ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

2-NITRO-9-ACRIDINAMINE
CAS:23045-35-4
Formula: C13H9N3O2
KIN02116197
2-NITRO-9-OXO-10(9H)-ACRIDINEACETIC ACID
CAS:38609-98-2
KIN02249256
2-NITRO-9-PHENOXY-ACRIDINE
CAS:56809-06-4
Formula: C19H12N2O3
KIN02389004
2-NITRO-9H-CARBAZOL-3-YLAMINE
CAS:60564-31-0
Formula: C12H9N3O2
KIN02445637
2-NITRO-9H-CARBAZOLE
CAS:14191-22-1
Formula: C12H8N2O2
KIN02029255
MFCD01739877
2-NITRO-9H-FLUOREN-3-OL
CAS:7235-16-7
Formula: C8H12ClFO3
KIN01182145
2-NITRO-9H-FLUOREN-9-OL
CAS:28149-15-7
Formula: C13H9NO3
KIN02163622
2-NITRO-9H-FLUOREN-9-ONE
CAS:3096-56-8
Formula: C13H7BrO
KIN01082308
2-NITRO-9H-FLUOREN-9-YLAMINE HCL
CAS:7596-56-7
Formula: C14H8N2O5
KIN01191853
2-NITRO-9H-FLUORENE
CAS:607-58-9
Formula: C17H14O
KIN01022030
2-NITRO-9H-FLUORENOL
CAS:114167-02-1
Formula: C13H9NO3
KIN03128979
2-NITRO-9H-XANTHEN-9-ONE
CAS:20061-59-0
Formula: C13H7NO4
KIN02087825
2-NITRO-ACETAMIDE
CAS:14011-21-3
Formula: C2H4N2O3
KIN02027089
2-NITRO-ACETAMIDE ION(I) SODIUM
CAS:55552-13-1
Formula: C2H3N2O3.Na
KIN02368334
2-NITRO-ACETIC ACID
CAS:625-76-3
Formula: CH2N2O4
KIN01023297
2-NITRO-ACETIC ACID 2,5-DIOXO-PYRROLIDIN-1-YL ESTER
CAS:1001755-53-8
Formula: C6H6N2O6
KIN05006257
2-NITRO-ACETIC ACID 2-(1-PHENYLETHYLIDENE)HYDRAZIDE
CAS:405106-49-2
KIN03004891
2-NITRO-ACETIC ACID 2-(THIOPHEN-2-YLMETHYLENE)HYDRAZIDE
CAS:405105-69-3
KIN03632835
2-NITRO-ACETIC ACID CYCLOPENTYL ESTER
CAS:98432-00-9
KIN02813710
2-NITRO-ACETIC ACID PHENYLMETHYL ESTER
CAS:30563-27-0
Formula: C9H9NO4
KIN02183242
2-NITRO-ACETIC ACID TRIMETHYLSILYL ESTER
CAS:59858-38-7
KIN02438397
2-NITRO-ACRIDIN-9(10H)-ONE
CAS:7251-01-6
Formula: C20H24N2O6
KIN01182863
2-NITRO-ACRYLIC ACID METHYL ESTER
CAS:89033-25-0
Formula: C4H5NO4
KIN02706131
2-NITRO-ADENOSINE
CAS:266360-65-0
Formula: C10H12N6O6
KIN03462460
2-NITRO-ALPHA-((2,2,2-TRIFLUORO-1-(TRIFLUOROMETHYL)ETHOXY)METHYL)-1H-IMIDAZOL-1-ETHANOL
CAS:104290-39-3
Formula: C9H9F6N3O4
KIN03060107
2-NITRO-ALPHA-((2,2,3,3-TETRAMETHYL-1-AZIRIDINYL)METHY)-1H-IMIDAZOL-1-ETHANOL
CAS:105027-76-7
Formula: C12H20N4O3
KIN03065670
2-NITRO-ALPHA-(1H-PYRROL-2-YLTHIO)-BENZENEACETONITRILE
CAS:87574-20-7
Formula: C12H9N3O2S
KIN02687766
2-NITRO-ALPHA-(2-NITROPHENYL)-BENZENEMETHANOL
CAS:36661-36-6
Formula: C13H10N2O5
KIN02233120
2-NITRO-ALPHA-(2-NITROPHENYL)-BENZENEPROPANENITRILE
CAS:112181-38-1
Formula: C15H11N3O4
KIN03113333
2-NITRO-ALPHA-(4-NITROPHENYL)-BETA-OXO-BENZENEPROPANAL
CAS:81883-97-8
Formula: C15H10N2O6
KIN02652316
2-NITRO-ALPHA-(NITRO-METHYL)-BENZENEMETHANOL 1-NITRATE
CAS:5816-94-4
Formula: C8H7N3O7
KIN01142512
2-NITRO-ALPHA-(NITRO-METHYL)-N-PHENYLBENZENEMETHANAMINE
CAS:107921-15-3
Formula: C14H13N3O4
KIN03632834
2-NITRO-ALPHA-(NITROMETHYL)-BENZENEMETHANOL
CAS:18731-43-6
Formula: C8H8N2O5
KIN02074724
2-NITRO-ALPHA-(NITROMETHYL)-BENZENEMETHANOL 1-ACETATE
CAS:64374-72-7
Formula: C10H10N2O6
KIN02508902
2-NITRO-ALPHA-(PHENOXYMETHYL)-1H-IMIDAZOL-1-ETHANOL
CAS:21788-11-4
Formula: C12H13N3O4
KIN02104247
2-NITRO-ALPHA-(PHENYLAMINO)-BENZENEACETONITRILE
CAS:109772-87-4
Formula: C14H11N3O2
KIN03097290
2-NITRO-ALPHA-(TRIBROMOMETHYL)-BENZENEMETHANOL
CAS:92617-54-4
Formula: C8H6Br3NO3
KIN02759333
2-NITRO-ALPHA-(TRICHLOROMETHYL)-BENZENEMETHANOL
CAS:62798-94-1
Formula: C8H6Cl3NO3
KIN02480559
2-NITRO-ALPHA-[(PHENYLAMINO)METHYL]BENZENEMETHANOL HCL
CAS:94288-16-1
Formula: C14H14N2O3.ClH
KIN02780372
2-NITRO-ALPHA-[2-(TRIMETHYLSILYL)ETHYNYL]BENZENEMETHANOL
CAS:1072913-33-7
Formula: C12H15NO3Si
KIN05114646
2-NITRO-ALPHA-2-OXIRANYL-1H-IMIDAZOL-1-ETHANOL
CAS:88876-98-6
Formula: C7H9N3O4
KIN02703857
2-NITRO-ALPHA-ALLYLBENZENEMETHANOL
CAS:125715-24-4
Formula: C10H11NO3
KIN03189868
2-NITRO-ALPHA-OXO-3-THIOPHENEPROPANOIC ACID
CAS:101257-18-5
KIN03038047
2-NITRO-ALPHA-OXO-BENZENEPROPANOIC ACID
CAS:182366-96-7
KIN03372781
2-NITRO-ALPHA-OXO-BENZENEPROPANOYL CHLORIDE
CAS:322764-40-9
Formula: C9H6ClNO4
KIN03494111
2-NITRO-ALPHA-PHENYLBENZENEACETIC ACID METHYL ESTER
CAS:207500-07-0
Formula: C15H13NO4
KIN03677390
2-NITRO-ALPHA-PHENYLBENZENEACETONITRILE
CAS:344440-77-3
Formula: C14H10N2O2
KIN03520309
2-NITRO-ALPHA-PHENYLBENZENEMETHANOL ACETATE (ESTER)
CAS:108621-64-3
Formula: C15H13NO4
KIN03677389
2-NITRO-ANILIN-4-YLSULFONIC ACID SODIUM SALT
CAS:5042-37-5
KIN01119580
2-NITRO-ANILINE
CAS:88-75-5
Formula: C6H5NO3
KIN01002288
2-NITRO-ANILINE 2,2,2-TRIFLUORO-ACETATE
CAS:29885-62-9
KIN02177443
2-NITRO-ANILINE HCL
CAS:15873-52-6
Formula: C6H6N2O2.ClH
KIN02045033
MFCD00060216
2-NITRO-ANILINE LABELED WITH CARBON-14
CAS:38500-40-2
KIN02248499
2-NITRO-ANILINE, HCL
CAS:14527-90-3
Formula: C6H7ClN2O2
KIN02032903
2-NITRO-ANISOLE
CAS:91-24-7
Formula: C8H10O3S
KIN01002497
2-NITRO-ANTHRA[1,2-B]FURAN
CAS:104662-23-9
Formula: C16H9NO3
KIN03062873
2-NITRO-ANTHRA[2,1-B]FURAN
CAS:104662-19-3
Formula: C16H9NO3
KIN03062871
2-NITRO-ANTHRACENE
CAS:3586-83-2
KIN01092070
2-NITRO-BENZALDEHYDE
CAS:552-92-1
Formula: C23H43NO4S
KIN01019565
2-NITRO-BENZALDEHYDE (3-CHLORO-9-ACRIDINYL)HYDRAZONE
CAS:109520-62-9
Formula: C20H13ClN4O2
KIN03095809
2-NITRO-BENZALDEHYDE 2-(1,6-DIHYDRO-4,5-DIMETHYL-6-OXO-PYRIMIDIN-2-YL)HYDRAZONE
CAS:463955-93-3
Formula: C13H13N5O3
KIN03597488
2-NITRO-BENZALDEHYDE 2-(3-CHLOROPYRAZIN-2-YL)HYDRAZONE
CAS:415699-28-4
Formula: C11H8ClN5O2
KIN03644148
2-NITRO-BENZALDEHYDE 2-(5,6,7,8-TETRAHYDRO-[1]BENZOTHIENO[2,3-D]PYRIMIDIN-4-YL)HYDRAZONE
CAS:301326-58-9
Formula: C17H15N5O2S
KIN03477321
2-NITRO-BENZALDEHYDE 2-(9-ACRIDINYL)HYDRAZONE
CAS:91627-27-9
Formula: C20H14N4O2
KIN02746609
2-NITRO-BENZALDEHYDE 2-FORMYLHYDRAZONE
CAS:330196-47-9
Formula: C8H7N3O3
KIN03501348
2-NITRO-BENZALDEHYDE 2-METHYL-2-PHENYLHYDRAZONE
CAS:23718-94-7
Formula: C14H13N3O2
KIN02122872
2-NITRO-BENZALDEHYDE 2-METHYLHYDRAZONE
CAS:5771-06-2
Formula: C9H12N2O
KIN01141306
2-NITRO-BENZALDEHYDE BENZO[D]THIAZOL-2-YLHYDRAZONE
CAS:113334-48-8
Formula: C14H10N4O2S
KIN03007239
2-NITRO-BENZALDEHYDE O-(2,3,3-TRICHLORO-ACRYLOYL)OXIME
CAS:93033-53-5
Formula: C10H5Cl3N2O4
KIN02764428
2-NITRO-BENZALDEHYDE O-[2-(2-ACETYLPHENOXY)ETHYL]OXIME
CAS:1110921-94-2
Formula: C17H16N2O5
KIN05172769
2-NITRO-BENZALDEHYDE O-[2-(DIETHYLAMINO)ETHYL]OXIME
CAS:61819-82-7
Formula: C13H19N3O3
KIN02462608
2-NITRO-BENZALDEHYDE O-[2-MORPHOLIN-4-YLETHYL]OXIME
CAS:61819-92-9
Formula: C13H17N3O4
KIN02462615
2-NITRO-BENZALDEHYDE O-METHYLOXIME
CAS:135436-97-4
Formula: [C8H8N2O3
KIN03232809
2-NITRO-BENZALDEHYDE OXIME
CAS:6635-42-3
Formula: C7H7N3O2S
KIN01167306
2-NITRO-BENZALDEHYDE SEMICARBAZONE
CAS:16004-43-6
Formula: C8H8N4O3
KIN02046570
MFCD00160990
2-NITRO-BENZALDEHYDE TOSYLHYDRAZONE
CAS:58809-90-8
Formula: C14H13N3O4S
KIN02421497
MFCD00009790
2-NITRO-BENZALDEHYDE, 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:5422-69-5
Formula: C9H16O4
KIN01129876
2-NITRO-BENZALDEHYDE, 2-(4-NITROPHENYL)HYDRAZONE
CAS:7510-48-7
Formula: C13H12BrNO2S
KIN01190298
2-NITRO-BENZALDEHYDE, 2-PHENYLHYDRAZONE
CAS:610-66-2
Formula: C8H6N2O2
KIN01022226
2-NITRO-BENZALDEHYDE, CYANOHYDRIN TMS ETHER
CAS:100948-24-1
Formula: C11H14N2O3Si
KIN03035868
2-NITRO-BENZALDEHYDE, N,N-DIMETHYLHYDRAZONE
CAS:10424-94-9
Formula: C9H11N3O2
KIN02006180
2-NITRO-BENZAMIDE
CAS:610-16-2
Formula: C9H11NO2
KIN01022191
2-NITRO-BENZANTHRONE
CAS:111326-48-8
Formula: C17H9NO3
KIN03107151
2-NITRO-BENZENE-1,3-DIOL
CAS:601-90-1
Formula: C21H30O4
KIN01021702
2-NITRO-BENZENE-1,4-DIAMINE
CAS:183870-67-9
Formula: [C6H7N3O2
KIN03375728
2-NITRO-BENZENE-1,4-DIAMINE HCL
CAS:71776-05-1
Formula: C6H7N3O2.xClH
KIN02586788
2-NITRO-BENZENE-1,4-DICARBOXYLIC ACID
CAS:610-30-0
Formula: C7H4N2O6
KIN01022203
2-NITRO-BENZENEACETAMIDE
CAS:31142-60-6
Formula: C8H8N2O3
KIN02187309
2-NITRO-BENZENEACETIC ACID
CAS:3740-55-4
Formula: C14H10N2O6
KIN01095034
2-NITRO-BENZENEACETIC ACID 1-CYANOETHYL ESTER
CAS:1009594-91-5
KIN05016712
2-NITRO-BENZENEACETIC ACID 1-METHYLETHYL ESTER
CAS:98508-84-0
KIN02814480
2-NITRO-BENZENEACETIC ACID 2,2-DIMETHYLHYDRAZIDE
CAS:107267-35-6
Formula: C10H13N3O3
KIN03081730
2-NITRO-BENZENEACETIC ACID 2-(1-IMINOETHYL)HYDRAZIDE
CAS:114953-86-5
Formula: C10H12N4O3
KIN03666737
2-NITRO-BENZENEACETIC ACID 2-[(3-ACETYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:475056-60-1
Formula: C18H16N2O6
KIN03602018
2-NITRO-BENZENEACETIC ACID 2-[(4-IODO-2-METHYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:475255-24-4
Formula: C17H15IN2O5
KIN03602374
2-NITRO-BENZENEACETIC ACID 2-[(4-IODO-PHENYL)AMINO]-2-OXOETHYL ESTER
CAS:475254-85-4
Formula: C16H13IN2O5
KIN03602373
2-NITRO-BENZENEACETIC ACID 2-ACETYLHYDRAZIDE
CAS:88499-51-8
Formula: C10H11N3O4
KIN02699080
2-NITRO-BENZENEACETIC ACID 2-CHLORO-ETHYL ESTER
CAS:31912-00-2
KIN02193042
2-NITRO-BENZENEACETIC ACID 2-METHYLPROPYL ESTER
CAS:181576-55-6
KIN03371232
2-NITRO-BENZENEACETIC ACID 2-OXO-2-PHENYLETHYL ESTER
CAS:194852-72-7
KIN03399139
2-NITRO-BENZENEACETIC ACID BUTYL ESTER
CAS:26466-32-0
KIN02148483
2-NITRO-BENZENEACETIC ACID CYANOMETHYL ESTER
CAS:1002478-99-0
KIN05007061
2-NITRO-BENZENEACETIC ACID ETHYL ESTER
CAS:31912-02-4
Formula: C10H11NO4
KIN02193044
MFCD00092226
2-NITRO-BENZENEACETIC ACID METHYL ESTER
CAS:30095-98-8
Formula: C9H9NO4
KIN02179237
2-NITRO-BENZENEACETIC ACID SODIUM SALT
CAS:24309-38-4
Formula: C8H7NO4.Na
KIN02129161
2-NITRO-BENZENEACETIC ACID TERT-BUTYL ESTER
CAS:98911-33-2
KIN02816546
2-NITRO-BENZENEACETIC-18O ACID
CAS:57372-55-1
KIN02398635
2-NITRO-BENZENEACETOHYDRAZIDE
CAS:114953-81-0
Formula: C8H9N3O3
KIN03134332
2-NITRO-BENZENEACETYL CHLORIDE
CAS:22751-23-1
Formula: C8H6ClNO3
KIN02113400
2-NITRO-BENZENEACETYL ISOTHIOCYANATE
CAS:1014977-70-8
Formula: C9H6N2O3S
KIN05020401
2-NITRO-BENZENEAULFONIC ACID 1,4-BUTANEDIYL ESTER
CAS:64704-15-0
Formula: C16H16N2O10S2
KIN02514175
2-NITRO-BENZENEBUTANENITRILE
CAS:90915-20-1
Formula: C10H10N2O2
KIN02735600
2-NITRO-BENZENEBUTANOIC ACID
CAS:67857-97-0
Formula: C10H11NO4
KIN02558787
2-NITRO-BENZENECARBOTHIOAMIDE
CAS:70102-35-1
Formula: C7H6N2O2S
KIN02575184
2-NITRO-BENZENECARBOTHIOIC ACID S-PHENYL ESTER
CAS:97839-44-6
Formula: C13H9NO3S
KIN02808066
2-NITRO-BENZENECARBOTHIOIC ACID S-PYRIDIN-2-YL ESTER
CAS:1000038-55-0
Formula: C12H8N2O3S
KIN05000143
2-NITRO-BENZENEDIAMINE
CAS:125607-91-2
Formula: C6H8N3O2
KIN03189376
2-NITRO-BENZENEDIAZONIUM
CAS:25910-37-6
Formula: C6H4N3O2+
KIN02143901
2-NITRO-BENZENEDIAZONIUM (T-4)-TETRACHLOROZINCATE(II) (2:1)
CAS:15636-56-3
Formula: C6H4Cl4N3O2Zn
KIN02043149
fast orange gr salt
2-NITRO-BENZENEDIAZONIUM CHLORIDE
CAS:119-67-5
Formula: C8H6O3
KIN01004892
