Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemspace




Country: USA

Chemspace US Office
7 Deer Park Drive, Suite M-5
Monmouth Junction, NJ 08852, USA


Phone: +1 (732) 917 0158
Phone 2: +371 (270) 60 007
FAX: +1 (844) 646 2007
E-Mail:E-Mail this Supplier


https://chem-space.com

Chemspace

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 |
 


Product List

1H-1,3-BENZODIAZOL-5-AMINE HYDROCHLORIDE
CAS:1772-40-3
Cl.Nc1ccc2[nH]cnc2c1
BBV-41698031
1H-1,3-BENZODIAZOL-5-YLMETHANAMINE DIHYDROCHLORIDE
CAS:267874-51-1
Cl.Cl.NCc1ccc2[nH]cnc2c1
BBV-32142787
1H-1,3-BENZODIAZOL-5-YLMETHANAMINE HYDROCHLORIDE
CAS:779353-78-5
Cl.NCc1ccc2[nH]cnc2c1
BBV-72350662
1H-1,3-BENZODIAZOL-6-YLMETHANAMINE
CAS:164648-60-6
NCc1ccc2nc[nH]c2c1
BBV-53036282
1H-1,3-BENZODIAZOLE-5-CARBALDEHYDE
CAS:58442-17-4
O=Cc1ccc2[nH]cnc2c1
BBV-38357852
1H-IMIDAZO[4,5-B]PYRIDIN-2-AMINE
CAS:132898-03-4
Nc1nc2ncccc2[nH]1
BBV-42339947
1H-IMIDAZO[4,5-B]PYRIDINE
CAS:273-21-2
c1nc2ncccc2[nH]1
BBV-535817
1H-IMIDAZOL-2-YLMETHANAMINE
CAS:53332-80-2
NCc1ncc[nH]1
BBV-27140797
1H-IMIDAZOL-2-YLMETHANAMINE DIHYDROCHLORIDE
CAS:22600-77-7
Cl.Cl.NCc1ncc[nH]1
BBV-51260537
1H-IMIDAZOL-2-YLMETHANOL
CAS:3724-26-3
OCc1ncc[nH]1
BBV-32811638
1H-IMIDAZOL-4-AMINE HYDROCHLORIDE
CAS:1261268-96-5
Cl.Nc1c[nH]cn1
BBV-57275880
1H-IMIDAZOL-4-YLMETHANAMINE DIHYDROCHLORIDE
CAS:72631-80-2
Cl.Cl.NCc1c[nH]cn1
BBV-47479419
1H-IMIDAZOL-5-AMINE
CAS:4919-03-3
Nc1cnc[nH]1
BBV-38372682
1H-IMIDAZOL-5-AMINE DIHYDROCHLORIDE
CAS:111005-19-7
Cl.Cl.Nc1cnc[nH]1
BBV-40272210
1H-IMIDAZOLE-2-SULFONYL CHLORIDE
CAS:281221-70-3
ClS(=O)(=O)c1ncc[nH]1
BBV-38392084
1H-IMIDAZOLE-2-SULFONYL CHLORIDE HYDROCHLORIDE
CAS:877861-76-2
Cl.ClS(=O)(=O)c1ncc[nH]1
BBV-38364958
1H-INDAZOL-4-AMINE
CAS:41748-71-4
Nc1cccc2[nH]ncc12
BBV-2159546
1H-INDAZOL-5-OL
CAS:15579-15-4
Oc1ccc2[nH]ncc2c1
BBV-39696810
1H-INDAZOLE-3-CARBOHYDRAZIDE
CAS:59591-84-3
NNC(=O)c1n[nH]c2ccccc12
BBV-92665791
1H-INDAZOLE-5-CARBALDEHYDE
CAS:253801-04-6
O=Cc1ccc2[nH]ncc2c1
BBV-38271890
1H-INDAZOLE-6-CARBOXAMIDE
CAS:906000-44-0
NC(=O)c1ccc2cn[nH]c2c1
BBV-36754838
1H-INDAZOLE-6-CARBOXYLIC ACID
CAS:704-91-6
OC(=O)c1ccc2cn[nH]c2c1
BBV-2156808
1H-INDOL-3-AMINE
CAS:7250-19-3
Nc1c[nH]c2ccccc12
BBV-108658613
1H-INDOL-3-YLMETHANAMINE
CAS:22259-53-6
NCc1c[nH]c2ccccc12
BBV-33901638
1H-INDOL-3-YLMETHANAMINE HYDROCHLORIDE
CAS:1266692-14-1
Cl.NCc1c[nH]c2ccccc12
BBV-39961876
1H-INDOL-3-YLMETHANOL
CAS:700-06-1
OCc1c[nH]c2ccccc12
BBV-34551189
1H-INDOL-4-YLMETHANAMINE
CAS:3468-18-6
NCc1cccc2[nH]ccc12
BBV-108672066
1H-INDOL-5-YLMETHANOL
CAS:1075-25-8
OCc1ccc2[nH]ccc2c1
BBV-38356797
1H-INDOL-7-YLMETHANAMINE
CAS:408356-52-5
NCc1cccc2cc[nH]c12
BBV-38272836
1H-INDOL-7-YLMETHANAMINE HYDROCHLORIDE
CAS:1797558-60-1
Cl.NCc1cccc2cc[nH]c12
BBV-60236587
1H-INDOL-7-YLMETHANAMINE; OXALIC ACID
CAS:1187928-34-2
OC(=O)C(O)=O.NCc1cccc2cc[nH]c12
BBV-71469662
1H-INDOLE-3-CARBONYL CHLORIDE
CAS:59496-25-2
ClC(=O)c1c[nH]c2ccccc12
BBV-38310588
1H-INDOLE-3-SULFONYL CHLORIDE
CAS:886578-15-0
ClS(=O)(=O)c1c[nH]c2ccccc12
BBV-38366381
1H-INDOLE-5-SULFONAMIDE
CAS:3074-27-9
NS(=O)(=O)c1ccc2[nH]ccc2c1
BBV-39777183
1H-PYRAZOL-1-OL
CAS:81945-73-5
On1cccn1
BBV-38335011
1H-PYRAZOL-3-YLMETHANOL HYDROCHLORIDE
CAS:270920-41-7
Cl.OCc1cc[nH]n1
BBV-39961875
1H-PYRAZOL-4-YLMETHANAMINE
CAS:37599-59-0
NCc1cn[nH]c1
BBV-079449
1H-PYRAZOL-4-YLMETHANAMINE DIHYDROCHLORIDE
CAS:1172862-88-2
Cl.Cl.NCc1cn[nH]c1
BBV-50279510
1H-PYRAZOL-4-YLMETHANOL
CAS:25222-43-9
OCc1cn[nH]c1
BBV-34702519
1H-PYRAZOL-5-YLMETHANOL
CAS:23585-49-1
OCc1ccn[nH]1
BBV-528930
1H-PYRAZOLE-3,5-DIAMINE
CAS:16082-33-0
Nc1cc(N)[nH]n1
BBV-32614178
1H-PYRAZOLE-4-CARBALDEHYDE
CAS:35344-95-7
O=Cc1cn[nH]c1
BBV-078589
1H-PYRAZOLE-4-CARBALDEHYDE HYDROCHLORIDE
CAS:1197230-88-8
Cl.O=Cc1cn[nH]c1
BBV-592277
1H-PYRAZOLE-4-CARBOHYDRAZIDE
CAS:87551-45-9
NNC(=O)c1cn[nH]c1
BBV-25193148
1H-PYRAZOLE-4-CARBONITRILE
CAS:31108-57-3
N#Cc1cn[nH]c1
BBV-36855823
1H-PYRAZOLE-4-CARBONITRILE HYDROCHLORIDE
CAS:1416351-94-4
Cl.N#Cc1cn[nH]c1
BBV-42361770
1H-PYRAZOLE-4-CARBOXAMIDE
CAS:437701-80-9
NC(=O)c1cn[nH]c1
BBV-25193178
1H-PYRAZOLE-4-CARBOXYLIC ACID
CAS:37718-11-9
OC(=O)c1cn[nH]c1
BBV-059910
1H-PYRAZOLE-4-CARBOXYLIC ACID HYDRATE
CAS:1209620-58-5
O.OC(=O)c1cn[nH]c1
BBV-462113
1H-PYRAZOLE-4-SULFONOHYDRAZIDE
CAS:1183491-92-0
NNS(=O)(=O)c1cn[nH]c1
BBV-32115568
1H-PYRAZOLE-4-SULFONYL CHLORIDE
CAS:438630-64-9
ClS(=O)(=O)c1cn[nH]c1
BBV-213328
1H-PYRAZOLE-5-CARBOXYLIC ACID
CAS:1621-91-6
OC(=O)c1ccn[nH]1
BBV-083675
1H-PYRAZOLO[3,4-B]PYRIDIN-5-AMINE
CAS:942185-01-5
Nc1cnc2[nH]ncc2c1
BBV-38319258
1H-PYRAZOLO[3,4-B]PYRIDIN-5-AMINE HYDROCHLORIDE
CAS:1431970-26-1
Cl.Nc1cnc2[nH]ncc2c1
BBV-41325960
1H-PYRAZOLO[3,4-B]PYRIDINE
CAS:271-73-8
c1n[nH]c2ncccc12
BBV-38271150
1H-PYRAZOLO[3,4-C]PYRIDIN-3-AMINE
CAS:76006-17-2
Nc1n[nH]c2cnccc12
BBV-38377293
1H-PYRROL-2-YLMETHANAMINE
CAS:64608-72-6
NCc1ccc[nH]1
BBV-33914721
1H-PYRROL-2-YLMETHANOL
CAS:27472-36-2
OCc1ccc[nH]1
BBV-38425166
1H-PYRROL-3-YLMETHANAMINE
CAS:888473-50-5
NCc1cc[nH]c1
BBV-077074
1H-PYRROL-3-YLMETHANAMINE HYDROCHLORIDE
CAS:1955498-33-5
Cl.NCc1cc[nH]c1
BBV-60219167
1H-PYRROLE-2,5-DICARBOXAMIDE
CAS:719278-42-9
NC(=O)c1ccc([nH]1)C(N)=O
BBV-38721594
1H-PYRROLO[2,3-B]PYRIDIN-3-YLMETHANOL
CAS:1065100-83-5
OCc1c[nH]c2ncccc12
BBV-108664798
1H-PYRROLO[2,3-B]PYRIDIN-5-OL
CAS:98549-88-3
Oc1cnc2[nH]ccc2c1
BBV-38295471
1H-PYRROLO[2,3-B]PYRIDIN-6-AMINE
CAS:145901-11-7
Nc1ccc2cc[nH]c2n1
BBV-38295461
1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID HYDROCHLORIDE
CAS:913181-73-4
Cl.OC(=O)c1cc2cccnc2[nH]1
BBV-38716423
1H-PYRROLO[2,3-B]PYRIDINE-3-CARBALDEHYDE
CAS:4649-09-6
O=Cc1c[nH]c2ncccc12
BBV-450715
1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXYLIC ACID
CAS:156270-06-3
OC(=O)c1c[nH]c2ncccc12
BBV-38785629
1H-PYRROLO[2,3-B]PYRIDINE-4-CARBONITRILE
CAS:344327-11-3
N#Cc1ccnc2[nH]ccc12
BBV-38271984
1H-PYRROLO[2,3-B]PYRIDINE-5-CARBOXYLIC ACID
CAS:754214-42-1
OC(=O)c1cnc2[nH]ccc2c1
BBV-38295470
1H-PYRROLO[2,3-B]PYRIDINE-6-CARBONITRILE
CAS:189882-33-5
N#Cc1ccc2cc[nH]c2n1
BBV-38289615
1H-PYRROLO[2,3-C]PYRIDIN-7-AMINE
CAS:165669-36-3
Nc1nccc2cc[nH]c12
BBV-38310801
1H-PYRROLO[3,2-B]PYRIDINE-3-CARBOXYLIC ACID
CAS:860496-20-4
OC(=O)c1c[nH]c2cccnc12
BBV-265860
1H-PYRROLO[3,2-B]PYRIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:860363-17-3
Cl.OC(=O)c1c[nH]c2cccnc12
BBV-42973419
1H-PYRROLO[3,2-C]PYRIDINE-4-CARBONITRILE
CAS:1040682-68-5
N#Cc1nccc2[nH]ccc12
BBV-38315667
1H-PYRROLO[3,2-C]PYRIDINE-4-CARBOXYLIC ACID
CAS:1040682-84-5
OC(=O)c1nccc2[nH]ccc12
BBV-38315668
1H-PYRROLO[3,2-C]PYRIDINE-4-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1864063-95-5
Cl.OC(=O)c1nccc2[nH]ccc12
BBV-27262261
2',3'-DIHYDROSPIRO[CYCLOPROPANE-1,1'-INDENE]-3-AMINE
CAS:1250204-62-6
NC1CC11CCc2ccccc12
BBV-34216793
2',3'-DIHYDROSPIRO[CYCLOPROPANE-1,1'-INDENE]-3-AMINE HYDROCHLORIDE
CAS:1423030-97-0
Cl.NC1CC11CCc2ccccc12
BBV-40434499
2,1,3-BENZOTHIADIAZOL-4-AMINE
CAS:767-64-6
Nc1cccc2nsnc12
BBV-181826
2,1,3-BENZOTHIADIAZOLE-4-CARBALDEHYDE
CAS:5170-68-3
O=Cc1cccc2nsnc12
BBV-108673156
2,1,3-BENZOTHIADIAZOLE-5-CARBOXYLIC ACID
CAS:16405-98-4
OC(=O)c1ccc2nsnc2c1
BBV-183400
2,1,3-BENZOXADIAZOL-4-AMINE
CAS:767-63-5
Nc1cccc2nonc12
BBV-181975
2,1-BENZOTHIAZOL-3-AMINE
CAS:2400-12-6
Nc1snc2ccccc12
BBV-38282800
2,2,2-TRIFLUORO-1-(1-METHYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE
CAS:1152551-09-1
Cn1cc(cn1)C(N)C(F)(F)F
BBV-2091246
2,2,2-TRIFLUORO-1-(1H-PYRAZOL-4-YL)ETHAN-1-ONE
CAS:161957-47-7
FC(F)(F)C(=O)c1cn[nH]c1
BBV-37844582
2,2,2-TRIFLUORO-1-(1H-PYRROL-2-YL)ETHAN-1-OL
CAS:151509-97-6
OC(c1ccc[nH]1)C(F)(F)F
BBV-37829846
2,2,2-TRIFLUORO-1-(2,4,6-TRIFLUOROPHENYL)ETHAN-1-AMINE
CAS:1020946-05-7
NC(c1c(F)cc(F)cc1F)C(F)(F)F
BBV-141775
2,2,2-TRIFLUORO-1-(2,4,6-TRIFLUOROPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1461713-55-2
Cl.NC(c1c(F)cc(F)cc1F)C(F)(F)F
BBV-57278316
2,2,2-TRIFLUORO-1-(3,4,5-TRIMETHOXYPHENYL)ETHAN-1-AMINE
CAS:1270493-51-0
COc1cc(cc(OC)c1OC)C(N)C(F)(F)F
BBV-38102708
2,2,2-TRIFLUORO-1-(3,4,5-TRIMETHOXYPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1443981-73-4
Cl.COc1cc(cc(OC)c1OC)C(N)C(F)(F)F
BBV-57278118
2,2,2-TRIFLUORO-1-(3-FLUORO-4-METHOXYPHENYL)ETHAN-1-AMINE
CAS:886371-56-8
COc1ccc(cc1F)C(N)C(F)(F)F
BBV-24676240
2,2,2-TRIFLUORO-1-(3-FLUORO-4-METHOXYPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1803606-55-4
Cl.COc1ccc(cc1F)C(N)C(F)(F)F
BBV-55270891
2,2,2-TRIFLUORO-1-(4-FLUOROPHENYL)ETHAN-1-AMINE
CAS:852443-99-3
NC(c1ccc(F)cc1)C(F)(F)F
BBV-067278
2,2,2-TRIFLUORO-1-(4-FLUOROPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1184980-60-6
Cl.NC(c1ccc(F)cc1)C(F)(F)F
BBV-39991652
2,2,2-TRIFLUORO-1-(4-FLUOROPHENYL)ETHAN-1-ONE
CAS:655-32-3
Fc1ccc(cc1)C(=O)C(F)(F)F
BBV-36751067
2,2,2-TRIFLUORO-1-(4-METHOXYPHENYL)ETHAN-1-AMINE
CAS:179996-42-0
COc1ccc(cc1)C(N)C(F)(F)F
BBV-075396
2,2,2-TRIFLUORO-1-(4-PHENYLPHENYL)ETHAN-1-AMINE
CAS:886370-48-5
NC(c1ccc(cc1)-c1ccccc1)C(F)(F)F
BBV-139865
2,2,2-TRIFLUORO-1-(6-METHYLPYRIDIN-3-YL)ETHAN-1-ONE
CAS:1060806-27-0
Cc1ccc(cn1)C(=O)C(F)(F)F
BBV-36983040
2,2,2-TRIFLUORO-1-(NAPHTHALEN-1-YL)ETHAN-1-AMINE
CAS:326594-18-7
NC(c1cccc2ccccc12)C(F)(F)F
BBV-38078671
2,2,2-TRIFLUORO-1-(NAPHTHALEN-1-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1443979-86-9
Cl.NC(c1cccc2ccccc12)C(F)(F)F
BBV-55106863
2,2,2-TRIFLUORO-1-(NAPHTHALEN-2-YL)ETHAN-1-OL
CAS:1645-50-7
OC(c1ccc2ccccc2c1)C(F)(F)F
BBV-33310590
2,2,2-TRIFLUORO-1-(OXAN-3-YL)ETHAN-1-AMINE
CAS:1339332-84-1
NC(C1CCCOC1)C(F)(F)F
BBV-38078717
2,2,2-TRIFLUORO-1-(OXAN-3-YL)ETHAN-1-OL
CAS:1342709-61-8
OC(C1CCCOC1)C(F)(F)F
BBV-33912257
2,2,2-TRIFLUORO-1-(OXAN-4-YL)ETHAN-1-AMINE
CAS:1339566-44-7
NC(C1CCOCC1)C(F)(F)F
BBV-38078680
2,2,2-TRIFLUORO-1-(OXOLAN-3-YL)ETHAN-1-ONE
CAS:1339862-66-6
FC(F)(F)C(=O)C1CCOC1
BBV-37618781
2,2,2-TRIFLUORO-1-(PIPERIDIN-4-YL)ETHAN-1-ONE
CAS:866929-67-1
FC(F)(F)C(=O)C1CCNCC1
BBV-38327558
2,2,2-TRIFLUORO-1-(PIPERIDIN-4-YL)ETHAN-1-ONE HYDROCHLORIDE
CAS:1372103-92-8
Cl.FC(F)(F)C(=O)C1CCNCC1
BBV-40456193
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHAN-1-OL
CAS:138624-99-4
OC(c1cccnc1)C(F)(F)F
BBV-33310644
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHAN-1-ONE
CAS:33284-21-8
FC(F)(F)C(=O)c1cccnc1
BBV-36758273
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHANE-1,1-DIOL
CAS:33284-19-4
OC(O)(c1cccnc1)C(F)(F)F
BBV-39729971
2,2,2-TRIFLUORO-1-(PYRIDIN-4-YL)ETHAN-1-OL
CAS:394203-58-8
OC(c1ccncc1)C(F)(F)F
BBV-39775200
2,2,2-TRIFLUORO-1-(PYRIMIDIN-5-YL)ETHAN-1-ONE
CAS:1342264-46-3
FC(F)(F)C(=O)c1cncnc1
BBV-36758293
2,2,2-TRIFLUORO-1-[2-(TRIFLUOROMETHYL)PHENYL]ETHAN-1-AMINE
CAS:1211507-43-5
NC(c1ccccc1C(F)(F)F)C(F)(F)F
BBV-38078732
2,2,2-TRIFLUORO-1-[2-(TRIFLUOROMETHYL)PHENYL]ETHAN-1-AMINE HYDROCHLORIDE
CAS:1443981-34-7
Cl.NC(c1ccccc1C(F)(F)F)C(F)(F)F
BBV-57278171
2,2,2-TRIFLUORO-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHAN-1-AMINE
CAS:65686-68-2
NC(c1cccc(c1)C(F)(F)F)C(F)(F)F
BBV-140271
2,2,2-TRIFLUORO-1-[3-(TRIFLUOROMETHYL)PHENYL]ETHAN-1-AMINE HYDROCHLORIDE
CAS:1228879-03-5
Cl.NC(c1cccc(c1)C(F)(F)F)C(F)(F)F
BBV-32182511
2,2,2-TRIFLUORO-1-[4-(TRIFLUOROMETHOXY)PHENYL]ETHAN-1-AMINE
CAS:1270479-61-2
NC(c1ccc(OC(F)(F)F)cc1)C(F)(F)F
BBV-38102715
2,2,2-TRIFLUORO-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHAN-1-OL
CAS:150698-81-0
OC(c1ccc(cc1)C(F)(F)F)C(F)(F)F
BBV-33310613
2,2,2-TRIFLUORO-1-PHENYLETHAN-1-AMINE
CAS:51586-24-4
NC(c1ccccc1)C(F)(F)F
BBV-070382
2,2,2-TRIFLUORO-1-PHENYLETHAN-1-AMINE HYDROCHLORIDE
CAS:13652-09-0
Cl.NC(c1ccccc1)C(F)(F)F
BBV-57273504
2,2,2-TRIFLUORO-N-(2-IODOPHENYL)ACETAMIDE
CAS:143321-89-5
FC(F)(F)C(=O)Nc1ccccc1I
BBV-32804424
2,2,2-TRIFLUORO-N-(3-IODOPHENYL)ACETAMIDE
CAS:180530-11-4
FC(F)(F)C(=O)Nc1cccc(I)c1
BBV-32872077
2,2,2-TRIFLUORO-N-(4-FLUOROPHENYL)ACETAMIDE
CAS:35980-25-7
Fc1ccc(NC(=O)C(F)(F)F)cc1
BBV-39136441
2,2,2-TRIFLUORO-N-(4-HYDROXYCYCLOHEXYL)ACETAMIDE
CAS:1183415-13-5
OC1CCC(CC1)NC(=O)C(F)(F)F
BBV-32278949
2,2,2-TRIFLUORO-N-(PIPERIDIN-4-YLMETHYL)ACETAMIDE
CAS:444617-44-1
FC(F)(F)C(=O)NCC1CCNCC1
BBV-36973971
2,2,2-TRIFLUORO-N-(PROP-2-YN-1-YL)ACETAMIDE
CAS:14719-21-2
FC(F)(F)C(=O)NCC#C
BBV-32763540
2,2,2-TRIFLUORO-N-[(METHYLCARBAMOYL)METHYL]ACETAMIDE
CAS:38694-10-9
CNC(=O)CNC(=O)C(F)(F)F
BBV-39147211
