ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

2-ETHYL-5-METHYL-1H-PYRROLE
CAS:765-95-7
Formula: C5H7FO2
KIN01028659
2-ETHYL-5-METHYL-2,3-HEXADIENOIC ACID
CAS:57585-06-5
Formula: C9H14O2
KIN02401916
2-ETHYL-5-METHYL-2,4-DIPHENYL-2,5-DIHYDROTHIAZOLE
CAS:14225-52-6
Formula: C18H19NS
KIN02029657
2-ETHYL-5-METHYL-2,5-CYCLOHEXADIENE-1,4-DIONE
CAS:29148-36-5
Formula: C9H10O2
KIN02171868
2-ETHYL-5-METHYL-2-HEXENAL
CAS:88456-18-2
Formula: C9H16O
KIN02698382
2-ETHYL-5-METHYL-3(2H)-ISOXAZOLETHIONE
CAS:70000-81-6
Formula: C6H9NOS
KIN02574481
2-ETHYL-5-METHYL-3(2H)-THIOPHENONE
CAS:57556-06-6
Formula: C7H10OS
KIN02401533
2-ETHYL-5-METHYL-3,3-DIPHENYLPYRROLIDINE
CAS:57100-29-5
Formula: C19H23N
KIN02394097
2-ETHYL-5-METHYL-3,3-DIPHENYLPYRROLIDINE HCL
CAS:61443-62-7
Formula: C19H23N.ClH
KIN02456116
2-ETHYL-5-METHYL-3,4-DIPHENYL-2,4-CYCLOPENTADIEN-1-ONE
CAS:65486-28-4
Formula: C20H18O
KIN02527626
2-ETHYL-5-METHYL-3,6-BIS(1-METHYLETHYL)-PYRAZINE
CAS:183601-99-2
KIN03375099
2-ETHYL-5-METHYL-3,6-BIS(1-METHYLPROPYL)-PYRAZINE
CAS:183602-01-9
KIN03023045
2-ETHYL-5-METHYL-3,6-BIS(2-METHYLPROPYL)-PYRAZINE
CAS:183601-97-0
KIN03023044
2-ETHYL-5-METHYL-3-(METHYLSULFONYL)-OXAZOLIDINE
CAS:63132-87-6
Formula: C7H15NO3S
KIN02486963
2-ETHYL-5-METHYL-3-FORMYLBENZALDEHYDE
CAS:115436-64-1
Formula: C11H12O2
KIN03137214
2-ETHYL-5-METHYL-3-HYDROXY-PHENOL
CAS:27465-63-0
Formula: C9H12O2
KIN02157610
2-ETHYL-5-METHYL-3-HYDROXY-PYRIDINE
CAS:57535-95-2
Formula: C8H11NO
KIN02401139
2-ETHYL-5-METHYL-3-OXO-1,1-CYCLOPENTANEDICARBOXYLIC ACID 1-ETHYL ESTER
CAS:15239-77-7
KIN02039725
2-ETHYL-5-METHYL-3-OXO-4-HEXENOIC ACID METHYL ESTER
CAS:90784-53-5
Formula: C10H16O3
KIN02733249
2-ETHYL-5-METHYL-3-PHENYL-1-(BENZYL)-1H-PYRROLE
CAS:353287-94-2
KIN03530882
2-ETHYL-5-METHYL-3-PHENYL-1H-INDOLE
CAS:1006863-43-9
Formula: C17H17N
KIN05013407
2-ETHYL-5-METHYL-3-PHENYLPYRROLIDINE
CAS:92195-59-0
KIN02754023
2-ETHYL-5-METHYL-3-PROPYL-4-OXAZOLIDINONE
CAS:64201-15-6
Formula: C9H17NO2
KIN02505994
2-ETHYL-5-METHYL-3-PROPYL-ANILINE
CAS:83245-90-3
Formula: C12H19N
KIN02660089
2-ETHYL-5-METHYL-3-THIAZOLINE
CAS:102169-64-2
Formula: C6H11NS
KIN03044983
2-ETHYL-5-METHYL-3-THIOPHENECARBONITRILE
CAS:41727-35-9
KIN02273032
2-ETHYL-5-METHYL-4(3H)-PYRIMIDINONE
CAS:192631-47-3
Formula: C7H10N2O
KIN03394372
2-ETHYL-5-METHYL-4(3H)-QUINAZOLINONE
CAS:229488-07-7
Formula: C11H12N2O
KIN03442395
2-ETHYL-5-METHYL-4-(1-METHYLETHYL)-THIAZOLE
CAS:102943-49-7
KIN03050921
2-ETHYL-5-METHYL-4-(1-METHYLETHYL)PHENOL
CAS:107055-13-0
Formula: C12H18O
KIN03080623
2-ETHYL-5-METHYL-4-(MORPHOLIN-4-YLMETHYL)PHENOL
CAS:110054-10-9
Formula: C14H21NO2
KIN03098962
2-ETHYL-5-METHYL-4-HEXEN-1-OL
CAS:82898-49-5
Formula: C9H18O
KIN02658223
2-ETHYL-5-METHYL-4-HYDROXY-PHENOL
CAS:98954-36-0
Formula: C9H12O2
KIN02816811
2-ETHYL-5-METHYL-4-NITRO-1-PROPYL-1H-IMIDAZOLE
CAS:24029-51-4
Formula: C9H15N3O2
KIN02126164
2-ETHYL-5-METHYL-4-NITRO-THIAZOLE
CAS:26213-94-5
KIN02146441
2-ETHYL-5-METHYL-4-OXAZOLEACETALDEHYDE
CAS:1017365-40-0
Formula: C8H11NO2
KIN05032519
2-ETHYL-5-METHYL-4-OXAZOLEACETIC ACID
CAS:1017181-42-8
Formula: C8H11NO3
KIN05030941
2-ETHYL-5-METHYL-4-OXAZOLEACETONITRILE
CAS:1017152-92-9
Formula: C8H10N2O
KIN05030505
2-ETHYL-5-METHYL-4-OXAZOLECARBONYL CHLORIDE
CAS:1048340-33-5
Formula: C7H8ClNO2
KIN05096455
2-ETHYL-5-METHYL-4-OXAZOLECARBOXALDEHYDE
CAS:1152617-25-8
Formula: C7H9NO2
KIN05200478
2-ETHYL-5-METHYL-4-OXAZOLECARBOXYLIC ACID
CAS:113366-77-1
Formula: C7H9NO3
KIN03122394
2-ETHYL-5-METHYL-4-OXAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:137267-49-3
Formula: C9H13NO3
KIN03240721
2-ETHYL-5-METHYL-4-OXAZOLEETHANAMINE
CAS:1017182-25-0
Formula: C8H14N2O
KIN05030958
2-ETHYL-5-METHYL-4-OXAZOLEETHANOL
CAS:1017232-37-9
Formula: C8H13NO2
KIN05031727
2-ETHYL-5-METHYL-4-PENTYL-1H-PYRROL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:27093-43-2
KIN02153976
2-ETHYL-5-METHYL-4-PENTYL-OXAZOLE
CAS:84028-10-4
Formula: C11H19NO
KIN02664929
2-ETHYL-5-METHYL-4-PHENYL-1,3,2-DIOXABORINANE
CAS:74646-03-0
KIN02607278
2-ETHYL-5-METHYL-4-PHENYL-THIAZOLE
CAS:14229-98-2
KIN02029703
2-ETHYL-5-METHYL-4-PHENYLPYRIMIDINE
CAS:91806-17-6
Formula: C13H14N2
KIN02748938
2-ETHYL-5-METHYL-4-PHENYLTHIENO[2,3-D]PYRIMIDINE
CAS:67718-63-2
Formula: C15H14N2S
KIN02557076
2-ETHYL-5-METHYL-4-THIAZOLECARBOXYLIC ACID
CAS:113366-76-0
Formula: C7H9NO2S
KIN03122393
2-ETHYL-5-METHYL-4-THIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:334017-25-3
Formula: [C9H13NO2S
KIN03507710
2-ETHYL-5-METHYL-4-THIAZOLEMETHANOL
CAS:1008795-40-1
Formula: C7H11NOS
KIN05016038
2-ETHYL-5-METHYL-4H-3,1-BENZOXAZIN-4-ONE
CAS:229488-20-4
Formula: C11H11NO2
KIN03442396
2-ETHYL-5-METHYL-5-HEPTEN-1-OL
CAS:65662-01-3
Formula: C10H20O
KIN02530499
2-ETHYL-5-METHYL-5-HEPTENAL
CAS:65661-97-4
Formula: C10H18O
KIN02530495
2-ETHYL-5-METHYL-5-NITRO-1,3-DIOXANE
CAS:63275-22-9
Formula: C7H13NO4
KIN02489673
2-ETHYL-5-METHYL-6,8-DIPHENYL-[1,3]OXAZOLO[1,2]PYRIDO[4,5-B]PYRIMIDIN-4,7,9-TRIONE
CAS:334668-92-7
Formula: C23H18N4O4
KIN03507927
2-ETHYL-5-METHYL-6-PHENYL-4-PROPYL-1,3,2-DIOXABORINANE
CAS:74421-13-9
KIN02605776
2-ETHYL-5-METHYL-6-PYRIDIN-4-YL-2H-1,4-THIAZIN-3(4H)-ONE
CAS:103807-34-7
Formula: C12H14N2OS
KIN03056302
2-ETHYL-5-METHYL-7H-1,3,4-THIADIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:55276-13-6
Formula: C8H9N3OS
KIN02363728
2-ETHYL-5-METHYL-ANILINE
CAS:4748-82-7
Formula: C11H15NO
KIN01113922
2-ETHYL-5-METHYL-BIPHENYL
CAS:91363-50-7
Formula: C15H16
KIN02742526
2-ETHYL-5-METHYL-C-5-(2-METHYLBENZYLOXY)-1,3-DIOXANE
CAS:41129-10-6
Formula: C15H22O3
KIN02268811
2-ETHYL-5-METHYL-FURAN
CAS:1703-58-8
Formula: C8H10O8
KIN01053766
2-ETHYL-5-METHYL-HEPTANE-1,5-DIOL
CAS:106001-85-8
Formula: C10H22O2
KIN03072928
2-ETHYL-5-METHYL-HEXANAMIDE
CAS:102450-10-2
Formula: C9H19NO
KIN03047379
2-ETHYL-5-METHYL-ISOXAZOLIUM TETRAFLUOROBORATE(I)
CAS:5765-56-0
Formula: C19H34N2O
KIN01141141
2-ETHYL-5-METHYL-N-(1-METHYLETHYL)-BENZAMIDE
CAS:343266-77-3
Formula: C13H19NO
KIN03517204
2-ETHYL-5-METHYL-OXAZOLE
CAS:42463-54-7
Formula: C6H9NO
KIN02278627
2-ETHYL-5-METHYL-OXAZOLIDINE
CAS:53019-52-6
Formula: C6H13NO
KIN02329107
2-ETHYL-5-METHYL-OXAZOLO[4,5-C]QUINOLIN-4(5H)-ONE
CAS:174196-99-7
Formula: C13H12N2O2
KIN03022615
2-ETHYL-5-METHYL-PYRIDINE 1-OXIDE
CAS:101870-72-8
Formula: C8H11NO
KIN03042533
2-ETHYL-5-METHYL-QUINOLIN-4(1H)-ONE
CAS:135016-19-2
Formula: C12H13NO
KIN03230983
2-ETHYL-5-METHYL-THIAZOLE
CAS:19961-53-6
Formula: C6H9NS
KIN02086598
2-ETHYL-5-METHYLBENZENEMETHANOL
CAS:936-58-3
Formula: C10H12O
KIN01034398
2-ETHYL-5-METHYLBENZENESULFONIC ACID
CAS:92639-80-0
Formula: C9H12O3S
KIN02759596
2-ETHYL-5-METHYLBENZO[D]ISOTHIAZOL-3(2H)-ONE 1-OXIDE
CAS:257953-00-7
Formula: [C10H11NO2S
KIN03456400
2-ETHYL-5-METHYLBENZO[D]OXAZOLE
CAS:20514-29-8
Formula: C10H11NO
KIN02091663
2-ETHYL-5-METHYLBENZO[D]THIAZOLE
CAS:344297-40-1
Formula: [C10H11NS
KIN03519488
2-ETHYL-5-METHYLBENZOFURAN
CAS:17133-95-8
Formula: C11H12O
KIN02058590
2-ETHYL-5-METHYLBENZOIC ACID ETHYL ESTER
CAS:4748-86-1
Formula: C8H10O
KIN01113925
2-ETHYL-5-METHYLENE-2-CYCLOPENTEN-1-ONE
CAS:93766-94-0
Formula: C8H10O
KIN02773367
2-ETHYL-5-METHYLISOINDOLIN-1-ONE
CAS:1190893-16-3
KIN05331641
2-ETHYL-5-METHYLPHENOL
CAS:1687-64-5
Formula: C9H12O
KIN01053373
2-ETHYL-5-METHYLPHENOL 1-ACETATE
CAS:34681-89-5
Formula: C11H14O2
KIN02216045
2-ETHYL-5-METHYLPHENOL 1-FORMATE
CAS:343868-17-7
Formula: C10H12O2
KIN03518617
2-ETHYL-5-METHYLPYRAZINE
CAS:13360-64-0
Formula: C7H10N2
KIN02018437
2-ETHYL-5-METHYLPYRAZOLO[1,5-A]PYRIDIN-3-CARBONITRILE
CAS:110886-23-2
KIN03104187
2-ETHYL-5-METHYLPYRAZOLO[1,5-A]PYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:110886-26-5
KIN03104190
2-ETHYL-5-METHYLPYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:31931-55-2
Formula: C11H15NO2
KIN02193189
2-ETHYL-5-METHYLPYRIDINE
CAS:18113-81-0
Formula: C8H11N
KIN02068926
6-Ethyl-3-methylpyridine; 2-Ethyl-5-methylpyridine
2-ETHYL-5-METHYLPYRIMIDIN-4-YLAMINE
CAS:25526-80-1
Formula: C7H11N3
KIN02140627
2-ETHYL-5-METHYLPYRIMIDINE
CAS:1087726-02-0
Formula: C7H10N2
KIN05126736
2-ETHYL-5-METHYLTHIAZOLIDINE
CAS:81829-67-6
Formula: C6H13NS
KIN02651999
2-ETHYL-5-METHYLTHIOMORPHOLIN-3-ONE
CAS:69226-16-0
Formula: C7H13NOS
KIN02568859
2-ETHYL-5-METHYLTHIOPHEN-3-OL
CAS:36880-36-1
KIN02235014
2-ETHYL-5-METHYLTHIOPHEN-3-OL 3-ACETATE
CAS:36880-37-2
KIN02235015
2-ETHYL-5-METHYLTHIOPHENE
CAS:40323-88-4
Formula: C7H10S
KIN02261865
MFCD00053128
2-ETHYL-5-METHYLTHIOPHENE 1,1-DIOXIDE
CAS:69485-36-5
Formula: C7H10O2S
KIN02570633
2-ETHYL-5-MORPHOLIN-4-YL-4-OXAZOLECARBONITRILE
CAS:49837-53-8
Formula: C10H13N3O2
KIN02290820
2-ETHYL-5-MORPHOLIN-4-YL-ANILINE
CAS:1175816-57-5
Formula: C12H18N2O
KIN05267620
2-ETHYL-5-NITRO-1-PROPYL-1H-IMIDAZOL-4-YLAMINE
CAS:4875-37-0
Formula: C8H13N3
KIN01116373
2-ETHYL-5-NITRO-1-PROPYL-1H-IMIDAZOLE
CAS:100883-04-3
Formula: C8H13N3O2
KIN03035370
2-ETHYL-5-NITRO-1H-BENZO[D]IMIDAZOLE
CAS:5805-47-0
Formula: C13H8N4O4
KIN01142178
2-ETHYL-5-NITRO-1H-IMIDAZOL-1-ETHANOL
CAS:13357-07-8
Formula: C7H11N3O3
KIN02018385
2-ETHYL-5-NITRO-1H-IMIDAZOL-1-ETHANOL TOSYLATE (ESTER)
CAS:62420-99-9
Formula: C14H17N3O5S
KIN02473810
2-ETHYL-5-NITRO-1H-IMIDAZOL-1-PROPANENITRILE
CAS:14885-28-0
Formula: C8H10N4O2
KIN02036447
2-ETHYL-5-NITRO-1H-IMIDAZOL-4-ETHANETHIOL
CAS:206359-28-6
KIN03416182
2-ETHYL-5-NITRO-1H-IMIDAZOL-4-ETHANOL
CAS:206359-34-4
KIN03416186
2-ETHYL-5-NITRO-1H-IMIDAZOLE
CAS:13230-03-0
Formula: C5H7N3O2
KIN02016725
2-ETHYL-5-NITRO-1H-INDOLE
CAS:3484-20-6
KIN01090164
2-ETHYL-5-NITRO-1H-ISOINDOL-1,3(2H)-DIONE
CAS:55080-56-3
Formula: C10H8N2O4
KIN02360319
2-ETHYL-5-NITRO-2H-BENZOTRIAZOLE
CAS:188943-39-7
Formula: C8H8N4O2
KIN03386780
2-ETHYL-5-NITRO-2H-PYRAZOLO[3,4-B]PYRIDINE
CAS:148291-53-6
Formula: C8H8N4O2
KIN03288947
2-ETHYL-5-NITRO-3-PYRIDINECARBOXYLIC ACID
CAS:1039313-22-8
Formula: C8H8N2O4
KIN05078822
2-ETHYL-5-NITRO-4-AMINO-ANILINE
CAS:82857-02-1
Formula: C8H11N3O2
KIN02657999
2-ETHYL-5-NITRO-ALPHA-PHENYLBENZENEMETHANAMINE
CAS:1021010-83-2
Formula: C15H16N2O2
KIN05052064
2-ETHYL-5-NITRO-ANILINE
CAS:20191-74-6
Formula: C8H10N2O2
KIN02088945
MFCD00034056
2-ETHYL-5-NITRO-BENZALDEHYDE%
CAS:22490-24-0
Formula: C9H9NO3
KIN02111074
2-ETHYL-5-NITRO-BENZENEACETONITRILE
CAS:209899-21-8
Formula: C10H10N2O2
KIN03420578
2-ETHYL-5-NITRO-BENZENEMETHANOL
CAS:1081826-37-0
Formula: C9H11NO3
KIN05117958
2-ETHYL-5-NITRO-BENZENESULFONYL CHLORIDE
CAS:89189-34-4
Formula: C8H8ClNO4S
KIN02708295
MFCD09729755
2-ETHYL-5-NITRO-BENZO[D]OXAZOLE
CAS:204771-74-4
Formula: C9H8N2O3
KIN03414019
2-ETHYL-5-NITRO-BENZOIC ACID
CAS:90564-19-5
Formula: C9H9NO4
KIN02730139
2-ETHYL-5-NITRO-BENZOIC ACID METHYL ESTER
CAS:103205-48-7
Formula: C10H11NO4
KIN03052398
2-ETHYL-5-NITRO-BENZONITRILE
CAS:98879-61-9
Formula: C9H8N2O2
KIN02816406
2-ETHYL-5-NITRO-BENZOYL CHLORIDE
CAS:101869-86-7
Formula: C9H8ClNO3
KIN03042508
2-ETHYL-5-NITRO-FURAN
CAS:90724-63-3
Formula: C6H7NO3
KIN02732325
2-ETHYL-5-NITRO-THIOPHENE
CAS:65967-46-6
Formula: C6H7NO2S
KIN02535042
2-ETHYL-5-NITRO-THIOPHENE 1-OXIDE
CAS:1021187-17-6
Formula: C6H7NO3S
KIN05054347
2-ETHYL-5-NITROPHENOL
CAS:90005-90-6
Formula: C8H9NO3
KIN02720901