2-NITRO-BENZENEDIAZONIUM HEXAFLUOROPHOSPHATE(I)
CAS:836-71-5
KIN01031446
2-NITRO-BENZENEDIAZONIUM HYDROGEN (T-4)-DICHLOROBIS[SULFATO(II)-KAPPAO]ZINCATE(IV) (2:2:1)
CAS:23188-23-0
Formula: C12H9Cl2N6O12S2Zn
KIN02117633
Diazole orange o
2-NITRO-BENZENEDIAZONIUM TETRAFLUOROBORATE
CAS:365-34-4
Formula: C7H7F3N2
KIN01012150
2-NITRO-BENZENEDIAZONIUM TOSYLATE
CAS:1059625-66-9
Formula: C13H11N3O5S
KIN05105546
2-NITRO-BENZENEETHANAMINE
CAS:33100-15-1
Formula: C8H10N2O2
KIN02202508
MFCD06212598
2-NITRO-BENZENEETHANETHIOIC ACID S-(5,6,7,8-TETRAHYDRO[1]BENZOTHIENO[2,3-D]PYRIMIDIN-4-YL) ESTER
CAS:380870-08-6
Formula: C18H15N3O3S2
KIN03549705
2-NITRO-BENZENEETHANIMIDIC ACID ETHYL ESTER
CAS:95614-36-1
Formula: C10H12N2O3
KIN02793383
2-NITRO-BENZENEETHANIMIDIC ACID ETHYL ESTER HCL
CAS:87081-86-5
Formula: C10H12N2O3.ClH
KIN02684322
2-NITRO-BENZENEETHANOL BENZOATE (ESTER)
CAS:88057-18-5
Formula: C15H13NO4
KIN02692407
2-NITRO-BENZENEETHANOL, ACETATE ESTER
CAS:833-47-6
Formula: C8H6N4O2S
KIN01031296
2-NITRO-BENZENEMERCAPTOAMINO-GUANIDINE
CAS:393129-96-9
Formula: [C7H9N5O2S
KIN03557902
2-NITRO-BENZENEMETHANAMINE
CAS:1904-80-9
KIN01058561
2-NITRO-BENZENEMETHANAMINE HCL
CAS:24835-08-3
Formula: C7H9ClN2O2
KIN02134273
MFCD00136280
2-NITRO-BENZENEMETHANESULFONAMIDE
CAS:51145-00-7
Formula: C7H8N2O4S
KIN02302412
2-NITRO-BENZENEMETHANESULFONIC ACID PHENYL ESTER
CAS:89841-03-2
Formula: C13H11NO5S
KIN02717911
2-NITRO-BENZENEMETHANESULFONYL AZIDE
CAS:141855-25-6
Formula: C7H6N4O4S
KIN03262336
2-NITRO-BENZENEMETHANESULFONYL CHLORIDE
CAS:24974-75-2
Formula: C7H6ClNO4S
KIN02135408
MFCD00082526
2-NITRO-BENZENEMETHANESULFONYL ISOCYANATE
CAS:83055-82-7
Formula: C8H6N2O5S
KIN02659052
2-NITRO-BENZENEMETHANETHIOL
CAS:38508-64-4
KIN02248543
2-NITRO-BENZENEMETHANOL
CAS:185533-00-0
Formula: C7H7NO3
KIN03379983
2-NITRO-BENZENEMETHANOL 1-(HYDROGEN CARBONATE)
CAS:118780-13-5
Formula: C8H7NO5
KIN03155936
2-NITRO-BENZENEMETHANOL 1-ACETATE
CAS:77376-01-3
Formula: C9H9NO4
KIN02625182
2-NITRO-BENZENEMETHANOL 1-BENZENESULFONATE
CAS:366781-17-1
Formula: C13H11NO5S
KIN03540612
2-NITRO-BENZENEMETHANOL 1-FORMATE
CAS:65962-16-5
Formula: C8H7NO4
KIN02534975
2-NITRO-BENZENEMETHANOL 1-METHANETHIOATE
CAS:1027166-89-7
KIN05062031
2-NITRO-BENZENEMETHANOL 1-NITRATE
CAS:15539-79-4
KIN02042385
2-NITRO-BENZENEMETHANOL 3-AMINOBENZOATE (ESTER)
CAS:200420-26-4
KIN03407542
2-NITRO-BENZENEMETHANOL HYDROGEN PHOSPHATE (ESTER)
CAS:56883-16-0
Formula: C14H13N2O8P
KIN02390169
2-NITRO-BENZENEMETHANOL METHANESULFONATE (ESTER)
CAS:163915-96-6
Formula: C8H9NO5S
KIN03334672
2-NITRO-BENZENEMETHANOL METHYLCARBAMATE(ESTER)
CAS:74109-34-5
Formula: C9H10N2O4
KIN02603388
2-NITRO-BENZENEMETHANOL PHENYLCARBAMATE ESTER
CAS:74109-35-6
Formula: C14H12N2O4
KIN02603389
2-NITRO-BENZENEPEROXYSELENINIC ACID
CAS:108787-93-5
Formula: C6H5NO5Se
KIN03091241
2-NITRO-BENZENEPROPANAMINE
CAS:90437-56-2
Formula: C9H12N2O2
KIN02727954
2-NITRO-BENZENEPROPANESULFONYL CHLORIDE
CAS:80639-67-4
Formula: C9H10ClNO4S
KIN02645372
2-NITRO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:66757-87-7
Formula: C11H13NO4
KIN02545406
2-NITRO-BENZENEPROPANOL
CAS:20716-26-1
Formula: C9H11NO3
KIN02093251
2-NITRO-BENZENEPROPANOYL CHLORIDE
CAS:85397-21-3
Formula: C9H8ClNO3
KIN02674134
2-NITRO-BENZENESELENENIC ACID
CAS:56790-60-4
Formula: C6H5NO3Se
KIN02388752
2-NITRO-BENZENESELENINIC ACID
CAS:56790-59-1
Formula: C6H5NO4Se
KIN02388751
2-NITRO-BENZENESULFENIC ACID
CAS:58534-19-3
Formula: C6H5NO3S
KIN02417142
2-NITRO-BENZENESULFENIC ACID (3-HYDROXY-PHENYL)METHYL ESTER
CAS:134390-31-1
Formula: C13H11NO4S
KIN03228044
2-NITRO-BENZENESULFENIC ACID BUTYLAMIDE
CAS:24398-46-7
Formula: C10H14N2O2S
KIN02130117
2-NITRO-BENZENESULFENIC ACID METHYL ESTER
CAS:15666-75-8
Formula: C7H7NO3S
KIN02043331
2-NITRO-BENZENESULFENYL THIOCYANATE
CAS:29572-51-8
Formula: C7H4N2O2S2
KIN02175015
2-NITRO-BENZENESULFINAMIDE
CAS:68597-88-6
Formula: C6H6N2O3S
KIN02564508
2-NITRO-BENZENESULFINIC ACID P-TOLUIDIDE
CAS:108874-40-4
Formula: C13H12N2O3S
KIN03091865
2-NITRO-BENZENESULFINIC ACID SODIUM
CAS:15898-45-0
Formula: C6H5NNaO4S
KIN02045314
2-NITRO-BENZENESULFONAMIDE
CAS:5455-61-8
Formula: C13H25NO3
KIN01132438
2-NITRO-BENZENESULFONAMIDE DISODIUM SALT
CAS:91512-15-1
Formula: C6H6N2O4S.2Na
KIN02744811
2-NITRO-BENZENESULFONAMIDE MONOSODIUM SALT
CAS:27444-80-0
Formula: C6H6N2O4S.Na
KIN02157441
2-NITRO-BENZENESULFONIC ACID
CAS:31212-28-9
Formula: C6H5NO5S
KIN02187873
2-NITRO-BENZENESULFONIC ACID (2R)-OXIRANYLMETHYL ESTER
CAS:86132-70-9
Formula: C9H9NO6S
KIN02678534
2-NITRO-BENZENESULFONIC ACID [(3-BORONO-FURAN-2-YL)METHYLENE]HYDRAZIDE
CAS:54730-43-7
KIN02354462
2-NITRO-BENZENESULFONIC ACID 1,2-ETHANEDIYL ESTER
CAS:346422-64-8
KIN03025911
2-NITRO-BENZENESULFONIC ACID 1,3,3A,4,7,7A-HEXAHYDRO-1,3-DIOXO-4,7-METHANO-2H-ISOINDOL-2-YL ESTER
CAS:317331-48-9
Formula: C15H12N2O7S
KIN03491211
2-NITRO-BENZENESULFONIC ACID 1,3-PROPANEDIYL ESTER
CAS:64704-14-9
Formula: C15H14N2O10S2
KIN02514174
2-NITRO-BENZENESULFONIC ACID 1-METHYLETHYL ESTER
CAS:64704-10-5
Formula: C9H11NO5S
KIN02514170
2-NITRO-BENZENESULFONIC ACID 2,2-DIFLUORO-ETHYLESTER
CAS:1036375-30-0
Formula: C8H7F2NO5S
KIN05069946
2-NITRO-BENZENESULFONIC ACID 2,2-DIMETHYLHYDRAZIDE
CAS:400839-48-7
KIN03015993
2-NITRO-BENZENESULFONIC ACID 2,3,3-TRIIODO-ALLYL ESTER
CAS:94358-66-4
Formula: C9H6I3NO5S
KIN02781054
2-NITRO-BENZENESULFONIC ACID 2-ETHOXY-4-FORMYL-6-IODO-PHENYL ESTER
CAS:431981-04-3
Formula: C15H12INO7S
KIN03578314
2-NITRO-BENZENESULFONIC ACID 2-METHYLCYCLOHEXYL ESTER
CAS:170447-13-9
KIN03655433
2-NITRO-BENZENESULFONIC ACID 2-METHYLPROPYL ESTER
CAS:189264-22-0
KIN03023261
2-NITRO-BENZENESULFONIC ACID 2-OXIRANYLMETHYL ESTER
CAS:106662-78-6
KIN03677388
2-NITRO-BENZENESULFONIC ACID 3-FLUOROPHENYL ESTER
CAS:1017333-27-5
Formula: C12H8FNO5S
KIN05032054
2-NITRO-BENZENESULFONIC ACID 3-HYDROXY-PYRIDIN-2-YL ESTER
CAS:1010396-19-6
Formula: C11H8N2O6S
KIN05017298
2-NITRO-BENZENESULFONIC ACID 3-ISOTHIAZOLYL ESTER
CAS:203639-26-3
KIN03023726
2-NITRO-BENZENESULFONIC ACID 3-METHYLPHENYL ESTER
CAS:25238-20-4
Formula: C13H11NO5S
KIN02137609
2-NITRO-BENZENESULFONIC ACID 4-FORMYL-2-IODO-6-METHOXY-PHENYL ESTER
CAS:432001-20-2
Formula: C14H10INO7S
KIN03578386
2-NITRO-BENZENESULFONIC ACID 4-METHOXY-PHENYL ESTER
CAS:444285-11-4
Formula: C13H11NO6S
KIN03005299
2-NITRO-BENZENESULFONIC ACID 4-METHYLPHENYL ESTER
CAS:147879-78-5
Formula: C13H11NO5S
KIN03021240
2-NITRO-BENZENESULFONIC ACID 9H-FLUOREN-9-YLIDENEDI-4,1-PHENYLENE ESTER
CAS:301658-03-7
Formula: C37H24N2O10S2
KIN03477594
2-NITRO-BENZENESULFONIC ACID ALLYL ESTER
CAS:189264-21-9
Formula: C9H9NO5S
KIN03388217
2-NITRO-BENZENESULFONIC ACID ETHYL ESTER
CAS:82617-80-9
Formula: C8H9NO5S
KIN02656647
2-NITRO-BENZENESULFONIC ACID HYDRATE
CAS:80-89-7
KIN01001645
2-NITRO-BENZENESULFONIC ACID PHENYL ESTER
CAS:41480-05-1
Formula: C12H9NO5S
KIN02271473
Phenyl o-nitro-benzenesulfonate
2-NITRO-BENZENESULFONIC ACID PROPARGYL ESTER
CAS:189264-20-8
KIN03388216
2-NITRO-BENZENESULFONIC ACID PROPYL ESTER
CAS:142886-89-3
KIN03267126
2-NITRO-BENZENESULFONIC ACID TERT-BUTYL ESTER
CAS:1089704-00-6
Formula: C10H13NO5S
KIN05129499
2-NITRO-BENZENESULFONOHYDRAZIDE
CAS:5907-00-6
KIN01144750
2-NITRO-BENZENESULFONYL AZIDE
CAS:6655-40-9
KIN01168092
2-NITRO-BENZENESULFONYL BROMIDE
CAS:1950-73-8
Formula: C6H4BrNO4S
KIN01059547
2-NITRO-BENZENESULFONYL CHLORIDE
CAS:1694-93-5
Formula: C21H15N5O11
KIN01053581
2-NITRO-BENZENESULFONYL CYANIDE
CAS:98231-62-0
Formula: C7H4N2O4S
KIN02812041
2-NITRO-BENZENESULFONYL FLUORIDE
CAS:434-02-6
KIN01014433
2-NITRO-BENZENESULFONYL ISOCYANATE
CAS:68322-82-7
Formula: C7H4N2O5S
KIN02562497
2-NITRO-BENZENESULPHINIC ACID
CAS:13165-79-2
Formula: C6H5NO4S
KIN02015855
2-NITRO-BENZENETHIOL
CAS:4875-12-1
Formula: C30H26N2O5S2
KIN01116364
2-NITRO-BENZENETHIOL SODIUM SALT
CAS:22755-25-5
Formula: C6H5NO2S.Na
KIN02113449
2-NITRO-BENZIMIDAMIDE
CAS:88718-94-9
Formula: C7H7N3O2
KIN02701714
2-NITRO-BENZIMIDAMIDE HCL
CAS:64633-88-1
Formula: C7H7N3O2.ClH
KIN02513012
2-NITRO-BENZO[B]SELENOPHENE
CAS:79246-24-5
Formula: C8H5NO2Se
KIN02636438
2-NITRO-BENZO[B]THIOPHEN-3-ACETIC ACID
CAS:5453-75-8
Formula: C13H10N2O2S
KIN01132292
2-NITRO-BENZO[B]THIOPHEN-3-ACETIC ACID METHYL ESTER
CAS:5453-74-7
Formula: C10H7NO4S
KIN01132291
2-NITRO-BENZO[B]THIOPHEN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:92539-86-1
Formula: C11H9NO4S
KIN02758127
2-NITRO-BENZO[B]THIOPHEN-3-OL
CAS:10133-35-4
Formula: C8H5NO3S
KIN02002181
2-NITRO-BENZO[B]THIOPHEN-3-YLAMINE
CAS:10133-36-5
Formula: C8H6N2O2S
KIN02002182
MFCD01566405
2-NITRO-BENZO[B]THIOPHENE
CAS:10133-33-2
Formula: C8H5NO2S
KIN02002179
2-NITRO-BENZO[D]ISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE
CAS:80283-99-4
Formula: C7H4N2O5S
KIN02643163
2-NITRO-BENZO[D]THIAZOLE
CAS:23505-64-8
Formula: C7H4N2O2S
KIN02120625
2-NITRO-BENZO[E][1]BENZOFURAN-7-CARBONITRILE
CAS:143921-39-5
Formula: C13H6N2O3
KIN03273017
2-NITRO-BENZO[E][1]BENZOFURAN-7-CARBOXYLIC ACID
CAS:92262-80-1
Formula: C13H7NO5
KIN02754865
2-NITRO-BENZO[E][1]BENZOFURAN-7-OL
CAS:86539-63-1
Formula: C12H7NO4
KIN02681007
2-NITRO-BENZO[F][1]BENZOFURAN-4,9-DIONE
CAS:171084-33-6
Formula: C12H5NO5
KIN03348389
2-NITRO-BENZO[F]QUINOLINE
CAS:91804-76-1
Formula: C13H8N2O2
KIN02748910
2-NITRO-BENZO[GHI]PERYLENE
CAS:91259-17-5
Formula: C22H11NO2
KIN02741114
2-NITRO-BENZO[J]-ACEANTHRYLENE
CAS:107673-63-2
Formula: [C20H11NO2
KIN03084177
2-NITRO-BENZO[PQR]-TETRAPHENE
CAS:138542-40-2
Formula: C20H11NO2
KIN03247356
2-NITRO-BENZOESAEURE-[2-BROM-ANILID]
CAS:34489-84-4
Formula: C13H9BrN2O3
KIN02214336
2-NITRO-BENZOFURAN
CAS:33094-66-5
Formula: C8H5NO3
KIN02202443
2-NITRO-BENZOFURAN-7-OL
CAS:40739-73-9
Formula: C8H5NO4
KIN02265344
2-NITRO-BENZOHYDRAZIDE
CAS:606-27-9
Formula: C8H7NO4
KIN01021943
2-NITRO-BENZOIC ACID
CAS:552-21-6
Formula: C15H12O10
KIN01019527
2-NITRO-BENZOIC ACID 2-(3-IODO-BENZOYL)HYDRAZIDE
CAS:314279-37-3
Formula: C14H10IN3O4
KIN03489490
2-NITRO-BENZOIC ACID 2-(4-METHYLBENZOYL)HYDRAZIDE
CAS:88185-05-1
Formula: C15H13N3O4
KIN02694379
2-NITRO-BENZOIC ACID 2-(6-CHLOROPYRIDIN-2-YL)HYDRAZIDE
CAS:27217-57-8
KIN02155192
2-NITRO-BENZOIC ACID 2-(BENZENESULFONYL)HYDRAZIDE
CAS:7732-42-5
Formula: C13H13N3O3S
KIN01194214
2-NITRO-BENZOIC ACID 2-(CHLORO-ACETYL)HYDRAZIDE
CAS:63002-50-6
Formula: C9H8ClN3O4
KIN02484432
2-NITRO-BENZOIC ACID 2-(CYCLOBUTYLCARBONYL)HYDRAZIDE
CAS:1148122-38-6
Formula: C12H13N3O4
KIN05196364
2-NITRO-BENZOIC ACID 2-(IODO-ACETYL)HYDRAZIDE
CAS:63002-51-7
Formula: C9H8IN3O4