2,2,2-TRIFLUORO-N-[2-(2-HYDROXYETHOXY)ETHYL]ACETAMIDE
CAS:302331-18-6
OCCOCCNC(=O)C(F)(F)F
BBV-34316663
2,2,2-TRIFLUORO-N-METHOXY-N-METHYLACETAMIDE
CAS:104863-67-4
CON(C)C(=O)C(F)(F)F
BBV-37629776
2,2,2-TRIFLUOROETHYL N-(3,5-DICHLOROPHENYL)CARBAMATE
CAS:1087788-79-1
FC(F)(F)COC(=O)Nc1cc(Cl)cc(Cl)c1
BBV-2090676
2,2,2-TRIMETHOXYETHAN-1-OL
CAS:107155-72-6
COC(CO)(OC)OC
BBV-39743250
2,2,3,3,3-PENTAFLUOROPROPAN-1-AMINE
CAS:422-03-7
NCC(F)(F)C(F)(F)F
BBV-14848864
2,2,3,3,3-PENTAFLUOROPROPAN-1-AMINE HYDROCHLORIDE
CAS:374-14-1
Cl.NCC(F)(F)C(F)(F)F
BBV-118322745
2,2,3,3-TETRAFLUOROPROPAN-1-AMINE
CAS:663-69-4
NCC(F)(F)C(F)F
BBV-102312
2,2,3,3-TETRAFLUOROPROPAN-1-AMINE HYDROCHLORIDE
CAS:663-65-0
Cl.NCC(F)(F)C(F)F
BBV-55270178
2,2,3-TRIMETHYLBUTANOIC ACID
CAS:49714-52-5
CC(C)C(C)(C)C(O)=O
BBV-38282141
2,2,4,4-TETRAMETHYLPENTAN-3-ONE
CAS:815-24-7
CC(C)(C)C(=O)C(C)(C)C
BBV-34220984
2,2,4-TRIMETHYLAZETIDINE
CAS:54395-75-4
CC1CC(C)(C)N1
BBV-265869
2,2,4-TRIMETHYLAZETIDINE HYDROCHLORIDE
CAS:1197627-45-4
Cl.CC1CC(C)(C)N1
BBV-50299579
2,2,4-TRIMETHYLPENTAN-3-ONE
CAS:5857-36-3
CC(C)C(=O)C(C)(C)C
BBV-108661621
2,2,4-TRIMETHYLPENTANOIC ACID
CAS:866-72-8
CC(C)CC(C)(C)C(O)=O
BBV-34588656
2,2,5,5-TETRAMETHYLMORPHOLINE
CAS:1018611-94-3
CC1(C)COC(C)(C)CN1
BBV-25474971
2,2,5,5-TETRAMETHYLMORPHOLINE HYDROCHLORIDE
CAS:1311314-96-1
Cl.CC1(C)COC(C)(C)CN1
BBV-48065173
2,2,5-TRIMETHYLHEXAN-3-AMINE
CAS:1184188-81-5
CC(C)CC(N)C(C)(C)C
BBV-29384367
2,2,5-TRIMETHYLHEXAN-3-AMINE HYDROCHLORIDE
CAS:1334149-69-7
Cl.CC(C)CC(N)C(C)(C)C
BBV-39989558
2,2,5-TRIMETHYLHEXAN-3-ONE
CAS:14705-50-1
CC(C)CC(=O)C(C)(C)C
BBV-29382116
2,2,6,6-TETRAMETHYLMORPHOLINE
CAS:19151-69-0
CC1(C)CNCC(C)(C)O1
BBV-38312693
2,2,6,6-TETRAMETHYLOXAN-4-ONE
CAS:1197-66-6
CC1(C)CC(=O)CC(C)(C)O1
BBV-39748937
2,2,6,6-TETRAMETHYLPIPERAZINE
CAS:38515-26-3
CC1(C)CNCC(C)(C)N1
BBV-34289975
2,2,6-TRIMETHYLHEPTAN-3-AMINE
CAS:1099683-27-8
CC(C)CCC(N)C(C)(C)C
BBV-29357076
2,2,6-TRIMETHYLHEPTAN-3-ONE
CAS:23033-70-7
CC(C)CCC(=O)C(C)(C)C
BBV-32050575
2,2,6-TRIMETHYLMORPHOLINE
CAS:113889-14-8
CC1CNCC(C)(C)O1
BBV-25474972
2,2-BIS(AMINOMETHYL)PROPANE-1,3-DIOL
CAS:63375-50-8
NCC(CN)(CO)CO
BBV-041464
2,2-BIS(AMINOMETHYL)PROPANE-1,3-DIOL DIHYDROCHLORIDE
CAS:1081847-32-6
Cl.Cl.NCC(CN)(CO)CO
BBV-45917420
2,2-DIBROMOPROPANE
CAS:594-16-1
CC(C)(Br)Br
BBV-40195739
2,2-DICYCLOPROPYLACETIC ACID
CAS:23772-94-3
OC(=O)C(C1CC1)C1CC1
BBV-32580904
2,2-DICYCLOPROPYLETHAN-1-AMINE
CAS:142913-40-4
NCC(C1CC1)C1CC1
BBV-15959879
2,2-DIETHYLBUTANOIC ACID
CAS:813-58-1
CCC(CC)(CC)C(O)=O
BBV-34588916
2,2-DIETHYLOXIRANE
CAS:1192-17-2
CCC1(CC)CO1
BBV-34719506
2,2-DIFLUORO-1-(3-FLUORO-4-METHOXYPHENYL)ETHAN-1-AMINE
CAS:1520412-15-0
COc1ccc(cc1F)C(N)C(F)F
BBV-43517488
2,2-DIFLUORO-1-(3-FLUORO-4-METHOXYPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1803604-95-6
Cl.COc1ccc(cc1F)C(N)C(F)F
BBV-55273838
2,2-DIFLUORO-1-[3-(PROPAN-2-YLOXY)PHENYL]ETHAN-1-ONE
CAS:1565091-61-3
CC(C)Oc1cccc(c1)C(=O)C(F)F
BBV-49396408
2,2-DIFLUORO-2-(1-HYDROXYCYCLOBUTYL)ACETIC ACID
CAS:681240-09-5
OC(=O)C(F)(F)C1(O)CCC1
BBV-34224259
2,2-DIFLUORO-2-(1-HYDROXYCYCLOHEXYL)ACETIC ACID
CAS:206346-77-2
OC(=O)C(F)(F)C1(O)CCCCC1
BBV-34224221
2,2-DIFLUORO-2-(1-HYDROXYCYCLOPENTYL)ACETIC ACID
CAS:681240-10-8
OC(=O)C(F)(F)C1(O)CCCC1
BBV-34224210
2,2-DIFLUORO-2-(1-METHYL-1H-PYRAZOL-4-YL)ACETIC ACID
CAS:1248011-19-9
Cn1cc(cn1)C(F)(F)C(O)=O
BBV-34223217
2,2-DIFLUORO-2-(1-METHYL-1H-PYRAZOL-5-YL)ACETIC ACID
CAS:1342825-90-4
Cn1nccc1C(F)(F)C(O)=O
BBV-38136090
2,2-DIFLUORO-2-(1-PROPYL-1H-IMIDAZOL-2-YL)ACETIC ACID
CAS:1340453-76-0
CCCn1ccnc1C(F)(F)C(O)=O
BBV-38137419
2,2-DIFLUORO-2-(1-PROPYL-1H-IMIDAZOL-2-YL)ACETIC ACID HYDROCHLORIDE
CAS:1795185-87-3
Cl.CCCn1ccnc1C(F)(F)C(O)=O
BBV-29427712
2,2-DIFLUORO-2-(2-FLUOROPHENYL)ACETIC ACID
CAS:1250779-80-6
OC(=O)C(F)(F)c1ccccc1F
BBV-25204865
2,2-DIFLUORO-2-(2-METHOXYPHENYL)ACETIC ACID
CAS:1250773-62-6
COc1ccccc1C(F)(F)C(O)=O
BBV-34223201
2,2-DIFLUORO-2-(2-METHYLPHENYL)ACETIC ACID
CAS:1250354-50-7
Cc1ccccc1C(F)(F)C(O)=O
BBV-34223204
2,2-DIFLUORO-2-(3-FORMYLPHENOXY)ACETIC ACID
CAS:1153778-64-3
OC(=O)C(F)(F)Oc1cccc(C=O)c1
BBV-27082878
2,2-DIFLUORO-2-(3-METHOXYPHENYL)ACETIC ACID
CAS:1027513-99-0
COc1cccc(c1)C(F)(F)C(O)=O
BBV-180969
2,2-DIFLUORO-2-(3-METHYLPHENYL)ACETIC ACID
CAS:1038247-17-4
Cc1cccc(c1)C(F)(F)C(O)=O
BBV-180965
2,2-DIFLUORO-2-(3-METHYLPHENYL)ETHAN-1-AMINE
CAS:1393540-47-0
Cc1cccc(c1)C(F)(F)CN
BBV-46761947
2,2-DIFLUORO-2-(3-METHYLPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1803562-69-7
Cl.Cc1cccc(c1)C(F)(F)CN
BBV-32531710
2,2-DIFLUORO-2-(4-FLUOROPHENYL)ACETIC ACID
CAS:94010-78-3
OC(=O)C(F)(F)c1ccc(F)cc1
BBV-34221016
2,2-DIFLUORO-2-(4-FORMYLPHENOXY)ACETIC ACID
CAS:1155459-90-7
OC(=O)C(F)(F)Oc1ccc(C=O)cc1
BBV-27082877
2,2-DIFLUORO-2-(4-HYDROXYPIPERIDIN-4-YL)ACETIC ACID
CAS:1250512-39-0
OC(=O)C(F)(F)C1(O)CCNCC1
BBV-34224261
2,2-DIFLUORO-2-(4-METHOXYPHENYL)ACETIC ACID
CAS:1027513-97-8
COc1ccc(cc1)C(F)(F)C(O)=O
BBV-34221018
2,2-DIFLUORO-2-(6-METHYLPYRIDIN-3-YL)ACETIC ACID
CAS:1342509-23-2
Cc1ccc(cn1)C(F)(F)C(O)=O
BBV-32807974
2,2-DIFLUORO-2-(6-METHYLPYRIDIN-3-YL)ACETIC ACID HYDROCHLORIDE
CAS:1790141-29-5
Cl.Cc1ccc(cn1)C(F)(F)C(O)=O
BBV-32261255
2,2-DIFLUORO-2-(PYRAZIN-2-YL)ACETIC ACID
CAS:1342462-39-8
OC(=O)C(F)(F)c1cnccn1
BBV-38137920
2,2-DIFLUORO-2-(PYRIDIN-3-YL)ACETIC ACID
CAS:1247461-08-0
OC(=O)C(F)(F)c1cccnc1
BBV-34223194
2,2-DIFLUORO-2-(PYRIDIN-4-YL)ACETIC ACID
CAS:1263178-28-4
OC(=O)C(F)(F)c1ccncc1
BBV-37724663
2,2-DIFLUORO-2-[2-(PROPAN-2-YLOXY)PHENYL]ACETIC ACID
CAS:1514825-08-1
CC(C)Oc1ccccc1C(F)(F)C(O)=O
BBV-42947574
2,2-DIFLUORO-2-PHENOXYACETIC ACID
CAS:24210-45-5
OC(=O)C(F)(F)Oc1ccccc1
BBV-27082733
2,2-DIFLUORO-2-PHENYLETHAN-1-OL
CAS:129973-51-9
OCC(F)(F)c1ccccc1
BBV-39768410
2,2-DIFLUORO-3,3-DIMETHYLBUTAN-1-AMINE
CAS:1546332-02-8
CC(C)(C)C(F)(F)CN
BBV-49271267
2,2-DIFLUORO-3-HYDROXYPROPANOIC ACID
CAS:2368-37-8
OCC(F)(F)C(O)=O
BBV-38368263
2,2-DIFLUORO-5-ISOTHIOCYANATO-2H-1,3-BENZODIOXOLE
CAS:869085-97-2
FC1(F)Oc2ccc(cc2O1)N=C=S
BBV-38784457
2,2-DIFLUOROCYCLOBUTAN-1-AMINE
CAS:1258640-60-6
NC1CCC1(F)F
BBV-39695093
2,2-DIFLUOROCYCLOBUTAN-1-AMINE HYDROCHLORIDE
CAS:1638761-45-1
Cl.NC1CCC1(F)F
BBV-60619894
2,2-DIFLUOROCYCLOPROPANE-1-CARBALDEHYDE
CAS:1192109-69-5
FC1(F)CC1C=O
BBV-39734492
2,2-DIFLUOROETHAN-1-AMINE
CAS:430-67-1
NCC(F)F
BBV-213228
2,2-DIFLUOROETHAN-1-AMINE HYDROCHLORIDE
CAS:79667-91-7
Cl.NCC(F)F
BBV-51228558
2,2-DIFLUOROETHANIMIDAMIDE
CAS:134669-67-3
NC(=N)C(F)F
BBV-38344131
2,2-DIFLUOROPROPAN-1-AMINE
CAS:421-00-1
CC(F)(F)CN
BBV-012498
2,2-DIFLUOROPROPAN-1-AMINE HYDROCHLORIDE
CAS:868241-48-9
Cl.CC(F)(F)CN
BBV-38355328
2,2-DIFLUOROPROPANE-1,3-DIAMINE DIHYDROCHLORIDE
CAS:133186-53-5
Cl.Cl.NCC(F)(F)CN
BBV-55100685
2,2-DIFLUOROPROPANOYL 2,2-DIFLUOROPROPANOATE
CAS:173900-46-4
CC(F)(F)C(=O)OC(=O)C(C)(F)F
BBV-40244134
2,2-DIMETHOXY-1-PHENYLETHAN-1-AMINE
CAS:57962-58-0
COC(OC)C(N)c1ccccc1
BBV-39979170
2,2-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE
CAS:20364-30-1
CC1(C)CCc2ccccc2N1
BBV-38319136
2,2-DIMETHYL-1,4-DIAZEPANE
CAS:105627-82-5
CC1(C)CNCCCN1
BBV-34709125
2,2-DIMETHYL-1,4-DIAZEPANE DIHYDROCHLORIDE
CAS:1864053-17-7
Cl.Cl.CC1(C)CNCCCN1
BBV-32534587
2,2-DIMETHYL-1,4-DIAZEPANE HYDROCHLORIDE
CAS:1955523-16-6
Cl.CC1(C)CNCCCN1
BBV-45875367
2,2-DIMETHYL-1,4-OXAZEPANE
CAS:933689-12-4
CC1(C)CNCCCO1
BBV-25474975
2,2-DIMETHYL-1,4-OXAZEPANE HYDROCHLORIDE
CAS:1313738-94-1
Cl.CC1(C)CNCCCO1
BBV-39894408
2,2-DIMETHYL-1,8-DIOXA-4-AZASPIRO[5.5]UNDECANE
CAS:1495198-38-3
CC1(C)CNCC2(CCCOC2)O1
BBV-39853253
2,2-DIMETHYL-1-(2,2,2-TRIFLUOROETHYL)PIPERAZINE
CAS:1267349-95-0
CC1(C)CNCCN1CC(F)(F)F
BBV-37675529
2,2-DIMETHYL-1-(4-METHYLPHENYL)PROPAN-1-OL
CAS:6013-94-1
Cc1ccc(cc1)C(O)C(C)(C)C
BBV-29383188
2,2-DIMETHYL-1-(5-METHYLFURAN-2-YL)PROPAN-1-ONE
CAS:117347-72-5
Cc1ccc(o1)C(=O)C(C)(C)C
BBV-33387670
2,2-DIMETHYL-1-(PYRIMIDIN-2-YL)PROPAN-1-AMINE
CAS:1248084-64-1
CC(C)(C)C(N)c1ncccn1
BBV-34223118
2,2-DIMETHYL-1-[2-(PYRIDIN-3-YL)PYRROLIDIN-1-YL]PROPAN-1-ONE
CAS:1466694-74-5
CC(C)(C)C(=O)N1CCCC1c1cccnc1
BBV-117581
2,2-DIMETHYL-1-[2-(THIOPHEN-3-YL)PYRROLIDIN-1-YL]PROPAN-1-ONE
CAS:1498742-53-2
CC(C)(C)C(=O)N1CCCC1c1ccsc1
BBV-39319248
2,2-DIMETHYL-1-{2-METHYL-OCTAHYDROPYRROLO[2,3-C]PYRROL-1-YL}PROPAN-1-ONE
CAS:1218273-10-9
CC1CC2CNCC2N1C(=O)C(C)(C)C
BBV-25478884
2,2-DIMETHYL-1-PHENYLCYCLOPROPANE-1-CARBOXYLIC ACID
CAS:33795-08-3
CC1(C)CC1(C(O)=O)c1ccccc1
BBV-38271609
2,2-DIMETHYL-1-PHENYLPROPAN-1-AMINE
CAS:61501-04-0
CC(C)(C)C(N)c1ccccc1
BBV-058573
2,2-DIMETHYL-1-PHENYLPROPAN-1-ONE
CAS:938-16-9
CC(C)(C)C(=O)c1ccccc1
BBV-32811617
2,2-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN-5-AMINE
CAS:31010-94-3
CC1(C)Cc2cc(N)ccc2O1
BBV-33913235
2,2-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN-5-CARBOXYLIC ACID
CAS:123656-34-8
CC1(C)Cc2cc(ccc2O1)C(O)=O
BBV-33901656
2,2-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN-5-SULFONYL CHLORIDE
CAS:118351-97-6
CC1(C)Cc2cc(ccc2O1)S(Cl)(=O)=O
BBV-33901954
2,2-DIMETHYL-2H-1,3-BENZODIOXOL-5-AMINE
CAS:6324-89-6
CC1(C)Oc2ccc(N)cc2O1
BBV-001803
2,2-DIMETHYL-2H-1,3-BENZODIOXOL-5-AMINE HYDROCHLORIDE
CAS:75200-79-2
Cl.CC1(C)Oc2ccc(N)cc2O1
BBV-57272079
2,2-DIMETHYL-3,4-DIHYDRO-2H-1-BENZOPYRAN-7-OL
CAS:31005-72-8
CC1(C)CCc2ccc(O)cc2O1
BBV-33343165
2,2-DIMETHYL-3-(1-METHYL-1H-PYRAZOL-4-YL)CYCLOBUTAN-1-ONE
CAS:1520741-03-0
Cn1cc(cn1)C1CC(=O)C1(C)C
BBV-32153490
2,2-DIMETHYL-3-(METHYLAMINO)PROPAN-1-OL
CAS:16047-86-2
CNCC(C)(C)CO
BBV-38272285
2,2-DIMETHYL-3-(METHYLAMINO)PROPANOIC ACID
CAS:763053-45-8
CNCC(C)(C)C(O)=O
BBV-42265215
2,2-DIMETHYL-3-(METHYLAMINO)PROPANOIC ACID HYDROCHLORIDE
CAS:141950-15-4
Cl.CNCC(C)(C)C(O)=O
BBV-46630413
2,2-DIMETHYL-3-(PYRROLIDIN-1-YL)PROPAN-1-AMINE
CAS:681247-27-8
CC(C)(CN)CN1CCCC1
BBV-33904210
2,2-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE-6-CARBONITRILE
CAS:205818-52-6
CC1(C)Oc2ccc(cc2NC1=O)C#N
BBV-45183871
2,2-DIMETHYL-3-PHENYLPROPAN-1-AMINE
CAS:95141-79-0
CC(C)(CN)Cc1ccccc1
BBV-34589100
2,2-DIMETHYL-3-PHENYLPROPAN-1-AMINE HYDROCHLORIDE
CAS:95141-78-9
Cl.CC(C)(CN)Cc1ccccc1
BBV-39885128
2,2-DIMETHYL-3-PHENYLPROPANOIC ACID
CAS:5669-14-7
CC(C)(Cc1ccccc1)C(O)=O
BBV-34571129
2,2-DIMETHYL-5-PHENYLPENTANOIC ACID
CAS:2840-74-6
CC(C)(CCCc1ccccc1)C(O)=O
BBV-34588699
2,2-DIMETHYL-N-(1,3-THIAZOL-2-YL)PROPANAMIDE
CAS:69212-62-0
CC(C)(C)C(=O)Nc1nccs1
BBV-39132398
2,2-DIMETHYL-N-(PIPERIDIN-3-YL)PROPANAMIDE
CAS:1016526-02-5
CC(C)(C)C(=O)NC1CCCNC1
BBV-047551
2,2-DIMETHYL-N-(PIPERIDIN-3-YLMETHYL)PROPANAMIDE
CAS:1016493-38-1
CC(C)(C)C(=O)NCC1CCCNC1
BBV-040598
2,2-DIMETHYL-N-(QUINOLIN-3-YL)PROPANIMIDAMIDE
CAS:1487854-87-4
CC(C)(C)C(=N)Nc1cnc2ccccc2c1
BBV-37079344
2,2-DIMETHYL-N-(QUINOLIN-3-YL)PROPANIMIDAMIDE DIHYDROCHLORIDE
CAS:1909311-93-8
Cl.Cl.CC(C)(C)C(=N)Nc1cnc2ccccc2c1
BBV-38186769
2,2-DIMETHYL-N-(QUINOLIN-3-YL)PROPANIMIDAMIDE HYDROCHLORIDE
CAS:1909314-01-7
Cl.CC(C)(C)C(=N)Nc1cnc2ccccc2c1
BBV-604145
2,2-DIMETHYLBUT-3-ENOIC ACID
CAS:10276-09-2
CC(C)(C=C)C(O)=O
BBV-38362016
2,2-DIMETHYLBUT-3-YNOIC ACID
CAS:56663-76-4
CC(C)(C#C)C(O)=O
BBV-38283065
2,2-DIMETHYLBUTAN-1-AMINE
CAS:41781-17-3
CCC(C)(C)CN
BBV-34577277
2,2-DIMETHYLBUTAN-1-AMINE HYDROCHLORIDE
CAS:123291-55-4
Cl.CCC(C)(C)CN
BBV-027888
2,2-DIMETHYLBUTAN-1-OL
CAS:1185-33-7
CCC(C)(C)CO
BBV-34577507
2,2-DIMETHYLBUTANAL
CAS:2094-75-9
CCC(C)(C)C=O
BBV-36841886
2,2-DIMETHYLCYCLOPENTAN-1-OL
CAS:37617-33-7
CC1(C)CCCC1O
BBV-38361356
2,2-DIMETHYLCYCLOPENTANE-1-CARBOXYLIC ACID
CAS:63861-26-7
CC1(C)CCCC1C(O)=O
BBV-38361562
2,2-DIMETHYLCYCLOPROPANE-1-CARBONYL CHLORIDE
CAS:50675-57-5
CC1(C)CC1C(Cl)=O
BBV-38319462
2,2-DIMETHYLCYCLOPROPANE-1-CARBOXYLIC ACID
CAS:75885-59-5
CC1(C)CC1C(O)=O
BBV-34216881
2,2-DIMETHYLHEPT-6-YN-3-ONE
CAS:51060-08-3
CC(C)(C)C(=O)CCC#C
BBV-57546319
2,2-DIMETHYLHEPTANOIC ACID
CAS:14250-73-8
CCCCCC(C)(C)C(O)=O
BBV-34588657
2,2-DIMETHYLHEXAN-3-AMINE
CAS:1099598-50-1
CCCC(N)C(C)(C)C
BBV-32819789
2,2-DIMETHYLHEXAN-3-AMINE HYDROCHLORIDE
CAS:1864063-57-9
Cl.CCCC(N)C(C)(C)C
BBV-44201821
2,2-DIMETHYLMORPHOLINE-4-SULFONYL CHLORIDE
CAS:1155544-42-5
CC1(C)CN(CCO1)S(Cl)(=O)=O
BBV-25476014
2,2-DIMETHYLOCTAN-3-AMINE
CAS:1099683-24-5
CCCCCC(N)C(C)(C)C
BBV-50304811
2,2-DIMETHYLOCTAN-3-ONE
CAS:5340-64-7
CCCCCC(=O)C(C)(C)C
BBV-463894
2,2-DIMETHYLOXAN-4-AMINE
