Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

3-BROMO-5-FLUORO-2-(HEXYLOXY) -ANILINE
CAS:1096797-88-4
KIN05155492
3-BROMO-5-FLUORO-2-(ISOXAZOL-4-YLMETHOXY) -ANILINE
CAS:1183360-47-5
KIN05303336
3-BROMO-5-FLUORO-2-(PENTYLOXY) -ANILINE
CAS:1096797-87-3
KIN05155491
3-BROMO-5-FLUORO-2-(PYRIDIN-2-YLMETHOXY) -ANILINE
CAS:1096798-18-3
Formula: C12H10BrFN2O
KIN05155496
3-BROMO-5-FLUORO-2-(PYRIDIN-3-YLMETHOXY) -ANILINE
CAS:1096323-80-6
Formula: C12H10BrFN2O
KIN05154272
3-BROMO-5-FLUORO-2-(PYRIDIN-4-YLMETHOXY) -ANILINE
CAS:1096798-16-1
Formula: C12H10BrFN2O
KIN05155494
3-BROMO-5-FLUORO-2-[(TETRAHYDRO-FURAN-2-YL)METHOXY]-ANILINE
CAS:1096324-08-1
KIN05154274
3-BROMO-5-FLUORO-2-AMINO-ANILINE
CAS:115440-10-3
Formula: C6H6BrFN2
KIN03137240
3-BROMO-5-FLUORO-2-HYDROXY-BENZALDEHYDE
CAS:178546-34-4
Formula: C7H4BrFO2
KIN03364994
3-BROMO-5-FLUORO-2-HYDROXY-BENZOIC ACID
CAS:4180-44-3
Formula: C7H5BrClNO3
KIN01102521
3-BROMO-5-FLUORO-2-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:4068-74-0
Formula: C8H6ClFO3
KIN01100406
3-BROMO-5-FLUORO-2-HYDROXY-BENZONITRILE
CAS:28165-66-4
Formula: C7H3BrFNO
KIN02163774
3-BROMO-5-FLUORO-2-IODO-ANILINE
CAS:144580-08-5
Formula: C6H4BrFIN
KIN03276290
3-BROMO-5-FLUORO-2-METHOXY-ANILINE
CAS:1096884-89-7
Formula: C7H7BrFNO
KIN05157257
3-BROMO-5-FLUORO-2-METHOXY-BENZALDEHYDE
CAS:1009093-60-0
Formula: C8H6BrFO2
KIN05016256
3-BROMO-5-FLUORO-2-METHOXY-PHENOL
CAS:1026796-60-0
Formula: C7H6BrFO2
KIN05061368
3-BROMO-5-FLUORO-2-METHYLBENZOIC ACID
CAS:1187318-52-0
Formula: C8H6BrFO2
KIN05322665
3-BROMO-5-FLUORO-2-METHYLBENZOIC ACID METHYL ESTER
CAS:1187318-53-1
Formula: C9H8BrFO2
KIN05322666
3-BROMO-5-FLUORO-2-PROPOXY-ANILINE
CAS:1096901-61-9
Formula: C9H11BrFNO
KIN05157650
3-BROMO-5-FLUORO-2-PYRIDINECARBOXYLIC ACID
CAS:1189513-55-0
Formula: C6H3BrFNO2
KIN05329072
3-BROMO-5-FLUORO-4'-METHOXY-BIPHENYL-2-YLAMINE
CAS:1187205-72-6
KIN05322484
3-BROMO-5-FLUORO-4-HYDROXY-BENZALDEHYDE
CAS:185345-46-4
Formula: C7H4BrFO2
KIN03379274
3-BROMO-5-FLUORO-4-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:445019-48-7
Formula: C8H6BrFO3
KIN03665875
3-BROMO-5-FLUORO-4-IODO-ALPHA-BENZOIC ACID ETHYL ESTER
CAS:1160574-73-1
Formula: C9H7BrFIO2
KIN05257936
3-BROMO-5-FLUORO-4-METHOXY-BENZALDEHYDE
CAS:185345-47-5
Formula: C8H6BrFO2
KIN03379275
3-BROMO-5-FLUORO-4-METHOXY-BENZENEETHANAMINE
CAS:392-29-0
Formula: C12H7F3O2S
KIN01013159
3-BROMO-5-FLUORO-4-METHOXY-BENZOIC ACID
CAS:445019-47-6
Formula: C8H6BrFO3
KIN03587332
3-BROMO-5-FLUORO-4-METHOXY-BENZOIC ACID METHYL ESTER
CAS:1195945-54-0
Formula: C9H8BrFO3
KIN05338776
3-BROMO-5-FLUORO-4-METHYL-ANILINE
CAS:207110-35-8
Formula: C7H7BrFN
KIN03416879
3-BROMO-5-FLUORO-4-METHYLBENZOIC ACID
CAS:1191988-29-0
Formula: C8H6BrFO2
KIN05332556
3-BROMO-5-FLUORO-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:1123171-93-6
Formula: C8H5BrFNO4
KIN05178514
3-BROMO-5-FLUORO-ALPHA-(4-METHOXY-PHENYL) -BENZENEMETHANAMINE
CAS:1094484-63-5
KIN05141850
3-BROMO-5-FLUORO-ALPHA-(4-PROPYLPHENYL)-BENZENEMETHANAMINE
CAS:1094555-58-4
KIN05142765
3-BROMO-5-FLUORO-ALPHA-METHYLBENZENEMETHANAMINE
CAS:1191908-56-1
Formula: C8H9BrFN
KIN05332467
3-BROMO-5-FLUORO-ALPHA-PHENYLBENZENEMETHANAMINE
CAS:1094761-25-7
Formula: C13H11BrFN
KIN05145097
3-BROMO-5-FLUORO-ANILINE
CAS:134168-97-1
Formula: C6H5BrFN.ClH
KIN03227031
3-BROMO-5-FLUORO-ANILINE HCL
CAS:134168-98-2
Formula: C6H6BrClFN
KIN03227032
3-BROMO-5-FLUORO-BETA-HYDROXY-BENZENEPROPANENITRILE
CAS:1075178-33-4
Formula: C9H7BrFNO
KIN05115597
3-BROMO-5-FLUORO-BETA-OXO-BENZENEPROPANENITRILE
CAS:1094731-17-5
Formula: C9H5BrFNO
KIN05144681
3-BROMO-5-FLUORO-BETA-OXO-BENZENEPROPANOIC ACID
CAS:1000519-08-3
Formula: C9H6BrFO3
KIN05001725
3-BROMO-5-FLUORO-BIPHENYL
CAS:136649-30-4
Formula: C12H8BrF
KIN03237896
3-BROMO-5-FLUORO-N,2-DIHYDROXY-BENZAMIDE
CAS:4068-68-2
KIN01100400
3-BROMO-5-FLUORO-N,N-DIMETHYL-BENZENAMINE
CAS:1129542-02-4
Formula: C8H9BrFN
KIN05182432
3-BROMO-5-FLUORO-N-(1-METHYLETHYL)-BENZAMIDE
CAS:1181538-97-5
Formula: C10H11BrFNO
KIN05292770
3-BROMO-5-FLUORO-N-(1-METHYLETHYL)-BENZENEMETHANAMINE
CAS:1094484-97-5
Formula: C10H13BrFN
KIN05141855
3-BROMO-5-FLUORO-N-(1-METHYLPROPYL)-BENZENEMETHANAMINE
CAS:1184527-05-6
Formula: C11H15BrFN
KIN05315035
3-BROMO-5-FLUORO-N-(1H-PYRAZOL-4-YLMETHYL)-BENZAMIDE
CAS:1178772-39-8
KIN05279638
3-BROMO-5-FLUORO-N-(2-HYDROXY-1-METHYLETHYL) -BENZAMIDE
CAS:1155519-57-5
Formula: C10H11BrFNO2
KIN05225358
3-BROMO-5-FLUORO-N-(2-HYDROXY-PROPYL) -BENZAMIDE
CAS:1156310-22-3
Formula: C10H11BrFNO2
KIN05232729
3-BROMO-5-FLUORO-N-(2-HYDROXY-TERT-BUTYL) -BENZAMIDE
CAS:1155517-57-9
Formula: C11H13BrFNO2
KIN05225331
3-BROMO-5-FLUORO-N-(2-HYDROXYETHYL) -BENZAMIDE
CAS:1155519-20-2
Formula: C9H9BrFNO2
KIN05225349
3-BROMO-5-FLUORO-N-(2-HYDROXYETHYL) -N-METHYLBENZAMIDE
CAS:1179099-12-7
Formula: C10H11BrFNO2
KIN05282174
3-BROMO-5-FLUORO-N-(2-METHOXY-1-METHYLETHYL) -BENZAMIDE
CAS:1147673-81-1
Formula: C11H13BrFNO2
KIN05195735
3-BROMO-5-FLUORO-N-(2-METHOXYETHYL) -BENZAMIDE
CAS:1181878-32-9
Formula: C10H11BrFNO2
KIN05295278
3-BROMO-5-FLUORO-N-(2-METHYLPROPYL)-BENZENEMETHANAMINE
CAS:1183164-46-6
Formula: C11H15BrFN
KIN05301173
3-BROMO-5-FLUORO-N-(3-HYDROXY-PROPYL) -BENZAMIDE
CAS:1156310-07-4
Formula: C10H11BrFNO2
KIN05232727
3-BROMO-5-FLUORO-N-(6-METHYLPYRIDINE-2-YL)-BENZAMIDE
CAS:1042498-29-2
KIN05088841
3-BROMO-5-FLUORO-N-(BENZYL)-BENZENEMETHANAMINE
CAS:1184499-52-2
Formula: C14H13BrFN
KIN05314711
3-BROMO-5-FLUORO-N-[1-(HYDROXYMETHYL) -PROPYL]BENZAMIDE
CAS:1155519-43-9
Formula: C11H13BrFNO2
KIN05225355
3-BROMO-5-FLUORO-N-[2-(PIPERAZIN-1-YL)ETHYL]BENZAMIDE
CAS:1153542-76-7
Formula: C13H17BrFN3O
KIN05211471
3-BROMO-5-FLUORO-N-[3-(METHYLAMINO)-PROPYL]BENZAMIDE
CAS:1153257-80-7
Formula: C11H14BrFN2O
KIN05207382
3-BROMO-5-FLUORO-N-1H-PYRAZOL-4-YLBENZAMIDE
CAS:1153205-69-6
Formula: C10H7BrFN3O
KIN05206554
3-BROMO-5-FLUORO-N-ALLYLBENZAMIDE
CAS:1181497-55-1
Formula: C10H9BrFNO
KIN05292663
3-BROMO-5-FLUORO-N-HYDROXY-2-METHOXY-BENZENEMETHANAMINE
CAS:1009093-61-1
Formula: C8H9BrFNO2
KIN05016257
3-BROMO-5-FLUORO-N-HYDROXY-BENZAMIDE
CAS:1094640-15-9
Formula: C7H5BrFNO2
KIN05143307
3-BROMO-5-FLUORO-N-HYDROXY-BENZIMIDAMIDE
CAS:453565-62-3
Formula: C7H6BrFN2O
KIN03593020
3-BROMO-5-FLUORO-N-METHYLBENZENEMETHANAMINE
CAS:259231-24-8
Formula: C8H9BrFN
KIN03457552
3-BROMO-5-FLUORO-N-METHYLBENZENESULFONAMIDE
CAS:1198614-92-4
Formula: C7H7BrFNO2S
KIN05342883
3-BROMO-5-FLUORO-N-PHENYLBENZENEMETHANAMINE
CAS:1184005-30-8
Formula: C13H11BrFN
KIN05310214
3-BROMO-5-FLUORO-N-PROPYLBENZENEMETHANAMINE
CAS:1094761-45-1
Formula: C10H13BrFN
KIN05145101
3-BROMO-5-FLUORO-TYROSINE
CAS:10085-89-9
KIN02001652
3-BROMO-5-FLUOROBENZALDEHYDE
CAS:188813-02-7
Formula: C7H4BrFO
KIN03386172
3-BROMO-5-FLUOROBENZALDEHYDE OXIME
CAS:304876-25-3
Formula: C7H5BrFNO
KIN03481480
3-BROMO-5-FLUOROBENZENEACETIC ACID
CAS:202000-99-5
Formula: C8H6BrFO2
KIN03409927
3-BROMO-5-FLUOROBENZENEACETONITRILE
CAS:305800-58-2
Formula: C8H5BrFN
KIN03481921
3-BROMO-5-FLUOROBENZENEBUTANENITRILE
CAS:1057672-63-5
Formula: C10H9BrFN
KIN05104578
3-BROMO-5-FLUOROBENZENEMETHANAMINE
CAS:1094555-68-6
Formula: C7H7BrFN
KIN05142766
3-BROMO-5-FLUOROBENZENEMETHANAMINE HCL
CAS:1189924-80-8
Formula: C7H7BrFN.ClH
KIN05329551
3-BROMO-5-FLUOROBENZENEMETHANOL
CAS:216755-56-5
Formula: C7H6BrFO
KIN03429487
3-BROMO-5-FLUOROBENZENEPROPANAL
CAS:1057671-03-0
Formula: C9H8BrFO
KIN05104465
3-BROMO-5-FLUOROBENZENEPROPANAMINE
CAS:1057671-86-9
Formula: C9H11BrFN
KIN05104525
3-BROMO-5-FLUOROBENZENEPROPANENITRILE
CAS:1057676-66-0
Formula: C9H7BrFN
KIN05104747
3-BROMO-5-FLUOROBENZENEPROPANOIC ACID ETHYL ESTER
CAS:1057674-10-8
Formula: C11H12BrFO2
KIN05104669
3-BROMO-5-FLUOROBENZENEPROPANOL
CAS:1057671-49-4
Formula: C9H10BrFO
KIN05104497
3-BROMO-5-FLUOROBENZENETHIOL
CAS:179161-18-3
Formula: C6H4BrFS
KIN03366637
3-BROMO-5-FLUOROBENZOHYDRAZIDE
CAS:1094510-55-0
Formula: C7H6BrFN2O
KIN05142166
3-BROMO-5-FLUOROBENZOIC ACID
CAS:176548-70-2
Formula: C7H4BrFO2
KIN03360942
3-BROMO-5-FLUOROBENZOIC ACID ETHYL ESTER
CAS:353743-43-8
Formula: C9H8BrFO2
KIN03531185
3-BROMO-5-FLUOROBENZOIC ACID METHYL ESTER
CAS:334792-52-8
Formula: C8H6BrFO2
KIN03508008
3-BROMO-5-FLUOROBENZOIC ACID PROPYL ESTER
CAS:1155519-01-9
Formula: C10H10BrFO2
KIN05225346
3-BROMO-5-FLUOROBENZONITRILE
CAS:179898-34-1
Formula: C7H3BrFN
KIN03367957
3-BROMO-5-FLUOROBENZOYL AZIDE
CAS:1152844-17-1
KIN05201873
3-BROMO-5-FLUOROBENZOYL ISOTHIOCYANATE
CAS:1156947-26-0
Formula: C8H3BrFNOS
KIN05240724
3-BROMO-5-FLUOROPHENOL
CAS:433939-27-6
Formula: C6H4BrFO
KIN03579500
3-BROMO-5-FLUOROPYRIDINE
CAS:407-21-6
Formula: C6H6FN
KIN01013916
3-BROMO-5-FORMYL-1H-PYRROL-2-CARBOXYLIC ACID METHYL ESTER
CAS:39975-51-4
Formula: C7H6BrNO3
KIN02258967
3-BROMO-5-FORMYL-2,4,6-TRIMETHYL-BENZONITRILE
CAS:374905-63-2
Formula: C11H10BrNO
KIN03545350
3-BROMO-5-FORMYL-2-FURANBORONIC ACID
CAS:27329-71-1
Formula: C5H4BBrO4
KIN02156335
3-BROMO-5-FORMYL-2-METHOXY-BENZOIC ACID METHYL ESTER
CAS:1072937-60-0
Formula: C10H9BrO4
KIN05114707
3-BROMO-5-FORMYL-ISOXAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:161126-46-1
Formula: C6H4BrNO4
KIN03620835
3-BROMO-5-FORMYLBENZOIC ACID
CAS:398119-27-2
KIN03560206
3-BROMO-5-FORMYLBENZOIC ACID METHYL ESTER
CAS:377734-27-5
Formula: C9H7BrO3
KIN03546800
3-BROMO-5-HEXYL-2,6-DIMETHYL-4-HYDROXY-PYRIDINE
CAS:148808-45-1
KIN03290465
3-BROMO-5-HYDRAZINYLPYRIDINE HCL%
CAS:28741-22-2
Formula: C5H6BrN3.ClH
KIN02168492
3-BROMO-5-HYDROXY-1-METHYLBENZO[CD]INDOL-2(1H)-ONE
CAS:1087713-69-6
Formula: C12H8BrNO2
KIN05126695
3-BROMO-5-HYDROXY-2,6-DINITRO-BENZOIC ACID
CAS:67973-20-0
Formula: C7H3BrN2O7
KIN02559715
MFCD03424322
3-BROMO-5-HYDROXY-2-METHOXY-BENZALDEHYDE
CAS:147067-68-3
Formula: C8H7BrO3
KIN03284702
3-BROMO-5-HYDROXY-2-METHYL-NAPHTHALEN-1,4-DIONE
CAS:113683-19-5
Formula: C11H7BrO3
KIN03125152
3-BROMO-5-HYDROXY-2-METHYLBENZENESULFONYL FLUORIDE
CAS:1195398-00-5
Formula: C7H6BrFO3S
KIN05337103
3-BROMO-5-HYDROXY-4-METHOXY-BENZALDEHYDE OXIME
CAS:89978-55-2
Formula: C8H8BrNO3
KIN02720239
3-BROMO-5-HYDROXY-4-METHOXY-BENZOIC ACID
CAS:52783-66-1
Formula: C8H7BrO4
KIN02325644
3-BROMO-5-HYDROXY-4-METHOXY-PHENYL-ACETIC ACID
CAS:89936-30-1
Formula: C9H9BrO4
KIN02719438
3-BROMO-5-HYDROXY-4-METHYL-5H-FURAN-2-ONE
CAS:139760-41-1
Formula: [C5H5BrO3
KIN03254492
3-BROMO-5-HYDROXY-4-METHYLBENZALDEHYDE
CAS:470691-49-7
Formula: C8H7BrO2
KIN03599208
3-BROMO-5-HYDROXY-4-PROPYLBENZOIC ACID ETHYL ESTER
CAS:382150-27-8
Formula: C12H15BrO3
KIN03015763
3-BROMO-5-HYDROXY-4H-PYRAN-4-ONE
CAS:95790-60-6
Formula: C5H3BrO3
KIN02795275
3-BROMO-5-HYDROXY-BENZALDEHYDE
CAS:199177-26-9
Formula: C7H5BrO2
KIN03405465
3-BROMO-5-HYDROXY-BENZALDEHYDE OXIME
CAS:56843-29-9
Formula: C7H6BrNO2
KIN02389484
3-BROMO-5-HYDROXY-BENZENEACETIC ACID METHYL ESTER
CAS:1105589-32-9
Formula: C9H9BrO3
KIN05170661
3-BROMO-5-HYDROXY-BENZENEMETHANOL
CAS:1020336-51-9
Formula: C7H7BrO2
KIN05049517
3-Bromo-5-hydroxy-benzenemethanol; 3-Bromo-5-hydroxymethylphenol
3-BROMO-5-HYDROXY-BENZOIC ACID
CAS:140472-69-1
Formula: C7H5BrO3
KIN03256640
3-BROMO-5-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:192810-12-1
Formula: C8H7BrO3
KIN03394805
3-BROMO-5-HYDROXY-BENZOIC ACID TERT-BUTYL ESTER
CAS:1162260-72-1
Formula: C11H13BrO3
KIN05259051
3-BROMO-5-HYDROXY-N,N-DIMETHYLBENZAMIDE
CAS:1162261-25-7
Formula: C9H10BrNO2
KIN05259052