KIN02484433
2-NITRO-BENZOIC ACID 2-[(2-HYDROXY-3,5-DIIODO-PHENYL)METHYLENE]HYDRAZIDE
CAS:341989-34-2
Formula: C14H9I2N3O4
KIN03515518
2-NITRO-BENZOIC ACID 2-[[4-(DIETHYLAMINO)PHENYL]METHYLENE]HYDRAZIDE
CAS:316131-85-8
Formula: C18H20N4O3
KIN03490616
2-NITRO-BENZOIC ACID 2-[1-METHYL-3-OXO-3-(TRICYCLO[3.3.1.13,7]DEC-1-YLAMINO)-PROPYLIDENE]HYDRAZIDE
CAS:382174-74-5
Formula: C21H26N4O4
KIN03550709
2-NITRO-BENZOIC ACID 2-ACETYLHYDRAZIDE
CAS:96134-73-5
Formula: C9H9N3O4
KIN02798193
2-NITRO-BENZOIC ACID 2-BENZOYL-1-(TERT-BUTYL)HYDRAZIDE
CAS:112225-86-2
Formula: C18H19N3O4
KIN03644147
2-NITRO-BENZOIC ACID ANHYDRIDE WITH ACETIC ACID
CAS:4015-64-9
KIN01099479
2-NITRO-BENZOIC ACID BARIUM SALT
CAS:56444-12-3
Formula: C7H5NO4.1/2Ba
KIN02383005
2-NITRO-BENZOIC ACID BROMOAMIDE
CAS:33348-83-3
Formula: C7H5BrN2O3
KIN02204873
2-NITRO-BENZOIC ACID COMPD. WITH BENZENEMETHANAMINE (1:1)
CAS:1186302-36-2
KIN05320917
2-NITRO-BENZOIC ACID ETHYL ESTER
CAS:610-35-5
Formula: C8H6O5
KIN01022207
2-NITRO-BENZOIC ACID FURFURYLAMIDE
CAS:120275-54-9
KIN03163488
2-NITRO-BENZOIC ACID ISOBUTYL ESTER
CAS:32357-18-9
Formula: C11H13NO4
KIN02196232
2-NITRO-BENZOIC ACID LITHIUM SALT
CAS:18390-53-9
Formula: C7H5NO4.Li
KIN02071580
2-NITRO-BENZOIC ACID PHENACYL ESTER
CAS:55153-33-8
Formula: C15H11NO5
KIN02361683
2-NITRO-BENZOIC ACID PHENYL ESTER
CAS:31042-59-8
Formula: C13H9NO4
KIN02186672
2-NITRO-BENZOIC ACID POTASSIUM SALT
CAS:15163-59-4
Formula: C7H5NO4.K
KIN02039029
2-NITRO-BENZOIC ACID POTASSIUM SALT (2:1)
CAS:58131-71-8
Formula: C7H5NO4.1/2K
KIN02410936
2-NITRO-BENZOIC ACID SILVER
CAS:72247-99-5
Formula: C7H5AgNO4
KIN02590076
2-NITRO-BENZOIC ACID TERT-BUTYL ESTER
CAS:55666-41-6
Formula: C11H13NO4
KIN02369890
2-NITRO-BENZOIC ACID TRICHLOROSILANYL ESTER
CAS:115759-72-3
Formula: C7H4Cl3NO4Si
KIN03138940
2-NITRO-BENZOIC ACID YTTRIUM(III) SALT DIHYDRATE
CAS:114515-71-8
Formula: C7H5NO4.2/3H2O.1/3Y
KIN03131414
2-NITRO-BENZONITRILE
CAS:612-25-9
Formula: C7H7NO3
KIN01022339
2-NITRO-BENZONITRILE N-OXIDE
CAS:66912-26-3
Formula: C7H4N2O3
KIN02546776
2-NITRO-BENZOPEROXOIC ACID
CAS:1711-42-8
Formula: C8H6O8
KIN01053976
2-NITRO-BENZOPHENONE
CAS:2243-80-3
Formula: C13H9NO3
KIN01065620
2-NITRO-BENZOTRIFLUORIDE
CAS:384-26-9
Formula: C22H31FO3
KIN01012956
2-NITRO-BENZOYL AZIDE
CAS:1134-11-8
KIN01040985
2-NITRO-BENZOYL BROMIDE
CAS:151093-39-9
Formula: C7H4BrNO3
KIN03298157
2-NITRO-BENZOYL CHLORIDE
CAS:610-15-1
Formula: C7H6N2O3
KIN01022190
2-NITRO-BENZYL 2-NITROPHENYL KETONE
CAS:107127-66-2
Formula: C14H10N2O5
KIN03080989
2-NITRO-BENZYL BENZOATE
CAS:110786-18-0
Formula: C14H11NO4
KIN03103613
2-NITRO-BENZYL BENZOHYDROXAMATE
CAS:36663-91-9
Formula: C14H12N2O4
KIN02233134
2-NITRO-BENZYL BROMIDE
CAS:3958-63-2
Formula: C3H6NO2.Li
KIN01098560
2-NITRO-BENZYL BUTYRATE
CAS:119979-38-3
Formula: C11H13NO4
KIN03161623
2-NITRO-BENZYL CHLORIDE
CAS:612-24-8
Formula: C7H4N2O2
KIN01022338
2-NITRO-BENZYL P-TOLUENESULFONATE
CAS:20444-09-1
Formula: C14H13NO5S
KIN02091185
2-NITRO-BENZYL PROPANOATE
CAS:132663-51-5
Formula: [C10H11NO4
KIN03219918
2-NITRO-BENZYL-3ALPHA4,7,7ALPHA-TETRAHYDRO-4,7-EPOXY-1H-ISOINDOL-1,3(2H)-DIONE
CAS:272449-67-9
Formula: C15H13NO3
KIN03464431
2-NITRO-BETA-MORPHOLIN-4-YL-STYRENE
CAS:107127-60-6
Formula: C12H14N2O3
KIN03080987
2-NITRO-BETA-NITROSO-BENZENEETHANOL
CAS:202263-94-3
Formula: C8H8N2O4
KIN03410307
2-NITRO-BETA-OXO-ALPHA-(TRIPHENYLPHOSPHORANYLIDENE)-BENZENEBUTANENITRILE
CAS:364365-47-9
Formula: C28H21N2O3P
KIN03538951
2-NITRO-BETA-OXO-ALPHA-PHENYLBENZENEPROPANAL
CAS:69511-72-4
Formula: C15H11NO4
KIN02570858
2-NITRO-BETA-OXO-BENZENEPROPANOIC ACID
CAS:22751-16-2
Formula: C9H7NO5
KIN02113398
2-NITRO-BETA-OXO-BENZENEPROPANOIC ACID BUTYL ESTER
CAS:479629-96-4
Formula: C13H15NO5
KIN03608153
2-NITRO-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:52119-39-8
Formula: C11H11NO5
KIN02316479
2-NITRO-BETA-OXO-BENZENEPROPANOIC ACID METHYL ESTER
CAS:61158-02-9
Formula: C10H9NO5
KIN02451823
2-NITRO-BETA[(TETRAHYDRO-2H-PYRAN-2-YLOXY)]-1H-IMIDAZOL-1-PROPANOL TOSYLATE (ESTER)
CAS:150196-34-2
Formula: C18H23N3O7S
KIN03295474
2-NITRO-BICYCLO[2.2.1]HEPTA-2,5-DIENE
CAS:78048-24-5
Formula: C7H7NO2
KIN02628960
2-NITRO-BICYCLO[2.2.2]OCT-2-ENE
CAS:477331-13-8
Formula: C8H11NO2
KIN03604336
2-NITRO-BICYCLO[2.2.2]OCTA-2,5-DIENE
CAS:477565-68-7
Formula: C8H9NO2
KIN03604889
2-NITRO-BICYCLO[3.1.1]HEPTANE-2-CARBONITRILE
CAS:172839-85-9
Formula: C8H10N2O2
KIN03351985
2-NITRO-BIPHENYL
CAS:86-01-1
Formula: C10H16N5O14P3
KIN01002056
2-NITRO-BIPHENYL-3-CARBOXYLIC ACID
CAS:229955-59-3
Formula: C13H9NO4
KIN03442526
2-NITRO-BIPHENYL-3-METHANOL
CAS:89951-70-2
KIN02719794
2-NITRO-BIPHENYL-3-OL
CAS:21419-74-9
Formula: C12H9NO3
KIN02100711
2-NITRO-BIPHENYL-3-YLAMINE
CAS:162279-66-5
KIN03331151
2-NITRO-BIPHENYL-4,4'-DIAMINE
CAS:2243-79-0
Formula: C13H9NO3
KIN01065619
2-NITRO-BIPHENYL-4,4'-DIOL
CAS:319014-77-2
KIN03491923
2-NITRO-BIPHENYL-4-ACETONITRILE
CAS:120985-55-9
Formula: [C14H10N2O2
KIN03167293
2-NITRO-BIPHENYL-4-CARBONYL CHLORIDE
CAS:99847-45-7
Formula: C13H8ClNO3
KIN02822908
2-NITRO-BIPHENYL-4-CARBOXYLIC ACID
CAS:99847-12-8
Formula: C13H9NO4
KIN02822891
2-NITRO-BIPHENYL-4-CARBOXYLIC ACID METHYL ESTER
CAS:39180-36-4
Formula: C14H11NO4
KIN02253505
MFCD09033504
2-NITRO-BIPHENYL-4-OL
CAS:51264-59-6
Formula: C12H9NO3
KIN02304022
MFCD00143326
2-NITRO-BIPHENYL-4-YLAMINE
CAS:7379-22-8
KIN01185454
2-NITRO-BISPHENOL, A
CAS:233756-97-3
Formula: C15H15NO4
KIN03443765
2-NITRO-BUT-2-ENE
CAS:4812-24-2
Formula: C9H17NO2
KIN01115160
2-NITRO-BUT-2-ENOIC ACID ETHYL ESTER
CAS:22623-97-8
Formula: C6H9NO4
KIN02112332
2-NITRO-BUTANE
CAS:600-25-9
Formula: C3H6ClNO2
KIN01021649
2-NITRO-BUTANE ION(I) LITHIUM
CAS:35818-95-2
Formula: C4H8NO2.Li
KIN02226544
2-NITRO-BUTANE ION(I) SODIUM SALT
CAS:91113-96-1
Formula: C4H8NO2.Na
KIN02738881
2-NITRO-BUTANEDIOIC ACID
CAS:144923-27-3
Formula: C4H5NO6
KIN03277764
2-NITRO-BUTANEDIOIC ACID 1,4-DIMETHYL ESTER
CAS:154621-99-5
Formula: C6H9NO6
KIN03309472
2-NITRO-BUTANOIC ACID ANHYDRIDE WITH HYPOFLUOROUS ACID
CAS:125973-30-0
Formula: C4H6FNO4
KIN03190939
2-NITRO-BUTANOIC ACID METHYL ESTER
CAS:59906-50-2
Formula: C5H9NO4
KIN02439337
2-NITRO-BUTANOIC ACID SODIUM SALT
CAS:125973-25-3
Formula: C4H7NO4.Na
KIN03190937
2-NITRO-BUTANOL
CAS:609-32-5
Formula: C3H3NO4
KIN01022146
2-NITRO-BUTANOLNITRONATE
CAS:85060-03-3
Formula: C4H8NO3
KIN02671579
2-NITRO-CHLOROGENIC ACID
CAS:347163-34-2
Formula: C16H17NO11
KIN03523966
2-NITRO-CHRYSENE
CAS:3989-97-7
Formula: C11H22N2O3
KIN01099108
2-NITRO-CYCLODODECANOL 1-ACETATE
CAS:52089-60-8
KIN02315934
2-NITRO-CYCLODODECANONE ION(I) AMMONIUM
CAS:52089-61-9
Formula: C12H20NO3.H4N
KIN02315935
2-NITRO-CYCLODODECANONE ION(I) CALCIUM
CAS:62424-65-1
Formula: C12H20NO3.1/2Ca
KIN02473853
2-NITRO-CYCLOHEPTANOL
CAS:159528-01-5
Formula: C7H13NO3
KIN03323487
2-NITRO-CYCLOHEXADIENYL
CAS:74899-02-8
Formula: C6H6NO2
KIN02609165
2-NITRO-CYCLOHEXANOL
CAS:4050-81-1
Formula: C6H4Br4N2O
KIN01100096
2-NITRO-CYCLOHEXANOL NITRATE (ESTER)
CAS:6925-11-7
Formula: C5H7NO2
KIN01172713
2-NITRO-CYCLOHEXANONE
CAS:4883-68-5
Formula: C6H9NO2
KIN01116522
2-NITRO-CYCLOHEXANONE OXIME
CAS:2209-35-0
Formula: C8H14N2O3
KIN01064851
2-NITRO-CYCLOOCTANOL ACETATE (ESTER)
CAS:88157-67-9
Formula: C10H17NO4
KIN02694019
2-NITRO-CYCLOOCTANOL NITRATE (ESTER)
CAS:59550-06-0
Formula: C8H14N2O5
KIN02433241
2-NITRO-CYCLOOCTANONE ION(I) CALCIUM
CAS:64117-33-5
Formula: C8H12NO3.1/2Ca
KIN02504582
2-NITRO-CYCLOOCTANONE OXIME
CAS:2209-36-1
Formula: C6H8N2O2
KIN01064852
2-NITRO-CYCLOPENTA[NO]-TETRAPHENE
CAS:107673-65-4
Formula: C20H11NO2
KIN03084179
2-NITRO-CYCLOPENTANOL
CAS:88157-72-6
Formula: C5H9NO3
KIN02694024
2-NITRO-CYCLOPENTANOL ACETATE (ESTER)
CAS:6925-14-0
Formula: C8H12O
KIN01172715
2-NITRO-CYCLOPROPAN-CARBOXYLIC ACID
CAS:89033-26-1
Formula: C4H5NO4
KIN02706132
2-NITRO-CYCLOTRIDECANONE
CAS:91652-56-1
Formula: C13H23NO3
KIN02746979
2-NITRO-D-PHENYL-ALANINE
CAS:169383-17-9
Formula: C9H10N2O4
KIN03344756
2-NITRO-DIBENZO[B,D]THIOPHENE
CAS:6639-38-9
Formula: C12H11AsO3
KIN01167598
2-NITRO-DIBENZO[B,F][1,4]OXAZEPIN-11(10H)-ONE
CAS:16398-16-6
Formula: C13H8N2O4
KIN02050954
2-NITRO-DIBENZO[B,F][1,4]OXAZEPINE
CAS:16398-29-1
KIN02050966
2-NITRO-DIBENZO[B,F][1,4]THIAZEPIN-11(10H)-ONE
CAS:65192-78-1
Formula: C13H8N2O3S
KIN02522738
2-NITRO-DIBENZO[B,F][1,4]THIAZEPINE-11(10H)-THIONE
CAS:146135-32-2
Formula: C13H8N2O2S2
KIN03009965
2-NITRO-DIBENZO[B]THIOPHENE 5,5-DIOXIDE
CAS:72469-59-1
Formula: C12H7NO4S
KIN02591590
2-NITRO-DIBENZOFURAN-3-YLAMINE
CAS:32497-33-9
Formula: C12H8N2O3
KIN02197573
2-NITRO-DITHIENO[2,3-B:3',2'-D]PYRIDINE
CAS:134166-19-1
Formula: C9H4N2O2S2
KIN03227013
2-NITRO-DITHIENO[2,3-B:3',2'-D]PYRIDINE 4-OXIDE
CAS:146795-58-6
Formula: C9H4N2O3S2
KIN03283687
2-NITRO-DITHIENO[3,2-B:3',2'-D]PYRIDINE
CAS:153256-95-2
Formula: C9H4N2O2S2
KIN03304583
2-NITRO-DITHIENO[3,2-B:3',4'-D]PYRIDINE
CAS:153256-97-4
Formula: C9H4N2O2S2
KIN03304585
2-NITRO-DL-PHENYL-ALANINE TERT-BUTYL ESTER MONOFORMATE
CAS:116366-35-9
KIN03142835
2-NITRO-ETHANAMINE HCL
CAS:89315-44-6
Formula: C2H6N2O2.ClH
KIN02710159
2-NITRO-ETHANEHYDRAZONOTHIOIC ACID METHYL ESTER
CAS:66031-19-4
Formula: C3H7N3O2S
KIN02535881
2-NITRO-ETHANETHIOL
CAS:53770-80-2
Formula: C2H5NO2S
KIN02340293
2-NITRO-ETHANOL 1-( TOSYLATE)
CAS:68142-14-3
Formula: C9H11NO5S
KIN02561024
2-NITRO-ETHANOL LITHIUM SALT
CAS:188819-33-2
Formula: C2H5NO3.Li
KIN03386208
2-NITRO-ETHANOL, PROPANOATE
CAS:5390-41-0
KIN01128304
2-NITRO-ETHENESULFONIC ACID SODIUM SALT
CAS:138685-35-5
Formula: C2H3NO5S.Na
KIN03248197
2-NITRO-ETHENYLCYCLOHEXANE
CAS:132839-80-6
Formula: C8H13NO2
KIN03220843
2-NITRO-ETHYL ACETATE
CAS:18942-89-7
Formula: C4H7NO4
KIN02076501
2-NITRO-ETHYL ACRYLATE
CAS:3430-85-1
Formula: C12H10GeO
KIN01089066
2-NITRO-ETHYL NITRATE
CAS:4528-37-4
Formula: C10H20O2
KIN01109903
2-NITRO-FLUORANTHEN-8-OL
CAS:109028-11-7
Formula: C16H9NO3
KIN03092817
2-NITRO-FLUORANTHENE
CAS:13177-29-2
Formula: C16H9NO2
KIN02016000
2-NITRO-FLUORENONE, OXIME
CAS:116365-53-8
Formula: C13H8N2O3
KIN03142803
2-NITRO-FURAN
CAS:609-40-5
Formula: C4H3NO2S
KIN01022151
2-NITRO-FURO[2,3-B]PYRIDINE
CAS:92404-75-6
Formula: C7H4N2O3
KIN02756217
2-NITRO-FURO[3,2-B]PYRIDINE
CAS:92404-78-9
Formula: C7H4N2O3
KIN02756218
2-NITRO-FURO[3,2-C]PYRIDINE
CAS:57420-03-8
Formula: C7H4N2O3
KIN02399372
2-NITRO-FURO[3,2-C]PYRIDINE MONONITRATE
CAS:92404-87-0
Formula: C7H4N2O3.HNO3
KIN02756221
2-NITRO-HEPTANE
CAS:617-73-2
Formula: C8H16O3
KIN01022722