CAS:25850-22-0
CC1(C)CC(N)CCO1
BBV-38461298
2,2-DIMETHYLOXAN-4-AMINE HYDROCHLORIDE
CAS:90048-31-0
Cl.CC1(C)CC(N)CCO1
BBV-42046131
2,2-DIMETHYLOXAN-4-OL
CAS:24945-13-9
CC1(C)CC(O)CCO1
BBV-38461166
2,2-DIMETHYLOXAN-4-ONE
CAS:1194-16-7
CC1(C)CC(=O)CCO1
BBV-38429935
2,2-DIMETHYLOXANE-4-CARBONITRILE
CAS:60549-63-5
CC1(C)CC(CCO1)C#N
BBV-38461832
2,2-DIMETHYLOXANE-4-CARBOXYLIC ACID
CAS:52916-16-2
CC1(C)CC(CCO1)C(O)=O
BBV-38431171
2,2-DIMETHYLPENTAN-3-AMINE
CAS:73153-81-8
CCC(N)C(C)(C)C
BBV-006416
2,2-DIMETHYLPENTAN-3-ONE
CAS:564-04-5
CCC(=O)C(C)(C)C
BBV-33462780
2,2-DIMETHYLPROPAN-1-AMINE
CAS:5813-64-9
CC(C)(C)CN
BBV-058326
2,2-DIMETHYLPROPAN-1-AMINE HYDROCHLORIDE
CAS:15925-18-5
Cl.CC(C)(C)CN
BBV-50274903
2,2-DIMETHYLPROPANE-1-SULFONYL CHLORIDE
CAS:53333-76-9
CC(C)(C)CS(Cl)(=O)=O
BBV-33816463
2,2-DIMETHYLPROPANE-1-THIOL
CAS:1679-08-9
CC(C)(C)CS
BBV-41797411
2,2-DIMETHYLPROPANECARBONYL ISOCYANATE
CAS:4461-20-5
CC(C)(C)C(=O)N=C=O
BBV-054921
2,2-DIMETHYLPROPANECARBONYL ISOTHIOCYANATE
CAS:93700-38-0
CC(C)(C)C(=O)N=C=S
BBV-027701
2,2-DIMETHYLPROPANEHYDRAZIDE
CAS:42826-42-6
CC(C)(C)C(=O)NN
BBV-036747
2,2-DIMETHYLPROPANETHIOAMIDE
CAS:630-22-8
CC(C)(C)C(N)=S
BBV-037333
2,2-DIMETHYLPROPANIMIDAMIDE
CAS:59950-56-0
CC(C)(C)C(N)=N
BBV-073261
2,2-DIMETHYLPROPANIMIDAMIDE HYDROCHLORIDE
CAS:18202-73-8
Cl.CC(C)(C)C(N)=N
BBV-429661
2,2-DIMETHYLPYRROLIDINE
CAS:35018-15-6
CC1(C)CCCN1
BBV-34205071
2,2-DIMETHYLPYRROLIDINE HYDROCHLORIDE
CAS:623580-01-8
Cl.CC1(C)CCCN1
BBV-57274644
2,3,3-TRIMETHYLBUTAN-1-AMINE
CAS:1096815-86-9
CC(CN)C(C)(C)C
BBV-15959901
2,3,3-TRIMETHYLBUTAN-1-OL
CAS:36794-64-6
CC(CO)C(C)(C)C
BBV-108661612
2,3,3-TRIMETHYLBUTAN-2-OL
CAS:594-83-2
CC(C)(C)C(C)(C)O
BBV-38264664
2,3,3-TRIMETHYLBUTANAL
CAS:17408-48-9
CC(C=O)C(C)(C)C
BBV-40320125
2,3,3-TRIMETHYLBUTANENITRILE
CAS:21101-85-9
CC(C#N)C(C)(C)C
BBV-15959797
2,3,3-TRIMETHYLBUTANOIC ACID
CAS:19910-29-3
CC(C(O)=O)C(C)(C)C
BBV-32473772
2,3,4,5,6,7-HEXAHYDRO-1,3-BENZOTHIAZOL-2-ONE
CAS:57001-13-5
O=c1[nH]c2CCCCc2s1
BBV-15804294
2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE
CAS:17775-01-8
C1COc2ccccc2CN1
BBV-183234
2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE HYDROCHLORIDE
CAS:21767-41-9
Cl.C1COc2ccccc2CN1
BBV-38357130
2,3,4,5-TETRAHYDRO-1-BENZOTHIEPIN-5-ONE
CAS:21609-70-1
O=C1CCCSc2ccccc12
BBV-38785615
2,3,4,5-TETRAHYDRO-1-BENZOXEPIN-5-ONE
CAS:6786-30-7
O=C1CCCOc2ccccc12
BBV-38785587
2,3,4,5-TETRAHYDRO-1?6-BENZOTHIEPINE-1,1,5-TRIONE
CAS:22710-97-0
O=C1CCCS(=O)(=O)c2ccccc12
BBV-38785616
2,3,4,5-TETRAHYDRO-1H-1,4-BENZODIAZEPIN-2-ONE
CAS:1824-72-2
O=C1CNCc2ccccc2N1
BBV-38295284
2,3,4,5-TETRAHYDRO-1H-2-BENZAZEPIN-1-ONE
CAS:6729-50-6
O=C1NCCCc2ccccc12
BBV-38358995
2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE
CAS:4424-20-8
C1Cc2ccccc2CCN1
BBV-213586
2,3,4-TRICHLOROPHENOL
CAS:15950-66-0
Oc1ccc(Cl)c(Cl)c1Cl
BBV-39686242
2,3,4-TRICHLOROPYRIDINE
CAS:55934-02-6
Clc1ccnc(Cl)c1Cl
BBV-49324651
2,3,4-TRIFLUOROBENZENE-1-SULFONAMIDE
CAS:518070-13-8
NS(=O)(=O)c1ccc(F)c(F)c1F
BBV-033892
2,3,4-TRIHYDROXYBUTANOIC ACID; 4-(2-AMINO-1-HYDROXYETHYL)BENZENE-1,2-DIOL
CAS:1212364-72-1
OCC(O)C(O)C(O)=O.NCC(O)c1ccc(O)c(O)c1
BBV-50322415
2,3,4-TRIMETHOXYANILINE
CAS:50625-48-4
COc1ccc(N)c(OC)c1OC
BBV-25216978
2,3,4-TRIMETHOXYANILINE HYDROCHLORIDE
CAS:860586-41-0
Cl.COc1ccc(N)c(OC)c1OC
BBV-53016913
2,3,4-TRIMETHYLPENTAN-3-OL
CAS:3054-92-0
CC(C)C(C)(O)C(C)C
BBV-27279763
2,3,5,6-TETRAFLUORO-4-METHOXYANILINE
CAS:1643-71-6
COc1c(F)c(F)c(N)c(F)c1F
BBV-22265520
2,3,5,6-TETRAFLUORO-4-NITROPHENOL
CAS:20994-04-1
Oc1c(F)c(F)c(c(F)c1F)[N+]([O-])=O
BBV-49788858
2,3,5-TRICHLOROPYRIDIN-4-AMINE
CAS:28443-69-8
Nc1c(Cl)cnc(Cl)c1Cl
BBV-39683145
2,3,5-TRICHLOROQUINOXALINE
CAS:2958-86-3
Clc1nc2cccc(Cl)c2nc1Cl
BBV-36982001
2,3-DIAMINO-2-METHYLPROPANOIC ACID
CAS:170554-69-5
CC(N)(CN)C(O)=O
BBV-32494540
2,3-DIAMINO-2-METHYLPROPANOIC ACID DIHYDROCHLORIDE
CAS:1803586-50-6
Cl.Cl.CC(N)(CN)C(O)=O
BBV-42214424
2,3-DICHLORO-4-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:35509-60-5
COc1ccc(c(Cl)c1Cl)S(Cl)(=O)=O
BBV-1087202
2,3-DICHLORO-5-(CHLOROSULFONYL)BENZOIC ACID
CAS:53552-95-7
OC(=O)c1cc(cc(Cl)c1Cl)S(Cl)(=O)=O
BBV-222999
2,3-DICHLORO-5-(PIPERIDINE-1-CARBONYL)PYRIDINE
CAS:577967-83-0
Clc1cc(cnc1Cl)C(=O)N1CCCCC1
BBV-037755
2,3-DICHLORO-5-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:1247801-40-6
[O-][N+](=O)c1cc(Cl)c(Cl)c(c1)S(Cl)(=O)=O
BBV-32857218
2,3-DICHLORO-5-SULFAMOYLBENZOIC ACID
CAS:869965-83-3
NS(=O)(=O)c1cc(Cl)c(Cl)c(c1)C(O)=O
BBV-054956
2,3-DICHLORO-N-METHYLANILINE
CAS:42265-79-2
CNc1cccc(Cl)c1Cl
BBV-185771
2,3-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-16-8
Cl.CNc1cccc(Cl)c1Cl
BBV-50205279
2,3-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:676500-39-3
Oc1ccc(C=O)c(F)c1F
BBV-38358097
2,3-DIFLUORO-5-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:1156136-97-8
[O-][N+](=O)c1cc(F)c(F)c(c1)S(Cl)(=O)=O
BBV-22263419
2,3-DIFLUORO-5-NITROBENZOIC ACID
CAS:942035-31-6
OC(=O)c1cc(cc(F)c1F)[N+]([O-])=O
BBV-34562172
2,3-DIFLUOROBENZENE-1-SULFONAMIDE
CAS:1133122-99-2
NS(=O)(=O)c1cccc(F)c1F
BBV-32383121
2,3-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:210532-24-4
Fc1cccc(c1F)S(Cl)(=O)=O
BBV-32382638
2,3-DIHYDRO-1,2,5-THIADIAZOL-3-ONE
CAS:5728-07-4
O=c1cns[nH]1
BBV-50409085
2,3-DIHYDRO-1,4-BENZODIOXIN-5-YLMETHANAMINE
CAS:261633-71-0
NCc1cccc2OCCOc12
BBV-25211081
2,3-DIHYDRO-1,4-BENZODIOXIN-5-YLMETHANAMINE DIHYDROCHLORIDE
CAS:1240529-26-3
Cl.Cl.NCc1cccc2OCCOc12
BBV-48243682
2,3-DIHYDRO-1,4-BENZODIOXIN-5-YLMETHANOL
CAS:274910-19-9
OCc1cccc2OCCOc12
BBV-27029812
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(5-METHYL-1,2,4-OXADIAZOL-3-YL)METHANAMINE
CAS:1155537-81-7
Cc1nc(no1)C(N)c1ccc2OCCOc2c1
BBV-25186604
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(5-METHYL-1,2,4-OXADIAZOL-3-YL)METHANAMINE HYDROCHLORIDE
CAS:1334148-18-3
Cl.Cc1nc(no1)C(N)c1ccc2OCCOc2c1
BBV-39971974
2,3-DIHYDRO-1,4-BENZODIOXINE-5-CARBOXYLIC ACID
CAS:4442-53-9
OC(=O)c1cccc2OCCOc12
BBV-006198
2,3-DIHYDRO-1,4-BENZODIOXINE-5-SULFONYL CHLORIDE
CAS:87474-15-5
ClS(=O)(=O)c1cccc2OCCOc12
BBV-32280532
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBONITRILE
CAS:19102-07-9
N#Cc1ccc2OCCOc2c1
BBV-2069448
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBOTHIOAMIDE
CAS:337508-71-1
NC(=S)c1ccc2OCCOc2c1
BBV-2069427
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBOXAMIDE
CAS:299169-62-3
NC(=O)c1ccc2OCCOc2c1
BBV-38773098
2,3-DIHYDRO-1,4-BENZODIOXINE-6-SULFONOHYDRAZIDE
CAS:1094453-02-7
NNS(=O)(=O)c1ccc2OCCOc2c1
BBV-2160261
2,3-DIHYDRO-1-BENZOFURAN-2-CARBOHYDRAZIDE
CAS:176179-03-6
NNC(=O)C1Cc2ccccc2O1
BBV-042876
2,3-DIHYDRO-1-BENZOFURAN-2-YLMETHANAMINE
CAS:21214-11-9
NCC1Cc2ccccc2O1
BBV-058657
2,3-DIHYDRO-1-BENZOFURAN-2-YLMETHANAMINE HYDROCHLORIDE
CAS:19997-54-7
Cl.NCC1Cc2ccccc2O1
BBV-51266105
2,3-DIHYDRO-1-BENZOFURAN-3,6-DIOL
CAS:1020947-92-5
OC1COc2cc(O)ccc12
BBV-142563
2,3-DIHYDRO-1-BENZOFURAN-3-AMINE
CAS:109926-35-4
NC1COc2ccccc12
BBV-116870
2,3-DIHYDRO-1-BENZOFURAN-3-AMINE HYDROCHLORIDE
CAS:860689-81-2
Cl.NC1COc2ccccc12
BBV-54499259
2,3-DIHYDRO-1-BENZOFURAN-3-OL
CAS:5380-80-3
OC1COc2ccccc12
BBV-40189865
2,3-DIHYDRO-1-BENZOFURAN-3-ONE
CAS:7169-34-8
O=C1COc2ccccc12
BBV-116859
2,3-DIHYDRO-1-BENZOFURAN-3-YLMETHANAMINE
CAS:111191-88-9
NCC1COc2ccccc12
BBV-38467452
2,3-DIHYDRO-1-BENZOFURAN-3-YLMETHANAMINE HYDROCHLORIDE
CAS:1421601-92-4
Cl.NCC1COc2ccccc12
BBV-40434143
2,3-DIHYDRO-1-BENZOFURAN-4-CARBOXYLIC ACID
CAS:209256-40-6
OC(=O)c1cccc2occc12
BBV-38317041
2,3-DIHYDRO-1-BENZOFURAN-5-AMINE
CAS:42933-43-7
Nc1ccc2OCCc2c1
BBV-020768
2,3-DIHYDRO-1-BENZOFURAN-5-AMINE HYDROCHLORIDE
CAS:1093403-66-7
Cl.Nc1ccc2OCCc2c1
BBV-60755409
2,3-DIHYDRO-1-BENZOFURAN-5-SULFONAMIDE
CAS:112894-47-0
NS(=O)(=O)c1ccc2OCCc2c1
BBV-030586
2,3-DIHYDRO-1-BENZOFURAN-5-SULFONYL AZIDE
CAS:1152874-08-2
[N-]=[N+]=NS(=O)(=O)c1ccc2OCCc2c1
BBV-15804122
2,3-DIHYDRO-1-BENZOFURAN-5-YLMETHANOL
CAS:103262-35-7
OCc1ccc2OCCc2c1
BBV-27279790
2,3-DIHYDRO-1-BENZOFURAN-6-AMINE
CAS:57786-34-2
Nc1ccc2CCOc2c1
BBV-38371485
2,3-DIHYDRO-1-BENZOFURAN-6-CARBOXYLIC ACID
CAS:301836-57-7
OC(=O)c1ccc2ccoc2c1
BBV-38317042
2,3-DIHYDRO-1-BENZOFURAN-6-SULFONYL CHLORIDE
CAS:724446-31-5
ClS(=O)(=O)c1ccc2CCOc2c1
BBV-38364908
2,3-DIHYDRO-1-BENZOFURAN-7-CARBALDEHYDE
CAS:196799-45-8
O=Cc1cccc2CCOc12
BBV-38359065
2,3-DIHYDRO-1-BENZOFURAN-7-CARBOXYLIC ACID
CAS:35700-40-4
OC(=O)c1cccc2CCOc12
BBV-38355654
2,3-DIHYDRO-1-BENZOTHIOPHEN-3-AMINE
CAS:1154342-11-6
NC1CSc2ccccc12
BBV-25165408
2,3-DIHYDRO-1-BENZOTHIOPHENE-2,3-DIONE
CAS:493-57-2
O=C1Sc2ccccc2C1=O
BBV-38277440
2,3-DIHYDRO-1-BENZOTHIOPHENE-2-CARBOHYDRAZIDE HYDROCHLORIDE
CAS:1427379-85-8
Cl.NNC(=O)C1Cc2ccccc2S1
BBV-477578
2,3-DIHYDRO-1H-IMIDAZOL-2-ONE
CAS:5918-93-4
O=c1[nH]cc[nH]1
BBV-38359876
2,3-DIHYDRO-1H-INDEN-2-YLMETHANAMINE
CAS:146737-65-7
NCC1Cc2ccccc2C1
BBV-27285418
2,3-DIHYDRO-1H-INDEN-2-YLMETHANAMINE HYDROCHLORIDE
CAS:178955-07-2
Cl.NCC1Cc2ccccc2C1
BBV-57274632
2,3-DIHYDRO-1H-INDEN-2-YLMETHANOL
CAS:5445-45-4
OCC1Cc2ccccc2C1
BBV-38295315
2,3-DIHYDRO-1H-INDEN-5-YLMETHANAMINE
CAS:13203-56-0
NCc1ccc2CCCc2c1
BBV-059169
2,3-DIHYDRO-1H-INDEN-5-YLMETHANAMINE HYDROCHLORIDE
CAS:721968-63-4
Cl.NCc1ccc2CCCc2c1
BBV-57272143
2,3-DIHYDRO-1H-INDEN-5-YLMETHANOL
CAS:51632-06-5
OCc1ccc2CCCc2c1
BBV-33359994
2,3-DIHYDRO-1H-INDENE-1-CARBONITRILE
CAS:26452-97-1
N#CC1CCc2ccccc12
BBV-15959772
2,3-DIHYDRO-1H-INDENE-1-CARBOXYLIC ACID
CAS:14381-42-1
OC(=O)C1CCc2ccccc12
BBV-32580906
2,3-DIHYDRO-1H-INDENE-1-THIOL
CAS:121607-77-0
SC1CCc2ccccc12
BBV-238248
2,3-DIHYDRO-1H-INDENE-2-CARBALDEHYDE
CAS:37414-44-1
O=CC1Cc2ccccc2C1
BBV-39757706
2,3-DIHYDRO-1H-INDENE-2-CARBOXYLIC ACID
CAS:25177-85-9
OC(=O)C1Cc2ccccc2C1
BBV-32473691
2,3-DIHYDRO-1H-INDENE-2-SULFONYL CHLORIDE
CAS:496946-74-8
ClS(=O)(=O)C1Cc2ccccc2C1
BBV-33816437
2,3-DIHYDRO-1H-INDENE-2-THIOL
CAS:83774-87-2
SC1Cc2ccccc2C1
BBV-27285389
2,3-DIHYDRO-1H-INDENE-5-CARBALDEHYDE
CAS:30084-91-4
O=Cc1ccc2CCCc2c1
BBV-36830018
2,3-DIHYDRO-1H-INDENE-5-CARBONITRILE
CAS:69975-67-3
N#Cc1ccc2CCCc2c1
BBV-36841822
2,3-DIHYDRO-1H-INDENE-5-THIOL
CAS:55119-14-7
Sc1ccc2CCCc2c1
BBV-204522
2,3-DIHYDRO-1H-INDOL-4-OL
CAS:85926-99-4
Oc1cccc2NCCc12
BBV-38302082
2,3-DIHYDRO-1H-INDOL-4-OL HYDROCHLORIDE
CAS:1415334-16-5
Cl.Oc1cccc2NCCc12
BBV-45814558
2,3-DIHYDRO-1H-INDOLE-1-CARBOXAMIDE
CAS:56632-33-8
NC(=O)N1CCc2ccccc12
BBV-019477
2,3-DIHYDRO-1H-INDOLE-1-CARBOXIMIDAMIDE
CAS:59589-60-5
NC(=N)N1CCc2ccccc12
BBV-115926
2,3-DIHYDRO-1H-INDOLE-1-SULFONAMIDE
CAS:34917-77-6
NS(=O)(=O)N1CCc2ccccc12
BBV-38784118
2,3-DIHYDRO-1H-INDOLE-6-CARBOXYLIC ACID
CAS:732922-86-0
OC(=O)c1ccc2CCNc2c1
BBV-38357823
2,3-DIHYDRO-1H-INDOLE-6-CARBOXYLIC ACID HYDROCHLORIDE
CAS:15861-37-7
Cl.OC(=O)c1ccc2CCNc2c1
BBV-38270149
2,3-DIHYDRO-1H-ISOINDOL-5-AMINE
CAS:45766-35-6
Nc1ccc2CNCc2c1
BBV-38273113
2,3-DIHYDRO-1H-ISOINDOL-5-AMINE HYDROCHLORIDE
CAS:503614-81-1
Cl.Nc1ccc2CNCc2c1
BBV-40301424
2,3-DIHYDRO-1H-ISOINDOL-5-OL
CAS:54544-67-1
Oc1ccc2CNCc2c1
BBV-38391175
2,3-DIHYDRO-1H-ISOINDOL-5-OL HYDROBROMIDE
CAS:105358-58-5
Br.Oc1ccc2CNCc2c1
BBV-57395255
2,3-DIHYDRO-1H-ISOINDOL-5-OL HYDROCHLORIDE
CAS:1126832-40-3
Cl.Oc1ccc2CNCc2c1
BBV-38319383
2,3-DIHYDRO-1H-ISOINDOLE
CAS:496-12-8
C1NCc2ccccc12
BBV-182646
2,3-DIHYDRO-1H-ISOINDOLE HYDROCHLORIDE
CAS:32372-82-0
Cl.C1NCc2ccccc12
BBV-38354987
2,3-DIHYDRO-1H-ISOINDOLE-1-CARBOXYLIC ACID
CAS:66938-02-1
OC(=O)C1NCc2ccccc12
BBV-38270140
2,3-DIHYDRO-1H-ISOINDOLE-1-CARBOXYLIC ACID HYDROCHLORIDE
CAS:96016-96-5
Cl.OC(=O)C1NCc2ccccc12
BBV-38364422
2,3-DIHYDRO-1H-ISOINDOLE-2-CARBOXIMIDAMIDE HYDROCHLORIDE
CAS:25289-48-9
Cl.NC(=N)N1Cc2ccccc2C1
BBV-010192
2,3-DIHYDRO-1H-ISOINDOLE-4-CARBONITRILE
CAS:1159883-00-7
N#Cc1cccc2CNCc12
BBV-38394202
2,3-DIHYDRO-1H-ISOINDOLE-5-CARBONITRILE
CAS:263888-58-0
N#Cc1ccc2CNCc2c1
BBV-38295275
2,3-DIHYDRO-1H-ISOINDOLE-5-CARBONITRILE HYDROCHLORIDE
CAS:1159823-51-4
Cl.N#Cc1ccc2CNCc2c1
BBV-38360133
2,3-DIHYDRO-1H-PERIMIDIN-2-ONE
CAS:5157-11-9
O=c1[nH]c2cccc3cccc([nH]1)c23
BBV-255728
2,3-DIHYDROSPIRO[INDENE-1,2'-MORPHOLINE]
CAS:1267983-86-7
C1CC2(CNCCO2)c2ccccc12
BBV-39709074
2,3-DIHYDROSPIRO[INDENE-1,3'-PYRROLIDINE]-2',5'-DIONE
CAS:81402-16-6
O=C1CC2(CCc3ccccc23)C(=O)N1
BBV-494614
2,3-DIHYDROXY-2-METHYLPROPANOIC ACID