3-BROMO-5-HYDROXY-QUINOLIN-2(1H)-ONE
CAS:1192263-85-6
Formula: C9H6BrNO2;C9H6BrNO2
KIN05333027
3-BROMO-5-HYDROXY-TYROSINE
CAS:52783-64-9
Formula: C9H10BrNO4
KIN02325643
3-BROMO-5-IODO-2,4,6-TRIMETHYLPYRIDINE
CAS:29976-61-2
Formula: C8H9BrIN
KIN02178202
3-BROMO-5-IODO-2,4,6-TRIMETHYLPYRIDINE PICRATE
CAS:29976-15-6
KIN02178185
3-BROMO-5-IODO-2,6-DIMETHYL-4(1H)-PYRIDINONE
CAS:54416-89-6
Formula: C7H7BrINO
KIN02349755
3-BROMO-5-IODO-4(1H)-PYRIDINONE
CAS:98136-22-2
Formula: C5H3BrINO
KIN02811087
3-BROMO-5-IODO-4-(BENZYLOXY) -BENZALDEHYDE 2-(5-NITROPYRIDIN-2-YL)HYDRAZONE
CAS:347914-20-9
Formula: C19H14BrIN4O3
KIN03524537
3-BROMO-5-IODO-ALPHA-1H-PYRAZOLE
CAS:1015779-70-0
Formula: C3H2BrIN2
KIN05021025
3-BROMO-5-IODO-ALPHA-2-METHYLBENZOIC ACID
CAS:1022983-50-1
Formula: C8H6BrIO2
KIN05056880
3-BROMO-5-IODO-ALPHA-4-METHOXY-BENZAMIDE
CAS:1092308-97-8
Formula: C8H7BrINO2
KIN05133480
3-BROMO-5-IODO-ALPHA-4-METHOXY-BENZOIC ACID
CAS:1092308-81-0
Formula: C8H6BrIO3
KIN05133477
3-BROMO-5-IODO-ALPHA-4-METHOXY-BENZONITRILE
CAS:1092309-01-7
Formula: C8H5BrINO
KIN05133481
3-BROMO-5-IODO-ALPHA-4-METHOXY-BENZOYL CHLORIDE
CAS:1092308-93-4
Formula: C8H5BrClIO2
KIN05133478
3-BROMO-5-IODO-ALPHA-N,N-DIMETHYLBENZAMIDE
CAS:1162261-40-6
Formula: C9H9BrINO
KIN05259053
3-BROMO-5-IODO-ALPHA-PYRIDIN-4-CARBONITRILE
CAS:1114333-02-6
Formula: C6H2BrIN2
KIN05175333
3-BROMO-5-IODO-ALPHA-PYRIDINE 1-OXIDE
CAS:1094166-01-4
Formula: C5H3BrINO
KIN05136602
3-BROMO-5-IODO-ANILINE
CAS:319491-89-9
KIN03492114
3-BROMO-5-IODO-BENZALDEHYDE
CAS:188813-09-4
Formula: C7H4BrIO
KIN03386179
3-BROMO-5-IODO-BENZAMIDE
CAS:289039-19-6
Formula: C7H5BrINO
KIN03470535
3-BROMO-5-IODO-BENZENEMETHANOL
CAS:188813-08-3
Formula: C7H6BrIO
KIN03386178
3-BROMO-5-IODO-BENZOIC ACID
CAS:188815-32-9
Formula: C7H4BrIO2
KIN03003787
3-BROMO-5-IODO-BENZOIC ACID ETHYL ESTER
CAS:186772-44-1
Formula: C9H8BrIO2
KIN03382270
3-BROMO-5-IODO-BENZOIC ACID METHYL ESTER
CAS:188813-07-2
Formula: C8H6BrIO2
KIN03386177
3-BROMO-5-IODO-BENZONITRILE
CAS:289039-21-0
Formula: C7H3BrIN
KIN03470537
3-BROMO-5-IODO-BIPHENYL
CAS:136649-44-0
Formula: C12H8BrI
KIN03237903
3-BROMO-5-IODO-N-METHYLBENZAMIDE
CAS:398151-45-6
KIN03560295
3-BROMO-5-IODO-PYRIDINE
CAS:233770-01-9
Formula: C5H3BrIN
KIN03443816
3-BROMO-5-ISOCYANATO-2-HYDROXY-PHENOL 1,2-DIACETATE
CAS:141555-25-1
KIN03676682
3-BROMO-5-ISOCYANATO-PYRIDINE
CAS:167951-51-1
Formula: C6H3BrN2O
KIN03341719
3-BROMO-5-ISOPROPOXY-BENZOIC ACID
CAS:1119779-04-2
Formula: C10H11BrO3
KIN05177359
3-BROMO-5-ISOQUINOLINECARBOXYLIC ACID METHYL ESTER
CAS:1206-97-9
Formula: C11H10ClNO2
KIN01043492
3-BROMO-5-ISOXAZOLEACETIC ACID
CAS:4992-21-6
Formula: C5H5NO3
KIN01118555
3-BROMO-5-ISOXAZOLECARBONYL CHLORIDE
CAS:76596-52-6
Formula: C4HBrClNO2
KIN02620412
3-BROMO-5-ISOXAZOLECARBOXALDEHYDE
CAS:220780-57-4
Formula: C4H2BrNO2
KIN03434921
3-BROMO-5-ISOXAZOLECARBOXYLIC ACID METHYL ESTER
CAS:272773-11-2
Formula: C5H4BrNO3
KIN03464463
3-BROMO-5-ISOXAZOLEETHANAMINE
CAS:1187932-81-5
Formula: C5H7BrN2O
KIN05324315
3-BROMO-5-ISOXAZOLEETHANOL
CAS:105175-00-6
Formula: C5H6BrNO2
KIN03066434
3-BROMO-5-ISOXAZOLEMETHANAMINE
CAS:2763-94-2
Formula: C5H8N2O2
KIN01075731
3-BROMO-5-ISOXAZOLEMETHANAMINE HCL
CAS:90802-21-4
Formula: C4H6BrClN2O
KIN02733613
3-BROMO-5-ISOXAZOLEMETHANOL
CAS:142941-77-3
KIN03267426
3-BROMO-5-ISOXAZOLEPROPANOIC ACID
CAS:6567-35-7
Formula: C4H2BrNO3
KIN01165087
3-BROMO-5-METHOXY-1(3H)-ISOBENZOFURANONE
CAS:60889-19-2
Formula: C9H7BrO3
KIN02448634
3-BROMO-5-METHOXY-1,2-DIMETHYL-1H-INDOLE
CAS:144808-59-3
Formula: C11H12BrNO
KIN03277313
3-BROMO-5-METHOXY-1-METHYL-1H-INDOLE
CAS:111454-57-0
Formula: C10H10BrNO
KIN03107853
3-BROMO-5-METHOXY-1H-INDOL-2-CARBOXYLIC ACID
CAS:136965-32-7
Formula: C10H8BrNO3
KIN03239479
3-BROMO-5-METHOXY-1H-INDOLE
CAS:85092-83-7
Formula: C9H8BrNO
KIN02671825
MFCD07778336
3-BROMO-5-METHOXY-1H-INDOLE-7-CARBOXALDEHYDE
CAS:309976-23-6
Formula: C10H8BrNO2
KIN03484904
3-BROMO-5-METHOXY-1H-PYRAZOL-1-ACETIC ACID
CAS:1015784-41-4
Formula: C6H7BrN2O3
KIN05021130
3-BROMO-5-METHOXY-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015782-03-2
Formula: C8H11BrN2O3
KIN05021060
3-BROMO-5-METHOXY-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015784-62-9
Formula: C6H6BrClN2O2
KIN05021142
3-BROMO-5-METHOXY-1H-PYRAZOLE
CAS:1015779-81-3
Formula: C4H5BrN2O
KIN05021030
3-BROMO-5-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1053655-76-7
Formula: C8H7BrN2O
KIN05101368
3-BROMO-5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1000341-09-2
Formula: C8H7BrN2O
KIN05000627
3-BROMO-5-METHOXY-2,4-DIMETHYL-PYRIDINE
CAS:134150-05-3
Formula: C8H10BrNO
KIN03226936
3-BROMO-5-METHOXY-2,6-DINITRO-BENZOIC ACID METHYL ESTER
CAS:56709-74-1
Formula: C9H7BrN2O7
KIN02387387
MFCD01098215
3-BROMO-5-METHOXY-2,6-DINITROPYRIDINE
CAS:326899-80-3
Formula: C6H4BrN3O5
KIN03496920
3-BROMO-5-METHOXY-2-(METHYLTHIO)THIOPHENE
CAS:88234-94-0
Formula: C6H7BrOS2
KIN02695152
3-BROMO-5-METHOXY-2-AMINO-ANILINE
CAS:98546-54-4
Formula: C7H9BrN2O
KIN02814714
3-BROMO-5-METHOXY-2-METHYL-ANILINE
CAS:62827-42-3
Formula: C8H10BrNO
KIN02481171
3-BROMO-5-METHOXY-2-METHYLBENZENEMETHANOL
CAS:13979-63-0
Formula: C9H11BrO2
KIN02026660
MFCD00230766
3-BROMO-5-METHOXY-2-METHYLBENZOIC ACID
CAS:13979-61-8
Formula: C9H9BrO3
KIN02026658
3-BROMO-5-METHOXY-2-METHYLBENZOIC ACID METHYL ESTER
CAS:13979-62-9
Formula: C10H11BrO3
KIN02026659
3-BROMO-5-METHOXY-2-METHYLBENZONITRILE
CAS:13979-60-7
Formula: C9H8BrNO
KIN02026657
3-BROMO-5-METHOXY-2-METHYLPHENOL
CAS:65841-12-5
Formula: C8H9BrO2
KIN02533236
3-BROMO-5-METHOXY-2-METHYLTHIOPHENE
CAS:61074-70-2
Formula: C6H7BrOS
KIN02450536
3-BROMO-5-METHOXY-2-NITRO-BENZOIC ACID
CAS:56709-75-2
Formula: C8H6BrNO5
KIN02387388
3-BROMO-5-METHOXY-4-(1-METHYLETHOXY) -BENZALDEHYDE
CAS:400070-31-7
Formula: C11H13BrO3
KIN03560942
3-BROMO-5-METHOXY-4-(1-OXO-PROPOXY) -BENZALDEHYDE
CAS:384859-28-3
Formula: C11H11BrO4
KIN03552866
3-BROMO-5-METHOXY-4-(2-METHOXYETHOXY) -BENZALDEHYDE
CAS:87154-51-6
KIN02684775
3-BROMO-5-METHOXY-4-(ALLYLOXY) -BENZAMIDE
CAS:1019-24-5
Formula: C11H11ClO4
KIN01037316
3-BROMO-5-METHOXY-4-(METHOXYMETHOXY) -BENZALDEHYDE
CAS:2363-16-8
Formula: C8H6BrNO4
KIN01067786
3-BROMO-5-METHOXY-4-(PROPARGYLOXY) -BENZENEMETHANAMINE
CAS:1183808-99-2
Formula: C11H12BrNO2
KIN05308145
3-BROMO-5-METHOXY-4-(PYRIDIN-2-YLMETHOXY) -BENZALDEHYDE
CAS:433330-10-0
Formula: C14H12BrNO3
KIN03579153
3-BROMO-5-METHOXY-4-[(2-METHYL-ALLYLOXY) ]BENZENEETHANAMINE
CAS:1179095-55-6
Formula: C13H18BrNO2
KIN05282139
3-BROMO-5-METHOXY-4-[(2-METHYL-ALLYLOXY) ]BENZENEMETHANOL
CAS:1154010-66-8
Formula: C12H15BrO3
KIN05214074
3-BROMO-5-METHOXY-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190321-09-5
KIN05330724
3-Bromo-5-methoxy-4-methyl-7-aza-1H-indole
3-BROMO-5-METHOXY-4-METHYL-PYRIDINE
CAS:70201-49-9
Formula: C7H8BrNO
KIN02575917
3-BROMO-5-METHOXY-4-PROPOXY-BENZALDEHYDE
CAS:91335-52-3
Formula: C11H13BrO3
KIN02742029
MFCD02256500
3-BROMO-5-METHOXY-4-PROPOXY-BENZENEMETHANOL
CAS:116754-27-9
Formula: C11H15BrO3
KIN03145662
3-BROMO-5-METHOXY-ALPHA,ALPHA-DIMETHYL-4-[[5-METHYL-3-(1-PROPYLBUTYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YL]OXY]BENZENEMETHANOL
CAS:197716-78-2
Formula: C22H30BrN5O3
KIN03402969
3-BROMO-5-METHOXY-ANILINE
CAS:16618-68-1
Formula: C7H8BrNO
KIN02053207
MFCD11878497
3-BROMO-5-METHOXY-BENZALDEHYDE
CAS:262450-65-7
Formula: C8H7BrO2
KIN03460053
3-BROMO-5-METHOXY-BENZAMIDE
CAS:1177558-45-0
Formula: C8H8BrNO2
KIN05271971
3-BROMO-5-METHOXY-BENZENEACETONITRILE
CAS:123018-27-9
Formula: C9H8BrNO
KIN03177759
3-BROMO-5-METHOXY-BENZENEETHANAMINE
CAS:262450-67-9
Formula: C9H12BrNO
KIN03460055
3-BROMO-5-METHOXY-BENZENEMETHANAMINE
CAS:1177558-46-1
Formula: C8H10BrNO
KIN05271972
[[3-Bromo-5-(methoxy)phenyl]methyl]amine
3-BROMO-5-METHOXY-BENZENEMETHANOL
CAS:262450-64-6
Formula: C8H9BrO2
KIN03460052
3-BROMO-5-METHOXY-BENZO[B]SELENOPHEN-2-CARBOXYLIC ACID
CAS:186890-56-2
Formula: C10H7BrO3Se
KIN03643327
3-BROMO-5-METHOXY-BENZO[B]THIOPHEN-2-CARBOXYLIC ACID
CAS:62913-20-6
Formula: C10H7BrO3S
KIN02482666
3-BROMO-5-METHOXY-BENZOFURAN
CAS:333385-25-4
Formula: C9H7BrO2
KIN03506692
3-BROMO-5-METHOXY-BENZOFURAN-2-CARBOXYLIC ACID,
CAS:333385-05-0
Formula: C10H7BrO4
KIN03506691
3-BROMO-5-METHOXY-BENZOIC ACID
CAS:157893-14-6
Formula: C8H7BrO3
KIN03319236
3-BROMO-5-METHOXY-BENZOIC ACID ETHYL ESTER
CAS:1095274-93-3
Formula: C10H11BrO3;C10H11BrO3
KIN05150363
3-BROMO-5-METHOXY-BENZOIC ACID METHYL ESTER
CAS:56709-70-7
Formula: C9H9BrO3
KIN02387386
MFCD11042779
3-BROMO-5-METHOXY-BIPHENYL
CAS:136649-32-6
KIN03237898
3-BROMO-5-METHOXY-IMIDAZO[1,2-A]PYRAZINE
CAS:91775-61-0
Formula: C7H6BrN3O
KIN02748538
3-BROMO-5-METHOXY-N,N-DIMETHYL-ANILINE
CAS:102236-51-1
Formula: C9H12BrNO
KIN03045615
3-BROMO-5-METHOXY-N,N-DIMETHYLBENZENEMETHANAMINE
CAS:1112210-51-1
Formula: C10H14BrNO
KIN05175061
3-BROMO-5-METHOXY-N-ALLYL-4-PROPOXY-BENZENEMETHANAMINE
CAS:1156798-98-9
Formula: C14H20BrNO2
KIN05238482
3-BROMO-5-METHOXY-PYRIDIN-4-CARBONITRILE
CAS:51454-49-0
Formula: C7H5BrN2O
KIN02306749
3-BROMO-5-METHOXY-PYRIDINE
CAS:50720-12-2
Formula: C6H6BrNO
KIN02296750
MFCD00234169
3-BROMO-5-METHOXY-PYRIDINE N1-OXIDE
CAS:78156-39-5
Formula: C6H6BrNO2
KIN02629644
3-BROMO-5-METHYL-1(3H)-ISOBENZOFURANONE
CAS:63113-04-2
Formula: C9H7BrO2
KIN02486620
3-BROMO-5-METHYL-1,6-NAPHTHYRIDIN-2(1H)-ONE
CAS:147293-25-2
Formula: C9H7BrN2O
KIN03285471
3-BROMO-5-METHYL-1,6-NAPHTHYRIDIN-2-YLAMINE
CAS:147293-26-3
Formula: C9H8BrN3
KIN03285472
3-BROMO-5-METHYL-1H-INDAZOLE
CAS:40598-72-9
Formula: C8H7BrN2
KIN02264196
MFCD07781622
3-BROMO-5-METHYL-1H-INDOL-2-CARBALDEHYDE
CAS:95094-53-4
Formula: C10H8BrNO
KIN02788144
3-BROMO-5-METHYL-1H-INDOL-2-CARBALDEHYDE OXIME
CAS:95094-55-6
Formula: C10H9BrN2O
KIN02788146
3-BROMO-5-METHYL-1H-INDOL-2-CARBOHYDRAZIDE
CAS:95538-62-8
Formula: C10H10BrN3O
KIN02792539
3-BROMO-5-METHYL-1H-INDOL-2-CARBONYL AZIDE
CAS:95538-67-3
Formula: C10H7BrN4O
KIN02792544
3-BROMO-5-METHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:1092298-84-4
Formula: C10H8BrNO2
KIN05133060
3-BROMO-5-METHYL-1H-INDOLE
CAS:1003708-62-0
Formula: C9H8BrN
KIN05008528
3-BROMO-5-METHYL-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-13-4
Formula: C6H7BrN2O2
KIN05021064
3-BROMO-5-METHYL-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015779-08-4
Formula: C8H11BrN2O2
KIN05021011
3-BROMO-5-METHYL-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015782-48-5
Formula: C6H6BrClN2O
KIN05021085
3-BROMO-5-METHYL-1H-PYRAZOLE
CAS:57097-81-1
Formula: C4H5BrN2
KIN02394055
3-BROMO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE
CAS:52090-78-5
Formula: C7H6BrN3
KIN02315969
3-BROMO-5-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190314-41-0
Formula: C8H7BrN2
KIN05330279
3-BROMO-5-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1000343-73-6
Formula: C8H7BrN2
KIN05000837
3-Bromo-5-methyl-4-aza-1H-indole
3-BROMO-5-METHYL-2(1H)-PYRIDINONE
CAS:17282-02-9
Formula: C6H6BrNO
KIN02060275
MFCD00955762
3-BROMO-5-METHYL-2(3H)-FURANONE
CAS:66955-58-6
Formula: C5H5BrO2
KIN02547242
3-BROMO-5-METHYL-2-(1-METHYLETHENYL)THIOPHENE
CAS:36880-39-4
KIN02235016
3-BROMO-5-METHYL-2-(1-METHYLETHYL)THIOPHENE
CAS:36880-40-7
KIN02235017
3-BROMO-5-METHYL-2-(1-PROPYN-1-YL)THIOPHENE
CAS:89556-10-5
Formula: C8H7BrS
KIN02713518
3-BROMO-5-METHYL-2-(2-METHYL-1-PROPENYL)THIOPHENE