2-NITRO-HEXADECAN-1,3-DIOL
CAS:343231-27-6
Formula: C16H33NO4
KIN03517105
2-NITRO-HEXANOIC ACID METHYL ESTER
CAS:59906-51-3
Formula: C7H13NO4
KIN02439338
2-NITRO-INDOLIZINE
CAS:195615-10-2
KIN03400523
2-NITRO-INOSINE O-METHYLOXIME
CAS:306275-39-8
KIN03482202
2-NITRO-ISOPHTHALAMIDE
CAS:32114-73-1
Formula: C8H7N3O4
KIN02194485
MFCD12024397
2-NITRO-L-PHENYL-ALANINE
CAS:19883-75-1
Formula: C9H10N2O4
KIN02085848
2-Nitro-L-phenyl-alanine; L-2-Nitrophenylalanine;
MFCD00270360
2-NITRO-L-PHENYL-ALANINE ETHYL ESTER
CAS:94213-42-0
Formula: C11H14N2O4
KIN02779183
2-NITRO-L-TYROSINE
CAS:110012-34-5
Formula: C9H10N2O5
KIN03098703
2-NITRO-L-TYROSINE METHYL ESTER
CAS:237755-14-5
Formula: C10H12N2O5
KIN03444833
2-NITRO-MALONALDEHYDE
CAS:609-35-8
Formula: C5H5NO2
KIN01022147
2-NITRO-MALONIC ACID
CAS:61468-84-6
Formula: C3H3NO6
KIN02456561
2-NITRO-MALONIC ACID DIETHYL ESTER
CAS:603-69-0
Formula: C8H12O4
KIN01021797
2-NITRO-METHYL-2-CYCLOPENTENONE
CAS:113526-12-8
Formula: C6H7NO3
KIN03123870
2-NITRO-N'-(PROPAN-2-YLIDENE)PHENYLSULFONOHYDRAZIDE
CAS:6655-31-8
KIN01168091
2-NITRO-N,5-DIPHENYL-N-(BENZYL)-3-THIOPHENAMINE
CAS:59583-34-5
Formula: C23H18N2O2S
KIN02433704
2-NITRO-N,N'-BIS(BENZYL)-1,1-ETHENEDIAMINE
CAS:62390-82-3
Formula: C16H17N3O2
KIN02473257
2-NITRO-N,N,5-TRIPHENYL-3-THIOPHENAMINE
CAS:59583-36-7
Formula: C22H16N2O2S
KIN02433705
2-NITRO-N,N-BIS(4-NITROPHENYL)-ANILINE
CAS:117847-23-1
Formula: C18H12N4O6
KIN03151089
2-NITRO-N,N-BIS(BENZYL)-BENZAMIDE
CAS:57409-27-5
Formula: C21H18N2O3
KIN02399176
2-NITRO-N,N-DIPHENYL-ANILINE
CAS:53013-38-0
Formula: C18H14N2O2
KIN02328997
MFCD07369590
2-NITRO-N,N-DIPROPAN-2-YLBENZAMIDE
CAS:169330-06-7
Formula: C13H18N2O3
KIN03344655
2-NITRO-N,N-DIPROPYLBENZENESULFONAMIDE
CAS:89840-69-7
Formula: C12H18N2O4S
KIN02717886
2-NITRO-N-(1,2,3,4-TETRAHYDRO-NAPHTHALEN-1-YL)-BENZAMIDE
CAS:120276-14-4
Formula: C17H16N2O3
KIN03163500
2-NITRO-N-(1-NITRO-NAPHTHALEN-2-YL)-BENZAMIDE
CAS:91532-59-1
Formula: C17H11N3O5
KIN02745186
2-NITRO-N-(1-OXO-1H-PHENALEN-2-YL)-BENZAMIDE
CAS:62051-75-6
Formula: C20H12N2O4
KIN02466898
2-NITRO-N-(1-OXO-BUT-2-EN-1-YL)-PYRIDIN-4-CARBOXAMIDE
CAS:60780-63-4
Formula: C10H9N3O4
KIN02447742
2-NITRO-N-(1-OXOOCTYL)-PYRIDIN-4-CARBOXAMIDE
CAS:60780-60-1
Formula: C14H19N3O4
KIN02447739
2-NITRO-N-(1-PHENYLETHYL)-BENZAMIDE
CAS:124264-90-0
Formula: [C15H14N2O3
KIN03183215
2-NITRO-N-(1-PHENYLETHYL)-BENZENESULFONAMIDE
CAS:295361-05-6
Formula: C14H14N2O4S
KIN03473545
2-NITRO-N-(1-PROPYLBUTYL)-ANILINE
CAS:1157542-83-0
Formula: C13H20N2O2
KIN05247660
2-NITRO-N-(1H-TETRAZOL-5-YL)-BENZAMIDE
CAS:87693-28-5
KIN02688761
MFCD00129245
2-NITRO-N-(2,2,2-TRIFLUORO-ETHYL)-4-(TRIFLUOROMETHYL)-ANILINE
CAS:42379-55-5
KIN02277941
2-NITRO-N-(2,2,2-TRIFLUORO-ETHYL)-4-[(TRIFLUOROMETHYL)SULFONYL]-ANILINE
CAS:42379-56-6
Formula: C9H6F6N2O4S
KIN02277942
2-NITRO-N-(2,2,2-TRIFLUORO-ETHYL)-ANILINE
CAS:68545-86-8
Formula: C8H7F3N2O2
KIN02564156
2-NITRO-N-(2,4,6-TRIMETHYLPHENYL)-BENZENESULFONAMIDE
CAS:40236-53-1
Formula: C15H16N2O4S
KIN02261100
2-NITRO-N-(2-(2-NITRO-1H-IMIDAZOL-1-YL)ETHYL)-1H-IMIDAZOL-1-BUTYRAMIDE
CAS:154094-87-8
Formula: [C12H15N7O5
KIN03307495
2-NITRO-N-(2-(4-NITRO-1H-IMIDAZOL-1-YL)ETHYL)-1H-IMIDAZOL-1-BUTYRAMIDE
CAS:155065-07-9
Formula: [C12H15N7O5
KIN03311000
2-NITRO-N-(2-NITRO-BENZOYL)-BENZAMIDE
CAS:88116-36-3
Formula: C14H9N3O6
KIN02693483
2-NITRO-N-(2-NITROPHENYL)-ANILINE
CAS:18264-71-6
Formula: C12H9N3O4
KIN02070378
MFCD01861530
2-NITRO-N-(2-NITROPHENYL)-BENZAMIDE
CAS:54559-21-6
Formula: C13H9N3O5
KIN02351900
2-NITRO-N-(2-NITROPHENYL)-N-PHENYL-ANILINE
CAS:127074-39-9
Formula: C18H13N3O4
KIN03195809
2-NITRO-N-(2-OXO-2-PYRROLIDIN-1-YLETHYL)-N-PHENYLBENZENESULFONAMIDE
CAS:6197-07-5
Formula: C21H41NO2
KIN01152184
2-NITRO-N-(2-OXO-PROPYL)-BENZAMIDE
CAS:1148122-58-0
Formula: C10H10N2O4
KIN05196370
2-NITRO-N-(2-OXOETHYL)-BENZENEACETAMIDE
CAS:67099-38-1
Formula: C10H10N2O4
KIN02548569
2-NITRO-N-(2-PHENYLETHYL)-BENZAMIDE
CAS:19209-03-1
KIN02079194
2-NITRO-N-(2-PHENYLETHYL)-BENZENESULFONAMIDE
CAS:141381-81-9
KIN03259957
2-NITRO-N-(2-PYRIDINYLMETHYL)-ACETAMIDE
CAS:72078-84-3
Formula: C8H9N3O3
KIN02588786
2-NITRO-N-(2-PYRROLIDINE-1-YLETHYL)-1-BENZO[B]THIOPHEN-3-YLAMINE
CAS:128554-85-8
Formula: C14H17N3O2S
KIN03202201
2-NITRO-N-(2-PYRROLIDINE-1-YLETHYL)THIOPHEN-3-YLAMINE HCL
CAS:122777-92-8
Formula: C10H15N3O2S.ClH
KIN03176665
2-NITRO-N-(2-TOLYL)-BENZAMIDE
CAS:2385-26-4
Formula: C13H9BrN2O3
KIN01068305
2-NITRO-N-(2H-1,3-OXAZIN-2-YLIDENEMETHYL)-ANILINE
CAS:301676-23-3
KIN03025187
2-NITRO-N-(3'-TRIFLUOROMETHYLPHENYL)-ANILINE
CAS:365-65-1
Formula: C8H7FN2O5S
KIN01012156
2-NITRO-N-(3,3,3-TRIFLUORO-2-HYDROXY-PROPYL)-1H-IMIDAZOL-1-ACETAMIDE
CAS:167648-73-9
Formula: C8H9F3N4O4
KIN03002212
2-NITRO-N-(3,3,5-TRIMETHYL-CYCLOHEXYL)-ANILINE
CAS:1157542-78-3
Formula: C15H22N2O2
KIN05247657
2-NITRO-N-(3,4,5-TRIMETHOXY-PHENYL)-BENZENESULFONAMIDE
CAS:312299-33-5
Formula: C15H16N2O7S
KIN03485904
2-NITRO-N-(3-(TRIFLUOROMETHYL)PHENYL)-BENZO[B]THIOPHEN-3-YLAMINE
CAS:149338-13-6
Formula: [C15H9F3N2O2S
KIN03292086
2-NITRO-N-(3-NITRO-BENZYLIDEN)-ANILINE
CAS:17064-90-3
Formula: C13H9N3O4
KIN02057738
2-NITRO-N-(3-NITROPHENYL)-4-(TRIFLUOROMETHYL)-ANILINE
CAS:153935-35-4
Formula: C13H8F3N3O4
KIN03655432
2-NITRO-N-(3-NITROPHENYL)-ANILINE
CAS:20964-33-4
Formula: C12H9N3O4
KIN02095979
2-NITRO-N-(3-NITROPHENYL)-BENZENEMETHANAMINE
CAS:1152641-32-1
Formula: C13H11N3O4
KIN05200765
2-NITRO-N-(3-NITROPHENYL)-BENZENESULFONAMIDE
CAS:63228-70-6
Formula: C12H9N3O6S
KIN02488820
2-NITRO-N-(3-PHENYL-ALLYLIDENE)-ANILINE
CAS:61660-20-6
Formula: C15H12N2O2
KIN02459483
2-NITRO-N-(3-PHENYL-CYCLOBUTYL)-ANILINE
CAS:1157503-45-1
Formula: C16H16N2O2
KIN05247248
2-NITRO-N-(3-PIPERIDIN-1-YLPROPYL)-ANILINE
CAS:115581-68-5
Formula: C14H21N3O2
KIN03137958
2-NITRO-N-(3-PYRIDINYLMETHYL)-1,1-ETHENEDIAMINE
CAS:120738-41-2
Formula: C8H10N4O2
KIN03681841
2-NITRO-N-(3-TRIFLUOROMETHYLPHENYL)-BENZAMIDE
CAS:304884-94-4
Formula: C14H9F3N2O3
KIN03481551
2-NITRO-N-(4,5,6,7-TETRAHYDRO-5,5-DIMETHYL-7-OXO-BENZO[D]THIAZOL-2-YL)-BENZENESULFENAMIDE
CAS:300572-41-2
Formula: C15H15N3O3S2
KIN03475975
2-NITRO-N-(4-(TRIFLUOROMETHYL)PHENYL)-BENZO[B]THIOPHEN-3-YLAMINE
CAS:149338-12-5
Formula: [C15H9F3N2O2S
KIN03292085
2-NITRO-N-(4-NITROPHENYL)-4-(TRIFLUOROMETHYL)-ANILINE
CAS:182565-75-9
Formula: C13H8F3N3O4
KIN03655431
2-NITRO-N-(4-NITROPHENYL)-ANILINE
CAS:612-37-3
Formula: C6H6N4O3
KIN01022349
2-NITRO-N-(4-NITROPHENYL)-BENZAMIDE
CAS:78411-60-6
Formula: C13H9N3O5
KIN02631393
2-NITRO-N-(4-NITROPHENYL)-BENZENEMETHANAMINE
CAS:1089855-30-0
Formula: C13H11N3O4
KIN05129662
2-NITRO-N-(4-NITROPHENYL)-BENZENESULFONAMIDE
CAS:63228-73-9
Formula: C12H9N3O6S
KIN02488823
2-NITRO-N-(4-NITROPHENYL)-N-NITROSO-ANILINE
CAS:21565-18-4
Formula: C12H8N4O5
KIN02102020
2-NITRO-N-(4-NITROPHENYL)-PROPANAMIDE
CAS:63916-00-7
Formula: C9H9N3O5
KIN02501266
2-NITRO-N-(5-NITRO-THIAZOL-2-YL)-BENZAMIDE
CAS:64724-87-4
Formula: C10H6N4O5S
KIN02514515
2-NITRO-N-(5-PHENYL-1,3,4-OXADIAZOL-2-YL)-BENZAMIDE
CAS:341943-52-0
KIN03677387
2-NITRO-N-(BENZENESULFONYL)-ACETAMIDE
CAS:135082-02-9
KIN03231340
2-NITRO-N-(BENZENESULFONYL)-BENZENESULFINIMIDIC ACID 1-METHYLETHYL ESTER
CAS:147992-37-8
KIN03287966
2-NITRO-N-(BENZENESULFONYL)-BENZENESULFINIMIDIC ACID 2-METHYLPROPYL ESTER
CAS:147992-39-0
KIN03287968
2-NITRO-N-(BENZENESULFONYL)-BENZENESULFINIMIDIC ACID BUTYL ESTER
CAS:147992-38-9
KIN03287967
2-NITRO-N-(BENZENESULFONYL)-BENZENESULFINIMIDIC ACID PROPYL ESTER
CAS:147992-36-7
KIN03287965
2-NITRO-N-(BENZYL)-ACETAMIDE
CAS:129222-48-6
Formula: C9H10N2O3
KIN03204892
2-NITRO-N-(BENZYL)-BENZENEMETHANAMINE
CAS:95982-61-9
Formula: C14H14N2O2
KIN02796935
2-NITRO-N-(BENZYL)-PYRIDIN-3-YLAMINE
CAS:54231-40-2
Formula: C12H11N3O2
KIN02346900
2-NITRO-N-(BENZYL)ETHANIMIDIC ACID HYDRAZIDE
CAS:66031-21-8
Formula: C9H12N4O2
KIN02535883
2-NITRO-N-(OXIDODIPHENYL-LAMBDA4-THIOIDENE)-ANILINE
CAS:299914-27-5
KIN03677386
2-NITRO-N-(P-TOLYL)-4-((TRIFLUOROMETHYL)SULFONYL)-ANILINE
CAS:744-37-6
KIN01028048
2-NITRO-N-(P-TOLYL)-4-(TRIFLUOROMETHYL)-ANILINE
CAS:1598-34-1
KIN01051104
2-NITRO-N-(PHENYLMETHYLENE)-1H-IMIDAZOL-1-YLAMINE
CAS:83279-40-7
Formula: C10H8N4O2
KIN02660285
2-NITRO-N-(PYRAZIN-2-YLMETHYL)-BENZENESULFONAMIDE
CAS:1046134-53-5
Formula: C11H10N4O4S
KIN05095143
2-NITRO-N-(PYRIDIN-2-YLTHIO)-BENZAMIDE
CAS:113780-54-4
KIN03125946
2-NITRO-N-(PYRROLIDIN-3-YLMETHYL)-BENZENESULFONAMIDE
CAS:290326-03-3
KIN03666736
2-NITRO-N-(TETRAHYDRO-2H-PYRAN-2-YLIDENE)-BENZENESULFONAMIDE
CAS:3128-49-2
Formula: C11H12N2O5S
KIN01082887
2-NITRO-N-(THIOPHEN-2-YLMETHYLENE)-ANILINE
CAS:68490-79-9
Formula: C11H8N2O2S
KIN02563705
2-NITRO-N-(TRIPHENYLPHOSPHORANYLIDENE)-ANILINE
CAS:31706-27-1
Formula: C24H19N2O2P
KIN02191498
2-NITRO-N-[(1-PHENYLCYCLOPENTYL)METHYL]-BENZAMIDE
CAS:334505-02-1
Formula: C19H20N2O3
KIN03025639
2-NITRO-N-[(2-NITROPHENYL)METHYL]BENZENEMETHANAMINE
CAS:74808-63-2
Formula: C14H13N3O4
KIN02608557
2-NITRO-N-[(4-NITROPHENYL)METHYL]BENZENEMETHANAMINE
CAS:1178405-79-2
Formula: C14H13N3O4
KIN05276471
2-NITRO-N-[(5-NITRO-FURAN-2-YL)METHYLENE]-ANILINE
CAS:82773-58-8
Formula: C11H7N3O5
KIN02657546
2-NITRO-N-[(E)-PYRIDIN-4-YLMETHYLENEAMINO]BENZAMIDE
CAS:5568-41-2
Formula: C9H12N4.HI
KIN01135868
2-NITRO-N-[(Z)-PYRIDIN-3-YLMETHYLENEAMINO]BENZAMIDE
CAS:19209-73-5
Formula: C13H10N4O3
KIN02079200
2-NITRO-N-[[(2-NITRO-BENZOYL)AMINO]PHENYLMETHYL]BENZAMIDE
CAS:102241-90-7
Formula: C21H16N4O6
KIN03045651
2-NITRO-N-[[[3-NITRO-4-[[5-(TRIFLUOROMETHYL)-PYRIDIN-2-YL]OXY]PHENYL]AMINO]CARBONYL]-BENZAMIDE
CAS:103829-06-7
Formula: C20H12F3N5O7
KIN03056448
2-NITRO-N-[[TRANS-4-[[[(1,2,3,4-TETRAHYDRO-NAPHTHALEN-2-YL)METHYL]AMINO]METHYL]CYCLOHEXYL]METHYL]BENZENESULFONAMIDE HCL
CAS:486453-65-0
Formula: C25H33N3O4SHCl
KIN03610809
2-NITRO-N-[1-(BENZYL)PIPERIDIN-4-YL]BENZAMIDE
CAS:197843-56-4
KIN03403420
2-NITRO-N-[1-(BENZYL)PIPERIDIN-4-YL]BENZENEACETAMIDE
CAS:208184-80-9
Formula: C20H23N3O3
KIN03418509
2-NITRO-N-[2-(4-PHENYLPIPERAZINE-1-YL)ETHYL]BENZAMIDE
CAS:1049342-15-5
KIN05097761
2-NITRO-N-[2-(4-SULFAMOYLPHENYL)ETHYL]BENZENESULFONAMIDE
CAS:196512-83-1
Formula: C14H15N3O6S2
KIN03401288
2-NITRO-N-[2-(5-NITRO-1H-IMIDAZOL-1-YL)ETHYL]-1H-IMIDAZOL-1-BUTYRAMIDE
CAS:154094-95-8
Formula: C12H15N7O5
KIN03307503
2-NITRO-N-[2-(BENZYL)PHENYL]BENZENEACETAMIDE
CAS:1182684-97-4
Formula: C21H18N2O3
KIN05296714
2-NITRO-N-[2-(PIPERAZIN-1-YL)ETHYL]BENZAMIDE
CAS:1153545-97-1
Formula: C13H18N4O3
KIN05211552
2-NITRO-N-[2-(PIPERAZIN-1-YL)ETHYL]BENZENEACETAMIDE