CAS:21620-60-0
CC(O)(CO)C(O)=O
BBV-38361053
2,3-DIHYDROXY-3-METHYLBUTANOIC ACID
CAS:1756-18-9
CC(C)(O)C(O)C(O)=O
BBV-38358512
2,3-DIMETHOXYANILINE
CAS:6299-67-8
COc1cccc(N)c1OC
BBV-37202794
2,3-DIMETHYL-5-NITROPYRIDIN-4-OL
CAS:68707-72-2
Cc1ncc(c(O)c1C)[N+]([O-])=O
BBV-38719340
2,3-DIMETHYL-6-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:74320-02-8
Cc1ccc(c(c1C)S(Cl)(=O)=O)[N+]([O-])=O
BBV-028146
2,3-DIMETHYL-N-(2,2,2-TRIFLUOROETHYL)ANILINE
CAS:1021088-29-8
Cc1cccc(NCC(F)(F)F)c1C
BBV-151628
2,3-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:2905-31-9
Cc1cccc(c1C)S(Cl)(=O)=O
BBV-032329
2,3-DIMETHYLBUTAN-1-AMINE
CAS:66553-05-7
CC(C)C(C)CN
BBV-15959899
2,3-DIMETHYLBUTAN-2-AMINE
CAS:4358-75-2
CC(C)C(C)(C)N
BBV-27286710
2,3-DIMETHYLBUTAN-2-AMINE HYDROCHLORIDE
CAS:29772-69-8
Cl.CC(C)C(C)(C)N
BBV-50318259
2,3-DIMETHYLBUTANE-1,2-DIAMINE
CAS:157663-74-6
CC(C)C(C)(N)CN
BBV-32664855
2,3-DIMETHYLBUTANENITRILE
CAS:20654-44-8
CC(C)C(C)C#N
BBV-15959795
2,3-DIMETHYLBUTANOIC ACID
CAS:14287-61-7
CC(C)C(C)C(O)=O
BBV-32443880
2,3-DIMETHYLBUTANOYL CHLORIDE
CAS:51760-90-8
CC(C)C(C)C(Cl)=O
BBV-108661648
2,3-DIMETHYLCYCLOBUTAN-1-ONE
CAS:38559-13-6
CC1CC(=O)C1C
BBV-43953823
2,3-DIMETHYLPENT-4-ENOIC ACID
CAS:59793-05-4
CC(C=C)C(C)C(O)=O
BBV-34720844
2,3-DIMETHYLPENTANOIC ACID
CAS:82608-03-5
CCC(C)C(C)C(O)=O
BBV-32580842
2,3-DIOXO-2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID
CAS:25128-32-9
OC(=O)c1ccc2NC(=O)C(=O)c2c1
BBV-029363
2,3-DIOXO-2,3-DIHYDRO-1H-INDOLE-5-SULFONAMIDE
CAS:3456-82-4
NS(=O)(=O)c1ccc2NC(=O)C(=O)c2c1
BBV-026800
2,3-DIOXO-2,3-DIHYDRO-1H-INDOLE-5-SULFONYL CHLORIDE
CAS:132898-96-5
ClS(=O)(=O)c1ccc2NC(=O)C(=O)c2c1
BBV-38364236
2,3-DIPHENYLPROPAN-1-AMINE
CAS:5415-80-5
NCC(Cc1ccccc1)c1ccccc1
BBV-15959914
2,4,4-TRIMETHYL-3-OXOPENTANENITRILE
CAS:29509-04-4
CC(C#N)C(=O)C(C)(C)C
BBV-50302833
2,4,5-TRICHLOROPYRIDINE
CAS:55934-01-5
Clc1cc(Cl)c(Cl)cn1
BBV-38300300
2,4,5-TRIMETHOXYANILINE
CAS:26510-91-8
COc1cc(OC)c(OC)cc1N
BBV-37185066
2,4,5-TRIMETHYL-1H-IMIDAZOLE
CAS:822-90-2
Cc1nc(C)c(C)[nH]1
BBV-38275600
2,4,6-TRIBROMOBENZENE-1-SULFONYL CHLORIDE
CAS:115876-73-8
ClS(=O)(=O)c1c(Br)cc(Br)cc1Br
BBV-242857
2,4,6-TRICHLOROPYRIDINE-3-CARBONITRILE
CAS:40381-91-7
Clc1cc(Cl)c(C#N)c(Cl)n1
BBV-41797893
2,4,6-TRICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:1036738-12-1
Clc1ccc2nc(Cl)nc(Cl)c2n1
BBV-40272618
2,4,6-TRIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:220239-64-5
Fc1cc(F)c(c(F)c1)S(Cl)(=O)=O
BBV-037858
2,4,6-TRIFLUOROBENZENE-1-THIOL
CAS:130922-42-8
Fc1cc(F)c(S)c(F)c1
BBV-224754
2,4,6-TRIHYDROXYBENZOIC ACID
CAS:83-30-7
OC(=O)c1c(O)cc(O)cc1O
BBV-213341
2,4,6-TRIMETHOXYANILINE
CAS:14227-17-9
COc1cc(OC)c(N)c(OC)c1
BBV-023630
2,4,6-TRIMETHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:52499-93-1
COc1cc(OC)c(c(OC)c1)S(Cl)(=O)=O
BBV-027465
2,4,6-TRIMETHYL-3-NITROBENZOIC ACID
CAS:106567-41-3
Cc1cc(C)c(c(C)c1C(O)=O)[N+]([O-])=O
BBV-22162949
2,4,6-TRIMETHYLBENZENE-1-CARBOTHIOAMIDE
CAS:57182-71-5
Cc1cc(C)c(C(N)=S)c(C)c1
BBV-2078160
2,4,6-TRIMETHYLBENZOYL ISOTHIOCYANATE
CAS:32709-74-3
Cc1cc(C)c(C(=O)N=C=S)c(C)c1
BBV-24925288
2,4-BIS(PROPAN-2-YL)ANILINE
CAS:79069-41-3
CC(C)c1ccc(N)c(c1)C(C)C
BBV-029993
2,4-DI-TERT-BUTYL-6-CHLOROPYRIMIDINE
CAS:69050-89-1
CC(C)(C)c1cc(Cl)nc(n1)C(C)(C)C
BBV-25184591
2,4-DIBROMO-1,3-THIAZOLE
CAS:4175-77-3
Brc1csc(Br)n1
BBV-40197797
2,4-DIBROMO-1,7-NAPHTHYRIDINE
CAS:54920-77-3
Brc1cc(Br)c2ccncc2n1
BBV-40224505
2,4-DICHLORO-1,3,5-TRIAZINE
CAS:2831-66-5
Clc1ncnc(Cl)n1
BBV-38358947
2,4-DICHLORO-1,5-NAPHTHYRIDINE
CAS:28252-82-6
Clc1cc(Cl)c2ncccc2n1
BBV-39768512
2,4-DICHLORO-1-(1-ISOTHIOCYANATOETHYL)BENZENE
CAS:1036622-05-5
CC(N=C=S)c1ccc(Cl)cc1Cl
BBV-38784444
2,4-DICHLORO-1-(2-ISOCYANATOETHYL)BENZENE
CAS:480439-41-6
Clc1ccc(CCN=C=O)c(Cl)c1
BBV-108674640
2,4-DICHLORO-1-(2-ISOTHIOCYANATOETHYL)BENZENE
CAS:184003-30-3
Clc1ccc(CCN=C=S)c(Cl)c1
BBV-38784456
2,4-DICHLORO-1-(IODOMETHYL)BENZENE
CAS:116529-35-2
Clc1ccc(CI)c(Cl)c1
BBV-39217580
2,4-DICHLORO-1-ETHENYLBENZENE
CAS:2123-27-5
Clc1ccc(C=C)c(Cl)c1
BBV-39177931
2,4-DICHLORO-3-METHOXYPYRIDINE
CAS:405143-46-6
COc1c(Cl)ccnc1Cl
BBV-39758304
2,4-DICHLORO-5-(METHYLSULFAMOYL)BENZOIC ACID
CAS:4847-36-3
CNS(=O)(=O)c1cc(C(O)=O)c(Cl)cc1Cl
BBV-456892
2,4-DICHLORO-5-(PYRROLIDINE-1-SULFONYL)BENZOIC ACID
CAS:351336-24-8
OC(=O)c1cc(c(Cl)cc1Cl)S(=O)(=O)N1CCCC1
BBV-51614073
2,4-DICHLORO-5-CYCLOPROPYLPYRIMIDINE
CAS:1190379-86-2
Clc1ncc(C2CC2)c(Cl)n1
BBV-38340596
2,4-DICHLORO-5-METHANESULFONYLBENZOIC ACID
CAS:51521-75-6
CS(=O)(=O)c1cc(C(O)=O)c(Cl)cc1Cl
BBV-2080128
2,4-DICHLORO-5-NITRO-1,3-THIAZOLE
CAS:107190-42-1
[O-][N+](=O)c1sc(Cl)nc1Cl
BBV-105035
2,4-DICHLORO-5-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:949-30-4
[O-][N+](=O)c1cc(c(Cl)cc1Cl)S(Cl)(=O)=O
BBV-33232990
2,4-DICHLORO-5-NITROBENZOIC ACID
CAS:19861-62-2
OC(=O)c1cc(c(Cl)cc1Cl)[N+]([O-])=O
BBV-22162951
2,4-DICHLORO-5-NITROPYRIMIDINE
CAS:49845-33-2
[O-][N+](=O)c1cnc(Cl)nc1Cl
BBV-266555
2,4-DICHLORO-6,6-DIMETHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:1480939-99-8
CC1(C)CCc2nc(Cl)nc(Cl)c2C1
BBV-40186468
2,4-DICHLORO-6-(2,2,2-TRIFLUOROETHOXY)-1,3,5-TRIAZINE
CAS:185677-00-3
FC(F)(F)COc1nc(Cl)nc(Cl)n1
BBV-36608841
2,4-DICHLORO-6-(MORPHOLIN-4-YL)-1,3,5-TRIAZINE
CAS:6601-22-5
Clc1nc(Cl)nc(n1)N1CCOCC1
BBV-34992327
2,4-DICHLORO-6-(PROPAN-2-YL)PYRIMIDINE
CAS:89938-05-6
CC(C)c1cc(Cl)nc(Cl)n1
BBV-39125555
2,4-DICHLORO-6-(PYRIDIN-2-YL)PYRIMIDINE
CAS:954232-56-5
Clc1cc(nc(Cl)n1)-c1ccccn1
BBV-40186419
2,4-DICHLORO-6-(PYRIDIN-4-YL)PYRIMIDINE
CAS:53345-49-6
Clc1cc(nc(Cl)n1)-c1ccncc1
BBV-40186420
2,4-DICHLORO-6-HYDROXYBENZOIC ACID
CAS:99725-34-5
OC(=O)c1c(O)cc(Cl)cc1Cl
BBV-264037
2,4-DICHLORO-6-METHYL-1,3,5-TRIAZINE
CAS:1973-04-2
Cc1nc(Cl)nc(Cl)n1
BBV-38363101
2,4-DICHLORO-6-METHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:1465063-86-8
CC1CCc2nc(Cl)nc(Cl)c2C1
BBV-40186469
2,4-DICHLORO-6-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:568586-12-9
[O-][N+](=O)c1cc(Cl)cc(Cl)c1S(Cl)(=O)=O
BBV-025996
2,4-DICHLORO-N-(PYRIDIN-3-YLMETHYL)ANILINE
CAS:84324-64-1
Clc1ccc(NCc2cccnc2)c(Cl)c1
BBV-124372
2,4-DICHLOROPYRIDIN-3-AMINE
CAS:173772-63-9
Nc1c(Cl)ccnc1Cl
BBV-38306392
2,4-DICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:871254-61-4
Clc1ncc(C=O)c(Cl)n1
BBV-38271064
2,4-DICHLOROPYRIMIDINE-5-CARBONITRILE
CAS:3177-24-0
Clc1ncc(C#N)c(Cl)n1
BBV-38306234
2,4-DICHLOROPYRIMIDINE-5-CARBONYL CHLORIDE
CAS:2972-52-3
ClC(=O)c1cnc(Cl)nc1Cl
BBV-036844
2,4-DICHLOROPYRIMIDINE-5-SULFONYL CHLORIDE
CAS:23920-08-3
Clc1ncc(c(Cl)n1)S(Cl)(=O)=O
BBV-006238
2,4-DICHLOROQUINAZOLINE-6-CARBONITRILE
CAS:150449-98-2
Clc1nc(Cl)c2cc(ccc2n1)C#N
BBV-14878342
2,4-DIFLUORO-1-(ISOCYANATOMETHYL)BENZENE
CAS:1291101-40-0
Fc1ccc(CN=C=O)c(F)c1
BBV-36975900
2,4-DIFLUORO-1-(PROP-1-EN-2-YL)BENZENE
CAS:156570-11-5
CC(=C)c1ccc(F)cc1F
BBV-38726280
2,4-DIFLUORO-5-(2-METHYLPROPANAMIDO)BENZOIC ACID
CAS:1183740-54-6
CC(C)C(=O)Nc1cc(C(O)=O)c(F)cc1F
BBV-29353275
2,4-DIFLUORO-6-PHENYLANILINE
CAS:926203-62-5
Nc1c(F)cc(F)cc1-c1ccccc1
BBV-003841
2,4-DIFLUORO-N-(FURAN-2-YLMETHYL)ANILINE
CAS:1021109-39-6
Fc1ccc(NCc2ccco2)c(F)c1
BBV-133649
2,4-DIFLUORO-N-(PYRIDIN-2-YLMETHYL)ANILINE
CAS:1019614-22-2
Fc1ccc(NCc2ccccn2)c(F)c1
BBV-133743
2,4-DIFLUORO-N-(PYRIDIN-3-YLMETHYL)ANILINE
CAS:84324-66-3
Fc1ccc(NCc2cccnc2)c(F)c1
BBV-133647
2,4-DIFLUORO-N-(THIOPHEN-2-YLMETHYL)ANILINE
CAS:1019513-80-4
Fc1ccc(NCc2cccs2)c(F)c1
BBV-133646
2,4-DIFLUOROPHENYL CHLOROFORMATE
CAS:400900-00-7
Fc1ccc(OC(Cl)=O)c(F)c1
BBV-239224
2,4-DIMETHYL-5-NITROBENZOIC ACID
CAS:220504-75-6
Cc1cc(C)c(cc1C(O)=O)[N+]([O-])=O
BBV-22162953
2,4-DIMETHYL-6-OXO-1-{[(PROPAN-2-YL)CARBAMOYL]METHYL}-1,6-DIHYDROPYRIDINE-3-CARBOXYLIC ACID
CAS:1281328-68-4
CC(C)NC(=O)Cn1c(C)c(C(O)=O)c(C)cc1=O
BBV-33403467
2,4-DIMETHYL-N-(PROPAN-2-YL)ANILINE
CAS:260432-86-8
CC(C)Nc1ccc(C)cc1C
BBV-118113
2,4-DIMETHYL-N-(PROPAN-2-YL)ANILINE HYDROCHLORIDE
CAS:1211024-44-0
Cl.CC(C)Nc1ccc(C)cc1C
BBV-53230312
2,4-DIMETHYLAZETIDINE
CAS:1314908-41-2
CC1CC(C)N1
BBV-38406462
2,4-DIMETHYLAZETIDINE HYDROCHLORIDE
CAS:1803606-22-5
Cl.CC1CC(C)N1
BBV-44062129
2,4-DIMETHYLCYCLOHEXAN-1-AMINE
CAS:28294-95-3
CC1CCC(N)C(C)C1
BBV-33397443
2,4-DIMETHYLCYCLOHEXAN-1-ONE
CAS:823-55-2
CC1CCC(=O)C(C)C1
BBV-33397339
2,4-DIMETHYLPENTAN-1-OL
CAS:6305-71-1
CC(C)CC(C)CO
BBV-38273557
2,4-DIMETHYLPENTAN-2-AMINE
CAS:64379-30-2
CC(C)CC(C)(C)N
BBV-27286714
2,4-DIMETHYLPENTAN-3-AMINE
CAS:4083-57-2
CC(C)C(N)C(C)C
BBV-29350427
2,4-DIMETHYLPENTAN-3-AMINE HYDROCHLORIDE
CAS:4083-58-3
Cl.CC(C)C(N)C(C)C
BBV-45272727
2,4-DIMETHYLPENTANOIC ACID
CAS:5868-33-7
CC(C)CC(C)C(O)=O
BBV-32443635
2,4-DINITROBENZENE-1-SULFONAMIDE
CAS:73901-01-6
NS(=O)(=O)c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O
BBV-026167
2,4-DIOXO-2,3,4,5-TETRAHYDRO-1H-1,5-BENZODIAZEPINE-7-SULFONYL CHLORIDE
CAS:865373-66-6
ClS(=O)(=O)c1ccc2NC(=O)CC(=O)Nc2c1
BBV-091062
2,5,5-TRIMETHYL-1-(2-METHYLPHENYL)PIPERAZINE
CAS:1226235-83-1
CC1CNC(C)(C)CN1c1ccccc1C
BBV-39484411
2,5,5-TRIMETHYL-1-(2-METHYLPHENYL)PIPERAZINE HYDROCHLORIDE
CAS:1864061-60-8
Cl.CC1CNC(C)(C)CN1c1ccccc1C
BBV-32117684
2,5,5-TRIMETHYLHEXANOIC ACID
CAS:53705-45-6
CC(CCC(C)(C)C)C(O)=O
BBV-32915736
2,5,5-TRIMETHYLMORPHOLINE
CAS:938374-22-2
CC1CNC(C)(C)CO1
BBV-57346273
2,5,6-TRIMETHYL-7-[2-(PYRIDIN-2-YL)ETHYL]-1H,4H,7H-PYRROLO[2,3-D]PYRIMIDIN-4-IMINE
CAS:1097163-83-1
Cc1c(C)c2c([nH]c(C)nc2=N)n1CCc1ccccn1
BBV-51602894
2,5,7-TRICHLORO-1,3-BENZOXAZOLE
CAS:6481-01-2
Clc1nc2cc(Cl)cc(Cl)c2o1
BBV-34214890
2,5,8-TRIOXA-11-AZADODECANE
CAS:51952-13-7
CNCCOCCOCCOC
BBV-38482580
2,5-DIAMINOPYRIDINE-3-CARBONITRILE
CAS:1184645-19-9
Nc1cnc(N)c(c1)C#N
BBV-32125933
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1373028-77-3
O=C1CCC2(CNC2)N1
BBV-44987135
2,5-DIBENZYLPIPERAZINE
CAS:1266822-95-0
C(C1CNC(Cc2ccccc2)CN1)c1ccccc1
BBV-39626462
2,5-DIBROMO-3-NITROPYRIDINE
CAS:15862-37-0
[O-][N+](=O)c1cc(Br)cnc1Br
BBV-32573144
2,5-DIBROMO-4-METHYLBENZALDEHYDE
CAS:706820-09-9
Cc1cc(Br)c(C=O)cc1Br
BBV-108661962
2,5-DIBROMOANILINE
CAS:3638-73-1
Nc1cc(Br)ccc1Br
BBV-026337
2,5-DIBROMOPHENOL
CAS:28165-52-8
Oc1cc(Br)ccc1Br
BBV-32811672
2,5-DIBROMOTHIOPHENE-3-CARBALDEHYDE
CAS:1193-69-7
Brc1cc(C=O)c(Br)s1
BBV-38456435
2,5-DIBROMOTHIOPHENE-3-CARBOXYLIC ACID
CAS:7311-70-8
OC(=O)c1cc(Br)sc1Br
BBV-39779119
2,5-DIBROMOTHIOPHENE-3-SULFONYL CHLORIDE
CAS:70374-40-2
ClS(=O)(=O)c1cc(Br)sc1Br
BBV-001537
2,5-DICHLORO-1,3-THIAZOLE
CAS:16629-14-4
Clc1cnc(Cl)s1
BBV-41262527
2,5-DICHLORO-2,5-DIMETHYLHEXANE
CAS:6223-78-5
CC(C)(Cl)CCC(C)(C)Cl
BBV-38267188
2,5-DICHLORO-3-(CHLOROMETHYL)THIOPHENE
CAS:10095-91-7
ClCc1cc(Cl)sc1Cl
BBV-38456637
2,5-DICHLORO-4-FLUOROBENZOIC ACID
CAS:35989-28-7
OC(=O)c1cc(Cl)c(F)cc1Cl
BBV-43785122
2,5-DICHLORO-4-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:35509-62-7
COc1cc(Cl)c(cc1Cl)S(Cl)(=O)=O
BBV-1087239
2,5-DICHLORO-4-METHOXYBENZOIC ACID
CAS:2500-03-0
COc1cc(Cl)c(cc1Cl)C(O)=O
BBV-33289334
2,5-DICHLORO-8-FLUOROQUINOLINE
CAS:1342357-62-3
Fc1ccc(Cl)c2ccc(Cl)nc12
BBV-38489317
2,5-DICHLORO-N-METHYLANILINE
CAS:10224-70-1
CNc1cc(Cl)ccc1Cl
BBV-144873
2,5-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1193389-58-0
Cl.CNc1cc(Cl)ccc1Cl
BBV-50204950
2,5-DICHLOROBENZOYL CHLORIDE
CAS:2905-61-5
ClC(=O)c1cc(Cl)ccc1Cl
BBV-108664289
2,5-DICHLOROQUINOLINE
CAS:59412-12-3
Clc1ccc2c(Cl)cccc2n1
BBV-38278452
2,5-DIETHYLANILINE
CAS:80427-50-5
CCc1ccc(CC)c(N)c1
BBV-27053511
2,5-DIETHYLANILINE HYDROCHLORIDE
CAS:1354952-16-1
Cl.CCc1ccc(CC)c(N)c1
BBV-50316573
2,5-DIETHYLMORPHOLINE
CAS:1094657-75-6
CCC1COC(CC)CN1
BBV-70615020
2,5-DIFLUORO-3-NITROBENZOIC ACID
CAS:741721-49-3
OC(=O)c1cc(F)cc(c1F)[N+]([O-])=O
BBV-22162931
2,5-DIFLUORO-4-METHYLBENZALDEHYDE
CAS:879093-07-9
Cc1cc(F)c(C=O)cc1F
BBV-39760910
2,5-DIFLUORO-N-METHYLANILINE
CAS:138563-58-3
CNc1cc(F)ccc1F
BBV-147106
2,5-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1235441-12-9
Cl.CNc1cc(F)ccc1F
BBV-55268825
2,5-DIFLUOROBENZENE-1-CARBOTHIOAMIDE
CAS:1029623-72-0
NC(=S)c1cc(F)ccc1F
BBV-37733867
2,5-DIHYDRO-1H-PYRROLE
CAS:109-96-6
C1NCC=C1
BBV-34552767
2,5-DIHYDRO-1H-PYRROLE HYDROCHLORIDE
CAS:63468-63-3
Cl.C1NCC=C1
BBV-72246947
2,5-DIHYDROTHIOPHENE
CAS:1708-32-3
C1SCC=C1
BBV-38345206
2,5-DIMETHOXY-N-METHYLANILINE
CAS:10224-66-5
CNc1cc(OC)ccc1OC