CAS:89556-04-7
Formula: C9H11BrS
KIN02713514
3-BROMO-5-METHYL-2-(4H-[1,2,4]-TRIAZOL-4-YL)-PYRIDINE
CAS:1123169-57-2
Formula: C8H7BrN4
KIN05178507
3-BROMO-5-METHYL-2-(BENZYLOXY) -BENZALDEHYDE
CAS:1194683-48-1
Formula: C15H13BrO2
KIN05335613
3-BROMO-5-METHYL-2-(PHENYLETHYNYL)THIOPHENE
CAS:89556-11-6
Formula: C13H9BrS
KIN02713519
3-BROMO-5-METHYL-2-(PROPYLAMINO)-BENZOHYDRAZIDE
CAS:1049108-08-8
Formula: C11H16BrN3O
KIN05097353
3-BROMO-5-METHYL-2-(TRIMETHYLSILYL)THIOPHENE
CAS:80959-94-0
Formula: C8H13BrSSi
KIN02647165
3-BROMO-5-METHYL-2-[(1-METHYLETHYL)AMINO]BENZOHYDRAZIDE
CAS:1049108-33-9
Formula: C11H16BrN3O
KIN05097357
3-BROMO-5-METHYL-2-AMINO-ANILINE
CAS:70733-25-4
Formula: C7H9BrN2
KIN02579498
3-BROMO-5-METHYL-2-HYDROXY-PHENOL
CAS:117654-19-0
Formula: C7H7BrO2
KIN03150030
3-BROMO-5-METHYL-2-NITRO-PYRIDINE
CAS:155790-02-6
Formula: C6H5BrN2O2
KIN03313371
3-BROMO-5-METHYL-2-NITRO-THIOPHENE
CAS:82834-44-4
Formula: C5H4BrNO2S
KIN02657887
3-BROMO-5-METHYL-2-NITROPHENOL
CAS:93796-62-4
Formula: C7H6BrNO3
KIN02773738
3-BROMO-5-METHYL-2-OXO-HEXANOIC ACID
CAS:90012-69-4
Formula: C7H11BrO3
KIN02721094
3-BROMO-5-METHYL-2-PHENOXY-PYRIDINE
CAS:1018782-87-0
Formula: C12H10BrNO
KIN05040004
3-BROMO-5-METHYL-2-PHENYL-1H-PYRROLE
CAS:58803-41-1
KIN02421373
3-BROMO-5-METHYL-2-PHENYLTHIOPHENE
CAS:61285-23-2
Formula: C11H9BrS
KIN02453748
3-BROMO-5-METHYL-2-PHENYLTHIOPHENE 1,1-DIOXIDE
CAS:135900-98-0
KIN03234805
3-BROMO-5-METHYL-2-PYRIDINEBUTANAMINE
CAS:85634-87-3
Formula: C10H15BrN2
KIN02675660
3-BROMO-5-METHYL-2-PYRIDINECARBONITRILE
CAS:474824-78-7
Formula: C7H5BrN2
KIN03601801
3-BROMO-5-METHYL-2-PYRIDINECARBONITRILE 1-OXIDE
CAS:474824-79-8
Formula: C7H5BrN2O
KIN03005553
3-BROMO-5-METHYL-2-THIOPHENECARBALDEHYDE
CAS:36155-82-5
Formula: C6H5BrOS
KIN02229467
MFCD01859869
3-BROMO-5-METHYL-2-THIOPHENEMETHANAMINE
CAS:1000686-09-8
Formula: C6H8BrNS
KIN05004588
3-BROMO-5-METHYL-4(1H)-PYRIDINONE
CAS:70149-41-6
Formula: C6H6BrNO
KIN02575538
3-BROMO-5-METHYL-4-ISOXAZOLECARBOXYLIC ACID
CAS:130742-22-2
Formula: C5H4BrNO3
KIN03211334
3-BROMO-5-METHYL-4-ISOXAZOLEETHANOL
CAS:153124-39-1
Formula: C6H8BrNO2
KIN03304147
3-BROMO-5-METHYL-4-ISOXAZOLEMETHANOL
CAS:153124-37-9
Formula: C5H6BrNO2
KIN03304145
3-BROMO-5-METHYL-4-NITRO-1H-PYRAZOLE
CAS:55120-09-7
Formula: C4H4BrN3O2
KIN02361047
3-BROMO-5-METHYL-4-NITRO-ISOXAZOLE
CAS:88982-26-7
Formula: C4H3BrN2O3
KIN02705295
3-BROMO-5-METHYL-4-NITROPHENOL
CAS:93796-59-9
Formula: C7H6BrNO3
KIN02773735
3-BROMO-5-METHYL-4-NITROPYRIDINE N1-OXIDE
CAS:97944-38-2
Formula: C6H5BrN2O3
KIN02808927
3-BROMO-5-METHYL-4-PROPYL-PYRIDINE
CAS:177273-29-9
Formula: C9H12BrN
KIN03362108
3-BROMO-5-METHYL-4-PYRIDINAMINE
CAS:97944-43-9
Formula: C6H7BrN2
KIN02808932
MFCD07437841
3-BROMO-5-METHYL-4-PYRIDINECARBOXALDEHYDE
CAS:203569-15-7
Formula: C7H6BrNO
KIN03412245
3-BROMO-5-METHYL-4-PYRIDINOL 1-OXIDE
CAS:108004-96-2
Formula: C6H6BrNO2
KIN03086249
3-BROMO-5-METHYL-5-PHENYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:1024162-89-7
KIN05058059
3-BROMO-5-METHYL-6-NITRO-1H-INDAZOLE
CAS:1082040-69-4
KIN05118198
3-BROMO-5-METHYL-6-PHENYL-2(1H)-PYRAZINONE
CAS:140862-40-4
KIN03257483
3-BROMO-5-METHYL-A-2-PROPEN-1-YL-4-PYRIDINEMETHANOL
CAS:203569-16-8
Formula: C10H12BrNO
KIN03637804
3-BROMO-5-METHYL-ANILINE
CAS:74586-53-1
Formula: C7H8BrN
KIN02606881
MFCD11845553
3-BROMO-5-METHYL-BIPHENYL-2-YLAMINE
CAS:1140969-95-4
Formula: C13H12BrN
KIN05189421
3-BROMO-5-METHYL-FURAN-2(5H)-ONE
CAS:76311-90-5
Formula: C5H5BrO2
KIN02618413
3-BROMO-5-METHYL-FURAN-2-D
CAS:1006721-04-5
Formula: C5H4BrDO
KIN05013370
3-BROMO-5-METHYL-IMIDAZO[1,2-A]PYRIDINE
CAS:5857-49-8
Formula: C8H9ClN2
KIN01143626
3-BROMO-5-METHYL-ISOXAZOLE
CAS:25741-97-3
Formula: C4H4BrNO
KIN02142411
MFCD06660140
3-BROMO-5-METHYL-N-(2-METHYLPHENYL)-PYRIDIN-2-YLAMINE
CAS:1005498-88-3
Formula: C13H13BrN2
KIN05010635
3-BROMO-5-METHYL-N-PHENYLPYRIDIN-2-YLAMINE
CAS:1005498-84-9
Formula: C12H11BrN2
KIN05010634
3-BROMO-5-METHYL-N-PROPYLBENZENESULFONAMIDE
CAS:1020252-89-4
Formula: C10H14BrNO2S
KIN05049397
3-BROMO-5-METHYL-PYRIDINE N1-OXIDE
CAS:97944-34-8
Formula: C6H6BrNO
KIN02808923
3-BROMO-5-METHYL-TRICYCLO[3.3.1.13,7]DECAN-1-CARBONITRILE
CAS:25187-58-0
Formula: C12H16BrN
KIN02137213
3-BROMO-5-METHYLADAMANTAN-1-CARBOXYLIC ACID
CAS:14670-95-2
Formula: C12H17BrO2
KIN02034441
MFCD00218941
3-BROMO-5-METHYLBENZALDEHYDE
CAS:188813-04-9
Formula: C8H7BrO
KIN03386174
3-BROMO-5-METHYLBENZAMIDE
CAS:1007578-82-6
Formula: C8H8BrNO
KIN05014614
3-BROMO-5-METHYLBENZENEACETIC ACID
CAS:51719-66-5
Formula: C9H9BrO2
KIN02310561
3-BROMO-5-METHYLBENZENEMETHANAMINE
CAS:1177558-42-7
Formula: C8H10BrN
KIN05271970
3-BROMO-5-METHYLBENZENESULFONAMIDE
CAS:452341-93-4
Formula: C7H8BrNO2S
KIN03592620
3-BROMO-5-METHYLBENZOIC ACID
CAS:58530-13-5
Formula: C8H7BrO2
KIN02417052
MFCD02684926
3-BROMO-5-METHYLBENZOIC ACID METHYL ESTER
CAS:478375-40-5
Formula: C9H9BrO2
KIN03606763
3-BROMO-5-METHYLBENZONITRILE
CAS:124289-21-0
Formula: C8H6BrN
KIN03183360
3-BROMO-5-METHYLENE-4-PROPYL-2(5H)-FURANONE
CAS:385438-08-4
Formula: C8H9BrO2
KIN03553286
3-BROMO-5-METHYLHEXAN-2-ONE
CAS:71700-44-2
Formula: C7H13BrO
KIN02586192
3-BROMO-5-METHYLINDANONE
CAS:28122-16-9
Formula: C10H9BrO
KIN02163394
3-BROMO-5-METHYLPHENOL
CAS:74204-00-5
Formula: C7H7BrO
KIN02604076
MFCD09038281
3-BROMO-5-METHYLPHENYL-ACETIC ACID
CAS:2721-96-2
Formula: C18H16IN3O2
KIN01074931
3-BROMO-5-METHYLPYRAZIN-2-YLAMINE
CAS:74290-65-6
Formula: C5H6BRN3
KIN02604677
3-BROMO-5-METHYLPYRAZIN-2-YLAMINE 1-OXIDE
CAS:202409-03-8
Formula: C5H6BrN3O
KIN03410538
3-BROMO-5-METHYLPYRAZIN-2-YLAMINE 4-OXIDE
CAS:152569-01-2
Formula: C5H6BrN3O
KIN03302631
3-BROMO-5-METHYLPYRAZOLO[1,5-A]PYRIMIDIN-2(1H)-ONE
CAS:52130-64-0
Formula: C7H6BrN3O
KIN02316747
3-BROMO-5-METHYLPYRAZOLO[1,5-A]PYRIMIDIN-2-YL ACETATE
CAS:89355-99-7
Formula: C9H8BrN3O2
KIN02710653
3-BROMO-5-METHYLPYRIDIN-2-CARBOXYLIC ACID
CAS:121151-56-2
Formula: C7H6BrNO2
KIN03168243
3-BROMO-5-METHYLPYRIDIN-2-YLAMINE
CAS:17282-00-7
Formula: C6H7BrN2
KIN02060273
MFCD00068231
3-BROMO-5-METHYLPYRIDIN-4-CARBONITRILE
CAS:51454-50-3
Formula: C7H5BrN2
KIN02306750
3-BROMO-5-METHYLPYRIDINE
CAS:3430-17-9
Formula: C6H6BrN
KIN01089039
3-BROMO-5-METHYLPYRIDINE HCL
CAS:1187932-48-4
KIN05324290
3-BROMO-5-MORPHOLIN-4-YLBENZOIC ACID METHYL ESTER
CAS:1020099-75-5
Formula: C12H14BrNO3
KIN05049173
3-BROMO-5-MORPHOLIN-4-YLBENZONITRILE
CAS:1129540-92-6
Formula: C11H11BrN2O
KIN05182398
3-BROMO-5-NITRO-1-(TETRAHYDRO-2H-PYRAN-2-YL)-1H-INDAZOLE
CAS:395099-73-7
Formula: C12H12BrN3O3
KIN03620834
3-BROMO-5-NITRO-1-PHENYL-1H-INDAZOLE
CAS:91178-55-1
Formula: C13H8BrN3O2
KIN02739892
3-BROMO-5-NITRO-1H-INDAZOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:473416-22-7
Formula: C12H12BrN3O4
KIN03599983
3-BROMO-5-NITRO-1H-INDAZOLE
CAS:67400-25-3
Formula: C7H4BrN3O2
KIN02552922
MFCD07367964
3-BROMO-5-NITRO-1H-INDOL-2-CARBOXYLIC ACID
CAS:400767-08-0
Formula: C9H5BrN2O4
KIN03561568
3-BROMO-5-NITRO-1H-PYRAZOLE
CAS:104599-38-4
KIN03062400
3-BROMO-5-NITRO-1H-PYRAZOLO[3,4-B]PYRIDINE
CAS:1186608-83-2
Formula: C6H3BrN4O2;C6H3BrN4O2
KIN05321443
3-BROMO-5-NITRO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190309-83-1
Formula: C7H4BrN3O2
KIN05330023
3-BROMO-5-NITRO-2(1H)-PYRIDINONE
CAS:15862-33-6
Formula: C5H3BrN2O3
KIN02044862
MFCD03840431
3-BROMO-5-NITRO-2,6-PYRIDINEDIAMINE
CAS:135513-86-9
Formula: C5H5BrN4O2
KIN03233190
3-BROMO-5-NITRO-2-(2,2,2-TRIFLUORO-ETHOXY) -PYRIDINE
CAS:1051372-09-8
Formula: C7H4BrF3N2O3
KIN05099960
3-BROMO-5-NITRO-2-(BENZENESULFONYL)THIOPHENE
CAS:62082-40-0
Formula: C10H6BrNO4S2
KIN02467379
3-BROMO-5-NITRO-2-(PYRROLIDIN-1-YL)-PYRIDINE
CAS:1065074-81-8
Formula: C9H10BrN3O2
KIN05109125
3-BROMO-5-NITRO-2-(TRIFLUOROMETHOXY) -PYRIDINE
CAS:1086392-98-4
Formula: C6H2BrF3N2O3
KIN05125895
3-BROMO-5-NITRO-2-AMINO-ANILINE
CAS:69399-60-6
Formula: C6H6BRN3O2
KIN02570082
3-BROMO-5-NITRO-2-FURANMETHANIMINE
CAS:104514-42-3
Formula: C5H3BrN2O3
KIN03061759
3-BROMO-5-NITRO-2-PHENOXY-PYRIDINE
CAS:15862-49-4
KIN02044875
3-BROMO-5-NITRO-2-PHENYL-1H-PYRROLE
CAS:1016650-18-2
Formula: C10H7BrN2O2
KIN05023152
3-BROMO-5-NITRO-2-PIPERIDIN-1-YLPYRIDINE
CAS:1065074-87-4
Formula: C10H12BrN3O2
KIN05109128
3-BROMO-5-NITRO-2-THIOPHENAMINE
CAS:85069-57-4
Formula: C4H3BrN2O2S
KIN02671676
3-BROMO-5-NITRO-4(1H)-PYRIDINONE
CAS:70149-42-7
Formula: C5H3BrN2O3
KIN02575539
MFCD00770218
3-BROMO-5-NITRO-4-[(4-NITROPHENYL)AZO]PHENOL
CAS:88210-40-6
Formula: C12H7BrN4O5
KIN02694658
3-BROMO-5-NITRO-4-HYDROXY-PYRIDINE
CAS:31872-65-8
Formula: C5H3BrN2O3
KIN02192695
MFCD08692339
3-BROMO-5-NITRO-4-HYDROXY-PYRIDINE N1-OXIDE
CAS:31872-66-9
Formula: C5H3BrN2O4
KIN02192696
MFCD11100684
3-BROMO-5-NITRO-4-PYRIDINAMINE
CAS:89284-05-9
Formula: C5H4BrN3O2
KIN02709814
MFCD01646057
3-BROMO-5-NITRO-ANILINE
CAS:55215-57-1
Formula: C6H5BrN2O2
KIN02362542
3-BROMO-5-NITRO-BENZALDEHYDE
CAS:355134-13-3
Formula: C7H4BrNO3
KIN03532276
3-BROMO-5-NITRO-BENZAMIDE
CAS:54321-80-1
Formula: C7H5BrN2O3
KIN02348309
MFCD01529620
3-BROMO-5-NITRO-BENZENEMETHANOL
CAS:139194-79-9
Formula: C7H6BrNO3
KIN03251246
3-BROMO-5-NITRO-BENZENESULFONAMIDE
CAS:59481-21-9
Formula: C6H5BrN2O4S
KIN02432113
3-BROMO-5-NITRO-BENZENESULFONIC ACID
CAS:1192472-48-2
Formula: C6H4BrNO5S
KIN05333760
3-BROMO-5-NITRO-BENZIMIDAMIDE
CAS:53202-65-6
Formula: C7H6BrN3O2
KIN02331656
3-BROMO-5-NITRO-BENZO[B]THIOPHENE
CAS:19492-95-6
Formula: C8H4BrNO2S
KIN02081788
MFCD08695302
3-BROMO-5-NITRO-BENZOHYDRAZIDE
CAS:374671-07-5
Formula: C7H6BrN3O3
KIN03544949
3-BROMO-5-NITRO-BENZOIC ACID
CAS:6307-84-2
Formula: C15H26ClNO
KIN01157020
3-BROMO-5-NITRO-BENZONITRILE
CAS:49674-15-9
Formula: C7H3BrN2O2
KIN02289639
MFCD00463804
3-BROMO-5-NITRO-BENZOYL AZIDE
CAS:374671-08-6
KIN03544950
3-BROMO-5-NITRO-BENZOYL CHLORIDE
CAS:51339-40-3
Formula: C7H3BrClNO3
KIN02305215
3-BROMO-5-NITRO-BETA-OXO-BENZENEPROPANOIC ACID
CAS:1000510-44-0
Formula: C9H6BrNO5
KIN05001333
3-BROMO-5-NITRO-BIPHENYL
CAS:136649-26-8
Formula: C12H8BrNO2
KIN03237894
3-BROMO-5-NITRO-N,N-DIPROPYLPYRIDIN-4-YLAMINE
CAS:31872-73-8
Formula: C11H16BrN3O2
KIN02192702
3-BROMO-5-NITRO-N-PHENYLPYRIDIN-4-YLAMINE
CAS:91182-61-5
Formula: C11H8BrN3O2
KIN02739972
3-BROMO-5-NITRO-THIOPHEN-2-CARBOXYLIC ACID
CAS:89283-23-8
Formula: C5H2BrNO4S
KIN02709768
3-BROMO-5-NITROPHENOL
CAS:116632-23-6
Formula: C6H4BrNO3
KIN03145064
3-BROMO-5-NITROPYRIDIN-2-YLAMINE
CAS:15862-31-4
Formula: C5H4BrN3O2
KIN02044861
MFCD00955628
3-BROMO-5-NITROPYRIDIN-4-THIOL
CAS:31872-81-8
Formula: C5H3BrN2O2S
KIN02192706
3-BROMO-5-NITROPYRIDINE
CAS:15862-30-3
Formula: C5H3BrN2O2
KIN02044860
MFCD04114216
3-BROMO-5-NITROQUINOLINE
CAS:116632-33-8
Formula: C9H5BrN2O2
KIN03145068
3-BROMO-5-OCTYL-5H-FURAN-2-ONE
CAS:76311-91-6
KIN02618414
3-BROMO-5-OCTYL-FURAN-2(5H)-ONE
CAS:76508-25-3
KIN02619734
3-BROMO-5-OXO-1-CYCLOPENTENE-1-ACETIC ACID METHYL ESTER
CAS:107708-93-0
KIN03632049
3-BROMO-5-OXOHEXAHYDRO-2,6-METHANOFURO[3,2-B]FURAN-7-CARBOXYLIC ACID
CAS:6280-79-1
Formula: C8H8Br2O5
KIN01155150
3-BROMO-5-PENTYLPHENOL
CAS:110827-94-6
Formula: C11H15BrO
KIN03103844
3-BROMO-5-PHENOXY-6-OXO-6H-ANTHRA[1,9-CD]ISOXAZOLE
CAS:106960-84-3
Formula: C20H10BrNO3
KIN03080011
3-BROMO-5-PHENOXY-PYRIDINE
CAS:28232-63-5
Formula: C11H8BrNO
KIN02164395
MFCD10698710
3-BROMO-5-PHENOXY-PYRIDINE N1-OXIDE
CAS:73407-34-8
Formula: C11H8BrNO2
KIN02598139
3-BROMO-5-PHENYL-1,2,4-OXADIAZOLE