CAS:1153545-30-2
Formula: C14H20N4O3
KIN05211529
2-NITRO-N-[2-(PYRROLIDIN-1-YL)ETHYL]PYRIDIN-3-YLAMINE OXALATE
CAS:55304-97-7
Formula: C11H16N4O2.xC2H2O4
KIN02364294
2-NITRO-N-[2-(THIOPHEN-2-YL)ETHYL]BENZAMIDE
CAS:1180913-27-2
Formula: C13H12N2O3S
KIN05290338
2-NITRO-N-[2-(THIOPHEN-2-YL)ETHYL]BENZENEACETAMIDE
CAS:1182195-88-5
Formula: C14H14N2O3S
KIN05295820
2-NITRO-N-[2-PIPERIDIN-1-YLETHYL]PYRIDIN-3-YLAMINE HCL
CAS:62194-60-9
Formula: C12H18N4O2.ClH
KIN02469773
2-NITRO-N-[3-(2-NITRO-1H-IMIDAZOL-1-YL)-PROPYL]-1H-IMIDAZOL-1-PROPANAMIDE
CAS:154094-88-9
Formula: C12H15N7O5
KIN03307496
2-NITRO-N-[3-(TRIFLUOROMETHOXY)-PHENYL]-ANILINE
CAS:1033225-57-8
KIN05067741
2-NITRO-N-[4-(2-PHENYLDIAZENYL)PHENYL]-4-[(TRIFLUOROMETHYL)SULFONYL]-ANILINE
CAS:315239-39-5
Formula: C19H13F3N4O4S
KIN03490071
2-NITRO-N-[4-(BENZYLOXY)PHENYL]-4-[(TRIFLUOROMETHYL)SULFONYL]-ANILINE
CAS:750-54-9
Formula: C26H25NO5
KIN01028141
2-NITRO-N-[4-(PYRIDIN-4-YLAMINO)PHENYL]-4-(QUINOLIN-4-YLAMINO)-BENZAMIDE
CAS:53221-73-1
Formula: C27H20N6O3
KIN02331949
2-NITRO-N-[4-(TRIFLUOROMETHOXY)PHENYL]-ANILINE
CAS:26179-59-9
KIN02146151
2-NITRO-N-[6-(3-THIAZOLIDINYL)HEXYL]BENZAMIDE
CAS:88346-64-9
Formula: C16H23N3O3S
KIN02696786
2-NITRO-N-[6-(3-THIAZOLIDINYL)HEXYL]BENZAMIDE HCL
CAS:88346-74-1
Formula: C16H23N3O3S.ClH
KIN02696791
2-NITRO-N-1,3,4-THIADIAZOL-2-YLBENZAMIDE
CAS:175653-43-7
Formula: C9H6N4O3S
KIN03359335
2-NITRO-N-1H-PYRAZOL-3-YLBENZAMIDE
CAS:103060-67-9
KIN03051666
2-NITRO-N-1H-PYRAZOL-4-YLBENZAMIDE
CAS:1153798-46-9
Formula: C10H8N4O3
KIN05212410
2-NITRO-N-1H-PYRAZOL-4-YLBENZENEACETAMIDE
CAS:1153795-46-0
Formula: C11H10N4O3
KIN05212363
2-NITRO-N-1H-PYRAZOLO[3,4-B]PYRIDIN-4-YLBENZAMIDE
CAS:370589-06-3
Formula: C13H9N5O3
KIN03026241
2-NITRO-N-2-PROPEN-1-YL-BENZENEMETHANAMINE
CAS:174536-40-4
Formula: C10H12N2O2
KIN03355984
2-NITRO-N-3-PYRIDINYL-1,1-ETHENEDIAMINE
CAS:323589-34-0
Formula: C7H8N4O2
KIN03494262
2-NITRO-N-4-PENTEN-1-YL-ANILINE
CAS:134856-53-4
KIN03230053
2-NITRO-N-4H-[1,2,4]-TRIAZOL-4-YLBENZENEACETAMIDE
CAS:349410-24-8
Formula: C10H9N5O3
KIN03025970
2-NITRO-N-9H-XANTHEN-9-YLBENZENESULFONAMIDE
CAS:7473-51-0
Formula: C19H21NO3
KIN01188416
2-NITRO-N-AETHYL-N-ACETYL-ANILIN
CAS:13475-70-2
Formula: C10H12N2O3
KIN02020146
2-NITRO-N-ALLYL-1H-IMIDAZOL-1-ACETAMIDE
CAS:322637-46-7
Formula: C8H10N4O3
KIN03494023
2-NITRO-N-ALLYL-ANILINE
CAS:13347-27-8
Formula: C9H10N2O2
KIN02018274
2-NITRO-N-ALLYL-N-PROPARGYLBENZENESULFONAMIDE
CAS:1174401-98-9
Formula: C12H12N2O4S
KIN05266051
2-NITRO-N-ALLYLBENZENESULFONAMIDE
CAS:65118-17-4
Formula: C9H10N2O4S
KIN02521373
2-NITRO-N-ALLYLPYRIDIN-4-CARBOXAMIDE
CAS:60780-27-0
Formula: C9H9N3O3
KIN02447710
2-NITRO-N-ISOBUTYLBENZENESULFONAMIDE
CAS:89840-65-3
Formula: C10H14N2O4S
KIN02717882
2-NITRO-N-NITROSO-4-(BENZENESULFONYL)-ANILINE
CAS:116082-78-1
Formula: C12H9N3O5S
KIN03140885
2-NITRO-N-NITROSO-N-PHENYL-ANILINE
CAS:21565-15-1
Formula: C12H9N3O3
KIN02102019
2-NITRO-N-OCTADECYL-3-(BENZYLOXY)-BENZAMIDE
CAS:63435-35-8
Formula: C32H48N2O4
KIN02492610
2-NITRO-N-OCTADECYL-ANILINE
CAS:95808-72-3
Formula: C24H42N2O2
KIN02795431
2-NITRO-N-OCTADECYLBENZENESULFONAMIDE
CAS:465520-56-3
KIN03597885
2-NITRO-N-OCTYL-3-(BENZYLOXY)-BENZAMIDE
CAS:63435-32-5
Formula: C22H28N2O4
KIN02492607
2-NITRO-N-OCTYLBENZENESULFONAMIDE
CAS:89840-68-6
Formula: C14H22N2O4S
KIN02717885
2-NITRO-N-PENT-4-ENYLBENZENESULFONAMIDE
CAS:351035-09-1
Formula: C11H14N2O4S
KIN03528340
2-NITRO-N-PENTYL-ANILINE
CAS:91430-23-8
Formula: C11H16N2O2
KIN02743603
2-NITRO-N-PENTYLBENZENESULFONAMIDE
CAS:349099-42-9
Formula: C11H16N2O4S
KIN03525329
2-NITRO-N-PHENYL-4-(BENZENESULFONYL)-ANILINE
CAS:94331-34-7
Formula: C18H14N2O4S
KIN02780748
2-NITRO-N-PHENYL-4-(TRIFLUOROMETHYL)-ANILINE
CAS:2715-03-9
KIN01074768
2-NITRO-N-PHENYL-4-[(BENZYL)SULFONYL]-ANILINE
CAS:94258-86-3
KIN02779960
2-NITRO-N-PHENYL-4-[(TRIFLUOROMETHYL)SULFONYL]-ANILINE
CAS:2928-00-9
Formula: C10H9FN2S
KIN01079065
2-NITRO-N-PHENYL-4-[[[(TRIFLUOROMETHYL)SULFONYL]METHYL]SULFONYL]-ANILINE
CAS:748-30-1
Formula: C24H18O3
KIN01028115
2-NITRO-N-PHENYL-5-[(TRIFLUOROMETHYL)SULFONYL]-ANILINE
CAS:406916-98-1
Formula: C13H9F3N2O4S
KIN03567486
2-NITRO-N-PHENYL-ACETAMIDE
CAS:10151-95-8
Formula: C8H8N2O3
KIN02002439
2-NITRO-N-PHENYL-ANILINE
CAS:119-76-6
Formula: C10H11N3O4
KIN01004898
2-NITRO-N-PHENYLBENZAMIDE
CAS:2385-28-6
Formula: C8H14N2O2
KIN01068307
2-NITRO-N-PHENYLBENZENECARBOXIMIDOYL CHLORIDE
CAS:57761-80-5
Formula: C13H9ClN2O2
KIN02404953
2-NITRO-N-PHENYLBENZENEMETHANESULFONAMIDE
CAS:107517-06-6
KIN03083190
2-NITRO-N-PHENYLBENZENESULFENAMIDE
CAS:4837-35-8
Formula: C9H12N2O3S
KIN01115616
2-NITRO-N-PHENYLBENZENESULFONAMIDE
CAS:5454-98-8
Formula: C14H23NO2S
KIN01132388
2-NITRO-N-PHENYLBENZO[B]THIOPHEN-3-YLAMINE
CAS:10133-37-6
Formula: C14H10N2O2S
KIN02002183
2-NITRO-N-PHENYLETHANIMIDIC ACID HYDRAZIDE
CAS:66031-20-7
Formula: C8H10N4O2
KIN02535882
2-NITRO-N-PHENYLPYRIDIN-3-YLAMINE
CAS:54231-46-8
Formula: C11H9N3O2
KIN02346906
2-NITRO-N-PIPERIDIN-1-YLBENZENEMETHANESULFONAMIDE
CAS:223794-70-5
KIN03024322
2-NITRO-N-PIPERIDIN-4-YLBENZAMIDE
CAS:1098362-79-8
Formula: C12H15N3O3
KIN05162744
2-NITRO-N-PROPARGYL-1H-IMIDAZOL-1-ACETAMIDE
CAS:161527-75-9
Formula: C8H8N4O3
KIN03329205
2-NITRO-N-PROPARGYL-4-(TRIFLUOROMETHYL)-ANILINE
CAS:75077-50-8
Formula: C10H7F3N2O2
KIN02610233
2-NITRO-N-PROPARGYL-ANILINE
CAS:75077-47-3
Formula: C9H8N2O2
KIN02610230
2-NITRO-N-PROPARGYLBENZENEACETAMIDE
CAS:1030748-20-9
Formula: C11H10N2O3
KIN05065760
2-NITRO-N-PROPARGYLBENZENEMETHANAMINE
CAS:1021068-42-7
Formula: C10H10N2O2
KIN05053024
2-NITRO-N-PROPOXY-BENZENESULFONAMIDE
CAS:300727-58-6
Formula: C9H12N2O5S
KIN03476407
2-NITRO-N-PROPYL-4-(TRIFLUOROMETHYL)-ANILINE
CAS:2078-11-7
Formula: C14H19N3O6
KIN01062233
2-NITRO-N-PROPYL-ANILINE
CAS:55432-58-1
KIN02366387
2-NITRO-N-PROPYLBENZENEACETAMIDE
CAS:186966-01-8
Formula: C11H14N2O3
KIN03382525
2-NITRO-N-PROPYLBENZENEETHANAMINE
CAS:5339-09-3
Formula: C14H10O3
KIN01126616
2-NITRO-N-PROPYLBENZENESULFONAMIDE
CAS:89840-63-1
Formula: C9H12N2O4S
KIN02717880
2-NITRO-N-PROPYLPYRIDIN-4-CARBOXAMIDE
CAS:60780-26-9
Formula: C9H11N3O3
KIN02447709
2-NITRO-N-PYRAZIN-2-YLBENZAMIDE
CAS:175653-48-2
KIN03359336
2-NITRO-N-PYRIDIN-2-YL-ACETAMIDE
CAS:72078-85-4
Formula: C7H7N3O3
KIN02588787
2-NITRO-N-PYRIDIN-2-YLBENZAMIDE
CAS:96656-49-4
Formula: C12H9N3O3
KIN02802329
2-NITRO-N-PYRIDIN-2-YLBENZENESULFENAMIDE
CAS:35070-02-1
KIN02219530
2-NITRO-N-PYRIDIN-3-YLBENZENESULFENAMIDE
CAS:35069-80-8
KIN02219523
2-NITRO-N-PYRIDIN-3-YLPYRIDIN-3-AMINE
CAS:1187191-95-2
Formula: C10H8N4O2
KIN05322465
2-NITRO-N-PYRROLIDIN-3-YLBENZENESULFONAMIDE
CAS:1086393-10-3
Formula: C10H13N3O4S
KIN05125901
2-NITRO-N-PYRROLIDINE-3-YLBENZENESULFONAMIDE HCL
CAS:1187933-02-3
KIN05324325
2-NITRO-N1-ALLYL-4-AMINO-ANILINE
CAS:160219-76-1
Formula: Nc1ccc(c(c1)[N+](=O)[O-])NCC=C
KIN03325376
2-NITRO-N1-PHENYLBENZENE-1,4-DIAMINE
CAS:2784-92-1
KIN01076070
2-NITRO-N1-PYRIDIN-4-YL-4-AMINO-ANILINE
CAS:53290-20-3
KIN02332862
2-NITRO-NAPHTHALEN-1-CARBALDEHYDE
CAS:58998-07-5
Formula: C11H7NO3
KIN02424516
2-NITRO-NAPHTHALEN-1-CARBOXYLIC ACID
CAS:91059-58-4
Formula: C11H7NO4
KIN02738028
2-NITRO-NAPHTHALEN-1-YL ACETATE
CAS:93201-37-7
Formula: C12H9NO4
KIN02766237
2-NITRO-NAPHTHALEN-BIS(HEXACHLORO-CYCLOPENTADIENE)
CAS:83878-00-6
Formula: C20H7Cl12NO2
KIN02664059
2-NITRO-NAPHTHALENE
CAS:581-90-8
Formula: C11H7F3
KIN01020679
2-NITRO-NAPHTHO[1,2-B]THIOPHENE
CAS:62615-62-7
Formula: C12H7NO2S
KIN02477342
2-NITRO-NAPHTHO[1,8-BC]PYRAN
CAS:105052-38-8
Formula: [C12H7NO3
KIN03065760
2-NITRO-NAPHTHO[2,1-B]FURAN
CAS:69267-51-2
Formula: C12H7NO3
KIN02569177
2-NITRO-NAPHTHO[2,1-B]FURAN-1-ACETIC ACID
CAS:92262-74-3
Formula: C14H9NO5
KIN02754862
2-NITRO-NAPHTHO[2,1-B]FURAN-1-CARBALDEHYDE
CAS:95455-09-7
Formula: C13H7NO4
KIN02791624
2-NITRO-NAPHTHO[2,1-B]FURAN-1-METHANOL
CAS:95455-08-6
Formula: C13H9NO4
KIN02791623
2-NITRO-NAPHTHO[2,1-B]FURAN-8-OL
CAS:86539-55-1
Formula: C12H7NO4
KIN02681005
2-NITRO-NAPHTHOL[1,2-B]FURAN
CAS:69267-50-1
Formula: C12H7NO3
KIN02569176
2-NITRO-NEVIRAPINE, YELLOW SOLID
CAS:284686-16-4
Formula: C15H13N5O3
KIN03468144
2-NITRO-OCTAHYDRO-1H-PYRIDO[1,2-A]PYRAZINE
CAS:100070-64-2
Formula: C8H15N3O2
KIN03028291
2-NITRO-OCTANE
CAS:4609-92-1
Formula: C8H17NO2
KIN01111346
2-NITRO-OXAZIRIDINE
CAS:88673-11-4
Formula: CH2N2O3
KIN02701157
2-NITRO-OXAZOLO[5,4-D]PYRIMIDINE
CAS:139392-52-2
KIN03252458
2-NITRO-OXY-HEPTANE
CAS:121955-34-8
Formula: C7H15NO3
KIN03172519
2-NITRO-P-BENZENEDIBORONIC ACID
CAS:28362-31-4
Formula: C6H7B2NO6
KIN02165536
2-NITRO-PENTAN-1-OL
CAS:2899-92-5
Formula: C9H11HgNS2-
KIN01078364
2-NITRO-PENTANE
CAS:4609-91-0
Formula: C8H17NO2
KIN01111345
2-NITRO-PENTANEDIOIC ACID
CAS:59665-39-3
Formula: C5H7NO6
KIN02435092
2-NITRO-PENTANEDIOIC ACID 5-ETHYL 1-METHYL ESTER
CAS:88238-93-1
Formula: C8H13NO6
KIN02695243
2-NITRO-PROP-1-ENE
CAS:4749-29-5
KIN01113933
2-NITRO-PROP-2-EN-1-OL
CAS:104313-48-6
Formula: C3H5NO3
KIN03060364
2-NITRO-PROPAN-1,3-DIOL
CAS:1794-92-9
KIN01055992
2-NITRO-PROPANAMIDE
CAS:55552-15-3
Formula: C3H6N2O3
KIN02368336
2-NITRO-PROPANAMIDE ION(I) SODIUM
CAS:55552-14-2
Formula: C3H5N2O3.Na
KIN02368335
2-NITRO-PROPANE
CAS:79-47-0
Formula: C3ClF5
KIN01001530
2-NITRO-PROPANE ION(I) LITHIUM
CAS:3958-76-7
Formula: C6H3NO4
KIN01098561
2-NITRO-PROPANE ION(I) POTASSIUM
CAS:28273-55-4
Formula: C3H6NO2.K
KIN02164682
2-NITRO-PROPANEDIAL
CAS:34460-99-6
KIN02214182
2-NITRO-PROPANENITRILE
CAS:62619-41-4
Formula: C3H4N2O2
KIN02477428
2-NITRO-PROPANOIC ACID
CAS:113747-80-1
Formula: C3H5NO4
KIN03125732
2-NITRO-PROPANOIC ACID PHENYL ESTER
CAS:53607-41-3
Formula: C9H9NO4
KIN02337766
2-NITRO-PROPANOL
CAS:2902-98-9
Formula: C14H10Cl2O
KIN01078458
2-NITRO-PROPIONAMIDINE HCL
CAS:1172932-42-1
KIN05264294
2-NITRO-SELENOPHENE
CAS:15429-04-6
Formula: C4H3NO2Se
KIN02041365
2-NITRO-SO-2-PROPANOL, ACETATE ESTER
CAS:6931-05-1
Formula: C5H9NO2
KIN01172843
2-NITRO-SO-PROPANE
CAS:920-46-7
Formula: CH2=C(CH3)COCL
KIN01033591
2-NITRO-SOBENZOIC ACID
CAS:612-28-2
Formula: C7H8N2O2
KIN01022341
2-NITRO-SOFLUORENE
CAS:2508-21-6
KIN01070940
2-NITRO-SONAPHTHALENE
CAS:6610-10-2
Formula: C12H11NO2
KIN01165988
2-NITRO-STRYCHNIDIN-10-ONE
CAS:29854-52-2
Formula: C21H21N3O4
KIN02177176
MFCD00023108
2-NITRO-STRYCHNIDINE-10-ONE
CAS:475157-81-4
Formula: C21H21N3O4
KIN03602213
2-NITRO-TEREPHTHALIC ACID 4-TERT-BUTYL ESTER
CAS:362469-92-9
KIN03537669
2-NITRO-TETRACYCLO[2.2.0.02,6.03,5]HEXANAMINE
CAS:132541-75-4
Formula: C6H6N2O2
KIN03219312
