: C12H14N2
Formula: C12H18N2O2
Formula: C12H22N2
Formula: C11H18N2O
Formula: C11H17NO
Formula: C11H19ClN2
Formula: C12H18O2
Formula: C11H16O2
Formula: #
Formula: C11HD15O2
Formula: C10H16
Formula: C11H19N3S
Formula: #
Formula: C12H19Cl3Si
Formula: C28H28O3
Formula: #
Formula: #
Formula: #
Formula: C25H26O3
Formula: C20H32N5O8P
Formula: C14H22N5O6P
Formula: C8H12N5O4P
Formula: #
Formula: #
Formula: C13H26N2O4
Formula: 2(C15H23N6O5S).2(C4H10O6S2).C4H8O6S2
Formula: C15H22N6O5S.2(H2SO4).C7H8SO3
Formula: #
Formula: C26H34O9
Formula: C5H5N5.HCl
Formula: 2(C5H5N5).2(HCl).H2O
Formula: C5H5N5O
Formula: C5H5N5.H3PO4
Formula: C5H8N5O4P
Formula: 2(C5H5N5).H2SO4
Formula: #
Formula: C5H4KN5
Formula: C5H4N5Na
Formula: C5H4DN5
Formula: C5H5N5O
Formula: C5H5N5
Formula: C69H96CoN18O14P
Formula: C21H24N8O5
Formula: C10H11N5O6P.Na
Formula: #
Formula: C10H14N5O12P3
Formula: C10H13N5Na2O10P2
Formula: C17H16N6NaO7P
Formula: C12H17N6O5P
Formula: C10H11N5O6P.Na
Formula: C10H11Li4N5O13P2S
Formula: C10H11Li4N5O13P2S
Formula: #
Formula: C14H23N6O9P
Formula: C18H23N6O14P3
Formula: C17H21N6O14P3
Formula: 2(C10H12N5O10P2).3Ba
Formula: C10H15N5O10P2.2(C6H13N)
Formula: C10H14N5O10P2.K.2(H2O)
Formula: C10H12Li4N5O12P3S
Formula: C21H26LiN7O14P2
Formula: C10H15N5O10P2
Formula: C11H18N5O12P3
Formula: C11H18N5O13P3
Formula: #
Formula: C10H13N5O10P2
Formula: C10H14N5NaO10P2
Formula: C17H27N5O16P2
Formula: C16H28N6O15P2
Formula: #
Formula: C15H22N5O14P2.Na
Formula: C10H12N5Na2O7P
Formula: C10H14N5O7P.H2O
Formula: C10H14N5O7P
Formula: C31H52N9O8P
Formula: C10H14N6NaO6P
Formula: C10H15N5O9P2S
Formula: C10H16N5O12P3S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H14K2N5O13P3
Formula: C10H12N5O13P3
Formula: C10H14N5Na2O13P3
Formula: C10H14N5Na2O13P3
Formula: C10H14MgN5O13P3
Formula: C10H18N5O13P3
Formula: C10H16N5O13P3
Formula: C10H15N6O7P
Formula: C13H16N5O8P
Formula: #
Formula: C20H32N10O31P8
Formula: C13H22ClN6O12P3
Formula: C20H23N6O15P3S
Formula: C10H16N5O13P3
Formula: C18H18N6NaO7P
Formula: C18H19N6O8P
Formula: #
Formula: C10H13N5Na3O13P3
Formula: C10H12N5Na3O10P2
Formula: C10H11N5NaO5PS
Formula: C10H13N5NaO6P
Formula: C10H26N9O13P3T2
Formula: C10H11T2N5O4
Formula: C10H12DN5O4
Formula: C10H16N5O8P
Formula: C16H17FN5O9PS
Formula: C10H11N5O5
Formula: C10H13N5Na2O10P2
Formula: C10H12Li3N5O10P2
Formula: C16H23N5Na2O15P2
Formula: C10H16N5O12P3S
Formula: C10H14N5O12P3
Formula: C10H11N5O6PT
Formula: C10H24N8O10P2
Formula: C9H18N7O7P
Formula: #
Formula: C10H13N5O4
Formula: C18H23N6O15P3
Formula: C10H14ClN5O4
Formula: C72H101CoN18O20P2
Formula: C59H85CoN16O14P
Formula: C15H22N6O5S.C4H10O6S2
Formula: C20H26N10O12P2S
Formula: C10H14N5O7P
Formula: C14H17N5NaO11P
Formula: C30H39N17O14P2
Formula: C10H16N5O14P3
Formula: C10H16N6O9P22NH3
Formula: C31H55N12O19P
Formula: #
Formula: C19H25N8O11P
Formula: C19H24N7O12P
Formula: C20H25N10O10P
Formula: #
Formula: C19H25N7O15P2
Formula: C30H37N15O16P2
Formula: C20H25N10O10P.xH3N
Formula: C40H49N20O22P3
Formula: C20H25N10O11P
Formula: C18H24N9O11P
Formula: C30H40N15O25P5
Formula: C10H13Li4N6O12P3
Formula: #
Formula: #
Formula: C20H25Cl2NO2
Formula: C21H28N4O5
Formula: C13H25N8O13P3S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H10O2
Formula: C6H12N2O2
Formula: C29H48O2
Formula: C20H25NO2
Formula: C20H25NO2.HCl
Formula: #
Formula: #
Formula: C34H60O11
Formula: C13H16O4
Formula: #
ADIPIC ACID, [1,6-14C]
Formula: C6H10O4
Formula: C12H26N2O4
Formula: C25H40N2O12
Formula: C13H28ClN3O5
Formula: #
Formula: C28H44O12
Formula: #
Formula: #
Formula: C26H38O15
Formula: #
Formula: #
Formula: C18H39ClN4O6
Formula: #
Formula: #
Formula: #
Formula: C6H10O4
Formula: C18H20N2O2
Formula: C6H14N4O2
Formula: C6H10O4
Formula: C6H2D8O4
Formula: #
Formula: #
Formula: C6H9NO2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H8Cl2O2
Formula: C6Cl2D8O2
Formula: #
Formula: C24H28N2O3.HCl
Formula: #
Formula: C9H10ClN5O2
Formula: #
Formula: #
Formula: C5H12O5
Formula: C24H24FN3O2
Formula: C30H22N4O4
Formula: C21H35N9O15P2
Formula: #
Formula: C18H28N6O15P2S
Formula: #
Formula: #
Formula: #
Formula: C15H15NO3S
Formula: C9H11NO3.HCl
Formula: C9H11NO3
Formula: C22H36O2
Formula: C9H9NO3
Formula: C11H15N5O5S
Formula: #
Formula: C272H422N80O70P2S2Zn3
Formula: #
Formula: C9H9NO3
Formula: C44H69N15O9S
Formula: C19H24O3
Formula: #
Formula: C27H29NO11
Formula: C27H31NO11
Formula: #
Formula: #
Formula: #
Formula: C28H31N5O
Formula: C20H17F2N3O2
Formula: C42H64O17
Formula: C30H44O7
Formula: C22H38NO5P
Formula: C10H8N4O2S2
Formula: C18H19NO3
Formula: C15H24O4
Formula: C11H18O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C30H48O5
Formula: C55H86O24
Formula: C55H86O24
Formula: C48H78O22
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C24H25ClFN5O3
Formula: C17H10Cl2O6
Formula: #
Formula: C20H24N2O2
Formula: C20H24N2O
Formula: C26H29NO2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H15NO8
Formula: C22H19N5O9
Formula: #
Formula: C17H12O7
Formula: C16H10O6