BBV-147634
2,5-DIMETHYL-1-(1,3-THIAZOL-2-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:953902-12-0
Cc1cc(C(O)=O)c(C)n1-c1nccs1
BBV-024825
2,5-DIMETHYL-1-(1-METHYL-1H-PYRAZOL-4-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:1153407-23-8
Cc1cc(C(O)=O)c(C)n1-c1cnn(C)c1
BBV-25160651
2,5-DIMETHYL-1-(OXAN-3-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:1292222-06-0
Cc1cc(C(O)=O)c(C)n1CC1CCCOC1
BBV-33568068
2,5-DIMETHYL-1-(PROP-2-YN-1-YL)-1H-PYRROLE
CAS:54609-19-7
Cc1ccc(C)n1CC#C
BBV-27041380
2,5-DIMETHYL-1-(PYRIDIN-2-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:953894-68-3
Cc1cc(C(O)=O)c(C)n1-c1ccccn1
BBV-026510
2,5-DIMETHYL-1-(PYRIDIN-2-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:953717-09-4
Cc1cc(C(O)=O)c(C)n1Cc1ccccn1
BBV-026271
2,5-DIMETHYL-1-(PYRIDIN-3-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:953717-57-2
Cc1cc(C(O)=O)c(C)n1-c1cccnc1
BBV-021635
2,5-DIMETHYL-1-(PYRIDIN-4-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:954583-91-6
Cc1cc(C(O)=O)c(C)n1-c1ccncc1
BBV-035077
2,5-DIMETHYL-1-(PYRIDIN-4-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:306936-15-2
Cc1cc(C(O)=O)c(C)n1Cc1ccncc1
BBV-569682
2,5-DIMETHYL-1-(PYRIMIDIN-2-YL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:1016505-56-8
Cc1cc(C(O)=O)c(C)n1-c1ncccn1
BBV-058002
2,5-DIMETHYL-1-[2-(MORPHOLIN-4-YL)ETHYL]-1H-PYRROLE-3-CARBALDEHYDE
CAS:887694-84-0
Cc1cc(C=O)c(C)n1CCN1CCOCC1
BBV-065417
2,5-DIMETHYL-1H-1,3-BENZODIAZOLE; NITRIC ACID
CAS:1955547-65-5
O[N+]([O-])=O.Cc1nc2cc(C)ccc2[nH]1
BBV-45879963
2,5-DIMETHYL-N-(PIPERIDIN-4-YL)FURAN-3-CARBOXAMIDE
CAS:954571-50-7
Cc1cc(C(=O)NC2CCNCC2)c(C)o1
BBV-035508
2,5-DIMETHYL-N-(PROPAN-2-YL)ANILINE
CAS:1021133-01-6
CC(C)Nc1cc(C)ccc1C
BBV-136822
2,5-DIMETHYLBENZOYL CHLORIDE
CAS:22328-43-4
Cc1ccc(C)c(c1)C(Cl)=O
BBV-186714
2,5-DIMETHYLFURAN-3-CARBALDEHYDE
CAS:54583-69-6
Cc1cc(C=O)c(C)o1
BBV-36828107
2,5-DIMETHYLIMIDAZO[1,2-A]PYRIDINE
CAS:6188-30-3
Cc1cn2c(C)cccc2n1
BBV-2064807
2,5-DIMETHYLMORPHOLINE-4-SULFONYL CHLORIDE
CAS:1216297-22-1
CC1CN(C(C)CO1)S(Cl)(=O)=O
BBV-25170897
2,5-DIMETHYLPYRIMIDIN-4-AMINE
CAS:73-70-1
Cc1cnc(C)nc1N
BBV-38313382
2,5-DIMETHYLTHIOPHENE-3-CARBALDEHYDE
CAS:26421-44-3
Cc1cc(C=O)c(C)s1
BBV-182269
2,5-DIOXOPYRROLIDIN-1-YL PROPANOATE
CAS:30364-55-7
CCC(=O)ON1C(=O)CCC1=O
BBV-38264490
2,6,6-TRIMETHYL-4,5,6,7-TETRAHYDRO-1-BENZOFURAN-4-AMINE
CAS:1016796-75-0
Cc1cc2C(N)CC(C)(C)Cc2o1
BBV-071005
2,6,6-TRIOXO-1H,2H,5H,7H,8H-6?6,1-[1?6]THIOPYRANO[4,3-B]PYRIDINE-3-CARBOXYLIC ACID
CAS:1249349-29-8
OC(=O)c1cc2CS(=O)(=O)CCc2[nH]c1=O
BBV-33322305
2,6-DI-TERT-BUTYLPYRIMIDIN-4-AMINE
CAS:69050-90-4
CC(C)(C)c1cc(N)nc(n1)C(C)(C)C
BBV-33453210
2,6-DIBROMO-4-FLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:954273-63-3
Fc1cc(Br)c(c(Br)c1)S(Cl)(=O)=O
BBV-031879
2,6-DIBROMOPYRAZINE
CAS:23229-25-6
Brc1cncc(Br)n1
BBV-40200635
2,6-DIBROMOPYRIDINE-3-CARBONITRILE
CAS:53367-52-5
Brc1ccc(C#N)c(Br)n1
BBV-40256768
2,6-DIBROMOPYRIDINE-4-CARBONITRILE
CAS:408352-58-9
Brc1cc(cc(Br)n1)C#N
BBV-40210805
2,6-DICHLORO-3-(CHLOROMETHYL)PYRIDINE
CAS:41789-37-1
ClCc1ccc(Cl)nc1Cl
BBV-38291558
2,6-DICHLORO-3-(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:686780-74-5
Cl.ClCc1ccc(Cl)nc1Cl
BBV-47852046
2,6-DICHLORO-3-(ETHANESULFONYL)BENZOIC ACID
CAS:1094238-17-1
CCS(=O)(=O)c1ccc(Cl)c(C(O)=O)c1Cl
BBV-2080046
2,6-DICHLORO-3-(METHYLSULFAMOYL)BENZOIC ACID
CAS:716360-56-4
CNS(=O)(=O)c1ccc(Cl)c(C(O)=O)c1Cl
BBV-441894
2,6-DICHLORO-3-METHANESULFONYLBENZOIC ACID
CAS:1094404-69-9
CS(=O)(=O)c1ccc(Cl)c(C(O)=O)c1Cl
BBV-2080061
2,6-DICHLORO-3-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:64063-38-3
Cc1ccc(Cl)c(c1Cl)S(Cl)(=O)=O
BBV-005554
2,6-DICHLORO-3-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:276702-53-5
[O-][N+](=O)c1ccc(Cl)c(c1Cl)S(Cl)(=O)=O
BBV-45178014
2,6-DICHLORO-3-SULFAMOYLBENZOIC ACID
CAS:72290-28-9
NS(=O)(=O)c1ccc(Cl)c(C(O)=O)c1Cl
BBV-011199
2,6-DICHLORO-4-IODOPYRIDINE-3-CARBOXYLIC ACID
CAS:343781-55-5
OC(=O)c1c(Cl)nc(Cl)cc1I
BBV-32587188
2,6-DICHLORO-4-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:74875-17-5
[O-][N+](=O)c1cc(Cl)c(c(Cl)c1)S(Cl)(=O)=O
BBV-032535
2,6-DICHLORO-N-METHYLANILINE
CAS:56462-00-1
CNc1c(Cl)cccc1Cl
BBV-36857957
2,6-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1423029-60-0
Cl.CNc1c(Cl)cccc1Cl
BBV-42019789
2,6-DICHLOROBENZENE-1-CARBOTHIOAMIDE
CAS:1918-13-4
NC(=S)c1c(Cl)cccc1Cl
BBV-2069314
2,6-DICHLOROBENZOHYDRAZIDE
CAS:867151-44-8
NNC(=O)c1c(Cl)cccc1Cl
BBV-044252
2,6-DICHLOROPYRIDIN-4-OL
CAS:17228-74-9
Oc1cc(Cl)nc(Cl)c1
BBV-38278795
2,6-DIETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:91920-30-8
CCc1cccc(CC)c1S(Cl)(=O)=O
BBV-38782973
2,6-DIETHYLPYRAZINE
CAS:13067-27-1
CCc1cncc(CC)n1
BBV-38344539
2,6-DIFLUORO-3-METHANESULFONYLBENZOIC ACID
CAS:845617-17-6
CS(=O)(=O)c1ccc(F)c(C(O)=O)c1F
BBV-2080573
2,6-DIFLUORO-3-METHYLANILINE
CAS:144851-63-8
Cc1ccc(F)c(N)c1F
BBV-38372667
2,6-DIFLUORO-3-SULFAMOYLBENZOIC ACID
CAS:926231-44-9
NS(=O)(=O)c1ccc(F)c(C(O)=O)c1F
BBV-013352
2,6-DIFLUORO-4-(HYDROXYMETHYL)PHENOL
CAS:206198-07-4
OCc1cc(F)c(O)c(F)c1
BBV-38290467
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:1309597-24-7
OC(=O)c1c(F)cc(cc1F)C(F)(F)F
BBV-55246726
2,6-DIFLUORO-4-IODOPYRIDINE
CAS:685517-71-9
Fc1cc(I)cc(F)n1
BBV-40199622
2,6-DIFLUORO-4-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:1178498-86-6
COc1cc(F)c(c(F)c1)S(Cl)(=O)=O
BBV-32208552
2,6-DIFLUORO-4-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:1602025-95-5
Cc1cc(F)c(c(F)c1)S(Cl)(=O)=O
BBV-46659187
2,6-DIFLUORO-4-NITROBENZALDEHYDE
CAS:1260825-63-5
[O-][N+](=O)c1cc(F)c(C=O)c(F)c1
BBV-39715216
2,6-DIFLUORO-N-(1H-PYRAZOL-3-YL)BENZAMIDE
CAS:1249343-86-9
Fc1cccc(F)c1C(=O)Nc1cc[nH]n1
BBV-32868224
2,6-DIFLUORO-N-METHYLANILINE
CAS:55847-14-8
CNc1c(F)cccc1F
BBV-207210
2,6-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1193390-17-8
Cl.CNc1c(F)cccc1F
BBV-51258179
2,6-DIFLUOROBENZENE-1-CARBOTHIOAMIDE
CAS:60230-33-3
NC(=S)c1c(F)cccc1F
BBV-049394
2,6-DIFLUOROBENZOYL ISOCYANATE
CAS:60731-73-9
Fc1cccc(F)c1C(=O)N=C=O
BBV-108667378
2,6-DIFLUOROPHENOL
CAS:28177-48-2
Oc1c(F)cccc1F
BBV-34552039
2,6-DIFLUOROPYRIDINE-3-SULFONYL CHLORIDE
CAS:1261843-52-0
Fc1ccc(c(F)n1)S(Cl)(=O)=O
BBV-38366925
2,6-DIHYDROXYBENZALDEHYDE
CAS:387-46-2
Oc1cccc(O)c1C=O
BBV-38268633
2,6-DIMETHOXY-3-SULFAMOYLBENZOIC ACID
CAS:874841-12-0
COc1ccc(c(OC)c1C(O)=O)S(N)(=O)=O
BBV-015733
2,6-DIMETHOXYBENZOHYDRAZIDE
CAS:671191-06-3
COc1cccc(OC)c1C(=O)NN
BBV-045948
2,6-DIMETHOXYPYRAZINE
CAS:4774-15-6
COc1cncc(OC)n1
BBV-38278808
2,6-DIMETHOXYPYRIDIN-3-AMINE
CAS:28020-37-3
COc1ccc(N)c(OC)n1
BBV-14848863
2,6-DIMETHOXYPYRIDINE-4-CARBOXYLIC ACID
CAS:6274-82-4
COc1cc(cc(OC)n1)C(O)=O
BBV-108670870
2,6-DIMETHYL-1,4-DIHYDROPYRIDIN-4-ONE
CAS:7516-31-6
Cc1cc(=O)cc(C)[nH]1
BBV-38363932
2,6-DIMETHYL-1-(2-METHYLPHENYL)PIPERAZINE
CAS:1017202-79-7
CC1CNCC(C)N1c1ccccc1C
BBV-45170595
2,6-DIMETHYL-1-(2-METHYLPHENYL)PIPERAZINE DIHYDROCHLORIDE
CAS:1909348-51-1
Cl.Cl.CC1CNCC(C)N1c1ccccc1C
BBV-45923109
2,6-DIMETHYL-1-(PROPAN-2-YL)PIPERAZINE
CAS:1017366-56-1
CC(C)N1C(C)CNCC1C
BBV-38121865
2,6-DIMETHYL-1?4,4-THIOMORPHOLIN-1-ONE
CAS:1483208-65-6
CC1CNCC(C)S1=O
BBV-41522915
2,6-DIMETHYL-1?4,4-THIOMORPHOLIN-1-ONE HYDROCHLORIDE
CAS:1803594-06-0
Cl.CC1CNCC(C)S1=O
BBV-57279659
2,6-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-AMINE
CAS:1225478-65-8
CC1Cc2ccc(C)cc2C1N
BBV-39785607
2,6-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-AMINE HYDROCHLORIDE
CAS:1443981-23-4
Cl.CC1Cc2ccc(C)cc2C1N
BBV-44122748
2,6-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:66309-83-9
CC1Cc2ccc(C)cc2C1=O
BBV-39777811
2,6-DIMETHYL-3-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:69383-57-9
Cc1ccc(c(C)c1S(Cl)(=O)=O)[N+]([O-])=O
BBV-38785814
2,6-DIMETHYL-3-NITROBENZOIC ACID
CAS:6307-70-6
Cc1ccc(c(C)c1C(O)=O)[N+]([O-])=O
BBV-38304374
2,6-DIMETHYL-4-(PIPERIDIN-4-YL)MORPHOLINE
CAS:551923-15-0
CC1CN(CC(C)O1)C1CCNCC1
BBV-064044
2,6-DIMETHYL-4-(PIPERIDIN-4-YL)MORPHOLINE DIHYDROCHLORIDE
CAS:1181457-91-9
Cl.Cl.CC1CN(CC(C)O1)C1CCNCC1
BBV-45438941
2,6-DIMETHYL-4-(PYRROLIDIN-2-YLMETHYL)MORPHOLINE
CAS:1212315-86-0
CC1CN(CC2CCCN2)CC(C)O1
BBV-152838
2,6-DIMETHYLBENZENE-1,4-DIAMINE
CAS:7218-02-2
Cc1cc(N)cc(C)c1N
BBV-38373969
2,6-DIMETHYLBENZENE-1,4-DIAMINE DIHYDROCHLORIDE
CAS:56496-89-0
Cl.Cl.Cc1cc(N)cc(C)c1N
BBV-33377994
2,6-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:2905-29-5
Cc1cccc(C)c1S(Cl)(=O)=O
BBV-034703
2,6-DIMETHYLCYCLOHEXAN-1-AMINE
CAS:6850-63-1
CC1CCCC(C)C1N
BBV-011398
2,6-DIMETHYLCYCLOHEXAN-1-AMINE HYDROCHLORIDE
CAS:192703-30-3
Cl.CC1CCCC(C)C1N
BBV-53003768
2,6-DIMETHYLHEPTAN-4-AMINE
CAS:65530-92-9
CC(C)CC(N)CC(C)C
BBV-158390
2,6-DIMETHYLHEPTAN-4-AMINE HYDROCHLORIDE
CAS:130996-65-5
Cl.CC(C)CC(N)CC(C)C
BBV-27085094
2,6-DIMETHYLMORPHOLIN-3-ONE
CAS:93240-61-0
CC1CNC(=O)C(C)O1
BBV-39753182
2,6-DIMETHYLOXAN-4-OL
CAS:41866-70-0
CC1CC(O)CC(C)O1
BBV-39788246
2,6-DIMETHYLPIPERIDIN-4-AMINE
CAS:1314916-14-7
CC1CC(N)CC(C)N1
BBV-063601
2,6-DIMETHYLPIPERIDIN-4-ONE
CAS:45717-87-1
CC1CC(=O)CC(C)N1
BBV-38395439
2,6-DIMETHYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:1005397-62-5
Cl.CC1CC(=O)CC(C)N1
BBV-40216131
2,6-DIMETHYLPYRIDINE-3-CARBOXYLIC ACID
CAS:5860-71-9
Cc1ccc(C(O)=O)c(C)n1
BBV-058025
2,6-DIMETHYLPYRIMIDINE-4-CARBOXYLIC ACID
CAS:54198-74-2
Cc1cc(nc(C)n1)C(O)=O
BBV-34702866
2,6-DIOXASPIRO[4.5]DECAN-9-AMINE
CAS:1343024-86-1
NC1CCOC2(CCOC2)C1
BBV-38461306
2,6-DIOXASPIRO[4.5]DECAN-9-OL
CAS:1342244-16-9
OC1CCOC2(CCOC2)C1
BBV-38461182
2,6-DIOXASPIRO[4.5]DECAN-9-YLMETHANAMINE
CAS:1466239-93-9
NCC1CCOC2(CCOC2)C1
BBV-42821096
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBOXAMIDE
CAS:769-97-1
NC(=O)c1cc(=O)[nH]c(=O)[nH]1
BBV-38773086
2,6-DIOXOPIPERIDINE-4-CARBOXYLIC ACID
CAS:6973-55-3
OC(=O)C1CC(=O)NC(=O)C1
BBV-090384
2,7-DIAZASPIRO[4.4]NONAN-3-ONE
CAS:1226550-00-0
O=C1CC2(CCNC2)CN1
BBV-38406999
2,7-DIAZASPIRO[4.4]NONAN-3-ONE HYDROCHLORIDE
CAS:1393330-70-5
Cl.O=C1CC2(CCNC2)CN1
BBV-43024476
2,7-DIMETHYL-1H-INDOLE
CAS:5621-13-6
Cc1cc2cccc(C)c2[nH]1
BBV-38273590
2,8,8-TRIMETHYL-1,9-DIOXA-4-AZASPIRO[5.5]UNDECANE
CAS:1496715-13-9
CC1CNCC2(CCOC(C)(C)C2)O1
BBV-39853196
2,8-DIAZASPIRO[4.5]DECAN-1-ONE
CAS:546086-95-7
O=C1NCCC11CCNCC1
BBV-39698351
2,8-DIAZASPIRO[4.5]DECAN-1-ONE HYDROCHLORIDE
CAS:832710-65-3
Cl.O=C1NCCC11CCNCC1
BBV-108666878
2,8-DIAZASPIRO[5.5]UNDECANE
CAS:180-50-7
C1CNCC2(C1)CCCNC2
BBV-38273059
2,8-DICHLORO-6-FLUOROQUINOLINE
CAS:1342015-45-5
Fc1cc(Cl)c2nc(Cl)ccc2c1
BBV-38489272
2,8-DIMETHYL-1,9-DIOXA-4-AZASPIRO[5.5]UNDECANE
CAS:1562038-48-5
CC1CNCC2(CCOC(C)C2)O1
BBV-39853155
2,8-DIOXASPIRO[4.5]DECANE-1,3-DIONE
CAS:5270-49-5
O=C1CC2(CCOCC2)C(=O)O1
BBV-27035301
2,9-DIAZATRICYCLO[8.4.0.0,6]TETRADECA-1(14),10,12-TRIEN-8-ONE
CAS:1432681-05-4
O=C1CC2CCCN2c2ccccc2N1
BBV-37011562
2-({[(1R)-1-PHENYLETHYL]AMINO}METHYL)-3,4-DIHYDROQUINAZOLIN-4-ONE
CAS:1406392-75-3
C[C@@H](NCc1nc2ccccc2c(=O)[nH]1)c1ccccc1
BBV-38068388
2-({[(1S)-1-PHENYLETHYL]AMINO}METHYL)-3,4-DIHYDROQUINAZOLIN-4-ONE
CAS:1410018-54-0
C[C@H](NCc1nc2ccccc2c(=O)[nH]1)c1ccccc1
BBV-38068304
2-({[(3-BROMOPHENYL)CARBAMOYL]METHYL}SULFANYL)ACETIC ACID
CAS:914630-14-1
OC(=O)CSCC(=O)Nc1cccc(Br)c1
BBV-049146
2-({[(3-BROMOPHENYL)CARBAMOYL]METHYL}SULFANYL)PROPANOIC ACID
CAS:1016786-75-6
CC(SCC(=O)Nc1cccc(Br)c1)C(O)=O
BBV-083512
2-({[(3-BROMOPHENYL)METHYL]CARBAMOYL}AMINO)-2-METHYLPROPANOIC ACID
CAS:953726-14-2
CC(C)(NC(=O)NCc1cccc(Br)c1)C(O)=O
BBV-025499
2-({[(3-BROMOPHENYL)METHYL]CARBAMOYL}AMINO)PENTANOIC ACID
CAS:1396962-27-8
CCCC(NC(=O)NCc1cccc(Br)c1)C(O)=O
BBV-031646
2-({[(4-BROMOPHENYL)CARBAMOYL]METHYL}SULFANYL)PROPANOIC ACID
CAS:919466-75-4
CC(SCC(=O)Nc1ccc(Br)cc1)C(O)=O
BBV-074771
2-({[(4-BROMOPHENYL)METHYL]CARBAMOYL}AMINO)PENTANOIC ACID
CAS:1396965-91-5
CCCC(NC(=O)NCc1ccc(Br)cc1)C(O)=O
BBV-052240
2-({[(4-CHLOROPHENYL)METHYL]CARBAMOYL}AMINO)ACETIC ACID
CAS:1016730-04-3
OC(=O)CNC(=O)NCc1ccc(Cl)cc1
BBV-040627
2-({[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}METHYL)-1,3-THIAZOLE-4-CARBOXYLIC ACID
CAS:182120-85-0
OC(=O)c1csc(CNC(=O)OCC2c3ccccc3-c3ccccc23)n1
BBV-41693177
2-({[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}METHYL)-3-METHYLBUTANOIC ACID
CAS:180181-98-0