2-ETHYL-5-NITROPYRIDINE
CAS:31557-73-0
Formula: C7H8N2O2
KIN02190293
MFCD03617763
2-ETHYL-5-NITROPYRIMIDINE
CAS:79899-27-7
Formula: C6H7N3O2
KIN02640578
2-ETHYL-5-OCTENOIC ACID METHYL ESTER
CAS:114577-16-1
Formula: C11H20O2
KIN03131869
2-ETHYL-5-OCTYL-1H-IMIDAZOLE
CAS:134353-20-1
KIN03227883
2-ETHYL-5-OCTYL-PYRIDINE
CAS:112945-07-0
Formula: C15H25N
KIN03119415
2-ETHYL-5-OCTYLTHIOPHENE
CAS:55030-16-5
KIN02359451
2-ETHYL-5-OXAZOLECARBOXALDEHYDE
CAS:1126634-01-2
Formula: C6H7NO2
KIN05180629
2-ETHYL-5-OXO-3-HEXENOIC ACID ETHYL ESTER
CAS:61895-60-1
Formula: C10H16O3
KIN02464156
2-ETHYL-5-OXO-3-PROPYL-HEXANAL
CAS:93743-31-8
Formula: C11H20O2
KIN02773033
2-ETHYL-5-OXO-3-PYRROLIDINEACETIC ACID METHYL ESTER
CAS:36412-04-1
KIN02231673
2-ETHYL-5-OXO-5H-1,3,4-THIADIAZOLO[3,2-A]PYRIMIDIN-6-CARBOXYLIC ACID
CAS:446829-83-0
Formula: C8H7N3O3S
KIN03588720
2-ETHYL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:38478-91-0
Formula: C7H11NO3
KIN02248350
2-ETHYL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:38478-90-9
KIN02248349
2-ETHYL-5-OXO-TETRAHYDROFURAN-3-CARBOXYLIC ACID
CAS:28274-28-4
Formula: C7H10O4
KIN02164689
2-ETHYL-5-PENTYL-1-(BENZYL)-1H-PYRROLE
CAS:115996-07-1
Formula: C18H25N
KIN03140297
2-ETHYL-5-PENTYL-1H-PYRROLE
CAS:1071034-24-6
Formula: C11H19N
KIN05111524
2-ETHYL-5-PENTYL-3-HYDROXY-PHENOL
CAS:56157-24-5
Formula: C13H20O2
KIN02378280
2-ETHYL-5-PENTYL-OXAZOLE
CAS:84027-99-6
Formula: C10H17NO
KIN02664921
2-ETHYL-5-PENTYLCYCLOPENTANONE
CAS:63807-79-4
Formula: C12H22O
KIN02499178
2-ETHYL-5-PENTYLPYRROLIDINE TOSYLATE
CAS:61824-04-2
Formula: C11H23N.C7H8O3S
KIN02462729
2-ETHYL-5-PENTYLTHIOPHENE
CAS:133082-49-2
KIN03222001
2-ETHYL-5-PHENOXY-PENTANOIC ACID
CAS:63258-05-9
Formula: C13H18O3
KIN02489350
2-ETHYL-5-PHENYL-1,2-THIAZOL-2-IUM,TETRAFLUOROBORATE
CAS:15688-20-7
Formula: C11H12BF4NS
KIN02043489
2-ETHYL-5-PHENYL-1,3,2-DIOXABOROLAN-4-ONE
CAS:74646-15-4
KIN02607281
2-ETHYL-5-PHENYL-1,3,4-OXADIAZOLE
CAS:73314-40-6
Formula: C10H10N2O
KIN02597508
2-ETHYL-5-PHENYL-1,3,4-THIADIAZOLE
CAS:41898-81-1
KIN02274268
2-ETHYL-5-PHENYL-1-PROPYL-1H-PYRROLE
CAS:36648-36-9
KIN02233040
2-ETHYL-5-PHENYL-1H-IMIDAZOLE
CAS:13739-51-0
Formula: C11H12N2
KIN02023868
2-ETHYL-5-PHENYL-1H-PYRROL-1-ETHANOL
CAS:494850-20-3
Formula: C14H17NO
KIN03614124
2-ETHYL-5-PHENYL-1H-PYRROL-1-ETHANOL 1-METHANESULFONATE
CAS:494850-80-5
Formula: C15H19NO3S
KIN03633059
2-ETHYL-5-PHENYL-1H-PYRROLE
CAS:13713-06-9
Formula: C12H13N
KIN02023535
2-ETHYL-5-PHENYL-2,5-CYCLOHEXADIENE-1,4-DIONE
CAS:350686-57-6
Formula: C14H12O2
KIN03527766
2-ETHYL-5-PHENYL-2-PENTENAL
CAS:56585-21-8
Formula: C13H16O
KIN02385152
2-ETHYL-5-PHENYL-2H-TETRAZOLE
CAS:31818-94-7
Formula: C9H10N4
KIN02192300
2-ETHYL-5-PHENYL-2H-TETRAZOLE 4-OXIDE
CAS:66572-13-2
Formula: C9H10N4O
KIN02543639
2-ETHYL-5-PHENYL-3(2H)-ISOXAZOLETHIONE
CAS:17281-09-3
KIN02060247
2-ETHYL-5-PHENYL-3(2H)-ISOXAZOLONE
CAS:945-60-8
Formula: C12H16O2
KIN01034897
2-ETHYL-5-PHENYL-3-FURANCARBOXYLIC ACID ETHYL ESTER
CAS:62596-46-7
Formula: C15H16O3
KIN02476981
2-ETHYL-5-PHENYL-4-OXAZOLAMINE
CAS:121019-63-4
Formula: C11H12N2O
KIN03167452
2-ETHYL-5-PHENYL-4-OXAZOLECARBOXYLIC ACID
CAS:1161776-81-3
Formula: C12H11NO3
KIN05258754
2-ETHYL-5-PHENYL-4-PENTEN-1-YLAMINE
CAS:101347-91-5
Formula: C13H19N
KIN03038711
2-ETHYL-5-PHENYL-6-(BENZYL)-4(3H)-PYRIMIDINONE
CAS:34127-15-6
Formula: C19H18N2O
KIN02211484
2-ETHYL-5-PHENYL-FURAN
CAS:57044-49-2
Formula: C12H12O
KIN02392958
2-ETHYL-5-PHENYL-ISOXAZOLIUM TETRAFLUOROBORATE(I)
CAS:1736-38-5
KIN01054575
2-ETHYL-5-PHENYL-OXAZOLE
CAS:69163-81-1
Formula: C11H11NO
KIN02568414
2-ETHYL-5-PHENYL-OXAZOLIDINE
CAS:60980-80-5
Formula: C11H15NO
KIN02449386
2-ETHYL-5-PHENYL-PYRIDINE
CAS:81879-88-1
Formula: C13H13N
KIN02652281
2-ETHYL-5-PHENYL-SPIRODECANE> HCL
CAS:108736-95-4
Formula: C20H28ClNO
KIN03090904
2-ETHYL-5-PHENYL-THIAZOLE
CAS:19968-74-2
Formula: C11H11NS
KIN02086695
2-ETHYL-5-PHENYLBENZO[D]OXAZOLE
CAS:402745-81-7
Formula: C15H13NO
KIN03563701
2-ETHYL-5-PHENYLTHIOPHENE
CAS:40808-44-4
KIN02266017
2-ETHYL-5-PIPERIDIN-1-YL-1H-BENZO[D]IMIDAZOLE
CAS:94526-43-9
Formula: C14H19N3
KIN02782755
2-ETHYL-5-PROPAN-2-YLIDENE-3-[2'-(1H-TETRAZOL-5-YL)-BIPHENYL-4-YLMETHYL]-3,5-DIHYDROIMIDAZOL-4-ONE
CAS:149675-51-4
KIN03293422
2-ETHYL-5-PROPYL-[1,2,4]-TRIAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:77695-20-6
Formula: C10H14N4O
KIN02626965
2-ETHYL-5-PROPYL-1,3,4-THIADIAZOLE
CAS:41398-05-4
Formula: C7H12N2S
KIN02270852
2-ETHYL-5-PROPYL-1H-IMIDAZOLE
CAS:37455-54-2
KIN02239440
2-ETHYL-5-PROPYL-1H-INDOLE
CAS:92462-71-0
Formula: C13H17N
KIN02757026
2-ETHYL-5-PROPYL-1H-PYRROLE
CAS:768-56-9
Formula: C10H12
KIN01028840
2-ETHYL-5-PROPYL-6-[[2'-(2H-TETRAZOL-5-YL)-BIPHENYL-4-YL]METHYL][1,2,4]-TRIAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:168152-69-0
Formula: C24H24N8O
KIN03342349
2-ETHYL-5-PROPYL-PYRIDINE
CAS:80167-44-8
Formula: C10H15N
KIN02642263
2-ETHYL-5-PROPYL-THIAZOLE
CAS:27149-25-3
KIN02154552
2-ETHYL-5-PROPYLPHENOL
CAS:72386-20-0
Formula: C11H16O
KIN02591033
2-ETHYL-5-PROPYLPYRAZINE
CAS:29461-08-3
Formula: C9H14N2
KIN02174216
2-ETHYL-5-PROPYLTHIOPHENE
CAS:54244-74-5
Formula: C9H14S
KIN02347164
2-ETHYL-5-PYRIMIDINAMINE
CAS:1152519-74-8
Formula: C6H9N3
KIN05198410
2-ETHYL-5-PYRIMIDINECARBALDEHYDE
CAS:205518-89-4
Formula: C7H8N2O
KIN03415071
2-ETHYL-5-PYRIMIDINECARBONITRILE
CAS:1060817-38-0
Formula: C7H7N3;C7H7N3
KIN05106656
2-ETHYL-5-PYRIMIDINECARBONYL CHLORIDE
CAS:1142924-92-2
Formula: C7H7ClN2O
KIN05191891
2-ETHYL-5-PYRIMIDINOL
CAS:90339-11-0
Formula: C6H8N2O
KIN02726295
2-ETHYL-5-THIAZOLAMINE
CAS:1159821-36-9
Formula: C5H8N2S
KIN05256238
2-ETHYL-5-THIAZOLECARBONYL CHLORIDE
CAS:133369-35-4
KIN03223233
2-ETHYL-5-THIAZOLECARBOXYLIC ACID
CAS:30709-68-3
Formula: C6H7NO2S
KIN02184170
MFCD01760299
2-ETHYL-5-THIAZOLECARBOXYLIC ACID METHYL ESTER
CAS:56012-36-3
Formula: C7H9NO2S
KIN02375844
2-ETHYL-5-THIAZOLEMETHANAMINE
CAS:1183523-89-8
Formula: C6H10N2S
KIN05305057
2-ETHYL-5-THIAZOLEMETHANOL
CAS:56012-33-0
KIN02375841
2-ETHYL-5-THIAZOLOL
CAS:1159819-20-1
Formula: C5H7NOS
KIN05256055
2-ETHYL-5H-(1)-BENZOTHIENO(3,2-D)-1,3,4-THIADIAZOLO(3,2-A)-PYRIMIDIN-5-ONE
CAS:110543-82-3
Formula: C13H9N3OS2
KIN03102255
2-ETHYL-5H-1,3,4-THIADIAZOLO[2,3-B]QUINAZOLIN-5-ONE
CAS:71859-88-6
Formula: C11H9N3OS
KIN02587422
2-ETHYL-6(5H)-PHENANTHRIDINONE
CAS:157848-50-5
Formula: C15H13NO
KIN03319115
2-ETHYL-6,10-DIMETHYL-HEPTADECANOIC ACID
CAS:90846-89-2
Formula: C21H42O2
KIN02734444
2-ETHYL-6,10-DIMETHYL-OCTADECANOIC ACID
CAS:90835-45-3
Formula: C22H44O2
KIN02734201
2-ETHYL-6,10-DIMETHYLNONADECANOIC ACID
CAS:90835-44-2
Formula: C23H46O2
KIN02734200
2-ETHYL-6,10-DITHIASPIRO[4.5]DEC-2-EN-1-ONE
CAS:56011-21-3
Formula: C10H14OS2
KIN02375820
2-ETHYL-6,10-DITHIASPIRO[4.5]DECAN-1-ONE
CAS:61364-91-8
Formula: C10H16OS2
KIN02455026
2-ETHYL-6,6-DIMETHYL-1,3-CYCLOHEXADIEN-1-CARBONYL CHLORIDE
CAS:57935-26-9
Formula: C11H15ClO-
KIN02407786
2-ETHYL-6,6-DIMETHYL-1,3-CYCLOHEXADIENE
CAS:79419-17-3
Formula: C10H16
KIN02637509
2-ETHYL-6,6-DIMETHYL-2,4-CYCLOHEXADIEN-1-CARBONYL CHLORIDE
CAS:57935-25-8
Formula: C11H15ClO-
KIN02407785
2-ETHYL-6,6-DIMETHYL-2-CYCLOHEXEN-1-ONE
CAS:79893-66-6
Formula: C10H16O
KIN02640548
2-ETHYL-6,6-DIMETHYL-2-CYCLOHEXENE-1-METHANOL
CAS:89452-23-3
Formula: C11H20O
KIN02712001
2-ETHYL-6,6-DIMETHYL-2-CYCLOHEXENE-1-METHANOL ACETATE
CAS:89452-28-8
Formula: C13H24O3
KIN02712004
2-ETHYL-6,6-DIMETHYL-4,8-DIOXASPIRO[2.5]OCT-1-ENE
CAS:133961-14-5
Formula: C10H16O2
KIN03226133
2-ETHYL-6,7,8,9-TETRAHYDRO-[1,3,4]THIADIAZOLO[2,3-B]QUINAZOLIN-5-ONE
CAS:116805-49-3
Formula: C11H13N3OS
KIN03145961
2-ETHYL-6,7,8,9-TETRAHYDRO-[1,3,4]THIADIAZOLO[2,3-B]QUINAZOLIN-5-THIONE
CAS:160893-92-5
Formula: C11H13N3S2
KIN03327419
2-ETHYL-6,7,8,9-TETRAHYDRO-3,9-DIMETHYL-5H-PYRIDO[2,3-B]AZEPIN-4-YLAMINE
CAS:464154-65-2
Formula: C13H21N3
KIN03597556
2-ETHYL-6,7,8,9-TETRAHYDRO-3-METHYLCYCLOPENTA[5,6]PYRIDO[1,2-B][1,2,4]TRIAZINE
CAS:475559-80-9
Formula: C13H17N3
KIN03602690
2-ETHYL-6,7,8,9-TETRAHYDRO-4-METHYLPYRIMIDO[2,1-B]BENZO[D]THIAZOL-5-IUM
CAS:46488-27-1
Formula: C13H17N2S
KIN02286020
2-ETHYL-6,7,8-TRIMETHOXY-4(3H)-QUINAZOLINONE
CAS:35241-19-1
Formula: C13H16N2O4
KIN02221170
2-ETHYL-6,7-DIFLUORO-3-METHYL-QUINOLIN-4-OL
CAS:473236-96-3
Formula: C12H11F2NO
KIN03599815
2-ETHYL-6,7-DIFLUORO-3-METHYL-QUINOXALINE
CAS:380582-98-9
Formula: C11H10F2N2
KIN03549235
2-ETHYL-6,7-DIFLUORO-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1152997-83-5
Formula: C11H9F2NO
KIN05203607
2-ETHYL-6,7-DIHYDRO-4-(PYRROLIDINE-1-YL)-5H-CYCLOPENTA[4,5]THIENO[2,3-D]PYRIMIDINE
CAS:302935-77-9
Formula: C15H19N3S
KIN03478653
2-ETHYL-6,7-DIHYDRO-4-PIPERAZIN-1-YL-5H-CYCLOPENTA[4,5]THIENO[2,3-D]PYRIMIDINE
CAS:301538-01-2
Formula: C15H20N4S
KIN03477501
2-ETHYL-6,7-DIHYDRO-4-PIPERAZIN-1-YL-5H-CYCLOPENTA[4,5]THIENO[2,3-D]PYRIMIDINE OXALATE
CAS:301538-02-3
Formula: C17H22N4O4S
KIN03477502
2-ETHYL-6,7-DIHYDRO-4-PIPERIDIN-1-YL-5H-CYCLOPENTA[4,5]THIENO[2,3-D]PYRIMIDINE
CAS:315677-55-5
Formula: C16H21N3S
KIN03490274
2-ETHYL-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE
CAS:30564-54-6
Formula: C10H13N
KIN02183263
2-ETHYL-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE-5-ONE
CAS:1092281-02-1
Formula: C8H9N3O
KIN05132556
2-ETHYL-6,7-DIHYDRO-CYCLOPENTA[B]PYRAN-4(5H)-ONE
CAS:138677-37-9
Formula: C10H12O2
KIN03248145
2-ETHYL-6,7-DIHYDRO-THIENO[3,2-D]PYRIMIDIN-4(3H)-ONE
CAS:117299-63-5
Formula: C8H10N2OS
KIN03666986
2-ETHYL-6,7-DIHYDROPYRIMIDO[4,5-D]PYRIDAZIN-5,8-DIONE
CAS:46279-20-3
KIN02285424
2-ETHYL-6,7-DIMETHOXY-2-METHYL-2H-BENZOPYRAN
CAS:63434-49-1
Formula: C14H18O3
KIN02492570
2-ETHYL-6,7-DIMETHOXY-3-METHYL-4(3H)-QUINAZOLINONE
CAS:63190-59-0
Formula: C13H16N2O3
KIN02488070
2-ETHYL-6,7-DIMETHOXY-4(3H)-QUINAZOLINONE
CAS:21560-78-1
Formula: C12H14N2O3
KIN02101978
2-ETHYL-6,7-DIMETHOXY-4H-1,3-BENZOTHIAZINE
CAS:65448-25-1
Formula: C12H15NO2S
KIN02526965
2-ETHYL-6,7-DIMETHYL-1,4-NAPHTHALENEDIONE
CAS:100886-03-1
Formula: C14H14O2
KIN03035399
2-ETHYL-6,8-DIFLUORO-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155600-38-6
Formula: C11H9F2NO
KIN05226515
2-ETHYL-6,8-DIMETHYL-2,7-NAPHTHYRIDINE-1(2H)-ONE
CAS:1070655-09-2
KIN05110931
2-ETHYL-6,8-DIMETHYL-5-PHENYL-[1,3]OXAZOLO[1,2]PYRIDO[4,5-B]PYRIMIDIN-4,7,9-TRIONE
CAS:334668-95-0
Formula: C18H16N4O4
KIN03507930
2-ETHYL-6,8-DIMETHYL-HEXADECANOIC ACID
CAS:90835-46-4
Formula: C20H40O2
KIN02734202
2-ETHYL-6,8-DIMETHYL-QUINOLIN-4(1H)-ONE
CAS:135016-21-6
Formula: C13H15NO
KIN03230985
2-ETHYL-6,8-DIMETHYLPYRIDO[2,3-B]PYRAZIN-3(4H)-ONE
CAS:151027-78-0
Formula: C11H13N3O
KIN03010260
2-ETHYL-6,8-DINITRO-4H-INDENO[1,2-B]THIOPHEN-4-ONE
CAS:62901-61-5
Formula: C13H8N2O5S
KIN02482446
2-ETHYL-6-(1-HYDROXY-PROPAN-2-YL)-3-METHYLCYCLOHEXANONE
CAS:165327-19-5
Formula: C12H22O2
KIN03337094
2-ETHYL-6-(1-IMINOETHYL)-ANILINE
CAS:148121-17-9
Formula: C10H14N2
KIN03288372
2-ETHYL-6-(1-METHYL-ALLYL)-ANILINE
CAS:68461-03-0
Formula: C12H17N
KIN02563471
2-ETHYL-6-(1-METHYLBUTYL)PHENOL
CAS:74926-92-4
Formula: C13H20O
KIN02609301
2-ETHYL-6-(1-METHYLETHOXY)-4(3H)-PYRIMIDINONE
CAS:38249-38-6
Formula: C9H14N2O2
KIN02246494