2-NITRO-THIANTHRENE
CAS:89880-56-8
Formula: C12H7NO2S2
KIN02718665
2-NITRO-THIAZOLE
CAS:1606-77-5
Formula: C2HN3O2S
KIN01051303
2-NITRO-THIENO[2,3-A]QUINOLIZIN-6-IUM
CAS:176691-94-4
Formula: C11H7N2O2S
KIN03361178
2-NITRO-THIENO[2,3-B]PYRIDIN-3-OL
CAS:152525-00-3
Formula: C7H4N2O3S
KIN03302414
2-NITRO-THIENO[2,3-B]PYRIDIN-3-YLAMINE
CAS:52505-49-4
Formula: C7H5N3O2S
KIN02322027
2-NITRO-THIENO[2,3-B]PYRIDIN-4-OL
CAS:104514-91-2
Formula: C7H4N2O3S
KIN03061771
2-NITRO-THIENO[3,2-A]QUINOLIZIN-6-IUM
CAS:176691-88-6
Formula: C11H7N2O2S
KIN03361175
2-NITRO-THIENO[3,2-C]ISOQUINOLINE 4-OXIDE
CAS:130081-58-2
Formula: C11H6N2O3S
KIN03208508
2-NITRO-THIENO[3,2-C]QUINOLINE 5-OXIDE
CAS:130081-54-8
Formula: C11H6N2O3S
KIN03208506
2-NITRO-THIOBENZOIC ACID S-(4-METHYLPHENYL) ESTER
CAS:52909-88-3
KIN02327545
2-NITRO-THIOCHROMENO[4,3-B]INDOL-11-IUM PERCHLORATE
CAS:4267-62-3
KIN01104123
2-NITRO-THIOPHEN-3-OL
CAS:128496-62-8
KIN03201946
2-NITRO-THIOPHENE
CAS:609-41-6
Formula: C6H7NO
KIN01022152
2-NITRO-TOLUENE
CAS:88-73-3
Formula: C6H4ClNO2
KIN01002286
2-NITRO-TOLUENE-4-SULFONIC ACID (2,4-DINITRO-ANILIDE)
CAS:36965-50-1
Formula: C13H10N4O8S
KIN02235808
2-NITRO-TOLUENE-4-SULFONIC ACID (4-METHOXY-2-NITRO-ANILIDE)
CAS:349099-71-4
Formula: C14H13N3O7S
KIN03525330
2-NITRO-TOLUENE-4-SULFONIC ACID (4-NITROPHENYL ESTER)
CAS:16634-83-6
Formula: C13H10N2O7S
KIN02053382
2-NITRO-TOLUENE-4-SULFONIC ACID P-PHENETIDIDE
CAS:349099-73-6
Formula: C15H16N2O5S
KIN03525331
2-NITRO-TRICYCLO[3.3.1.13,7]DECAN-2-CARBONITRILE
CAS:128478-71-7
Formula: C11H14N2O2
KIN03201887
2-NITRO-TRICYCLO[3.3.1.13,7]DECANE
CAS:54564-31-7
Formula: C10H15NO2
KIN02351975
2-NITRO-TRIPHENYLENE
CAS:81316-79-2
Formula: C18H11NO2
KIN02649134
2-NITRO-TYROSINE
CAS:7220-54-4
Formula: C10H12N2O5
KIN01181480
2-NITRO-TYROSINE HBR
CAS:10167-62-1
KIN02002625
2-NITROACETALDEHYDE O-1,1-DINITRO-ETHYL OXIME
CAS:10565-52-3
Formula: C4H6N4O7
KIN02008208
2-NITROACETALDEHYDE OXIME
CAS:5653-22-5
KIN01137930
2-NITROACETOHYDRAZIDE
CAS:99709-16-7
KIN02822001
2-NITROACETOXY-PROPANE
CAS:3750-83-2
Formula: C8H15NO4
KIN01095234
2-NITROAMINOETHYL NITRATE
CAS:41719-24-8
Formula: C2H5N3O5
KIN02273008
2-NITROAMINOPYRIDINE POTASSIUM SALT
CAS:62209-52-3
Formula: C5H6KN3O2
KIN02470081
2-NITROAZOBENZENE
CAS:29530-39-0
Formula: C12H9N3O2
KIN02174718
2-NITROBICYCLO[2.2.2]OCTANE
CAS:62984-48-9
KIN02484073
2-NITROBUTYL 3-(AZIRIDIN-1-YL)-PROPANOATE
CAS:99901-03-8
Formula: C9H16N2O4
KIN02823465
2-NITROBUTYL ACETATE
CAS:2123-85-5
Formula: C9H7NO4
KIN01063127
2-NITROBUTYL BROMO-ACETATE
CAS:32815-96-6
Formula: C6H10BrNO4
KIN02200194
2-NITROCYCLODODECANONE
CAS:13154-31-9
Formula: C12H21NO3
KIN02015664
MFCD00015363
2-NITROCYCLOHEX-1-ENOL
CAS:25176-13-0
Formula: C6H9NO3
KIN02137068
2-NITROCYCLOHEX-2-EN-1-OL
CAS:51254-77-4
Formula: C6H9NO3
KIN02303916
2-NITRODIBENZO-4-DIOXINE
CAS:38178-41-5
Formula: C12H7NO4
KIN02245866
2-NITRODIBENZO-P-DIOXIN-1-YLAMINE
CAS:94514-59-7
Formula: C12H8N2O4
KIN02782647
2-NITRODIBENZO[B,D]FURAN
CAS:20927-95-1
Formula: C12H7NO3
KIN02095519
MFCD00184181
2-NITROETHANOL
CAS:625-49-0
KIN01023275
2-NITROETHEN-1,1-DIAMINE
CAS:71090-35-2
Formula: C2H5N3O2
KIN02581827
MFCD09753476
2-NITROETHENE-1,1-DITHIOL
CAS:1092923-85-7
KIN05134870
2-NITROFURO[3,2-E][1]BENZOFURAN
CAS:69267-54-5
Formula: C10H5NO4
KIN02569178
2-NITROFURO[3,2-G][1]BENZOFURAN
CAS:69267-49-8
Formula: C10H5NO4
KIN02569175
2-NITROHEXAN-3-OL
CAS:5448-01-1
Formula: C27H19NO
KIN01131846
2-NITROISOINDOL-1,3-DIONE
CAS:5336-98-1
Formula: C15H12N2O5
KIN01126503
2-NITRONORBORNANE
CAS:35520-82-2
Formula: C7H11NO2
KIN02223895
2-NITROPENT-1-ENE
CAS:2783-14-4
Formula: C8H15NO2
KIN01076044
2-NITROPENT-2-ENE
CAS:27748-50-1
Formula: C5H9NO2
KIN02160015
2-NITROPENTAN-3-OL
CAS:20575-40-0
Formula: C5H11NO3
KIN02092112
2-NITROPHENANTHRENE
CAS:17024-18-9
Formula: C14H9NO2
KIN02057339
2-NITROPHENANTHRIDINE
CAS:137531-20-5
Formula: C13H8N2O2
KIN03242046
2-NITROPHENANTHRO[1,2-B]FURAN
CAS:125372-47-6
Formula: C16H9NO3
KIN03188354
2-NITROPHENAZINE
CAS:3442-69-1
Formula: C6H12O6
KIN01089323
2-NITROPHENAZINE 5-OXIDE
CAS:73742-12-8
Formula: C12H7N3O3
KIN02600357
2-NITROPHENAZINE, 10-OXIDE
CAS:2876-34-8
Formula: C12H7N3O3
KIN01077847
2-NITROPHENOL
CAS:88-76-6
Formula: C10H9ClN2O4S
KIN01002289
2-NITROPHENOL BARIUM SALT
CAS:7050-18-2
Formula: C6H12O4.xFe.Na
KIN01177329
2-NITROPHENOL COMPD. WITH BENZENEMETHANAMINE
CAS:109568-94-7
KIN03096159
2-NITROPHENOL COMPD. WITH N-CYCLOHEXYLCYCLOHEXANAMINE
CAS:125316-98-5
Formula: C12H23N.C6H5NO3
KIN03188087
2-NITROPHENOL COMPD. WITH N-METHYLCYCLOHEXANAMINE
CAS:134509-49-2
Formula: C13H20N2O3
KIN03020298
2-NITROPHENOL, POTASSIUM SALT
CAS:824-39-5
Formula: C6H4NNaO3
KIN01030751
2-NITROPHENOL-4-YLSULFOMETHYLAMIDE
CAS:96-59-3
Formula: C9H11ClN2O4S
KIN01003000
2-NITROPHENOTHIAZIN-10-CARBONYL CHLORIDE
CAS:92960-99-1
KIN02763575
2-NITROPHENOXATHIIN-10,10-DIOXIDE
CAS:105583-03-7
Formula: C12H7NO5S
KIN03069313
2-NITROPHENOXYACETYL CHLORIDE
CAS:20142-87-4
Formula: C8H6ClNO4
KIN02088522
MFCD00059822
2-NITROPHENOXYN-PHENYL-ACETAMIDE
CAS:20916-31-8
Formula: C14H12N2O4
KIN02095319
2-NITROPHENYL (S)-2-(N-BOC-AMINO)-3-METHYLBUTYRATE
CAS:41120-72-3
Formula: C16H22N2O6
KIN02268747
N-BOC-L-Valine 2-nitro-phenyl ester
MFCD09840108
2-NITROPHENYL 1,2,3,4,4-PENTACHLORO-1,3-BUTADIENYL DISULFIDE
CAS:117760-95-9
Formula: C10H4Cl5NO2S2
KIN03150592
2-NITROPHENYL 2,2',3,3',4'-PENTA-O-ACETYL-BETA-D-XYLOBIOSIDE
CAS:162088-92-8
Formula: C26H31NO16
KIN03330641
2-NITROPHENYL 2,3-DI-O-BENZOYLBETA-D-XYLOPYRANOSIDE
CAS:173468-08-1
Formula: C25H21NO9
KIN03353743
2-NITROPHENYL 2-(ACETAMIDO)-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE
CAS:23646-67-5
Formula: C14H18N2O8
KIN02122220
MFCD00069784
2-NITROPHENYL 2-(ACETAMIDO)-2-DEOXY-ALPHA-D-GLUCOPYRANOSIDE
CAS:10139-01-2
Formula: C14H18N2O8
KIN02002284
MFCD00006587
2-NITROPHENYL 2-(ACETAMIDO)-2-DEOXY-BETA-D-GALACTOPYRANOSIDE
CAS:152957-34-1
Formula: C14H18N2O8
KIN03303695
2-NITROPHENYL 2-(ACETAMIDO)-2-DEOXY-BETA-D-GLUCOPYRANOSIDE
CAS:13264-92-1
Formula: C14H18N2O8
KIN02017176
2-Nitro-phenyl N-acetyl-beta-D-glucosaminide; 2-Ni
MFCD00067648
2-NITROPHENYL 2-(ACETAMIDO)-2-DEOXY-BETA-D-GLUCOPYRANOSIDE 3,4,6-TRIACETATE
CAS:13089-26-4
Formula: C20H24N2O11
KIN02014576
MFCD08703870
2-NITROPHENYL 4-NITROPHENYL DISULFIDE
CAS:408351-60-0
Formula: C12H8N2O4S2
KIN03000783
2-NITROPHENYL 4-NITROPHENYL-ACETATE
CAS:104245-81-0
Formula: C14H10N2O6
KIN03059881
2-NITROPHENYL 5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANOATE
CAS:131303-71-4
Formula: [C16H19N3O5S
KIN03213759
2-NITROPHENYL ACETATE
CAS:610-70-8
KIN01022230
2-NITROPHENYL BENZOATE
CAS:1523-13-3
Formula: C13H9NO4
KIN01049258
2-NITROPHENYL BETA-D-GALACTOPYRANOSIDE-6-PHOSPHATE CYCLOHEXYLAMMONIUM SALT
CAS:25405-62-3
Formula: C18H30N2O11P
KIN02139429
MFCD01863229
2-NITROPHENYL BETA-D-GLUCOPYRANOSIDE
CAS:96844-02-9
KIN02803204
2-NITROPHENYL BETA-D-MANNOPYRANOSIDE
CAS:81132-76-5
KIN02648192
beta-D-Mannopyranoside, 2-nitrophenyl
2-NITROPHENYL BUTYRATE
CAS:2487-33-4
KIN01070448
2-NITROPHENYL D-GALACTOPYRANOSIDE,
CAS:118396-84-2
Formula: C12H15NO8
KIN03153967
2-NITROPHENYL DIMETHYLCARBAMATE
CAS:3373-93-1
KIN01087878
2-NITROPHENYL DIMETHYLSULFAMATE
CAS:1141-16-8
KIN01041332
2-NITROPHENYL DIPHENYLPHOSPHINATE
CAS:112968-84-0
Formula: C18H14NO4P
KIN03119550
2-NITROPHENYL DISULFIDE ANION
CAS:118209-13-5
Formula: C6H4NO2S2-
KIN03153193
2-NITROPHENYL DODECANOATE
CAS:2639-53-4
Formula: C19H30O
KIN01073503
2-NITROPHENYL ISOTHIOCYANATE
CAS:2719-32-6
Formula: C8H4N2S
KIN01074862
2-NITROPHENYL MYRISTATE
CAS:59986-46-8
Formula: C20H31NO4
KIN02440484
MFCD00057583
2-NITROPHENYL N-METHYLCARBAMATE
CAS:7374-15-4
Formula: C2H4OT2
KIN01185365
2-NITROPHENYL NONAFLATE
CAS:342589-38-2
Formula: C10H4F9NO5S
KIN03516208
2-NITROPHENYL OCTYL ETHER_X000D_
CAS:37682-29-4
Formula: C14H21NO3
KIN02241690
MFCD00014693
2-NITROPHENYL PENTYL ETHER
CAS:39645-91-5
Formula: C11H15NO3
KIN02256475
MFCD00142954
2-NITROPHENYL PHENYL DISULFIDE
CAS:28215-02-3
Formula: C12H9NO2S2
KIN02164149
2-NITROPHENYL PHENYL TRISULFIDE
CAS:31819-14-4
KIN02192309
2-NITROPHENYL PHOSPHATE
CAS:6064-85-3
Formula: C8H9NO
KIN01148818
2-NITROPHENYL SELENOCYANATE
CAS:72473-22-4
KIN02591620
2-NITROPHENYL-(HGCL)
CAS:28969-29-1
Formula: C6H4ClHgNO2
KIN02170254
2-NITROPHENYL-ACETIC ACID
CAS:20095-98-8
Formula: C9H9NO4
KIN02088148
2-NITROPHENYL-ACETIC ACID 2,2-DIPHENYLHYDRAZIDE
CAS:1180956-66-4
Formula: C20H17N3O3
KIN05290391
2-NITROPHENYL-ACETIC ACID 2-(2-ACETYLPHENOXY)ETHYL ESTER
CAS:1008322-04-0
KIN05015564
2-NITROPHENYL-ACETIC ACID 2-(4-ETHOXY-BENZOYL)HYDRAZIDE
CAS:1002930-58-6
Formula: C17H17N3O5
KIN05007623
2-NITROPHENYL-ACETIC ACID 2-(4-ETHYLBENZOYL)HYDRAZIDE
CAS:1002018-18-9
Formula: C17H17N3O4
KIN05006599
2-NITROPHENYL-ACETIC ACID 2-(4-FLUOROBENZOYL)HYDRAZIDE
CAS:1182570-66-6
Formula: C15H12FN3O4
KIN05296597
2-NITROPHENYL-ACETIC ACID 2-(4-METHYLBENZOYL)HYDRAZIDE
CAS:1037963-75-9
Formula: C16H15N3O4
KIN05074443
2-NITROPHENYL-ACETIC ACID 2-(4-NITRO-BENZOYL)HYDRAZIDE
CAS:349410-21-5
Formula: C15H12N4O6
KIN03644146
2-NITROPHENYL-ACETIC ACID 2-(BENZYLENE)HYDRAZIDE
CAS:1025208-92-7
Formula: C15H13N3O3
KIN05058903
2-NITROPHENYL-ACETIC ACID 2-(FURAN-2-YLMETHYLENE)HYDRAZIDE
CAS:1024717-75-6
Formula: C13H11N3O4
KIN05058711
2-NITROPHENYL-ACETIC ACID 2-(FURAN-3-YLMETHYLENE)HYDRAZIDE
CAS:1025610-73-4
Formula: C13H11N3O4
KIN05059133
2-NITROPHENYL-ACETIC ACID 2-BROMOETHYL ESTER
CAS:1048920-29-1
Formula: C10H10BrNO4
KIN05096949
2-NITROPHENYL-ACETIC ACID TRIMETHYLSILYL ESTER
CAS:62673-17-0
Formula: C11H15NO4Si
KIN02478366
2-NITROPHENYL-ALANINE
CAS:35378-63-3
Formula: C9H10N2O4
KIN02222592
2-nitrophenyl-DL-alanine
MFCD00508172
2-NITROPHENYL-ALANINE ETHYL ESTER
CAS:166887-89-4
Formula: C11H14N2O4
KIN03339493
2-NITROPHENYL-ALANINE HCL
CAS:92658-92-9
KIN02759793
2-NITROPHENYL-ALANINE METHYL ESTER
CAS:85080-50-8
Formula: C10H12N2O4
KIN02671766
2-NITROPHENYL-BETA-D-THIOFUCOPYRANOSIDE
CAS:24404-59-9
KIN02130214
MFCD00006614
2-NITROPHENYL4-O-BETA-D-XYLOPYRANOSYL-BETA-D-XYLOPYRANOSIDE
CAS:157956-98-4
Formula: C16H21NO11
KIN03319398
2-NITROPHENYLARSONIC ACID
CAS:5410-30-0
Formula: C6H8AsCl3N2O
KIN01129151
2-NITROPHENYLAZO-N2-NITRO-FORMAMIDINE
CAS:135609-52-8
Formula: C7H6N6O4
KIN03233579
2-NITROPHENYLBORONIC ACID
CAS:1079877-12-5
KIN05116717
2-NITROPHENYLSULFENYL CHLORIDE
CAS:7669-57-0
KIN01193092
2-NITROPHENYLSULFONOPEROXOIC ACID
CAS:5279-08-3
Formula: C13H11NO5S
KIN01124483