CC(C)C(CNC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O
BBV-40089966
2-({[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}METHYL)BUTANOIC ACID
CAS:180181-95-7
CCC(CNC(=O)OCC1c2ccccc2-c2ccccc12)C(O)=O
BBV-40045473
2-({[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}METHYL)PYRIDINE-4-CARBOXYLIC ACID
CAS:1514977-42-4
OC(=O)c1ccnc(CNC(=O)OCC2c3ccccc3-c3ccccc23)c1
BBV-15822564
2-({[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}OXY)ACETIC ACID
CAS:123106-21-8
OC(=O)CONC(=O)OCC1c2ccccc2-c2ccccc12
BBV-38118889
2-({[(TERT-BUTOXY)CARBONYL]AMINO}METHYL)-3-METHYLBUTANOIC ACID
CAS:1233517-91-3
CC(C)C(CNC(=O)OC(C)(C)C)C(O)=O
BBV-40044560
2-({[(TERT-BUTOXY)CARBONYL]AMINO}METHYL)-3-METHYLBUTANOIC ACID HYDROCHLORIDE
CAS:1858241-73-2
Cl.CC(C)C(CNC(=O)OC(C)(C)C)C(O)=O
BBV-33214432
2-({[(TERT-BUTOXY)CARBONYL]AMINO}OXY)ACETIC ACID
CAS:42989-85-5
CC(C)(C)OC(=O)NOCC(O)=O
BBV-38112389
2-({[1-(5-BROMOTHIOPHEN-2-YL)ETHYLIDENE]AMINO}OXY)ACETIC ACID
CAS:847781-96-8
CC(=NOCC(O)=O)c1ccc(Br)s1
BBV-001847
2-({[1-(DIFLUOROMETHYL)-1H-IMIDAZOL-2-YL]METHYL}(1,1-DIOXO-1?6-THIOLAN-3-YL)AMINO)ACETIC ACID
CAS:1184412-47-2
OC(=O)CN(Cc1nccn1C(F)F)C1CCS(=O)(=O)C1
BBV-29427248
2-({[4-(BENZYLOXY)PHENYL]METHYL}AMINO)ACETAMIDE
CAS:774506-05-7
NC(=O)CNCc1ccc(OCc2ccccc2)cc1
BBV-007676
2-({[5-(4-CHLOROPHENYL)-1,3-OXAZOL-2-YL]METHYL}SULFANYL)PROPANOIC ACID
CAS:1094685-51-4
CC(SCc1ncc(o1)-c1ccc(Cl)cc1)C(O)=O
BBV-38773967
2-({[5-(THIOPHEN-2-YL)-1,2-OXAZOL-3-YL]METHYL}SULFANYL)ACETIC ACID
CAS:923721-92-0
OC(=O)CSCc1cc(on1)-c1cccs1
BBV-29347691
2-({1-[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]PIPERIDIN-4-YL}OXY)ACETIC ACID
CAS:1341147-06-5
OC(=O)COC1CCN(CC1)C(=O)OCC1c2ccccc2-c2ccccc12
BBV-36763143
2-({1-[4-(TRIFLUOROMETHYL)PHENYL]-1H-IMIDAZOL-2-YL}SULFANYL)ACETIC ACID
CAS:1038335-12-4
OC(=O)CSc1nccn1-c1ccc(cc1)C(F)(F)F
BBV-257045
2-({4-AMINO-5-[4-(TRIFLUOROMETHYL)PHENYL]-4H-1,2,4-TRIAZOL-3-YL}SULFANYL)ACETIC ACID
CAS:1038305-08-6
Nn1c(SCC(O)=O)nnc1-c1ccc(cc1)C(F)(F)F
BBV-260812
2-({4-METHYL-5,12-DITHIA-3-AZATRICYCLO[7.3.0.0,6]DODECA-1,3,6,8,10-PENTAEN-8-YL}OXY)ACETIC ACID
CAS:926211-05-4
Cc1nc2c(cc(OCC(O)=O)c3ccsc23)s1
BBV-010152
2-({5,7-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-3-YL}FORMAMIDO)ACETIC ACID
CAS:1094463-86-1
Cc1cc(C)n2ncc(C(=O)NCC(O)=O)c2n1
BBV-41456803
2-({6-ETHYLTHIENO[2,3-D]PYRIMIDIN-4-YL}AMINO)ACETIC ACID
CAS:313534-29-1
CCc1cc2c(NCC(O)=O)ncnc2s1
BBV-27099649
2-({THIENO[2,3-D]PYRIMIDIN-4-YL}AMINO)ACETAMIDE
CAS:1094306-75-8
NC(=O)CNc1ncnc2sccc12
BBV-2065792
2-(1,1-DIOXO-1?6,2-THIAZINAN-2-YL)ACETIC ACID
CAS:89676-96-0
OC(=O)CN1CCCCS1(=O)=O
BBV-108660034
2-(1,1-DIOXO-1?6,2-THIAZOLIDIN-2-YL)-3-METHYLBUTANOIC ACID
CAS:1016729-63-7
CC(C)C(N1CCCS1(=O)=O)C(O)=O
BBV-058349
2-(1,1-DIOXO-1?6,2-THIAZOLIDIN-2-YL)ACETIC ACID
CAS:63459-24-5
OC(=O)CN1CCCS1(=O)=O
BBV-059370
2-(1,1-DIOXO-1?6,2-THIAZOLIDIN-2-YL)HEXANOIC ACID
CAS:1218238-57-3
CCCCC(N1CCCS1(=O)=O)C(O)=O
BBV-22279736
2-(1,1-DIOXO-1?6,4-THIOMORPHOLIN-4-YL)-2-METHYLPROPANOIC ACID
CAS:1249219-78-0
CC(C)(N1CCS(=O)(=O)CC1)C(O)=O
BBV-32617093
2-(1,1-DIOXO-1?6,4-THIOMORPHOLIN-4-YL)-2-PHENYLACETIC ACID
CAS:446276-14-8
OC(=O)C(N1CCS(=O)(=O)CC1)c1ccccc1
BBV-47988534
2-(1,1-DIOXO-1?6,4-THIOMORPHOLIN-4-YL)ACETONITRILE
CAS:79207-43-5
O=S1(=O)CCN(CC#N)CC1
BBV-25209234
2-(1,1-DIOXO-1?6-THIAN-3-YL)ACETIC ACID
CAS:1340400-77-2
OC(=O)CC1CCCS(=O)(=O)C1
BBV-38121930
2-(1,1-DIOXO-1?6-THIAN-4-YL)-2-HYDROXYACETIC ACID
CAS:1369320-59-1
OC(C1CCS(=O)(=O)CC1)C(O)=O
BBV-34402386
2-(1,1-DIOXO-1?6-THIAN-4-YL)ACETIC ACID
CAS:1224869-02-6
OC(=O)CC1CCS(=O)(=O)CC1
BBV-33180405
2-(1,1-DIOXO-1?6-THIOLANE-3-SULFONAMIDO)ACETIC ACID
CAS:926248-43-3
OC(=O)CNS(=O)(=O)C1CCS(=O)(=O)C1
BBV-006196
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-1-YL)ACETIC ACID
CAS:105400-81-5
OC(=O)CC1NCCc2ccccc12
BBV-000126
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-1-YL)ACETIC ACID HYDROCHLORIDE
CAS:53014-68-9
Cl.OC(=O)CC1NCCc2ccccc12
BBV-51674292
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)ACETONITRILE
CAS:91349-97-2
N#CCN1CCc2ccccc2C1
BBV-073609
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)ANILINE
CAS:246247-91-6
Nc1ccccc1N1CCc2ccccc2C1
BBV-004817
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)BUTAN-1-AMINE
CAS:954578-49-5
CCC(CN)N1CCc2ccccc2C1
BBV-035864
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)ETHAN-1-OL
CAS:88014-15-7
OCCN1CCc2ccccc2C1
BBV-24916971
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)PROPAN-1-AMINE
CAS:900718-17-4
CC(CN)N1CCc2ccccc2C1
BBV-032499
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)PROPAN-1-AMINE DIHYDROCHLORIDE
CAS:1170257-73-4
Cl.Cl.CC(CN)N1CCc2ccccc2C1
BBV-90833519
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)PROPAN-1-AMINE HYDROCHLORIDE
CAS:1172938-80-5
Cl.CC(CN)N1CCc2ccccc2C1
BBV-60755012
2-(1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)QUINOLIN-6-AMINE
CAS:1154583-56-8
Nc1ccc2nc(ccc2c1)N1CCc2ccccc2C1
BBV-22164965
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YL)ACETIC ACID
CAS:63328-17-6
OC(=O)CC1CCCc2ccccc12
BBV-193021
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YL)ETHANIMIDAMIDE HYDROCHLORIDE
CAS:1384557-75-8
Cl.NC(=N)CC1CCCc2ccccc12
BBV-473427
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YL)PYRROLIDINE
CAS:95092-06-1
C1CNC(C1)c1cccc2ccccc12
BBV-34591268
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YLOXY)ACETAMIDE
CAS:1250301-40-6
NC(=O)COC1CCCc2ccccc12
BBV-33394711
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-1-YLOXY)ACETIC ACID
CAS:120681-00-7
OC(=O)COC1CCCc2ccccc12
BBV-061886
2-(1,2,3,4-TETRAHYDRONAPHTHALEN-2-YL)ACETIC ACID
CAS:147384-05-2
OC(=O)CC1CCc2ccccc2C1
BBV-29375404
2-(1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ETHAN-1-AMINE
CAS:37481-18-8
NCCN1CCCc2ccccc12
BBV-022180
2-(1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:890713-92-5
Cl.Cl.NCCN1CCCc2ccccc12
BBV-56321518
2-(1,2,3,4-TETRAHYDROQUINOLIN-1-YL)ETHAN-1-OL
CAS:52704-48-0
OCCN1CCCc2ccccc12
BBV-24916999
2-(1,2,4-OXADIAZOL-3-YL)ETHAN-1-AMINE
CAS:856311-41-6
NCCc1ncon1
BBV-32669216
2-(1,2,4-OXADIAZOL-3-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1315365-77-5
Cl.NCCc1ncon1
BBV-39894735
2-(1,2,4-OXADIAZOL-3-YL)PROPAN-2-AMINE
CAS:1153757-41-5
CC(C)(N)c1ncon1
BBV-25186410
2-(1,2,4-OXADIAZOL-5-YL)ETHAN-1-AMINE
CAS:1083396-12-6
NCCc1ncno1
BBV-32491499
2-(1,2,4-OXADIAZOL-5-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1384430-69-6
Cl.NCCc1ncno1
BBV-57276657
2-(1,2,4-OXADIAZOL-5-YL)PROPAN-2-AMINE
CAS:1249127-64-7
CC(C)(N)c1ncno1
BBV-32617073
2-(1,2,4-OXADIAZOL-5-YL)PROPAN-2-AMINE; TRIFLUOROACETIC ACID
CAS:1909337-38-7
OC(=O)C(F)(F)F.CC(C)(N)c1ncno1
BBV-32138927
2-(1,2-BENZOXAZOL-3-YL)ACETAMIDE
CAS:23008-68-6
NC(=O)Cc1noc2ccccc12
BBV-46882763
2-(1,2-OXAZOL-3-YLOXY)ACETIC ACID
CAS:56674-47-6
OC(=O)COc1ccon1
BBV-38412304
2-(1,2-OXAZOL-4-YL)ACETIC ACID
CAS:141679-57-4
OC(=O)Cc1cnoc1
BBV-108666198
2-(1,2-OXAZOL-4-YL)BENZENE-1-SULFONYL CHLORIDE
CAS:87488-71-9
ClS(=O)(=O)c1ccccc1-c1cnoc1
BBV-38366220
2-(1,2-OXAZOL-4-YL)ETHAN-1-AMINE
CAS:933726-31-9
NCCc1cnoc1
BBV-34342478
2-(1,2-OXAZOL-4-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1187928-51-3
Cl.NCCc1cnoc1
BBV-70354971
2-(1,2-OXAZOL-5-YL)BENZENE-1-SULFONYL CHLORIDE
CAS:87488-64-0
ClS(=O)(=O)c1ccccc1-c1ccno1
BBV-38366221
2-(1,2-OXAZOL-5-YL)PYRIDINE
CAS:1314809-76-1
c1cc(on1)-c1ccccn1
BBV-39860964
2-(1,2-THIAZOL-5-YL)ETHAN-1-OL
CAS:1009068-65-8
OCCc1ccns1
BBV-108674589
2-(1,3,4-THIADIAZOL-2-YL)ACETIC ACID
CAS:154022-92-1
OC(=O)Cc1nncs1
BBV-50505330
2-(1,3,4-THIADIAZOL-2-YL)ETHAN-1-AMINE
CAS:1097305-12-8
NCCc1nncs1
BBV-38474411
2-(1,3,4-THIADIAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1523571-16-5
Cl.Cl.NCCc1nncs1
BBV-128054220
2-(1,3,4-THIADIAZOL-2-YLSULFANYL)ACETIC ACID
CAS:53030-41-4
OC(=O)CSc1nncs1
BBV-021245
2-(1,3,4-THIADIAZOL-2-YLSULFANYL)PROPANOIC ACID
CAS:893745-58-9
CC(Sc1nncs1)C(O)=O
BBV-028629
2-(1,3-BENZOTHIAZOL-2-YL)PROPAN-2-AMINE
CAS:157763-14-9
CC(C)(N)c1nc2ccccc2s1
BBV-32473709
2-(1,3-BENZOTHIAZOL-2-YLSULFANYL)-3-METHYLBUTANOIC ACID
CAS:3383-64-0
CC(C)C(Sc1nc2ccccc2s1)C(O)=O
BBV-091992
2-(1,3-BENZOTHIAZOL-2-YLSULFANYL)PROPANOIC ACID
CAS:3383-66-2
CC(Sc1nc2ccccc2s1)C(O)=O
BBV-025274
2-(1,3-BENZOXAZOL-2-YL)ETHAN-1-AMINE
CAS:623553-29-7
NCCc1nc2ccccc2o1
BBV-182541
2-(1,3-BENZOXAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1803606-67-8
Cl.Cl.NCCc1nc2ccccc2o1
BBV-45751626
2-(1,3-BENZOXAZOL-2-YL)PROPAN-1-AMINE
CAS:1249255-95-5
CC(CN)c1nc2ccccc2o1
BBV-34566028
2-(1,3-DIMETHYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE
CAS:1007461-03-1
Cc1nn(C)cc1CCN
BBV-38268175
2-(1,3-DIMETHYL-2,6-DIOXO-2,3,6,7-TETRAHYDRO-1H-PURIN-7-YL)ETHYL 2-(4-CHLOROPHENOXY)-2-METHYLPROPANOATE
CAS:54504-70-0
Cn1c2ncn(CCOC(=O)C(C)(C)Oc3ccc(Cl)cc3)c2c(=O)n(C)c
BBV-50512486
2-(1,3-DIOXO-2,3-DIHYDRO-1H-ISOINDOL-2-YL)ACETALDEHYDE
CAS:2913-97-5
O=CCN1C(=O)c2ccccc2C1=O
BBV-33751538
2-(1,3-OXAZOL-2-YL)ANILINE
CAS:62882-10-4
Nc1ccccc1-c1ncco1
BBV-32867809
2-(1,3-THIAZOL-2-YL)-2,3-DIHYDRO-1H-ISOINDOL-4-AMINE
CAS:1017462-59-7
Nc1cccc2CN(Cc12)c1nccs1
BBV-60160353
2-(1,3-THIAZOL-2-YL)-2,3-DIHYDRO-1H-ISOINDOLE-4-SULFONYL CHLORIDE
CAS:1553985-64-0
ClS(=O)(=O)c1cccc2CN(Cc12)c1nccs1
BBV-32302517
2-(1,3-THIAZOL-2-YL)ACETIC ACID
CAS:188937-16-8
OC(=O)Cc1nccs1
BBV-27140788
2-(1,3-THIAZOL-2-YL)ANILINE
CAS:923946-90-1
Nc1ccccc1-c1nccs1
BBV-33532174
2-(1,3-THIAZOL-2-YL)ETHAN-1-AMINE
CAS:18453-07-1
NCCc1nccs1
BBV-156620
2-(1,3-THIAZOL-2-YL)ETHAN-1-OL
CAS:89323-88-6
OCCc1nccs1
BBV-39728814
2-(1,3-THIAZOL-2-YL)PHENOL
CAS:83053-38-7
Oc1ccccc1-c1nccs1
BBV-32865429
2-(1,3-THIAZOL-2-YL)PROPANENITRILE
CAS:101010-75-7
CC(C#N)c1nccs1
BBV-39768296
2-(1,3-THIAZOL-4-YL)-1H-1,3-BENZODIAZOL-5-AMINE
CAS:25893-06-5
Nc1ccc2[nH]c(nc2c1)-c1cscn1
BBV-009385
2-(1,3-THIAZOL-4-YL)ACETIC ACID
CAS:7504-44-1
OC(=O)Cc1cscn1
BBV-32606546
2-(1,3-THIAZOL-4-YL)ETHAN-1-OL
CAS:180207-28-7
OCCc1cscn1
BBV-40026336
2-(1,3-THIAZOL-5-YL)ACETIC ACID
CAS:52454-63-4
OC(=O)Cc1cncs1
BBV-38295487
2-(1,3-THIAZOL-5-YL)ETHAN-1-AMINE
CAS:7728-77-0
NCCc1cncs1
BBV-34708830
2-(1,3-THIAZOL-5-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:7730-82-7
Cl.Cl.NCCc1cncs1
BBV-616713
2-(1,3-THIAZOL-5-YL)ETHAN-1-OL
CAS:5664-55-1
OCCc1cncs1
BBV-38332706
2-(1,3-THIAZOL-5-YL)PYRIMIDIN-4-AMINE
CAS:1511717-05-7
Nc1ccnc(n1)-c1cncs1
BBV-42963904
2-(1,4-DIAZEPAN-1-YL)-1-(PYRROLIDIN-1-YL)ETHAN-1-ONE
CAS:55829-42-0
O=C(CN1CCCNCC1)N1CCCC1
BBV-009605
2-(1,4-DIAZEPAN-1-YL)-1H-1,3-BENZODIAZOLE
CAS:692724-14-4
C1CNCCN(C1)c1nc2ccccc2[nH]1
BBV-32124288
2-(1,4-DIAZEPAN-1-YL)-1H-1,3-BENZODIAZOLE DIHYDROCHLORIDE
CAS:1240526-56-0
Cl.Cl.C1CNCCN(C1)c1nc2ccccc2[nH]1
BBV-57273399
2-(1,4-DIAZEPAN-1-YL)-N,N-DIETHYLACETAMIDE
CAS:87055-46-7
CCN(CC)C(=O)CN1CCCNCC1
BBV-015527
2-(1,4-DIAZEPAN-1-YL)-N,N-DIMETHYLACETAMIDE
CAS:87055-44-5
CN(C)C(=O)CN1CCCNCC1
BBV-012364
2-(1,4-DIAZEPAN-1-YL)-N-(PROP-2-YN-1-YL)ACETAMIDE
CAS:1016757-78-0
O=C(CN1CCCNCC1)NCC#C
BBV-065988
2-(1,4-DIAZEPAN-1-YL)-N-(PROP-2-YN-1-YL)ACETAMIDE DIHYDROCHLORIDE
CAS:1258650-82-6
Cl.Cl.O=C(CN1CCCNCC1)NCC#C
BBV-41797589
2-(1,4-DIAZEPAN-1-YL)-N-ETHYLACETAMIDE
CAS:87055-38-7
CCNC(=O)CN1CCCNCC1
BBV-013612
2-(1,4-DIAZEPAN-1-YL)-N-ETHYLACETAMIDE DIHYDROCHLORIDE
CAS:1172095-30-5
Cl.Cl.CCNC(=O)CN1CCCNCC1
BBV-57271629
2-(1,4-DIAZEPAN-1-YL)-N-METHYLACETAMIDE
CAS:87055-37-6
CNC(=O)CN1CCCNCC1
BBV-046381
2-(1,4-DIAZEPAN-1-YL)ACETAMIDE
CAS:147558-20-1
NC(=O)CN1CCCNCC1
BBV-006528
2-(1,4-DIAZEPAN-1-YL)ACETAMIDE DIHYDROCHLORIDE
CAS:1171720-80-1
Cl.Cl.NC(=O)CN1CCCNCC1
BBV-152132
2-(1,4-DIAZEPAN-1-YL)ACETIC ACID
CAS:1154897-96-7
OC(=O)CN1CCCNCC1
BBV-24930170
2-(1,4-DIAZEPAN-1-YL)ACETIC ACID DIHYDROCHLORIDE
CAS:1240528-26-0
Cl.Cl.OC(=O)CN1CCCNCC1
BBV-50312844
2-(1,4-DIAZEPAN-1-YL)BENZONITRILE
CAS:1020986-79-1
N#Cc1ccccc1N1CCCNCC1
BBV-154062
2-(1,4-DIAZEPAN-1-YL)BENZONITRILE HYDROCHLORIDE
CAS:1258650-73-5
Cl.N#Cc1ccccc1N1CCCNCC1
BBV-038920
2-(1,4-DIAZEPAN-1-YL)ETHAN-1-OL
CAS:53427-65-9
OCCN1CCCNCC1
BBV-021413
2-(1,4-DIAZEPAN-1-YL)PROPAN-1-OL
CAS:1184691-34-6
CC(CO)N1CCCNCC1
BBV-32353274
2-(1,4-DIAZEPAN-1-YL)PYRIDINE-3-CARBONITRILE
CAS:352018-97-4
N#Cc1cccnc1N1CCCNCC1
BBV-009928
2-(1,4-DIAZEPAN-1-YL)PYRIDINE-3-CARBONITRILE HYDROCHLORIDE