2-ETHYL-6-(1-METHYLETHYL)-4(3H)-PYRIMIDINONE
CAS:34127-00-9
Formula: C9H14N2O
KIN02211478
2-ETHYL-6-(1-METHYLETHYL)-4-(BENZYL)-ANILINE
CAS:121450-96-2
Formula: C18H23N
KIN03169786
2-ETHYL-6-(1-METHYLETHYL)-ANILINE
CAS:53443-93-9
Formula: C11H17N
KIN02335353
2-ETHYL-6-(1-METHYLETHYL)-N-NITRO-ANILINE
CAS:84480-99-9
Formula: C11H16N2O2
KIN02667765
2-ETHYL-6-(1-METHYLETHYL)-N-PROPARGYL-ANILINE
CAS:53443-86-0
Formula: C14H19N
KIN02335350
2-ETHYL-6-(1-METHYLETHYL)-PYRAZINE
CAS:32262-93-4
Formula: C9H14N2
KIN02195461
2-ETHYL-6-(1-METHYLETHYL)-PYRIDINE
CAS:74701-47-6
Formula: C10H15N
KIN02607745
MFCD00061085
2-ETHYL-6-(1-METHYLETHYL)-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155600-88-6
Formula: C14H17NO
KIN05226519
2-ETHYL-6-(1-METHYLETHYL)PHENOL
CAS:52997-11-2
Formula: C11H16O
KIN02328706
2-ETHYL-6-(1-METHYLPROPYL)-ANILINE
CAS:71758-10-6
Formula: C12H19N
KIN02586691
MFCD00025210
2-ETHYL-6-(1-METHYLPROPYL)PHENOL
CAS:74926-91-3
Formula: C12H18O
KIN02609300
2-ETHYL-6-(1-PROPEN-1-YL)-ANILINE
CAS:68461-09-6
Formula: C11H15N
KIN02563475
2-ETHYL-6-(1-PROPEN-1-YL)PHENOL
CAS:130815-93-9
Formula: C11H14O
KIN03211620
2-ETHYL-6-(1H-IMIDAZOL-1-YL)-3(2H)-PYRIDAZINONE
CAS:170955-59-6
Formula: C9H10N4O
KIN03347972
2-ETHYL-6-(2-FLUORO-ETHOXY)-BENZENESULFONAMIDE
CAS:459812-69-2
KIN03595056
2-ETHYL-6-(2-HYDROXY-PHENYL)-5-NITRO-4(3H)-PYRIMIDINONE
CAS:110566-11-5
Formula: C12H11N3O4
KIN03633058
2-ETHYL-6-(2-HYDROXY-PROPAN-2-YL)-4H-CHROMEN-4-ONE
CAS:58282-54-5
Formula: C14H16O3
KIN02413204
2-ETHYL-6-(2-HYDROXYETHYL)-4H-CHROMEN-4-ONE
CAS:58282-52-3
Formula: C13H14O3
KIN02413202
2-ETHYL-6-(2-METHYL-[1,3]DIOXOLAN-2-YL)-ANILINE
CAS:177176-27-1
Formula: C12H17NO2
KIN03361946
2-ETHYL-6-(2-METHYL-ALLYL)PHENOL
CAS:73255-07-9
Formula: C12H16O
KIN02597075
2-ETHYL-6-(2-METHYLPROPOXY)-2H-PYRAN-3(6H)-ONE
CAS:66293-69-4
Formula: C11H18O3
KIN02539974
2-ETHYL-6-(2-METHYLPROPYL)-4-PYRIDINECARBOXYLIC ACID
CAS:1011347-24-2
Formula: C12H17NO2
KIN05017913
2-ETHYL-6-(2-METHYLPROPYL)-ANILINE
CAS:344303-36-2
Formula: C12H19N
KIN03519542
2-ETHYL-6-(3-ETHYLPHENYL)-3-METHYL-PYRIDINE
CAS:126202-05-9
Formula: C16H19N
KIN03191873
2-ETHYL-6-(3-METHOXYPHENYL)-4(3H)-PYRIMIDINONE
CAS:1055905-47-9
Formula: C13H14N2O2
KIN05102323
2-ETHYL-6-(4-METHOXYPHENYL)-PYRIDINE
CAS:134370-42-6
Formula: C14H15NO
KIN03227980
2-ETHYL-6-(4-METHYL-PIPERAZIN-1-YL)-BENZENESULFONIC ACID
CAS:460038-60-2
Formula: C13H20N2O3S
KIN03621843
2-ETHYL-6-(4H-[1,2,4]-TRIAZOL-4-YL)-BENZO[D]OXAZOLE
CAS:1134317-11-5
Formula: C11H10N4O
KIN05185156
2-ETHYL-6-(ALLYLOXY)-4-(TRIFLUOROMETHYL)-PYRIDINE
CAS:177098-98-5
Formula: C11H12F3NO
KIN03022758
2-ETHYL-6-(ALLYLTHIO)-ANILINE
CAS:126276-26-4
Formula: C11H15NS
KIN03192278
2-ETHYL-6-(BENZYL)-2,6-DIAZASPIRO[3.4]OCTANE
CAS:135380-40-4
Formula: C15H22N2
KIN03232607
2-ETHYL-6-(BENZYL)PHENOL
CAS:53346-84-2
Formula: C15H16O
KIN02333701
2-ETHYL-6-(ETHYLAMINO)-1H-1,3,5-TRIAZIN-4-ONE
CAS:57639-51-7
Formula: C7H12N4O
KIN02402789
2-ETHYL-6-(ETHYLMETHYLAMINO)-4-PYRIDINECARBOXYLIC ACID
CAS:1062669-15-1
Formula: C11H16N2O2
KIN05108384
2-ETHYL-6-(ETHYLTHIO)-4(1H)-PYRIMIDINONE
CAS:38249-53-5
Formula: C8H12N2OS
KIN02246509
2-ETHYL-6-(FLUOROMETHYL)-PYRIDINE
CAS:1025939-31-4
Formula: C8H10FN
KIN05059552
2-ETHYL-6-(FURAN-2-YL)-4,5-DIHYDROPYRIDAZIN-3(2H)-ONE
CAS:7627-78-3
Formula: C9H10N2O2
KIN01192443
2-ETHYL-6-(FURAN-2-YLMETHYLENE)-2,3-DIMETHYLCYCLOHEXAN-1-ONE
CAS:17429-56-0
Formula: C15H20O2
KIN02061979
2-ETHYL-6-(HEXYLOXY)DIHYDRO-2H-PYRAN-3(4H)-ONE
CAS:65712-99-4
Formula: C13H24O3
KIN02531256
2-ETHYL-6-(HYDROXYMETHYLENE)CYCLOHEXANONE
CAS:58711-03-8
Formula: C9H14O2
KIN02419851
2-ETHYL-6-(IMINOMETHYL)PHENOL
CAS:106897-55-6
Formula: C9H11NO
KIN03079543
2-ETHYL-6-(METHOXYMETHOXY)-BENZALDEHYDE%
CAS:1146962-14-2
Formula: C11H14O3
KIN05194875
2-ETHYL-6-(METHOXYMETHOXY)-BENZENEMETHANOL
CAS:1146962-13-1
Formula: C11H16O3
KIN05194874
2-ETHYL-6-(METHYLTHIO)-4(1H)-PYRIMIDINONE
CAS:38260-74-1
Formula: C7H10N2OS
KIN02246605
2-ETHYL-6-(METHYLTHIO)-ANILINE
CAS:102093-71-0
Formula: C9H13NS
KIN03044383
2-ETHYL-6-(METHYLTHIO)-BENZO[D]THIAZOLE
CAS:17142-78-8
Formula: C10H11NS2
KIN02058688
2-ETHYL-6-(METHYLTHIO)-QUINOLIN-4(1H)-ONE
CAS:135050-75-8
Formula: C12H13NOS
KIN03231159
2-ETHYL-6-(PIPERAZIN-1-YL)-BENZO[D]THIAZOLE
CAS:1176024-31-9
Formula: C13H17N3S
KIN05268487
2-ETHYL-6-(PROPAN-2-YLAMINO)-1H-1,3,5-TRIAZIN-4-ONE
CAS:57639-52-8
Formula: C8H14N4O
KIN02402790
2-ETHYL-6-(PYRROLIDIN-1-YL)-4(3H)-PYRIMIDINONE
CAS:159832-28-7
Formula: C10H15N3O
KIN03324424
2-ETHYL-6-(TRIFLUOROMETHYL)-2H-1,2,4-BENZOTHIADIAZINE1,1-DIOXIDE
CAS:727-48-0
KIN01027566
2-ETHYL-6-(TRIFLUOROMETHYL)-3-PYRIDINECARBOXALDEHYDE
CAS:1005172-44-0
Formula: C9H8F3NO
KIN05010249
2-ETHYL-6-(TRIFLUOROMETHYL)-4(3H)-PYRIMIDINONE
CAS:199114-65-3
Formula: C7H7F3N2O
KIN03405366
2-ETHYL-6-(TRIFLUOROMETHYL)-ANILINE
CAS:81949-54-4
Formula: C9H10F3N
KIN02652632
2-ETHYL-6-(TRIMETHYLSILYL)-2,5-CYCLOHEXADIEN-1-ONE
CAS:1123568-15-9
Formula: C11H18OSi
KIN05178671
2-ETHYL-6-(TRIMETHYLSILYL)-PYRIDINE
CAS:134435-21-5
Formula: C10H17NSi
KIN03228245
2-ETHYL-6-[(1R,3R,4S,5S)-5-[(1R,3R,5R,7R,8S,9S,10R)-5-ETHYL-7-HYDROXY-8,9,10-TRIMETHYL-2,4,6-TRIOXATRICYCLO[3.3.1.13,7]DEC-3-YL]-4-HYDROXY-1,3-DIMETHYL-2-OXOHEXYL]-3,5-DIMETHYL-4H-PYRAN-4-ONE
CAS:160098-73-7
Formula: C29H44O8
KIN03325112
2-ETHYL-6-[(2S)-1-HYDROXY-PROPAN-2-YL]-3,5-DIMETHYLPYRAN-4-ONE
CAS:152901-76-3
Formula: C12H18O3
KIN03303541
2-ETHYL-6-[(BENZYL)THIO]BENZOIC ACID METHYL ESTER
CAS:139665-73-9
KIN03254057
2-ETHYL-6-[(ISOPROPOXY)METHYLENE]CYCLOHEXANONE
CAS:65519-69-9
Formula: C12H20O2
KIN02528193
2-ETHYL-6-[(METHYL-IMINO)METHYL]-4-NITROPHENOL
CAS:63770-14-9
Formula: C10H12N2O3
KIN02498612
2-ETHYL-6-[(METHYL-IMINO)METHYL]PHENOL
CAS:63770-03-6
Formula: C10H13NO
KIN02498601
2-ETHYL-6-[(METHYLSULFINYL)METHYL]-ANILINE
CAS:92643-48-6
Formula: C10H15NOS
KIN02759668
2-ETHYL-6-[(METHYLTHIO)METHYL]-ANILINE
CAS:92643-44-2
Formula: C10H15NS
KIN02759665
2-ETHYL-6-[[4-[2-(3-ETHYL-5-METHYLPHENOXY)ETHOXY]-3-IODO-5-METHOXY-PHENYL]METHYLENE]-5,6-DIHYDRO-5-IMINO-7H-1,3,4-THIADIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:430432-49-8
Formula: C26H27IN4O4S
KIN03577652
2-ETHYL-6-[3-(FURAN-2-YL)ISOXAZOL-5-YL]-4-METHYLPHENOL
CAS:60477-85-2
Formula: C16H15NO3
KIN02444800
2-ETHYL-6-[4-(TRIFLUOROMETHYL)PHENYL]-4(3H)-PYRIMIDINONE
CAS:251299-35-1
Formula: C13H11F3N2O
KIN03621842
2-ETHYL-6-ALLYL-ANILINE
CAS:68461-02-9
Formula: C11H15N
KIN02563470
2-ETHYL-6-ALLYLPHENOL
CAS:3354-58-3
Formula: C10H12O
KIN01087467
2-ETHYL-6-ETHYNYL-4-METHYLBENZENEACETIC ACID
CAS:1131417-84-9
Formula: C13H14O2
KIN05182905
2-ETHYL-6-FLUORO-1-METHYL-3H-PYRROLO[1,2-A]INDOL-3-ONE
CAS:1057243-37-4
Formula: C14H12FNO
KIN05103692
2-ETHYL-6-FLUORO-1-PHENYL-1H-BENZO[D]IMIDAZOLE
CAS:97870-61-6
Formula: C15H13FN2
KIN02808389
2-ETHYL-6-FLUORO-1H-BENZO[D]IMIDAZOLE
CAS:1195774-88-9
Formula: C9H9FN2;C9H9FN2
KIN05338591
2-ETHYL-6-FLUORO-1H-INDOLE
CAS:437717-47-0
Formula: C10H10FN
KIN03581089
2-ETHYL-6-FLUORO-3-(2-FLUOROPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-25-1
Formula: C16H12F2N2O
KIN02288800
2-ETHYL-6-FLUORO-3-(2-METHYLPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-20-6
Formula: C17H15FN2O
KIN02288795
2-ETHYL-6-FLUORO-3-(3-FLUOROPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-26-2
Formula: C16H12F2N2O
KIN02288801
2-ETHYL-6-FLUORO-3-(3-METHYLPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-21-7
Formula: C17H15FN2O
KIN02288796
2-ETHYL-6-FLUORO-3-(3-METHYLPHENYL)-QUINAZOLIN-4-THIONE
CAS:49579-51-3
Formula: C17H15FN2S
KIN02288822
2-ETHYL-6-FLUORO-3-(4-FLUOROPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-27-3
Formula: C16H12F2N2O
KIN02288802
2-ETHYL-6-FLUORO-3-(4-METHOXY-PHENYL)-QUINAZOLIN-4-ONE
CAS:49579-23-9
Formula: C17H15FN2O2
KIN02288798
2-ETHYL-6-FLUORO-3-(4-METHYLPHENYL)-QUINAZOLIN-4-ONE
CAS:49579-22-8
Formula: C17H15FN2O
KIN02288797
2-ETHYL-6-FLUORO-3-[3-(TRIFLUOROMETHYL)PHENYL]QUINAZOLIN-4-ONE
CAS:49579-28-4
Formula: C17H12F4N2O
KIN02288803
2-ETHYL-6-FLUORO-3-[3-(TRIFLUOROMETHYL)PHENYL]QUINAZOLIN-4-THIONE
CAS:49579-53-5
Formula: C17H12F4N2S
KIN02288824
2-ETHYL-6-FLUORO-3-METHYL-QUINOLIN-4(1H)-ONE
CAS:444609-99-8
Formula: C12H12FNO
KIN03586689
2-ETHYL-6-FLUORO-3-METHYL-QUINOLIN-4-CARBOXYLIC ACID
CAS:436096-49-0
Formula: C13H12FNO2
KIN03580442
2-ETHYL-6-FLUORO-3-METHYL-QUINOLINE
CAS:1139922-36-3
Formula: C12H12FN
KIN05189060
2-ETHYL-6-FLUORO-3-PHENYL-QUINAZOLIN-4-ONE
CAS:49579-19-3
Formula: C16H13FN2O
KIN02288794
2-ETHYL-6-FLUORO-5-(TRIFLUOROMETHYL)-4(1H)-PYRIMIDINONE
CAS:119194-11-5
Formula: C7H6F4N2O
KIN03633057
2-ETHYL-6-FLUORO-8-METHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1154918-55-4
Formula: C12H12FNO
KIN05221126
2-ETHYL-6-FLUORO-ANILINE
CAS:53982-04-0
Formula: C8H10FN
KIN02343284
2-ETHYL-6-FLUORO-N-(2-METHOXYETHYL)-ANILINE
CAS:53982-00-6
Formula: C11H16FNO
KIN02343281
2-ETHYL-6-FLUORO-NAPHTHALENE
CAS:55830-95-0
Formula: C12H11F
KIN02373041
2-ETHYL-6-FLUORO-QUINOLIN-4(1H)-ONE
CAS:135077-31-5
Formula: C11H10FNO
KIN03231315
2-ETHYL-6-FLUORO-QUINOLINE
CAS:169316-80-7
Formula: C11H10FN
KIN03344628
2-ETHYL-6-FLUOROBENZO[D]THIAZOLE
CAS:170862-41-6
Formula: [C9H8FNS
KIN03347653
2-ETHYL-6-FLUOROBENZOFURAN
CAS:158837-81-1
Formula: [C10H9FO
KIN03321664
2-ETHYL-6-FLUOROBENZOIC ACID
CAS:479676-22-7
Formula: C9H9FO2
KIN03608234
2-ETHYL-6-FLUOROPHENOL
CAS:24539-97-7
Formula: C8H9FO
KIN02131415
2-ETHYL-6-FORMYLBENZENESULFONIC ACID%
CAS:1193545-94-6
Formula: C9H10O4S
KIN05335202
2-ETHYL-6-HYDRAZINYLPYRIDIN-4-CARBOXYLIC ACID HYDRAZIDE
CAS:54881-33-3
Formula: C8H13N5O
KIN02356914
2-ETHYL-6-HYDROXY-1H-BENZO[DE]ISOQUINOLIN-13(2H)-DIONE
CAS:42359-42-2
KIN02277807
2-ETHYL-6-HYDROXY-3-METHYLBENZOIC ACID ETHYL ESTER
CAS:81852-35-9
Formula: C12H16O3
KIN02652138
2-ETHYL-6-HYDROXY-3-METHYLPYRYLIUM
CAS:62968-82-5
Formula: C8H11O2
KIN02483790
2-ETHYL-6-HYDROXY-4(3H)-PYRIMIDINONE
CAS:3710-06-3
Formula: C14H13O
KIN01094449
2-ETHYL-6-HYDROXY-4-METHOXY-BENZOIC ACID
CAS:343773-25-1
Formula: C10H12O4
KIN03518088
2-ETHYL-6-HYDROXY-4H-PYRAN-4-ONE
CAS:64964-96-1
Formula: C7H8O3
KIN02518707
2-ETHYL-6-HYDROXY-5,8-QUINOXALINEDIONE
CAS:61373-05-5
Formula: C10H8N2O3
KIN02455177
2-ETHYL-6-HYDROXY-5-((2-METHOXY-4-NITROPHENYL)DIAZENYL)-1H-BENZO[DE]ISOQUINOLIN-1,3(2H)-DIONE
CAS:42358-36-1
Formula: C21H16N4O6
KIN02277803
2-ETHYL-6-HYDROXY-5-ALLYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1189681-88-6
Formula: C9H12N2O2
KIN05329292
2-ETHYL-6-HYDROXY-5-METHYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1189940-27-9
Formula: C7H10N2O2
KIN05329557
2-ETHYL-6-HYDROXY-5-NITRO-4(3H)-PYRIMIDINONE
CAS:6238-03-5
Formula: C24H22N2O7
KIN01153130
2-ETHYL-6-HYDROXY-5-PENTYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1189947-18-9
Formula: C11H18N2O2
KIN05329560
2-ETHYL-6-HYDROXY-BENZALDEHYDE
CAS:138308-78-8
Formula: C9H10O2
KIN03246061
2-ETHYL-6-HYDROXY-BENZO[D]OXAZOLE
CAS:171628-43-6
Formula: C9H9NO2
KIN03349468
2-ETHYL-6-HYDROXY-BENZOIC ACID
CAS:59681-42-4
Formula: C9H10O3
KIN02435415
2-ETHYL-6-HYDROXY-BENZOIC ACID ETHYL ESTER
CAS:82064-77-5
Formula: C11H14O3
KIN02653208
2-ETHYL-6-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:55836-64-1