CAS:23432-94-2
Formula: C8H5BrN2O
KIN02119883
MFCD06795878
3-BROMO-5-PHENYL-1,2,4-THIADIAZOLE
CAS:101495-43-6
Formula: C8H5BrN2S
KIN03039822
3-BROMO-5-PHENYL-1H-[1,2,4]-TRIAZOLE 4-OXIDE
CAS:31991-72-7
KIN02193579
3-BROMO-5-PHENYL-1H-PYRAZOLE
CAS:1092533-03-3
Formula: C9H7BrN2
KIN05134291
3-BROMO-5-PHENYL-2(1H)-PYRAZINONE
CAS:67602-02-2
Formula: C10H7BrN2O
KIN02555564
3-BROMO-5-PHENYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:85297-57-0
Formula: C9H7BrN2O2
KIN02673416
3-BROMO-5-PHENYL-2-PYRIDINAMINE
CAS:107351-80-4
Formula: C11H9BrN2
KIN03082165
3-BROMO-5-PHENYL-2-THIOPHENECARBALDEHYDE
CAS:107938-07-8
KIN03085894
3-BROMO-5-PHENYL-2-THIOPHENECARBOXYLIC ACID
CAS:1017687-42-1
Formula: C11H7BrO2S
KIN05034865
3-BROMO-5-PHENYL-2-THIOPHENECARBOXYLIC ACID METHYL ESTER
CAS:478028-23-8
KIN03620833
3-BROMO-5-PHENYL-2-THIOPHENEMETHANOL
CAS:1174879-60-7
Formula: C11H9BrOS
KIN05266546
3-BROMO-5-PHENYL-3H-1,2,3-DITHIABOROLE
CAS:91573-46-5
Formula: C8H6BBrS2
KIN02745915
3-BROMO-5-PHENYL-4,5-DIHYDRO-ISOXAZOLE
CAS:86256-88-4
Formula: C9H8BrNO
KIN02679390
3-BROMO-5-PHENYL-7-(TRIFLUOROMETHYL)-1H-PYRAZOLO[1,5-A]PYRIMIDIN-2-CARBOXYLIC ACID
CAS:304687-28-3
Formula: C14H7BrF3N3O2
KIN03481279
3-BROMO-5-PHENYL-ISOTHIAZOLE
CAS:57027-49-3
KIN02392720
3-BROMO-5-PHENYL-ISOXAZOLE
CAS:10557-74-1
Formula: C9H6BrNO
KIN02008095
3-BROMO-5-PHENYL-PHOSPHORIN
CAS:87274-72-4
Formula: C11H8BrP
KIN02685550
3-BROMO-5-PHENYL-PYRIDINE
CAS:142137-17-5
Formula: C11H8BrN
KIN03263745
3-BROMO-5-PHENYLPYRAZIN-2-YLAMINE
CAS:67602-05-5
Formula: C10H8BrN3
KIN02555567
MFCD09027884
3-BROMO-5-PIPERIDIN-1-YLPYRIDINE
CAS:24255-93-4
Formula: C10H13BrN2
KIN02128599
3-BROMO-5-PROPOXY-6-PROPYL-7H-FURO[3,2-B]PYRAN-7-ONE
CAS:1097931-90-2
Formula: C13H15BrO4
KIN05161933
3-BROMO-5-PROPOXY-PYRIDINE
CAS:370879-78-0
Formula: C8H10BrNO
KIN03542502
3-BROMO-5-PROPYL-3H-1,2,3-DITHIABOROLE
CAS:91573-44-3
Formula: C5H8BBrS2
KIN02745913
3-BROMO-5-PROPYLPHENOL
CAS:94102-92-8
Formula: C9H11BrO
KIN02777788
3-BROMO-5-PYRIDIN-3-YLBENZOIC ACID
CAS:453565-96-3
Formula: C12H8BrNO2
KIN03593037
3-BROMO-5-QUINOLINAMINE
CAS:116632-57-6
Formula: C9H7BrN2
KIN03145084
3-BROMO-5-TERT-BUTYL-2-HYDROXY-BENZALDEHYDE
CAS:11946-68-3
KIN02009715
3-BROMO-5-TERT-BUTYL-4,5-DIHYDRO-ISOXAZOLE
CAS:128464-85-7
Formula: C7H12BrNO
KIN03201856
3-BROMO-5-TERT-BUTYL-4-HYDROXY-BENZONITRILE
CAS:4910-07-0
KIN01117051
3-BROMO-5-TERT-BUTYLBENZENE-1,2-DIOL
CAS:38782-39-7
KIN02250364
3-BROMO-5-TRIMETHYLSILANYL-ISOXAZOLE
CAS:181947-25-1
KIN03371844
3-BROMO-5H-DIBENZO[B,F]AZEPINE
CAS:92161-06-3
Formula: C14H10BrN
KIN02753619
3-BROMO-5H-PYRROLO[2,3-B]PYRAZINE
CAS:126066-54-4
Formula: C6H4BrN3
KIN03191286
3-BROMO-6,11-DIHYDRO-11-METHOXY-DIBENZO[B,E]OXEPIN
CAS:127167-60-6
Formula: C15H13BrO2
KIN03008517
3-BROMO-6,11-DIHYDRO-DIBENZO[B,E]OXEPIN-11-OL
CAS:188607-49-0
Formula: C14H11BrO2
KIN03385271
3-BROMO-6,6'-DIMETHOXY-2,2'-BIPYRIDINE
CAS:156629-64-0
KIN03315988
3-BROMO-6,6-DIETHOXY-2-HEXANONE
CAS:61092-71-5
Formula: C10H19BrO3
KIN02450802
3-BROMO-6,6-DIMETHOXY-2-HEXANONE
CAS:61092-69-1
Formula: C8H15BrO3
KIN02450800
3-BROMO-6,6-DIMETHYL-1,2,4-CYCLOHEXANETRIONE
CAS:21428-71-7
Formula: C8H9BrO3
KIN02100783
3-BROMO-6,6-DIMETHYL-1-CYCLOHEXENE-1-CARBONITRILE
CAS:56830-36-5
Formula: C9H12BrN
KIN02389321
3-BROMO-6,6-DIMETHYL-2,4-PIPERIDINEDIONE
CAS:1000801-14-8
Formula: C7H10BrNO2
KIN05004748
3-BROMO-6,6-DIMETHYL-BICYCLO[3.1.1]HEPT-2-ONE
CAS:1610-51-1
Formula: C10H10
KIN01051408
3-BROMO-6,7,8,9-TETRAHYDRO-1-[[(2-IODO-PHENYL)IMINO]METHYL]-2-DIBENZOFURANOL
CAS:374912-34-2
Formula: C19H15BrINO2
KIN03545377
3-BROMO-6,7,8,9-TETRAHYDRO-1-[[(4-IODO-2-METHYLPHENYL)IMINO]METHYL]-2-DIBENZOFURANOL
CAS:374612-20-1
Formula: C20H17BrINO2
KIN03544748
3-BROMO-6,7,8,9-TETRAHYDRO-1-[[(4-IODO-PHENYL)AMINO]METHYL]-2-DIBENZOFURANOL
CAS:312939-48-3
Formula: C19H17BrINO2
KIN03487141
3-BROMO-6,7,8,9-TETRAHYDRO-1-[[(4-IODO-PHENYL)IMINO]METHYL]-2-DIBENZOFURANOL
CAS:375351-39-6
Formula: C19H15BrINO2
KIN03545556
3-BROMO-6,7,8,9-TETRAHYDRO-5H-BENZOCYCLOHEPTEN-2-OL
CAS:32337-89-6
Formula: C11H13BrO
KIN02196052
3-BROMO-6,7,8,9-TETRAHYDRO-5H-BENZOCYCLOHEPTEN-5-ONE
CAS:87779-78-0
Formula: C11H11BrO
KIN02689651
3-BROMO-6,7,8,9-TETRAHYDRO-5H-BENZOCYCLOHEPTEN-5-ONE 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:22647-90-1
Formula: C17H15BrN4O4
KIN02112527
3-BROMO-6,7,8,9-TETRAHYDRO-5H-PYRIDO[2,3-B]AZEPINE
CAS:1003023-66-2
KIN05007804
3-BROMO-6,7,8-TRIMETHOXY-4-METHYL-2H-BENZOPYRAN-2-ONE
CAS:63446-07-1
Formula: C13H13BrO5
KIN02492797
3-BROMO-6,7-DICHLORO-2-METHOXY-QUINOLINE
CAS:172843-67-3
KIN03351999
3-BROMO-6,7-DICHLORO-4(1H)-CINNOLINONE
CAS:86222-51-7
Formula: C8H3BrCl2N2O
KIN02679078
3-BROMO-6,7-DICHLORO-4H-CHROMEN-4-ONE
CAS:288399-48-4
Formula: C9H3BrCl2O2
KIN03470132
3-BROMO-6,7-DIHYDRO-[1,4]DIOXINO[2,3-C]PYRIDAZINE
CAS:1003944-31-7
Formula: C6H5BrN2O2
KIN05008889
3-BROMO-6,7-DIHYDRO-1H,5H-PYRROLO[2,3-C]AZEPINE-4,8-DIONE
CAS:161200-38-0
KIN03328303
3-BROMO-6,7-DIHYDRO-2-NITRO-5H-PYRROLO[1,2-A]IMIDAZOLE
CAS:41604-77-7
Formula: C6H6BRN3O2
KIN02272298
3-BROMO-6,7-DIHYDRO-2-PHENYL-4(5H)-BENZOFURANONE
CAS:1092976-27-6
Formula: C14H11BrO2
KIN05134959
3-BROMO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDIN-5-AMINE
CAS:1196151-64-0
Formula: C8H9BrN2
KIN05339172
3-BROMO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDIN-5-ONE
CAS:1196154-87-6
Formula: C8H6BrNO
KIN05339422
3-BROMO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE
CAS:158331-18-1
Formula: C8H8BrN
KIN03320210
3-BROMO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE, 1-OXIDE
CAS:158331-19-2
Formula: C8H8BrNO
KIN03320211
3-BROMO-6,7-DIHYDRO-8(5H)-INDOLIZINONE
CAS:1199971-55-5
Formula: C8H8BrNO
KIN05343913
3-BROMO-6,7-DIHYDRO-CYCLOPENTA[B]PYRAN-2(5H)-ONE
CAS:98437-37-7
Formula: C8H7BrO2
KIN02813837
3-BROMO-6,7-DIHYDROPYRROLO[2,3-C]AZEPIN-8(1H)-ONE
CAS:1103395-82-9
Formula: C8H7BrN2O
KIN05168646
3-BROMO-6,7-DIHYDROXY-2-QUINOXALINECARBOXYLIC ACID
CAS:122234-93-9
Formula: C9H5BrN2O4
KIN03008112
3-BROMO-6,7-DIMETHOXY-1(3H)-ISOBENZOFURANONE
CAS:73563-23-2
Formula: C10H9BrO4
KIN02599092
3-BROMO-6,7-DIMETHOXY-2H-BENZOPYRAN-2-ONE
CAS:66384-64-3
Formula: C11H9BrO4
KIN02541319
3-BROMO-6,7-DIMETHOXY-4-CINNOLINOL
CAS:20988-75-4
KIN02096238
3-BROMO-6,7-DIMETHYL-CHROMONE
CAS:73220-36-7
Formula: C11H9BrO2
KIN02596740
3-BROMO-6,8,9-TRIHYDROXY-4-OXO-AMBROS-2-EN-12-OIC ACID 12,8-LACTONE 6-METHACRYLATE
CAS:25873-37-4
KIN02143668
3-BROMO-6,8,9-TRIHYDROXY-4-OXO-AMBROS-2-EN-12-OIC ACID 12,8-LACTONE 6-METHACRYLATE ACETATE
CAS:25817-03-2
KIN02143197
3-BROMO-6,8-DICHLORO-4H-CHROMEN-4-ONE
CAS:263365-49-7
Formula: C9H3BrCl2O2
KIN03460613
3-BROMO-6,8-DIFLUORO-4-HYDROXY-QUINOLINE
CAS:1065087-96-8
Formula: C9H4BrF2NO
KIN05109155
3-BROMO-6,8-DIMETHOXY-ISOQUINOLINE
CAS:13388-77-7
KIN02018825
3-BROMO-6,8-DIMETHYL-2-PHENYL-4H-QUINOLIZIN-4-ONE
CAS:64194-15-6
Formula: C17H14BrNO
KIN02505881
3-BROMO-6,8-DIMETHYL-4H-CHROMEN-4-ONE
CAS:288399-49-5
Formula: C11H9BrO2
KIN03470133
3-BROMO-6,9-DIPHENYL-9H-CARBAZOLE
CAS:1160294-85-8
Formula: C24H16BrN
KIN05257556
3-BROMO-6-(1-METHYLETHOXY) -PYRIDAZINE
CAS:17321-32-3
Formula: C7H9BrN2O
KIN02060781
3-BROMO-6-(1-METHYLETHYL)-PYRIDAZINE
CAS:1086383-70-1
Formula: C7H9BrN2
KIN05125800
3-BROMO-6-(1H-IMIDAZOL-1-YL)-PYRIDAZINE
CAS:1159820-70-8
Formula: C7H5BrN4
KIN05256181
3-BROMO-6-(1H-PYRAZOL-1-YL)-PYRIDAZINE
CAS:1159821-22-3
Formula: C7H5BrN4
KIN05256227
3-BROMO-6-(1H-PYRROL-1-YL)-PYRIDAZINE
CAS:1027512-95-3
Formula: C8H6BrN3
KIN05062713
3-BROMO-6-(2-CHLOROPHENOXY) -2-METHYLPYRIDINE
CAS:28216-07-1
KIN02164171
3-BROMO-6-(2-CYANOACETYL)-PYRIDIN-2-CARBOXYLIC ACID
CAS:1107053-89-3
Formula: C9H5BrN2O3
KIN05171312
3-BROMO-6-(2-ETHOXYETHOXY) PHTHALONITRILE
CAS:154435-05-9
KIN03308780
3-BROMO-6-(2-METHYL-1H-IMIDAZOL-1-YL)-PYRIDAZINE
CAS:1159820-77-5
Formula: C8H7BrN4
KIN05256187
3-BROMO-6-(2-METHYLPHENYL)-PYRIDAZINE
CAS:1086383-96-1
Formula: C11H9BrN2
KIN05125808
3-BROMO-6-(3-CHLOROPHENOXY) -2-METHYLPYRIDINE
CAS:28216-08-2
KIN02164172
3-BROMO-6-(3-METHYL-1H-PYRAZOL-1-YL)-PYRIDAZINE
CAS:1159820-81-1
Formula: C8H7BrN4
KIN05256191
3-BROMO-6-(3-METHYLBUTOXY) -PYRIDAZINE
CAS:17321-34-5
KIN02060783
3-BROMO-6-(3-METHYLPHENYL)-PYRIDAZINE
CAS:1086383-93-8
Formula: C11H9BrN2
KIN05125807
3-BROMO-6-(4-CHLOROPHENYL)-4-METHYLTHIOPYRAN-2-ONE
CAS:203171-92-0
Formula: C12H8BrClO2S
KIN03411592
3-BROMO-6-(4-HEXYLPHENYL) -PYRIDAZINE
CAS:64779-23-3
Formula: C16H19BrN2
KIN02515534
3-BROMO-6-(4-HYDROXY-PHENYL) -2-HEPTANONE
CAS:74320-27-7
Formula: C13H17BrO2
KIN02604948
3-BROMO-6-(4-METHYL-1H-IMIDAZOL-1-YL)-PYRIDAZINE
CAS:1027513-47-8
Formula: C8H7BrN4
KIN05062736
3-BROMO-6-(4-METHYL-1H-PYRAZOL-1-YL)-PYRIDAZINE
CAS:1159820-87-7
Formula: C8H7BrN4
KIN05256197
3-BROMO-6-(4-METHYLPHENYL)-2H-PYRAN-2-ONE
CAS:5567-36-2
Formula: C22H20N2O5
KIN01135839
3-BROMO-6-(4-METHYLPHENYL)-PYRIDAZINE
CAS:1086383-90-5
Formula: C11H9BrN2
KIN05125806
3-BROMO-6-(4-METHYLPIPERAZINE-1-YL)-PYRIDAZINE
CAS:1027513-15-0
KIN05062723
3-BROMO-6-(5-CHLORO-PYRIDIN-2-YL)-PYRIDAZINE
CAS:1185312-98-4
Formula: C9H5BrClN3
KIN05319382
3-BROMO-6-(5-HYDROXY-PENTYL) PHTHALONITRILE
CAS:154435-40-2
KIN03308783
3-BROMO-6-(6-CHLORO-PYRAZIN-2-YL)-PYRIDAZINE
CAS:1185319-09-8
Formula: C8H4BrClN4
KIN05319607
3-BROMO-6-(6-CHLORO-PYRIDIN-2-YL)-PYRIDAZINE
CAS:1185316-31-7
Formula: C9H5BrClN3
KIN05319490
3-BROMO-6-(BENZYLOXY) -PYRIDIN-2-CARBONITRILE
CAS:1186637-45-5
Formula: C13H9BrN2O
KIN05321567
3-BROMO-6-(CARBOXYMETHYLAMINO) -2-CHLOROBENZOIC ACID
CAS:3030-13-5
KIN01081169
3-BROMO-6-(CHLOROMETHYL)-2-HYDROXY-BENZALDEHYDE
CAS:209789-38-8
Formula: C8H6BrClO2
KIN03420430
3-BROMO-6-(CHLOROMETHYL)-2-PROPYL-PYRIDINE
CAS:1149593-14-5
Formula: C9H11BrClN
KIN05196690
3-BROMO-6-(CYCLOBUTYLOXY) -PYRIDAZINE
CAS:1086383-99-4
Formula: C8H9BrN2O
KIN05125809
3-BROMO-6-(CYCLOPENTYLOXY) -PYRIDAZINE
CAS:1027513-37-6
Formula: C9H11BrN2O
KIN05062730
3-BROMO-6-(FURAN-2-YL)-PYRIDAZINE
CAS:1086383-84-7
Formula: C8H5BrN2O
KIN05125804
3-BROMO-6-(FURAN-3-YL)-PYRIDAZINE
CAS:1086383-87-0
Formula: C8H5BrN2O
KIN05125805
3-BROMO-6-(HYDROXYMETHYL) -4-METHOXY-2H-THIOPYRAN-2-ONE
CAS:72863-81-1
Formula: C7H7BrO3S
KIN02594392
3-BROMO-6-(METHYLTHIO)-2(1H)-PYRAZINONE
CAS:250659-55-3
Formula: C5H5BrN2OS
KIN03450926
3-BROMO-6-(METHYLTHIO)-PYRAZIN-2-YLAMINE
CAS:250659-54-2
KIN03450925
3-BROMO-6-(METHYLTHIO)-PYRIDAZINE
CAS:1159977-67-9
Formula: C5H5BrN2S
KIN05256882
3-BROMO-6-(PHENYLSELENO)CYCLOHEX-2-EN-1-ONE
CAS:121073-08-3
Formula: C12H11BrOSe
KIN03167852
3-BROMO-6-(PIPERAZIN-1-YL)-PYRIDAZINE
CAS:1159977-68-0
Formula: C8H11BrN4
KIN05256883
3-BROMO-6-(PIPERIDIN-1-YL)-PYRIDAZINE
CAS:1027513-11-6
Formula: C9H12BrN3
KIN05062721
3-BROMO-6-(PYRIDIN-2-YL)-PYRIDAZINE
CAS:1005036-23-6
Formula: C9H6BrN3
KIN05010162
3-BROMO-6-(PYRIDIN-3-YL)-PYRIDAZINE
CAS:1159818-53-7
Formula: C9H6BrN3
KIN05256006
3-BROMO-6-(PYRIDIN-4-YL)-PYRIDAZINE
CAS:1159818-39-9
Formula: C9H6BrN3
KIN05255992
3-BROMO-6-(PYRIDIN-4-YLMETHOXY) -PYRIDAZINE
CAS:325781-41-7
KIN03495598
3-BROMO-6-(PYRROLIDIN-1-YL)-PYRIDAZINE
CAS:1027513-07-0
Formula: C8H10BrN3
KIN05062719
3-BROMO-6-(TERT-BUTYL)-2,3-DIHYDRO-4H-CHROMEN-4-ONE
CAS:80930-49-0
Formula: C13H15BrO2
KIN02646964
3-BROMO-6-(TERT-BUTYL)-2,4-DIMETHYLPHENOL
CAS:91560-99-5
Formula: C12H17BrO
KIN02745617
3-BROMO-6-(TERT-BUTYL)-2-METHYLPYRIDINE
CAS:52999-91-4
Formula: C10H14BrN