CAS:1197865-33-0
Cl.N#Cc1cccnc1N1CCCNCC1
BBV-51264003
2-(1,4-DIAZEPAN-1-YL)PYRIDINE-3-CARBOXAMIDE
CAS:954563-82-7
NC(=O)c1cccnc1N1CCCNCC1
BBV-034107
2-(1,4-OXAZEPAN-4-YL)ETHAN-1-AMINE
CAS:878155-50-1
NCCN1CCCOCC1
BBV-36759285
2-(1,5-DIMETHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE
CAS:1017325-79-9
Cc1ccc2n(C)c(CCN)nc2c1
BBV-29367757
2-(1,5-DIMETHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1305712-10-0
Cl.Cl.Cc1ccc2n(C)c(CCN)nc2c1
BBV-51574280
2-(1,5-DIMETHYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE
CAS:1007502-55-7
Cc1c(CCN)cnn1C
BBV-38297249
2-(1-{[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]AMINO}CYCLOBUTYL)ACETIC ACID
CAS:1199775-14-8
OC(=O)CC1(CCC1)NC(=O)OCC1c2ccccc2-c2ccccc12
BBV-42357647
2-(1-{[4-FLUORO-3-(TRIFLUOROMETHYL)PHENYL]METHYL}PIPERIDIN-3-YL)ETHAN-1-AMINE
CAS:1546544-78-8
NCCC1CCCN(Cc2ccc(F)c(c2)C(F)(F)F)C1
BBV-32067773
2-(1-{[METHYL(OXAN-4-YL)CARBAMOYL]METHYL}CYCLOHEXYL)ACETIC ACID
CAS:1157262-35-5
CN(C1CCOCC1)C(=O)CC1(CC(O)=O)CCCCC1
BBV-27281076
2-(1-{2,7-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-6-YL}-N-METHYLFORMAMIDO)ACETIC ACID
CAS:1098389-14-0
CN(CC(O)=O)C(=O)c1cnc2cc(C)nn2c1C
BBV-41456890
2-(1-ACETYLPIPERIDIN-2-YL)ETHANE-1-SULFONYL CHLORIDE
CAS:1248685-78-0
CC(=O)N1CCCCC1CCS(Cl)(=O)=O
BBV-32947100
2-(1-AMINO-2-ETHYLBUTYL)THIOPHENE
CAS:1019120-29-6
CCC(CC)C(N)c1cccs1
BBV-105130
2-(1-AMINO-2-ETHYLBUTYL)THIOPHENE HYDROCHLORIDE
CAS:1193387-61-9
Cl.CCC(CC)C(N)c1cccs1
BBV-50283680
2-(1-AMINOCYCLOHEXYL)-1,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1354950-74-5
Cl.NC1(CCCCC1)c1nc(=O)cc[nH]1
BBV-41414464
2-(1-AMINOCYCLOHEXYL)-1H,4H,5H,6H,7H-CYCLOPENTA[D]PYRIMIDIN-4-ONE
CAS:1334103-76-2
NC1(CCCCC1)c1nc(=O)c2CCCc2[nH]1
BBV-39893364
2-(1-AMINOCYCLOHEXYL)-1H,4H,5H,6H,7H-CYCLOPENTA[D]PYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1334002-00-4
Cl.NC1(CCCCC1)c1nc(=O)c2CCCc2[nH]1
BBV-39972312
2-(1-AMINOCYCLOHEXYL)-3,4,5,6,7,8-HEXAHYDROQUINAZOLIN-4-ONE
CAS:1274673-92-5
NC1(CCCCC1)c1nc2CCCCc2c(=O)[nH]1
BBV-37328430
2-(1-AMINOCYCLOHEXYL)-3,4,5,6,7,8-HEXAHYDROQUINAZOLIN-4-ONE HYDROCHLORIDE
CAS:1333858-04-0
Cl.NC1(CCCCC1)c1nc2CCCCc2c(=O)[nH]1
BBV-78127616
2-(1-AMINOCYCLOHEXYL)-3H,4H,5H,6H,7H,8H,9H-CYCLOHEPTA[D]PYRIMIDIN-4-ONE
CAS:1271705-10-2
NC1(CCCCC1)c1nc2CCCCCc2c(=O)[nH]1
BBV-37359199
2-(1-AMINOCYCLOHEXYL)-3H,4H,5H,6H,7H,8H,9H-CYCLOHEPTA[D]PYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1354951-20-4
Cl.NC1(CCCCC1)c1nc2CCCCCc2c(=O)[nH]1
BBV-41529422
2-(1-AMINOCYCLOHEXYL)-5-ETHYL-6-METHYL-1,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1283632-33-6
CCc1c(C)[nH]c(nc1=O)C1(N)CCCCC1
BBV-39893354
2-(1-AMINOCYCLOHEXYL)-5-ETHYL-6-METHYL-1,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333723-70-8
Cl.CCc1c(C)[nH]c(nc1=O)C1(N)CCCCC1
BBV-39972310
2-(1-AMINOCYCLOHEXYL)-6-(DIFLUOROMETHYL)-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1355584-15-4
NC1(CCCCC1)c1nc(cc(=O)[nH]1)C(F)F
BBV-37328406
2-(1-AMINOCYCLOHEXYL)-6-(METHOXYMETHYL)-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334102-42-9
COCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-37328400
2-(1-AMINOCYCLOHEXYL)-6-(METHOXYMETHYL)-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333801-90-3
Cl.COCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-39972304
2-(1-AMINOCYCLOHEXYL)-6-(PROPAN-2-YL)-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1273913-19-1
CC(C)c1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-37328424
2-(1-AMINOCYCLOHEXYL)-6-(PROPAN-2-YL)-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333688-81-5
Cl.CC(C)c1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-39972290
2-(1-AMINOCYCLOHEXYL)-6-(TRIFLUOROMETHYL)-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334203-64-3
NC1(CCCCC1)c1nc(cc(=O)[nH]1)C(F)(F)F
BBV-37328423
2-(1-AMINOCYCLOHEXYL)-6-(TRIFLUOROMETHYL)-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1334149-29-9
Cl.NC1(CCCCC1)c1nc(cc(=O)[nH]1)C(F)(F)F
BBV-39972298
2-(1-AMINOCYCLOHEXYL)-6-CYCLOPROPYL-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334203-57-4
NC1(CCCCC1)c1nc(cc(=O)[nH]1)C1CC1
BBV-37362053
2-(1-AMINOCYCLOHEXYL)-6-CYCLOPROPYL-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1334147-66-8
Cl.NC1(CCCCC1)c1nc(cc(=O)[nH]1)C1CC1
BBV-39972313
2-(1-AMINOCYCLOHEXYL)-6-ETHYL-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334102-50-9
CCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-37212689
2-(1-AMINOCYCLOHEXYL)-6-ETHYL-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333823-14-5
Cl.CCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-79320870
2-(1-AMINOCYCLOHEXYL)-6-METHYL-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334102-01-0
Cc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-37212690
2-(1-AMINOCYCLOHEXYL)-6-METHYL-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333672-66-4
Cl.Cc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-39972311
2-(1-AMINOCYCLOHEXYL)-6-PROPYL-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1334103-56-8
CCCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-37328419
2-(1-AMINOCYCLOHEXYL)-6-PROPYL-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333968-04-9
Cl.CCCc1cc(=O)[nH]c(n1)C1(N)CCCCC1
BBV-39972297
2-(1-AMINOCYCLOPENTYL)-5,6-DIMETHYL-1,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333547-61-7
Cl.Cc1[nH]c(nc(=O)c1C)C1(N)CCCC1
BBV-39997539
2-(1-AMINOCYCLOPENTYL)-6-(THIOPHEN-2-YL)-3,4-DIHYDROPYRIMIDIN-4-ONE
CAS:1284129-44-7
NC1(CCCC1)c1nc(cc(=O)[nH]1)-c1cccs1
BBV-37610633
2-(1-AMINOCYCLOPENTYL)-6-ETHYL-5-METHYL-1,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1354962-86-9
Cl.CCc1[nH]c(nc(=O)c1C)C1(N)CCCC1
BBV-41757264
2-(1-AMINOCYCLOPENTYL)-6-METHYL-3,4-DIHYDROPYRIMIDIN-4-ONE HYDROCHLORIDE
CAS:1333748-06-3
Cl.Cc1cc(=O)[nH]c(n1)C1(N)CCCC1
BBV-39998092
2-(1-AMINOCYCLOPENTYL)ACETIC ACID
CAS:58885-92-0
NC1(CC(O)=O)CCCC1
BBV-38271895
2-(1-AMINOCYCLOPENTYL)ACETIC ACID HYDROCHLORIDE
CAS:1049720-85-5
Cl.NC1(CC(O)=O)CCCC1
BBV-51264481
2-(1-AMINOCYCLOPROPYL)ACETIC ACID
CAS:133616-20-3
NC1(CC(O)=O)CC1
BBV-38379364
2-(1-AMINOCYCLOPROPYL)ACETIC ACID HYDROCHLORIDE
CAS:139132-50-6
Cl.NC1(CC(O)=O)CC1
BBV-42889197
2-(1-AMINOCYCLOPROPYL)ETHAN-1-OL
CAS:794469-78-6
NC1(CCO)CC1
BBV-082180
2-(1-AMINOCYCLOPROPYL)ETHAN-1-OL HYDROCHLORIDE
CAS:753023-56-2
Cl.NC1(CCO)CC1
BBV-32606521
2-(1-AMINOETHYL)-4-FLUORO-N,N-DIMETHYLANILINE
CAS:1019602-10-8
CC(N)c1cc(F)ccc1N(C)C
BBV-115397
2-(1-AMINOETHYL)-4-METHOXYPHENOL
CAS:926271-13-8
COc1ccc(O)c(c1)C(C)N
BBV-012098
2-(1-AMINOETHYL)-5-METHYL-1,3-THIAZOLE-4-CARBOXYLIC ACID
CAS:1369337-63-2
CC(N)c1nc(C(O)=O)c(C)s1
BBV-43545461
2-(1-AMINOETHYL)-N,N-DIMETHYLANILINE
CAS:1019606-43-9
CC(N)c1ccccc1N(C)C
BBV-115399
2-(1-AMINOETHYL)ANILINE
CAS:39909-26-7
CC(N)c1ccccc1N
BBV-39697328
2-(1-AMINOETHYL)ANILINE DIHYDROCHLORIDE
CAS:1423032-93-2
Cl.Cl.CC(N)c1ccccc1N
BBV-52016340
2-(1-BENZOFURAN-2-YL)-1,3-THIAZOLE-4-CARBOXYLIC ACID
CAS:1152604-97-1
OC(=O)c1csc(n1)-c1cc2ccccc2o1
BBV-2078191
2-(1-BENZOFURAN-2-YL)PROPANOIC ACID
CAS:1249571-02-5
CC(C(O)=O)c1cc2ccccc2o1
BBV-32580874
2-(1-BENZOFURAN-2-YLFORMAMIDO)ACETIC ACID
CAS:69826-70-6
OC(=O)CNC(=O)c1cc2ccccc2o1
BBV-086881
2-(1-BENZOTHIOPHEN-2-YLFORMAMIDO)PENTANOIC ACID
CAS:1485725-73-2
CCCC(NC(=O)c1cc2ccccc2s1)C(O)=O
BBV-27061504
2-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-OL
CAS:808736-97-2
OCCc1cn(Cc2ccccc2)nn1
BBV-34222088
2-(1-BENZYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE
CAS:1071657-00-5
NCCc1cnn(Cc2ccccc2)c1
BBV-34702558
2-(1-BENZYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1071537-11-5
Cl.Cl.NCCc1cnn(Cc2ccccc2)c1
BBV-50330938
2-(1-BENZYLPIPERIDIN-4-YL)ETHAN-1-AMINE
CAS:86945-25-7
NCCC1CCN(Cc2ccccc2)CC1
BBV-33133527
2-(1-BROMOETHYL)-1,3-DIFLUOROBENZENE
CAS:113212-10-5
CC(Br)c1c(F)cccc1F
BBV-2082159
2-(1-BROMOETHYL)-1,3-THIAZOLE
CAS:1353959-24-6
CC(Br)c1nccs1
BBV-39846030
2-(1-BROMOETHYL)-1,3-THIAZOLE HYDROBROMIDE
CAS:1443980-45-7
Br.CC(Br)c1nccs1
BBV-476067
2-(1-BROMOETHYL)-1,4-DICHLOROBENZENE
CAS:98437-27-5
CC(Br)c1cc(Cl)ccc1Cl
BBV-2082157
2-(1-BROMOETHYL)-1,4-DIFLUOROBENZENE
CAS:655-10-7
CC(Br)c1cc(F)ccc1F
BBV-2082121
2-(1-BROMOETHYL)-5-METHYLPYRAZINE
CAS:91920-66-0
CC(Br)c1cnc(C)cn1
BBV-43987950
2-(1-BROMOETHYL)-6-METHOXYNAPHTHALENE
CAS:36946-99-3
COc1ccc2cc(ccc2c1)C(C)Br
BBV-2082078
2-(1-BROMOETHYL)NAPHTHALENE
CAS:52428-02-1
CC(Br)c1ccc2ccccc2c1
BBV-2082101
2-(1-BROMOETHYL)PYRIDINE
CAS:75504-01-7
CC(Br)c1ccccn1
BBV-2082158
2-(1-BROMOETHYL)PYRIDINE HYDROBROMIDE
CAS:78036-40-5
Br.CC(Br)c1ccccn1
BBV-456638
2-(1-CHLOROETHYL)-1,3,5-TRIMETHYLBENZENE
CAS:51270-90-7
CC(Cl)c1c(C)cc(C)cc1C
BBV-216296
2-(1-CHLOROETHYL)-4-ETHYL-5-PHENYL-1,3-OXAZOLE
CAS:1094382-58-7
CCc1nc(oc1-c1ccccc1)C(C)Cl
BBV-2088165
2-(1-CHLOROETHYL)-5-(2,4-DICHLOROPHENYL)-1,3,4-OXADIAZOLE
CAS:1156191-87-5
CC(Cl)c1nnc(o1)-c1ccc(Cl)cc1Cl
BBV-24918434
2-(1-CHLOROETHYL)-5-(2,4-DICHLOROPHENYL)-1,3-OXAZOLE
CAS:1094382-55-4
CC(Cl)c1ncc(o1)-c1ccc(Cl)cc1Cl
BBV-2088144
2-(1-CHLOROETHYL)-5-(2-METHYLPROPYL)-1,3,4-OXADIAZOLE
CAS:926231-94-9
CC(C)Cc1nnc(o1)C(C)Cl
BBV-003250
2-(1-CHLOROETHYL)-5-(3,4-DICHLOROPHENYL)-1,3,4-OXADIAZOLE
CAS:1156946-42-7
CC(Cl)c1nnc(o1)-c1ccc(Cl)c(Cl)c1
BBV-24921710
2-(1-CHLOROETHYL)-5-(3,4-DICHLOROPHENYL)-1,3-OXAZOLE
CAS:1094318-44-1
CC(Cl)c1ncc(o1)-c1ccc(Cl)c(Cl)c1
BBV-2088160
2-(1-CHLOROETHYL)-5-(3,4-DIMETHYLPHENYL)-1,3,4-OXADIAZOLE
CAS:1156945-18-4
CC(Cl)c1nnc(o1)-c1ccc(C)c(C)c1
BBV-485445
2-(1-CHLOROETHYL)-5-(4-CHLOROPHENYL)-1,3-OXAZOLE
CAS:70996-53-1
CC(Cl)c1ncc(o1)-c1ccc(Cl)cc1
BBV-2088154
2-(1-CHLOROETHYL)-5-(4-CHLOROPHENYL)-4-METHYL-1,3-OXAZOLE
CAS:1152541-88-2
CC(Cl)c1nc(C)c(o1)-c1ccc(Cl)cc1
BBV-2088141
2-(1-CHLOROETHYL)-5-ETHYL-1,3,4-OXADIAZOLE
CAS:926214-36-0
CCc1nnc(o1)C(C)Cl
BBV-002549
2-(1-CHLOROETHYL)-6-METHOXYNAPHTHALENE
CAS:72775-41-8
COc1ccc2cc(ccc2c1)C(C)Cl
BBV-216285
2-(1-CHLOROETHYL)PYRAZINE
CAS:1289386-51-1
CC(Cl)c1cnccn1
BBV-38482148
2-(1-CHLOROETHYL)PYRIDINE HYDROCHLORIDE
CAS:149691-40-7
Cl.CC(Cl)c1ccccn1
BBV-470657
2-(1-CYCLOPENTYL-1H-PYRAZOL-3-YL)ETHAN-1-AMINE
CAS:1328640-71-6
NCCc1ccn(n1)C1CCCC1
BBV-39215782
2-(1-CYCLOPROPYL-N-METHYLFORMAMIDO)ACETIC ACID
CAS:926213-98-1
CN(CC(O)=O)C(=O)C1CC1
BBV-016126
2-(1-ETHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE
CAS:910395-61-8
CCn1c(CCN)nc2ccccc12
BBV-2085017
2-(1-ETHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1258640-90-2
Cl.Cl.CCn1c(CCN)nc2ccccc12
BBV-56319953
2-(1-ETHYL-1H-IMIDAZOL-2-YL)PIPERIDINE
CAS:1344365-73-6
CCn1ccnc1C1CCCCN1
BBV-38137782
2-(1-ETHYL-1H-IMIDAZOL-2-YL)PIPERIDINE DIHYDROCHLORIDE
CAS:1955520-58-7
Cl.Cl.CCn1ccnc1C1CCCCN1
BBV-51409135
2-(1-ETHYL-1H-IMIDAZOL-5-YL)PIPERIDINE
CAS:1601232-25-0
CCn1cncc1C1CCCCN1
BBV-53070521
2-(1-ETHYL-1H-INDOL-3-YL)ACETIC ACID
CAS:58690-18-9
CCn1cc(CC(O)=O)c2ccccc12
BBV-153567
2-(1-ETHYL-1H-PYRAZOL-4-YL)-2,2-DIFLUOROACETIC ACID
CAS:1249324-44-4
CCn1cc(cn1)C(F)(F)C(O)=O
BBV-34223222
2-(1-ETHYL-1H-PYRAZOL-4-YL)ETHAN-1-OL
CAS:1251131-12-0
CCn1cc(CCO)cn1
BBV-34536916
2-(1-ETHYLPIPERIDIN-4-YL)ETHAN-1-AMINE
CAS:720001-91-2
CCN1CCC(CCN)CC1
BBV-33196463
2-(1-ETHYLPYRROLIDIN-2-YL)ACETIC ACID HYDROCHLORIDE
CAS:42791-85-5
Cl.CCN1CCCC1CC(O)=O
BBV-42889267
2-(1-HYDROXY-4-PHENYLCYCLOHEXYL)BUTANOIC ACID
CAS:5977-10-6
CCC(C(O)=O)C1(O)CCC(CC1)c1ccccc1
BBV-34277857
2-(1-HYDROXYCYCLOBUTYL)ACETIC ACID
CAS:933695-45-5
OC(=O)CC1(O)CCC1
BBV-34223637
2-(1-HYDROXYCYCLOHEXYL)ACETIC ACID
CAS:14399-63-4
OC(=O)CC1(O)CCCCC1
BBV-34220999
2-(1-HYDROXYCYCLOHEXYL)BUTANOIC ACID
CAS:512-16-3
CCC(C(O)=O)C1(O)CCCCC1
BBV-34224092
2-(1-HYDROXYCYCLOPENTYL)ACETIC ACID
CAS:7499-04-9
OC(=O)CC1(O)CCCC1
BBV-34223527
2-(1-ISOCYANATOETHYL)-5-METHYLFURAN
CAS:1340257-19-3
CC(N=C=O)c1ccc(C)o1
BBV-36975975
2-(1-ISOCYANATOETHYL)-5-METHYLTHIOPHENE
CAS:1341887-09-9
CC(N=C=O)c1ccc(C)s1
BBV-32635401
2-(1-ISOTHIOCYANATOETHYL)OXOLANE
CAS:1153129-43-1
CC(N=C=S)C1CCCO1
BBV-25160139
2-(1-ISOTHIOCYANATOETHYL)THIOPHENE
CAS:1153971-59-5
CC(N=C=S)c1cccs1
BBV-25160513
2-(1-METHANESULFONYLPIPERIDIN-4-YL)ACETIC ACID
CAS:423722-27-4
CS(=O)(=O)N1CCC(CC(O)=O)CC1
BBV-40281093
2-(1-METHOXYETHYL)-1,3-OXAZOLE-4-CARBOXYLIC ACID
CAS:1566576-18-8
COC(C)c1nc(co1)C(O)=O
BBV-49723267