Formula: C10H12O3
KIN02373125
2-ETHYL-6-HYDROXY-BETA-OXO-BENZENEPROPANOIC ACID TERT-BUTYL ESTER
CAS:252567-45-6
Formula: C15H20O4
KIN03452509
2-ETHYL-6-IMINO-5-METHYL-1(6H)-PYRIMIDINAMINE
CAS:150239-65-9
Formula: C7H12N4
KIN03295603
2-ETHYL-6-INDOLIZINECARBOXYLIC ACID METHYL ESTER
CAS:207791-83-1
KIN03417861
2-ETHYL-6-IODO-4(3H)-QUINAZOLINONE
CAS:252966-70-4
Formula: C10H9IN2O
KIN03453039
2-ETHYL-6-IODO-4-PYRIDINECARBOTHIOAMIDE
CAS:54881-29-7
Formula: C8H9IN2S
KIN02356910
2-ETHYL-6-IODO-4H-3,1-BENZOXAZIN-4-ONE
CAS:68100-92-5
Formula: C10H8INO2
KIN02560703
2-ETHYL-6-IODO-ALPHA-BENZENESULFONAMIDE
CAS:1064282-38-7
Formula: C8H10INO2S
KIN05108749
2-ETHYL-6-IODO-ALPHA-BENZENESULFONYL ISOCYANATE
CAS:1064273-93-3
Formula: C9H8INO3S
KIN05108717
2-ETHYL-6-IODO-PYRIDIN-4-CARBONITRILE
CAS:54881-24-2
Formula: C8H7IN2
KIN02356905
2-ETHYL-6-IODO-PYRIDIN-4-CARBOXAMIDE
CAS:54881-27-5
Formula: C8H9IN2O
KIN02356908
2-ETHYL-6-IODO-PYRIDIN-4-CARBOXYLIC ACID
CAS:54881-19-5
Formula: C8H8INO2
KIN02356900
2-ETHYL-6-IODO-PYRIDIN-4-CARBOXYLIC ACID HYDRAZIDE
CAS:54881-32-2
Formula: C8H10IN3O
KIN02356913
2-ETHYL-6-IODO-PYRIDIN-4-CARBOXYLIC ACID METHYL ESTER
CAS:54881-21-9
Formula: C9H10INO2
KIN02356902
2-ETHYL-6-IODO-PYRIDIN-4-CARBOXYLIC ACID SODIUM SALT
CAS:54881-25-3
Formula: C8H8INO2.Na
KIN02356906
2-ETHYL-6-IODO-PYRIDINE
CAS:342614-23-7
Formula: C7H8IN
KIN03516364
2-ETHYL-6-IODO-QUINOLIN-4(1H)-ONE
CAS:1154921-33-1
Formula: C11H10INO
KIN05221154
2-ETHYL-6-ISOCYANATO-4-PROPOXY-BENZOIC ACID METHYL ESTER
CAS:118718-70-0
Formula: C14H17NO4
KIN03621841
2-ETHYL-6-ISOCYANATO-BENZOIC ACID METHYL ESTER
CAS:123102-42-1
Formula: C11H11NO3
KIN03178156
2-ETHYL-6-ISOTHIOCYANATO-BENZO[D]THIAZOLE
CAS:42517-27-1
Formula: C10H8N2S2
KIN02279067
2-ETHYL-6-ISOTHIOCYANATO-PYRIDINE
CAS:1103425-65-5
Formula: C8H8N2S
KIN05168671
2-Isothiocyanato-6-ethylpyridine
2-ETHYL-6-MERCAPTO-PHENOL
CAS:470454-34-3
Formula: C8H10OS
KIN03599051
2-ETHYL-6-METHOXY-1,5-NAPHTHYRIDINE-4(1H)-ONE
CAS:135900-10-6
Formula: C11H12N2O2
KIN03234797
2-ETHYL-6-METHOXY-1-(BENZYL)-INDOLIZINE
CAS:177558-39-3
KIN03362625
2-ETHYL-6-METHOXY-1H-BENZO[D]IMIDAZOLE
CAS:23073-50-9
Formula: C10H12N2O
KIN02116493
2-ETHYL-6-METHOXY-1H-INDOLE
CAS:177342-72-2
KIN03362228
2-ETHYL-6-METHOXY-2,5-CYCLOHEXADIENE-1,4-DIONE
CAS:55137-03-6
Formula: C9H10O3
KIN02361349
2-ETHYL-6-METHOXY-3,6-DIHYDRO-2H-PYRAN-3-ONE
CAS:60249-14-1
Formula: C8H12O3
KIN02442879
2-ETHYL-6-METHOXY-3-(3-METHOXY-PHENYL)-1H-INDOLE
CAS:97968-21-3
Formula: C18H19NO2
KIN02809252
2-ETHYL-6-METHOXY-3-(4-METHOXY-PHENYL)-1H-INDOLE
CAS:91444-14-3
Formula: C18H19NO2
KIN02743768
2-ETHYL-6-METHOXY-3-METHYL-1H-INDOLE
CAS:34601-58-6
KIN02215308
2-ETHYL-6-METHOXY-3-METHYL-8-QUINOLINAMINE
CAS:118783-18-9
Formula: C13H16N2O
KIN03155940
2-ETHYL-6-METHOXY-3-METHYL-QUINOLINE
CAS:72406-58-7
Formula: C13H15NO
KIN02591185
2-ETHYL-6-METHOXY-4(3H)-PYRIMIDINONE
CAS:38249-51-3
Formula: C7H10N2O2
KIN02246507
2-ETHYL-6-METHOXY-4(3H)-QUINAZOLINONE
CAS:338739-36-9
Formula: C11H12N2O2
KIN03511130
2-ETHYL-6-METHOXY-4-METHYL-8-QUINOLINAMINE
CAS:73321-83-2
Formula: C13H16N2O
KIN02597567
2-ETHYL-6-METHOXY-4-METHYL-PYRIDINE
CAS:1035810-03-7
Formula: C9H13NO
KIN05069601
2-ETHYL-6-METHOXY-4-METHYLBENZENEACETIC ACID
CAS:1131417-72-5
Formula: C12H16O3
KIN05182902
2-ETHYL-6-METHOXY-4-METHYLPHENOL
CAS:90925-52-3
Formula: C10H14O2
KIN02735999
2-ETHYL-6-METHOXY-4-PROPYLPHENOL
CAS:86253-73-8
Formula: C12H18O2
KIN02679339
2-ETHYL-6-METHOXY-8-QUINOLINAMINE
CAS:67411-08-9
Formula: C12H14N2O
KIN02553138
2-ETHYL-6-METHOXY-ANILINE
CAS:53982-01-7
Formula: C9H13NO
KIN02343282
2-ETHYL-6-METHOXY-BENZO[D]THIAZOLE
CAS:17142-77-7
Formula: C10H11NOS
KIN02058687
2-ETHYL-6-METHOXY-BENZOIC ACID
CAS:72216-29-6
Formula: C10H12O3
KIN02589843
2-ETHYL-6-METHOXY-BENZOIC ACID ETHYL ESTER
CAS:186670-45-1
Formula: C12H16O3
KIN03382101
2-ETHYL-6-METHOXY-BENZOIC ACID METHYL ESTER
CAS:256664-96-7
Formula: C11H14O3
KIN03455841
2-ETHYL-6-METHOXY-N,N-DIMETHYLBENZAMIDE
CAS:135217-58-2
Formula: C12H17NO2
KIN03231858
2-ETHYL-6-METHOXY-N-(2-METHOXYETHYL)-ANILINE
CAS:53981-91-2
Formula: C12H19NO2
KIN02343279
2-ETHYL-6-METHOXY-NAPHTHALENE
CAS:21388-17-0
Formula: C13H15NO
KIN02100338
MFCD08704412
2-ETHYL-6-METHOXY-PHENOL
CAS:90534-46-6
Formula: C9H12O2
KIN02729483
2-ETHYL-6-METHOXY-PYRAZINE
CAS:67845-38-9
Formula: C7H10N2O
KIN02558654
2-ETHYL-6-METHOXY-PYRIDINE
CAS:199273-56-8
Formula: C8H11NO
KIN03405556
2-ETHYL-6-METHOXY-PYRIMIDIN-4-YLAMINE
CAS:122379-88-8
Formula: C7H11N3O
KIN03174507
2-ETHYL-6-METHOXY-QUINOLIN-4(1H)-ONE
CAS:135016-13-6
Formula: C12H13NO2
KIN03230981
2-ETHYL-6-METHOXYINDAN-1-ONE
CAS:100121-78-6
Formula: C12H14O2
KIN03028717
2-ETHYL-6-METHOXYNAPHTHALENE
CAS:1146894-92-9
Formula: [C13H15NO;C13H14O
KIN05194752
2-ETHYL-6-METHYL-1,2,4-TRIAZIN-5(2H)-ONE
CAS:81193-88-6
Formula: C6H9N3O
KIN02648419
2-ETHYL-6-METHYL-1,3-OXATHIANE
CAS:33709-59-0
Formula: C7H14OS
KIN02208224
2-ETHYL-6-METHYL-1,3-OXAZIN-4-ONE
CAS:141883-40-1
Formula: C7H9NO2
KIN03262436
2-ETHYL-6-METHYL-1,4-DIAZABICYCLO[2.2.2]OCTANE
CAS:67820-72-8
Formula: C9H18N2
KIN02558375
2-ETHYL-6-METHYL-1,5-NAPHTHYRIDIN-4(1H)-ONE
CAS:135900-22-0
Formula: C11H12N2O
KIN03234798
2-ETHYL-6-METHYL-1-PHENYL-1H-BENZO[D]IMIDAZOLE
CAS:97870-59-2
Formula: C16H16N2
KIN02808387
2-ETHYL-6-METHYL-1-PIPERIDINECARBOXYLIC ACID TERT-BUTYL ESTER
CAS:409061-23-0
Formula: C13H25NO2
KIN03568984
2-ETHYL-6-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:30411-81-5
Formula: C10H12N2
KIN02182056
2-ETHYL-6-METHYL-1H-INDOL-3-ACETIC ACID
CAS:20955-90-2
KIN02095889
2-ETHYL-6-METHYL-1H-INDOL-3-ACETIC ACID METHYL ESTER
CAS:21164-69-2
KIN02097951
2-ETHYL-6-METHYL-1H-INDOL-3-ACETONITRILE
CAS:20955-88-8
KIN02095887
2-ETHYL-6-METHYL-1H-INDOLE
CAS:91131-83-8
KIN02739126
2-ETHYL-6-METHYL-2,5-CYCLOHEXADIENE-1,4-DIONE
CAS:109848-40-0
Formula: C9H10O2
KIN03097716
2-ETHYL-6-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:17959-92-1
Formula: C11H13NO2
KIN02067374
2-ETHYL-6-METHYL-3,4-DIPROPYL-PYRIDINE
CAS:432556-35-9
Formula: C14H23N
KIN03578748
2-ETHYL-6-METHYL-3-(3-METHYL-ISOXAZOL-5-YL)-4(3H)-QUINAZOLINONE
CAS:144485-88-1
Formula: C15H15N3O2
KIN03275904
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE
CAS:123939-43-5
KIN03182010
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE CITRATE
CAS:1048640-20-5
KIN05096691
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE FUMARATE (2:1)
CAS:1182844-32-1
KIN05297886
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE HBR
CAS:1179369-00-6
KIN05284791
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE HCL
CAS:73561-05-4
KIN02599083
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE N1-OXIDE
CAS:30810-24-3
Formula: C8H11NO2
KIN02185020
2-ETHYL-6-METHYL-3-HYDROXY-PYRIDINE PHOSPHATE (1:1)
CAS:1035640-34-6
KIN05069435
2-ETHYL-6-METHYL-3-PYRIDINECARBOXYLIC ACID ETHYL ESTER
CAS:181269-80-7
Formula: C11H15NO2
KIN03370714
2-ETHYL-6-METHYL-3H-PYRAZOLO[1,5-B][1,2,4]-TRIAZOLE
CAS:151406-47-2
Formula: [C7H10N4
KIN03299255
2-ETHYL-6-METHYL-4(1H)-PYRIDINONE
CAS:57276-07-0
Formula: C8H11NO
KIN02396976
2-ETHYL-6-METHYL-4(3H)-PYRIMIDINONE
CAS:16858-50-7
Formula: C7H10N2O
KIN02055704
2-ETHYL-6-METHYL-4(3H)-QUINAZOLINONE
CAS:130379-70-3
Formula: C11H12N2O
KIN03209623
2-ETHYL-6-METHYL-4-(1,5,9-TRIMETHYLDECYL)MORPHOLINE
CAS:67641-90-1
Formula: C20H41NO
KIN02556147
2-ETHYL-6-METHYL-4-(1-METHYLBUT-2-EN-1-YL)-ANILINE
CAS:95454-54-9
Formula: C14H21N
KIN02791598
2-ETHYL-6-METHYL-4-(BENZENESULFONYL)-ANILINE
CAS:116906-31-1
KIN03146458
2-ETHYL-6-METHYL-4-(PHENYLTHIO)-ANILINE
CAS:116906-25-3
KIN03146456
2-ETHYL-6-METHYL-4-[(4-METHYLPHENYL)THIO]-ANILINE
CAS:116906-26-4
KIN03018758
2-ETHYL-6-METHYL-4-HYDROXY-PHENOL
CAS:72693-14-2
Formula: C9H12O2
KIN02593188
2-ETHYL-6-METHYL-4-HYDROXY-PYRIDINE
CAS:15898-18-7
Formula: C8H11NO
KIN02045304
2-ETHYL-6-METHYL-4-NITRO-3-HYDROXY-PYRIDINE
CAS:19837-20-8
Formula: C8H10N2O3
KIN02085246
2-ETHYL-6-METHYL-4-NITRO-3-HYDROXY-PYRIDINE N1-OXIDE
CAS:30810-25-4
Formula: C8H10N2O4
KIN02185021
2-ETHYL-6-METHYL-4-NITROPHENOL
CAS:32021-54-8
Formula: C9H11NO3
KIN02193853
2-ETHYL-6-METHYL-4-NITROPYRIDINE N1-OXIDE
CAS:38594-63-7
Formula: C8H10N2O3
KIN02249105
2-ETHYL-6-METHYL-4-OXO-N-PHENYLPYRAN-3-CARBOXAMIDE
CAS:104688-27-9
Formula: C15H15NO3
KIN03063121
2-ETHYL-6-METHYL-4-PYRIDINECARBONYL CHLORIDE
CAS:1122092-66-3
Formula: C9H10ClNO
KIN05178325
2-Ethyl-6-methylisonicotinoyl chloride
2-ETHYL-6-METHYL-4-PYRIDINECARBOTHIOAMIDE
CAS:51454-18-3
Formula: C9H12N2S
KIN02306744
2-ETHYL-6-METHYL-4-PYRIDINECARBOXAMIDE
CAS:1122091-62-6
Formula: C9H12N2O
KIN05178299
2-ETHYL-6-METHYL-4-PYRIDINECARBOXYLIC ACID ETHYL ESTER
CAS:1122091-59-1
Formula: C11H15NO2
KIN05178298
2-Ethyl-6-methylpyridin-4-carboxylic acid ethyl ester
2-ETHYL-6-METHYL-4H-1,3-THIAZIN-4-ONE
CAS:86137-34-0
Formula: C7H9NOS
KIN02678565
2-ETHYL-6-METHYL-4H-3,1-BENZOXAZIN-4-ONE
CAS:157834-02-1
Formula: C11H11NO2
KIN03319041
2-ETHYL-6-METHYL-4H-PYRAN-4-ONE
CAS:57276-03-6
Formula: C8H10O2
KIN02396975
2-ETHYL-6-METHYL-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE
CAS:63736-04-9
Formula: C11H12N2O
KIN02498000
2-ETHYL-6-METHYL-5-(BENZYL)-4(3H)-ALPHA-PYRIMIDINONE
CAS:1185147-02-7
Formula: C14H16N2O
KIN05318518
2-ETHYL-6-METHYL-5-ALLYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1185004-06-1
Formula: C10H14N2O
KIN05318298
2-ETHYL-6-METHYL-5-PENTYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1189498-35-8
Formula: C12H20N2O
KIN05329060
2-ETHYL-6-METHYL-5-PHENYL-4(3H)-PYRIMIDINONE
CAS:377760-40-2
Formula: C13H14N2O
KIN03546860
2-ETHYL-6-METHYL-5-PROPYL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1189708-63-1
Formula: C10H16N2O
KIN05329312
2-ETHYL-6-METHYL-ANILINE
CAS:24549-06-2
Formula: C9H13N
KIN02131489
MFCD00007752
2-ETHYL-6-METHYL-ANILINE HCL
CAS:50522-39-9
Formula: C9H13N.ClH
KIN02293891
2-ETHYL-6-METHYL-ANILINE, SULFURIC ACID
CAS:137374-00-6
Formula: C9H13N.1/2H2O4S
KIN03241221
2-ETHYL-6-METHYL-BIPHENYL
CAS:91363-48-3
Formula: C15H16
KIN02742524
2-ETHYL-6-METHYL-DIBENZO[B]THIOPHENE
CAS:1145671-58-4
Formula: C15H14S
KIN05193681
2-ETHYL-6-METHYL-HEPTADECANOIC ACID
CAS:90835-60-2
Formula: C20H40O2
KIN02734213
2-ETHYL-6-METHYL-HEXADECANOIC ACID
CAS:90835-61-3
Formula: C19H38O2
KIN02734214
2-ETHYL-6-METHYL-N,3-BIS(TRICYCLO[3.3.1.13,7]DEC-1-YLOXY)-4-AMINOPYRIDINE HCL
CAS:126947-75-9
Formula: C28H40N2O2HCl
KIN03195308
2-ETHYL-6-METHYL-N,N-DIPHENYL-ANILINE
CAS:256660-16-9
Formula: C21H21N
KIN03455824
2-ETHYL-6-METHYL-N-(1-METHYLBUT-2-EN-1-YL)-ANILINE
CAS:95454-53-8
Formula: C14H21N
KIN02791597
2-ETHYL-6-METHYL-N-(1-METHYLETHYL)-ANILINE
CAS:73147-41-8
Formula: C12H19N
KIN02596231
2-ETHYL-6-METHYL-N-(1-METHYLETHYLIDENE)-ANILINE
CAS:85384-98-1
Formula: C12H17N
KIN02673941
2-ETHYL-6-METHYL-N-(1-METHYLPROPYL)-ANILINE
CAS:1184793-76-7
Formula: C13H21N
KIN05317477
2-ETHYL-6-METHYL-N-(2,4,7-TRINITRO-9H-FLUOREN-9-YLIDENE)-ANILINE
CAS:180142-96-5
Formula: C22H16N4O6
KIN03368513
2-ETHYL-6-METHYL-N-(2-METHYLPROPYL)-ANILINE
CAS:1175838-38-6
Formula: C13H21N
KIN05267747
2-ETHYL-6-METHYL-N-(2-METHYLPROPYLIDENE)-ANILINE
CAS:79937-89-6