KIN02328754
3-BROMO-6-(TERT-BUTYL)-PYRIDAZINE
CAS:1086383-74-5
Formula: C8H11BrN2
KIN05125801
3-BROMO-6-(THIOPHEN-2-YL)-PYRIDAZINE
CAS:172507-39-0
KIN03351146
3-BROMO-6-(TRIFLUOROMETHOXY) -QUINOLIN-4-OL
CAS:1065087-86-6
Formula: C10H5BrF3NO2
KIN05109151
3-BROMO-6-(TRIFLUOROMETHYL)-1H-INDAZOLE
CAS:1000341-21-8
Formula: C8H4BrF3N2;C8H4BrF3N2
KIN05000638
3-BROMO-6-(TRIFLUOROMETHYL)-1H-INDOL-5-CARBONITRILE
CAS:1186404-83-0
KIN05321092
3-BROMO-6-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190320-80-9
KIN05330702
3-Bromo-6-(trifluoromethyl)-7-aza-1H-indole
3-BROMO-6-(TRIFLUOROMETHYL)-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190311-58-0
KIN05330127
3-Bromo-6-trifluoromethyl-4-aza-1H-indole
3-BROMO-6-(TRIFLUOROMETHYL)-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190315-61-7
KIN05330345
3-Bromo-6-(trifluoromethyl)-5-aza-1H-indole
3-BROMO-6-(TRIFLUOROMETHYL)-IMIDAZO[1,2-A]PYRIDINE
CAS:1146615-86-2
Formula: C8H4BrF3N2
KIN05194488
3-BROMO-6-(TRIFLUOROMETHYL)-PYRIDAZINE
CAS:174607-37-5
KIN03356219
3-BROMO-6-[(1E)-1-METHYL-1-PROPEN-1-YL]-2H-PYRAN-2-ONE
CAS:444886-62-8
Formula: C9H9BrO2
KIN03643326
3-BROMO-6-[(2-METHOXYETHOXY) METHYL]-2-METHYLPYRIDINE
CAS:1149593-01-0
Formula: C10H14BrNO2
KIN05196689
3-BROMO-6-[(2-METHYLPROPYL)THIO]-PHTHALONITRILE
CAS:154435-33-3
Formula: C12H11BrN2S
KIN03308781
3-BROMO-6-[(4-METHYLPHENYL)SULFONYL]-3,4-HEXADIEN-2-OL
CAS:88830-59-5
Formula: C13H15BrO3S
KIN02703260
3-BROMO-6-[(CARBOXYMETHYL) AMINO]-2-IODO-BENZOIC ACID
CAS:63037-69-4
Formula: C9H7BrINO4
KIN02485258
3-BROMO-6-[3-(1-METHYLETHYL)PIPERAZIN-1-YL]PYRIDAZINE
CAS:1001184-70-8
Formula: C11H17BrN4
KIN05005496
3-BROMO-6-[4-(HEXYLOXY) PHENYL]PYRIDAZINE
CAS:64779-26-6
Formula: C16H19BrN2O
KIN02515537
3-BROMO-6-AMINO-1H-INDAZOLE
CAS:52347-72-5
Formula: C7H6BrN3
KIN02319959
3-BROMO-6-AMINO-QUINOLINE
CAS:7101-97-5
Formula: C11H11N3O
KIN01178670
3-BROMO-6-BROMOMETHYL-2-METHYLPYRIDINE
CAS:123094-75-7
Formula: C7H7Br2N
KIN03178120
3-BROMO-6-BROMOMETHYL-2H-BENZOPYRAN-2-ONE
CAS:50465-99-1
Formula: C10H6Br2O2
KIN02293309
3-BROMO-6-BROMOMETHYL-4-METHOXY-2-PYRONE
CAS:105525-88-0
Formula: C7H5Br3O3
KIN03068879
3-BROMO-6-BROMOMETHYL-4-METHOXY-2H-PYRAN-2-ONE
CAS:81960-53-4
Formula: C7H6Br2O3
KIN02652666
3-BROMO-6-BROMOMETHYL-4-METHYLPYRAN-2-ONE
CAS:141402-08-6
Formula: C7H6Br2O2
KIN03260072
3-BROMO-6-BUTOXY-PYRIDAZINE
CAS:17321-33-4
KIN02060782
3-BROMO-6-BUTOXY-PYRIDIN-2-CARBONITRILE
CAS:1186637-44-4
Formula: C10H11BrN2O
KIN05321566
3-BROMO-6-BUTYL-2H-PYRAN-2-ONE
CAS:444887-00-7
Formula: C9H11BrO2
KIN03587020
3-BROMO-6-BUTYL-4-METHYL-2H-PYRAN-2-ONE
CAS:99187-46-9
Formula: C10H13BrO2
KIN02818838
3-BROMO-6-BUTYLPYRIDIN-2-CARBOXYLIC ACID
CAS:30683-18-2
Formula: C10H12BrNO2
KIN02183963
3-BROMO-6-CHLORO-[1,2,4]-TRIAZOLO[4,3-B]PYRIDAZINE
CAS:383157-16-2
KIN03551684
3-BROMO-6-CHLORO-[2,2'-BIPYRIDINE]-5-CARBONITRILE
CAS:1135283-47-4
Formula: C11H5BrClN3
KIN05186155
3-BROMO-6-CHLORO-1,2,3,4,5,6-HEXAFLUORO-CYCLOHEXA-1,4-DIENE
CAS:111837-21-9
Formula: C6BrClF6
KIN03110416
3-BROMO-6-CHLORO-1,2-DIMETHYL-9H-PYRROLO[1,2-A]INDOL-9-ONE
CAS:53592-74-8
Formula: C13H9BrClNO
KIN02337525
3-BROMO-6-CHLORO-1H-INDAZOL-5-YLAMINE
CAS:1000342-44-8
KIN05000748
3-BROMO-6-CHLORO-1H-INDOLE
CAS:1094641-40-3
Formula: C8H5BrClN
KIN05143326
3-BROMO-6-CHLORO-1H-PYRROLO[2,3-B]PYRIDINE-4-OL
CAS:1190314-89-6
KIN05330307
3-Bromo-6-chloro-4-hydroxy-7-aza-1H-indole
3-BROMO-6-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190317-85-1
KIN05330467
3-Bromo-6-chloro-4-aza-1H-indole
3-BROMO-6-CHLORO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1000341-61-6
Formula: C7H4BrClN2
KIN05000673
3-Bromo-6-chloro-5-aza-1H-indole
3-BROMO-6-CHLORO-2,4-DIFLUORO-5-IODO-PYRIDINE
CAS:41649-40-5
Formula: C5BrClF2IN
KIN02272610
3-BROMO-6-CHLORO-2,4-DIFLUOROBENZALDEHYDE
CAS:1160573-58-9
Formula: C7H2BrClF2O
KIN05257840
3-BROMO-6-CHLORO-2,4-DIFLUOROBENZOIC ACID
CAS:1160573-56-7
Formula: C7H2BrClF2O2
KIN05257838
3-BROMO-6-CHLORO-2,4-DIMETHYL-5-NITROPYRIDINE
CAS:415907-79-8
Formula: C7H6BrClN2O2
KIN03572121
3-BROMO-6-CHLORO-2-(TRIFLUOROMETHYL)-IMIDAZO[1,2-A]PYRIDINE
CAS:1160474-82-7
KIN05257653
3-BROMO-6-CHLORO-2-ETHOXY-5-NITROPYRIDINE
CAS:239791-63-0
Formula: C7H6BrClN2O3
KIN03445569
3-BROMO-6-CHLORO-2-FLUORO-5-IODO-4-HYDROXY-PYRIDINE
CAS:41649-25-6
Formula: C5HBrClFINO
KIN02272602
3-BROMO-6-CHLORO-2-FLUOROBENZENEACETIC ACID ETHYL ESTER
CAS:1020087-81-3
Formula: C10H9BrClFO2
KIN05049165
3-BROMO-6-CHLORO-2-HYDROXY-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:165317-35-1
Formula: C7H4BrClO2
KIN03643325
3-BROMO-6-CHLORO-2-HYDROXY-BENZALDEHYDE
CAS:1009094-06-7
Formula: C7H4BrClO2
KIN05016259
3-BROMO-6-CHLORO-2-HYDROXY-PHENOL
CAS:180268-95-5
Formula: C6H4BrClO2
KIN03368884
3-BROMO-6-CHLORO-2-HYDROXY-QUINOLIN-4(1H)-ONE
CAS:1009636-33-2
Formula: C9H5BrClNO2
KIN05016768
3-BROMO-6-CHLORO-2-METHOXY-BENZALDEHYDE
CAS:1009094-07-8
Formula: C8H6BrClO2
KIN05016260
3-BROMO-6-CHLORO-2-METHOXY-QUINOLINE
CAS:1197340-23-0
Formula: C10H7BrClNO
KIN05340608
3-BROMO-6-CHLORO-2-METHYL-4-NITROPYRIDINE 1-OXIDE
CAS:185017-84-9
Formula: C6H4BrClN2O3
KIN03378173
3-BROMO-6-CHLORO-2-METHYL-5-NITROPYRIDINE
CAS:186413-75-2
Formula: C6H4BrClN2O2
KIN03381543
3-BROMO-6-CHLORO-2-METHYL-ANILINE
CAS:1007226-77-8
Formula: C7H7BrClN
KIN05013888
3-BROMO-6-CHLORO-2-METHYL-PYRIDINE
CAS:132606-40-7
Formula: C6H5BrClN
KIN03003749
3-BROMO-6-CHLORO-2-METHYL-PYRIDINE 1-OXIDE
CAS:185017-78-1
Formula: C6H5BrClNO
KIN03378169
3-BROMO-6-CHLORO-2-METHYL-QUINOLIN-4-OL
CAS:65673-91-8
Formula: C10H7BrClNO
KIN02530635
3-BROMO-6-CHLORO-2-NITRO-BENZALDEHYDE
CAS:213382-41-3
Formula: C7H3BrClNO3
KIN03424976
3-BROMO-6-CHLORO-2-PHENYL-IMIDAZO[1,2-A]PYRIDINE
CAS:477886-81-0
Formula: C13H8BrClN2
KIN03605667
3-BROMO-6-CHLORO-2-PHENYL-IMIDAZO[1,2-B]PYRIDAZINE
CAS:19601-74-2
Formula: C12H7BrClN3
KIN02082671
MFCD09832527
3-BROMO-6-CHLORO-2-PYRAZINECARBOXYLIC ACID METHYL ESTER
CAS:13457-28-8
Formula: C6H4BrClN2O2
KIN02019852
3-BROMO-6-CHLORO-2-PYRIDINAMINE
CAS:442127-50-6
Formula: C5H4BrClN2
KIN03583990
3-BROMO-6-CHLORO-2-PYRIDINECARBALDEHYDE
CAS:1060815-64-6
Formula: C6H3BrClNO
KIN05106568
3-BROMO-6-CHLORO-2-PYRIDINECARBONITRILE
CAS:1053659-39-4
Formula: C6H2BrClN2
KIN05101440
3-BROMO-6-CHLORO-3-(BENZYL)-2,4(1H,3H)-QUINOLINEDIONE
CAS:211859-28-8
Formula: C16H11BrClNO2
KIN03654592
3-BROMO-6-CHLORO-3-METHYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:211859-24-4
Formula: C10H7BrClNO2
KIN03676681
3-BROMO-6-CHLORO-4-(2-CHLORO-TERT-BUTYL)-PYRIDAZINE
CAS:108287-93-0
Formula: C8H9BrCl2N2
KIN03088062
3-BROMO-6-CHLORO-4-FLUORO-1H-INDAZOLE
CAS:1000340-85-1
KIN05000603
3-BROMO-6-CHLORO-4-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190322-49-6
KIN05330827
3-Bromo-6-chloro-4-methoxy-7-aza-1H-indole
3-BROMO-6-CHLORO-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:4893-91-8
KIN01116752
3-BROMO-6-CHLORO-4-METHYL-2-NITROPHENOL
CAS:1195525-28-0
Formula: C7H5BrClNO3
KIN05337377
3-BROMO-6-CHLORO-4-METHYL-2-PYRIDINECARBONITRILE
CAS:1186637-53-5
Formula: C7H4BrClN2
KIN05321575
3-BROMO-6-CHLORO-4-METHYL-QUINOLIN-2(1H)-ONE
CAS:23976-60-5
Formula: C10H7BrClNO
KIN02125564
3-BROMO-6-CHLORO-4-METHYLPYRIDAZINE
CAS:89283-90-9
Formula: C5H4BrClN2
KIN02709801
3-BROMO-6-CHLORO-5-(2-CHLORO-ETHYL)-4-HYDROXY-2(1H)-PYRIDINONE
CAS:24334-10-9
KIN02129415
3-BROMO-6-CHLORO-5-(DIMETHYLAMINO)-2-PYRAZINECARBOXYLIC ACID METHYL ESTER
CAS:21874-50-0
Formula: C8H9BrClN3O2
KIN02104977
3-BROMO-6-CHLORO-5-(ETHYLAMINO)-2-PYRAZINECARBOXYLIC ACID METHYL ESTER
CAS:21874-51-1
Formula: C8H9BrClN3O2
KIN02104978
3-BROMO-6-CHLORO-5-(TERT-BUTYL)-2-HYDROXY-BENZALDEHYDE
CAS:119646-73-0
KIN03643324
3-BROMO-6-CHLORO-5-FLUORO-2-HYDROXY-BENZALDEHYDE
CAS:286836-31-5
Formula: C7H3BrClFO2
KIN03468744
3-BROMO-6-CHLORO-5-METHYL-2-PYRIDINECARBONITRILE
CAS:1186637-76-2
Formula: C7H4BrClN2
KIN05321578
3-BROMO-6-CHLORO-5-NITRO-1H-INDAZOLE
CAS:1000342-41-5
KIN05000746
3-BROMO-6-CHLORO-7-AZA-1H-INDOLE
CAS:1190321-08-4
Formula: C7H4BrClN2;C7H4BrClN2
KIN05330723
3-BROMO-6-CHLORO-7-METHYL-CHROMONE
CAS:263365-48-6
Formula: C10H6BrClO2
KIN03460612
3-BROMO-6-CHLORO-8-HYDROXY-QUINOLINE
CAS:183543-67-1
Formula: C9H5BrClNO
KIN03374901
3-BROMO-6-CHLORO-8-NITROQUINOLINE
CAS:183543-61-5
Formula: C9H4BrClN2O2
KIN03374899
3-BROMO-6-CHLORO-CHROMONE
CAS:73220-38-9
Formula: C9H4BrClO2
KIN02596742
3-BROMO-6-CHLORO-CYCLOHEPTA[B]PYRROL-2(1H)-ONE
CAS:20884-29-1
Formula: C9H5BrClNO
KIN02094922
3-BROMO-6-CHLORO-IMIDAZO[1,2-A]PYRIMIDIN-2-CARBALDEHYDE
CAS:1019026-89-1
Formula: C7H3BrClN3O
KIN05040673
3-BROMO-6-CHLORO-IMIDAZO[1,2-A]PYRIMIDIN-2-METHANAMINE
CAS:1019027-67-8
Formula: C7H6BrClN4
KIN05040696
3-BROMO-6-CHLORO-IMIDAZO[1,2-B]PYRIDAZINE
CAS:13526-66-4
Formula: C6H3BrClN3
KIN02020878
MFCD09027274
3-BROMO-6-CHLORO-PYRIDIN-2-CARBOXYLIC ACID ETHYL ESTER
CAS:1065074-97-6
Formula: C8H7BrClNO2
KIN05109132
3-BROMO-6-CHLORO-QUINOLIN-2(1H)-ONE
CAS:1197340-22-9
Formula: C9H5BrClNO
KIN05340607
3-BROMO-6-CHLORO-QUINOLIN-8-YLAMINE
CAS:183543-65-9
Formula: C9H6BrClN2
KIN03374900
3-BROMO-6-CHLORO-QUINOLINE
CAS:13669-65-3
Formula: C9H5BrClN
KIN02022939
3-BROMO-6-CHLORO-THIENO[2,3-C]-1,5-NAPHTHYRIDINE
CAS:154418-95-8
Formula: C10H4BrClN2S
KIN03308707
3-BROMO-6-CHLORO-TRICYCLO[4.3.1.13,8]UNDECANE
CAS:188621-93-4
KIN03385321
3-BROMO-6-CHLOROBENZO[A]PYRENE
CAS:111189-55-0
Formula: C20H10BrCl
KIN03106197
3-BROMO-6-CHLOROPYRAZIN-2-YLAMINE
CAS:212779-21-0
Formula: C4H3BrClN3
KIN03424379
3-BROMO-6-CHLOROPYRIDAZINE
CAS:89089-18-9
Formula: C4H2BrClN2
KIN02706892
MFCD09834814
3-BROMO-6-CYCLOBUTYL-IMIDAZO[1,2-A]PYRIMIDINE-2-CARBALDEHYDE
CAS:1020034-84-7
Formula: C11H10BrN3O
KIN05048697
3-BROMO-6-CYCLOBUTYLPYRIDAZINE
CAS:1086384-05-5
Formula: C8H9BrN2
KIN05125810
3-BROMO-6-CYCLOHEXYLPYRIDAZINE
CAS:1086383-81-4
Formula: C10H13BrN2
KIN05125803
3-BROMO-6-CYCLOPENTYLPYRIDAZINE
CAS:1086383-78-9
Formula: C9H11BrN2
KIN05125802
3-BROMO-6-CYCLOPROPYLPYRIDAZINE
CAS:1046816-40-3
Formula: C7H7BrN2
KIN05095676
3-BROMO-6-ETHENYL-2-METHYL-PYRIDINE
CAS:1122090-67-8
Formula: C8H8BrN
KIN05178281
3-BROMO-6-ETHOXY-2-(1-METHYLETHOXY) -PYRIDINE
CAS:1017577-30-8
Formula: C10H14BrNO2
KIN05034583
3-BROMO-6-ETHOXY-7-METHYL-1,8-NAPHTHYRIDIN-4-OL
CAS:151099-25-1
KIN03298253
3-BROMO-6-ETHOXY-N-PHENYLPYRIDIN-2-YLAMINE
CAS:1146547-66-1
Formula: C13H13BrN2O
KIN05194419
3-BROMO-6-ETHOXY-PYRIDAZINE
CAS:17321-30-1
Formula: C6H7BrN2O
KIN02060779
3-BROMO-6-ETHYL-2-HYDROXY-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:2902-50-3
KIN01078441
3-BROMO-6-ETHYL-5-METHYL-2(1H)-PYRAZINONE
CAS:153809-04-2
Formula: C7H9BrN2O
KIN03306508
3-BROMO-6-ETHYL-5-METHYL-2(1H)-PYRIDINETHIONE
CAS:99314-70-2
Formula: C8H10BrNS
KIN02819511
3-BROMO-6-ETHYL-5-METHYL-2(1H)-PYRIDINONE
CAS:99307-95-6
Formula: C8H10BrNO
KIN02819462
3-BROMO-6-ETHYL-CHROMONE
CAS:288399-50-8
Formula: C11H9BrO2
KIN03470134
3-BROMO-6-ETHYLPYRIDAZINE
CAS:152665-26-4
Formula: C6H7BrN2
KIN03302896
3-BROMO-6-FLUORO-1H-INDOLE
CAS:1094754-90-1
Formula: C8H5BrFN
KIN05144987
3-BROMO-6-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190315-22-0
KIN05330324
3-Bromo-6-fluoro-7-aza-1H-indole
3-BROMO-6-FLUORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190320-37-6
KIN05330673
3-Bromo-6-fluoro-4-aza-1H-indole
3-BROMO-6-FLUORO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190316-52-9
KIN05330393
