ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

2,4,4-TRIMETHYL-HEXAN-1,6-DIAMINE
CAS:3236-55-3
Formula: C10H12N2O2
KIN01085036
2,4,4-TRIMETHYL-HEXAN-3-ONE
CAS:34575-34-3
Formula: C9H18O
KIN02214940
2,4,4-TRIMETHYL-HEXAN-3-YL N-NAPHTHALEN-1-YLCARBAMATE
CAS:7770-06-1
Formula: C6H9N2O3+
KIN01194777
2,4,4-TRIMETHYL-HEXANAL
CAS:50902-73-3
Formula: C9H18O
KIN02299171
2,4,4-TRIMETHYL-HEXANE
CAS:16747-30-1
Formula: C9H20
KIN02054510
MFCD00061012
2,4,4-TRIMETHYL-HEXANEDIOIC ACID
CAS:3937-66-4
KIN01098217
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 1,6-BIS(2-OXIRANYLMETHYL) ESTER
CAS:25677-83-2
Formula: C15H24O6
KIN02141899
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 1-DECYL 6-OCTYL ESTER
CAS:68425-97-8
Formula: C27H52O4
KIN02563193
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 6-DECYL 1-OCTYL ESTER
CAS:67873-93-2
Formula: C27H52O4
KIN02558959
2,4,4-TRIMETHYL-HEXANEDIOIC ACID DIDECYL ESTER
CAS:95258-38-1
Formula: C29H56O4
KIN02789766
2,4,4-TRIMETHYL-N,N-BIS[(NAPHTHALEN-2-YLTHIO)METHYL]-2-PENTANAMINE
CAS:28926-16-1
Formula: C30H35NS2
KIN02169956
2,4,4-TRIMETHYL-OCT-2-ENE
CAS:103982-60-1
Formula: C11H22
KIN03057749
2,4,4-TRIMETHYL-OCTANE
CAS:62016-35-7
Formula: C11H24
KIN02466179
2,4,4-TRIMETHYL-OXAZOLIDINE
CAS:31720-56-6
Formula: C6H13NO
KIN02191620
2,4,4-TRIMETHYLCYCLOHEPTA[CD]BENZOFURAN-6(3H)-ONE
CAS:64437-97-4
KIN02509884
2,4,4-TRIMETHYLCYCLOHEX-1-ENECARBALDEHYDE
CAS:5939-91-3
Formula: C19H17Cl2N3OS
KIN01145610
2,4,4-TRIMETHYLCYCLOHEX-2-EN-1-OL
CAS:134736-78-0
Formula: C9H16O
KIN03229543
2,4,4-TRIMETHYLCYCLOHEX-2-ENONE
CAS:13395-71-6
Formula: C9H14O
KIN02018961
2,4,4-TRIMETHYLCYCLOHEXAN-1-ONE
CAS:2230-79-7
KIN01065384
2,4,4-TRIMETHYLCYCLOHEXAN-CARBALDEHYDE
CAS:64825-17-8
Formula: C10H18O
KIN02516369
2,4,4-TRIMETHYLCYCLOPENTANONE
CAS:4694-17-1
Formula: C8H12O
KIN01112761
2,4,4-TRIMETHYLCYCLOPENTANONE (TERT-BUTYL)HYDRAZONE
CAS:62204-22-2
Formula: C12H24N2
KIN02470000
2,4,4-TRIMETHYLHEXAN-1,6-DIOL
CAS:32305-38-7
Formula: C9H20O2
KIN02195804
2,4,4-TRIMETHYLNONA-6,8-DIEN-3-ONE OXIME
CAS:84625-53-6
Formula: C12H21NO
KIN02668842
2,4,4-TRIMETHYLNONANE
CAS:62184-61-6
Formula: C12H26
KIN02469549
2,4,4-TRIMETHYLPENT-1-EN-3-OL
CAS:7432-49-7
Formula: C7H12O
KIN01186797
2,4,4-TRIMETHYLPENT-1-ENE
CAS:107-40-4
Formula: C8H16
KIN01003986
2,4,4-TRIMETHYLPENT-2-ENE
CAS:107-41-5
Formula: C6H14O2
KIN01003987
2,4,4-TRIMETHYLPENTAN-1-OL
CAS:16325-63-6
Formula: C8H18O
KIN02050213
MFCD00004741
2,4,4-TRIMETHYLPENTAN-1-OL PHOSPHATE (3:1)
CAS:129877-64-1
Formula: C24H51O4P
KIN03207784
2,4,4-TRIMETHYLPENTAN-2,3-DIOL
CAS:64512-96-5
Formula: C8H18O2
KIN02511096
2,4,4-TRIMETHYLPENTAN-2-YL 2,2-DIMETHYLPROPANEPEROXOATE
CAS:22288-41-1
Formula: C13H26O3
KIN02109288
2,4,4-TRIMETHYLPENTAN-2-YL 3,5,5-TRIMETHYLHEXANEPEROXOATE
CAS:207851-10-3
KIN03417963
2,4,4-TRIMETHYLPENTAN-2-YL 6,6-DIMETHYL-HEPTANEPEROXOATE
CAS:136829-88-4
Formula: C17H34O3
KIN03238890
2,4,4-TRIMETHYLPENTAN-2-YL BENZENECARBODITHIOATE
CAS:201611-86-1
Formula: C15H22S2
KIN03409307
2,4,4-TRIMETHYLPENTAN-2-YL HEXANEPEROXOATE
CAS:220290-81-3
Formula: C14H28O3
KIN03433585
2,4,4-TRIMETHYLPENTAN-2-YL OCTANEPEROXOATE
CAS:175426-14-9
Formula: C16H32O3
KIN03358971
2,4,4-TRIMETHYLPENTAN-2-YLAMINE
CAS:107-46-0
Formula: C6H18OSi2
KIN01003991
2,4,4-TRIMETHYLPENTAN-2-YLAMINE ACETATE
CAS:43077-72-1
Formula: C10H23NO2
KIN02282509
2,4,4-TRIMETHYLPENTAN-2-YLAMINE, BENZOATE
CAS:6281-49-8
Formula: C9H18N2O2S
KIN01155193
2,4,4-TRIMETHYLPENTANAL
CAS:17414-46-9
Formula: C8H16O
KIN02061792
2,4,4-TRIMETHYLPENTANAL OXIME
CAS:56267-23-3
Formula: C8H17NO
KIN02380029
2,4,4-TRIMETHYLPENTANE-1,2-DIOL
CAS:64484-85-1
Formula: C8H18O2
KIN02510569
2,4,4-TRIMETHYLPENTANOIC ACID
CAS:3302-10-1
Formula: C9H18O2
KIN01086352
2,4,4-TRIMETHYLPENTANOIC ACID ETHYL ESTER
CAS:60302-30-9
Formula: C10H20O2
KIN02443395
2,4,4-TRIMETHYLPENTANOIC ACID METHYL ESTER
CAS:64198-22-7
Formula: C9H18O2
KIN02505945
2,4,4-TRIMETHYLPENTANOYL CHLORIDE
CAS:5340-44-3
KIN01126698
2,4,4-TRIMETHYLPENTENE
CAS:25167-70-8
Formula: C8H16
KIN02136969
2,4,4-TRIMETHYLPENTENE EPOXIDE
CAS:63919-00-6
Formula: C8H16O
KIN02501354
2,4,4-TRIMETHYLPENTENE REACTION PRODUCTS WITH NITRO-GEN OXIDE (N2O4)
CAS:474266-68-7
KIN03601014
2,4,4-TRIMETHYLPENTYL 2-PEROXY-PHENOXY-ACETATE
CAS:59382-51-3
Formula: C16H24O4
KIN02430646
2,4,4-TRIMETHYLPENTYL 4-CYANOBENZOATE
CAS:86590-88-7
Formula: C16H21NO2
KIN02681298
2,4,4-TRIMETHYLPENTYL-PHOSPHINE
CAS:82164-75-8
Formula: CH3C(CH3)2CH2CH(CH3)CH2PH2
KIN02653900
MFCD00269836
2,4,4-TRIMETHYLPENTYL-PHOSPINE
CAS:82164-76-9
KIN02653901
2,4,4-TRIMETHYLPYRROLIDIN-2-CARBONITRILE
CAS:86351-39-5
Formula: C8H14N2
KIN02679921
2,4,4-TRIMETHYLPYRROLIDINE
CAS:73604-52-1
Formula: C7H15N
KIN02599351
MFCD09032720
2,4,4-TRIPHENYL-[1,2]OXAZETIDIN-3-ONE
CAS:17003-58-6
Formula: C20H15NO2
KIN02057112
2,4,4-TRIPHENYL-1,4-BENZOXAPHOSPHININ-4-IUM, BROMIDE
CAS:72596-47-5
Formula: C26H20BrOP
KIN02592487
2,4,4-TRIPHENYL-2-PROPOXY-4H-BENZO[1,3]DIOXIN
CAS:61768-12-5
Formula: C29H26O3
KIN02461644
2,4,4-TRIPHENYL-4H-BENZO[1,3]DIOXIN-1-IUM PERCHLORATE
CAS:56228-47-8
Formula: C26H19O2.ClO4
KIN02379418
2,4,4-TRIPHENYL-4H-BENZO[1,3]DIOXIN-2-OL
CAS:61768-11-4
Formula: C26H20O3
KIN02461643
2,4,4-TRIPHENYL-5(4H)-OXAZOLONE
CAS:61365-94-4
Formula: C21H15NO2
KIN02455048
2,4,4-TRIPHENYL-6-[(4,4,6-TRIPHENYL-1,4-OXAPHOSPHININ-4-IUM-2-YL)METHYL]-1,4-OXAPHOSPHININ-4-IUM, BROMIDE
CAS:21680-89-7
Formula: C45H36BrO2P2+
KIN02103190
2,4,4-TRIS(ETHYLTHIO)BUTANOIC ACID
CAS:94014-39-8
Formula: C10H20O2S3
KIN02776522
2,4,4A,5,6,7-HEXAHYDRO-2-(4-METHOXY-PHENYL)-9-METHYL-3H-THIENO[2',3':6,7]CYCLOHEPTA[1,2-C]PYRIDAZIN-3-ONE
CAS:129477-46-9
Formula: C19H20N2O2S
KIN03206010
2,4,4A,5,6,7-HEXAHYDRO-3H-BENZO[6,7]CYCLOHEPTA[1,2-C]PYRIDAZIN-3-ONE
CAS:25742-87-4
Formula: C13H14N2O
KIN02142430
2,4,4A,5,6,7-HEXAHYDRO-3H-CYCLOPENTA[C]PYRIDAZIN-3-ONE
CAS:94767-50-7
Formula: C7H10N2O
KIN02784867
2,4,4A,5-TETRAHYDRO-7-(METHYLAMINO)-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-73-0
Formula: C12H13N3O
KIN03134142
2,4,4A,5-TETRAHYDRO-7-HYDROXY-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-72-9
Formula: C11H10N2O2
KIN03134141
2,4,4A,5-TETRAHYDRO-8-NITRO-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-66-1
Formula: C11H9N3O3
KIN03134137
2,4,4A,5-TETRAHYDROINDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:69099-74-7
Formula: C11H10N2O
KIN02567943
2,4,4A,8-TETRAHYDRO-4-HYDROXY-4A-1H-INDOL-3-YL-6,8-DIMETHYLPYRIMIDO[5,4-E][1,2,4]-TRIAZIN-3,5,7(6H)-TRIONE
CAS:110621-93-7
Formula: C15H14N6O4
KIN03102756
2,4,4A,8-TETRAHYDRO-4A-1H-INDOL-3-YL-6,8-DIMETHYLPYRIMIDO[5,4-E][1,2,4]-TRIAZIN-3,5,7(6H)-TRIONE
CAS:113458-63-2
Formula: C15H14N6O3
KIN03123193
2,4,4A,9-TETRAHYDRO-3H-INDENO[2,1-C]PYRIDAZIN-3-ONE
CAS:100595-18-4
Formula: C11H10N2O
KIN03033142
2,4,5 -TRIBROMO-2,2,5,2 -TERTHIOPHENE
CAS:118824-91-2
Formula: C12H5Br3S3
KIN03156225
2,4,5,10-TETRAHYDRO-1H-PYRAZOLO[3,4-A]CARBAZOLE
CAS:169136-33-8
Formula: C13H11N3
KIN03344034
2,4,5,10-TETRAHYDRO-7-METHYL-1H-PYRAZOLO[3,4-A]CARBAZOLE
CAS:169136-32-7
Formula: C14H13N3
KIN03622835
2,4,5,10-TETRAHYDRO-AZEPINO[2,3-B]INDOL-5A(3H)-OL
CAS:23240-60-0
KIN02118185
2,4,5,12-TETRAHYDRO-12-(BENZYL)-[1,3]DIAZEPINO[2,1-B]QUINAZOLIN-7(3H)-ONE
CAS:55536-52-2
Formula: C19H19N3O
KIN02368133
2,4,5,2',4',5'-HEXABROMO-BIPHENYL
CAS:59080-40-9
Formula: *C12H4Br6
KIN02425871
2,4,5,2',5'-PENTACHLORO-BIPHENYL
CAS:37680-73-2
Formula: *C12H5Cl5
KIN02241689
MFCD00055553
2,4,5,2,4,5'-HEXABROMO[3,3 ]BITHIOPHENYL
CAS:35070-39-4
Formula: C8Br6S2
KIN02219533
2,4,5,3',4',5'-HEXACHLORO-BIPHENYL
CAS:52663-72-6
Formula: C12H4Cl6
KIN02323869
2,4,5,3',4'-PENTABROMO-BIPHENYL
CAS:67888-97-5
Formula: C12H5Br5
KIN02559106
2,4,5,5-TETRAETHYL-2,5-DIHYDRO-2,3-DIMETHYL-1-(TRIMETHYL-STANNYL)-1,2,5-OXONIASILABORATOLE
CAS:132126-05-7
Formula: C15H35BOSiSn
KIN03217321
2,4,5,5-TETRAMETHYL-[1,2,4]-TRIAZOLIDINE-3-THIONE
CAS:115029-47-5
Formula: C6H13N3S
KIN03134844
2,4,5,5-TETRAMETHYL-2,3-OCTADIEN-6-YNE
CAS:65150-08-5
Formula: C12H18
KIN02522094
2,4,5,5-TETRAMETHYL-2,6-OCTADIENE
CAS:65132-94-7
Formula: C12H22
KIN02521786
2,4,5,5-TETRAMETHYL-2-[2-(1-HYDROXY-3,5-DI-TERT-BUTYLCYCLOHEXADIEN-2,5-ONYL)-1-ETHYL]-3(1H)-IMIDAZOLINE, 3-OXIDE
CAS:105654-17-9
Formula: C23H38N2O3
KIN03070024
2,4,5,5-TETRAMETHYL-2-PHENYL-1,3-DIOXANE
CAS:24571-27-5
Formula: C14H20O2
KIN02131721
2,4,5,5-TETRAMETHYL-3-CYCLOHEPTEN-1-ONE
CAS:65371-62-2
Formula: C11H18O
KIN02525699
2,4,5,5-TETRAMETHYL-4-PROPAN-2-YL-3-HEXANONE
CAS:79964-62-8
Formula: C13H26O
KIN02640944
2,4,5,5-TETRAMETHYL-HEPTANE
CAS:61868-58-4
Formula: C11H24
KIN02463530
2,4,5,5-TETRAMETHYL-OCTANE
CAS:62199-36-4
Formula: C12H26
KIN02469900
2,4,5,6(1H,3H)-PYRIMIDINETETRONE
CAS:50-73-7
Formula: C7H3Cl3O2
KIN01000064
2,4,5,6(1H,3H)-PYRIMIDINETETRONE 5-[(3,7-DIMETHYL-2,6-DIOXO-2,3,6,7-TETRAHYDRO-1H-PURIN-8-YL)HYDRAZONE]
CAS:476481-27-3
Formula: C11H10N8O5
KIN03603638
2,4,5,6(1H,3H)-PYRIMIDINETETRONE 5-[(7-BENZYL-1,3-DIMETHYL-2,6-DIOXO-2,3,6,7-TETRAHYDRO-1H-PURIN-8-YL)HYDRAZONE]
CAS:476481-71-7
Formula: C18H16N8O5
KIN03603647
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(2-METHYLPHENYL)HYDRAZONE]
CAS:111709-59-2
Formula: C11H10N4O3
KIN03109480
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(2-NITROPHENYL)HYDRAZONE]
CAS:111709-57-0
Formula: C10H7N5O5
KIN03109479
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(3-NITROPHENYL)HYDRAZONE]
CAS:19849-54-8
Formula: C10H7N5O5
KIN02085451
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-CHLOROPHENYL)HYDRAZONE]
CAS:7293-32-5
Formula: C10H8N2O3S
KIN01183719
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-METHOXY-PHENYL)HYDRAZONE]
CAS:19849-56-0
Formula: C11H10N4O4
KIN02085453
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-METHYLPHENYL)HYDRAZONE]
CAS:19849-57-1
Formula: C11H10N4O3
KIN02085454
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(3-ACETYLPHENYL)HYDRAZONE]
CAS:314758-51-5
Formula: C12H10N4O4
KIN03489713
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(4-ACETYLPHENYL)HYDRAZONE]
CAS:342783-96-4
Formula: C12H10N4O4
KIN03516694
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(4-IODO-PHENYL)HYDRAZONE]
CAS:314758-35-5
Formula: C10H7IN4O3
KIN03489712
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-[2,3,6,7-TETRAHYDRO-3-METHYL-7-(3-METHYLBUTYL)-2,6-DIOXO-1H-PURIN-8-YL]HYDRAZONE]
CAS:476481-33-1
Formula: C15H18N8O5
KIN03603639
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-[7-(3-CHLORO-BUT-2-EN-1-YL)-2,3,6,7-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-1H-PURIN-8-YL]HYDRAZONE]
CAS:478253-38-2
Formula: C15H15ClN8O5
KIN03606499
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-PYRIDIN-3-YLHYDRAZONE]
CAS:327087-31-0
KIN03497403