Formula: C13H19N
KIN02640796
2-ETHYL-6-METHYL-N-(3-METHYL-2-OXAZOLIDINYLIDENE)-ANILINE
CAS:33587-38-1
Formula: C13H18N2O
KIN02207085
2-ETHYL-6-METHYL-N-1-PROPEN-1-YL-ANILINE
CAS:72825-55-9
Formula: C12H17N
KIN02594145
2-ETHYL-6-METHYL-N-METHYLENE-ANILINE
CAS:35203-06-6
Formula: C10H13N
KIN02220781
N-(2-Ethyl-6-methylphenyl)methanimine
2-ETHYL-6-METHYL-N-PHENYL-ANILINE
CAS:287481-04-3
Formula: C15H17N
KIN03469285
2-ETHYL-6-METHYL-N-PROPARGYL-ANILINE
CAS:53443-87-1
Formula: C12H15N
KIN02335351
2-ETHYL-6-METHYL-N-PROPYL-ANILINE
CAS:1175920-50-9
Formula: C12H19N
KIN05268124
2-ETHYL-6-METHYL-N-SULFINYL-ANILINE
CAS:51068-26-9
Formula: C9H11NOS
KIN02301162
2-ETHYL-6-METHYL-NAPHTHALENE
CAS:7372-87-4
Formula: C16H14
KIN01185343
2-ETHYL-6-METHYL-OCTADECANOIC ACID
CAS:90835-59-9
Formula: C21H42O2
KIN02734212
2-ETHYL-6-METHYL-PIPERAZINE
CAS:32736-19-9
KIN02199490
2-ETHYL-6-METHYL-QUINOLIN-4(1H)-ONE
CAS:123637-44-5
Formula: C12H13NO
KIN03180482
2-ETHYL-6-METHYL-QUINOLINE
CAS:116529-82-9
Formula: C12H13N
KIN03144398
2-ETHYL-6-METHYL-THIAZOLO[3,2-B][1,2,4]-TRIAZOLE
CAS:62032-89-7
Formula: C7H9N3S
KIN02466514
2-ETHYL-6-METHYLBENZALDEHYDE
CAS:106976-44-7
Formula: C10H12O
KIN03080194
2-ETHYL-6-METHYLBENZAMIDE
CAS:1189379-42-7
Formula: C10H13NO
KIN05328981
2-ETHYL-6-METHYLBENZENEMETHANOL
CAS:106976-43-6
Formula: C10H14O
KIN03080193
2-ETHYL-6-METHYLBENZENESULFONAMIDE
CAS:1094671-90-5
Formula: C9H13NO2S
KIN05143882
2-ETHYL-6-METHYLBENZO[D]ISOTHIAZOL-3(2H)-ONE 1-OXIDE
CAS:257952-99-1
Formula: [C10H11NO2S
KIN03456399
2-ETHYL-6-METHYLBENZO[D]THIAZOLE
CAS:1188158-75-9
Formula: C10H11NS
KIN05326166
2-ETHYL-6-METHYLBENZOFURAN
CAS:139717-99-0
Formula: [C11H12O]
KIN03254286
2-ETHYL-6-METHYLBENZOIC ACID
CAS:106976-50-5
Formula: C10H12O2
KIN03080200
2-ETHYL-6-METHYLBENZOIC ACID 2,2-DIMETHYLHYDRAZIDE
CAS:256664-89-8
Formula: C12H18N2O
KIN03013805
2-ETHYL-6-METHYLBENZOIC ACID METHYL ESTER
CAS:106987-84-2
Formula: C11H14O2
KIN03080273
2-ETHYL-6-METHYLBENZONITRILE
CAS:95881-22-4
Formula: C10H11N
KIN02795954
MFCD00052864
2-ETHYL-6-METHYLCYCLOHEXYLAMINE
CAS:24216-76-0
Formula: C9H19N
KIN02128120
2-ETHYL-6-METHYLNONADECANOIC ACID
CAS:90835-58-8
Formula: C22H44O2
KIN02734211
2-ETHYL-6-METHYLPHENOL
CAS:1687-65-6
Formula: C9H12O
KIN01053374
2-ETHYL-6-METHYLPHENOL 1-METHANESULFONATE
CAS:288402-28-8
Formula: C10H14O3S
KIN03470218
2-ETHYL-6-METHYLPHENOL 1-PROPANOATE
CAS:1195245-16-9
Formula: C12H16O2
KIN05336639
2-ETHYL-6-METHYLPIPERIDINE
CAS:1195580-43-8
KIN05337619
2-ETHYL-6-METHYLPYRAZINE
CAS:13925-03-6
Formula: C7H10N2
KIN02026027
2-ETHYL-6-METHYLPYRIDINE
CAS:1122-70-9
Formula: C8H9N
KIN01040316
2-ETHYL-6-METHYLPYRIDINE N1-OXIDE
CAS:19917-16-9
Formula: C8H11NO
KIN02086134
2-ETHYL-6-METHYLPYRIMIDIN-4-YLAMINE
CAS:36999-33-4
Formula: C7H11N3
KIN02236079
MFCD16690444
2-ETHYL-6-MORPHOLIN-4-YL-4(1H)-PYRIMIDINONE HYDRAZONE
CAS:94415-45-9
Formula: C10H17N5O
KIN02781700
2-ETHYL-6-NITRO-1-BENZOFURAN-3-CARBONITRILE
CAS:42901-91-7
Formula: C11H8N2O3
KIN02281327
2-ETHYL-6-NITRO-1H-BENZO[DE]ISOQUINOLIN-1,3(2H)-DIONE
CAS:39061-37-5
Formula: C14H10N2O4
KIN02252371
N-Ethyl-4-nitro-naphthalimide; 4-Nitro-N-ethyl-1,8
2-ETHYL-6-NITRO-2H-INDAZOLE
CAS:65642-29-7
Formula: C9H9N3O2
KIN02530072
2-ETHYL-6-NITRO-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:21714-54-5
KIN02103502
2-ETHYL-6-NITRO-4(3H)-QUINAZOLINONE
CAS:153681-13-1
Formula: C10H9N3O3
KIN03305962
2-ETHYL-6-NITRO-4-(BENZYL)-ANILINE
CAS:51639-53-3
Formula: C15H16N2O2
KIN02309525
2-ETHYL-6-NITRO-4-PYRIDINECARBOXAMIDE
CAS:65384-96-5
Formula: C8H9N3O3
KIN02525856
2-ETHYL-6-NITRO-ANILINE
CAS:59816-94-3
Formula: C8H10N2O2
KIN02437584
2-ETHYL-6-NITRO-BENZO[D]OXAZOLE
CAS:13243-39-5
Formula: C9H8N2O3
KIN02016907
2-ETHYL-6-NITRO-BENZO[D]THIAZOLE
CAS:17142-80-2
Formula: C9H8N2O2S
KIN02058690
2-ETHYL-6-NITRO-BENZONITRILE
CAS:58580-00-0
Formula: C9H8N2O2
KIN02417872
2-ETHYL-6-NITROPHENOL
CAS:28177-67-5
Formula: C8H9NO3
KIN02163903
2-ETHYL-6-NITROQUINAZOLINE
CAS:221641-96-9
Formula: C10H9N3O2
KIN03436662
2-ETHYL-6-NITROQUINOLIN-4(1H)-ONE
CAS:112182-48-6
Formula: C11H10N2O3
KIN03113342
2-ETHYL-6-NITROQUINOLIN-4-OL
CAS:99985-02-1
Formula: C11H10N2O3
KIN02824153
2-ETHYL-6-NITROQUINOLINE
CAS:70858-09-2
Formula: C11H10N2O2
KIN02580290
2-ETHYL-6-NITROSO-PHENOL
CAS:202754-55-0
Formula: C8H9NO2
KIN03410976
2-ETHYL-6-OXA-BICYCLO[3.1.0]HEXANE
CAS:349654-71-3
Formula: [C7H12O]
KIN03527232
2-ETHYL-6-OXO-HEPTANOIC ACID
CAS:85054-82-6
Formula: C9H16O3
KIN02671551
2-ETHYL-6-OXO-PIPERIDIN-4-CARBOXYLIC ACID
CAS:38478-84-1
Formula: C8H13NO3
KIN02248345
2-ETHYL-6-PENTOFURANOSYL[1,3]OXAZOLO[5,4-D]PYRIMIDIN-7(6H)-ONE
CAS:42014-94-8
KIN02275174
2-ETHYL-6-PHENOXY-4(3H)-PYRIMIDINONE
CAS:38249-49-9
Formula: C12H12N2O2
KIN02246505
2-ETHYL-6-PHENYL-1,2,4-TRIAZIN-5(2H)-ONE
CAS:308276-78-0
Formula: [C11H11N3O
KIN03483970
2-ETHYL-6-PHENYL-3-PYRIDINOL
CAS:188669-97-8
Formula: C13H13NO
KIN03385566
2-ETHYL-6-PHENYL-4(1H)-PYRIDINONE
CAS:92028-46-1
Formula: C13H13NO
KIN02752005
2-ETHYL-6-PHENYL-4(3H)-PYRIMIDINONE
CAS:52421-76-8
Formula: C12H12N2O
KIN02320965
2-ETHYL-6-PHENYL-4H-1,3-OXAZIN-4-ONE PERCHLORATE
CAS:63673-54-1
Formula: C12H11NO2.ClHO4
KIN02496974
2-ETHYL-6-PHENYL-8H-<1,3,4>THIADIAZOLO<3,2-A>THIENO<2,3-D>PYRIMIDIN-8-ONE
CAS:103357-77-3
Formula: C15H11N3OS2
KIN03053309
2-ETHYL-6-PHENYL-NAPHTHALENE
CAS:1016160-95-4
Formula: C18H16
KIN05021530
2-ETHYL-6-PHENYL-THIAZOLO[3,2-B][1,2,4]-TRIAZOLE
CAS:67944-14-3
KIN02559499
2-ETHYL-6-PHENYLCYCLOHEXANONE
CAS:92862-85-6
KIN02762357
2-ETHYL-6-PHENYLMORPHOLINE
CAS:1156337-05-1
Formula: C12H17NO
KIN05233224
2-ETHYL-6-PHENYLPYRIDINE
CAS:59239-12-2
Formula: C13H13N
KIN02428559
2-ETHYL-6-PHENYLPYRROLO[3,2-D]PYRIMIDIN-4-OL
CAS:237435-32-4
Formula: C14H13N3O
KIN03444751
2-ETHYL-6-PHENYLTHIENO[2,3-D]PYRIMIDINE-4(1H)-ONE
CAS:1082128-72-0
Formula: C14H12N2OS
KIN05118517
2-ETHYL-6-PIPERAZIN-1-YLBENZENESULFONIC ACID
CAS:460038-42-0
Formula: C12H18N2O3S
KIN03595186
2-ETHYL-6-PIPERIDIN-1-YL-4(1H)-PYRIMIDINONE HYDRAZONE
CAS:94415-43-7
Formula: C11H19N5
KIN02781699
2-ETHYL-6-PROPOXY-4(3H)-PYRIMIDINONE
CAS:38249-37-5
Formula: C9H14N2O2
KIN02246493
2-ETHYL-6-PROPYL-3-PYRIDINOL
CAS:188670-01-1
Formula: C10H15NO
KIN03385569
2-ETHYL-6-PROPYL-4(3H)-PYRIMIDINONE
CAS:90565-55-2
Formula: C9H14N2O
KIN02730200
2-ETHYL-6-PROPYL-ANILINE
CAS:96343-14-5
Formula: C11H17N
KIN02800085
2-ETHYL-6-PROPYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1152999-22-8
Formula: C14H17NO
KIN05203633
2-ETHYL-6-PROPYLPHENOL
CAS:46034-85-9
Formula: C11H16O
KIN02284790
2-ETHYL-6-PROPYLPYRAZINE
CAS:32736-92-8
KIN02199497
2-ETHYL-6-PROPYLPYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:1198774-13-8
Formula: C13H19NO2
KIN05342973
2-ETHYL-6-PROPYLPYRIDINE
CAS:40946-43-8
Formula: C10H15N
KIN02267144
2-ETHYL-6-PYRIDIN-4-YL-4(3H)-PYRIMIDINONE
CAS:263243-50-1
Formula: [C11H11N3O
KIN03460454
2-ETHYL-6-THIO-INOSINE
CAS:42890-35-7
KIN02281260
2-ETHYL-7,8-DIHYDRO-2-METHYL-1H,6H-PYRAZOLO[1,2-A]INDAZOL-1,3,9(2H,5H)-TRIONE
CAS:53179-92-3
Formula: C13H16N2O3
KIN02331388
2-ETHYL-7,8-DIHYDRO-2-PROPYL-1H,6H-PYRAZOLO[1,2-A]INDAZOL-1,3,9(2H,5H)-TRIONE
CAS:53180-02-2
Formula: C15H20N2O3
KIN02331398
2-ETHYL-7,8-DIMETHOXY-1-METHYL-NAPHTHALENE
CAS:93464-65-4
Formula: C15H18O2
KIN02769570
2-ETHYL-7,8-DIMETHOXY-4-PHENYL-1,3,3A,4,5,9B-HEXAHYDRO-BENZO[E]ISOINDOLE, HCL
CAS:35202-53-0
Formula: C22H28ClNO2
KIN02220769
2-ETHYL-7,8-DIMETHOXY-PYRIMIDO[4,5-B]QUINOLIN-4(1H)-ONE
CAS:55149-32-1
Formula: C15H15N3O3
KIN02361554
2-ETHYL-7,8-DIMETHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155603-25-0
Formula: C13H15NO
KIN05226549
2-ETHYL-7-(4-HYDROXY-2,3,5-TRIMETHYLPHENOXY)-2-METHYL-HEPTANOIC ACID
CAS:112109-71-4
Formula: C19H30O4
KIN03112714
2-ETHYL-7-(BENZYL)-2,7-DIAZASPIRO[4.4]NONANE
CAS:99735-28-1
Formula: C16H24N2
KIN02822098
2-ETHYL-7-(BENZYL)-2,7-DIAZASPIRO[4.4]NONANE 2HCL
CAS:91189-30-9
Formula: C16H26Cl2N2
KIN02740084
2-ETHYL-7-(HYDROXYMETHYL)-QUINOLIN-4(1H)-ONE
CAS:135050-86-1
Formula: C12H13NO2
KIN03231163
2-ETHYL-7-(TRIFLUOROMETHYL)-1,8-NAPHTHYRIDINE-3-CARBOXYLIC ACID
CAS:1188431-38-0
Formula: C12H9F3N2O2
KIN05327617
2-Ethyl-7-trifluoromethyl-[1,8]naphthyridin-3-carboxylic acid
2-ETHYL-7-(TRIFLUOROMETHYL)-1,8-NAPHTHYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:1188433-65-9
Formula: C14H13F3N2O2
KIN05327638
Ethyl 2-ethyl-7-trifluoromethyl-[1,8]naphthyridin-3-carboxylate
2-ETHYL-7-BENZO[D]OXAZOLAMINE
CAS:1018558-22-9
Formula: C9H10N2O
KIN05038004
2-ETHYL-7-BENZO[D]THIAZOLOL
CAS:163299-22-7
Formula: [C9H9NOS
KIN03333415
2-ETHYL-7-FLUORO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:103362-09-0
Formula: C10H10FNO2
KIN03017467
2-ETHYL-7-FLUORO-4H-3,1-BENZOXAZIN-4-ONE
CAS:128992-57-4
Formula: C10H8FNO2
KIN03203901
2-ETHYL-7-FLUORO-9H-XANTHEN-9-ONE
CAS:149191-02-6
KIN03291657
2-ETHYL-7-HYDROXY-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:408335-41-1
Formula: C9H10O2
KIN03568315
2-ETHYL-7-HYDROXY-5-METHYL-4H-CHROMEN-4-ONE
CAS:62036-42-4
Formula: C12H12O3
KIN02466628
2-ETHYL-7-IODO-9,9-DIMETHYL-9H-FLUORENE
CAS:198291-17-7
Formula: C17H17I
KIN03404251
2-ETHYL-7-METHOXY-1H-BENZO[D]IMIDAZOLE
CAS:114224-42-9
Formula: C10H12N2O
KIN03129399
2-ETHYL-7-METHOXY-1H-INDOLE
CAS:350821-53-3
Formula: [C11H13NO]
KIN03527928
2-ETHYL-7-METHOXY-3-(BENZYL)-INDOLIZINE
CAS:177559-67-0
KIN03362639
2-ETHYL-7-METHOXY-3-METHYL-1H-INDOLE
CAS:114540-18-0
KIN03131583
2-ETHYL-7-METHOXY-3-METHYL-QUINOLINE
CAS:80609-97-8
Formula: C13H15NO
KIN02645164
2-ETHYL-7-METHOXY-5-METHYL-4H-CHROMEN-4-ONE
CAS:62036-45-7
Formula: C13H14O3
KIN02466629
2-ETHYL-7-METHOXY-5-NITRO-BENZO[B]FURAN
CAS:1036648-17-5
Formula: C11H11NO4
KIN05072624
2-ETHYL-7-METHOXY-BENZO[D]THIAZOLE
CAS:163299-21-6
Formula: [C10H11NOS
KIN03333414
2-ETHYL-7-METHOXY-BENZOFURAN
CAS:102234-44-6
Formula: C11H12O2
KIN03045570
2-ETHYL-7-METHOXY-FURO[2,3-C]PYRIDINE
CAS:252029-45-1
Formula: C10H11NO2
KIN03452065
2-ETHYL-7-METHOXY-INDOLIZINE
CAS:182116-41-2
KIN03372082
2-ETHYL-7-METHOXY-N-[2-[[(4-METHYLPHENYL)SULFONYL]METHOXY]-ETHYL]-3-BENZO[B]FURANMETHANAMINE
CAS:6523-22-4
KIN01164181
2-ETHYL-7-METHOXY-QUINOLIN-4(1H)-ONE
CAS:135016-08-9
Formula: C12H13NO2
KIN03230979
2-ETHYL-7-METHOXY-SYN-BICYCLO[2.2.1]HEPTA-2,5-DIENE
CAS:197565-55-2
Formula: [C10H14O
KIN03402652
2-ETHYL-7-METHYL-1,8-NAPHTHYRIDIN-4(1H)-ONE
CAS:63736-09-4
Formula: C11H12N2O
KIN02498002
2-ETHYL-7-METHYL-1-BENZO[B]THIOPHENE
CAS:16587-43-2
Formula: C11H12S
KIN02052861
2-ETHYL-7-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:77303-09-4
Formula: C10H12N2
KIN02624699
2-ETHYL-7-METHYL-1H-IMIDAZO[4,5-B]PYRIDIN-5-CARBONITRILE
CAS:147404-79-3
Formula: C10H10N4
KIN03621840
2-ETHYL-7-METHYL-1H-INDOLE
CAS:91131-84-9
KIN02739127
2-ETHYL-7-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:440627-12-3
Formula: C11H13NO2
KIN03026922
2-ETHYL-7-METHYL-3-(3-METHYL-ISOXAZOL-5-YL)-4(3H)-QUINAZOLINONE
CAS:144485-92-7
Formula: C15H15N3O2
KIN03275908
2-ETHYL-7-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:133240-12-7
Formula: C9H11N3
KIN03222688
2-ETHYL-7-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE 4-OXIDE
CAS:137421-78-4
Formula: C9H11N3O