2-(1-METHYL-1H-1,2,3,4-TETRAZOL-5-YL)ANILINE
CAS:858484-20-5
Cn1nnnc1-c1ccccc1N
BBV-32765395
2-(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)ACETIC ACID
CAS:1512226-21-9
Cn1cc(CC(O)=O)nn1
BBV-45011128
2-(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-AMINE
CAS:856861-69-3
Cn1cc(CCN)nn1
BBV-34712822
2-(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-OL
CAS:1250772-80-5
Cn1cc(CCO)nn1
BBV-34222103
2-(1-METHYL-1H-1,2,3-TRIAZOL-4-YL)PROPAN-2-AMINE
CAS:1342512-71-3
Cn1cc(nn1)C(C)(C)N
BBV-38438638
2-(1-METHYL-1H-1,3-BENZODIAZOL-2-YL)ACETIC ACID
CAS:2219-13-8
Cn1c(CC(O)=O)nc2ccccc12
BBV-32620528
2-(1-METHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE
CAS:184959-13-5
Cn1c(CCN)nc2ccccc12
BBV-2084961
2-(1-METHYL-1H-1,3-BENZODIAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:138078-14-5
Cl.Cl.Cn1c(CCN)nc2ccccc12
BBV-51257206
2-(1-METHYL-1H-IMIDAZOL-2-YL)ACETIC ACID
CAS:118054-54-9
Cn1ccnc1CC(O)=O
BBV-38137071
2-(1-METHYL-1H-IMIDAZOL-2-YL)ACETIC ACID HYDROCHLORIDE
CAS:131654-57-4
Cl.Cn1ccnc1CC(O)=O
BBV-43544891
2-(1-METHYL-1H-IMIDAZOL-2-YL)ETHAN-1-AMINE
CAS:87786-06-9
Cn1ccnc1CCN
BBV-001922
2-(1-METHYL-1H-IMIDAZOL-2-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:87786-05-8
Cl.Cl.Cn1ccnc1CCN
BBV-108665422
2-(1-METHYL-1H-IMIDAZOL-2-YL)PROPANOIC ACID
CAS:1343312-31-1
CC(C(O)=O)c1nccn1C
BBV-38137067
2-(1-METHYL-1H-IMIDAZOL-4-YL)ETHAN-1-AMINE
CAS:501-75-7
Cn1cnc(CCN)c1
BBV-2064559
2-(1-METHYL-1H-IMIDAZOL-5-YL)ETHAN-1-AMINE
CAS:644-42-8
Cn1cncc1CCN
BBV-38372609
2-(1-METHYL-1H-IMIDAZOL-5-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:36475-47-5
Cl.Cl.Cn1cncc1CCN
BBV-106820
2-(1-METHYL-1H-IMIDAZOL-5-YL)ETHAN-1-OL
CAS:802027-25-4
Cn1cncc1CCO
BBV-38314943
2-(1-METHYL-1H-IMIDAZOL-5-YL)OXAN-4-OL
CAS:1461706-51-3
Cn1cncc1C1CC(O)CCO1
BBV-34022443
2-(1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDO)ACETIC ACID
CAS:1249411-93-5
Cn1cnc(c1)S(=O)(=O)NCC(O)=O
BBV-34216328
2-(1-METHYL-1H-INDAZOL-3-YL)ETHAN-1-AMINE
CAS:181144-25-2
Cn1nc(CCN)c2ccccc12
BBV-40310284
2-(1-METHYL-1H-INDOL-2-YL)ACETIC ACID
CAS:127019-98-1
Cn1c(CC(O)=O)cc2ccccc12
BBV-42345552
2-(1-METHYL-1H-INDOL-3-YL)ETHAN-1-AMINE
CAS:7518-21-0
Cn1cc(CCN)c2ccccc12
BBV-36983236
2-(1-METHYL-1H-INDOL-3-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:2826-96-2
Cl.Cn1cc(CCN)c2ccccc12
BBV-51432022
2-(1-METHYL-1H-PYRAZOL-3-YL)ETHAN-1-OL
CAS:177940-19-1
Cn1ccc(CCO)n1
BBV-46764469
2-(1-METHYL-1H-PYRAZOL-4-YL)-1,3-BENZOXAZOL-6-AMINE
CAS:1152583-84-0
Cn1cc(cn1)-c1nc2ccc(N)cc2o1
BBV-220899
2-(1-METHYL-1H-PYRAZOL-4-YL)-1,3-OXAZOLE-4-CARBOXYLIC ACID
CAS:1247425-58-6
Cn1cc(cn1)-c1nc(co1)C(O)=O
BBV-33898846
2-(1-METHYL-1H-PYRAZOL-4-YL)-1,3-THIAZOLE-4-CARBOXYLIC ACID
CAS:1152605-07-6
Cn1cc(cn1)-c1nc(cs1)C(O)=O
BBV-2078241
2-(1-METHYL-1H-PYRAZOL-4-YL)-1,3-THIAZOLE-5-CARBALDEHYDE
CAS:1248209-05-3
Cn1cc(cn1)-c1ncc(C=O)s1
BBV-32635497
2-(1-METHYL-1H-PYRAZOL-4-YL)-1,3-THIAZOLE-5-CARBOXYLIC ACID
CAS:1035235-01-8
Cn1cc(cn1)-c1ncc(s1)C(O)=O
BBV-32476772
2-(1-METHYL-1H-PYRAZOL-4-YL)-2-(MORPHOLIN-4-YL)ACETIC ACID
CAS:1218541-76-4
Cn1cc(cn1)C(N1CCOCC1)C(O)=O
BBV-27278368
2-(1-METHYL-1H-PYRAZOL-4-YL)-2-OXOACETIC ACID
CAS:1134691-09-0
Cn1cc(cn1)C(=O)C(O)=O
BBV-062716
2-(1-METHYL-1H-PYRAZOL-4-YL)ACETIC ACID
CAS:1152582-56-3
Cn1cc(CC(O)=O)cn1
BBV-457409
2-(1-METHYL-1H-PYRAZOL-4-YL)ACETONITRILE
CAS:754159-15-4
Cn1cc(CC#N)cn1
BBV-38425106
2-(1-METHYL-1H-PYRAZOL-4-YL)BENZOIC ACID
CAS:953076-87-4
Cn1cc(cn1)-c1ccccc1C(O)=O
BBV-32321375
2-(1-METHYL-1H-PYRAZOL-4-YL)CYCLOPROPAN-1-AMINE
CAS:1157139-36-0
Cn1cc(cn1)C1CC1N
BBV-27286898
2-(1-METHYL-1H-PYRAZOL-4-YL)CYCLOPROPAN-1-AMINE DIHYDROCHLORIDE
CAS:1354954-26-9
Cl.Cl.Cn1cc(cn1)C1CC1N
BBV-51606427
2-(1-METHYL-1H-PYRAZOL-4-YL)CYCLOPROPANE-1-CARBOXYLIC ACID
CAS:1157139-23-5
Cn1cc(cn1)C1CC1C(O)=O
BBV-27286891
2-(1-METHYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE
CAS:796845-58-4
Cn1cc(CCN)cn1
BBV-153831
2-(1-METHYL-1H-PYRAZOL-4-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:1431962-30-9
Cl.Cl.Cn1cc(CCN)cn1
BBV-41301884
2-(1-METHYL-1H-PYRAZOL-4-YL)ETHAN-1-OL
CAS:176661-75-9
Cn1cc(CCO)cn1
BBV-34536912
2-(1-METHYL-1H-PYRAZOL-4-YL)IMIDAZO[1,2-A]PYRIDIN-3-AMINE
CAS:1338985-08-2
Cn1cc(cn1)-c1nc2ccccn2c1N
BBV-32625657
2-(1-METHYL-1H-PYRAZOL-4-YL)OXAN-4-AMINE
CAS:1341074-26-7
Cn1cc(cn1)C1CC(N)CCO1
BBV-38460843
2-(1-METHYL-1H-PYRAZOL-4-YL)OXAN-4-AMINE DIHYDROCHLORIDE
CAS:1820706-21-5
Cl.Cl.Cn1cc(cn1)C1CC(N)CCO1
BBV-27139176
2-(1-METHYL-1H-PYRAZOL-4-YL)PIPERIDINE
CAS:1343116-48-2
Cn1cc(cn1)C1CCCCN1
BBV-36854354
2-(1-METHYL-1H-PYRAZOL-4-YL)PROPAN-2-AMINE
CAS:1215936-45-0
Cn1cc(cn1)C(C)(C)N
BBV-33344522
2-(1-METHYL-1H-PYRAZOL-4-YL)PROPANOIC ACID
CAS:1248781-46-5
CC(C(O)=O)c1cnn(C)c1
BBV-33490525
2-(1-METHYL-1H-PYRAZOL-4-YL)PYRIMIDINE-5-CARBALDEHYDE
CAS:1484524-86-8
Cn1cc(cn1)-c1ncc(C=O)cn1
BBV-54920372
2-(1-METHYL-1H-PYRAZOL-5-YL)BENZALDEHYDE
CAS:1339182-17-0
Cn1nccc1-c1ccccc1C=O
BBV-38135940
2-(1-METHYL-1H-PYRAZOL-5-YL)ETHAN-1-AMINE
CAS:807315-40-8
Cn1nccc1CCN
BBV-38136187
2-(1-METHYL-1H-PYRAZOL-5-YL)ETHAN-1-OL
CAS:924911-13-7
Cn1nccc1CCO
BBV-38136174
2-(1-METHYL-1H-PYRAZOL-5-YL)PIPERIDINE
CAS:1330756-31-4
Cn1nccc1C1CCCCN1
BBV-38136207
2-(1-METHYL-1H-PYRAZOL-5-YL)PIPERIDINE DIHYDROCHLORIDE
CAS:1609402-74-5
Cl.Cl.Cn1nccc1C1CCCCN1
BBV-32177943
2-(1-METHYL-1H-PYRAZOL-5-YL)PIPERIDINE HYDROCHLORIDE
CAS:1803581-02-3
Cl.Cn1nccc1C1CCCCN1
BBV-32391642
2-(1-METHYL-1H-PYRAZOL-5-YL)PROPANOIC ACID
CAS:1339150-49-0
CC(C(O)=O)c1ccnn1C
BBV-38136084
2-(1-METHYL-1H-PYRAZOL-5-YL)PROPANOIC ACID HYDROCHLORIDE
CAS:1909308-73-1
Cl.CC(C(O)=O)c1ccnn1C
BBV-601620
2-(1-METHYL-1H-PYRROL-2-YL)ACETIC ACID
CAS:21898-59-9
Cn1cccc1CC(O)=O
BBV-33902264
2-(1-METHYL-1H-PYRROL-2-YL)ETHAN-1-AMINE
CAS:83732-75-6
Cn1cccc1CCN
BBV-250749
2-(1-METHYL-1H-PYRROL-2-YL)PIPERIDINE
CAS:1039329-72-0
Cn1cccc1C1CCCCN1
BBV-230651
2-(1-METHYL-2,3-DIHYDRO-1H-INDOL-3-YL)ACETIC ACID
CAS:764591-64-2
CN1CC(CC(O)=O)c2ccccc12
BBV-182530
2-(1-METHYL-2,3-DIHYDRO-1H-INDOL-5-YL)ACETIC ACID
CAS:152149-35-4
CN1CCc2cc(CC(O)=O)ccc12
BBV-33921354
2-(1-METHYL-2-OXO-2,3-DIHYDRO-1H-INDOL-5-YL)-2-OXOACETIC ACID
CAS:1152495-80-1
CN1C(=O)Cc2cc(ccc12)C(=O)C(O)=O
BBV-2078984
2-(1-METHYL-5-OXO-4,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID
CAS:1094269-98-3
CN1N=C(CC(O)=O)CC1=O
BBV-1085835
2-(1-METHYLAZETIDIN-3-YL)ACETIC ACID
CAS:1343050-86-1
CN1CC(CC(O)=O)C1
BBV-39163381
2-(1-METHYLAZETIDIN-3-YL)ACETIC ACID HYDROCHLORIDE
CAS:1909337-03-6
Cl.CN1CC(CC(O)=O)C1
BBV-32124456
2-(1-METHYLCYCLOPENTYL)ACETIC ACID
CAS:933-47-1
CC1(CC(O)=O)CCCC1
BBV-38368494
2-(1-METHYLCYCLOPROPYL)ACETIC ACID
CAS:71199-15-0
CC1(CC(O)=O)CC1
BBV-38345620
2-(1-METHYLCYCLOPROPYL)PYRIMIDIN-4-AMINE
CAS:1521482-21-2
CC1(CC1)c1nccc(N)n1
BBV-42959517
2-(1-METHYLHYDRAZIN-1-YL)PYRIDINE
CAS:4231-74-7
CN(N)c1ccccn1
BBV-108673442
2-(1-METHYLPIPERIDIN-2-YL)ACETIC ACID
CAS:107388-72-7
CN1CCCCC1CC(O)=O
BBV-32296216
2-(1-METHYLPIPERIDIN-2-YL)ACETIC ACID HYDROCHLORIDE
CAS:60979-27-3
Cl.CN1CCCCC1CC(O)=O
BBV-546444
2-(1-METHYLPIPERIDIN-2-YL)ETHAN-1-OL
CAS:533-15-3
CN1CCCCC1CCO
BBV-25151546
2-(1-METHYLPIPERIDIN-3-YL)ETHAN-1-OL
CAS:101257-32-3
CN1CCCC(CCO)C1
BBV-33920522
2-(1-METHYLPIPERIDIN-4-YL)ACETIC ACID
CAS:87647-06-1
CN1CCC(CC(O)=O)CC1
BBV-193050
2-(1-METHYLPIPERIDIN-4-YL)ACETIC ACID HYDROCHLORIDE
CAS:67686-06-0
Cl.CN1CCC(CC(O)=O)CC1
BBV-470772
2-(1-METHYLPIPERIDIN-4-YLIDENE)ACETIC ACID
CAS:759457-29-9
CN1CCC(CC1)=CC(O)=O
BBV-192943
2-(1-METHYLPIPERIDIN-4-YLIDENE)ACETIC ACID HYDROCHLORIDE
CAS:676341-72-3
Cl.CN1CCC(CC1)=CC(O)=O
BBV-493025
2-(1-METHYLPYRROLIDIN-3-YL)ACETIC ACID HYDROCHLORIDE
CAS:1071634-26-8
Cl.CN1CCC(CC(O)=O)C1
BBV-42973864
2-(1-METHYLPYRROLIDIN-3-YL)ETHAN-1-AMINE
CAS:774213-88-6
CN1CCC(CCN)C1
BBV-36751357
2-(1-METHYLPYRROLIDIN-3-YLIDENE)ACETIC ACID
CAS:1344797-62-1
CN1CCC(C1)=CC(O)=O
BBV-36761757
2-(1-OXO-1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)ACETIC ACID
CAS:101301-18-2
OC(=O)CN1CCc2ccccc2C1=O
BBV-38697357
2-(1-OXO-1,2-DIHYDROISOQUINOLIN-2-YL)ACETIC ACID
CAS:59139-93-4
OC(=O)CN1CCc2ccccc2C1=O
BBV-45161531
2-(1-OXO-1,2-DIHYDROPHTHALAZIN-2-YL)ETHANETHIOAMIDE
CAS:1016860-91-5
NC(=S)Cn1ncc2ccccc2c1=O
BBV-080360
2-(1-OXO-2,3-DIHYDRO-1H-ISOINDOL-2-YL)ACETALDEHYDE
CAS:1163250-37-0
O=CCN1Cc2ccccc2C1=O
BBV-33752666
2-(1-PHENYL-1H-PYRAZOL-3-YL)ACETIC ACID
CAS:82668-47-1
OC(=O)Cc1ccn(n1)-c1ccccc1
BBV-36625691
2-(1-PHENYL-1H-PYRAZOL-4-YL)-1,3-THIAZOLE-4-CARBOXYLIC ACID
CAS:137576-90-0
OC(=O)c1csc(n1)-c1cnn(c1)-c1ccccc1
BBV-2078243
2-(1-PHENYLETHOXY)ANILINE
CAS:1019121-85-7
CC(Oc1ccccc1N)c1ccccc1
BBV-108494
2-(1-PHENYLETHOXY)ANILINE HYDROCHLORIDE
CAS:1311317-13-1
Cl.CC(Oc1ccccc1N)c1ccccc1
BBV-39720003
2-(1-PHENYLETHYL)OXIRANE
CAS:15701-82-3
CC(C1CO1)c1ccccc1
BBV-34719486
2-(1-PHENYLPROPYL)PYRROLIDINE
CAS:383127-54-6
CCC(C1CCCN1)c1ccccc1
BBV-57500918
2-(1-PHENYLPROPYL)PYRROLIDINE HYDROCHLORIDE
CAS:1177339-97-7
Cl.CCC(C1CCCN1)c1ccccc1
BBV-50271725
2-(1H-1,2,3,4-TETRAZOL-1-YL)ANILINE
CAS:14210-51-6
Nc1ccccc1-n1cnnn1
BBV-014094
2-(1H-1,2,3,4-TETRAZOL-1-YL)ETHAN-1-AMINE
CAS:926649-00-5
NCCn1cnnn1
BBV-32796911
2-(1H-1,2,3,4-TETRAZOL-1-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1201937-23-6
Cl.NCCn1cnnn1
BBV-40223094
2-(1H-1,2,3,4-TETRAZOL-5-YL)MORPHOLINE
CAS:1248942-38-2
C1COC(CN1)c1nnn[nH]1
BBV-32794684
2-(1H-1,2,3,4-TETRAZOL-5-YL)MORPHOLINE HYDROCHLORIDE
CAS:1269151-67-8
Cl.C1COC(CN1)c1nnn[nH]1
BBV-50328974
2-(1H-1,2,3,4-TETRAZOL-5-YL)PROPAN-1-AMINE
CAS:1248097-99-5
CC(CN)c1nnn[nH]1
BBV-34559743
2-(1H-1,2,3,4-TETRAZOL-5-YL)PROPAN-1-AMINE HYDROCHLORIDE
CAS:1461705-04-3
Cl.CC(CN)c1nnn[nH]1
BBV-37825027
2-(1H-1,2,3,4-TETRAZOL-5-YL)PROPAN-2-AMINE
CAS:1211587-69-7
CC(C)(N)c1nnn[nH]1
BBV-32459776
2-(1H-1,2,3,4-TETRAZOL-5-YL)PYRIDINE
CAS:33893-89-9
c1ccc(nc1)-c1nnn[nH]1
BBV-153801
2-(1H-1,2,3,4-TETRAZOLE-5-AMIDO)CYCLOPENTANE-1-CARBOXYLIC ACID
CAS:1538359-40-8
OC(=O)C1CCCC1NC(=O)c1nnn[nH]1
BBV-42936546
2-(1H-1,2,3-BENZOTRIAZOL-1-YL)BENZALDEHYDE
CAS:138479-57-9
O=Cc1ccccc1-n1nnc2ccccc12
BBV-265816
2-(1H-1,2,3-TRIAZOL-1-YL)ANILINE
CAS:15213-01-1
Nc1ccccc1-n1ccnn1
BBV-012219
2-(1H-1,2,3-TRIAZOL-1-YL)ANILINE HYDROCHLORIDE
CAS:1170240-23-9
Cl.Nc1ccccc1-n1ccnn1
BBV-39685055
2-(1H-1,2,3-TRIAZOL-4-YL)ETHAN-1-OL
CAS:1012040-40-2
OCCc1c[nH]nn1
BBV-34222148
2-(1H-1,2,3-TRIAZOL-4-YL)PROPAN-2-AMINE
CAS:1088886-66-1
CC(C)(N)c1c[nH]nn1
BBV-084381
2-(1H-1,2,3-TRIAZOL-4-YL)PROPAN-2-AMINE DIHYDROBROMIDE
CAS:1909348-13-5
Br.Br.CC(C)(N)c1c[nH]nn1
BBV-32149469
2-(1H-1,2,4-TRIAZOL-1-YL)BENZALDEHYDE
CAS:138479-53-5
O=Cc1ccccc1-n1cncn1
BBV-155981
2-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID
CAS:138479-54-6
OC(=O)c1ccccc1-n1cncn1
BBV-156386
2-(1H-1,2,4-TRIAZOL-1-YL)CYCLOHEXANE-1-CARBOXYLIC ACID
CAS:1341945-75-2
OC(=O)C1CCCCC1n1cncn1
BBV-36852992
2-(1H-1,2,4-TRIAZOL-1-YL)ETHAN-1-AMINE
CAS:51444-31-6
NCCn1cncn1
BBV-030402
2-(1H-1,2,4-TRIAZOL-1-YL)ETHAN-1-AMINE DIHYDROCHLORIDE
CAS:51444-26-9
Cl.Cl.NCCn1cncn1
BBV-57271900
2-(1H-1,2,4-TRIAZOL-1-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1033521-69-5
Cl.NCCn1cncn1
BBV-37700774
2-(1H-1,2,4-TRIAZOL-1-YL)ETHAN-1-OL
CAS:3273-14-1
OCCn1cncn1
BBV-24917248
2-(1H-1,2,4-TRIAZOL-1-YL)ETHANIMIDAMIDE
CAS:446276-04-6
NC(=N)Cn1cncn1
BBV-070310
2-(1H-1,2,4-TRIAZOL-1-YL)PHENOL
CAS:1340463-49-1
Oc1ccccc1-n1cncn1
BBV-38827319
2-(1H-1,2,4-TRIAZOL-1-YL)PYRIDIN-3-AMINE
CAS:103092-75-7
Nc1cccnc1-n1cncn1
BBV-010271
2-(1H-1,2,4-TRIAZOL-1-YL)PYRIDINE-4-CARBOXIMIDAMIDE
CAS:1016530-23-6
NC(=N)c1ccnc(c1)-n1cncn1
BBV-064193
2-(1H-1,2,4-TRIAZOL-1-YL)PYRIDINE-4-CARBOXIMIDAMIDE HYDROCHLORIDE
CAS:1421606-01-0
Cl.NC(=N)c1ccnc(c1)-n1cncn1
BBV-40464379
2-(1H-1,2,4-TRIAZOL-1-YLMETHYL)ANILINE
CAS:127988-21-0
Nc1ccccc1Cn1cncn1
BBV-039366
2-(1H-1,2,4-TRIAZOL-1-YLMETHYL)BENZENE-1-SULFONYL CHLORIDE HYDROCHLORIDE
CAS:1432681-63-4
Cl.ClS(=O)(=O)c1ccccc1Cn1cncn1
BBV-478557
2-(1H-1,2,4-TRIAZOL-1-YLMETHYL)BENZOIC ACID
CAS:876718-01-3
OC(=O)c1ccccc1Cn1cncn1
BBV-23465943
2-(1H-1,2,4-TRIAZOL-3-YL)ACETIC ACID
CAS:155049-60-8
OC(=O)Cc1nc[nH]n1
BBV-32772134
2-(1H-1,2,4-TRIAZOL-5-YL)ACETIC ACID HYDROCHLORIDE
CAS:1087714-25-7
Cl.OC(=O)Cc1ncn[nH]1
BBV-41600994
2-(1H-1,3-BENZODIAZOL-1-YL)-1-(4-FLUOROPHENYL)ETHAN-1-AMINE
CAS:927996-69-8
NC(Cn1cnc2ccccc12)c1ccc(F)cc1
BBV-034384