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-HYDRAZONE
CAS:89603-59-8
Formula: C4H4N4O3
KIN02714205
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME
CAS:87-40-1
Formula: C7H5Cl3O
KIN01002171
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME MONOPOTASSIUM SALT DIHYDRATE
CAS:5138-04-5
Formula: C25H20Cl2FN5O4S
KIN01121473
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME, SODIUM SALT
CAS:825-30-9
KIN01030808
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, TRIHYDRATE
CAS:75870-79-0
Formula: C4H8N2O7
KIN02615392
2,4,5,6(1H,3H)-PYRIMIDINETETRONE,5-[[3-(DIFLUOROMETHOXY)PHENYL]HYDRAZONE]
CAS:302583-86-4
Formula: C11H8F2N4O4
KIN03478163
2,4,5,6(1H,3H)-PYRIMIDINETETRONE,5-[[4-(DIFLUOROMETHOXY)PHENYL]HYDRAZONE]
CAS:302935-80-4
Formula: C11H8F2N4O4
KIN03478655
2,4,5,6,7,7-HEXAMETHYL-4-OCTEN-3-ONE
CAS:81786-84-7
Formula: C14H26O
KIN02651743
2,4,5,6,7,7-HEXAMETHYL-5-OCTEN-3-ONE
CAS:81786-86-9
Formula: C14H26O
KIN02651745
2,4,5,6,7,7A-HEXAHYDRO-1,1-DIMETHYL-1H-PHOSPHINDOLIUM IODIDE
CAS:57065-73-3
Formula: C10H18P.I
KIN02393385
2,4,5,6,7,7A-HEXAHYDRO-1-HYDROXY-2,2,7A-TRIMETHYL-1H-BENZO[D]IMIDAZOLE 3-OXIDE
CAS:29522-49-4
Formula: C10H18N2O2
KIN02174646
2,4,5,6,7,7A-HEXAHYDRO-1H-INDEN-6-YLIUM
CAS:67731-45-7
Formula: C9H13
KIN02557249
2,4,5,6,7,7A-HEXAHYDRO-2,2,3-TRIFLUORO-7A-METHYLBENZO[B]THIOPHENE
CAS:100333-45-7
Formula: [C9H11F3S
KIN03030690
2,4,5,6,7,7A-HEXAHYDRO-2-[(1E,3E,5E,7E,9E,11E)-13-HYDROXY-1,5,10-TRIMETHYL-1,3,5,7,9,11-TRIDECAHEXAENYL]-4,4,7A-TRIMETHYL-6-BENZOFURANOL
CAS:53905-15-0
Formula: C27H38O3
KIN02342116
2,4,5,6,7,7A-HEXAHYDRO-2-OXO-3-BENZOFURANCARBONITRILE
CAS:103324-80-7
Formula: C9H9NO2
KIN03656619
2,4,5,6,7,7A-HEXAHYDRO-3-BENZOFURANCARBALDEHYDE
CAS:252721-65-6
Formula: [C9H12O2
KIN03452654
2,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDENE
CAS:87238-76-4
Formula: C10H14
KIN02685309
2,4,5,6,7,7ALPHA-HEXAHYDRO-1-(1-METHYLETHYL)-1H-INDEN-1-OL
CAS:143398-18-9
Formula: C12H20O
KIN03270009
2,4,5,6,7,8,8-HEPTACHLORO-3A,4,7,7A-TETRAHYDRO-4,7-METHANO-1H-INDENE
CAS:5103-66-2
Formula: C12H8Cl6O4
KIN01120771
2,4,5,6,7,8-HEXAFLUORO-1(4H)-NAPHTHALENONE
CAS:57070-24-3
KIN02393590
2,4,5,6,7,8-HEXAFLUORO-1,3-NAPHTHALENEDIOL
CAS:41481-27-0
KIN02271487
2,4,5,6,7,8-HEXAFLUORO-3-METHOXY-NAPHTHALEN-1-OL
CAS:72793-89-6
KIN02593879
2,4,5,6,7,8-HEXAFLUORO-3-METHYL-NAPHTHALEN-1-OL
CAS:54835-51-7
KIN02356214
2,4,5,6,7,8-HEXAFLUORO-3-PHENOXY-NAPHTHALEN-1-OL
CAS:57070-19-6
KIN02393587
2,4,5,6,7,8-HEXAFLUORO-QUINAZOLINE
CAS:28734-87-4
Formula: C8F6N2
KIN02168383
2,4,5,6,7,8-HEXAHYDRO-1,4,6-TRIMETHYL-3H-3A,6-EPOXYAZULENE
CAS:51334-45-3
Formula: C13H20O
KIN02305083
2,4,5,6,7,8-HEXAHYDRO-1,4-DIMETHYL-3H-3A,6-EPOXYAZULENE
CAS:51334-55-5
Formula: C12H18O
KIN02305089
2,4,5,6,7,8-HEXAHYDRO-3-CYCLOHEPTA-1H-PYRAZOLOL
CAS:117891-68-6
Formula: C8H12N2O
KIN03151362
2,4,5,6,7,8-HEXAHYDRO-3-CYCLOHEPTAPYRAZOLAMINE
CAS:54162-24-2
Formula: C8H13N3
KIN02346048
2,4,5,6,7,8-HEXAHYDRO-3-METHYLCYCLOHEPTA-1H-PYRAZOLE
CAS:114425-71-7
Formula: [C9H14N2
KIN03130688
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[4,5-C]AZEPIN-3-ONE
CAS:65202-72-4
Formula: C7H10N2O2
KIN02522968
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[4,5-D]AZEPIN-3-ONE
CAS:53658-58-5
Formula: C7H10N2O2
KIN02338515
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[5,4-B]AZEPIN-3-ONE
CAS:121379-66-6
Formula: C7H10N2O2
KIN03169434
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[5,4-C]AZEPIN-3-ONE
CAS:65202-67-7
Formula: C7H10N2O2
KIN02522967
2,4,5,6,7,8-HEXAHYDRO-CYCLOHEPTA[C]PYRROLE
CAS:113880-83-4
Formula: C9H13N
KIN03126767
2,4,5,6,7,8-HEXAHYDRO-N,N,2-TRIMETHYL-3-CYCLOHEPTAPYRAZOLAMINE
CAS:51658-39-0
KIN02309787
2,4,5,6,7,8-HEXAHYDROAZULEN-2-YL-[2,4,5,6,7,8-HEXAHYDROAZULEN-2-YL-(DIMETHYL)SILYL]-DIMETHYLSILANE
CAS:209738-77-2
Formula: C24H38Si2
KIN03420368
2,4,5,6,7,8-HEXAHYDROPYRAZOLO[3,4-D]AZEPINE
CAS:111416-15-0
Formula: C7H11N3
KIN03107666
2,4,5,6,7,8-HEXAHYDROPYRAZOLO[4,3-C]AZEPINE
CAS:111416-17-2
Formula: C7H11N3
KIN03107667
2,4,5,6,7,8-HEXAMETHYL-AZULENE
CAS:63297-21-2
Formula: C16H20
KIN02490036
2,4,5,6,7,9-HEXATHIADECANE
CAS:88496-85-9
Formula: C4H10S6
KIN02699035
2,4,5,6,7-PENTABROMO-1H-BENZO[D]IMIDAZOLE
CAS:16865-25-1
Formula: C7HBr5N2
KIN02055781
MFCD07776823
2,4,5,6,7-PENTACHLORO-1H-BENZO[D]IMIDAZOLE
CAS:7682-38-4
Formula: C3HCl3N2
KIN01193321
2,4,5,6,7-PENTAFLUOROBENZOFURAN
CAS:337958-55-1
KIN03510254
2,4,5,6,7-PENTAMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:69700-34-1
Formula: C12H16N2
KIN02572208
2,4,5,6,7-PENTAMETHYL-2H-ISOINDOLE
CAS:126134-14-3
Formula: C13H17N
KIN03191575
2,4,5,6,7-PENTAMETHYL-QUINOLINE
CAS:1639-31-2
Formula: C9H13N
KIN01052232
2,4,5,6,7-PENTAMETHYLINDEN-1-ONE
CAS:147834-98-8
Formula: C14H16O
KIN03287525
2,4,5,6,8-PENTAMETHYL-QUINOLINE
CAS:50519-33-0
Formula: C14H17N
KIN02293876
2,4,5,6-PYRIMIDINETETRAMINE, 2HBR
CAS:158754-80-4
Formula: C4H8N6.2BrH
KIN03321416
2,4,5,6-PYRIMIDINETETRAMINE, 2HCL
CAS:52980-67-3
Formula: C4H9ClN6
KIN02328445
MFCD00859060
2,4,5,6-PYRIMIDINETETRAMINE, 3HCL
CAS:51093-30-2
Formula: C4H8N6.3ClH
KIN02301588
2,4,5,6-PYRIMIDINETETRAMINE, ACETATE (1:)
CAS:101511-84-6
Formula: C4H8N6.xC2H4O2
KIN03039960
2,4,5,6-PYRIMIDINETETRAMINE, HBR (1:3)
CAS:278800-37-6
Formula: C4H8N6.3BrH
KIN03466174
2,4,5,6-PYRIMIDINETETRAMINE, HCL
CAS:65540-06-9
Formula: C4H9ClN6
KIN02528502
2,4,5,6-PYRIMIDINETETRAMINE, HCL (1:)
CAS:39944-62-2
Formula: C4H8N6.x(HCl)
KIN02258711
MFCD01310538
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE
CAS:5392-30-3
Formula: C17H14N2O5
KIN01128364
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE (1:)
CAS:49647-58-7
Formula: C4H8N6.H2SO4
KIN02289422
MFCD00012786
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE (1:4)
CAS:1004297-42-0
Formula: C4H8N6.4H2O4S
KIN05009401
2,4,5,6-PYRIMIDINETETRAMINE, SULFITE
CAS:65003-86-3
Formula: C4H8N6.H2O3S
KIN02519472
2,4,5,6-PYRIMIDINETETRAMINE, TOSYLATE
CAS:39232-37-6
Formula: C7H8O3S.C4H8N6
KIN02254084
2,4,5,6-QUINAZOLINETETRAMINE
CAS:215182-74-4
Formula: C8H10N6
KIN03427589
2,4,5,6-TETRAAMINOPYRIMIDE, SULFATE
CAS:103661-14-9
KIN03055333
2,4,5,6-TETRAAMINOPYRIMIDINE
CAS:1004-75-7
Formula: C5H8N4O
KIN01036585
2,4,5,6-TETRACARBOXY-BENZENE-1,3-DICARBOXYLATE
CAS:7235-74-7
Formula: C20H16F3N3O
KIN01182184
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONITRILE
CAS:216082-57-4
Formula: C8Cl4N2
KIN03428779
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONITRILE MIXT. WITH 4-[(2R)-2-[(1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL]-2-HYDROXYETHYL]-2,6-PIPERIDINEDIONE
CAS:37301-48-7
KIN02238480
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONYL DICHLORIDE
CAS:77450-97-6
Formula: C8Cl6O2
KIN02625697
2,4,5,6-TETRACHLORO-2-CYCLOHEXEN-1-OL
CAS:78137-69-6
Formula: C6H6Cl4O
KIN02629521
2,4,5,6-TETRACHLORO-3-AMINO-ANILINE
CAS:26288-19-7
Formula: C6H4Cl4N2
KIN02147088
2,4,5,6-TETRACHLORO-3-FORMYLBENZALDEHYDE
CAS:40860-93-3
Formula: C8H2Cl4O2
KIN02266395
2,4,5,6-TETRACHLORO-3-HYDROXY-PHENOL
CAS:28520-00-5
Formula: C6H2Cl4O2
KIN02166697
2,4,5,6-TETRACHLORO-3-HYDROXY-PHENOL DIACETATE
CAS:69158-26-5
Formula: C10H6Cl4O4
KIN02568376
2,4,5,6-TETRACHLORO-3-METHYL-TOLUEN-ALPHA,ALPHA'-DIAMINE
CAS:16969-06-5
Formula: C8H8Cl4N2
KIN02056846
MFCD00025573
2,4,5,6-TETRACHLORO-3-METHYL-TOLUENE
CAS:877-10-1
Formula: C8H6Cl4
KIN01032568
2,4,5,6-TETRACHLORO-3-PYRIDINECARBONYL CHLORIDE
CAS:35592-28-0
KIN02224511
2,4,5,6-TETRACHLORO-3-PYRIDINETHIOL
CAS:75723-81-8
Formula: C5HCl4NS
KIN02614427
2,4,5,6-TETRACHLORO-ISOPHTHALAMIDE
CAS:1786-87-4
Formula: C8H6O6
KIN01055839
2,4,5,6-TETRACHLOROBENZENE-1,3-DICARBONITRILE
CAS:1897-46-7
KIN01058358
2,4,5,6-TETRACHLOROBENZENE-1,3-DICARBOXYLIC ACID
CAS:7401-91-4
Formula: C5H11ClHgO
KIN01186054
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBONITRILE
CAS:17824-82-7
Formula: C6Cl4N2
KIN02066023
MFCD00624086
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXAMIDE
CAS:70593-60-1
Formula: C6H2Cl4N2O
KIN02578490
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID
CAS:35592-22-4
KIN02224506
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:180298-66-2
KIN03622834
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID METHYL ESTER
CAS:35592-30-4
KIN02224513
2,4,5,6-TETRACHLOROPYRIDIN-3-YLAMINE
CAS:447433-84-3
Formula: C5H2Cl4N2
KIN03589099
2,4,5,6-TETRACHLOROPYRIMIDINE
CAS:1780-42-3
Formula: C7H7Cl3N2
KIN01055658
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIACETONITRILE
CAS:1000535-81-8
Formula: C10H4F4N2
KIN05002489
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBONITRILE
CAS:2377-85-7
Formula: C8F12
KIN01068120
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBONYL DICHLORIDE
CAS:110649-97-3
Formula: C8Cl2F4O2
KIN03102910
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXAMIDE
CAS:153279-27-7
Formula: C8H4F4N2O2
KIN03304655
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID BIS(2-METHYL-ALLYL) ESTER
CAS:114645-84-0
KIN03132373
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID DIETHYL ESTER
CAS:119947-29-4
KIN03161506
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID ION(II)
CAS:437756-92-8
Formula: C8F4O4
KIN03622833
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIETHANAMINE
CAS:1000550-58-2
Formula: C10H12F4N2
KIN05003150
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANAMINE
CAS:478912-17-3
Formula: C8H8F4N2
KIN03607329
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANETHIOL
CAS:119947-36-3
KIN03161509
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANOL
CAS:119947-30-7
Formula: C8H6F4O2
KIN03161507
2,4,5,6-TETRAFLUORO-1-N 3-N-BIS(TRIMETHYLSILYL)-BENZENE-1,3-DIAMINE
CAS:141551-68-0
Formula: C12H20F4N2Si2
KIN03260812
2,4,5,6-TETRAFLUORO-2,4-CYCLOHEXADIEN-1-ONE
CAS:57070-22-1
Formula: C6H2F4O
KIN02393588
2,4,5,6-TETRAFLUORO-3-(PENTAFLUOROPHENOXY)-6-PHENYL-2,4-CYCLOHEXADIEN-1-ONE
CAS:152342-45-5
Formula: C18H5F9O2
KIN03301760
2,4,5,6-TETRAFLUORO-3-AMINO-ANILINE
CAS:1198-64-7
Formula: C6H4F4N2
KIN01043046
2,4,5,6-TETRAFLUORO-3-AMINO-ANILINE 2HCL
CAS:63886-77-1
Formula: C6H4F4N2.2HCl
KIN02500645
2,4,5,6-TETRAFLUORO-3-FORMYLBENZALDEHYDE
CAS:137593-09-0
Formula: C8H2F4O2
KIN03242288
2,4,5,6-TETRAFLUORO-3-HYDROXY-PHENOL
CAS:16840-25-8
Formula: C6H2F4O2
KIN02055514
Tetrafluoro-resorcinol
MFCD00040202
2,4,5,6-TETRAFLUORO-3-HYDROXY-PHENOL HYDRATE
CAS:207738-03-2
Formula: C6H2F4O2.xH2O
KIN03417774
2,4,5,6-TETRAFLUORO-3-PYRIDINECARBALDEHYDE
CAS:24306-75-0
Formula: C6HF4NO
KIN02129126
2,4,5,6-TETRAFLUORO-3-PYRIDINOL
CAS:74199-51-2
Formula: C5HF4NO
KIN02604049
2,4,5,6-TETRAFLUORO-4-ALLYL-3(4H)-PYRIDINONE
CAS:1071193-17-3
Formula: C8H5F4NO
KIN05112048
2,4,5,6-TETRAFLUORO-ALPHA-PHENYL-3-PYRIDINEMETHANOL
CAS:259675-89-3
Formula: C12H7F4NO
KIN03678528