KIN03009414
2-ETHYL-7-METHYL-4-NITRO-1H-INDOLE
CAS:1000604-09-0
Formula: C11H12N2O2
KIN05004500
2-ETHYL-7-METHYL-6-BENZO[D]OXAZOLOL
CAS:1084802-72-1
Formula: C10H11NO2
KIN05124891
2-ETHYL-7-METHYL-9H-XANTHEN-9-ONE
CAS:115967-35-6
KIN03140096
2-ETHYL-7-METHYL-NAPHTHALENE
CAS:17059-55-1
Formula: C13H14
KIN02057670
2-ETHYL-7-METHYL-QUINOLIN-4(1H)-ONE
CAS:135016-20-5
Formula: C12H13NO
KIN03230984
2-ETHYL-7-METHYLBENZO[1,2-D:4,3-D']BISTHIAZOLE
CAS:81693-91-6
KIN02651183
2-ETHYL-7-METHYLHEXAHYDROIMIDAZO[1,5-A]PYRAZIN-3(2H)-ONE
CAS:56904-20-2
Formula: C9H17N3O
KIN02390520
2-ETHYL-7-METHYLPYRAZOLO[1,5-A]PYRIDIN-3-CARBONITRILE
CAS:110886-22-1
KIN03104186
2-ETHYL-7-METHYLPYRAZOLO[1,5-A]PYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:110886-25-4
KIN03104189
2-ETHYL-7-METHYLTHIENO[2,3-C]PYRIDINE
CAS:120010-04-0
Formula: C10H11NS
KIN03161871
2-ETHYL-7-NITRO-1,2,3,4-TETRAHYDRO-ISOQUINOLINE
CAS:72963-93-0
KIN02594979
2-ETHYL-7-NITRO-1-PROPYL-5-(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:55702-44-8
Formula: C13H14F3N3O2
KIN02370637
2-ETHYL-7-NITRO-1H-BENZO[D]IMIDAZOLE
CAS:101236-92-4
Formula: C9H9N3O2
KIN03037854
2-ETHYL-7-NITRO-2,3-DIHYDROIMIDAZO[1,2-F]PHENANTHRIDINE
CAS:38181-07-6
Formula: C17H15N3O2
KIN02245891
2-ETHYL-7-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:85160-85-6
Formula: C10H10N2O4
KIN02672395
2-ETHYL-7-NITRO-2H-INDAZOLE
CAS:41926-13-0
Formula: C9H9N3O2
KIN02274442
2-ETHYL-7-NITRO-4(3H)-QUINAZOLINONE
CAS:26059-82-5
Formula: C10H9N3O3
KIN02145146
2-ETHYL-7-NITRO-4-QUINAZOLINOL 3-OXIDE
CAS:1144-71-4
Formula: C16H14O
KIN01041458
2-ETHYL-7-NITRO-9H-XANTHEN-9-ONE
CAS:107918-12-7
KIN03085774
2-ETHYL-7-OXA-BICYCLO[4.1.0]HEPTANE
CAS:223480-81-7
Formula: [C8H14O
KIN03438078
2-ETHYL-7-PROPYL-6-[[2'-(2H-TETRAZOL-5-YL)-BIPHENYL-4-YL]METHYL][1,2,4]-TRIAZOLO[1,5-A]PYRIMIDIN-5(1H)-ONE
CAS:168152-74-7
Formula: C24H24N8O
KIN03342354
2-ETHYL-7H-1,3,4-THIADIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:94605-12-6
Formula: C7H7N3OS
KIN02783313
2-ETHYL-8-(1-METHYLETHYL)-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155603-56-7
Formula: C14H17NO
KIN05226552
2-ETHYL-8-(2-ETHYL-[1,3]DIOXOLAN-2-YL)-INDOLIZINE
CAS:1005475-84-2
Formula: C15H19NO2
KIN05010584
2-Ethyl-8-(2-ethyl-[1,3]dioxolan-2-yl)-indolizine
2-ETHYL-8-(2-OXO-BUTOXY)-1-INDOLIZINEACETAMIDE
CAS:177558-50-8
KIN03362628
2-ETHYL-8-(2S)-2-OXIRANYL-QUINOLINE
CAS:261899-74-5
Formula: C13H13NO
KIN03459404
2-ETHYL-8-(BENZYL)-2,8-DIAZASPIRO[4.5]DECAN-1,3-DIONE
CAS:1463-48-5
Formula: C15H18N2O2
KIN01047645
2-ETHYL-8-(BENZYLOXY)-INDOLIZINE
CAS:177559-03-4
KIN03362632
2-ETHYL-8-FLUORO-5-(4-FLUOROPHENYL)-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLEHCL
CAS:58039-01-3
Formula: C19H18F2N2.ClH
KIN02409450
2-ETHYL-8-FLUORO-5-METHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1154916-61-6
Formula: C12H12FNO
KIN05221094
2-ETHYL-8-FLUORO-6-METHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155602-49-5
Formula: C12H12FNO
KIN05226543
2-ETHYL-8-FLUORO-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1153001-33-2
Formula: C11H10FNO
KIN05203652
2-ETHYL-8-FLUORO-QUINOLINE
CAS:169316-81-8
Formula: C11H10FN
KIN03344629
2-ETHYL-8-HYDROXY-3-PHENYL-QUINAZOLIN-4(3H)-ONE
CAS:105459-52-7
Formula: C16H14N2O2
KIN03068440
2-ETHYL-8-HYDROXY-4(3H)-QUINAZOLINONE
CAS:105459-51-6
Formula: C10H10N2O2
KIN03068439
2-ETHYL-8-INDOLIZINECARBOXYLIC ACID
CAS:1005475-40-0
Formula: C11H11NO2
KIN05010577
2-Ethyl-1H-indolizin-8-carboxylic acid
2-ETHYL-8-INDOLIZINECARBOXYLIC ACID ETHYL ESTER
CAS:1005475-39-7
Formula: C13H15NO2
KIN05010576
2-Ethyl-1H-indolizin-8-carboxylic acid ethyl ester; Ethyl 2-ethyl-1H-indolizin-8-carboxylate
2-ETHYL-8-IODO-QUINOLIN-4(1H)-ONE
CAS:1154915-61-3
Formula: C11H10INO
KIN05221075
2-ETHYL-8-METHOXY-2-METHYL-4H-BENZO[1,3]DIOXIN
CAS:90682-18-1
Formula: C12H16O3
KIN02731730
2-ETHYL-8-METHOXY-3-METHYL-QUINOLINE
CAS:80609-92-3
Formula: C13H15NO
KIN02645161
2-ETHYL-8-METHOXY-4H-BENZO[1,3]DIOXIN
CAS:90682-19-2
Formula: C11H14O3
KIN02731731
2-ETHYL-8-METHOXY-5-METHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1154912-72-7
Formula: C13H15NO2
KIN05221034
2-ETHYL-8-METHOXY-DIBENZO[B,E]OXEPIN-11(6H)-ONE
CAS:77389-82-3
Formula: C17H16O3
KIN02625308
2-ETHYL-8-METHOXY-INDOLIZINE
CAS:177559-04-5
KIN03362633
2-ETHYL-8-METHOXY-QUINOLIN-4(1H)-ONE
CAS:135016-14-7
Formula: C12H13NO2
KIN03230982
2-ETHYL-8-METHOXY-QUINOLIN-4-OL
CAS:167840-95-1
Formula: C12H13NO2
KIN03341484
2-ETHYL-8-METHOXY-QUINOLINE
CAS:199871-97-1
Formula: C12H13NO
KIN03406595
2-ETHYL-8-METHYL-1,5-NAPHTHYRIDIN-4(1H)-ONE
CAS:135900-23-1
Formula: C11H12N2O
KIN03234799
2-ETHYL-8-METHYL-1,7-DIOXASPIRO[5.5]UNDECAN-3-OL
CAS:168106-86-3
Formula: C12H22O3
KIN03342197
2-ETHYL-8-METHYL-1,7-DIOXASPIRO[5.5]UNDECANE
CAS:105452-50-4
Formula: C12H22O2
KIN03068374
2-ETHYL-8-METHYL-1-OXA-2,8-DIAZASPIRO[4.5]DECAN-3-ONE
CAS:172981-93-0
Formula: C10H18N2O2
KIN03655671
2-ETHYL-8-METHYL-1-OXA-3,8-DIAZASPIRO[4.5]DEC-2-ENE
CAS:138300-73-9
KIN03246005
2-ETHYL-8-METHYL-1-OXA-8-AZASPIRO[4.5]DECAN-3-ONE
CAS:123318-91-2
Formula: C11H19NO2
KIN03179035
2-ETHYL-8-METHYL-10H-PHENOTHIAZINE
CAS:5828-56-8
KIN01142811
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-1,3-DIONE
CAS:3576-75-8
Formula: C20H22N2O
KIN01091884
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-1,3-DIONE FUMARATE
CAS:51382-46-8
Formula: C15H22N2O6
KIN02305822
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-1,3-DIONE HBR
CAS:7525-02-2
Formula: C20H17ClO2
KIN01190676
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-1-ONE
CAS:64097-76-3
Formula: C11H20N2O
KIN02504330
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECAN-1-ONE HCL
CAS:64097-87-6
Formula: C11H20N2O.ClH
KIN02504339
2-ETHYL-8-METHYL-2,8-DIAZASPIRO[4.5]DECANE
CAS:64097-84-3
Formula: C11H22N2
KIN02504336
2-ETHYL-8-METHYL-3-OXA-1,8-DIAZASPIRO[4.5]DEC-1-ENE
CAS:138300-70-6
Formula: C10H18N2O
KIN03246003
2-ETHYL-8-METHYL-3-OXO-1-OXA-8-AZASPIRO[4,5]DECANE
CAS:132041-83-9
Formula: [C11H19NO2
KIN03216944
2-ETHYL-8-METHYL-HEPTADECANOIC ACID
CAS:90835-54-4
Formula: C20H40O2
KIN02734209
2-ETHYL-8-METHYL-HEXADECANOIC ACID
CAS:90835-55-5
Formula: C19H38O2
KIN02734210
2-ETHYL-8-METHYL-OCTADECANOIC ACID
CAS:90835-53-3
Formula: C21H42O2
KIN02734208
2-ETHYL-8-METHYL-QUINOLIN-4(1H)-ALPHA-ONE
CAS:1155601-58-3
Formula: C12H13NO
KIN05226528
2-ETHYL-8-METHYL-QUINOLINE
CAS:19209-58-6
Formula: C12H13N
KIN02079195
2-ETHYL-8-METHYL[1,2,4]-TRIAZOLO[1,5-A]PYRIDINE
CAS:4931-22-0
Formula: C8H9N3
KIN01117478
2-ETHYL-8-METHYLNONADECANOIC ACID
CAS:90835-52-2
Formula: C22H44O2
KIN02734207
2-ETHYL-8-OXO-NONANOIC ACID
CAS:85054-87-1
Formula: C11H20O3
KIN02671556
2-ETHYL-8-QUINOLINECARBOXAMIDE
CAS:1106785-18-5
Formula: C12H12N2O
KIN05171235
2-ETHYL-8-QUINOLINESULFONAMIDE
CAS:157686-38-9
Formula: [C11H12N2O2S
KIN03318691
2-ETHYL-8H-CYCLOHEPTOXAZOL-8-ONE
CAS:90909-35-6
KIN02735518
2-ETHYL-8H-INDENO[1,2-D]THIAZOLE
CAS:291756-55-3
Formula: C12H11NS
KIN03471699
2-ETHYL-9(10H)-ACRIDINONE
CAS:65753-77-7
Formula: C15H13NO
KIN02531844
2-ETHYL-9,10-ANTHRACENEDIOL
CAS:839-75-8
Formula: C15H12N2O
KIN01031556
2-ETHYL-9,10-ANTHRACENEDIOL 9,10-DIACETATE
CAS:70419-43-1
Formula: C20H18O4
KIN02577441
2-ETHYL-9,10-BIS(2-METHOXYETHOXY)ANTHRACENE
CAS:360045-18-7
Formula: C22H26O4
KIN03536266
2-ETHYL-9,10-DIHYDRO-9,10-ANTHRACENEDIOL
CAS:2026-33-7
Formula: C14H22N3O9S3+
KIN01061141
2-ETHYL-9,10-DIHYDRO-ACRIDINE
CAS:337959-60-1
Formula: [C15H15N
KIN03510262
2-ETHYL-9,10-DIMETHOXY-ANTHRACENE
CAS:26708-04-3
Formula: C18H18O2
KIN02150639
MFCD00075578
2-ETHYL-9,10-DIPHENYLANTHRACENE
CAS:2026-19-9
KIN01061135
2-ETHYL-9-(2-FLUORO-ETHYL)-6-PIPERAZIN-1-YL-9H-PURINE 2HCL
CAS:121371-74-2
KIN03169400
2-ETHYL-9-(4-METHYLPHENYL)-9H-PURIN-6-CARBONITRILE
CAS:1187085-99-9
Formula: C15H13N5
KIN05322000
2-ETHYL-9-HYDROXY-5,11-DIMETHYL-6H-PYRIDO[4,3-B]CARBAZOLIUM IODIDE
CAS:58447-25-9
Formula: C19H19N2O.I
KIN02415740
2-ETHYL-9-METHYL-6-PIPERAZIN-1-YL-9H-PURINE 2HCL
CAS:121371-64-0
KIN03169392
2-ETHYL-9-METHYL-6-PIPERAZIN-1-YLPURINE
CAS:121370-50-1
Formula: C12H18N6
KIN03169325
2-ETHYL-9-METHYL-6-PROPYL-3-THIOIDENE-[1,2,4]-TRIAZOLO[3,4-F]PURIN-5-ONE
CAS:135446-17-2
Formula: C12H16N6OS
KIN03232876
2-ETHYL-9-METHYL-8-PHENYL-9H-PURINE
CAS:199583-21-6
KIN03406106
2-ETHYL-9H-[1]BENZOTHIOPYRANO[3,2-B]FURAN-9-ONE
CAS:499222-09-2
Formula: C13H10O2S
KIN03617465
2-ETHYL-9H-10-ANTHRANONE
CAS:286463-72-7
Formula: C16H14O
KIN03468666
2-ETHYL-9H-CARBAZOLE
CAS:106551-62-6
Formula: C14H13N
KIN03077020
2-ETHYL-9H-CYCLOHEPTA[B]PYRIDINE
CAS:129410-88-4
Formula: C12H13N
KIN03205775
2-ETHYL-9H-FLUORENE
CAS:1207-21-2
Formula: C13H13NO
KIN01043505
2-ETHYL-9H-THIOXANTHEN-9-ONE
CAS:5495-84-1
Formula: C16H14OS
KIN01134165
2-ETHYL-9H-XANTHEN-9-ONE
CAS:108013-08-7
KIN03086324
2-ETHYL-A,3,4,5,6-PENTAMETHYL-BENZENEMETHANOL
CAS:92368-74-6
Formula: C14H22O
KIN02755931
2-ETHYL-A,6-DIMETHYL-ALPHA-PHENYLBENZENEMETHANOL
CAS:106976-51-6
KIN03080201
2-ETHYL-A,A-DIMETHYL-4-PYRIDINEMETHANOL
CAS:143142-28-3
Formula: C10H15NO
KIN03268431
2-ETHYL-A-1-PYRROLIDINYL-3-PYRIDINEACETONITRILE
CAS:64114-23-4
Formula: C13H17N3
KIN02504549
2-ETHYL-A-1H-IMIDAZOL-5-YL-3-PYRIDINEMETHANOL
CAS:469863-91-0
Formula: C11H13N3O
KIN03598811
2-ETHYL-ADENOSINE
CAS:37151-12-5
KIN02237622
2-Ethyladenosine
2-ETHYL-ADENOSINE 1-OXIDE
CAS:25314-42-5
KIN02138376
2-ETHYL-ALPHA,1-DIMETHYL-1H-INDOL-3-ETHANOL
CAS:73967-91-6
Formula: C14H19NO
KIN02602256
2-ETHYL-ALPHA,3,3,4,4-PENTAMETHYL-2-OXETANEMETHANOL
CAS:61266-63-5
Formula: C11H22O2
KIN02453469
2-ETHYL-ALPHA,4-DIMETHYL-1H-IMIDAZOL-1-PROPANENITRILE
CAS:109523-32-2
Formula: C10H15N3
KIN03655670
2-ETHYL-ALPHA,6-DIMETHYLBENZENEACETIC ACID METHYL ESTER
CAS:128259-42-7
Formula: C13H18O2
KIN03633056
2-ETHYL-ALPHA,ALPHA-DIETHYNYLBENZENEMETHANOL
CAS:52052-87-6
Formula: C13H12O
KIN02315372
2-ETHYL-ALPHA,ALPHA-DIMETHYL-1-PIPERIDINEETHANAMINE
CAS:1082529-88-1
Formula: C11H24N2
KIN05121087
2-ETHYL-ALPHA,ALPHA-DIMETHYL-1H-IMIDAZOL-1-ETHANOL
CAS:180634-17-7
KIN03011886
2-ETHYL-ALPHA,ALPHA-DIMETHYL-4-MORPHOLINEETHANOL
CAS:1178218-92-2
Formula: C10H21NO2
KIN05274456
2-ETHYL-ALPHA,ALPHA-DIMETHYLBENZENEACETIC ACID
CAS:29390-72-5
Formula: C12H16O2
KIN02173670
2-ETHYL-ALPHA,ALPHA-DIMETHYLBENZENEMETHANOL
CAS:104174-11-0
Formula: C11H16O
KIN03059264
2-ETHYL-ALPHA,ALPHA-DIMETHYLBENZENEPROPANAL
CAS:67634-14-4
Formula: C13H18O
KIN02556039
2-ETHYL-ALPHA,ALPHA-DIMETHYLBENZENEPROPANAL OXIME
CAS:134123-88-9
Formula: C13H19NO
KIN03020262
2-ETHYL-ALPHA,ALPHA-DIMETHYLBENZENEPROPANENITRILE
CAS:134123-91-4
Formula: C13H17N
KIN03226804
2-ETHYL-ALPHA-(2-ETHYL-6-METHYLPHENYL)-6-METHYLBENZENEMETHANOL
CAS:106976-41-4
KIN03080191
2-ETHYL-ALPHA-(2-ETHYL-6-METHYLPHENYL)-6-METHYLBENZENEMETHANOL BENZOATE
CAS:106976-46-9
KIN03080196
2-ETHYL-ALPHA-(2-IODO-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1021037-09-1
KIN05052579
2-ETHYL-ALPHA-(2-METHOXY-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1020950-62-2
KIN05050733
2-ETHYL-ALPHA-(3-IODO-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1039939-99-5
KIN05082693
2-ETHYL-ALPHA-(3-METHOXY-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1021036-95-2