2-NITROPHENYLSULFONOTHIOIC ACID S-(2-NITROPHENYL) ESTER
CAS:7669-64-9
Formula: C22H24N2O5
KIN01193093
2-NITROPHENYLTHIO
CAS:114990-33-9
Formula: C6H4NO2S
KIN03134608
2-NITROPHENYLTHIO-NITRO-L-ARGININE DICYCLOHEXYLAMINE SALT
CAS:33385-74-9
Formula: C12H16N6O6SC12H23N
KIN02205189
2-NITROPHTHALAZINO[2,3-B]PHTHALAZIN-5,12(7H,14H)-DIONE
CAS:37149-78-3
KIN02237601
2-NITROPROPANE, SODIUM, SALT
CAS:24163-39-1
Formula: C3H6NNaO2
KIN02127569
2-NITROPYRENE
CAS:789-12-8
KIN01029831
2-NITROPYRIDIN-3-CARBALDEHYDE
CAS:5175-36-0
Formula: C6H10O2
KIN01122208
2-NITROPYRIDIN-3-CARBOXYLIC ACID
CAS:33225-72-8
Formula: C6H4N2O4
KIN02203636
MFCD04114130
2-NITROPYRIDIN-3-CARBOXYLIC ACID METHYL ESTER
CAS:54973-79-4
Formula: C7H6N2O4
KIN02358591
2-NITROPYRIDIN-3-YLAMINE
CAS:13269-19-7
Formula: C5H5N3O2
KIN02017220
MFCD00044102
2-NITROPYRIDIN-4-CARBOXYLIC ACID
CAS:332255-74-0
Formula: C6H4N2O4
KIN03505741
2-NITROPYRIDIN-4-CARBOXYLIC ACID HYDRAZIDE
CAS:58481-05-3
Formula: C6H6N4O3
KIN02416286
2-NITROPYRIDIN-4-CARBOXYLIC ACID METHYL ESTER
CAS:26218-82-6
Formula: C7H6N2O4
KIN02146493
2-NITROPYRIDIN-4-CARBOXYLIC ACID SODIUM SALT
CAS:65370-41-4
Formula: C6H4N2O4.Na
KIN02525669
2-NITROPYRIDIN-4-YLAMINE
CAS:14916-64-4
Formula: C5H5N3O2
KIN02036712
MFCD04114153
2-NITROPYRIDINE
CAS:15009-91-3
Formula: C5H4N2O2
KIN02037543
MFCD00160414
2-NITROPYRIDINE 1-OXIDE
CAS:2403-22-7
Formula: C6H5CH2NH(CH2)3CH3
KIN01068740
2-NITROPYRIDINE, HYDRATE
CAS:354527-54-1
Formula: C5H6N2O3
KIN03531596
2-NITROPYRIDINE-4-YLAMINE HCL
CAS:1187929-34-5
KIN05324090
2-NITROPYRIMIDIN-5-YLAMINE
CAS:123770-64-9
Formula: C4H4N4O2
KIN03181067
2-NITROPYRIMIDINE
CAS:55133-62-5
Formula: C4H3N3O2
KIN02361242
Nitropyrimidine
2-NITROQUINOLIN-8-OL
CAS:142363-54-0
Formula: C9H6N2O3
KIN03264809
2-NITROQUINOXALINE
CAS:117764-57-5
Formula: [C8H5N3O2
KIN03150600
2-NITRORESORCINOL LEAD SALT BASIC
CAS:68411-33-6
KIN02563067
2-NITROSO-1,3,5-BENZENETRIOL
CAS:202754-64-1
KIN03410985
2-NITROSO-1,4-BENZENEDICARBONYL DICHLORIDE
CAS:111084-13-0
KIN03105587
2-NITROSO-1-PHENYL-1,3-BUTANEDIONE
CAS:62025-72-3
Formula: C10H9NO3
KIN02466418
2-NITROSO-1-PHENYL-1-PROPANONE
CAS:32102-68-4
Formula: C9H9NO2
KIN02194432
2-NITROSO-1-PHENYLETHANONE
CAS:48116-07-0
Formula: C8H7NO2
KIN02288207
2-NITROSO-1-PHENYLPROPANE
CAS:55941-34-9
Formula: C9H11NO
KIN02374708
2-NITROSO-1H-IMIDAZOLE
CAS:119499-19-3
KIN03159311
2-NITROSO-1H-INDEN-1,3(2H)-DIONE
CAS:20854-76-6
Formula: C9H5NO3
KIN02094562
2-NITROSO-1H-INDOLE
CAS:139392-53-3
Formula: C8H6N2O
KIN03252459
2-NITROSO-1H-PYRROLE
CAS:71580-22-8
Formula: C4H4N2O
KIN02585309
2-NITROSO-1H-PYRROLO[2,3-D]PYRIMIDINE
CAS:139392-71-5
Formula: [C6H4N4O]
KIN03252464
2-NITROSO-2,5-DIAZAHEXAN
CAS:29104-67-4
Formula: C4H11N3O
KIN02171462
2-NITROSO-2-(1H-PYRIDIN-4-YLIDENE)-ACETONITRILE
CAS:4185-98-2
Formula: C6H6Cl2N2O
KIN01102596
2-NITROSO-2-(BENZYL)HYDRAZINECARBOXIMIDAMIDE
CAS:1760-35-6
Formula: C4H12N10O2
KIN01055202
2-NITROSO-2-(PHENYLMETHYL)-HYDRAZINECARBOXAMIDE
CAS:106095-42-5
Formula: C8H10N4O2
KIN03073837
2-NITROSO-2-(QUINOLIN-2(1H)-YLIDENE)-ACETONITRILE
CAS:146561-42-4
Formula: C11H7N3O
KIN03021118
2-NITROSO-2-[4-NITROPHENYLPROPAN
CAS:3276-37-7
Formula: C9H12N2O2
KIN01085818
2-NITROSO-2-AZABICYCLO[2.2.2]OCTAN-3-ONE
CAS:82897-02-7
Formula: C7H10N2O2
KIN02658215
2-NITROSO-2-AZABICYCLO[2.2.2]OCTANE
CAS:21744-12-7
Formula: C7H12N2O
KIN02103870
2-NITROSO-2-AZABICYCLO[4.2.1]NON-4-EN-3-ONE
CAS:50550-67-9
Formula: C8H10N2O2
KIN02294333
2-NITROSO-2-BUTANOL NITRATE (ESTER)
CAS:89769-12-0
Formula: C4H8N2O4
KIN02716641
2-NITROSO-2-HEXANOL NITRATE (ESTER)
CAS:89769-13-1
Formula: C6H12N2O4
KIN02716642
2-NITROSO-2-PHENYLCYCLOHEXANONE
CAS:100192-19-6
KIN03029531
2-NITROSO-2-PROPANOL 4-NITRO-BENZOATE (ESTER)
CAS:99072-47-6
Formula: C10H10N2O5
KIN02817903
2-NITROSO-2-PROPANOL ACETATE DIMER
CAS:68777-98-0
KIN02565656
2-NITROSO-3,5-DIPHENYL-1H-PYRROLE
CAS:154675-02-2
Formula: C16H12N2O
KIN03309634
2-NITROSO-3-HYDROXY-PHENOL
CAS:66266-79-3
Formula: C6H5NO3
KIN02539551
2-NITROSO-3-PYRIDINAMINE
CAS:208984-21-8
Formula: C5H5N3O
KIN03419378
2-NITROSO-3-PYRIDINETHIOL
CAS:208984-19-4
Formula: C5H4N2OS
KIN03419376
2-NITROSO-3-PYRIDINOL
CAS:208984-17-2
Formula: C5H4N2O2
KIN03419374
2-NITROSO-4,6-DIPHENYL-PYRIMIDINE
CAS:111862-38-5
Formula: C16H11N3O
KIN03110641
2-NITROSO-4-(BENZYL)PHENOL
CAS:177725-31-4
Formula: C13H11NO2
KIN03362942
2-NITROSO-4-HYDROXY-PHENOL
CAS:215431-75-7
KIN03427918
2-NITROSO-4-ISOTHIAZOLIDINECARBOXYLIC ACID
CAS:94751-62-9
Formula: C4H6N2O3S
KIN02784825
2-NITROSO-4-PHENYL-NAPHTHALEN-1-OL
CAS:6624-23-3
Formula: C16H12O2
KIN01166436
2-NITROSO-4-PHENYL-PYRIMIDINE
CAS:111862-39-6
Formula: C10H7N3O
KIN03110642
2-NITROSO-4-PROPOXY-PHENOL
CAS:90610-34-7
Formula: C9H11NO3
KIN02730725
2-NITROSO-5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANOIC ACID
CAS:56859-26-8
Formula: C10H15N3O4S
KIN02389704
Nitrosobiotin
2-NITROSO-5-(PYRROLIDIN-1-YL)PHENOL
CAS:25912-11-2
KIN02143915
2-NITROSO-5-PHENYL-3(2H)-THIOPHENONE 2-PHENYLHYDRAZONE
CAS:72177-16-3
Formula: C16H13N3OS
KIN02589612
2-NITROSO-5-PHENYL-PYRIMIDINE
CAS:126382-53-4
Formula: C10H7N3O
KIN03192782
2-NITROSO-5-PHENYLTHIOPHEN-3-OL
CAS:72177-15-2
Formula: C10H7NO2S
KIN02589611
2-NITROSO-5-PIPERIDIN-1-YLPHENOL
CAS:27292-59-7
KIN02155971
2-NITROSO-5-PROPOXY-PHENOL
CAS:67574-97-4
Formula: C9H11NO3
KIN02555272
2-NITROSO-6-(BENZYL)PHENOL
CAS:202754-59-4
Formula: C13H11NO2
KIN03410980
2-NITROSO-6-(TRIFLUOROMETHYL)-BENZALDEHYDE
CAS:141784-09-0
KIN03261958
2-NITROSO-ACRYLIC ACID ETHYL ESTER
CAS:87497-88-9
Formula: C5H7NO3
KIN02687238
2-NITROSO-ADENOSINE
CAS:383364-90-7
KIN03551832
2-NITROSO-ALPHA-OXO-BENZENEACETAMIDE
CAS:148084-49-5
KIN03288298
2-NITROSO-ANILINE
CAS:104262-59-1
Formula: C6H6N2O
KIN03059980
2-NITROSO-ANISOLE
CAS:17075-26-2
Formula: C7H7NO2
KIN02057880
2-NITROSO-BENZAMIDE
CAS:89795-55-1
Formula: C7H6N2O2
KIN02717211
2-NITROSO-BENZENEACETIC ACID
CAS:144366-40-5
Formula: C8H7NO3
KIN03275286
2-NITROSO-BENZENEACETIC ACID METHYL ESTER
CAS:207797-59-9
Formula: C9H9NO3
KIN03417873
2-NITROSO-BENZENEMETHANIMINE
CAS:1035950-70-9
Formula: C7H6N2O
KIN05069760
2-NITROSO-BENZENEMETHANOL
CAS:173548-01-1
Formula: C7H7NO2
KIN03353875
2-NITROSO-BENZENEPROPANOIC ACID
CAS:1094772-18-5
Formula: C9H9NO3
KIN05145288
2-NITROSO-BENZENESULFONAMIDE
CAS:90109-76-5
Formula: C6H6N2O3S
KIN02722528
2-NITROSO-BENZOIC ACID 2-HYDROXYETHYL ESTER
CAS:99358-11-9
Formula: C9H9NO4
KIN02819747
o-Nitroso-benzoic acid 2-hydroxyethyl ester
2-NITROSO-BENZOIC ACID ANILIDE
CAS:27126-08-5
Formula: C13H10N2O2
KIN02154333
2-NITROSO-BENZOIC ACID METHYL ESTER
CAS:61161-26-0
Formula: C8H7NO3
KIN02451850
2-NITROSO-BENZONITRILE
CAS:38469-86-2
KIN02248266
2-NITROSO-BENZOYL CHLORIDE
CAS:143621-65-2
Formula: [C7H4ClNO2-
KIN03271364
2-NITROSO-BIPHENYL
CAS:21711-71-7
Formula: C12H9NO
KIN02103467
2-NITROSO-BUTANE ION(I) SODIUM
CAS:75392-07-3
Formula: C4H8NO.Na
KIN02612321
2-NITROSO-CYCLOHEXANOL
CAS:45660-24-0
KIN02284288
2-NITROSO-CYCLOHEXANOL 1-NITRATE
CAS:46047-57-8
KIN02284809
2-NITROSO-CYCLOHEXANOL DIMER
CAS:14523-75-2
KIN02032865
2-NITROSO-CYCLOHEXANOL FORMATE ESTER
CAS:412273-65-5
Formula: C7H11NO3
KIN03570288
2-NITROSO-CYCLOHEXANOL NITRATE (ESTER)- DIMER
CAS:6993-66-4
Formula: C20H32
KIN01176012
2-NITROSO-ETHANOL DIHYDROGEN PHOSPHATE (ESTER)
CAS:190584-50-0
Formula: C2H6NO5P
KIN03391255
2-NITROSO-ETHENONE
CAS:134736-48-4
Formula: C2HNO2
KIN03229542
2-NITROSO-ETHYLIUM
CAS:116342-28-0
Formula: C2H4NO
KIN03142684
2-NITROSO-HEXANEDIOIC ACID 1,6-DIETHYL ESTER
CAS:1195297-86-9
Formula: C10H17NO5
KIN05336802
2-NITROSO-MALONIC ACID 1,3-DIETHYL ESTER
CAS:344755-46-0
KIN03520756
2-NITROSO-N,N-DIPHENYL-ANILINE
CAS:30772-85-1
Formula: C18H14N2O
KIN02184749
2-NITROSO-N-PHENYL-ANILINE
CAS:53013-42-6
Formula: C12H10N2O
KIN02329000
2-NITROSO-N-PYRIDIN-2-YL-GLYCINE
CAS:100868-31-3
Formula: C7H7N3O3
KIN03035238
2-NITROSO-NAPHTHALEN-1-OL
CAS:132-54-7
Formula: C17H12O3
KIN01005724
2-NITROSO-NAPHTHALEN-1-OL LITHIUM SALT (2:1)
CAS:62450-85-5
Formula: C10H7NO2.1/2Li
KIN02474275
2-NITROSO-NAPHTHALEN-1-OL POTASSIUM SALT (2:1)
CAS:62450-86-6
Formula: C10H7NO2.1/2K
KIN02474276
2-NITROSO-NAPHTHALEN-1-OL RUBIDIUM SALT (2:1)
CAS:62344-42-7
Formula: C10H7NO2.1/2Rb
KIN02472433
2-NITROSO-NAPHTHALEN-1-OL SODIUM SALT
CAS:3011-61-8
Formula: C25H44O
KIN01080865
2-NITROSO-NAPHTHALEN-1-OL SODIUM SALT (2:1)
CAS:62344-41-6
Formula: C10H7NO2.1/2Na
KIN02472432
2-NITROSO-OCTANEDIOIC ACID 1,8-DIMETHYL ESTER
CAS:1195167-19-1
Formula: C10H17NO5
KIN05336352
2-NITROSO-OXAZOLO[5,4-D]PYRIMIDINE
CAS:139392-55-5
Formula: [C5H2N4O2]
KIN03252461
2-NITROSO-PHENANTHRENE
CAS:38241-20-2
Formula: C14H9NO
KIN02246435
2-NITROSO-PHENOL 1-( TOSYLATE)
CAS:1194786-56-5
Formula: C13H11NO4S
KIN05335979
2-NITROSO-PYRIMIDINE
CAS:79917-39-8
Formula: C4H3N3O
KIN02640667
2-NITROSO-PYRROLIDINE
CAS:92070-36-5
Formula: C4H8N2O
KIN02752481
2-NITROSO-QUINOLINE
CAS:1167539-78-7
Formula: C9H6N2O
KIN05260395
2-NITROSO-TRICYCLO[3.3.1.13,7]DECAN-2-CARBONITRILE
CAS:60038-41-7
Formula: C11H14N2O
KIN02441032
2-NITROSOBUTAN-2-OL, ACETATE
CAS:13880-90-5
Formula: C6H12NO4
KIN02025411
2-NITROSOOCTAHYDRO-2H-PYRIDO[1,2-A]PYRAZINE
CAS:67092-59-5
Formula: C8H15N3O
KIN02548505
2-NITROSPIRO[CYCLOPROPAN-1,9'-FLUORENE]
CAS:34348-57-7
KIN02213343
2-NITROTETRAHYDROFURAN
CAS:1198185-04-4
Formula: C4H7NO3
KIN05342120
2-NO2C6H4CH2N(H)-SO2CF3
CAS:36457-53-1
Formula: C8H7F3N2O4S
KIN02232026
2-NON-8-ENYLOXYTETRAHYDROPYRAN
CAS:13175-42-3
Formula: C14H26O2
KIN02015983
2-NON-8-YNYLCYCLOPROPENE-1-CARBOXYLIC ACID
CAS:18325-59-2
Formula: C13H18O2
KIN02070920
2-NONACOSYL-3-TRIDECEN-1,10-DIOL
CAS:108793-61-9
Formula: C42H84O2
KIN03091303
2-NONADEC-18-ENYL-3-OCTYLOXIRANE
CAS:123219-93-2
Formula: C29H56O
KIN03178581
2-NONADECYL-[1,3]DIOXOLANE-2-TETRADECANOL
CAS:61745-94-6
Formula: C36H72O3
KIN02461076
2-NONADECYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:89423-13-2
Formula: C27H43NO2
KIN02711580
2-NONADECYL-4,5-DIHYDRO-OXAZOLE
CAS:115723-19-8
Formula: C22H43NO
KIN03138708
2-NONANOL, 2-( TOSYLATE)
CAS:122533-18-0
KIN03175439
2-NONANOL, HYDROGEN SULFATE
CAS:103142-09-2
Formula: C9H20O4S
KIN03052022
2-NONANOL, NITRATE
CAS:54894-21-2
Formula: C9H19NO3
KIN02357183
2-NONANOL, PHOSPHATE (3:1)
CAS:104660-38-0
Formula: C27H57O4P
KIN03062822
2-NONANONE O-METHYLOXIME
CAS:56292-72-9
KIN02380416
2-NONANONE, (4-NITROPHENYL)HYDRAZONE
CAS:2675-17-4
Formula: C16H24N4O4
KIN01074125
2-NONANONE, (TERT-BUTYL)HYDRAZONE
CAS:88631-07-6
Formula: C13H28N2
KIN02700646