2,4,5,6-TETRAFLUORO-ISOPHTHALIC ACID
CAS:1551-41-3
Formula: C15H28O2
KIN01049904
2,4,5,6-TETRAFLUORO-N1,N1,N3,N3-TETRAMETHYL-3-AMINO-ANILINE
CAS:2241-50-1
Formula: C8H8F3N3O2
KIN01065565
2,4,5,6-TETRAFLUOROPYRIDIN-3-CARBONITRILE
CAS:35720-79-7
Formula: C6F4N2
KIN02225765
2,4,5,6-TETRAFLUOROPYRIDIN-3-CARBOXYLIC ACID
CAS:3512-16-1
Formula: C5HF4N
KIN01090595
2,4,5,6-TETRAFLUOROPYRIMIDINE
CAS:767-80-6
Formula: C4H3FN2O3
KIN01028780
2,4,5,6-TETRAHYDRO-1,2,3,4,6,6-HEXAMETHYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-84-6
Formula: C14H22N2O
KIN02352671
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(2-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-00-3
Formula: C20H26N2O
KIN02352682
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(3-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-98-2
Formula: C20H26N2O
KIN02352680
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(4-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-94-8
Formula: C20H26N2O
KIN02352677
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(BENZYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-92-6
Formula: C20H26N2O
KIN02352676
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-27-7
Formula: C19H22N2
KIN02352661
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-89-1
Formula: C19H24N2O
KIN02352673
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPAN-2-YLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-07-0
Formula: C16H26N2O
KIN02352685
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-29-9
Formula: C16H24N2
KIN02352662
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-91-5
Formula: C16H26N2O
KIN02352675
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-24-4
Formula: C13H18N2
KIN02352660
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-85-7
Formula: C13H20N2O
KIN02352672
2,4,5,6-TETRAHYDRO-1-(HYDROXYMETHYL)-4,6,6-TRIMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-34-3
Formula: C18H22N2O2
KIN02352691
2,4,5,6-TETRAHYDRO-1-METHYLCYCLOPENTA[C]PYRROLE
CAS:151464-92-5
Formula: C8H11N
KIN03299446
2,4,5,6-TETRAHYDRO-1H-CYCLOBUTA[F]INDENE
CAS:60582-10-7
Formula: C11H12
KIN02445808
2,4,5,6-TETRAHYDRO-1H-PYRAZINO[3,2,1-JK]CARBAZOLE
CAS:56903-46-9
KIN02390494
2,4,5,6-TETRAHYDRO-2,5,6-TRIMETHYL-7-(NAPHTHALEN-1-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:36981-18-7
KIN02235910
2,4,5,6-TETRAHYDRO-2,5,6-TRIMETHYL-7-(NAPHTHALEN-2-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:36981-17-6
KIN02235909
2,4,5,6-TETRAHYDRO-2,5-DIMETHYL-3-CYCLOPENTAPYRAZOLECARBONYL CHLORIDE
CAS:132529-87-4
Formula: C9H11ClN2O
KIN03219259
2,4,5,6-TETRAHYDRO-2,6-DIMETHYL-3-CYCLOPENTAPYRAZOLECARBONYL CHLORIDE
CAS:146979-79-5
Formula: C9H11ClN2O
KIN03284305
2,4,5,6-TETRAHYDRO-2-METHYL-1,7-ETHENOCYCLOHEPTA[C]PYRROLE
CAS:59138-80-6
Formula: C12H13N
KIN02426786
2,4,5,6-TETRAHYDRO-2-METHYL-1H-BENZO[DE]ISOQUINOLIN-1-ONE
CAS:142944-63-6
KIN03267459
2,4,5,6-TETRAHYDRO-2-METHYL-3-CYCLOPENTAPYRAZOLECARBOXYLIC ACID
CAS:129560-01-6
Formula: C8H10N2O2
KIN03206350
2,4,5,6-TETRAHYDRO-2-METHYL-6-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:53277-31-9
KIN02332675
2,4,5,6-TETRAHYDRO-2-METHYL-7-(THIOPHEN-2-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:35641-80-6
KIN02224980
2,4,5,6-TETRAHYDRO-2-METHYL-7-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:29953-91-1
KIN02178008
2,4,5,6-TETRAHYDRO-2-METHYLCYCLOPENTAPYRAZOLE
CAS:84597-86-4
KIN02668626
2,4,5,6-TETRAHYDRO-3-CYCLOPENTAPYRAZOLAMINE
CAS:1092301-31-9
Formula: C6H9N3
KIN05133162
2,4,5,6-TETRAHYDRO-3-CYCLOPENTAPYRAZOLEETHANAMINE
CAS:1083368-50-6
Formula: C8H13N3
KIN05124565
2,4,5,6-TETRAHYDRO-3-METHYLCYCLOPENTAPYRAZOLE
CAS:84597-98-8
KIN02668627
2,4,5,6-TETRAHYDRO-3-PYRIDIN-4-YLBENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:52837-82-8
Formula: C17H15N3
KIN02326604
2,4,5,6-TETRAHYDRO-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-43-1
KIN02346421
2,4,5,6-TETRAHYDRO-5,5,7-TRIMETHYL-3H-1,2,4-TRIAZEPINE-3-THIONE
CAS:58488-41-8
Formula: C7H13N3S
KIN02416419
2,4,5,6-TETRAHYDRO-5,5-DIMETHYLCYCLOPENTA[C]PYRROLE
CAS:95014-44-1
Formula: C9H13N
KIN02787180
2,4,5,6-TETRAHYDRO-5-METHYL-7-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:35641-79-3
KIN02224979
2,4,5,6-TETRAHYDRO-6-(4-METHYLPHENYL)-3-PHENYL-7H-PYRAZOLO[3,4-C]PYRIDIN-7-ONE
CAS:6506-36-1
Formula: C27H28ClN3
KIN01163862
2,4,5,6-TETRAHYDRO-7-METHYL-2-[2-(MORPHOLIN-4-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE
CAS:58191-92-7
Formula: C12H21N3O2
KIN02411976
2,4,5,6-TETRAHYDRO-7-METHYL-2-[2-(MORPHOLIN-4-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE MALEATE
CAS:58191-93-8
Formula: C12H21N3O2.C4H4O4
KIN02411977
2,4,5,6-TETRAHYDRO-7-PHENYL-2-[2-(4-PHENYL-PIPERAZIN-1-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE OXALATE
CAS:58191-85-8
Formula: C23H28N4O
KIN02411972
2,4,5,6-TETRAHYDRO-7H-INDAZOL-7-ONE
CAS:165686-41-9
Formula: C7H8N2O
KIN03337767
2,4,5,6-TETRAHYDRO-8-METHOXY-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-45-3
Formula: C15H17N3O
KIN02346422
2,4,5,6-TETRAHYDRO-8-PHENYL-1H-PYRAZINO[3,2,1-JK]CARBAZOLE MONOMETHANESULFONATE
CAS:134285-31-7
Formula: [C21H22N2O3S
KIN03227532
2,4,5,6-TETRAHYDRO-9-METHOXY-3-PYRIDIN-4-YLBENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:52837-87-3
Formula: C18H17N3O
KIN02326605
2,4,5,6-TETRAHYDRO-9-METHOXY-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-38-4
Formula: C15H17N3O
KIN02346419
2,4,5,6-TETRAHYDRO-AZEPINO[3,2-B]INDOL-5A(3H)-OL
CAS:14296-23-2
KIN02030378
2,4,5,6-TETRAHYDRO-BENZO[3,4]CYCLOHEPTA[1,2]TRIAZOLE
CAS:96733-25-4
Formula: C11H11N3
KIN02802755
2,4,5,6-TETRAHYDRO-BENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:108650-93-7
Formula: C12H12N2
KIN03645306
2,4,5,6-TETRAHYDRO-CYCLOPENTA-1H-PYRAZOL-3-OL
CAS:364746-32-7
Formula: C6H8N2O
KIN03539260
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROL-1-CARBOXYLIC ACID
CAS:144791-44-6
Formula: C8H9NO2
KIN03277276
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROL-1-CARBOXYLIC ACID ETHYL ESTER
CAS:128812-35-1
Formula: [C10H13NO2
KIN03203160
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROLE
CAS:95014-37-2
Formula: C7H9N
KIN02787179
2,4,5,6-TETRAHYDRO-CYCLOPENTAPYRAZOLE
CAS:15409-55-9
Formula: C6H8N2
KIN02041222
2,4,5,6-TETRAHYDROPYRROLO[3,4-C]PYRAZOLE
CAS:6573-26-8
KIN01165189
2,4,5,6-TETRAHYDROXY-1-METHOXY-3-METHYLANTHRACENE-9,10-DIONE
CAS:183789-84-6
Formula: C16H12O7
KIN03375510
2,4,5,6-TETRAIODO-1,3-BENZENEDICARBOXYLIC ACID
CAS:162321-54-2
Formula: C8H2I4O4
KIN03331259
2,4,5,6-TETRAKIS-O-(BENZYL)-D-MYO-INOSITOL 1-[(2R)-2,3-BIS[(1-OXOHEXADECYCLOXY)]PROPYL PHENYLMETHYLPHOSPHATE] 3-[BIS(BENZYL) PHOSPHATE]
CAS:180794-85-8
Formula: C90H122O16P2
KIN03369915
2,4,5,6-TETRAKIS-O-BENZYL-MYO-INOSITOL
CAS:141040-63-3
Formula: [C34H36O6]
KIN03258052
2,4,5,6-TETRAMETHOXY-3-FORMYLBENZALDEHYDE
CAS:51442-96-7
Formula: C12H14O6
KIN02306509
Tetramethoxy-isophthalaldehyde; 1,3-Diformyl-2,4,5
2,4,5,6-TETRAMETHYL-1,3-BENZENEDIACETONITRILE
CAS:54491-28-0
Formula: C14H16N2
KIN02350823
2,4,5,6-TETRAMETHYL-1,3-BENZENEDICARBONITRILE
CAS:51351-96-3
Formula: C12H12N2
KIN02305330
2,4,5,6-TETRAMETHYL-1,3-BENZENEDICARBOXALDEHYDE
CAS:71466-03-0
Formula: C12H14O2
KIN02584482
2,4,5,6-TETRAMETHYL-1,3-BENZENEDIMETHANETHIOL
CAS:119947-37-4
KIN03161510
2,4,5,6-TETRAMETHYL-1,3-BENZENEDIMETHANOL
CAS:71466-02-9
Formula: C12H18O2
KIN02584481
2,4,5,6-TETRAMETHYL-1,3-BENZENEDIOL
CAS:139054-54-9
Formula: C10H14O2
KIN03250377
2,4,5,6-TETRAMETHYL-1,3-BENZENEDISULFONIC ACID
CAS:81211-99-6
Formula: C10H14O6S2
KIN02648504
2,4,5,6-TETRAMETHYL-1,3-BENZENEDISULFONYL DICHLORIDE
CAS:97997-76-7
Formula: C10H12Cl2O4S2
KIN02809561
MFCD00191502
2,4,5,6-TETRAMETHYL-3-AMINO-ANILINE
CAS:3103-13-7
Formula: C21H30O3
KIN01082420
2,4,5,6-TETRAMETHYL-3-PYRIDINOL
CAS:375830-02-7
Formula: C9H13NO
KIN03545861
2,4,5,6-TETRAMETHYL-OCTANE
CAS:62199-37-5
Formula: C12H26
KIN02469901
2,4,5,6-TETRAMETHYL-QUINOLINE
CAS:88500-07-6
Formula: C13H15N
KIN02699104
2,4,5,6-TETRAMETHYLPYRIMIDINE
CAS:22868-80-0
Formula: C8H12N2
KIN02114423
2,4,5,6-TETRAPHENYL-1,3-DIAZABICYCLO[3.1.0]HEX-3-ENE
CAS:59169-19-6
Formula: C28H22N2
KIN02427351
2,4,5,6-TETRAPHENYL-1,3-DIOXANE
CAS:111791-02-7
Formula: C28H24O2
KIN03110153
2,4,5,6-TETRAPHENYL-TETRAHYDROPYRROLO[3,4-C]PYRROL-1,3(2H,3AH)-DIONE
CAS:13175-09-2
Formula: C30H24N2O2
KIN02015978
2,4,5,6-TETRAPHENYLPYRIMIDINE
CAS:14277-91-9
Formula: C28H20N2
KIN02030174
2,4,5,7,8,10,11,13,14,16,17,19,20-TRIDECAMETHOXY-1-(2,3-DIMETHOXY-PROPOXY)DOCOSANE
CAS:56247-74-6
KIN02379706
2,4,5,7,8,8A-HEXAHYDRO-3-METHYL-8-METHYLENE-6(1H)-AZULENONE
CAS:51334-36-2
Formula: C12H16O
KIN02305079
2,4,5,7,8,8A-HEXAHYDRO-4-NONYL-7-PROPYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID 4-[(4,6-DIMETHYLPYRIMIDIN-2-YL)AMINO]BUTYL ESTER
CAS:147664-37-7
Formula: C32H52N6O2
KIN03286877
2,4,5,7,8,8A-HEXAHYDRO-4-NONYL-7-PROPYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID 4-[(4-OXO-1,3-DIAZASPIRO[4.4]NON-2-EN-2-YL)AMINO]BUTYL ESTER
CAS:147664-35-5
Formula: C33H54N6O3
KIN03286876
2,4,5,7,8,8A-HEXAHYDRO-7-NONYL-4-PENTYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID 4-[(AMINOIMINOMETHYL)AMINO]BUTYL ESTER
CAS:162047-84-9
Formula: C29H52N6O2
KIN03330552
2,4,5,7,8,8A-HEXAHYDRO-7-NONYL-4-PROPYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID
CAS:147664-29-7
Formula: C22H37N3O2
KIN03286870
2,4,5,7,8,8A-HEXAHYDRO-7-NONYL-4-PROPYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID 4-[(AMINOIMINOMETHYL)AMINO]BUTYL ESTER
CAS:147664-21-9
Formula: C27H48N6O2
KIN03286865
2,4,5,7,8,8A-HEXAHYDRO-7-NONYL-4-PROPYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID METHYL ESTER
CAS:147664-28-6
Formula: C23H39N3O2
KIN03286869
2,4,5,7,8,8A-HEXAHYDRO-7-OCTYL-4-PENTYL-1H-5,6,8B-TRIAZAACENAPHTHYLENE-3-CARBOXYLIC ACID 4-[(AMINOIMINOMETHYL)AMINO]BUTYL ESTER
CAS:162047-83-8
Formula: C28H50N6O2
KIN03330551
2,4,5,7,8-PENTAMETHYLOXEPINO[4,5-C]PYRROL-1,3-DIONE
CAS:132785-70-7
Formula: C13H15NO3
KIN03220531
2,4,5,7,9,10-HEXAHYDROPYRENE
CAS:20330-24-9
Formula: C16H16
KIN02090177
2,4,5,7-TETRABROMO-10,11,12,13-TETRACHLOROFLUORESCEIN, ALUMINUM(III) SALT
CAS:27532-17-8
KIN02158209
2,4,5,7-TETRABROMO-2,7-DIMETHYL-3,6-OCTANEDIONE
CAS:62738-23-2
Formula: C10H14Br4O2
KIN02479538
2,4,5,7-TETRABROMO-6-HYDROXY-3H-XANTHEN-3-ONE
CAS:142189-37-5
Formula: C13H4Br4O3
KIN03263973
2,4,5,7-TETRABROMO-6-HYDROXY-9-PHENYL-3H-XANTHEN-3-ONE SODIUM SALT
CAS:4735-84-6
KIN01113621
2,4,5,7-TETRACHLORO-1,3,6-TRIHYDROXY-8-METHYL-9H-XANTHEN-9-ONE
CAS:7584-36-3
Formula: C23H18S
KIN01191667
2,4,5,7-TETRACHLORO-3,6-DIHYDROXY-XANTHEN-9-ONE
CAS:91692-99-8
KIN02747593
2,4,5,7-TETRACHLORO-QUINAZOLINE
CAS:174566-17-7
KIN03356070
2,4,5,7-TETRAHYDRO-6H-INDAZOL-6-ONE