KIN05052575
2-ETHYL-ALPHA-(4-ETHYLPHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1021011-21-1
KIN05052076
2-ETHYL-ALPHA-(4-HYDROXY-PHENYL)-3-BENZOFURANMETHANOL
CAS:91627-42-8
Formula: C17H16O3
KIN02746613
2-ETHYL-ALPHA-(4-IODO-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1039888-72-6
KIN05081511
2-ETHYL-ALPHA-(4-METHOXY-PHENYL)-5-NITRO-BENZENEMETHANAMINE
CAS:1020975-95-4
KIN05051378
2-ETHYL-ALPHA-(PHENYLETHYNYL)-1-AZIRIDINEMETHANOL
CAS:62913-61-5
Formula: C13H15NO
KIN02482692
2-ETHYL-ALPHA-(TRIFLUOROMETHYL)-1H-IMIDAZOL-5-METHANOL
CAS:107344-67-2
KIN03644367
2-ETHYL-ALPHA-[(4-IODO-PHENOXY)METHYL]-1H-BENZO[D]IMIDAZOL-1-ETHANOL
CAS:447449-34-5
Formula: C18H19IN2O2
KIN03589198
2-ETHYL-ALPHA-3-DIMETHYL-OXIRANEMETHANOL
CAS:135185-97-6
Formula: C7H14O2
KIN03231672
2-ETHYL-ALPHA-ETHYNYL-1-AZIRIDINEMETHANOL
CAS:62913-51-3
Formula: C7H11NO
KIN02482685
2-ETHYL-ALPHA-ETHYNYL-6-HYDROXY-BENZENEMETHANOL
CAS:143726-13-0
Formula: C11H12O2
KIN03271971
2-ETHYL-ALPHA-ETHYNYLBENZENEMETHANOL
CAS:326496-10-0
Formula: C11H12O
KIN03496465
2-ETHYL-ALPHA-ETHYNYLCYCLOPROPANEETHANOL
CAS:55444-47-8
Formula: C9H14O
KIN02366584
2-ETHYL-ALPHA-METHYL-1H-IMIDAZOL-1-ETHANOL
CAS:180634-16-6
KIN03369611
2-ETHYL-ALPHA-METHYL-1H-IMIDAZOL-1-PROPANENITRILE
CAS:109523-31-1
KIN03018067
2-ETHYL-ALPHA-METHYL-1H-IMIDAZOL-1-PROPANOIC ACID
CAS:53660-13-2
Formula: C9H14N2O2
KIN02338531
2-ETHYL-ALPHA-METHYL-1H-INDOL-3-PROPANOL
CAS:1071595-61-3
Formula: C14H19NO
KIN05112977
2-ETHYL-ALPHA-METHYL-3-BENZOFURANACETIC ACID
CAS:63606-55-3
Formula: C13H14O3
KIN02495804
2-ETHYL-ALPHA-METHYL-3-BENZOFURANACETONITRILE
CAS:63606-50-8
Formula: C13H13NO
KIN02495802
2-ETHYL-ALPHA-METHYL-3-THIOPHENEACETALDEHYDE
CAS:125284-90-4
KIN03187868
2-ETHYL-ALPHA-METHYL-4-(1-METHYLPROPYL)-BENZENEMETHANOL
CAS:100963-61-9
Formula: C14H22O
KIN03633055
2-ETHYL-ALPHA-METHYL-4-OXO-4H-BENZOPYRAN-6-ACETIC ACID
CAS:58282-57-8
Formula: C14H14O4
KIN02413207
2-ETHYL-ALPHA-METHYL-4-THIAZOLEETHANAMINE
CAS:1172713-60-8
Formula: C8H14N2S
KIN05264003
2-ETHYL-ALPHA-METHYL-5-NITRO-BENZENEMETHANAMINE
CAS:1020950-14-4
Formula: C10H14N2O2
KIN05050717
2-ETHYL-ALPHA-METHYLBENZENEACETALDEHYDE
CAS:91969-53-8
Formula: C11H14O
KIN02751158
2-ETHYL-ALPHA-METHYLBENZENEETHANETHIOL
CAS:30126-79-5
Formula: C11H16S
KIN02179476
2-ETHYL-ALPHA-METHYLBENZENEMETHANAMINE HCL
CAS:104338-67-2
Formula: C10H15N.ClH
KIN03060573
2-ETHYL-ALPHA-METHYLBENZENEMETHANIMINE
CAS:1072942-56-3
Formula: C10H13N
KIN05114708
2-ETHYL-ALPHA-METHYLBENZENEMETHANOL
CAS:19161-17-2
Formula: C10H14O
KIN02078595
2-ETHYL-ALPHA-OXO-1H-INDOL-3-ACETIC ACID
CAS:1170717-36-8
Formula: C12H11NO3
KIN05261525
2-ETHYL-ALPHA-OXO-BENZENEACETIC ACID METHYL ESTER
CAS:143130-97-6
Formula: C11H12O3
KIN03020896
2-ETHYL-ALPHA-OXO-BENZENEACETONITRILE
CAS:1101132-37-9
Formula: C10H9NO
KIN05167379
2-ETHYL-ALPHA-PHENYL-1-PIPERIDINEETHANAMINE
CAS:1094863-59-8
Formula: C15H24N2
KIN05146480
2-ETHYL-ALPHA-PHENYLBENZENEETHANAMINE
CAS:406174-55-8
Formula: C16H19N
KIN03566918
2-ETHYL-ALPHA-PHENYLBENZENEMETHANIMINE
CAS:65232-37-3
Formula: C15H15N
KIN02523379
2-ETHYL-ALPHA-PHENYLBENZENEMETHANOL
CAS:2029-94-9
Formula: C11H14O3
KIN01061194
2-ETHYL-ALPHA-PROPYLBENZENEMETHANOL
CAS:408523-27-3
Formula: C12H18O
KIN03568777
2-ETHYL-ALPHA-PYRIDIN-2-YL-1H-INDOL-3-METHANIMINE
CAS:37128-34-0
KIN02237384
2-ETHYL-ALPHA-PYRIDIN-4-YL-1H-INDOL-3-METHANIMINE
CAS:37128-35-1
KIN02237385
2-ETHYL-ALPHA-SULFINYL-4-PYRIDINEMETHANAMINE
CAS:536-29-8
Formula: C6H7AsCl3NO
KIN01018850
2-ETHYL-ANILINE
CAS:578-56-3
KIN01020554
2-ETHYL-ANILINE HCL
CAS:50522-37-7
Formula: C8H11N.ClH
KIN02293890
2-ETHYL-ANTHRACEN-9,10-DIONE
CAS:84-52-6
Formula: C9H14N3O8P
KIN01001926
2-ETHYL-ANTHRACENE
CAS:52251-71-5
Formula: C16H14
KIN02318561
MFCD00003584
2-ETHYL-BETA,4-DIMETHYL-1H-IMIDAZOL-1-PROPANENITRILE
CAS:109523-28-6
Formula: C10H15N3
KIN03666985
2-ETHYL-BETA,6-DIMETHYLBENZENEETHANOL
CAS:128259-37-0
Formula: C12H18O
KIN03200940
2-ETHYL-BETA,BETA-DIMETHYL-1-PIPERIDINEETHANAMINE
CAS:1095019-98-9
Formula: C11H24N2
KIN05147927
2-ETHYL-BETA,BETA-DIMETHYL-4-MORPHOLINEETHANAMINE
CAS:1154170-45-2
Formula: C10H22N2O
KIN05215054
2-ETHYL-BETA-METHYL-10H-PHENOTHIAZIN-10-PROPANAMINE
CAS:94263-65-7
KIN02779979
2-ETHYL-BETA-METHYL-1H-IMIDAZOL-1-PROPANAMINE
CAS:1017413-99-8
Formula: C9H17N3
KIN05033284
2-ETHYL-BETA-METHYL-1H-IMIDAZOL-1-PROPANENITRILE
CAS:62093-13-4
Formula: C9H13N3
KIN02467592
2-ETHYL-BETA-METHYL-1H-IMIDAZOL-1-PROPANOIC ACID
CAS:1170654-24-6
Formula: C9H14N2O2
KIN05261440
2-ETHYL-BETA-OXO-BENZENEPROPANENITRILE
CAS:1040723-91-8
Formula: C11H11NO
KIN05086564
2-ETHYL-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:1194825-75-6
Formula: C13H16O3
KIN05336132
2-ETHYL-BETA-PHENYL-1-PIPERIDINEETHANAMINE
CAS:1094942-72-9
Formula: C15H24N2
KIN05147627
2-ETHYL-BICYCLO[1.1.0]BUTANE
CAS:95572-61-5
Formula: C6H10
KIN02792808
2-ETHYL-BICYCLO[2.2.1]HEPTA-2,5-DIENE
CAS:7158-40-9
KIN01180332
2-ETHYL-BICYCLO[2.2.1]HEPTANE
CAS:2146-42-1
KIN01063566
2-ETHYL-BICYCLO[2.2.1]HEPTANE-2-CARBONITRILE
CAS:104175-60-2
KIN03059312
2-ETHYL-BIPHENYL
CAS:1812-53-9
Formula: C34H72N.Cl
KIN01056397
2-ETHYL-BIPHENYL-3-CARBONITRILE
CAS:82617-41-2
Formula: C15H13N
KIN02656635
2-ETHYL-BIPHENYL-3-CARBOXAMIDE
CAS:82617-42-3
Formula: C15H15NO
KIN02656636
2-ETHYL-BIPHENYL-3-CARBOXYLIC ACID
CAS:82617-43-4
Formula: C15H14O2
KIN02656637
2-ETHYL-BIPHENYL-3-METHANOL
CAS:82617-44-5
Formula: C15H16O
KIN02656638
2-ETHYL-BIPHENYL-4-ACETIC ACID
CAS:5002-44-8
KIN01118798
2-ETHYL-BIPHENYL-4-CARBOXYLIC ACID
CAS:1008774-13-7
KIN05015993
2-ETHYL-BUTANAL 2-(2,4-DIMETHYLPHENYL)HYDRAZONE
CAS:391646-74-5
Formula: C14H22N2
KIN03004713
2-ETHYL-BUTANOIC ACID 6-METHYL-3-PYRIDINYL ESTER
CAS:486440-83-9
Formula: C12H17NO2
KIN03671790
2-ETHYL-CIS-CROTONIC ACID
CAS:34452-15-8
Formula: C6H10O2
KIN02214095
2-ETHYL-D-TRYPTOPHAN
CAS:140703-54-4
KIN03257219
2-ETHYL-DECANOIC ACID ETHYL ESTER
CAS:119856-56-3
Formula: C14H28O2
KIN03160988
2-ETHYL-DELTA-OXO-1H-IMIDAZOL-1-PENTANOIC ACID
CAS:330828-75-6
Formula: C10H14N2O3
KIN03502404
2-ETHYL-DIBENZO[B,E]OXEPIN-11(6H)-ONE
CAS:80627-06-1
Formula: C16H14O2
KIN02645257
2-ETHYL-DIBENZO[B]THIOPHENE
CAS:89816-98-8
Formula: C14H12S
KIN02717618
2-ETHYL-DIBENZO[B]THIOPHENE 5,5-DIOXIDE
CAS:147792-35-6
KIN03287402
2-ETHYL-DODECANOIC ACID
CAS:2874-76-2
Formula: C12H24O2
KIN01077808
2-ETHYL-FURAN
CAS:3208-22-8
Formula: C7H14O
KIN01084522
2-ETHYL-FURO[3,4-B]PYRIDIN-5,7-DIONE
CAS:90376-80-0
KIN02726869
2-ETHYL-GAMMA-OXO-3-INDOLIZINEBUTANOIC ACID
CAS:80085-32-1
Formula: C14H15NO3
KIN02641767
2-ETHYL-GAMMA-OXO-BENZENEBUTANOIC ACID
CAS:1108158-32-2
Formula: C12H14O3
KIN05171930
2-ETHYL-HEPT-1-OL
CAS:817-71-0
Formula: C5H9BrO
KIN01030448
2-ETHYL-HEPTADECANOIC ACID
CAS:69868-08-2
Formula: C19H38O2
KIN02573531
2-ETHYL-HEPTANALDEHYDE
CAS:27649-40-7
Formula: C9H18O
KIN02159188
2-ETHYL-HEPTANAMIDE
CAS:4165-02-0
KIN01102225
2-ETHYL-HEPTANEDIOYL DICHLORIDE
CAS:50828-57-4
Formula: C9H14Cl2O2
KIN02297980
2-ETHYL-HEPTANOIC ACID
CAS:3274-32-6
Formula: C17H15N
KIN01085767
2-ETHYL-HEPTANOIC ACID METHYL ESTER
CAS:816-65-9
Formula: C6H13NO
KIN01030421
2-ETHYL-HEPTYL BUTYRATE
CAS:94200-05-2
Formula: C13H26O2
KIN02778993
2-ETHYL-HEPTYL FORMATE
CAS:94200-06-3
Formula: C10H20O2
KIN02778994
2-ETHYL-HEPTYL PROPANOATE
CAS:94200-08-5
Formula: C12H24O2
KIN02778996
2-ETHYL-HEX-2-ENOYL-2-ETHYL-HEX-2-ENOATE
CAS:41848-00-4
Formula: C16H26O3
KIN02273935
MFCD03938974
2-ETHYL-HEXADECANOIC ACID
CAS:54240-85-6
Formula: C18H36O2
KIN02347118
2-ETHYL-HEXADECANOIC ACID ETHYL ESTER
CAS:70116-75-5
Formula: C20H40O2
KIN02575283
2-ETHYL-HEXAN-1,3-DIOL
CAS:94-97-3
Formula: C6H4ClN3
KIN01002849
2-ETHYL-HEXAN-1-THIOL
CAS:7341-24-4
Formula: C8H10S
KIN01184662
2-ETHYL-HEXAN-1-YLAMINE
CAS:104-76-7
Formula: C8H18O
KIN01003741
2-ETHYL-HEXANAL
CAS:123-06-8
Formula: C6H6N2O
KIN01005162
2-ETHYL-HEXANAL (5-(HYDROXY(OXIDO)AMINO)-PYRIDIN-2-YL)HYDRAZONE
CAS:7255-71-2
Formula: C18H11BrN2O
KIN01183105
2-ETHYL-HEXANAL 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:14086-22-7
Formula: C14H20N4O4
KIN02028062
2-ETHYL-HEXANAL 2-PYRIDIN-2-YLHYDRAZONE
CAS:93578-68-8
Formula: C13H21N3
KIN02770907
2-ETHYL-HEXANAL BENZO[D]THIAZOL-2-YLHYDRAZONE
CAS:93578-64-4
Formula: C15H21N3S
KIN02770903
2-ETHYL-HEXANAL PHENYLHYDRAZONE
CAS:93578-61-1
Formula: C14H22N2
KIN02770901
2-ETHYL-HEXANAMIDE
CAS:4164-94-7
Formula: C9H19NO
KIN01102224
2-ETHYL-HEXANENITRILE
CAS:4528-41-0
Formula: C10H19N
KIN01109905
2-ETHYL-HEXANEPEROXOIC ACID 1,1,4,4-TETRAMETHYL-1,4-BUTANEDIYL ESTER
CAS:189641-40-5
Formula: C24H46O6
KIN03389462
2-ETHYL-HEXANEPEROXOIC ACID 1,1-DIMETHYLBUTYL ESTER
CAS:136662-27-6
Formula: [C14H28O3]
KIN03237948
2-ETHYL-HEXANEPEROXOIC ACID 1,1-DIMETHYLPROPYL ESTER
CAS:686-33-9
Formula: C7H9NO2
KIN01025527
2-ETHYL-HEXANEPEROXOIC ACID 1-[(2,2-DIMETHYL-1-OXO-PROPYL)DIOXY]-1,3-DIMETHYLBUTYL ESTER
CAS:228415-62-1
KIN03441806
2-ETHYL-HEXANETHIOIC ACID, S-2-PYRIDINYL ESTER
CAS:75560-87-1
Formula: C13H19NOS
KIN02613448
2-ETHYL-HEXANOIC ACID
CAS:125804-07-1
Formula: C21H42O2
KIN03190326
2-ETHYL-HEXANOIC ACID (3,5,5-TRIMETHYL-6-OXO-3-MORPHOLINYL)METHYL ESTER
CAS:221556-22-5
Formula: C16H29NO4
KIN03436574
2-ETHYL-HEXANOIC ACID (9Z)-9-OCTADECENYL ESTER
CAS:70531-35-0
Formula: C26H50O2
KIN02578090
2-ETHYL-HEXANOIC ACID [4-[[(1-OXOHEXYLOXY)]METHYL]CYCLOHEXYL]METHYL ESTER
CAS:113410-37-0
Formula: C22H40O4
KIN03122782
2-ETHYL-HEXANOIC ACID 1,1',1''-(1,2,3-PROPANETRIYL) ESTER
CAS:7360-39-6
Formula: C12H20O2
KIN01185139
2-ETHYL-HEXANOIC ACID 1,1',1''-(BUTYL-STANNYLIDYNE) ESTER
CAS:23850-94-4
Formula: C28H54O6Sn
KIN02124121
MFCD00015260
2-ETHYL-HEXANOIC ACID 1,1'-[OXYBIS(2,1-ETHANEDIYLOXY-2,1-ETHANEDIYL)] ESTER
CAS:18268-70-7
KIN02070435
2-ETHYL-HEXANOIC ACID 1,1'-ANHYDRIDE
CAS:36765-89-6
Formula: C16H30O3
KIN02233993
MFCD00043963
2-ETHYL-HEXANOIC ACID 1,10-DECANEDIYL ESTER
CAS:95258-40-5
Formula: C26H50O4
KIN02789768
2-ETHYL-HEXANOIC ACID 1,2,2,6,6-PENTAMETHYL-PIPERIDIN-4-YL ESTER
CAS:43224-01-7
KIN02283540
2-ETHYL-HEXANOIC ACID 1,2,3- PROPANETRIYL ESTER
CAS:199003-40-2
KIN03405283
2-ETHYL-HEXANOIC ACID 1,2-ETHANEDIYL ESTER
CAS:79793-05-8
Formula: C18H34O4
KIN02639900
2-ETHYL-HEXANOIC ACID 1,4-CYCLOHEXANEDIYL ESTER
CAS:53148-31-5
Formula: C22H40O4
KIN02330944
2-ETHYL-HEXANOIC ACID 1,6-HEXANEDIYL ESTER
CAS:112546-78-8
Formula: C22H42O4
KIN03116304
2-ETHYL-HEXANOIC ACID 1,7-HEPTANEDIYL ESTER
CAS:5453-30-5
Formula: C25H48O4
KIN01132263
2-ETHYL-HEXANOIC ACID 1-(ACETYLOXY)ETHYL ESTER
CAS:94354-71-9
Formula: C12H22O4
KIN02780981
2-ETHYL-HEXANOIC ACID 1-METHYL-2-OXO-2-(PHENYLAMINO)ETHYL ESTER
CAS:5323-70-6
Formula: C15H12O7
KIN01125743
2-ETHYL-HEXANOIC ACID 1-METHYL-PIPERIDIN-4-YL ESTER
CAS:119256-52-9
Formula: C14H27NO2
KIN03677621
2-ETHYL-HEXANOIC ACID 2,2,2-TRIFLUORO-ETHYL ESTER
CAS:62615-82-1
Formula: C10H17F3O2
KIN02477355
2-ETHYL-HEXANOIC ACID 2,2-BIS[[(ACRYLOYLOXY)]METHYL]BUTYL ESTER
CAS:490030-21-2
Formula: C20H32O6
KIN03612473
2-ETHYL-HEXANOIC ACID 2,2-DIETHYL-1,3-PROPANEDIYL ESTER
CAS:114804-95-4
Formula: C23H44O4
KIN03633054
2-ETHYL-HEXANOIC ACID 2,3-DIHYDROXY-PROPYL ESTER
CAS:66725-62-0