3-Bromo-6-fluoro-5-aza-1H-indole
3-BROMO-6-FLUORO-2,3-DIHYDRO-4H-CHROMEN-4-ONE
CAS:105300-37-6
Formula: C9H6BrFO2
KIN03067290
3-BROMO-6-FLUORO-2-(2-METHYL-ALLYL)-BENZONITRILE
CAS:1194341-04-2
Formula: C11H9BrFN
KIN05335392
3-BROMO-6-FLUORO-2-HYDROXY-BENZALDEHYDE
CAS:199287-82-6
Formula: C7H4BrFO2
KIN03405636
3-BROMO-6-FLUORO-2-HYDROXY-PHENOL
CAS:186589-83-3
Formula: C6H4BrFO2
KIN03381890
3-BROMO-6-FLUORO-2-METHOXY-BENZALDEHYDE
CAS:473416-74-9
Formula: C8H6BrFO2
KIN03599990
3-BROMO-6-FLUORO-2-METHOXY-PHENOL
CAS:1026796-50-8
Formula: C7H6BrFO2
KIN05061363
3-BROMO-6-FLUORO-2-METHYL-PYRIDINE
CAS:375368-83-5
Formula: C6H5BrFN
KIN03003810
3-BROMO-6-FLUORO-2-NITRO-ANILINE
CAS:1119454-21-5
Formula: C6H4BrFN2O2
KIN05177215
3-BROMO-6-FLUORO-2-NITRO-BENZALDEHYDE
CAS:213382-43-5
Formula: C7H3BrFNO3
KIN03424978
3-BROMO-6-FLUORO-2H-1-BENZOPYRAN-2-OL
CAS:104326-05-8
Formula: C9H6BrFO2
KIN03060484
3-BROMO-6-FLUORO-4-HYDROXY-2-(TRIFLUOROMETHYL)-QUINOLINE
CAS:1072944-66-1
Formula: C10H4BrF4NO;C10H4BrF4NO
KIN05114756
3-BROMO-6-FLUORO-4-HYDROXY-QUINOLINE
CAS:1065087-77-5
Formula: C9H5BrFNO
KIN05109147
3-BROMO-6-FLUORO-4H-CHROMEN-4-ONE
CAS:179111-05-8
Formula: [C9H4BrFO2
KIN03366550
3-BROMO-6-FLUORO-IMIDAZO[1,2-A]PYRIDINE
CAS:1186405-11-7
KIN05321102
3-BROMO-6-FLUORO-QUINOLINE
CAS:205114-16-5
Formula: C9H5BrFN
KIN03414511
3-BROMO-6-HYDRAZINYL-2-METHYLPYRIDINE
CAS:39919-66-9
Formula: C6H8BrN3
KIN02258537
MFCD10000078
3-BROMO-6-HYDRAZINYLPYRIDAZINE
CAS:64461-67-2
Formula: C4H5BrN4
KIN02510142
3-BROMO-6-HYDROXY-1H-INDAZOLE
CAS:117883-42-8
Formula: C7H5BrN2O
KIN03151253
3-BROMO-6-HYDROXY-2,4,5-TRIMETHYLBENZALDEHYDE
CAS:99070-20-9
Formula: C10H11BrO2
KIN02817818
3-BROMO-6-HYDROXY-2,4-DIMETHYLBENZALDEHYDE
CAS:1172886-91-7
Formula: C9H9BrO2
KIN05264244
3-BROMO-6-HYDROXY-2,5-DIMETHOXY-BENZALDEHYDE
CAS:65162-35-8
Formula: C9H9BrO4
KIN02522280
3-BROMO-6-HYDROXY-2,5-DIMETHYLBENZALDEHYDE
CAS:108373-08-6
Formula: C9H9BrO2
KIN03088745
3-BROMO-6-HYDROXY-2,5-DIMETHYLBENZALDEHYDE OXIME
CAS:109098-73-9
Formula: C9H10BrNO2
KIN03093292
3-BROMO-6-HYDROXY-2,5-DIMETHYLBENZOIC ACID
CAS:108373-20-2
Formula: C9H9BrO3
KIN03088747
3-BROMO-6-HYDROXY-2,5-DIMETHYLBENZOPHENONE
CAS:6721-09-1
Formula: C16H15BrO2
KIN01169224
3-BROMO-6-HYDROXY-2-METHOXY-BENZALDEHYDE
CAS:65162-32-5
Formula: C8H7BrO3
KIN02522277
3-BROMO-6-HYDROXY-2-METHYLBENZALDEHYDE
CAS:137644-94-1
Formula: C8H7BrO2
KIN03242614
3-BROMO-6-HYDROXY-2-METHYLBENZENEMETHANOL
CAS:173849-69-9
Formula: C8H9BrO2
KIN03354323
3-BROMO-6-HYDROXY-2-METHYLBENZOIC ACID
CAS:252955-18-3
Formula: C8H7BrO3
KIN03453008
3-BROMO-6-HYDROXY-2-METHYLBENZOIC ACID ETHYL ESTER
CAS:296236-21-0
Formula: C10H11BrO3
KIN03014226
3-BROMO-6-HYDROXY-4-METHOXY-2-METHYLBENZOIC ACID METHYL ESTER
CAS:715-39-9
Formula: C10H11ClO4
KIN01027057
3-BROMO-6-HYDROXY-5-ISOPROPYL-2-METHYLBENZOPHENONE
CAS:16846-17-6
Formula: C17H17BrO2
KIN02055552
3-BROMO-6-HYDROXY-PHTHALONITRILE
CAS:188112-71-2
Formula: C8H3BrN2O
KIN03384408
3-BROMO-6-HYDROXY-QUINOLINE 6-ACETATE
CAS:1022151-47-8
Formula: n1cc(cc2cc(ccc21)OC(=O)C)Br;C11H8BrNO2
KIN05055997
3-BROMO-6-IODO-1H-QUINOLIN-4-ONE
CAS:1032816-36-6
Formula: C9H5BrINO
KIN05067242
3-BROMO-6-IODO-2,5-DIMETHOXY-PHENOL
CAS:202735-35-1
KIN03410913
3-BROMO-6-IODO-2-METHYL-1-BENZO[B]THIOPHENE
CAS:152403-79-7
Formula: C9H6BrIS
KIN03301990
3-BROMO-6-IODO-ALPHA-2-HYDROXY-PHENOL
CAS:1128237-32-0
Formula: C6H4BrIO2
KIN05182020
3-BROMO-6-IODO-ALPHA-2-METHYLPYRIDINE
CAS:1008361-77-0
Formula: C6H5BrIN
KIN05015588
3-BROMO-6-IODO-IMIDAZO[1,2-A]PYRIDINE
CAS:1146615-52-2
Formula: C7H4BrIN2
KIN05194486
3-BROMO-6-IODO-QUINOLINE
CAS:205114-20-1
Formula: C9H5BrIN
KIN03414514
3-BROMO-6-ISOCYANATO-1-ALLYL-1H-INDAZOLE
CAS:189560-03-0
Formula: C11H8BrN3O
KIN03389224
3-BROMO-6-ISOTHIOCYANATO-PYRIDAZINE
CAS:1192814-50-8
Formula: C5H2BrN3S
KIN05334439
3-BROMO-6-METHOXY-1(3H)-ISOBENZOFURANONE
CAS:40125-47-1
Formula: C9H7BrO3
KIN02260235
3-BROMO-6-METHOXY-1,2-BENZENEDIMETHANOL
CAS:130662-50-9
Formula: C9H11BrO3
KIN03211016
3-BROMO-6-METHOXY-1-(4-NITROPHENOXY) -BENZENE
CAS:84304-18-7
Formula: C13H10BrNO4
KIN02666550
3-BROMO-6-METHOXY-1H-INDAZOLE
CAS:1134328-18-9
KIN05185175
3-BROMO-6-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190317-52-2
Formula: C8H7BrN2O
KIN05330449
3-BROMO-6-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190317-79-3
Formula: C8H7BrN2O
KIN05330464
3-BROMO-6-METHOXY-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190313-25-7
Formula: C8H7BrN2O
KIN05330216
3-BROMO-6-METHOXY-2(1H)-PYRIDINONE
CAS:198268-94-9
Formula: C6H6BrNO2
KIN03404169
3-BROMO-6-METHOXY-2,4-DIMETHYLBENZALDEHYDE
CAS:343784-94-1
Formula: C10H11BrO2
KIN03518207
3-BROMO-6-METHOXY-2,5-BIS(ISOPROPOXY) -BENZALDEHYDE
CAS:1033591-46-6
Formula: C14H19BrO4
KIN05067997
3-BROMO-6-METHOXY-2,5-DIMETHYLBENZOPHENONE
CAS:6721-26-2
KIN01169225
3-BROMO-6-METHOXY-2-(1-METHYLETHOXY) -PYRIDINE
CAS:1017577-29-5
Formula: C9H12BrNO2
KIN05034582
3-BROMO-6-METHOXY-2-(2-METHYL-ALLYL)PHENOL
CAS:185406-75-1
Formula: C11H13BrO2
KIN03379458
3-BROMO-6-METHOXY-2-(4-METHYL-3-PENTEN-1-YL)-PYRIDINE
CAS:283612-39-5
KIN03654591
3-BROMO-6-METHOXY-2-(BENZYL)-PYRIDINE
CAS:332133-67-2
KIN03505487
3-BROMO-6-METHOXY-2-[(METHOXYMETHOXY) METHYL]PYRIDINE
CAS:1006599-55-8
Formula: C9H12BrNO3
KIN05013184
3-BROMO-6-METHOXY-2-HYDROXY-PHENOL
CAS:61559-82-8
Formula: C7H7BrO3
KIN02457935
1-Bromo-2,3-dihydroxy-4-methoxy-benzene; 3-Bromo-6
3-BROMO-6-METHOXY-2-METHYL-3,6-DIHYDRO-2H-PYRAN
CAS:283156-12-7
Formula: C7H11BrO2
KIN03467521
3-BROMO-6-METHOXY-2-METHYL-4-(BENZYLOXY) -BENZOIC ACID METHYL ESTER
CAS:56526-83-1
Formula: C17H17BrO4
KIN02384363
3-BROMO-6-METHOXY-2-METHYL-5-NITRO-PYRIDINE
CAS:186413-76-3
Formula: C7H7BRN2O3
KIN03381544
3-BROMO-6-METHOXY-2-METHYL-PYRIDINE
CAS:126717-59-7
Formula: C7H8BrNO
KIN03194273
3-BROMO-6-METHOXY-2-METHYL-PYRIDINE 1-OXIDE
CAS:269058-50-6
Formula: C7H8BrNO2
KIN03463365
3-BROMO-6-METHOXY-2-METHYLBENZALDEHYDE
CAS:137644-93-0
Formula: C9H9BrO2
KIN03242613
3-BROMO-6-METHOXY-2-METHYLBENZOIC ACID
CAS:220901-25-7
Formula: C9H9BrO3
KIN03435208
3-BROMO-6-METHOXY-2-METHYLBENZOIC ACID ETHYL ESTER
CAS:133379-06-3
Formula: C11H13BrO3
KIN03009075
3-BROMO-6-METHOXY-2-METHYLBENZOIC ACID METHYL ESTER
CAS:133379-09-6
Formula: C10H11BrO3
KIN03676680
3-BROMO-6-METHOXY-2-METHYLPHENOL
CAS:60632-41-9
Formula: C8H9BrO2
KIN02446293
3-BROMO-6-METHOXY-2-METHYLPHENOL 1-ACETATE
CAS:60632-43-1
Formula: C10H11BrO3
KIN02446295
3-BROMO-6-METHOXY-2-NITRO-BIPHENYL
CAS:84251-48-9
KIN02666184
3-BROMO-6-METHOXY-2-NITROPHENOL
CAS:30710-49-7
Formula: C7H6BrNO4
KIN02184180
3-BROMO-6-METHOXY-2-PYRIDINECARBONITRILE
CAS:1186637-43-3
Formula: C7H5BrN2O
KIN05321565
3-Bromo-6-methoxy-picolinonitrile; 3-Bromo-6-methoxy-pyridin-2-carbonitrile
3-BROMO-6-METHOXY-2-PYRIDINECARBOXALDEHYDE
CAS:269058-49-3
Formula: C7H6BrNO2
KIN03463364
3-BROMO-6-METHOXY-2-PYRIDINECARBOXYLIC ACID
CAS:1196147-56-4
Formula: C7H6BrNO3
KIN05339118
3-Bromo-6-methoxy-picolinic acid
3-BROMO-6-METHOXY-2-PYRIDINEMETHANOL 2-ACETATE
CAS:269058-51-7
KIN03463366
3-BROMO-6-METHOXY-2H-BENZOPYRAN
CAS:122323-29-9
Formula: C10H9BrO2
KIN03174184
3-BROMO-6-METHOXY-3,6-DIHYDRO-2H-PYRAN
CAS:283156-10-5
Formula: C6H9BrO2
KIN03467520
3-BROMO-6-METHOXY-3-(BENZYL)-2,4(1H,3H)-QUINOLINEDIONE
CAS:211859-27-7
Formula: C17H14BrNO3
KIN03643323
3-BROMO-6-METHOXY-3-METHYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:211859-25-5
Formula: C11H10BrNO3
KIN03665874
3-BROMO-6-METHOXY-3-PHENYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:144603-17-8
Formula: C16H12BrNO3
KIN03665873
3-BROMO-6-METHOXY-4,5-DIMETHYL-2-NITRO-BENZENAMINE
CAS:93349-72-5
Formula: C9H11BrN2O3
KIN02768349
3-BROMO-6-METHOXY-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:5169-33-5
Formula: CHNSe.Ag
KIN01122067
3-BROMO-6-METHOXY-4-METHYL-2-HYDROXY-PHENOL
CAS:1039105-23-1
Formula: C8H9BrO3
KIN05078740
3-BROMO-6-METHOXY-4-NITRO-1H-INDAZOLE
CAS:1000341-13-8
Formula: C8H6BrN3O3
KIN05000631
3-BROMO-6-METHOXY-4H-CHROMEN-4-ONE
CAS:120185-87-7
Formula: C10H7BrO3
KIN03162924
3-BROMO-6-METHOXY-8-NITROQUINOLINE
CAS:95836-48-9
Formula: C10H7BrN2O3
KIN02795602
3-BROMO-6-METHOXY-BENZO[B]SELENOPHEN-2-CARBOXYLIC ACID
CAS:186890-57-3
Formula: C10H7BrO3Se
KIN03643322
3-BROMO-6-METHOXY-IMIDAZO[1,2-A]PYRIDINE
CAS:1044733-59-6
Formula: C8H7BrN2O
KIN05094157
3-BROMO-6-METHOXY-PYRIDAZINE
CAS:17321-29-8
Formula: C5H5BRN2O
KIN02060778
MFCD09702456
3-BROMO-6-METHOXY-QUINOLINE
CAS:14036-96-5
Formula: C10H8BrNO
KIN02027438
MFCD09260428
3-BROMO-6-METHYL-[1,2,4]-TRIAZOLO[4,3-B]PYRIDAZINE
CAS:55054-93-8
KIN02359977
3-BROMO-6-METHYL-1,2-BENZENEDIAMINE
CAS:344595-73-9
Formula: C7H9BrN2
KIN03520579
3-BROMO-6-METHYL-1,2-BENZENEDIOL
CAS:201471-76-3
Formula: C7H7BrO2
KIN03409014
3-BROMO-6-METHYL-1H-INDAZOLE
CAS:40598-73-0
Formula: C8H7BrN2
KIN02264197
MFCD07781626
3-BROMO-6-METHYL-1H-INDOLE
CAS:1152850-55-9
Formula: C9H8BrN
KIN05201978
3-BROMO-6-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1000340-28-2
Formula: C8H7BrN2
KIN05000546
3-BROMO-6-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190323-01-3
Formula: C8H7BrN2
KIN05330876
3-BROMO-6-METHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190313-09-7
Formula: C8H7BrN2
KIN05330206
3-BROMO-6-METHYL-2(1H)-PYRIDINONE
CAS:374633-33-7
Formula: C6H6BrNO
KIN03544819
3-BROMO-6-METHYL-2-OXO-4-PHENYL-2H-PYRAN-5-CARBOXYLIC ACID ETHYL ESTER
CAS:18152-84-6
Formula: C15H13BrO4
KIN02069249
3-BROMO-6-METHYL-2-PHENYL-4H-CHROMEN-4-ONE
CAS:73910-82-4
Formula: C16H11BrO2
KIN02601795
3-BROMO-6-METHYL-2-PYRIDINAMINE
CAS:126325-46-0
Formula: C6H7BrN2
KIN03192481
3-BROMO-6-METHYL-2-PYRIDINECARBALDEHYDE
CAS:1060810-14-1
Formula: C7H6BrNO
KIN05106335
3-BROMO-6-METHYL-2-PYRIDINEMETHANAMINE
CAS:1060810-19-6
Formula: C7H9BrN2
KIN05106339
3-BROMO-6-METHYL-2H-CHROMENE
CAS:122323-28-8
Formula: C10H9BrO
KIN03174183
3-BROMO-6-METHYL-3-(BENZYL)-2,4(1H,3H)-QUINOLINEDIONE
CAS:211859-26-6
Formula: C17H14BrNO2
KIN03654590
3-BROMO-6-METHYL-3-PHENYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:144603-15-6
Formula: C16H12BrNO2
KIN03676679
3-BROMO-6-METHYL-4-(TRIFLUOROMETHYL)ISOTHIAZOLO[5,4-B]PYRIDINE
CAS:296797-19-8
Formula: C8H4BrF3N2S
KIN03474006
3-BROMO-6-METHYL-4-[4-(METHYLSULFONYL)PHENYL]-2H-PYRAN-2-ONE
CAS:387866-37-7
Formula: C13H11BrO4S
KIN03554504
3-BROMO-6-METHYL-5-(1-OXO-BUTYL) -2(1H)-PYRIDINONE
CAS:169228-01-7
Formula: C10H12BrNO2
KIN03022405
3-BROMO-6-METHYL-5-(1-OXOPROPYL) -2(1H)-PYRIDINONE
CAS:169228-00-6
Formula: C9H10BrNO2
KIN03660344
3-BROMO-6-METHYL-5-(4-NITRO-BENZOYL)-2(1H)-PYRIDINONE
CAS:169228-03-9
Formula: C13H9BrN2O4
KIN03654589
3-BROMO-6-METHYL-5-NITRO-1H-INDAZOLE
CAS:1000343-58-7
Formula: C8H6BrN3O2
KIN05000827
3-BROMO-6-METHYL-5-NITRO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1000340-20-4
Formula: C8H6BrN3O2
KIN05000538
3-Bromo-6-methyl-5-nitro-7-aza-1H-indole
3-BROMO-6-METHYL-5-NITRO-2-PYRIDINAMINE
CAS:150935-62-9
Formula: C6H6BRN3O2
KIN03297686
3-BROMO-6-METHYL-8-NITROQUINOLINE
CAS:210708-23-9
Formula: C10H7BrN2O2
KIN03421824
3-BROMO-6-METHYL-CHROMONE
CAS:102653-68-9
Formula: C10H7BrO2
KIN03049243
3-BROMO-6-METHYL-IMIDAZO[1,2-A]PYRIDINE HCL
CAS:1072944-60-5
Formula: C8H8BrClN2
KIN05114750
3-BROMO-6-METHYL-IMIDAZO[1,2-A]PYRIMIDIN-2-CARBALDEHYDE
CAS:1019017-60-7
Formula: C8H6BrN3O
KIN05040399
3-BROMO-6-METHYL-IMIDAZO[1,2-A]PYRIMIDIN-2-METHANAMINE