CAS:73625-68-0
Formula: C7H8N2O
KIN02599555
2,4,5,7-TETRAHYDROXY-1-(1-OXO-BUTYL)-9,10-ANTHRACENEDIONE
CAS:15478-53-2
Formula: C18H14O7
KIN02041862
2,4,5,7-TETRAHYDROXY-8-(3-HYDROXY-3-METHYLBUTYL)ISO-2-PHENYL-4H-CHROMEN-4-ONE
CAS:104691-93-2
Formula: C20H20O7
KIN03063158
2,4,5,7-TETRAKIS(BENZOYLOXY)-8-(3-HYDROXY-3-METHYLBUTYL)ISO-2-PHENYL-4H-CHROMEN-4-ONE
CAS:160154-75-6
Formula: C48H36O11
KIN03325226
2,4,5,7-TETRAKIS(BENZYLOXY)-6-IODO-ISO-2-PHENYL-4H-CHROMEN-4-ONE
CAS:321569-95-3
Formula: C43H33IO6
KIN03493153
2,4,5,7-TETRAKIS(BENZYLOXY)-8-(3-HYDROXY-3-METHYL-1-BUTYNYL)ISO-2-PHENYL-4H-CHROMEN-4-ONE
CAS:160154-74-5
Formula: C48H40O7
KIN03325225
2,4,5,7-TETRAMETHOXY-QUINOLINE
CAS:406204-76-0
Formula: C13H15NO4
KIN03567095
2,4,5,7-TETRAMETHYL-2,6-OCTADIENE
CAS:65164-65-0
Formula: C12H22
KIN02522297
2,4,5,7-TETRAMETHYL-3,5-OCTADIENE
CAS:67652-86-2
Formula: C12H22
KIN02556348
2,4,5,7-TETRAMETHYL-4,5-BIS(4-TERT-BUTYLPHENYL)OCTANE
CAS:85668-75-3
Formula: C32H50
KIN02675849
2,4,5,7-TETRAMETHYL-8-QUINAZOLINOL
CAS:91566-28-8
Formula: C12H14N2O
KIN02745779
2,4,5,7-TETRAMETHYL-9-PHENYL-XANTHENE
CAS:102560-09-8
Formula: C23H22O
KIN03048099
2,4,5,7-TETRAMETHYL-9H-XANTHEN-9-ONE
CAS:215186-09-7
KIN03427603
2,4,5,7-TETRAMETHYL-OCTANE
CAS:2217-21-2
KIN01065093
2,4,5,7-TETRAMETHYL-QUINOLINE
CAS:139719-13-4
Formula: C13H15N
KIN03254295
2,4,5,7-TETRAMETHYLPHENANTHRENE
CAS:7396-41-0
Formula: C7H6O4S3
KIN01185770
2,4,5,7-TETRAMETHYLPHENANTHRENE, 1,3,5-TRINITRO-BENZENE
CAS:7343-23-9
KIN01184713
2,4,5,7-TETRAMETHYLPHENANTHRENE-9,10-DIONE
CAS:17825-38-6
Formula: C18H16O2
KIN02066037
2,4,5,7-TETRAMETHYLPYRIMIDO[4,5-D]PYRIMIDINE
CAS:51245-65-9
Formula: C10H12N4
KIN02303792
2,4,5,7-TETRANITRO-1-(2,4,6-TRINITROPHENYL)-NAPHTHALENE
CAS:185119-42-0
Formula: C16H5N7O14
KIN03378544
2,4,5,7-TETRANITRO-9(10H)-ACRIDINONE
CAS:128911-47-7
KIN03203512
2,4,5,7-TETRANITRO-9H-FLUOREN-9-ONE
CAS:746-68-9
KIN01028090
2,4,5,7-TETRANITRO-9H-FLUOREN-9-ONE COMPD. WITH DIBENZO[A,H]ANTHRACENE
CAS:57431-83-1
KIN02399516
2,4,5,7-TETRANITRO-9H-FLUOREN-9-ONE O-ACETYLOXIME
CAS:93105-68-1
Formula: C15H7N5O10
KIN02765292
2,4,5,7-TETRANITRO-9H-FLUOREN-9-ONE O-BENZOYLOXIME
CAS:93105-70-5
Formula: C20H9N5O10
KIN02765293
2,4,5,7-TETRANITRO-9H-FLUORENE
CAS:29210-71-7
Formula: C13H6N4O8
KIN02172390
MFCD00180007
2,4,5,7-TETRANITROCARBAZOLE
CAS:28453-24-9
Formula: C12H5N5O8
KIN02166160
2,4,5,7A-TETRAHYDRO-1H-INDENE
CAS:93640-52-9
Formula: C9H12
KIN02771804
2,4,5,8,9,11-HEXAMETHYL-6-DODECYNE-4,5,8,9-TETROL
CAS:64577-39-5
Formula: C18H34O4
KIN02512033
2,4,5,8-TETRACHLORO-1-METHOXYNAPHTHALENE
CAS:74298-69-4
KIN02604729
2,4,5,8-TETRAHYDRO-1H-AZONINO[5,4-B]INDOL-3-CARBONITRILE
CAS:114476-08-3
Formula: C15H15N3
KIN03131091
2,4,5,8-TETRAHYDRO-2,8-DIMETHYLPYRROLO[3,2-G]INDAZOL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:113342-48-6
KIN03122172
2,4,5,8-TETRAHYDRO-2,8-DIMETHYLPYRROLO[3,2-G]INDAZOLE
CAS:113342-45-3
KIN03122169
2,4,5,8-TETRAMETHOXY-QUINOLINE
CAS:66570-52-3
KIN02543574
2,4,5,8-TETRAMETHYL-6-QUINOLINAMINE
CAS:336181-35-2
Formula: C13H16N2
KIN03509380
2,4,5,8-TETRAMETHYL-QUINOLINE
CAS:39581-63-0
Formula: C13H15N
KIN02255973
2,4,5- TRIBROMO-3-NITRO-ANILINE
CAS:88475-62-1
Formula: C6H3Br3N2O2
KIN02698718
2,4,5-HEXATRIENAL, (2Z)-,
CAS:335195-59-0
Formula: C6H6O
KIN03508449
2,4,5-PYRIDINETRIACETONITRILE
CAS:1142928-49-1
Formula: C11H8N4
KIN05191960
2,4,5-PYRIDINETRIAMINE
CAS:23244-87-3
Formula: C5H8N4
KIN02118223
2,4,5-PYRIDINETRIAMINE, 2HCL
CAS:2604-42-4
KIN01072832
2,4,5-PYRIDINETRICARBONITRILE
CAS:1142927-81-8
Formula: C8H2N4
KIN05191929
2,4,5-PYRIDINETRICARBOXYLIC ACID 2,4,5-TRIMETHYL ESTER
CAS:23808-53-9
KIN02123709
2,4,5-PYRIDINETRICARBOXYLIC ACID 2,5-DIETHYL 4-METHYL ESTER
CAS:110911-16-5
KIN03104350
2,4,5-PYRIDINETRICARBOXYLIC ACID 5-ETHYL 2,4-DIMETHYL ESTER
CAS:110911-14-3
KIN03104348
2,4,5-PYRIMIDINETRIACETONITRILE
CAS:1142928-52-6
Formula: C10H7N5
KIN05191963
2,4,5-QUINAZOLINETRIAMINE
CAS:123242-03-5
Formula: C8H9N5
KIN03178679
2,4,5-T BUTOXYETHYL ESTER
CAS:2545-60-0
Formula: C6H3Cl3N2O2.K
KIN01071673
2,4,5-T PROPYLENE GLYCOL BUTYL ESTER
CAS:28880-66-2
Formula: C15H19Cl3O4
KIN02169584
2,4,5-T-2-OCTYL ESTER
CAS:219827-50-6
Formula: C16H21Cl3O3
KIN03432368
2,4,5-THIAZOLETRICARBOXYLIC ACID
CAS:290294-61-0
Formula: C6H3NO6S
KIN03471131
2,4,5-THIAZOLIDINETRIONE, 5-[O-(1-METHYLETHYL)OXIME]
CAS:107646-39-9
Formula: C6H8N2O3S
KIN03667972
2,4,5-THIAZOLIDINETRIONE, 5-OXIME
CAS:107646-38-8
Formula: C3H2N2O3S
KIN03083942
2,4,5-TRI-O-BENZOYL-3,6-DI-O-BENZYL MYO-INOSITOL
CAS:196954-87-7
Formula: C41H36O9
KIN03401770
2,4,5-TRI-P-METHYLPHENYL-1H-IMIDAZOLE
CAS:33515-43-4
Formula: C24H22N2
KIN02206305
2,4,5-TRI-P-TOLYL-[1,3]DIOXOLANE
CAS:133387-23-2
Formula: C24H24O2
KIN03223342
2,4,5-TRIAMINO-6-(METHYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:100032-74-4
KIN03634124
2,4,5-TRIAMINO-6-CHLOROPYRIMIDNE
CAS:11094-78-1
Formula: C4H6ClN5
KIN02009388
2,4,5-TRIAMINOBENZENESULFONIC ACID
CAS:13066-82-5
KIN02014264
2,4,5-TRIAMINOBENZOIC ACID
CAS:69217-32-9
Formula: C7H9N3O2
KIN02568798
2,4,5-TRIAMINONITRO-BENZENE
CAS:6635-36-5
Formula: C6H12N6O3
KIN01167301
2,4,5-TRIAMINOPHENOL
CAS:159661-40-2
Formula: C6H9N3O
KIN03323922
2,4,5-TRIAZABICYCLO[1.1.1]PENTANE
CAS:272437-07-7
Formula: C2H5N3
KIN03464378
2,4,5-TRIAZATRICYCLO[1.1.1.01,3]PENTANE
CAS:272437-02-2
Formula: C2H3N3
KIN03464375
2,4,5-TRIBROMO-1,6,8-TRIMETHOXY-3-METHYL-9,10-ANTHRACENEDIONE
CAS:54130-74-4
KIN02345611
2,4,5-TRIBROMO-1-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-1H-IMIDAZOLE
CAS:159590-01-9
Formula: C9H15Br3N2OSi
KIN03323708
2,4,5-TRIBROMO-1-(4-METHOXY-BENZOYL)-1H-IMIDAZOLE
CAS:6595-54-6
Formula: C10H4Br3N3O3
KIN01165637
2,4,5-TRIBROMO-1-(4-NITRO-BENZOYL)-1H-IMIDAZOLE
CAS:6595-55-7
Formula: C4H3Br3N2O
KIN01165638
2,4,5-TRIBROMO-1-(CHLOROMETHYL)-1H-IMIDAZOLE
CAS:6595-58-0
Formula: C4H2Br4N2
KIN01165641
2,4,5-TRIBROMO-1-(METHOXYMETHYL)-1H-IMIDAZOLE
CAS:22927-61-3
Formula: C5H5Br3N2O
KIN02114983
2,4,5-TRIBROMO-1-[(3,4-DIMETHOXY-PHENYL)METHYL]IMIDAZOLE
CAS:101853-75-2
Formula: C12H11Br3N2O2
KIN03042272
2,4,5-TRIBROMO-1-[(4-METHOXY-PHENYL)METHYL]IMIDAZOLE
CAS:101901-58-0
Formula: C11H9Br3N2O
KIN03042682
2,4,5-TRIBROMO-1-[(4-METHYLPHENYL)SULFONYL]-1H-IMIDAZOLE
CAS:6595-52-4
Formula: C10H5Br3N2O
KIN01165635
2,4,5-TRIBROMO-1-BROMOMETHYL-1H-IMIDAZOLE
CAS:6595-75-1
KIN01165642
2,4,5-TRIBROMO-1-ETHYL-1H-IMIDAZOLE
CAS:31250-75-6
Formula: C5H5Br3N2
KIN02188039
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:1003-92-5
Formula: C5H7NO2S
KIN01036536
2,4,5-TRIBROMO-1-PROPYL-1H-IMIDAZOLE
CAS:31250-78-9
Formula: C6H7Br3N2
KIN02188040
2,4,5-TRIBROMO-1-VINYL-1H-IMIDAZOLE
CAS:41205-31-6
Formula: C5H3Br3N2
KIN02269242
MFCD02179556
2,4,5-TRIBROMO-1H-IMIDAZOL-1-CARBOTHIOIC ACID S-(1-METHYLETHYL) ESTER
CAS:102306-55-8
Formula: C7H7Br3N2OS
KIN03046219
2,4,5-TRIBROMO-1H-IMIDAZOL-1-DIMETHYLCARBAMIC ACID
CAS:94847-66-2
Formula: C6H6Br3N3O
KIN02785940
2,4,5-TRIBROMO-1H-IMIDAZOL-1-METHANOL
CAS:6595-56-8
Formula: C6H5Br3N2O2
KIN01165639
2,4,5-TRIBROMO-1H-IMIDAZOL-1-METHANOL ACETATE (ESTER)
CAS:6595-57-9
Formula: C4H2Br3ClN2
KIN01165640
2,4,5-TRIBROMO-1H-IMIDAZOL-N1-BUTYLCARBOXYLATE
CAS:15287-51-1
Formula: C8H9Br3N2O2
KIN02040167
2,4,5-TRIBROMO-1H-IMIDAZOLE
CAS:2034-23-3
Formula: C7H5ClN2O
KIN01061301
2,4,5-TRIBROMO-1H-IMIDAZOLE CADMIUM SALT
CAS:73941-35-2
Formula: C6H4Br6CdN4
KIN02602089
2,4,5-TRIBROMO-3,4,6-TRIMETHYL-2,5-CYCLOHEXADIEN-1-ONE
CAS:95111-40-3
Formula: C9H9Br3O
KIN02788458
2,4,5-TRIBROMO-3,6-DIMETHYLPHENOL
CAS:78998-97-7
Formula: C8H7Br3O
KIN02635012
2,4,5-TRIBROMO-3-HYDROXY-PHENOL
CAS:89284-58-2
Formula: C6H3Br3O2
KIN02709842
2,4,5-TRIBROMO-3-METHYLPHENOL
CAS:89187-90-6
Formula: C7H5Br3O
KIN02708250
2,4,5-TRIBROMO-3-THIOPHENECARBALDEHYDE
CAS:61200-58-6
Formula: C5HBr3OS
KIN02452528
2,4,5-TRIBROMO-3-THIOPHENECARBALDEHYDE OXIME
CAS:91074-37-2
Formula: C5H2Br3NOS
KIN02738286
2,4,5-TRIBROMO-ALPHA-METHYL-STYRENE
CAS:58683-72-0
Formula: C9H7Br3
KIN02419455
2,4,5-TRIBROMO-ANILINE
CAS:615-87-2
Formula: C8H8Br2
KIN01022600
2,4,5-TRIBROMO-BIPHENYL
CAS:115245-07-3
Formula: [C12H7Br3
KIN03136154
2,4,5-TRIBROMO-CUMENE
CAS:58683-70-8
Formula: C9H9Br3
KIN02419454
2,4,5-TRIBROMO-N,N-BIS(2-METHYLPROPYL)-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102306-51-4
Formula: C12H18Br3N3O
KIN03046217
2,4,5-TRIBROMO-N,N-DI-ALLYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102306-50-3
Formula: C10H10Br3N3O
KIN03046216
2,4,5-TRIBROMO-N,N-DIETHYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102306-47-8
Formula: C8H10Br3N3O
KIN03046213
2,4,5-TRIBROMO-N,N-DIMETHYL-ANILINE PICRATE
CAS:64230-07-5
Formula: C8H8Br3N.C6H3N3O7
KIN02506474
2,4,5-TRIBROMO-N,N-DIPROPYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102306-49-0
Formula: C10H14Br3N3O
KIN03046215
2,4,5-TRIBROMO-N-METHOXY-N-METHYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102342-06-3
Formula: C6H6Br3N3O2
KIN03046471
2,4,5-TRIBROMO-N-METHYL-N-PHENYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:102306-52-5
Formula: C11H8Br3N3O
KIN03046218
2,4,5-TRIBROMOBENZALDEHYDE
CAS:93701-41-8
Formula: C7H3Br3O
KIN02772637
2,4,5-TRIBROMOBENZENEMETHANAMINE
CAS:100346-15-4
Formula: C7H6Br3N
KIN03030794
2,4,5-TRIBROMOBENZENEMETHANOL
CAS:22585-26-8
Formula: C7H5Br3O
KIN02112013
2,4,5-TRIBROMOBENZENESULFONAMIDE
CAS:98130-98-4
KIN02811013
2,4,5-TRIBROMOBENZENESULFONYL CHLORIDE
CAS:38004-83-0
KIN02244477
2,4,5-TRIBROMOBENZENETHIOL
CAS:1081849-89-9
Formula: C6H3Br3S
KIN05118095
2,4,5-TRIBROMOBENZOIC ACID
CAS:87976-23-6
Formula: C7H3Br3O2
KIN02691318
2,4,5-TRIBROMOPHENOL
CAS:14401-61-7
Formula: C6H3Br3O
KIN02031650
2,4,5-TRIBROMOTHIOPHEN-3-CARBOXYLIC ACID
CAS:16694-22-7
Formula: C5HBr3O2S
KIN02053975
2,4,5-TRICARBOXY-BIPHENYL
CAS:34196-40-2
Formula: C15H10O6
KIN02212038
2,4,5-TRICHLORO-1,3,8-TRIMETHOXY-6-METHYL-9,10-ANTHRACENEDIONE
CAS:25672-69-9
KIN02141864
2,4,5-TRICHLORO-1,3-BENZENEDICARBONITRILE
CAS:23039-03-4
Formula: C8HCl3N2
KIN02116130
2,4,5-TRICHLORO-1,6-DIHYDROXY-3-METHOXY-8-METHYL-9H-XANTHEN-9-ONE
CAS:22105-34-6
Formula: C15H9Cl3O5
KIN02107297
2,4,5-TRICHLORO-1,8-DIHYDROXY-3-METHOXY-6-METHYL-9,10-ANTHRACENEDIONE
CAS:25672-68-8
KIN02141863
2,4,5-TRICHLORO-1-(2-METHYL-ALLYL)-1H-IMIDAZOLE
CAS:31255-38-6
Formula: C7H7Cl3N2
KIN02188092
2,4,5-TRICHLORO-1-(BENZYL)-1H-PYRROL-3-CARBONITRILE
CAS:130511-82-9
KIN03678527
2,4,5-TRICHLORO-1-(CHLOROMETHYL)-1H-IMIDAZOLE
CAS:29941-67-1
Formula: C4H2Cl4N2
KIN02177855
2,4,5-TRICHLORO-1-(METHOXYMETHYL)-1H-IMIDAZOLE
CAS:22927-63-5
Formula: C5H5Cl3N2O
KIN02114984
2,4,5-TRICHLORO-1-(PROPARGYL)-1H-IMIDAZOLE
CAS:27442-80-4
Formula: C6H3Cl3N2
KIN02157412
2,4,5-TRICHLORO-1-(PROPARGYL)-1H-PYRROL-3-CARBONITRILE
CAS:152663-78-0
KIN03645305