Formula: C11H22O4
KIN02545109
2-ETHYL-HEXANOIC ACID 2,4,6-TRIBROMOPHENYL ESTER
CAS:84852-57-3
Formula: C14H17Br3O2
KIN02670253
2-ETHYL-HEXANOIC ACID 2-(2-HYDROXYETHOXY)ETHYL ESTER
CAS:88216-64-2
Formula: C12H24O4
KIN02694745
2-ETHYL-HEXANOIC ACID 2-[[(1-OXOHEXYLOXY)]METHYL]-2-METHYL-1,3-PROPANEDIYL ESTER
CAS:54272-41-2
Formula: C29H54O6
KIN02347599
2-ETHYL-HEXANOIC ACID 2-[2-[2-(2-HYDROXYETHOXY)ETHOXY]-ETHOXY]-ETHYL ESTER
CAS:53814-86-1
Formula: C16H32O6
KIN02340875
2-ETHYL-HEXANOIC ACID 2-[3-(2-ETHYL-HEXANOYLOXY)-2,2-DIMETHYLPROPOXYCARBONYL]-2-METHYLPROPYL ESTER
CAS:23144-57-2
Formula: C26H48O6
KIN02117149
2-ETHYL-HEXANOIC ACID 2-[4-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-3-HYDROXY-PHENOXY]-ETHYL ESTER
CAS:371146-04-2
Formula: C31H33N3O4
KIN03542702
2-ETHYL-HEXANOIC ACID 2-BROMO-1-PHENYLETHYL ESTER
CAS:412274-32-9
Formula: C16H23BrO2
KIN03026658
2-ETHYL-HEXANOIC ACID 2-HYDROXY-PROPYL ESTER
CAS:58921-10-1
Formula: C11H22O3
KIN02423346
2-ETHYL-HEXANOIC ACID 2-MERCAPTOETHYL ESTER
CAS:67859-57-8
Formula: C10H20O2S
KIN02558811
2-ETHYL-HEXANOIC ACID 3-(TETRAHYDROFURAN-2-YL)-PROPYL ESTER
CAS:5451-26-3
Formula: C15H28O3
KIN01132093
2-ETHYL-HEXANOIC ACID 3-[(2-ETHYLHEXYLOXY)]-2-HYDROXY-PROPYL ESTER
CAS:59068-09-6
Formula: C19H38O4
KIN02425731
2-ETHYL-HEXANOIC ACID 3-ETHYLHEXYL ESTER
CAS:209684-50-4
Formula: [C16H32O2]
KIN03420151
2-ETHYL-HEXANOIC ACID 3-HYDROXY-1-METHYLPROPYL ESTER
CAS:89457-48-7
Formula: C12H24O3
KIN02712087
2-ETHYL-HEXANOIC ACID 3-HYDROXY-BUTYL ESTER
CAS:89457-32-9
Formula: C12H24O3
KIN02712072
2-ETHYL-HEXANOIC ACID 3-OXOSPIRO[ISOBENZOFURAN-1(3H),9'(9H)-XANTHENE]-3',6'-DIYL ESTER
CAS:175888-04-7
Formula: C36H40O7
KIN03359890
2-ETHYL-HEXANOIC ACID 3ALPHA-TROPANYL ESTER CITRATE
CAS:119188-23-7
KIN03677620
2-ETHYL-HEXANOIC ACID 4-(CHLOROCARBONYL)PHENYL ESTER
CAS:189748-37-6
KIN03389687
2-ETHYL-HEXANOIC ACID 4-SULFOPHENYL ESTER SODIUM SALT
CAS:100754-67-4
Formula: C14H20O5S.Na
KIN03034480
2-ETHYL-HEXANOIC ACID 8-METHYLNONANOIC ACID IRON
CAS:93981-42-1
KIN02776223
2-ETHYL-HEXANOIC ACID 8-METHYLNONANOIC ACID ZINC
CAS:94246-98-7
KIN02779803
2-ETHYL-HEXANOIC ACID ALUMINUM SALT (3:1)
CAS:97048-19-6
KIN02804262
2-ETHYL-HEXANOIC ACID BENZYL ESTER
CAS:67874-83-3
Formula: C15H22O2
KIN02558985
2-ETHYL-HEXANOIC ACID BIS(CEKANOIC C8 ACID ) CERIUM
CAS:93981-38-5
KIN02776221
2-ETHYL-HEXANOIC ACID BIS(ISONONANOIC ACID ) CERIUM
CAS:93894-34-9
KIN02775015
2-ETHYL-HEXANOIC ACID BIS(TERT-DECANOIC ACID ) CERIUM
CAS:93894-40-7
KIN02775018
2-ETHYL-HEXANOIC ACID BISMUTH SALT
CAS:71010-77-0
KIN02581257
2-ETHYL-HEXANOIC ACID C8-12-ALKYL ESTERS
CAS:90411-64-6
KIN02727461
2-ETHYL-HEXANOIC ACID CADMIUM SALT BASIC
CAS:90411-62-4
KIN02727460
2-ETHYL-HEXANOIC ACID CEKANOIC C8 ACID IRON
CAS:93981-41-0
KIN02776222
2-ETHYL-HEXANOIC ACID CERIUM SALT
CAS:24593-34-8
Formula: C24H45CeO6
KIN02131963
2-ETHYL-HEXANOIC ACID COBALT SALT
CAS:13586-82-8
Formula: C8H16O2.xCo
KIN02021727
Cobalt octoate
2-ETHYL-HEXANOIC ACID COBALT(III) SALT
CAS:81955-22-8
Formula: C8H16O2.1/3Co
KIN02652650
2-ETHYL-HEXANOIC ACID COMPD. WITH (1R,2R)-2-[(DIMETHYLAMINO)METHYL]-1-(3-METHOXY-PHENYL)CYCLOHEXANOL
CAS:1158170-66-1
Formula: C16H25NO2.C8H16O2
KIN05253090
2-ETHYL-HEXANOIC ACID COMPD. WITH 2,3,4,6,7,8,9,10-OCTAHYDROPYRIMIDO[1,2-A]- AZEPINE
CAS:33918-18-2
Formula: C17H32N2O2
KIN02209834
Dbu 2-ethylhexanoate
2-ETHYL-HEXANOIC ACID COMPD. WITH 2,3,4,6,7,8,9,10-OCTAHYDROPYRIMIDO[1,2-A]AZEPINE
CAS:168967-85-9
KIN03343700
2-ETHYL-HEXANOIC ACID COMPD. WITH 2,4,6-TRIS[(DIMETHYLAMINO)METHYL]PHENOL, (3:1)
CAS:4572-96-7
KIN01110703
2-ETHYL-HEXANOIC ACID COMPD. WITH 2-AMINOETHANOL
CAS:74931-55-8
Formula: C10H23NO3
KIN02609351
2-ETHYL-HEXANOIC ACID COMPD. WITH GUANIDINE
CAS:26793-02-2
Formula: C9H21N3O2
KIN02151243
2-ETHYL-HEXANOIC ACID COMPD. WITH N,N,N',N'-TETRAMETHYLGUANIDINE
CAS:4348-19-0
Formula: C8H11N.ClH
KIN01105597
2-ETHYL-HEXANOIC ACID COMPD. WITH N,N-DIBUTYL-1-BUTANAMINE
CAS:58823-74-8
Formula: C20H43NO2
KIN02421699
2-ETHYL-HEXANOIC ACID COMPD. WITH N,N-DIETHYLETHANAMINE
CAS:58823-72-6
Formula: C14H31NO2
KIN02421698
2-ETHYL-HEXANOIC ACID COMPD. WITH N-DODECYLGUANIDINE
CAS:22381-11-9
Formula: C13H29N3.C8H16O2
KIN02110097
2-ETHYL-HEXANOIC ACID COMPD. WITH,1,2-DIMETHYL-1H-IMIDAZOLE
CAS:391684-42-7
Formula: C8H16O2.C5H8N2
KIN03556739
2-ETHYL-HEXANOIC ACID COMPD. WITH,2-((2-(DIMETHYLAMINO)ETHYL)METHYLAMINO)ETHANOL
CAS:143309-93-7
Formula: C15H34N2O3
KIN03269386
2-ETHYL-HEXANOIC ACID COMPOUND WITH DODECYLAMINE
CAS:85068-69-5
Formula: C20H43NO2
KIN02671671
2-ETHYL-HEXANOIC ACID COPPER SALT (2:1)
CAS:22221-10-9
Formula: C16H30CuO4
KIN02108528
2-ETHYL-HEXANOIC ACID COPPER SALT COMPD. WITH (1R,4AS,10AR)-1,2,3,4,4A,9,10,10A-OCTAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-1-PHENANTHRENEMETHANAMINE (2::1)
CAS:53404-24-3
Formula: C36H61CuNO4
KIN02334679
2-Ethyl-hexanoic acid compd. with [1R-(1alpha,4abe
2-ETHYL-HEXANOIC ACID EICOSYL ESTER
CAS:72201-44-6
Formula: C28H56O2
KIN02589758
2-ETHYL-HEXANOIC ACID ETHENYL ESTER
CAS:94-05-3
Formula: C8H11NO3
KIN01002763
2-ETHYL-HEXANOIC ACID ETHYL ESTER
CAS:2983-38-2
Formula: C8H16O2
KIN01080343
2-ETHYL-HEXANOIC ACID GALLIUM SALT
CAS:67969-68-0
Formula: C24H45GaO6
KIN02559694
2-ETHYL-HEXANOIC ACID GOLD SALT
CAS:137023-52-0
Formula: C8H16O2.xAu
KIN03239739
2-ETHYL-HEXANOIC ACID HEXADECYL ESTER
CAS:59130-69-7
Formula: C24H48O2
KIN02426662
Hexadecyl 2-ethylhexanoate
2-ETHYL-HEXANOIC ACID HEXYL ESTER
CAS:20748-87-2
Formula: C14H28O2
KIN02093587
2-ETHYL-HEXANOIC ACID INDIUM SALT
CAS:69375-27-5
Formula: C24H45InO6
KIN02569858
2-ETHYL-HEXANOIC ACID INDIUM(III) SALT
CAS:67816-06-2
Formula: C24H45InO6
KIN02558319
2-ETHYL-HEXANOIC ACID IRIDIUM SALT
CAS:158627-28-2
Formula: C8H16O2.xIr
KIN03320966
2-ETHYL-HEXANOIC ACID IRON(II) IRON(III) SALT
CAS:68201-81-0
Formula: C40H75Fe2O10
KIN02561420
2-ETHYL-HEXANOIC ACID IRON(II) SALT (2:1)
CAS:93981-08-9
Formula: C16H30FeO4
KIN02776205
2-ETHYL-HEXANOIC ACID ISONONANOIC ACID IRON
CAS:93981-46-5
KIN02776227
2-ETHYL-HEXANOIC ACID ISONONANOIC ACID ZINC
CAS:94246-97-6
KIN02779802
2-ETHYL-HEXANOIC ACID ISOPROPENYL ESTER
CAS:25309-43-7
Formula: C11H20O2
KIN02138312
2-ETHYL-HEXANOIC ACID LANTHANUM(III) SALT (3:1)
CAS:67816-09-5
Formula: C8H16O2.1/3La
KIN02558322
2-ETHYL-HEXANOIC ACID LEAD(II) SALT BASIC
CAS:68515-76-4
KIN02563903
2-ETHYL-HEXANOIC ACID MANGANESE SALT
CAS:15956-58-8
Formula: C8H16O2.xMn
KIN02045989
2-ETHYL-HEXANOIC ACID MANGANESE(II) SALT (2:1)
CAS:13434-24-7
Formula: C16H30MnO4
KIN02019494
2-ETHYL-HEXANOIC ACID MOLYBDENUM(III) SALT (3:1)
CAS:106414-11-3
Formula: C48H90MoO12
KIN03076300
2-ETHYL-HEXANOIC ACID MONOESTER WITH PROPAN-1,2-DIOL
CAS:85114-00-7
KIN02672004
2-ETHYL-HEXANOIC ACID N-BUTYL ESTER
CAS:68443-63-0
Formula: C12H24O2
KIN02563323
MFCD00059430
2-ETHYL-HEXANOIC ACID NEODYMIUM(III) SALT (3:1)
CAS:73227-23-3
Formula: Nd[OOCCH(C2H5)C4H9]3
KIN02596886
2-ETHYL-HEXANOIC ACID NICKEL SALT
CAS:7580-33-8
Formula: C9H18O2.1/3Al
KIN01191594
2-ETHYL-HEXANOIC ACID PALLADIUM SALT
CAS:141219-72-9
Formula: C8H16O2.xPd
KIN03258879
2-ETHYL-HEXANOIC ACID PALLADIUM(II) SALT
CAS:67816-11-9
Formula: C16H30O4Pd
KIN02558323
2-ETHYL-HEXANOIC ACID PHENYL ESTER
CAS:62615-80-9
Formula: C14H20O2
KIN02477354
2-ETHYL-HEXANOIC ACID PLATINUM(II) SALT
CAS:140480-60-0
Formula: C8H16O2.1/2Pt
KIN03256676
2-ETHYL-HEXANOIC ACID PROPAN-1,2,3-TRIOL
CAS:102802-97-1
Formula: C11H24O5
KIN03050023
2-ETHYL-HEXANOIC ACID RUTHENIUM(III) SALT
CAS:67816-05-1
Formula: C24H45O6Ru
KIN02558318
2-ETHYL-HEXANOIC ACID SAMARIUM(III) SALT
CAS:19189-20-9
Formula: C24H45O6Sm
KIN02078912
2-ETHYL-HEXANOIC ACID SULFOPHENYL ESTER SODIUM SALT
CAS:93682-61-2
Formula: C14H20O5S.Na
KIN02772412
2-ETHYL-HEXANOIC ACID TERBIUM(III) SALT
CAS:84573-74-0
Formula: C8H16O2.1/3Tb
KIN02668481
2-ETHYL-HEXANOIC ACID TERT-BUTYL ESTER
CAS:67024-46-8
Formula: C12H24O2
KIN02547807
2-ETHYL-HEXANOIC ACID TERT-DECANOIC ACID IRON
CAS:93981-43-2
KIN02776224
2-ETHYL-HEXANOIC ACID TETRAHYDRO-2H-PYRAN-2-YL ESTER
CAS:142877-09-6
Formula: C13H24O3
KIN03267074
2-ETHYL-HEXANOIC ACID TIN(IV) SALT
CAS:1187-80-0
Formula: C7H12O
KIN01042487
2-ETHYL-HEXANOIC ACID TITANIUM SALT
CAS:147964-61-2
Formula: C8H16O2.xTi
KIN03287866
2-ETHYL-HEXANOIC ACID TRIANHYDRIDE WITH BORIC ACID (H3BO3)
CAS:51136-86-8
Formula: C24H45BO6
KIN02302330
2-ETHYL-HEXANOIC ACID TRIBUTYLPLUMBYL ESTER
CAS:15873-20-8
Formula: C20H42O2Pb
KIN02045025
2-ETHYL-HEXANOIC ACID URANIUM SALT
CAS:160648-43-1
Formula: C8H16O2.xU
KIN03326704
2-ETHYL-HEXANOIC ACID ZINC SALT BASIC
CAS:85203-81-2
KIN02672663
2-ETHYL-HEXANOIC PEROXYANHYDRIDE
CAS:1069-23-4
Formula: C6H10O2
KIN01038465
2-ETHYL-HEXANOL
CAS:104-77-8
Formula: C7H16ClN
KIN01003742
2-ETHYL-HEXANOYL CHLORIDE
CAS:760-68-9
KIN01028421
2-ETHYL-HEXEN-1-OL
CAS:29594-61-4
Formula: C8H16O
KIN02175224
2-ETHYL-HEXENAL OXIME
CAS:140627-22-1
Formula: C8H15NO
KIN03256816
2-ETHYL-HEXENOIC ACID
CAS:70004-82-9
Formula: C8H14O2
KIN02574506
2-ETHYL-HEXYL (2S)-5-OXO-PYRROLIDINE-2-CARBOXYLATE
CAS:4262-03-7
Formula: C11H10N2S
KIN01104026
2-ETHYL-HEXYL 2-(2,4,5-TRICHLOROPHENOXY)-ACETATE
CAS:1928-48-9
Formula: C15H19Cl3O4
KIN01059062
2-ETHYL-HEXYL 2-(2,4-DICHLOROPHENOXY)-ACETATE
CAS:1928-44-5
Formula: C16H22Cl2O3
KIN01059060
2-ETHYL-HEXYL 2-ETHYL-HEXANOATE
CAS:7425-15-2
Formula: C14H28O2
KIN01186658
2-ETHYL-HEXYL 2-HYDROXY-PROPANOATE
CAS:6283-87-0
Formula: C11H22O4
KIN01155365
2-ETHYL-HEXYL 2-MERCAPTOACETATE
CAS:7659-95-2
Formula: C24H26N2O13
KIN01192921
2-ETHYL-HEXYL 2-METHYLPENTANOATE
CAS:6641-74-3
Formula: C16H16O2
KIN01167794
2-ETHYL-HEXYL 4-(2,4-DICHLOROPHENOXY)BUTYRATE
CAS:7720-37-8
KIN01194011
2-ETHYL-HEXYL 4-HYDROXY-BENZOATE
CAS:5153-29-7
KIN01121747
2-ETHYL-HEXYL 4-NITRO-BENZOATE
CAS:6500-51-2
Formula: C9H8O3
KIN01163748
2-ETHYL-HEXYL 8-(3-OCTYLOXIRAN-2-YL)OCTANOATE
CAS:141-40-2
Formula: C7H9NO
KIN01006228
2-ETHYL-HEXYL ACETATE
CAS:103-11-7
Formula: C11H2OO2
KIN01003591
2-ETHYL-HEXYL ACRYLATE
CAS:103-12-8
Formula: C12H13N5O2S
KIN01003592
2-ETHYL-HEXYL ALPHA-CYANO-5-PHENYL-2,4-PENTADIENOATE
CAS:131512-74-8
Formula: C20H25NO2
KIN03214534
2-ETHYL-HEXYL CHLOROFORMATE
CAS:24468-13-1
Formula: CH3(CH2)3CH(CH2CH3)CH2OCOCl
KIN02130785
MFCD00000643
2-ETHYL-HEXYL DIPHENYL PHOSPHATE
CAS:1242-12-2
Formula: C22H28O3
KIN01044494
2-ETHYL-HEXYL HEXADECANOATE
CAS:29806-73-3
Formula: C24H48O2
KIN02176776
MFCD00072255
2-ETHYL-HEXYL METHACRYLATE
CAS:688-92-6
Formula: C8H17N
KIN01025602
2-ETHYL-HEXYL NITRATE
CAS:27247-96-7
Formula: C8H17NO3
KIN02155531
MFCD00011582
2-ETHYL-HEXYL NITRITE
CAS:1653-52-7
Formula: C14H16N4O8
KIN01052548
2-ETHYL-HEXYL OCTANOATE
CAS:63321-70-0
Formula: C16H32O2
KIN02490481
MFCD12031480
2-ETHYL-HEXYL SALICYLATE
CAS:118-61-6
Formula: C9H10O3
KIN01004808
2-ETHYL-HEXYLAMINE HCL
CAS:26392-49-4
Formula: C8H20ClN
KIN02147959
MFCD00060201
2-ETHYL-IMIDAZO[1,2-A]PYRAZIN-3(7H)-ONE
CAS:57683-97-3
Formula: C8H9N3O
KIN02403601
2-ETHYL-IMIDAZO[1,2-A]PYRIDIN-3-CARBALDEHYDE
CAS:89021-13-6
Formula: C10H10N2O
KIN02705855
2-ETHYL-IMIDAZO[1,2-A]PYRIDIN-8-YLAMINE
CAS:185133-87-3
KIN03378594
2-ETHYL-IMIDAZO[1,2-A]PYRIDINE-8-OL
CAS:1058656-05-5
Formula: C9H10N2O
KIN05105208