CAS:1019018-62-2
Formula: C8H9BrN4
KIN05040416
3-BROMO-6-METHYL-ISOTHIAZOLO[5,4-B]PYRIDINE
CAS:61889-29-0
Formula: C7H5BrN2S
KIN02463977
3-BROMO-6-METHYL-QUINOLINE
CAS:66438-78-6
Formula: C10H8BrN
KIN02542045
3-BROMO-6-METHYLPYRAN-2,4-DIONE
CAS:110654-20-1
Formula: C6H5BrO3
KIN03102937
3-BROMO-6-METHYLPYRIDAZIN-1-IUM CHLORIDE
CAS:97721-78-3
Formula: C5H6BrClN2
KIN02807400
3-BROMO-6-METHYLPYRIDAZIN-15N2
CAS:88491-69-4
KIN02698984
3-BROMO-6-METHYLPYRIDAZINE
CAS:65202-58-6
Formula: C5H5BrN2
KIN02522965
MFCD09831907
3-BROMO-6-METHYLTHIENO[3,2-B]THIOPHEN-2,5-DIONE
CAS:133514-85-9
Formula: [C7H3BrO2S2
KIN03223960
3-BROMO-6-METHYLTHIOINDEN-1-ONE
CAS:138485-83-3
Formula: C10H7BrOS
KIN03247038
3-BROMO-6-NITRO-(QUINOLIN-4-YL)AMINE
CAS:90224-83-2
Formula: C9H6BrN3O2
KIN02724289
3-BROMO-6-NITRO-1-(BENZYL)-1H-INDAZOLE
CAS:92161-18-7
KIN02753623
3-BROMO-6-NITRO-1-(PIPERIDIN-1-YLMETHYL)-1H-INDAZOLE
CAS:72334-58-8
KIN02590711
3-BROMO-6-NITRO-1-(PYRROLIDIN-1-YLMETHYL)-1H-INDAZOLE
CAS:72334-59-9
KIN02590712
3-BROMO-6-NITRO-1-PHENYL-1H-INDAZOLE
CAS:91178-56-2
Formula: C13H8BrN3O2
KIN02739893
3-BROMO-6-NITRO-1H-INDAZOL-1-METHANOL
CAS:70315-72-9
Formula: C8H6BrN3O3
KIN02576677
3-BROMO-6-NITRO-1H-INDAZOLE
CAS:70315-68-3
Formula: C7H4BrN3O2
KIN02576674
MFCD06410881
3-BROMO-6-NITRO-1H-INDOLE
CAS:126807-09-8
Formula: C8H5BrN2O2
KIN03194658
3-BROMO-6-NITRO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190318-49-0
Formula: C7H4BrN3O2
KIN05330507
3-BROMO-6-NITRO-4(1H)-CINNOLINONE
CAS:86222-56-2
Formula: C8H4BrN3O3
KIN02679080
3-BROMO-6-NITRO-4-HYDROXY-CINNOLINE
CAS:5265-47-4
KIN01124085
3-BROMO-6-NITRO-IMIDAZO[1,2-A]PYRIDINE
CAS:52310-42-6
Formula: C7H4BrN3O2
KIN02319219
MFCD13193088
3-BROMO-6-NITROPYRIDAZINE 2-OXIDE
CAS:24710-95-0
KIN02133156
3-BROMO-6-NITROQUINOLINE
CAS:7101-96-4
Formula: C9H7BrN2
KIN01178669
3-BROMO-6-OXA-BICYCLO[3.1.0]HEXANE
CAS:80778-34-3
Formula: C5H7BrO
KIN02646098
3-BROMO-6-OXO-2,4,7-OCTATRIENOIC ACID ETHYL ESTER
CAS:63270-02-0
Formula: C10H11BrO3
KIN02489548
3-BROMO-6-PENTYLPYRIDAZINE
CAS:93216-63-8
Formula: C9H13BrN2
KIN02766617
3-BROMO-6-PHENYL-1,2,4,5-TETRAZINE
CAS:35011-53-1
KIN02218963
3-BROMO-6-PHENYL-2-PYRAZINECARBONITRILE
CAS:208993-71-9
KIN03419410
3-BROMO-6-PHENYL-3-HEXEN-5-YN-2-ONE
CAS:52688-12-7
Formula: C12H9BrO
KIN02324112
3-BROMO-6-PHENYL-IMIDAZO[1,2-A]PYRIDINE
CAS:328062-46-0
Formula: C13H9BrN2
KIN03498135
3-BROMO-6-PHENYL-IMIDAZO[1,2-A]PYRIMIDIN-2-METHANAMINE
CAS:1020039-10-4
Formula: C13H11BrN4
KIN05048862
3-BROMO-6-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1039364-87-8
Formula: C12H8BrN3
KIN05079464
3-BROMO-6-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE-7-YLAMINE
CAS:1039364-82-3
Formula: C12H9BrN4
KIN05079462
3-BROMO-6-PHENYLPYRIDAZINE
CAS:14959-34-3
Formula: C10H7BrN2
KIN02037078
3-BROMO-6-PHENYLPYRIDIN-2-AMINE
CAS:1097725-77-3
Formula: C11H9BrN2
KIN05160795
3-BROMO-6-PIPERAZINOMETHYLPYRIDINE HCL
CAS:1187386-04-4
Formula: C10H15BrClN3
KIN05322959
3-BROMO-6-PROPAN-2-YL-4-NITRO-1H-INDAZOLE
CAS:1000340-89-5
KIN05000607
3-BROMO-6-PROPAN-2-YL-CHROMONE
CAS:288399-51-9
Formula: C12H11BrO2
KIN03470135
3-BROMO-6-PROPOXY-5-PROPYL-4H-FURO[2,3-B]PYRAN-4-ONE
CAS:1097949-30-8
Formula: C13H15BrO4
KIN05161941
3-BROMO-6-PROPOXY-PYRIDAZINE
CAS:17321-31-2
Formula: C7H9BrN2O
KIN02060780
3-BROMO-6-PROPYLPYRIDAZINE
CAS:93216-56-9
Formula: C7H9BrN2
KIN02766611
3-BROMO-6-PYRIDINE-3-YLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1109284-28-7
KIN05172417
3-BROMO-6-QUINOLINECARBONITRILE
CAS:205114-19-8
KIN03414513
3-BROMO-6-TERT-BUTOXY-PYRIDAZINE
CAS:1027513-32-1
Formula: C8H11BrN2O
KIN05062728
3-BROMO-6-TERT-BUTYL-CHROMONE
CAS:288399-52-0
Formula: C13H13BrO2
KIN03470136
3-BROMO-6-THIOCYCLOHEXA-2,4-DIEN-1-OL
CAS:113269-52-6
Formula: C6H7BrOS
KIN03121547
3-BROMO-7,10-DIPHENYLFLUORANTHENE
CAS:153390-86-4
Formula: C28H17Br
KIN03304949
3-BROMO-7,12-DIMETHYLBENZO[A]ANTHRACENE
CAS:78302-38-2
Formula: C20H15Br
KIN02630681
3-BROMO-7,12-DIPHENYLBENZO[K]FLUORANTHENE
CAS:187086-32-4
Formula: C32H19Br
KIN03382629
3-BROMO-7,7-DIMETHYL-2-OXO-BICYCLO[2.2.1]HEPTANE-1-METHANESULFONIC ACID
CAS:24262-38-2
Formula: C10H17BrO5S
KIN02128669
D-3-Bromocamphor-10-sulfonic acid monohydrate
MFCD00167452
3-BROMO-7,7-DIMETHYL-OXEPAN-2-ONE
CAS:21748-36-7
Formula: C8H13BrO2
KIN02103914
3-BROMO-7,8,9,10-TETRAHYDRO-BENZO[A]PYREN-7-ONE
CAS:119784-46-2
Formula: C20H13BrO
KIN03160571
3-BROMO-7,8,9,10-TETRAHYDRO-BENZO[A]PYRENE-7-ONE, ETHYLENE, KETAL
CAS:119784-48-4
Formula: C22H17BrO2
KIN03160572
3-BROMO-7,8-DICHLORO-3-PHENYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:380634-82-2
Formula: C15H8BrCl2NO2
KIN03632048
3-BROMO-7,8-DIHYDRO-1,6-NAPHTHYRIDINE-5(6H)-ONE
CAS:301666-81-9
Formula: C8H7BrN2O
KIN03477618
3-BROMO-7,8-DIHYDRO-2,5(1H,6H)-QUINOLINEDIONE
CAS:1082159-72-5
Formula: C9H8BrNO2
KIN05118638
3-BROMO-7,8-DIHYDRO-5H-PYRANO[4,3-B]PYRIDINE
CAS:1196145-30-8
Formula: C8H8BrNO
KIN05339025
3-BROMO-7,8-DIHYDRO-7,7-DIMETHYL-2,5(1H,6H)-QUINOLINEDIONE
CAS:1007107-51-8
Formula: C11H12BrNO2
KIN05013772
3-BROMO-7,8-DIHYDRO-QUINOLIN-6(5H)-ONE
CAS:1196157-23-9
Formula: C9H8BrNO
KIN05339601
3-BROMO-7,8-DIIODO-BICYCLO[4.2.0]OCTA-1,3,5-TRIENE
CAS:4181-32-2
Formula: C14H18O
KIN01102540
3-BROMO-7,8-DIMETHOXY-4-METHYL-COUMARIN
CAS:313976-18-0
Formula: C12H11BrO4
KIN03488944
3-BROMO-7,8-DIMETHOXY-QUINOLINE
CAS:173728-98-8
KIN03354153
3-BROMO-7-(2,5-DIMETHOXY-PHENYL) -2-HYDROXY-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:3525-18-6
KIN01090855
3-BROMO-7-(PYRIDIN-4-YL)-IMIDAZO[1,2-A]PYRIDINE
CAS:1146615-83-9
Formula: C12H8BrN3
KIN05194487
3-Bromo-7-pyridin-4-yl-imidazo[1,2-a]pyridine
3-BROMO-7-(TERT-BUTYL)-2,3-DIHYDRO-4H-CHROMEN-4-ONE
CAS:80930-50-3
Formula: C13H15BrO2
KIN02646965
3-BROMO-7-(TRIFLUOROMETHOXY) -QUINOLIN-4-OL
CAS:1065087-90-2
Formula: C10H5BrF3NO2
KIN05109152
3-BROMO-7-(TRIFLUOROMETHYL)-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190320-45-6
KIN05330679
3-Bromo-7-(trifluoromethyl)-4-aza-1H-indole
3-BROMO-7-(TRIFLUOROMETHYL)-4-HYDROXY-QUINOLINE
CAS:65673-94-1
Formula: C10H5BrF3NO
KIN02530638
3-BROMO-7-(TRIFLUOROMETHYL)-IMIDAZO[1,2-A]PYRIMIDINE
CAS:375857-65-1
Formula: [C7H3BrF3N3
KIN03545993
3-BROMO-7-(TRIFLUOROMETHYL)-IMIDAZO[1,2-B][1,2,4]TRIAZINE
CAS:425378-67-2
Formula: C6H2BrF3N4
KIN03575602
3-BROMO-7-(TRIFLUOROMETHYL)-IMIDAZO[1,2-C]PYRIMIDINE
CAS:425615-35-6
Formula: C7H3BrF3N3
KIN03575987
3-BROMO-7-AMINO-1H-INDAZOLE
CAS:316810-90-9
Formula: C7H6BrN3
KIN03491077
3-BROMO-7-AZA-1H-INDOL-5-CARBOXYLIC ACID METHYL ESTER
CAS:119032-26-7
Formula: C9H7BrN2O2
KIN03157265
3-BROMO-7-AZABICYCLO[2.2.1]HEPTA-2,5-DIENE-2,7-DICARBOXYLIC ACID 7-(TERT-BUTYL) 2-METHYL ESTER
CAS:181873-33-6
Formula: C13H16BrNO4
KIN03371727
3-BROMO-7-BROMOMETHYL-1,7-DIMETHYL-BICYCLO[2.2.1]HEPT-2-ONE
CAS:10293-10-4
Formula: C10H14Br2O
KIN02004493
MFCD00167983
3-BROMO-7-BROMOMETHYLTHIENO[2,3-C]PYRIDINE
CAS:120009-92-9
Formula: C8H5Br2NS
KIN03161868
3-BROMO-7-CHLORO-1,2-DIMETHYL-9H-PYRROLO[1,2-A]INDOL-9-ONE
CAS:53592-75-9
Formula: C13H9BrClNO
KIN02337526
3-BROMO-7-CHLORO-1-FLUORO-10H-PHENOTHIAZINE
CAS:1020745-89-4
KIN05049994
3-BROMO-7-CHLORO-1-METHYL-10H-PHENOTHIAZINE
CAS:318276-99-2
KIN03491704
3-BROMO-7-CHLORO-1-METHYL-9-NITRO-10H-PHENOTHIAZINE
CAS:72168-05-9
KIN02589567
3-BROMO-7-CHLORO-10H-PHENOTHIAZINE
CAS:13677-04-8
KIN02023071
3-BROMO-7-CHLORO-1H-INDOL-2-CARBOHYDRAZIDE
CAS:95538-66-2
Formula: C9H7BrClN3O
KIN02792543
3-BROMO-7-CHLORO-1H-INDOL-2-CARBONYL AZIDE
CAS:95538-71-9
Formula: C9H4BrClN4O
KIN02792548
3-BROMO-7-CHLORO-1H-INDOLE
CAS:78225-46-4
Formula: C8H5BrClN
KIN02630087
3-BROMO-7-CHLORO-1H-PYRAZOLO[4,3-D]PYRIMIDINE
CAS:68510-70-3
Formula: C5H2BrClN4
KIN02563848
MFCD09746269
3-BROMO-7-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190318-41-2
KIN05330502
3-Bromo-7-chloro-4-aza-1H-indole
3-BROMO-7-CHLORO-2,3-DIHYDRO-4H-CHROMEN-4-ONE
CAS:66125-09-5
Formula: C9H6BrClO2
KIN02537325
3-BROMO-7-CHLORO-2,4-DIMETHYL-1,8-NAPHTHYRIDINE
CAS:1021117-08-7
Formula: C10H8BrClN2
KIN05053648
3-BROMO-7-CHLORO-4-HYDROXY-QUINOLIN-2(1H)-ONE
CAS:328396-32-3
Formula: C9H5BrClNO2
KIN03498877
3-BROMO-7-CHLORO-4-METHYL-QUINOLIN-2(1H)-ONE
CAS:23976-61-6
Formula: C10H7BrClNO
KIN02125565
3-BROMO-7-CHLORO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE
CAS:268547-53-1
Formula: C7H5BrClN3
KIN03463203
3-BROMO-7-CHLORO-5-METHYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:58347-47-0
Formula: C7H5BrClN3
KIN02414186
3-BROMO-7-CHLORO-6-IODO-4-HYDROXY-QUINOLINE
CAS:1021913-04-1
Formula: C9H4BrClINO
KIN05055590
3-BROMO-7-CHLORO-6-METHOXY-QUINOLINE
CAS:1009811-92-0
Formula: C10H7BrClNO
KIN05016889
3-BROMO-7-CHLORO-8-METHYL-2-(TRIFLUOROMETHYL)-4-HYDROXY-QUINOLINE
CAS:59108-22-4
Formula: C11H6BrClF3NO
KIN02426390
3-BROMO-7-CHLORO-8-QUINOLINECARBOXYLIC ACID METHYL ESTER
CAS:116586-81-3
Formula: C11H7BrClNO2
KIN03620832
3-BROMO-7-CHLORO-CINNOLINE
CAS:1083181-45-6
Formula: C8H4BrClN2
KIN05124017
3-BROMO-7-CHLORO-FURO[2,3-C]PYRIDINE
CAS:220939-70-8
KIN03435316
3-BROMO-7-CHLORO-IMIDAZO[1,2-A]PYRIDINE
CAS:342613-67-6
Formula: C7H4BrClN2
KIN03516351
3-BROMO-7-CHLORO-QUINOLIN-8-CARBOXYLIC ACID
CAS:115813-22-4
Formula: C10H5BrClNO2
KIN03139196
3-BROMO-7-CHLORO-QUINOLINE
CAS:84973-05-7
Formula: C9H5BrClN
KIN02671083
3-Bromo-7-chloro-quinoline
3-BROMO-7-CYCLOBUTYL-IMIDAZO[1,2-A]PYRIMIDINE
CAS:375857-77-5
Formula: C10H10BrN3
KIN03545998
3-BROMO-7-CYCLOBUTYL-IMIDAZO[1,2-A]PYRIMIDINE-2-CARBALDEHYDE
CAS:1020034-81-4
Formula: C11H10BrN3O
KIN05048695
3-BROMO-7-CYCLOBUTYL-IMIDAZO[1,2-A]PYRIMIDINE-2-METHANAMINE
CAS:1020035-06-6
Formula: C11H13BrN4
KIN05048705
3-BROMO-7-ETHENYL-10-(1-METHYLETHYL)-10H-PHENOTHIAZINE
CAS:98312-03-9
KIN02812797
3-BROMO-7-ETHENYL-10-METHYL-10H-PHENOTHIAZINE
CAS:98312-05-1
Formula: C15H12BrNS
KIN02812798
3-BROMO-7-ETHOXY-10H-PHENOTHIAZINE
CAS:13677-03-7
KIN02023070
3-BROMO-7-ETHYNYL-10-METHYL-10H-PHENOTHIAZINE
CAS:312924-98-4
KIN03487063
3-BROMO-7-FLUORO-1H-PYRROLO[2,3-C]PYRIDINE
CAS:1190320-95-6
KIN05330710
3-Bromo-7-fluoro-6-aza-1H-indole
3-BROMO-7-FLUORO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190320-09-2
KIN05330645
3-Bromo-7-fluoro-5-aza-1H-indole
3-BROMO-7-FLUORO-2-NITRO-FLUOREN-9-ONE
CAS:16233-11-7
Formula: C13H5BrFNO3
KIN02049310
3-BROMO-7-FLUORO-4-HYDROXY-QUINOLINE
CAS:1065087-80-0
Formula: C9H5BrFNO
KIN05109148
3-BROMO-7-FLUORO-4H-CHROMEN-4-ONE
CAS:1159978-73-0
KIN05256909
3-BROMO-7-FLUOROCHROMONE
3-BROMO-7-FLUORO-QUINOLINE
CAS:225366-90-5
Formula: C9H5BrFN
KIN03439965
3-BROMO-7-HYDROXY-4-METHYL-CHROMEN-2-ONE
CAS:55977-10-1
Formula: C10H7BrO3
KIN02375319
3-BROMO-7-HYDROXY-8-IODO-4-METHYL-CHROMEN-2-ONE
CAS:137809-72-4
Formula: C10H6BrIO3
KIN03243439
3-BROMO-7-HYDROXY-CHROMEN-2-ONE
CAS:146900-52-9
Formula: C9H5BrO3
KIN03284064
3-BROMO-7-HYDROXY-QUINOLIN-8-CARBOXYLIC ACID
CAS:1159427-86-7
Formula: C10H6BrNO3
KIN05254891
3-BROMO-7-HYDROXY-QUINOLINE
CAS:1160949-99-4
KIN05258386
3-BROMO-7-HYDROXY-THIENO[3,2-B]PYRIDIN-6-CARBOXYLIC ACID
CAS:152996-03-7
Formula: C8H4BrNO3S
KIN03620831
3-BROMO-7-METHOXY-1(3H)-ISOBENZOFURANONE
CAS:139360-85-3
Formula: C9H7BrO3
KIN03252237
3-BROMO-7-METHOXY-1,2-DIHYDRO-NAPHTHALENE
CAS:91820-05-2
Formula: C11H11BrO
KIN02749171
3-BROMO-7-METHOXY-1-METHYL-10H-PHENOTHIAZINE
CAS:318277-02-0
KIN03491706
3-BROMO-7-METHOXY-10H-PHENOTHIAZIN-10-PROPANOIC ACID