2,4,5-TRICHLORO-1-ALLYL-1H-IMIDAZOLE
CAS:31255-37-5
Formula: C6H5Cl3N2
KIN02188091
2,4,5-TRICHLORO-1-ETHYL-1H-IMIDAZOLE
CAS:59800-51-0
Formula: C5H5Cl3N2
KIN02437331
2,4,5-TRICHLORO-1-METHOXYNAPHTHALENE
CAS:74298-68-3
KIN02604728
2,4,5-TRICHLORO-1-METHYL-1H-IMIDAZOLE
CAS:873-26-7
Formula: C5H8N2OS
KIN01032330
2,4,5-TRICHLORO-1-METHYL-1H-PYRROL-3-CARBONITRILE
CAS:130511-60-3
Formula: C6H3Cl3N2
KIN03019957
2,4,5-TRICHLORO-1-PROPYL-1H-IMIDAZOLE
CAS:111161-00-3
Formula: C6H7Cl3N2
KIN03106031
2,4,5-TRICHLORO-1H-IMIDAZOL-1-CARBONITRILE
CAS:18584-88-8
Formula: C4Cl3N3
KIN02073208
2,4,5-TRICHLORO-1H-IMIDAZOLE
CAS:7682-42-0
Formula: C6H5Br3N2O2
KIN01193322
2,4,5-TRICHLORO-1H-IMIDAZOLE-1-ACETONITRILE
CAS:136238-45-4
Formula: C5H2Cl3N3
KIN03236063
2,4,5-TRICHLORO-1H-PYRROL-3-CARBONITRILE
CAS:130511-57-8
KIN03210184
2,4,5-TRICHLORO-1H-PYRROL-3-CARBOXYLIC ACID METHYL ESTER
CAS:217457-53-9
KIN03622832
2,4,5-TRICHLORO-2-(1,1-DICHLORO-ETHYL)-2H-IMIDAZOLE
CAS:59206-92-7
Formula: C5H3Cl5N2
KIN02427967
2,4,5-TRICHLORO-2-(TRICHLOROMETHYL)-2H-IMIDAZOLE
CAS:59206-97-2
Formula: C4Cl6N2
KIN02427968
2,4,5-TRICHLORO-2-PHENYL-2H-IMIDAZOLE
CAS:59206-98-3
Formula: C9H5Cl3N2
KIN02427969
2,4,5-TRICHLORO-3,6-DIFLUOROPHENOL
CAS:2375-67-9
KIN01068087
2,4,5-TRICHLORO-3,6-DIFLUOROPYRIDINE
CAS:54732-62-6
Formula: C5Cl3F2N
KIN02354511
2,4,5-TRICHLORO-3,6-DIHYDROXY-BENZONITRILE
CAS:4640-39-5
KIN01111782
2,4,5-TRICHLORO-3,6-DIHYDROXY-PHENYL-ACETIC ACID
CAS:25753-34-8
Formula: C8H5Cl3O4
KIN02142514
2,4,5-TRICHLORO-3,6-DIMETHOXY-ANILINE
CAS:35281-52-8
KIN02221592
2,4,5-TRICHLORO-3,6-DIMETHOXY-BENZONITRILE
CAS:4640-38-4
KIN01111781
2,4,5-TRICHLORO-3,6-DIMETHYLPHENOL
CAS:36433-46-2
KIN02231810
2,4,5-TRICHLORO-3,6-DINITRO-TOLUENE
CAS:115423-93-3
Formula: C7H3Cl3N2O4
KIN03137159
2,4,5-TRICHLORO-3-(METHYLTHIO)PHENOL
CAS:85349-22-0
Formula: C7H5Cl3OS
KIN02673730
2,4,5-TRICHLORO-3-CYANO-6-(ETHYLSULFINYL)-BENZOIC ACID
CAS:118412-95-6
Formula: C10H6Cl3NO3S
KIN03645304
2,4,5-TRICHLORO-3-CYANO-6-(ETHYLSULFONYL)-BENZOIC ACID
CAS:118412-96-7
Formula: C10H6Cl3NO4S
KIN03645303
2,4,5-TRICHLORO-3-FLUOROBENZONITRILE
CAS:161612-69-7
KIN03329446
2,4,5-TRICHLORO-3-HYDROXY-BENZOIC ACID
CAS:78647-88-8
Formula: C7H3Cl3O3
KIN02632855
2,4,5-TRICHLORO-3-HYDROXY-PHENOL
CAS:61562-82-1
Formula: C6H3Cl3O2
KIN02457998
2,4,5-TRICHLORO-3-NITRO-BENZONITRILE
CAS:89692-41-1
Formula: C7HCl3N2O2
KIN02715584
2,4,5-TRICHLORO-3-PHENYLPYRIDINE N1-OXIDE
CAS:74503-56-3
Formula: C11H6Cl3NO
KIN02606413
2,4,5-TRICHLORO-3-PYRIDINAMINE
CAS:173435-47-7
Formula: C5H3Cl3N2
KIN03353635
2,4,5-TRICHLORO-3-PYRIDINECARBOXYLIC ACID
CAS:328289-33-4
Formula: C6H2Cl3NO2
KIN03498821
2,4,5-TRICHLORO-3-THIOPHENECARBALDEHYDE
CAS:61200-61-1
Formula: C5HCl3OS
KIN02452531
2,4,5-TRICHLORO-3-THIOPHENECARBONITRILE
CAS:104432-95-3
KIN03061205
2,4,5-TRICHLORO-3-THIOPHENECARBOXYLIC ACID METHYL ESTER
CAS:163431-39-8
Formula: C6H3Cl3O2S
KIN03634123
2,4,5-TRICHLORO-4-CYCLOPENTENE-1,3-DIONE
CAS:5723-69-3
Formula: C27H28ClNO4
KIN01140034
2,4,5-TRICHLORO-6-(1-METHYLETHOXY)-1,3-BENZENEDICARBONITRILE
CAS:57531-89-2
KIN02401087
2,4,5-TRICHLORO-6-(1-METHYLETHYL)-PYRIMIDINE
CAS:89793-71-5
Formula: C7H7Cl3N2
KIN02717157
2,4,5-TRICHLORO-6-(2-CHLOROPROPOXY)-1,3-BENZENEDICARBONITRILE
CAS:57532-09-9
KIN02401098
2,4,5-TRICHLORO-6-(2-HYDROXYETHOXY)-1,3-BENZENEDICARBONITRILE
CAS:57532-14-6
KIN02401102
2,4,5-TRICHLORO-6-(2-METHOXYETHOXY)-1,3-BENZENEDICARBONITRILE
CAS:57531-94-9
KIN02401091
2,4,5-TRICHLORO-6-(3-METHYLBUTOXY)-1,3-BENZENEDICARBONITRILE
CAS:57531-90-5
KIN02401088
2,4,5-TRICHLORO-6-(ALLYLOXY)-1,3-BENZENEDICARBONITRILE
CAS:57531-91-6
KIN02401089
2,4,5-TRICHLORO-6-(BENZYLOXY)-1,3-BENZENEDICARBONITRILE
CAS:57531-92-7
KIN02401090
2,4,5-TRICHLORO-6-(CHLORO-DIFLUOROMETHYL)-PYRIMIDINE
CAS:84737-22-4
Formula: C5Cl4F2N2
KIN02669590
2,4,5-TRICHLORO-6-(CHLOROMETHYL)-PYRIMIDINE
CAS:25818-43-3
Formula: C5H2Cl4N2
KIN02143203
2,4,5-TRICHLORO-6-(CYCLOHEXYLOXY)-1,3-BENZENEDICARBONITRILE
CAS:57532-10-2
KIN02401099
2,4,5-TRICHLORO-6-(DICHLORO-FLUOROMETHYL)-PYRIMIDINE
CAS:84737-21-3
Formula: C5Cl5FN2
KIN02669589
2,4,5-TRICHLORO-6-(DICHLOROMETHYL)-PYRIMIDINE
CAS:84395-13-1
Formula: C5HCl5N2
KIN02667125
2,4,5-TRICHLORO-6-(ETHYLSULFONYL)-1,3-BENZENEDICARBONITRILE
CAS:56952-85-3
KIN02391444
2,4,5-TRICHLORO-6-(ETHYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:56952-80-8
KIN02391439
2,4,5-TRICHLORO-6-(METHYLSULFINYL)-1,3-BENZENEDICARBONITRILE
CAS:56952-91-1
KIN02391447
2,4,5-TRICHLORO-6-(METHYLSULFONYL)-1,3-BENZENEDICARBONITRILE
CAS:56990-45-5
KIN02392219
2,4,5-TRICHLORO-6-(METHYLSULFONYL)-PYRIMIDINE
CAS:85508-88-9
Formula: C5H3Cl3N2O2S
KIN02674749
2,4,5-TRICHLORO-6-(METHYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:39145-58-9
KIN02253281
2,4,5-TRICHLORO-6-(METHYLTHIO)-PYRIMIDINE
CAS:85508-97-0
Formula: C5H3Cl3N2S
KIN02674754
2,4,5-TRICHLORO-6-(PHENYLAMINO)-1,3-BENZENEDICARBONITRILE
CAS:1142208-21-6
Formula: C14H6Cl3N3
KIN05190915
2,4,5-TRICHLORO-6-(PHENYLAMINO)-PYRIDIN-3-CARBONITRILE
CAS:134626-36-1
KIN03645302
2,4,5-TRICHLORO-6-(PYRIDIN-3-YLOXY)-1,3-BENZENEDICARBONITRILE
CAS:57532-07-7
KIN02401097
2,4,5-TRICHLORO-6-(TRICHLOROMETHYL)-PYRIMIDINE
CAS:74039-25-1
Formula: C5Cl6N2
KIN02602843
2,4,5-TRICHLORO-6-(TRIFLUOROMETHYL)-PYRIMIDINE
CAS:84737-23-5
Formula: C5Cl3F3N2
KIN02669591
2,4,5-TRICHLORO-6-[2-(DIETHYLAMINO)ETHOXY]-1,3-BENZENEDICARBONITRILE
CAS:57532-15-7
KIN02401103
2,4,5-TRICHLORO-6-[2-(ISOPROPOXY)ETHOXY]-1,3-BENZENEDICARBONITRILE
CAS:57531-95-0
KIN02401092
2,4,5-TRICHLORO-6-[3-(DIMETHYLAMINO)-PROPOXY]-1,3-BENZENEDICARBONITRILE
CAS:57532-03-3
KIN02401094
2,4,5-TRICHLORO-6-CYANO-3-MERCAPTO-BENZOIC ACID METHYL ESTER
CAS:42989-14-0
KIN02281917
2,4,5-TRICHLORO-6-CYANO-3-METHOXY-BENZOIC ACID METHYL ESTER
CAS:42988-92-1
KIN02281914
2,4,5-TRICHLORO-6-CYCLOHEXYL-1,3-BENZENEDICARBONITRILE
CAS:258327-40-1
Formula: C14H11Cl3N2
KIN03645301
2,4,5-TRICHLORO-6-ETHOXY-1,3-BENZENEDICARBONITRILE
CAS:57532-23-7
KIN02401105
2,4,5-TRICHLORO-6-ETHOXY-PYRIMIDINE
CAS:89581-96-4
Formula: C6H5Cl3N2O
KIN02713915
2,4,5-TRICHLORO-6-ETHYL-1,3-BENZENEDICARBONITRILE
CAS:124739-68-0
Formula: C10H5Cl3N2
KIN03019434
2,4,5-TRICHLORO-6-ETHYLPYRIMIDINE
CAS:6585-51-9
KIN01165466
2,4,5-TRICHLORO-6-FLUORO-1,3-BENZENEDICARBONITRILE
CAS:23052-70-2
Formula: C8Cl3FN2
KIN02116259
2,4,5-TRICHLORO-6-FLUOROPYRIDIN-3-CARBONITRILE
CAS:24500-83-2
Formula: C6Cl3FN2
KIN02131091
2,4,5-TRICHLORO-6-FLUOROPYRIMIDINE
CAS:24122-52-9
Formula: C4Cl3FN2
KIN02127088
2,4,5-TRICHLORO-6-HYDRAZINYL-3-PYRIDINECARBONITRILE
CAS:144498-84-0
Formula: C6H3Cl3N4
KIN03275979
2,4,5-TRICHLORO-6-HYDRAZINYLPYRIMIDINE
CAS:299440-07-6
Formula: C4H3Cl3N4
KIN03475172
2,4,5-TRICHLORO-6-HYDROXY-1,3-BENZENEDICARBONITRILE
CAS:28343-61-5
Formula: C8HCl3N2O
KIN02165369
MFCD00152214
2,4,5-TRICHLORO-6-ISOCYANATO-PYRIMIDINE
CAS:33232-09-6
Formula: C5Cl3N3O
KIN02203690
2,4,5-TRICHLORO-6-MERCAPTO-1,3-BENZENEDICARBONITRILE
CAS:56952-99-9
Formula: C8HCl3N2S
KIN02391452
2,4,5-TRICHLORO-6-METHOXY-1,3-BENZENEDICARBONITRILE
CAS:57531-87-0
Formula: C9H3Cl3N2O
KIN02401085
2,4,5-TRICHLORO-6-METHOXY-PYRIMIDINE
CAS:1022659-70-6
Formula: C5H3Cl3N2O
KIN05056515
2,4,5-TRICHLORO-6-METHYL-1,3-BENZENEDICARBONITRILE
CAS:63314-48-7
Formula: C9H3Cl3N2
KIN02490271
2,4,5-TRICHLORO-6-METHYLPYRIMIDINE
CAS:6554-72-9
Formula: C5H2BrCl3N2
KIN01164829
2,4,5-TRICHLORO-6-MORPHOLIN-4-YLPYRIDIN-3-CARBONITRILE
CAS:304650-24-6
KIN03645300
2,4,5-TRICHLORO-6-PHENOXY-1,3-BENZENEDICARBONITRILE
CAS:57531-97-2
KIN02401093
2,4,5-TRICHLORO-6-PHENYLPYRIMIDINE
CAS:86984-19-2
Formula: C10H5Cl3N2
KIN02683666
2,4,5-TRICHLORO-6-PIPERIDIN-1-YLPYRIDIN-3-CARBONITRILE
CAS:345257-16-1
KIN03645299
2,4,5-TRICHLORO-6-PROPOXY-1,3-BENZENEDICARBONITRILE
CAS:57531-88-1
Formula: C11H7Cl3N2O
KIN02401086
2,4,5-TRICHLORO-6-PROPYLPYRIMIDINE
CAS:89793-72-6
Formula: C7H7Cl3N2
KIN02717158
2,4,5-TRICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1053228-28-6
Formula: C6H2Cl3N3;C6H2Cl3N3
KIN05101310
2,4,5-TRICHLORO-ALPHA-(CHLOROMETHYL)-BENZENEMETHANOL
CAS:20917-55-9
Formula: C8H6Cl4O
KIN02095338
2,4,5-TRICHLORO-ALPHA-(CHLOROMETHYLENE)-BENZENEMETHANOL DIHYDROGEN PHOSPHATE
CAS:20186-90-7
Formula: C8H5Cl4O4P
KIN02088907
2,4,5-TRICHLORO-ALPHA-HYDROXY-PHENYL-ACETIC ACID
CAS:14299-51-5
Formula: C8H5Cl3O3
KIN02030417
2,4,5-TRICHLORO-ALPHA-METHYLBENZENEETHANAMINE
CAS:87179-32-6
Formula: C9H10Cl3N
KIN02684936
2,4,5-TRICHLORO-ALPHA-METHYLBENZENEMETHANOL
CAS:14299-54-8
Formula: C8H7Cl3O
KIN02030420
2,4,5-TRICHLORO-ANILINE
CAS:636-31-7
Formula: C6H2I4
KIN01023867
2,4,5-TRICHLORO-ANILINE HCL
CAS:33663-48-8
Formula: C6H4Cl3N.ClH
KIN02207753
2,4,5-TRICHLORO-ANILINE LABELED WITH CARBON-14
CAS:80333-60-4
KIN02643386
2,4,5-TRICHLORO-ANILINE-14C
CAS:52399-56-1
KIN02320596
2,4,5-TRICHLORO-BENZALDEHYDE OXIME
CAS:1022082-97-8
Formula: C7H4Cl3NO
KIN05055843
2,4,5-TRICHLORO-BIPHENYL
CAS:15862-07-4
Formula: C12H7Cl3
KIN02044853
2,4,5-TRICHLORO-CINNAMIC ACID
CAS:113267-03-1
KIN03121507
2,4,5-TRICHLORO-N,N-DIMETHYL-ANILINE
CAS:150730-18-0
KIN03297171
2,4,5-TRICHLORO-N,N-DIMETHYLBENZENEMETHANAMINE
CAS:219718-74-8
Formula: C9H10Cl3N
KIN03432067
2,4,5-TRICHLORO-N-(1-METHYLETHYL)-ANILINE
CAS:1042508-67-7
Formula: C9H10Cl3N
KIN05088974
2,4,5-TRICHLORO-N-(2,4,5-TRICHLOROPHENYL)-BENZAMIDE
CAS:62164-79-8
Formula: C13H5Cl6NO
KIN02469119
2,4,5-TRICHLORO-N-(2,4,6-TRINITROPHENYL)-ANILINE
CAS:62902-24-3
Formula: C12H5Cl3N4O6
KIN02482466
2,4,5-TRICHLORO-N-(2,4-DINITRO-NAPHTHALEN-1-YL)-BENZENESULFONAMIDE
CAS:52078-05-4
Formula: C16H8Cl3N3O6S
KIN02315801
2,4,5-TRICHLORO-N-(2-CHLORO-ETHYL)-BENZENESULFONAMIDE
CAS:89939-01-5
Formula: C8H7Cl4NO2S
KIN02719545
2,4,5-TRICHLORO-N-(3-PHENYL-CYCLOBUTYL)-ANILINE
CAS:1156243-56-9
Formula: C16H14Cl3N
KIN05231768
2,4,5-TRICHLORO-N-(4-CHLORO-3-METHYLPHENYL)-BENZAMIDE
CAS:62129-32-2
Formula: C14H9Cl4NO
KIN02468353
2,4,5-TRICHLORO-N-(4-METHYL-3-NITROPHENYL)-BENZAMIDE
CAS:62129-33-3
Formula: C14H9Cl3N2O3
KIN02468354
2,4,5-TRICHLORO-N-(5-IODO-PYRIDIN-2-YL)-BENZENESULFONAMIDE
CAS:338401-06-2
Formula: C11H6Cl3IN2O2S
KIN03510442
2,4,5-TRICHLORO-N-(CYCLOBUTYLMETHYL)-ANILINE
CAS:356539-91-8
Formula: C11H12Cl3N
KIN03533413
2,4,5-TRICHLORO-N-(PYRIDIN-2-YLMETHYL)-BENZENESULFONAMIDE
CAS:6383-52-4
Formula: C21H17ClN2O6
KIN01160985
2,4,5-TRICHLORO-N-[3-(2-FLUOROPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156124-28-5
Formula: C16H13Cl3FN
KIN05229840
2,4,5-TRICHLORO-N-[3-(2-METHYLPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156084-52-4
Formula: C17H16Cl3N
KIN05229295
2,4,5-TRICHLORO-N-[3-(3-FLUOROPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156125-91-5
Formula: C16H13Cl3FN
KIN05229913
2,4,5-TRICHLORO-N-[3-(3-METHYLPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156124-33-2
Formula: C17H16Cl3N
KIN05229842