2-NONANONE, O-(BENZENESULFONYL)OXIME
CAS:1033259-05-0
Formula: C15H23NO3S
KIN05067806
2-NONANOYLPYRIDINE
CAS:143773-13-1
Formula: [C14H21NO
KIN03272248
2-NONEN-4-OL
CAS:4798-66-7
KIN01114927
2-NONEN-4-YNE 2-METHYL-3-(PENTAFLUORO-ETHYL)-,
CAS:112678-68-9
Formula: C12H15F5
KIN03117351
2-NONEN-4-YNYL-LITHIUM
CAS:67978-47-6
Formula: C9H13Li
KIN02559753
2-NONEN-5-YN-4-ONE
CAS:157726-79-9
Formula: C9H12O
KIN03318778
2-NONEN-8-YNOIC ACID METHYL ESTER
CAS:93101-89-4
Formula: C10H14O2
KIN02765155
2-NONENAL
CAS:2463-63-0
Formula: C7H12O
KIN01070052
2-NONENAL, (2,4-DINITROPHENYL)HYDRAZONE
CAS:1726-80-3
Formula: C5H8O5
KIN01054310
2-NONENAL, 9-(ACETYLOXY)-,
CAS:127191-79-1
Formula: C11H18O3
KIN03196328
2-NONENAL, MIXT. WITH 3,7-DIMETHYL-2,6-OCTADIENAL
CAS:68466-55-7
KIN02563509
2-NONENE-4,6-DIYNE-1,9-DIOL
CAS:90536-13-3
Formula: C9H10O2
KIN02729529
2-NONENOIC ACID
CAS:3760-13-2
Formula: C10H16
KIN01095393
2-NONENOIC ACID 1 TERT-BUTYL ESTER
CAS:118561-53-8
Formula: C13H24O2
KIN03154858
2-NONENOIC ACID ETHYL ESTER
CAS:17463-01-3
Formula: C11H20O2
KIN02062305
2-NONENOIC ACID PENTYL ESTER
CAS:67663-04-1
Formula: C14H26O2
KIN02556503
2-NONENOYL CHLORIDE
CAS:764-87-4
Formula: C9H15ClO
KIN01028593
2-NONYL-[1,3]DIOXOLANE
CAS:4353-07-5
KIN01105691
2-NONYL-[1,3]DIOXOLANE-2-ACETIC ACID METHYL ESTER
CAS:109873-29-2
Formula: C15H28O4
KIN03097859
2-NONYL-1,3-BENZODITHIOL-1-IUM PERCHLORATE
CAS:62102-68-5
Formula: C16H23S2.ClO4
KIN02467831
2-NONYL-1,3-BENZODITHIOLE
CAS:62102-60-7
Formula: C16H24S2
KIN02467828
2-NONYL-1,3-CYCLOPENTANEDIONE
CAS:62248-55-9
Formula: C14H24O2
KIN02470904
2-NONYL-1,3-DIOXANE
CAS:6413-73-6
Formula: C12H16O2
KIN01161746
2-NONYL-1,3-DITHIOLANE
CAS:131195-53-4
Formula: C12H24S2
KIN03213332
2-NONYL-1,3-OXATHIOLANE
CAS:69895-04-1
Formula: C12H24OS
KIN02573707
2-NONYL-1-PIPERIDINEPROPANOL HCL
CAS:61515-73-9
Formula: C17H35NO.ClH
KIN02457203
2-NONYL-10H-PHENOTHIAZINE
CAS:124872-64-6
KIN03186114
2-NONYL-1H-BENZO[D]IMIDAZOLE
CAS:5851-51-4
Formula: C18H28N2
KIN01143441
2-NONYL-1H-IMIDAZOLE
CAS:52819-56-4
Formula: C12H22N2
KIN02326282
2-NONYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:82181-90-6
Formula: C17H23NO2
KIN02653987
2-NONYL-1H-PERIMIDINE
CAS:13925-64-9
Formula: C20H26N2
KIN02026068
2-NONYL-1H-PERIMIDINE HCL
CAS:111356-96-8
Formula: C20H27ClN2
KIN03107286
2-NONYL-3-(1-PROPENYL)-OXIRANEMETHANOL
CAS:92753-19-0
Formula: C15H28O2
KIN02761048
2-NONYL-3-HYDROXY-PHENOL
CAS:63264-82-4
Formula: C15H24O2
KIN02489489
2-NONYL-3-PHENYL-OXIRANE
CAS:65473-80-5
Formula: C17H26O
KIN02527365
2-NONYL-4,5-DIHYDROTHIAZOLE
CAS:21226-53-9
Formula: C12H23NS
KIN02098594
2-NONYL-4,6-BIS(TRICHLOROMETHYL)-1,3,5-TRIAZINE
CAS:24481-36-5
Formula: C14H19Cl6N3
KIN02130936
2-NONYL-4-HYDROXY-PHENOL
CAS:10576-43-9
Formula: C15H24O2
KIN02008357
2-NONYL-4-HYDROXY-PHENOL DIACETATE
CAS:98046-34-5
Formula: C19H28O4
KIN02810151
2-NONYL-4-HYDROXY-PHENOL DIBENZOATE
CAS:98046-24-3
Formula: C29H32O4
KIN02810141
2-NONYL-4-HYDROXY-QUINOLINE N1-OXIDE
CAS:316-68-7
Formula: C12H9FO
KIN01010041
2-NONYL-4-OXO-4H-BENZOPYRAN-8-CARBALDEHYDE
CAS:94127-35-2
Formula: C19H24O3
KIN02778162
2-NONYL-4-PYRIDINECARBONITRILE
CAS:101353-58-6
Formula: C15H22N2
KIN03038769
2-NONYL-5'-INOSINIC ACID DIAMMONIUM SALT
CAS:88868-81-9
Formula: C19H31N4O8P.2H3N
KIN02703751
2-NONYL-ALPHA-PENTYLBENZENEMETHANOL
CAS:110629-71-5
Formula: C21H36O
KIN03102843
2-NONYL-DECANEDIOIC ACID
CAS:4165-04-2
Formula: C6H10FNO2
KIN01102226
2-NONYL-N-PHENYL-ANILINE
CAS:52033-73-5
Formula: C21H29N
KIN02315138
2-NONYL-NAPHTHALENE
CAS:61886-67-7
Formula: C19H26
KIN02463907
2-NONYL-OXAZOLE
CAS:139607-97-9
Formula: C12H21NO
KIN03253747
2-NONYL-OXAZOLO[4,5-C]QUINOLIN-4(5H)-ONE
CAS:211874-76-9
Formula: C19H24N2O2
KIN03423258
2-NONYL-QUINOLIN-4-OL
CAS:2503-84-6
Formula: C17H23NO2
KIN01070855
2-NONYL-QUINOLIN-4-OL 1-OXIDE
CAS:133080-32-7
KIN03221979
2-NONYL-QUINOLINOL 1-OXIDE
CAS:66319-28-6
Formula: C18H25NO2
KIN02540399
2-NONYL-UNDECANOIC ACID
CAS:102465-24-7
Formula: C20H40O2
KIN03047438
2-NONYLBENZALDEHYDE
CAS:110629-99-7
KIN03102844
2-NONYLBENZENESULFONIC ACID
CAS:101829-92-9
KIN03042021
2-NONYLBENZO[D]OXAZOLE
CAS:6797-20-2
Formula: C7H7NO
KIN01170480
2-NONYLBENZO[D]THIAZOLE
CAS:6340-31-4
Formula: C18H27NS
KIN01159604
2-NONYLBUTANEDIOIC ACID
CAS:6543-57-3
Formula: C28H16O8
KIN01164624
2-NONYLCYCLOPENTANONE
CAS:40566-27-6
KIN02263894
2-NONYLCYCLOPROPANEUNDECANAL
CAS:56196-17-9
KIN02378827
2-NONYLIDENE-HYDRAZINECARBOXAMIDE
CAS:16742-11-3
Formula: C10H21N3O
KIN02054471
2-NONYLIDENECYCLOPENTAN-1-ONE
CAS:16424-38-7
Formula: C14H24O
KIN02051203
2-NONYLMALONIC ACID
CAS:3578-64-1
Formula: C8H16O3S
KIN01091902
2-NONYLPHENOL
CAS:136-84-5
Formula: C5H10N2O3
KIN01005976
2-NONYLPHENOL ACETATE
CAS:67367-12-8
Formula: C17H26O2
KIN02552376
2-NONYLPHENYL HYDROGEN SULFATE
CAS:1322-90-3
Formula: C16H14O
KIN01045431
2-NONYLPROPAN-1,3-DIOL
CAS:110260-74-7
Formula: C12H26O2
KIN03100377
2-NONYLPROPANEDIAMIDE
CAS:100385-01-1
Formula: C12H24N2O2
KIN03031317
2-NONYLPYRAZINE
CAS:30712-69-7
KIN02184203
2-NONYLPYRIDIN-3-CARBALDEHYDE 1-OXIDE
CAS:108156-45-2
KIN03087236
2-NONYLPYRIDIN-4-CARBOXAMIDE
CAS:101260-63-3
KIN03038141
2-NONYLPYRIDIN-4-CARBOXYLIC ACID METHYL ESTER
CAS:101449-85-8
KIN03039490
2-NONYLTHIAZOLIDINE
CAS:116112-94-8
Formula: C12H25NS
KIN03141029
2-NONYLTHIO-N-[(3S)-2-OXOOXOLAN-3-YL]ACETAMIDE
CAS:252726-06-0
Formula: C15H27NO3S
KIN03452670
2-NONYLTHIOBENZO[D]THIAZOLE
CAS:60372-28-3
Formula: C16H23NS2
KIN02443924
2-NONYLTHIOMORPHOLIN-3-ONE
CAS:88987-98-8
Formula: C13H25NOS
KIN02705372
2-NONYLTHIOMORPHOLINE
CAS:88988-10-7
Formula: C13H27NS
KIN02705384
2-NONYLTHIOPHENE
CAS:57754-07-1
Formula: C13H22S
KIN02404845
2-NONYN-1-AL DIETHYL ACETAL
CAS:79496-57-4
Formula: C13H24O2
KIN02638092
2-NONYN-1-OL
CAS:5921-74-4
Formula: C9H15Br
KIN01145111
2-NONYN-1-OL, 1-( TOSYLATE)
CAS:154659-35-5
KIN03309572
2-NONYN-1-OL, 1-BENZENESULFONATE
CAS:205584-31-2
KIN03415164
2-NONYN-1-OL, METHANESULFONATE
CAS:58793-83-2
Formula: C10H18O3S
KIN02421243
2-NONYN-1-YL 2,3,4,6-TETRA-O-ACETYLBETA-D-GLUCOPYRANOSIDE
CAS:174647-49-5
Formula: C23H34O10
KIN03356388
2-NONYNOIC ACID 1 TERT-BUTYL ESTER
CAS:244607-33-8
Formula: C13H22O2
KIN03447503
2-NONYNOIC ACID 2-METHYLPROPYL ESTER
CAS:84282-44-0
Formula: C13H22O2
KIN02666399
2-NONYNOIC ACID CIS-3-HEXEN-1-YL ESTER
CAS:68480-29-5
Formula: C15H24O2
KIN02563651
MFCD00036626
2-NONYNOIC ACID ETHYL ESTER
CAS:10031-92-2
Formula: C11H18O2
KIN02001063
MFCD00036553
2-NONYNOIC ACID PENTYL ESTER
CAS:64181-14-2
Formula: C14H24O2
KIN02505603
2-NOR-1,3-SECO-1,25-DIHYDROXYVITAMIN D3
CAS:113490-37-2
Formula: C26H44O3
KIN03123439
2-NOR-1,3-SECO-25-DEHYDRO-1-HYDROXYVITAMIN D3
CAS:113490-31-6
Formula: C26H42O2
KIN03123437
2-NORBORNANE-CARBOXYLIC ACID COMPD. WITH CINCHONIDINE
CAS:121315-73-9
KIN03169065
2-NORBORNANESULFONAMIDE
CAS:7167-10-4
Formula: C23H20BrN3OS
KIN01180451
2-NORBORNANONE, CARBOMETHOXYHYDRAZONE
CAS:124243-24-9
Formula: C9H14N2O2
KIN03183157
2-NORBORNEN-1-CARBOXAMIDE
CAS:15023-49-1
Formula: C8H11NO
KIN02037671
2-NORBORNYL KETONE, (2,4-DINITROPHENYL)HYDRAZONE
CAS:17610-52-5
KIN02063703
2-NORBORNYL-XANTHIC ACID METHYL ESTER
CAS:103797-55-3
KIN03056265
2-NORBORNYLBORONIC ACID
CAS:122035-41-0
Formula: C7H13BO2
KIN03172881
2-NORCAREN-7-CARBOXYLIC ACID METHYL ESTER
CAS:90582-29-9
Formula: C9H12O2
KIN02730282
2-NORCARENE-7,7-DICARBOXYLIC ACID MONOETHYL ESTER, STEREOISOMER
CAS:30782-81-1
KIN02184815
2-NORLEUKOTRIENE D1
CAS:88477-96-7
Formula: C24H44N2O6S
KIN02698774
2-O 4-O-DICYCLOHEXYL 1-O-HEXYL BENZENE-1,2,4-TRICARBOXYLATE
CAS:110475-01-9
Formula: C27H38O6
KIN03101836
2-O,3-O,4-O,5-O,6-O,7-O-HEXAKIS(TRIMETHYLSILYL)-D-GLYCERO-D-GULO-HEPTOSE O-METHYL OXIME
CAS:56196-15-7
KIN02378825
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-D-ALTROSE
CAS:56114-56-8
KIN02377602
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-D-GALACTOSE
CAS:6736-96-5
Formula: C19H46O6Si4
KIN01169509
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-D-GLUCITOL 1-[PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55528-11-5
KIN02367980
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-D-GLUCOSE
CAS:6736-99-8
KIN01169511
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-D-MANNOSE
CAS:6737-01-5
KIN01169512
2-O,3-O,4-O,5-O,6-O-PENTAKIS(TRIMETHYLSILYL)-L-ALTROSE
CAS:56114-55-7
KIN02377601
2-O,3-O,4-O,5-O-TETRAACETYL-6-DEOXY-L-GALACTOSE 1,2-ETHANEDIYL DITHIOACETAL
CAS:55955-81-2
KIN02374950
2-O,3-O,4-O,5-O-TETRABENZOYL-D-RIBOSE O-BENZYL OXIME
CAS:71641-37-7
KIN02585715
2-O,3-O,4-O,5-O-TETRABENZOYL-D-XYLOSE O-BENZYL OXIME
CAS:71641-36-6
KIN02585714
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-6-O-[2-O,3-O,4-O,6-O-TETRAKIS(TRIMETHYLSILYL)-ALPHA-D-GLUCOPYRANOSYL]-D-GLUCOSE
CAS:55191-01-0
KIN02362176
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-6-O-[2-O,3-O,4-O,6-O-TETRAKIS(TRIMETHYLSILYL)-BETA-D-GLUCOPYRANOSYL]-D-GLUCOSE
CAS:55191-02-1
KIN02362177
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-6-O-[BIS(TRIMETHYLSILYLOXY)PHOSPHINYL]-D-GALACTOSE O-METHYL OXIME
CAS:55530-75-1
KIN02368036
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-6-O-[BIS(TRIMETHYLSILYLOXY)PHOSPHINYL]-D-GLUCOSE O-METHYL OXIME
CAS:55530-73-9
KIN02368034
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-6-O-[BIS(TRIMETHYLSILYLOXY)PHOSPHINYL]-D-MANNOSE O-METHYL OXIME
CAS:55530-76-2
KIN02368037
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-D-GALACTOSE 6-[PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55520-83-7
KIN02367868
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-D-GLUCOSE 6-[PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55520-80-4
KIN02367865
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-D-RIBOSE O-METHYL OXIME
CAS:56196-08-8
KIN02378818
2-O,3-O,4-O,5-O-TETRAKIS(TRIMETHYLSILYL)-D-XYLOSE O-METHYL OXIME
CAS:56196-07-7
KIN02378817
2-O,3-O,4-O,6-O-TETRAKIS(TRIMETHYLSILYL)-ALPHA-D-GALACTOPYRANOSE [PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55530-81-9
KIN02368040
2-O,3-O,4-O,6-O-TETRAKIS(TRIMETHYLSILYL)-ALPHA-D-GLUCOPYRANOSE [PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55520-79-1
KIN02367864
2-O,3-O,4-O,6-O-TETRAKIS(TRIMETHYLSILYL)-ALPHA-D-MANNOPYRANOSE [PHOSPHORIC ACID BIS(TRIMETHYLSILYL)] ESTER
CAS:55520-81-5
KIN02367866
2-O,3-O,4-O,6-O-TETRAMETHYL-5-O-(TRIMETHYLSILYL)-D-GALACTOSE O-METHYL OXIME
CAS:56196-38-4
KIN02378841
2-O,3-O,4-O,6-O-TETRAMETHYL-D-MANNONIC ACID DELTA-LACTONE
CAS:51224-21-6
KIN02303335