CAS:226424-62-0
KIN03665872
3-BROMO-7-METHOXY-10H-PHENOTHIAZINE
CAS:13677-02-6
KIN02023069
3-BROMO-7-METHOXY-1H-INDAZOLE
CAS:133841-06-2
Formula: C8H7BrN2O
KIN03225605
3-BROMO-7-METHOXY-1H-PYRROLO[2,3-C]PYRIDINE
CAS:352434-16-3
Formula: C8H7BrN2O
KIN03529926
3-BROMO-7-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190319-33-5
Formula: C8H7BrN2O
KIN05330572
3-BROMO-7-METHOXY-2,2-DIMETHYL-2H-BENZOPYRAN
CAS:156685-91-5
Formula: C12H13BrO2
KIN03316140
3-BROMO-7-METHOXY-2-(4-METHOXY-PHENYL) -2H-BENZOPYRAN
CAS:89840-34-6
Formula: C17H15BrO3
KIN02717878
3-BROMO-7-METHOXY-2-OXO-2H-BENZOPYRAN-4-ACETIC ACID
CAS:93300-08-4
Formula: C12H9BrO5
KIN02767885
3-BROMO-7-METHOXY-2H-BENZOPYRAN-2-ONE
CAS:72167-80-7
Formula: C10H7BrO3
KIN02589562
3-BROMO-7-METHOXY-4-METHYL-2H-BENZOPYRAN-2-ONE
CAS:75908-67-7
Formula: C11H9BrO3
KIN02615692
3-BROMO-7-METHOXY-4H-CHROMEN-4-ONE
CAS:73220-41-4
Formula: C10H7BrO3
KIN02596744
3-BROMO-7-METHOXY-9-(4-(DIMETHYLAMINO)BUTYLAMINO)ACRIDINE 2HCL
CAS:12725-34-7
Formula: C20H26BrCl2N3O
KIN02013124
3-BROMO-7-METHOXY-IMIDAZO[1,2-A]PYRIDINE
CAS:342613-73-4
Formula: C8H7BrN2O
KIN03516353
3-BROMO-7-METHOXY-IMIDAZO[1,2-A]PYRIDINE-8-CARBONITRILE
CAS:1072944-45-6
Formula: [C9H6BrN3O];C9H6BrN3O
KIN05114740
3-BROMO-7-METHOXY-QUINOLIN-2(1H)-ALPHA--ONE
CAS:1025369-75-8
Formula: C10H8BrNO2
KIN05058967
3-BROMO-7-METHOXY-QUINOLINE 1-OXIDE
CAS:1025369-72-5
Formula: C10H8BrNO2
KIN05058966
3-BROMO-7-METHYL-1(3H)-ISOBENZOFURANONE
CAS:63113-05-3
Formula: C9H7BrO2
KIN02486621
3-BROMO-7-METHYL-1,8-NAPHTHYRIDIN-4(1H)-ONE
CAS:142907-76-4
Formula: C9H7BrN2O
KIN03267223
3-BROMO-7-METHYL-1H-PYRAZOLO[1,5-A]PYRIMIDINE
CAS:61552-56-5
Formula: C7H6BrN3
KIN02457790
3-BROMO-7-METHYL-1H-PYRROLO[2,3-C]PYRIDINE
CAS:1190316-53-0
Formula: C8H7BrN2
KIN05330394
3-BROMO-7-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190312-48-1
Formula: C8H7BrN2
KIN05330173
3-BROMO-7-METHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1000341-40-1
Formula: C8H7BrN2
KIN05000654
3-BROMO-7-METHYL-2-(2-PHENYLETHENYL)CHROMEN-4-ONE
CAS:104387-30-6
Formula: C18H13BrO2
KIN03060836
3-BROMO-7-METHYL-3-PHENYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:144603-14-5
Formula: C16H12BrNO2
KIN03676678
3-BROMO-7-METHYL-5-PHENYL-7H-INDOLO[2,3-C]ISOQUINOLINE
CAS:62693-62-3
Formula: C22H15BrN2
KIN02478805
3-BROMO-7-METHYL-6-HYDROXY-QUINOLINE
CAS:1009812-19-4
Formula: C10H8BrNO
KIN05016891
3-BROMO-7-METHYL-IMIDAZO[1,2-A]PYRIDINE
CAS:56051-32-2
Formula: C8H7BrN2
KIN02376484
MFCD08056208
3-BROMO-7-METHYL-IMIDAZO[1,2-A]PYRIMIDINE
CAS:375857-62-8
Formula: [C7H6BrN3
KIN03545991
3-BROMO-7-METHYL-IMIDAZO[1,2-C]PYRIMIDINE
CAS:425615-34-5
Formula: C7H6BrN3
KIN03575986
3-BROMO-7-METHYL-NAPHTHALEN-2-CARBALDEHYDE
CAS:1042170-58-0
Formula: C12H9BrO
KIN05088692
3-BROMO-7-METHYL-QUINOLINE
CAS:66438-79-7
Formula: C10H8BrN
KIN02542046
3-BROMO-7-METHYL-TRICYCLO[2.2.1.02,6]HEPTANE-1-CARBONITRILE
CAS:24318-35-2
KIN02129266
3-BROMO-7-METHYLPYRAZOLO[1,5-A]PYRIMIDIN-2-YL ACETATE
CAS:89355-85-1
Formula: C9H8BrN3O2
KIN02710650
3-BROMO-7-METHYLTHIENO[2,3-C]PYRIDINE
CAS:120010-06-2
Formula: C8H6BrNS
KIN03161873
3-BROMO-7-NITRO-10H-PHENOTHIAZINE
CAS:35565-24-3
KIN02224285
3-BROMO-7-NITRO-1H-INDAZOLE
CAS:74209-34-0
Formula: C7H4BrN3O2
KIN02604174
3-BROMO-7-NITRO-1H-INDOLE
CAS:397864-11-8
Formula: [C8H5BrN2O2
KIN03560107
3-BROMO-7-NITRO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190313-52-0
Formula: C7H4BrN3O2
KIN05330229
3-BROMO-7-NITRO-BENZO[B]THIOPHENE
CAS:90407-23-1
Formula: C8H4BrNO2S
KIN02727388
3-BROMO-7-NITRO-DIBENZOFURAN
CAS:25074-60-6
Formula: C12H6BrNO3
KIN02136159
3-BROMO-7-NITRO-NAPHTHALENE
CAS:102153-46-8
Formula: C10H6BrNO2
KIN03044861
3-BROMO-7-NITROSO-6-HYDROXY-1H-INDAZOLE
CAS:115003-13-9
Formula: C7H4BrN3O2
KIN03134685
3-BROMO-7-OXO-1-CYCLOHEPTEN-1,2-DICARBOXYLIC ACID DIMETHYL ESTER
CAS:54223-01-7
KIN02346770
3-BROMO-7-OXO-7H-BENZO[DE]ANTHRACEN-9-SULFONIC ACID
CAS:69658-04-4
Formula: C17H9BrO4S
KIN02571900
3-BROMO-7-PHENOXY-10H-PHENOTHIAZINE
CAS:174092-14-9
KIN03354969
3-BROMO-7-PHENYL-[1,2,4]-TRIAZOLO[4,3-A]PYRIDINE
CAS:40744-04-5
KIN02265377
3-BROMO-7-PHENYL-IMIDAZO[1,2-A]PYRIDINE
CAS:453510-85-5
Formula: C13H9BrN2
KIN03592878
3-BROMO-7-PROPOXY-6-PROPYL-5H-FURO[3,2-B]PYRAN-5-ONE
CAS:1097945-77-1
Formula: C13H15BrO4
KIN05161940
3-BROMO-7[H]BENZO[C]CARBAZOL
CAS:3342-07-2
KIN01087168
3-BROMO-7H-BENZIMIDAZO[2,1-A]BENZO[DE]ISOQUINOLIN-7-ONE
CAS:26559-67-1
Formula: C18H9BrN2O
KIN02149401
3-BROMO-7H-BENZO[A]PHENAZIN-5-ONE
CAS:7468-93-1
Formula: C16H16
KIN01188029
3-BROMO-7H-BENZO[DE]ANTHRACEN-7-ONE
CAS:81-98-1
Formula: C17H8Br2O
KIN01001732
3-BROMO-8-(4-METHYL-PIPERAZIN-1-YL)-IMIDAZO[1,2-A]PYRAZINE
CAS:143591-62-2
Formula: C11H14BrN5
KIN03271190
3-BROMO-8-(DIMETHYLAMINO)-2-METHYL-QUINOLIN-4-OL
CAS:65674-03-5
Formula: C12H13BrN2O
KIN02530646
3-BROMO-8-(METHYLAMINO)-IMIDAZO[1,2-A]PYRAZINE
CAS:117718-82-8
Formula: C7H7BrN4
KIN03150367
3-BROMO-8-(METHYLTHIO)-QUINOLINE
CAS:3989-06-8
KIN01099081
3-BROMO-8-(TRIFLUOROMETHOXY) -QUINOLIN-4-OL
CAS:1065087-91-3
Formula: C10H5BrF3NO2
KIN05109153
3-BROMO-8-(TRIFLUOROMETHYL)-QUINOLINE
CAS:1059064-11-7
Formula: C10H5BrF3N
KIN05105412
3-BROMO-8-BENZYLOXYIMIDAZO[1,2-A]PYRIDINE
CAS:109388-59-2
Formula: C14H11BrN2O
KIN03095017
3-BROMO-8-CHLORO-1,2-DIMETHYL-9H-PYRROLO[1,2-A]INDOL-9-ONE
CAS:53592-76-0
Formula: C13H9BrClNO
KIN02337527
3-BROMO-8-CHLORO-1,5-NAPHTHYRIDINE
CAS:97267-61-3
Formula: C8H4BrClN2
KIN02805257
3-bromo-8-chloro-1,5-naphthyridine
MFCD11848377
3-BROMO-8-CHLORO-2-HYDROXY-QUINOLIN-4(1H)-ONE
CAS:1009636-34-3
Formula: C9H5BrClNO2
KIN05016769
3-BROMO-8-CHLORO-5,6-DIHYDRO-11H-BENZO[5,6]CYCLOHEPTA[1,2-B]PYRID IN-11-ONE
CAS:156073-28-8
Formula: C14H9BrClNO
KIN03314294
3-BROMO-8-CHLORO-IMIDAZO[1,2-A]PYRAZINE
CAS:143591-61-1
Formula: [C6H3BrClN3
KIN03271189
3-BROMO-8-CHLORO-QUINOLINE
CAS:205111-94-0
Formula: C9H5BrClN
KIN03414499
3-BROMO-8-FLUORO-4-HYDROXY-QUINOLINE
CAS:1065087-83-3
Formula: C9H5BrFNO
KIN05109149
3-BROMO-8-HYDROXY-QUINOLINE
CAS:139399-62-5
Formula: C9H6BrNO
KIN03252594
3-BROMO-8-IODO-4-METHYL-7-PROP-2-ENOXY-CHROMEN-2-ONE
CAS:137809-73-5
Formula: C13H10BrIO3
KIN03243440
3-BROMO-8-METHOXY-[1]NAPHTHOIC ACID
CAS:105837-41-0
Formula: C12H9BrO3
KIN03071410
3-BROMO-8-METHOXY-[1]NAPHTHOIC ACID METHYL ESTER
CAS:100375-04-0
Formula: C13H11BrO3
KIN03031124
3-BROMO-8-METHOXY-[1]NAPHTHOIC ACIDAMIDE
CAS:100123-23-7
Formula: C12H10BrNO2
KIN03028733
3-BROMO-8-METHOXY-[1]NAPHTHOL
CAS:104094-29-3
Formula: C11H9BrO2
KIN03058648
3-BROMO-8-METHOXY-[1]NAPHTHYLAMINE
CAS:103862-54-0
Formula: C11H10BrNO
KIN03056850
3-BROMO-8-METHOXY-1,2-DIHYDRONAPHTHALENE
CAS:158440-98-3
Formula: C11H11BrO
KIN03320450
3-BROMO-8-METHOXY-1,5-NAPHTHYRIDINE
CAS:97267-63-5
Formula: C9H7BrN2O
KIN02805258
3-BROMO-8-METHOXY-1-METHYL-4(1H)-CINNOLINONE
CAS:33852-58-3
KIN02209331
3-BROMO-8-METHOXY-2-METHYL-QUINOLIN-4(1H)-ONE
CAS:385392-32-5
KIN03553063
3-BROMO-8-METHOXY-2-METHYL-QUINOLIN-4-OL
CAS:65673-97-4
Formula: C11H10BrNO2
KIN02530641
3-BROMO-8-METHOXY-2H-BENZOPYRAN
CAS:122323-32-4
Formula: C10H9BrO2
KIN03174185
3-BROMO-8-METHOXY-3-PHENYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:144603-18-9
Formula: C16H12BrNO3
KIN03665871
3-BROMO-8-METHOXY-4(1H)-CINNOLINONE
CAS:33844-20-1
KIN02209274
3-BROMO-8-METHOXY-4-METHYL-QUINOLIN-2(1H)-ONE
CAS:41968-64-3
KIN02274861
3-BROMO-8-METHOXY-ISOQUINOLIN-6-OL
CAS:13388-81-3
Formula: C10H8BrNO2
KIN02018828
3-BROMO-8-METHOXY-N-(2-METHYLPHENYL)-4-QUINOLINAMINE
CAS:189568-58-9
Formula: [C17H15BrN2O
KIN03389258
3-BROMO-8-METHOXY-QUINOLINE
CAS:103030-27-9
Formula: C10H8BrNO
KIN03051398
3-BROMO-8-METHOXYIMIDAZO[1,2-A]PYRAZINE
CAS:91775-62-1
Formula: C7H6BrN3O
KIN02748539
MFCD09835035
3-BROMO-8-METHYL-4-HYDROXY-CINNOLINE
CAS:5375-21-3
KIN01127918
3-BROMO-8-METHYL-6-NITROQUINOLINE
CAS:210708-22-8
Formula: C10H7BrN2O2
KIN03421823
3-BROMO-8-METHYL-8-AZABICYCLO[3.2.1]OCTANE
CAS:2292-12-8
Formula: C8H14CLN
KIN01066582
3-BROMO-8-METHYL-IMIDAZO[1,2-A]PYRIDIN-2-CARBALDEHYDE
CAS:175878-06-5
Formula: C9H7BrN2O
KIN03359855
3-BROMO-8-NITRO-4-CINNOLINOL
CAS:13526-40-4
KIN02020873
3-BROMO-8-NITRO-4-HYDROXY-QUINOLINE
CAS:65674-05-7
Formula: C9H5BrN2O3
KIN02530648
3-BROMO-8-NITRO-IMIDAZO[1,2-A]PYRIDINE
CAS:52310-43-7
Formula: C7H4BrN3O2
KIN02319220
3-BROMO-8-NITROQUINOLINE
CAS:5341-09-3
Formula: C18H19Cl2NO.ClH
KIN01126736
3-BROMO-8-OXA-BICYCLO[3.2.1]OCT-6-EN-2,4-DIONE
CAS:1045694-49-2
Formula: C7H5BrO3
KIN05094876
3-BROMO-8-OXO-5,6,7-TRIHYDRO-NAPHTHALEN-2-CARBOXYLIC ACID
CAS:273612-58-0
KIN03464723
3-BROMO-8-PHENYL-IMIDAZO[1,2-A]PYRIDINE
CAS:104271-47-8
Formula: C13H9BrN2
KIN03060021
3-BROMO-8-QUINOLINAMINE
CAS:139399-67-0
Formula: C9H7BrN2
KIN03252599
3-BROMO-8-QUINOLINETHIOL
CAS:3989-04-6
KIN01099080
3-BROMO-9(10H)-ACRIDINONE
CAS:1140-93-8
Formula: C13H15NO2
KIN01041323
3-BROMO-9,10-DIHYDRO-10-METHOXY-PHENANTHRENE
CAS:146630-02-6
Formula: C15H13BrO
KIN03283120
3-BROMO-9,10-DIHYDRO-9-METHOXY-PHENANTHRENE
CAS:146630-03-7
Formula: C15H13BrO
KIN03283121
3-BROMO-9,9-DIHEXYL-9H-FLUORENE
CAS:1185264-59-8
Formula: C25H33Br
KIN05318650
3-BROMO-9,9-DIMETHYL-9H-FLUORENE
CAS:1190360-23-6
KIN05330887
3-BROMO-9-(2,2-DICHLORO-CYCLOPROPYL)-9H-CARBAZOLE
CAS:90279-56-4
Formula: C15H10BrCl2N
KIN02725179
3-BROMO-9-(2-METHYLPHENYL)-9H-CARBAZOLE
CAS:1133057-81-4
KIN05184679
3-BROMO-9-(3-BROMO-9H-XANTHEN-9-YLIDENE) -9H-XANTHENE
CAS:62668-51-3
Formula: C26H14Br2O2
KIN02478292
3-BROMO-9-(CYCLOHEXYLMETHYLAMINO) -SPIRO[12H-BENZO[A]XANTHENE-12,1'(3'H)-ISOBENZOFURAN]-3'-ONE
CAS:55773-02-9
KIN02371926
3-BROMO-9-(OXIRANYLMETHYL) -9H-CARBAZOLE
CAS:79348-95-1
Formula: C15H12BrNO
KIN02637103
3-BROMO-9-[ETHYL(2-METHYLPROPYL)AMINO]-SPIRO[12H-BENZO[A]XANTHENE-12,1'(3'H)-ISOBENZOFURAN]-3'-ONE
CAS:106132-25-6
Formula: C30H26BrNO3
KIN03074179
3-BROMO-9-CHLORO-5-METHYL-ACRIDINE
CAS:88914-98-1
Formula: C14H9BrClN
KIN02704278
3-BROMO-9-CHLORO-9H-CARBAZOLE
CAS:193558-55-3
KIN03396721
3-BROMO-9-ETHENYLCARBAZOLE
CAS:32072-08-5
KIN02194162
3-BROMO-9-ETHYLCARBAZOLE
CAS:57102-97-3
Formula: C14H12BrN
KIN02394123
MFCD00092392
3-BROMO-9-HEXYLCARBAZOLE
CAS:156972-74-6
Formula: C18H20BrN
KIN03316900
3-BROMO-9-HYDROXY-9H-FLUORENE-1-METHANOL
CAS:136682-10-5
Formula: C14H11BrO2
KIN03238061
3-BROMO-9-HYDROXY-9H-FLUORENE-1-METHANOL 1-ACETATE
CAS:137154-49-5
Formula: C16H13BrO3
KIN03009396
3-BROMO-9-METHOXY-2-METHYL-4H-PYRIDO[1,2-A]PYRIMIDINE-4-ONE
CAS:1186487-32-0
Formula: C10H9BrN2O2
KIN05321181
3-BROMO-9-METHYL-6-TRIFLUORO-ACETYLCARBAZOLE
CAS:114973-69-2
Formula: C15H9BrF3NO
KIN03134509
3-BROMO-9-PHENANTHRENECARBOXYLIC ACID
CAS:77252-28-9
Formula: C15H9BrO2
KIN02624398
3-BROMO-9-PHENYL-9H-CARBAZOLE
CAS:1153-90-8
Formula: C15H9NO4
KIN01041768
3-BROMO-9H-CARBAZOL-9-CARBALDEHYDE
CAS:349492-52-0
Formula: C13H8BrNO
KIN03526545
3-BROMO-9H-CARBAZOL-9-ETHANOL
CAS:7556-03-8
KIN01191185
3-BROMO-9H-CARBAZOLE
CAS:1593-03-9
Formula: C9H3N13
KIN01050990
3-BROMO-9H-FLUOREN-9-OL
CAS:2038-91-7
Formula: C13H9Br
KIN01061400
3-BROMO-9H-FLUOREN-9-ONE
CAS:2041-21-6
KIN01061495
3-BROMO-9H-FLUOREN-9-ONE OXIME
CAS:145548-24-9
Formula: C13H8BrNO
KIN03279974
3-BROMO-9H-FLUORENE
CAS:2038-92-8
Formula: C13H9BrO2
KIN01061401
3-BROMO-9H-PYRIDO[3,4-B]INDOLE
CAS:91985-79-4
Formula: C11H7BrN2
KIN02751396
3-BROMO-A,A-DIETHYL-4-PYRIDINEMETHANOL
CAS:85452-82-0
Formula: C10H14BrNO
KIN02674457