2,4,5-TRICHLORO-N-[3-(4-FLUOROPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156125-76-6
Formula: C16H13Cl3FN
KIN05229907
2,4,5-TRICHLORO-N-[3-(4-METHYLPHENYL)CYCLOBUTYL]-ANILINE
CAS:1156125-86-8
Formula: C17H16Cl3N
KIN05229911
2,4,5-TRICHLORO-N-ETHYL-ANILINE
CAS:42266-11-5
KIN02277159
2,4,5-TRICHLORO-N-HYDROXY-ANILINE
CAS:89598-87-8
Formula: C6H4Cl3NO
KIN02714126
2,4,5-TRICHLORO-N-METHOXY-BENZENESULFONAMIDE
CAS:63132-72-9
Formula: C7H6Cl3NO3S
KIN02486953
2,4,5-TRICHLORO-N-METHYL-ANILINE
CAS:42266-05-7
Formula: C7H6Cl3N
KIN02277158
2,4,5-TRICHLORO-N-METHYLBENZAMIDE
CAS:20643-39-4
Formula: C8H6Cl3NO
KIN02092714
2,4,5-TRICHLORO-N-METHYLBENZENEMETHANAMINE
CAS:51353-64-1
Formula: C8H8Cl3N
KIN02305366
2,4,5-TRICHLORO-N-PROPYL-ANILINE
CAS:356532-70-2
KIN03533304
2,4,5-TRICHLORO-N-SULFINYL-ANILINE
CAS:73637-09-9
Formula: C6H2Cl3NOS
KIN02599638
2,4,5-TRICHLORO-OXAZOLE
CAS:89570-49-0
Formula: C3Cl3NO
KIN02713742
2,4,5-TRICHLORO-THIAZOLE
CAS:50844-30-9
Formula: C3Cl3NS
KIN02298215
2,4,5-TRICHLORO-THIOPHEN-3-OL
CAS:295780-99-3
KIN03473604
2,4,5-TRICHLORO-THIOPHEN-3-OL 3-ACETATE
CAS:295781-05-4
Formula: C6H3Cl3O2S
KIN03473609
2,4,5-TRICHLOROBENZALDEHYDE
CAS:35696-87-8
KIN02225533
MFCD09999820
2,4,5-TRICHLOROBENZAMIDE
CAS:70439-09-7
Formula: C7H4Cl3NO
KIN02577557
2,4,5-TRICHLOROBENZENEACETAMIDE
CAS:2903-64-2
Formula: C8H5Cl3O2
KIN01078477
2,4,5-TRICHLOROBENZENEACETIC ACID
CAS:2903-75-5
Formula: C9H12O2
KIN01078478
2,4,5-TRICHLOROBENZENEACETONITRILE
CAS:2903-63-1
Formula: C8H6Cl3NO
KIN01078476
2,4,5-TRICHLOROBENZENEDIAZONIUM NITRATE
CAS:66561-68-0
Formula: C6H2Cl3N2.NO3
KIN02543492
2,4,5-TRICHLOROBENZENEDIAZONIUM TETRAFLUOROBORATE(I)
CAS:2339-78-8
Formula: C6H2Cl2FNO2
KIN01067291
2,4,5-TRICHLOROBENZENEETHANAMINE
CAS:18970-86-0
Formula: C8H8Cl3N
KIN02076711
2,4,5-TRICHLOROBENZENEETHANOL
CAS:75425-57-9
Formula: C8H7Cl3O
KIN02612605
2,4,5-TRICHLOROBENZENEMETHANAMINE
CAS:2903-62-0
Formula: C8H4Cl3N
KIN01078475
2,4,5-TRICHLOROBENZENEMETHANESULFONAMIDE
CAS:98274-07-8
Formula: C7H6Cl3NO2S
KIN02812395
2,4,5-TRICHLOROBENZENEMETHANESULFONIC ACID
CAS:92550-47-5
Formula: C7H5Cl3O3S
KIN02758302
2,4,5-TRICHLOROBENZENEMETHANETHIOL
CAS:89692-98-8
Formula: C7H5Cl3S
KIN02715614
2,4,5-TRICHLOROBENZENEMETHANOL
CAS:19010-52-7
KIN02077112
2,4,5-TRICHLOROBENZENEPROPANOIC ACID
CAS:99740-24-6
Formula: C9H7Cl3O2
KIN02822107
2,4,5-TRICHLOROBENZENESULFENYL CHLORIDE
CAS:62726-90-3
Formula: C6H2Cl4S
KIN02479344
2,4,5-TRICHLOROBENZENESULFINIC ACID
CAS:10439-21-1
Formula: C6H3Cl3O2S
KIN02006391
2,4,5-TRICHLOROBENZENESULFONAMIDE
CAS:29092-27-1
Formula: C6H4Cl3NO2S
KIN02171341
MFCD00119361
2,4,5-TRICHLOROBENZENESULFONIC ACID
CAS:6378-29-6
Formula: C16H12ClFN4OS2
KIN01160846
2,4,5-TRICHLOROBENZENESULFONIC ACID 2-[(4-CHLOROPHENYL)METHYLENE]HYDRAZIDE
CAS:6647-50-3
KIN01167922
2,4,5-TRICHLOROBENZENESULFONIC ACID 2-OXOPENTYL ESTER
CAS:80524-39-6
Formula: C11H11Cl3O4S
KIN02644648
2,4,5-TRICHLOROBENZENESULFONIC ACID 4-SULFOPHENYL ESTER SODIUM SALT
CAS:56860-66-3
Formula: C12H7Cl3O6S2.Na
KIN02389726
2,4,5-TRICHLOROBENZENESULFONIC ACID BARIUM SALT
CAS:57004-27-0
Formula: C6H3Cl3O3S.1/2Ba
KIN02392355
2,4,5-TRICHLOROBENZENESULFONIC ACID CYANOMETHYL ESTER
CAS:56000-15-8
Formula: C8H4Cl3NO3S
KIN02375650
2,4,5-TRICHLOROBENZENESULFONIC ACID CYCLOHEXYL ESTER
CAS:91394-25-1
Formula: C12H13Cl3O3S
KIN02742965
2,4,5-TRICHLOROBENZENESULFONIC ACID ETHYL ESTER
CAS:89938-99-8
Formula: C8H7Cl3O3S
KIN02719543
2,4,5-TRICHLOROBENZENESULFONIC ACID METHYL ESTER
CAS:89692-95-5
Formula: C7H5Cl3O3S
KIN02715613
2,4,5-TRICHLOROBENZENESULFONIC ACID POTASSIUM SALT
CAS:62625-17-6
Formula: C6H2Cl3KO3S
KIN02477546
MFCD00024894
2,4,5-TRICHLOROBENZENESULFONYL AZIDE
CAS:6647-56-9
KIN01167923
2,4,5-TRICHLOROBENZENESULFONYL CHLORIDE
CAS:15945-07-0
Formula: C6H2Cl4O2S
KIN02045878
MFCD00007428
2,4,5-TRICHLOROBENZENESULFONYL FLUORIDE
CAS:26120-89-8
Formula: C6H2Cl3FO2S
KIN02145622
2,4,5-TRICHLOROBENZENETHIOL
CAS:3773-16-8
Formula: C10H7ClN4O7S
KIN01095675
2,4,5-TRICHLOROBENZENETHIOL SODIUM SALT
CAS:91157-00-5
Formula: C6H3Cl3S.Na
KIN02739604
2,4,5-TRICHLOROBENZOHYDRAZIDE
CAS:19376-97-7
Formula: C7H5Cl3N2O
KIN02080812
2,4,5-TRICHLOROBENZOIC ACID
CAS:50-84-0
Formula: C7H4Cl2O2
KIN01000072
2,4,5-TRICHLOROBENZOIC ACID 2-PHENYLHYDRAZIDE
CAS:19376-95-5
Formula: C13H9Cl3N2O
KIN02080810
2,4,5-TRICHLOROBENZOIC ACID AZANYL ESTER
CAS:42865-90-7
Formula: C7H4Cl3NO2
KIN02281068
2,4,5-TRICHLOROBENZOIC ACID METHYL ESTER
CAS:86569-81-5
Formula: C8H5Cl3O2
KIN02681189
2,4,5-TRICHLOROBENZONITRILE
CAS:6575-05-9
Formula: C7H2Cl3N
KIN01165222
2,4,5-TRICHLOROBENZOYL CHLORIDE
CAS:42221-49-8
Formula: C7H2Cl4O
KIN02276840
2,4,5-TRICHLOROPHENETOLE
CAS:6851-45-2
KIN01171420
2,4,5-TRICHLOROPHENOL
CAS:95-96-5
Formula: C6H8O4
KIN01002942
2,4,5-TRICHLOROPHENOL 1-(N-PHENYLCARBAMATE)
CAS:22001-41-8
Formula: C13H8Cl3NO2
KIN02106280
2,4,5-TRICHLOROPHENOL 1-FORMATE
CAS:33104-36-8
Formula: C7H3Cl3O2
KIN02202574
2,4,5-TRICHLOROPHENOL 1-METHANESULFONATE
CAS:99620-28-7
Formula: C7H5Cl3O3S
KIN02821618
2,4,5-TRICHLOROPHENOL CADMIUM SALT
CAS:35210-77-6
Formula: C6H3Cl3O.1/2Cd
KIN02220870
2,4,5-TRICHLOROPHENOL COPPER SALT
CAS:24567-77-9
Formula: C6H3Cl3O.xCu
KIN02131686
2,4,5-TRICHLOROPHENOL PHOSPHITE (3:1)
CAS:3197-06-6
Formula: (HOCH2CH2)2NCH2CH2NH2
KIN01084277
2,4,5-TRICHLOROPHENOL, 1-(N-METHYLCARBAMATE)
CAS:3942-58-3
Formula: C9H10ClNO2
KIN01098316
2,4,5-TRICHLOROPHENOL, 1-ACETATE
CAS:5393-81-7
Formula: C10H20O3
KIN01128397
2,4,5-TRICHLOROPHENOL, TRIDECAN-2-YLAMINE
CAS:42589-07-1
Formula: C19H32Cl3NO
KIN02279587
2,4,5-TRICHLOROPHENOXY-BUTANOIC ACID
CAS:93-81-2
Formula: C22H44N2O2
KIN01002739
2,4,5-TRICHLOROPHENOXYACETIC ACID
CAS:93-77-6
Formula: C10H11ClO2S
KIN01002735
2,4,5-TRICHLOROPHENOXYACETIC ACID SEC-BUTYL ESTER
CAS:61792-07-2
Formula: C12H13Cl3O3
KIN02462138
2,4,5-TRICHLOROPHENOXYACETIC ACID TRIETHANOLAMINE, SALT
CAS:3813-26-1
Formula: C7H16N2O
KIN01096389
2,4,5-TRICHLOROPHENYL (S)-2-(N-BOC-AMINO)-PROPANOATE
CAS:7586-98-3
KIN01191699
2,4,5-TRICHLOROPHENYL (S)-N-CBZ-5-OXO-PYRROLIDINE-2-CARBOXYLATE
CAS:5910-47-4
Formula: C11H8Cl3NO3
KIN01144851
2,4,5-TRICHLOROPHENYL 4-[(ETHOXYCARBONYLOXY)]-3-METHOXY-BENZOATE
CAS:5438-64-2
Formula: C16H14O4
KIN01131151
2,4,5-TRICHLOROPHENYL 4-NITRO-BENZENESULFONATE
CAS:244633-30-5
Formula: C12H6Cl3NO5S
KIN03447538
2,4,5-TRICHLOROPHENYL CHLOROFORMATE
CAS:16947-69-6
Formula: C7H2Cl4O2
KIN02056632
2,4,5-TRICHLOROPHENYL N-[N-BOC-L-ALANYL]GLYCINATE
CAS:53054-11-8
Formula: C16H19Cl3N2O5
KIN02329549
2,4,5-TRICHLOROPHENYL PROPANOATE
CAS:5147-18-2
KIN01121647
2,4,5-TRICHLOROPHENYL TOSYLATE
CAS:7466-03-7
Formula: C14H11BrO2
KIN01187792
2,4,5-TRICHLOROPHENYLSULFONIC ACID 2,5-DIMETHYLPHENYL ESTER
CAS:1071683-26-5
Formula: C14H11Cl3O3S
KIN05113376
2,4,5-TRICHLOROPHENYLSULFONOHYDRAZIDE
CAS:6655-74-9
Formula: C6H6Cl2N2O2S
KIN01168103
2,4,5-TRICHLOROPYRIDINE
CAS:55934-01-5
Formula: C5H2Cl3N
KIN02374621
2,4,5-TRICHLOROPYRIMIDINE
CAS:5750-77-6
Formula: C5H6ClN3O
KIN01140785
2,4,5-TRICYCLOHEXYLPHENOL
CAS:90104-75-9
Formula: C24H36O
KIN02722386
2,4,5-TRICYCLOPENTYLPHENOL
CAS:60834-64-2
Formula: C21H30O
KIN02448235
2,4,5-TRIDEOXY-2-(N-BOC-AMINO)-THREO-PENT-4-ENONIC ACID
CAS:101623-96-5
Formula: C10H17NO5
KIN03634122
2,4,5-TRIDEOXY-4,5-EPITHIO-ERYTHRO-PENTONONITRILE
CAS:32151-13-6
Formula: C5H7NOS
KIN02194709
2,4,5-TRIDEOXY-4,5-EPITHIO-THREO-PENTONONITRILE
CAS:32250-72-9
Formula: C5H7NOS
KIN02195372
2,4,5-TRIDEOXY-4-[[(2S)-3-METHYL-1-OXO-2-(N-CBZ-AMINO)BUTYL]AMINO]-N-[(1S)-2-METHYL-1-[[(BENZYL)AMINO]CARBONYL]PROPYL]-5-PHENYL-2-[(BENZYL)AMINO]-L-LYXONAMIDE
CAS:161277-26-5
Formula: C43H53N5O6
KIN03328464
2,4,5-TRIDEOXY-5-PHENYL-4-[[N-[2,4,5-TRIDEOXY-5-PHENYL-4-[[N-[N-(PHENYL-ACETYL)-L-VALYL]-L-VALYL]AMINO]PENTONOYL]-L-ALANYL]AMINO]-PENTONIC ACID
CAS:158335-52-5
Formula: C43H57N5O9
KIN03320214
2,4,5-TRIDEOXY-N-[(1S)-1-[[[(2,4-DIMETHOXY-PHENYL)METHYL]AMINO]CARBONYL]-2-METHYLPROPYL]-2-[[(4-METHOXY-PHENYL)METHYL]AMINO]-4-[[(2S)-3-METHYL-1-OXO-2-(N-CBZ-AMINO)BUTYL]AMINO]-5-PHENYL-L-LYXONAMIDE
CAS:169305-67-3
Formula: C46H59N5O9
KIN03344588
2,4,5-TRIDEOXY-N-[(1S,2R)-2,3-DIHYDRO-2-HYDROXY-1H-INDEN-1-YL]-4-[[(2S)-3,3-DIMETHYL-1-OXO-2-(N-CBZ-AMINO)BUTYL]AMINO]-2-[[(4-METHOXY-PHENYL)METHYL]AMINO]-5-PHENYL-L-LYXONAMIDE
CAS:164514-52-7
Formula: C42H50N4O7
KIN03335718
2,4,5-TRIDEUTERIO-1-(TRIDEUTERIOMETHYL)-IMIDAZOLE
CAS:285978-27-0
Formula: C4H6N2
KIN03468305
2,4,5-TRIETHOXY-BENZALDEHYDE
CAS:67827-54-7
Formula: C13H18O4
KIN02558469
2,4,5-TRIETHOXY-PYRIMIDINE
CAS:91005-72-0
Formula: C10H16N2O3
KIN02737165
2,4,5-TRIETHYL-1H-IMIDAZOLE
CAS:32044-27-2
KIN02193981
2,4,5-TRIETHYL-1H-PYRROL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:27093-48-7
KIN02153981
2,4,5-TRIETHYL-3-AMINO-ANILINE
CAS:118606-54-5
Formula: C12H20N2
KIN03155035
2,4,5-TRIETHYL-3-HYDROXY-PHENOL
CAS:1083213-73-3
Formula: C12H18O2
KIN05124104
2,4,5-TRIETHYL-3-THIOPHENEACETONITRILE
CAS:115755-84-5
KIN03138920
2,4,5-TRIETHYL-6-METHYLPYRIMIDINE
CAS:120537-62-4
Formula: C11H18N2
KIN03164915
2,4,5-TRIETHYL-OXAZOLE
CAS:40953-16-0
Formula: C9H15NO
KIN02267196
2,4,5-TRIETHYLBENZALDEHYDE
CAS:216165-80-9
Formula: C13H18O
KIN03428846
2,4,5-TRIETHYLBENZENEMETHANOL
CAS:2715-54-0
Formula: C14H20O
KIN01074788
2,4,5-TRIETO-AMPHETAMINE
CAS:23693-42-7
Formula: C15H25NO3
KIN02122676
2,4,5-TRIFLUORO-1,3-BENZENEDICARBONITRILE
CAS:122546-73-0
Formula: C8HF3N2
KIN03175502
2,4,5-TRIFLUORO-1,3-BENZENEDICARBOXYLIC ACID
CAS:2010-58-4
KIN01060815
2,4,5-TRIFLUORO-1,3-BENZENEDICARBOXYLIC ACID COMPD. WITH BENZYL CARBAMIMIDOTHIOATE (1:2)
CAS:2502-60-5
Formula: C11H15BrO
KIN01070819
2,4,5-TRIFLUORO-1-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:129574-49-8
Formula: C4F6N2
KIN03671925
2,4,5-TRIFLUORO-1-METHYL-1H-IMIDAZOLE
CAS:120047-72-5
Formula: C4H3F3N2
KIN03162098
2,4,5-TRIFLUORO-1H-IMIDAZOLE
CAS:120047-58-7
Formula: C3HF3N2
KIN03162084
2,4,5-TRIFLUORO-1H-IMIDAZOLE-1-CARBOXALDEHYDE
CAS:120047-74-7
Formula: C4HF3N2O
KIN03162100
2,4,5-TRIFLUORO-3,6-BIS(METHYLTHIO)-ANILINE
CAS:60190-19-4
Formula: C8H8F3NS2
KIN02442418
2,4,5-TRIFLUORO-3,6-BIS(TRIFLUOROMETHYL)-BENZENESULFONYL CHLORIDE
CAS:2377-81-3
Formula: C8F4N2
KIN01068119
2,4,5-TRIFLUORO-3,6-DIMETHYL-ANILINE
CAS:119916-10-8
Formula: C8H8F3N
KIN03161347
2,4,5-TRIFLUORO-3,6-DIMETHYL-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:132630-88-7
Formula: C13H13F3O3
KIN03219720
2,4,5-TRIFLUORO-3,6-DIMETHYLBENZOIC ACID
CAS:132630-87-6
Formula: C9H7F3O2
KIN03219719
2,4,5-TRIFLUORO-3,6-DINITROPHENOL
CAS:123270-99-5
Formula: C6HF3N2O5
KIN03178773
2,4,5-TRIFLUORO-3-(1-METHYLETHENYL)-BENZOIC ACID
CAS:147425-24-9
Formula: C10H7F3O2
KIN03286031
2,4,5-TRIFLUORO-3-(1-METHYLETHOXY)-BENZOIC ACID
CAS:208166-32-9
Formula: C10H9F3O3
KIN03418447
2,4,5-TRIFLUORO-3-(FLUOROMETHOXY)-BENZAMIDE
CAS:479090-85-2
Formula: C8H5F4NO2
KIN03607663
2,4,5-TRIFLUORO-3-(FLUOROMETHOXY)-BENZOIC ACID
CAS:138140-74-6
Formula: C8H4F4O3
KIN03245072
2,4,5-TRIFLUORO-3-(FLUOROMETHOXY)-BENZOYL ISOCYANATE%
CAS:1098984-28-1
Formula: C9H3F4NO3
KIN05163301
2,4,5-TRIFLUORO-3-(METHYLAMINO)-BENZOIC ACID
CAS:127660-43-9
Formula: C8H6F3NO2
KIN03198249
2,4,5-TRIFLUORO-3-(METHYLTHIO)-BENZOIC ACID
CAS:178173-92-7
Formula: C8H5F3O2S
KIN03363855
2,4,5-TRIFLUORO-3-(METHYLTHIO)-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:178173-93-8
Formula: C12H11F3O3S
KIN03363856
2,4,5-TRIFLUORO-3-(TRIFLUOROMETHOXY)-BENZOIC ACID
CAS:128426-90-4
Formula: C8H2F6O3
KIN03019768
2,4,5-TRIFLUORO-3-(TRIFLUOROMETHYL)-BENZOIC ACID
CAS:118829-14-4
Formula: C8H2F6O2
KIN03156266
2,4,5-TRIFLUORO-3-(TRIFLUOROMETHYL)-BENZOYL CHLORIDE
CAS:118829-18-8
Formula: C8HClF6O
KIN03667971
2,4,5-TRIFLUORO-3-ALLYLBENZOIC ACID
CAS:189024-99-5
Formula: C10H7F3O2
KIN03387164
2,4,5-TRIFLUORO-3-AMINO-ANILINE
CAS:321182-37-0
Formula: C6H5F3N2
KIN03492761
2,4,5-TRIFLUORO-3-BROMOBENZOIC ACID AND THE DERIVATIVES
CAS:104222-46-6
Formula: C7HBrF3O2R
KIN03059749
2,4,5-TRIFLUORO-3-CHLORO-6-NITRO-BENZOIC ACID
CAS:111230-48-9
KIN03106537
2,4,5-TRIFLUORO-3-FORMYLBENZOIC ACID
CAS:189025-00-1
Formula: C8H3F3O3
KIN03387165
2,4,5-TRIFLUORO-3-FORMYLBENZOIC ACID METHYL ESTER
CAS:218608-01-6
Formula: C9H5F3O3
KIN03024116
2,4,5-TRIFLUORO-3-HYDROXY-6-NITRO-BENZOIC ACID
CAS:149707-60-8
Formula: C7H2F3NO5
KIN03293530
2,4,5-TRIFLUORO-3-HYDROXY-BENZAMIDE
CAS:128426-87-9
Formula: C7H4F3NO2
KIN03201660
2,4,5-TRIFLUORO-3-HYDROXY-BENZOHYDRAZIDE
CAS:1019451-65-0
Formula: C7H5F3N2O2
KIN05043321
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID
CAS:116751-24-7
Formula: C7H3F3O3
KIN03145644
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID BUTYL ESTER
CAS:159468-70-9
Formula: C11H11F3O3
KIN03010844
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID CALCIUM SALT (1:)
CAS:116751-27-0
Formula: C7H3F3O3.xCa
KIN03622831
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID ETHYL ESTER
CAS:128426-84-6
Formula: C9H7F3O3
KIN03201657
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID LITHIUM SALT (1:)
CAS:116786-41-5
Formula: C7H3F3O3.xLi
KIN03622830
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:137234-92-5
Formula: C8H5F3O3
KIN03240590
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID PROPYLESTER
CAS:1156177-54-6
Formula: C10H9F3O3
KIN05230706
2,4,5-TRIFLUORO-3-HYDROXY-BENZOIC ACID SODIUM SALT (1:)
CAS:116751-25-8
Formula: C7H3F3O3.xNa
KIN03634121
2,4,5-TRIFLUORO-3-HYDROXY-BENZOYL CHLORIDE
CAS:1042641-60-0
Formula: C7H2ClF3O2
KIN05090774
2,4,5-TRIFLUORO-3-HYDROXY-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:452092-28-3
Formula: C11H9F3O4
KIN03592399
2,4,5-TRIFLUORO-3-HYDROXY-N-(2-HYDROXYETHYL)-BENZAMIDE
CAS:1154308-92-5
Formula: C9H8F3NO3
KIN05216495
2,4,5-TRIFLUORO-3-HYDROXY-N-(2-MORPHOLINYLMETHYL)-BENZAMIDE
CAS:1153763-77-9
Formula: C12H13F3N2O3
KIN05212013
2,4,5-TRIFLUORO-3-HYDROXY-N-METHYLBENZAMIDE
CAS:151298-29-2
Formula: C8H6F3NO2
KIN03298939
2,4,5-TRIFLUORO-3-HYDROXY-N-PHENYLBENZAMIDE
CAS:151298-30-5
KIN03298940
2,4,5-TRIFLUORO-3-HYDROXY-N-PYRROLIDIN-3-YLBENZAMIDE
CAS:1154968-08-7
Formula: C11H11F3N2O2
KIN05221783
2,4,5-TRIFLUORO-3-HYDROXY-PHENOL
CAS:35770-72-0
Formula: C6H3F3O2
KIN02226151
2,4,5-TRIFLUORO-3-IODO-BENZOIC ACID
CAS:129306-18-9
Formula: C7H2F3IO2
KIN03205347
2,4,5-TRIFLUORO-3-IODO-BENZOIC ACID ETHYL ESTER
CAS:203916-66-9
Formula: C9H6F3IO2
KIN03412813
2,4,5-TRIFLUORO-3-IODO-BENZOYL FLUORIDE
CAS:115549-12-7
KIN03137741
2,4,5-TRIFLUORO-3-METHOXY-6-METHYL-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:130165-20-7
Formula: C13H13F3O4
KIN03208809
2,4,5-TRIFLUORO-3-METHOXY-6-METHYLBENZENEMETHANOL
CAS:130165-17-2
Formula: C9H9F3O2
KIN03019921
2,4,5-TRIFLUORO-3-METHOXY-6-METHYLBENZOIC ACID
CAS:130165-18-3
Formula: C9H7F3O3
KIN03208808
2,4,5-TRIFLUORO-3-METHOXY-6-METHYLBENZONITRILE
CAS:1003708-50-6
Formula: C9H6F3NO
KIN05008526
2,4,5-TRIFLUORO-3-METHOXY-6-METHYLBENZOYL CHLORIDE
CAS:130165-19-4
Formula: C9H6ClF3O2
KIN03008811
2,4,5-TRIFLUORO-3-METHOXY-6-METHYLPHENOL
CAS:113397-97-0
Formula: C8H7F3O2
KIN03122684
2,4,5-TRIFLUORO-3-METHOXY-6-NITRO-BENZOIC ACID
CAS:149707-41-5
Formula: [C8H4F3NO5
KIN03293529
2,4,5-TRIFLUORO-3-METHOXY-ANILINE
CAS:114214-45-8
Formula: C7H6F3NO
KIN03129303
2,4,5-TRIFLUORO-3-METHOXY-BENZAMIDE
CAS:112811-64-0
Formula: C8H6F3NO2
KIN03118380
2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID
CAS:112811-65-1
Formula: C8H5F3O3
KIN03118381
2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID ALLYL ESTER%
CAS:1044590-57-9
Formula: C11H9F3O3
KIN05093971
2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID ETHENYLESTER%
CAS:1044590-56-8
Formula: C10H7F3O3
KIN05093970
2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID ETHYL ESTER
CAS:351354-45-5
Formula: C10H9F3O3
KIN03528761
2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID METHYL ESTER
CAS:136897-64-8
Formula: C9H7F3O3
KIN03239207
2,4,5-TRIFLUORO-3-METHOXY-BENZONITRILE
CAS:112811-63-9
Formula: C8H4F3NO
KIN03118379
2,4,5-TRIFLUORO-3-METHOXY-BENZOYL CHLORIDE
CAS:112811-66-2
Formula: C8H4ClF3O2
KIN03118382
2,4,5-TRIFLUORO-3-METHOXY-BETA-OXO-BENZENEPROPANAL
CAS:1019033-10-3
Formula: C10H7F3O3
KIN05040905
2,4,5-TRIFLUORO-3-METHOXY-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:112811-68-4
Formula: C12H11F3O4
KIN03118384
2,4,5-TRIFLUORO-3-METHOXY-N,N-DIMETHYL-6-NITRO-ANILINE
CAS:14851-31-1
Formula: C9H9F3N2O3
KIN02036201
2,4,5-TRIFLUORO-3-METHOXY-PHENOL
CAS:17490-74-3
Formula: C7H5F3O2
KIN02062556
2,4,5-TRIFLUORO-3-METHYL-6-[(METHYLTHIO)METHYL]-ANILINE
CAS:119916-09-5
Formula: C9H10F3NS
KIN03634120
2,4,5-TRIFLUORO-3-METHYL-6-NITRO-ANILINE
CAS:119915-57-0
Formula: C7H5F3N2O2
KIN03161336
2,4,5-TRIFLUORO-3-METHYL-6-NITRO-BENZOIC ACID
CAS:167887-95-8
Formula: C8H4F3NO4
KIN03341598
2,4,5-TRIFLUORO-3-METHYL-6-NITRO-BENZOYL CHLORIDE
CAS:167888-41-7
Formula: C8H3ClF3NO3
KIN03022341
2,4,5-TRIFLUORO-3-METHYL-ANILINE
CAS:119916-26-6
Formula: C7H6F3N
KIN03161356
2,4,5-TRIFLUORO-3-METHYL-BETA-OXO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:112822-88-5
Formula: C12H11F3O3
KIN03118481
2,4,5-TRIFLUORO-3-METHYLBENZAMIDE
CAS:112822-84-1
Formula: C8H6F3NO
KIN03118478
2,4,5-TRIFLUORO-3-METHYLBENZOIC ACID
CAS:112822-85-2
Formula: C8H5F3O2
KIN03118479
2,4,5-TRIFLUORO-3-METHYLBENZOIC ACID ETHYL ESTER
CAS:174637-91-3
Formula: C10H9F3O2
KIN03356361
2,4,5-TRIFLUORO-3-METHYLBENZOIC ACID METHYL ESTER
CAS:479090-47-6
Formula: C9H7F3O2
KIN03607658
2,4,5-TRIFLUORO-3-METHYLBENZONITRILE
CAS:112822-83-0
Formula: C8H4F3N
KIN03118477
2,4,5-TRIFLUORO-3-METHYLBENZOYL CHLORIDE
CAS:112822-86-3
Formula: C8H4ClF3O
KIN03118480
2,4,5-TRIFLUORO-3-NITRO-BENZOIC ACID
CAS:115549-15-0
Formula: C7H2F3NO4
KIN03137744
2,4,5-TRIFLUORO-3-NITRO-BENZOYL FLUORIDE
CAS:115549-14-9
Formula: C7HF4NO3
KIN03137743
2,4,5-TRIFLUORO-6-(1,1,2,2,2-PENTAFLUORO-ETHYL)-PYRIMIDINE
CAS:54415-66-6
Formula: C6F8N2
KIN02349717
2,4,5-TRIFLUORO-6-(ALLYLOXY)-PYRIMIDINE
CAS:106537-36-4
Formula: C7H5F3N2O
KIN03076933
2,4,5-TRIFLUORO-6-(HEXYLOXY)-1,3-BENZENEDICARBONITRILE
CAS:102122-42-9
Formula: C14H13F3N2O
KIN03645298
2,4,5-TRIFLUORO-6-(METHYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:102122-46-3
Formula: C9H3F3N2S
KIN03622829
2,4,5-TRIFLUORO-6-(PHENYLAMINO)-PYRIDIN-3-CARBONITRILE
CAS:1081978-35-9
Formula: C12H6F3N3
KIN05118128
2,4,5-TRIFLUORO-6-(PHENYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:102122-38-3
Formula: C14H5F3N2S
KIN03622828
2,4,5-TRIFLUORO-6-(PROPARGYLOXY)-PYRIMIDINE
CAS:106537-38-6
Formula: C7H3F3N2O
KIN03076935
2,4,5-TRIFLUORO-6-(PROPYLTHIO)-1,3-BENZENEDICARBONITRILE
CAS:102122-47-4
Formula: C11H7F3N2S
KIN03622827
2,4,5-TRIFLUORO-6-(TRIFLUOROMETHYL)-3-AMINO-ANILINE
CAS:1112987-20-8
Formula: C7H4F6N2
KIN05175209
2,4,5-TRIFLUORO-6-(TRIFLUOROMETHYL)-PYRIMIDINE
CAS:27077-34-5
Formula: C5F6N2
KIN02153824
2,4,5-TRIFLUORO-6-[(BENZENESULFONYL)METHYL]PYRIMIDINE
CAS:97848-16-3
Formula: C11H7F3N2O2S
KIN02808174
2,4,5-TRIFLUORO-6-[(TRIFLUOROMETHYL)THIO]PYRIMIDINE
CAS:115347-08-5
Formula: C5F6N2S
KIN03678526
2,4,5-TRIFLUORO-6-HYDROXY-1,3-BENZENEDICARBONITRILE
CAS:102122-16-7
Formula: C8HF3N2O
KIN03678525
2,4,5-TRIFLUORO-6-IODO-PYRIMIDINE
CAS:23899-05-0
Formula: C4F3IN2
KIN02124610
2,4,5-TRIFLUORO-6-METHOXY-1,3-BENZENEDICARBONITRILE
CAS:102122-17-8
Formula: C9H3F3N2O
KIN03678524
2,4,5-TRIFLUORO-6-METHOXY-3-METHYLBENZOIC ACID
CAS:208166-41-0
Formula: C9H7F3O3
KIN03418448
2,4,5-TRIFLUORO-6-METHOXY-PYRIMIDINE
CAS:17573-80-7
Formula: C5H3F3N2O
KIN02063278
2,4,5-TRIFLUORO-6-METHYL-1,3-BENZENEDICARBONITRILE
CAS:142603-31-4
Formula: C9H3F3N2
KIN03009725
2,4,5-TRIFLUORO-6-METHYL-1,3-BENZENEDICARBOXYLIC ACID
CAS:142603-49-4
Formula: C9H5F3O4
KIN03265749
2,4,5-TRIFLUORO-6-METHYL-3-(TRIMETHYLSILYL)-BENZOIC ACID
CAS:132630-86-5
Formula: C11H13F3O2Si
KIN03219718
2,4,5-TRIFLUORO-6-METHYL-3-NITRO-BENZOIC ACID
CAS:360065-36-7
Formula: C8H4F3NO4
KIN03536331
2,4,5-TRIFLUORO-6-NITRO-3-(2-PROPEN-1-YLOXY)-PHENOL
CAS:223387-06-2
Formula: C9H6F3NO4
KIN03678523
2,4,5-TRIFLUORO-6-NITRO-3-AMINO-ANILINE
CAS:2106-01-6
KIN01062790
2,4,5-TRIFLUORO-6-NITRO-3-HYDROXY-PHENOL
CAS:31438-88-7
Formula: C6H2F3NO4
KIN02189483
2,4,5-TRIFLUORO-6-PHENOXY-1,3-BENZENEDICARBONITRILE
CAS:102122-26-9
Formula: C14H5F3N2O
KIN03678522
2,4,5-TRIFLUORO-6-PROPOXY-1,3-BENZENEDICARBONITRILE
CAS:102122-20-3
Formula: C11H7F3N2O
KIN03678521
2,4,5-TRIFLUORO-ALPHA-(1-METHYLETHYL)-BENZENEETHANAMINE
CAS:1159577-35-1
Formula: C11H14F3N
KIN05255255
2,4,5-TRIFLUORO-ALPHA-HYDROXY-BENZENEACETIC ACID
CAS:375369-29-2
Formula: C8H5F3O3
KIN03545657
2,4,5-TRIFLUORO-ALPHA-METHYLBENZENEETHANAMINE HCL
CAS:1062587-61-4
Formula: C9H10F3N.ClH
KIN05108249
2,4,5-TRIFLUORO-ALPHA-METHYLBENZENEMETHANAMINE
CAS:1191948-13-6
Formula: C8H8F3N
KIN05332535
2,4,5-TRIFLUORO-ALPHA-METHYLBENZENEMETHANAMINE HCL
CAS:1191908-43-6
Formula: C8H8F3N.ClH
KIN05332463
2,4,5-TRIFLUORO-ALPHA-METHYLBENZENEMETHANOL
CAS:347193-99-1
Formula: C8H7F3O
KIN03524020
2,4,5-TRIFLUORO-ALPHA-PHENYLBENZENEMETHANOL
CAS:252357-00-9
KIN03452347
2,4,5-TRIFLUORO-ANILINE
CAS:367-35-1
Formula: C6H4F2O2
KIN01012229
2,4,5-TRIFLUORO-ANISOLE
CAS:5006-39-3
Formula: C16H18
KIN01118890
2,4,5-TRIFLUORO-BENZENEMETHANAMINE
CAS:168644-93-7
Formula: C7H6F3N
KIN03343210
2,4,5-TRIFLUORO-BETA-OXO-BENZENEPROPANAL%
CAS:1019027-23-6
Formula: C9H5F3O2
KIN05040682
2,4,5-TRIFLUORO-BETA-OXO-BENZENEPROPANENITRILE
CAS:142501-42-6
Formula: C9H4F3NO
KIN03265386
2,4,5-TRIFLUORO-BETA-OXO-BENZENEPROPANOIC ACID
CAS:160450-09-9
Formula: C9H5F3O3
KIN03326028
2,4,5-TRIFLUORO-BETA-OXO-BENZENEPROPANOIC ACID METHYL ESTER
CAS:129527-43-1
Formula: C10H7F3O3
KIN03206216
2,4,5-TRIFLUORO-BETA-OXO-BENZENEPROPANOIC ACID TERT-BUTYL ESTER
CAS:195253-58-8
Formula: C13H13F3O3
KIN03399909
2,4,5-TRIFLUORO-BIPHENYL
CAS:67277-35-4
Formula: C12H7F3
KIN02551005
2,4,5-TRIFLUORO-BROMOBENZENE
CAS:327-54-8
Formula: C6H2F4
KIN01010483
2,4,5-TRIFLUORO-CARBANILIC ACID ETHYL ESTER
CAS:1997-93-9
Formula: C28H30FN3O
KIN01060521
2,4,5-TRIFLUORO-CARBANILIC ACID PROPAN-2-YL ESTER
CAS:2354-93-0
Formula: C10H10F3NO2
KIN01067598
2,4,5-TRIFLUORO-N,3-DIHYDROXY-BENZAMIDE
CAS:1019128-07-4
Formula: C7H4F3NO3
KIN05041405
2,4,5-TRIFLUORO-N,N-DIMETHYLBENZENEETHANETHIOAMIDE
CAS:1054559-71-5
Formula: C10H10F3NS
KIN05101908
2,4,5-TRIFLUORO-N-(1-METHYLBUT-2-EN-1-YL)-ANILINE
CAS:439943-49-4
Formula: C11H12F3N
KIN03026908
2,4,5-TRIFLUORO-N-(2-HYDROXY-TERT-BUTYL)-BENZAMIDE
CAS:125290-71-3
Formula: C11H12F3NO2
KIN03187899
2,4,5-TRIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:1189175-49-2
Formula: C9H8F3NO2
KIN05328650
2,4,5-TRIFLUORO-N-METHYL-ANILINE
CAS:256412-92-7
Formula: C7H6F3N
KIN03455459
2,4,5-TRIFLUORO-N1,N1,N3-TRIMETHYL-6-NITRO-3-AMINO-ANILINE
CAS:14851-21-9
KIN02036192
2,4,5-TRIFLUORO-N1,N1-DIMETHYL-6-NITRO-3-AMINO-ANILINE
CAS:14851-17-3
KIN02036188
2,4,5-TRIFLUORO-N1,N3-DIMETHYL-3-AMINO-ANILINE
CAS:31664-56-9
Formula: C8H9F3N2
KIN02191126
2,4,5-TRIFLUORO-N1,N3-DIMETHYL-6-NITRO-3-AMINO-ANILINE
CAS:2241-61-4
Formula: C24H22O9
KIN01065566
2,4,5-TRIFLUORO-N1-METHYL-6-NITRO-3-AMINO-ANILINE
CAS:14851-15-1
KIN02036186
2,4,5-TRIFLUOROBENZALDEHYDE
CAS:165047-24-5
Formula: C7H3F3O
KIN03336530
2,4,5-TRIFLUOROBENZAMIDE
CAS:98349-23-6
Formula: C7H4F3NO
KIN02813136
MFCD00082478
2,4,5-TRIFLUOROBENZENEACETALDEHYDE
CAS:111991-20-9
Formula: C8H5F3O
KIN03111735
2,4,5-TRIFLUOROBENZENEACETIC ACID
CAS:209995-38-0
Formula: C8H5F3O2
KIN03420777
2,4,5-TRIFLUOROBENZENEACETIC ACID METHYL ESTER
CAS:1036273-20-7
Formula: C9H7F3O2
KIN05069922
2,4,5-TRIFLUOROBENZENEACETONITRILE
CAS:220141-74-2
Formula: C8H4F3N
KIN03433124
2,4,5-TRIFLUOROBENZENEACETYL CHLORIDE
CAS:1176895-65-0
Formula: C8H4ClF3O
KIN05270505
2,4,5-TRIFLUOROBENZENEBUTANENITRILE
CAS:1057672-23-7
Formula: C10H8F3N
KIN05104547
2,4,5-TRIFLUOROBENZENEMETHANAMINE HCL
CAS:168644-98-2
Formula: C7H6F3N.ClH
KIN03343211
2,4,5-TRIFLUOROBENZENEMETHANOL
CAS:144284-25-3
Formula: C7H5F3O
KIN03274894
2,4,5-TRIFLUOROBENZENEPENTANOL
CAS:136618-45-6
Formula: C11H13F3O
KIN03237761
2,4,5-TRIFLUOROBENZENEPROPANAMINE
CAS:1057679-68-1
Formula: C9H10F3N
KIN05104799
2,4,5-TRIFLUOROBENZENEPROPANENITRILE
CAS:1057676-34-2
Formula: C9H6F3N
KIN05104720
2,4,5-TRIFLUOROBENZENEPROPANOIC ACID ETHYL ESTER
CAS:1057673-95-6
Formula: C11H11F3O2
KIN05104658
2,4,5-TRIFLUOROBENZENEPROPANOL
CAS:130887-16-0
Formula: C9H9F3O
KIN03211918
2,4,5-TRIFLUOROBENZENEPROPANOYL CHLORIDE
CAS:1102373-43-2
Formula: C9H6ClF3O
KIN05168231
2,4,5-TRIFLUOROBENZENESULFONAMIDE
CAS:287172-63-8
Formula: C6H4F3NO2S
KIN03468991
2,4,5-TRIFLUOROBENZENESULFONYL CHLORIDE
CAS:220227-21-4
Formula: C6H2ClF3O2S
KIN03433369
2,4,5-TRIFLUOROBENZIMIDAMIDE HCL
CAS:1187929-36-7
Formula: C7H5F3N2.ClH
KIN05324092
2,4,5-TRIFLUOROBENZOIC ACID
CAS:446-18-4
Formula: C7H7FN2O2
KIN01014735
2,4,5-TRIFLUOROBENZOIC ACID COPPER(II) SALT (2:1)
CAS:146671-33-2
Formula: C7H3F3O2.1/2Cu
KIN03021126
2,4,5-TRIFLUOROBENZOIC ACID ETHYL ESTER
CAS:351354-41-1
Formula: C9H7F3O2
KIN03528760
2,4,5-TRIFLUOROBENZOIC ACID ION(I)
CAS:255875-47-9
KIN03455031
2,4,5-TRIFLUOROBENZOIC ACID METHYL ESTER
CAS:20372-66-1
Formula: C8H5F3O2
KIN02090557
2,4,5-TRIFLUOROBENZOIC ACID TERT-BUTYL ESTER
CAS:182875-05-4
Formula: C11H11F3O2
KIN03373430
2,4,5-TRIFLUOROBENZONITRILE
CAS:98349-22-5
Formula: C7H2F3N
KIN02813135
MFCD00013289
2,4,5-TRIFLUOROBENZOYL AZIDE
CAS:1033771-68-4
KIN05068256
2,4,5-TRIFLUOROBENZOYL CHLORIDE
CAS:88417-56-1
Formula: C7H2ClF3O
KIN02697874
2,4,5-TRIFLUOROBENZOYL FLUORIDE
CAS:101513-67-1
Formula: C7H2F4O
KIN03039991
2,4,5-TRIFLUOROPHENOL
CAS:2268-17-9
Formula: C6H3F3O
KIN01066159
2,4,5-TRIFLUOROPHENOL 1-(HYDROGEN SULFATE)
CAS:147300-06-9
KIN03285540
2,4,5-TRIFLUOROPHENYL-ACETIC ACID
CAS:20995-38-0
Formula: C8H5F3O2
KIN02096303
2,4,5-TRIFLUOROPYRIMIDINE
CAS:17573-79-4
Formula: C4HF3N2
KIN02063277
MFCD11845791
2,4,5-TRIFULOROPHENYLBORONIC ACID
CAS:352-46-5
KIN01011542
2,4,5-TRIHYDROXY-1,3-BENZENEDICARBOXYLIC ACID
CAS:69727-33-9
Formula: C8H6O7
KIN02572387
2,4,5-TRIHYDROXY-1,3-BENZENEDISULFONIC ACID
CAS:205690-85-3
KIN03415327
2,4,5-TRIHYDROXY-1,7-DIMETHYL-9,10-ANTHRACENEDIONE
CAS:1187646-39-4
Formula: C16H12O5
KIN05323490
2,4,5-TRIHYDROXY-1-METHOXY-9H-XANTHEN-9-ONE
CAS:115713-07-0
Formula: C14H10O6
KIN03138660
2,4,5-TRIHYDROXY-3-(PYRROLIDIN-1-YLMETHYL)-BENZALDEHYDE
CAS:1033038-01-5
Formula: C12H15NO4
KIN05067470
2,4,5-TRIHYDROXY-3-METHOXY-BENZOIC ACID
CAS:100111-46-4
Formula: C8H8O6
KIN03028569
2,4,5-TRIHYDROXY-ALPHA-METHYLBENZENEACETIC ACID
CAS:88122-13-8
Formula: C9H10O5
KIN02693506
2,4,5-TRIHYDROXY-ALPHA-OXO-BENZENEACETIC ACID
CAS:10385-69-0
Formula: C8H6O6
KIN02005747
2,4,5-TRIHYDROXY-BENZALDEHYDE
CAS:35094-87-2
Formula: C7H6O4
KIN02219756
MFCD00016592
2,4,5-TRIHYDROXY-BENZALDEHYDE OXIME
CAS:41273-89-6
Formula: C7H7NO4
KIN02269838
2,4,5-TRIHYDROXY-BENZAMIDE
CAS:1056960-66-7
Formula: C7H7NO4
KIN05103456
2,4,5-TRIHYDROXY-BENZENEACETIC ACID
CAS:51109-27-4
KIN02301865
2,4,5-TRIHYDROXY-BENZENEPROPANOIC ACID
CAS:70303-80-9
Formula: C9H10O5
KIN02576622
2,4,5-TRIHYDROXY-BENZENEPROPANOIC ACID METHYL ESTER
CAS:182690-36-4
KIN03678520
2,4,5-TRIHYDROXY-BENZENESULFONIC ACID
CAS:205690-84-2
Formula: C6H6O6S
KIN03415326
2,4,5-TRIHYDROXY-BENZOHYDRAZIDE
CAS:1056956-89-8
Formula: C7H8N2O4
KIN05103316
2,4,5-TRIHYDROXY-BENZOIC ACID
CAS:610-91-3
Formula: C9H11NO2
KIN01022240
2,4,5-TRIHYDROXY-BENZOIC ACID 2-HYDROXYETHYLESTER
CAS:1056960-63-4
Formula: C9H10O6
KIN05103455
2,4,5-TRIHYDROXY-BENZOIC ACID CYCLOPROPYLESTER
CAS:1056960-62-3
Formula: C10H10O5
KIN05103454
2,4,5-TRIHYDROXY-BENZOIC ACID ETHYL ESTER
CAS:90536-73-5
Formula: C9H10O5
KIN02729575
2,4,5-TRIHYDROXY-BENZOIC ACID METHYL ESTER
CAS:178678-93-8
KIN03365236
2,4,5-TRIHYDROXY-BENZOIC ACID PROPYL ESTER
CAS:1056961-42-2
Formula: C10H12O5
KIN05103475
2,4,5-TRIHYDROXY-BENZONITRILE
CAS:1056960-80-5
Formula: C7H5NO3
KIN05103462
2,4,5-TRIHYDROXY-N,N-DIMETHYLBENZAMIDE
CAS:1056960-78-1
Formula: C9H11NO4
KIN05103461
2,4,5-TRIHYDROXY-N-(1-METHYLETHYL)-BENZAMIDE
CAS:1056960-71-4
Formula: C10H13NO4
KIN05103460
2,4,5-TRIHYDROXY-N-METHYLBENZAMIDE
CAS:1056960-67-8
Formula: C8H9NO4
KIN05103457
2,4,5-TRIHYDROXY-N-PROPYLBENZAMIDE
CAS:1056956-90-1
Formula: C10H13NO4
KIN05103317
2,4,5-TRIHYDROXYTOLUENE
CAS:1124-10-3
Formula: C7H13N3
KIN01040414
2,4,5-TRIIODO-1H-IMIDAZOLE
CAS:1746-26-5
Formula: C9H10Cl2
KIN01054860
2,4,5-TRIIODO-3-ACETYLPYRROLE
CAS:111468-98-5
Formula: C6H4I3NO
KIN03107989
2,4,5-TRIIODO-3-FORMYLPYRROLE
CAS:35302-95-5
Formula: C5H2I3NO
KIN02221792
2,4,5-TRIIODO-BENZOIC ACID
CAS:35674-21-6
Formula: C7H3I3O2
KIN02225249
2,4,5-TRIIODO-TOLUENE
CAS:32704-10-2
Formula: C7H5I3
KIN02199252
2,4,5-TRIMESITYL-1,3-DIOXA-2-BOROLE
CAS:125440-77-9
Formula: C29H33BO2
KIN03188644
2,4,5-TRIMETHOXY-3,6-DIMETHYLBENZALDEHYDE
CAS:92421-47-1
Formula: C12H16O4
KIN02756506
2,4,5-TRIMETHOXY-3,6-DIMETHYLBENZENEACETONITRILE
CAS:60059-01-0
KIN02441224
2,4,5-TRIMETHOXY-3-(1-METHYLETHYL)-BENZALDEHYDE
CAS:144707-41-5
KIN03276943
2,4,5-TRIMETHOXY-3-(1-METHYLETHYL)-BENZENEACETONITRILE
CAS:144707-48-2
KIN03645297
2,4,5-TRIMETHOXY-3-AMINO-ANILINE
CAS:4602-68-0
KIN01111216
2,4,5-TRIMETHOXY-3-FORMYLBENZALDEHYDE
CAS:78835-27-5
Formula: C11H12O5
KIN02633920
2,4,5-TRIMETHOXY-3-HYDROXY-PHENOL
CAS:56002-92-7
KIN02375680
2,4,5-TRIMETHOXY-3-METHYL-ANILINE
CAS:152531-76-5
KIN03302436
2,4,5-TRIMETHOXY-3-METHYLBENZALDEHYDE
CAS:60059-09-8
Formula: C11H14O4
KIN02441228
2,4,5-TRIMETHOXY-3-METHYLBENZENEACETIC ACID
CAS:478303-36-5
KIN03606687
2,4,5-TRIMETHOXY-3-METHYLBENZENEACETONITRILE
CAS:77515-73-2
KIN02626124
2,4,5-TRIMETHOXY-3-METHYLBENZENEETHANAMINE
CAS:84018-46-2
Formula: C12H19NO3
KIN02664834
2,4,5-TRIMETHOXY-3-METHYLBENZENEMETHANOL
CAS:137023-15-5
KIN03239738
2,4,5-TRIMETHOXY-3-METHYLPHENOL
CAS:105104-01-6
KIN03065975
2,4,5-TRIMETHOXY-ALPHA-(4-METHYLPHENYL)-BENZENEMETHANAMINE
CAS:1037154-16-7
KIN05073604
2,4,5-TRIMETHOXY-ALPHA-ALLYLBENZENEMETHANOL
CAS:68305-20-4
Formula: C13H18O4
KIN02562351
2,4,5-TRIMETHOXY-ALPHA-METHYLBENZENEETHANAMINE
CAS:22199-15-1
Formula: C12H19NO3
KIN02108333
2,4,5-TRIMETHOXY-ALPHA-METHYLBENZENEMETHANOL
CAS:41317-93-5
KIN02270231
2,4,5-TRIMETHOXY-ALPHA-OXO-BENZENEACETAMIDE
CAS:70023-63-1
KIN02574633
2,4,5-TRIMETHOXY-ALPHA-OXO-BENZENEPROPANOIC ACID
CAS:38449-36-4
Formula: C12H14O6
KIN02248095
2,4,5-TRIMETHOXY-ALPHA-PHENYLBENZENEMETHANAMINE
CAS:1152540-78-7
Formula: C16H19NO3
KIN05198918
2,4,5-TRIMETHOXY-ANILINE
CAS:26510-91-8
Formula: C9H13NO3
KIN02148916
MFCD03840519
2,4,5-TRIMETHOXY-BENZALDEHYDE
CAS:4460-95-1
KIN01108504
2,4,5-TRIMETHOXY-BENZALDEHYDE HYDRAZONE
CAS:14469-99-9
Formula: C10H14N2O3
KIN02032339
2,4,5-TRIMETHOXY-BENZALDEHYDE OXIME
CAS:14894-76-9
Formula: C10H13NO4
KIN02036531
MFCD00544885
2,4,5-TRIMETHOXY-BENZAMIDE
CAS:4424-80-0
Formula: C10H11NO
KIN01107519
2,4,5-TRIMETHOXY-BENZENEACETALDEHYDE
CAS:22973-79-1
Formula: C11H14O4
KIN02115519
2,4,5-TRIMETHOXY-BENZENEACETAMIDE
CAS:38444-51-8
Formula: C11H15NO4
KIN02248043
2,4,5-TRIMETHOXY-BENZENEACETIC ACID
CAS:4463-18-7
Formula: C2H6N2O
KIN01108561
2,4,5-TRIMETHOXY-BENZENEACETIC ACID METHYL ESTER
CAS:2638-36-0
Formula: C11H18O2
KIN01073486
2,4,5-TRIMETHOXY-BENZENEACETONITRILE
CAS:38444-50-7
Formula: C11H13NO3
KIN02248042
2,4,5-TRIMETHOXY-BENZENEACETYL CHLORIDE
CAS:63359-53-5
Formula: C11H13ClO4
KIN02491202
2,4,5-TRIMETHOXY-BENZENEDIAZONIUM CHLORIDE
CAS:88301-38-6
Formula: C9H11ClN2O3
KIN02696039
2,4,5-TRIMETHOXY-BENZENEETHANAMINE
CAS:15394-83-9
Formula: C11H17NO3
KIN02041067
2,4,5-TRIMETHOXY-BENZENEETHANAMINE HCL
CAS:3166-82-3
Formula: C12H20ClNO3
KIN01083728
2,4,5-TRIMETHOXY-BENZENEETHANOL
CAS:28800-17-1
KIN02168900
2,4,5-TRIMETHOXY-BENZENEMETHANAMINE
CAS:154584-98-2
Formula: C10H15NO3
KIN03309299
2,4,5-TRIMETHOXY-BENZENEMETHANETHIOL
CAS:212555-22-1
KIN03424040
2,4,5-TRIMETHOXY-BENZENEMETHANOL
CAS:30038-31-4
Formula: C10H14O4
KIN02178671
MFCD00021966
2,4,5-TRIMETHOXY-BENZENEPROPANOIC ACID
CAS:125438-30-4
KIN03188631
2,4,5-TRIMETHOXY-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:1073648-15-3
Formula: C14H20O5
KIN05115474
2,4,5-TRIMETHOXY-BENZENEPROPANOIC ACID METHYL ESTER
CAS:264147-43-5
KIN03678519
2,4,5-TRIMETHOXY-BENZENESULFINYL CHLORIDE
CAS:144426-91-5
Formula: C9H11ClO4S
KIN03275577
2,4,5-TRIMETHOXY-BENZENESULFONYL CHLORIDE
CAS:85477-01-6
Formula: C9H11ClO5S
KIN02674598
2,4,5-TRIMETHOXY-BENZIMIDAMIDE
CAS:1026276-19-6
Formula: C10H14N2O3
KIN05060262
2,4,5-TRIMETHOXY-BENZOIC ACID
CAS:490-65-3
Formula: C14H16
KIN01016749
2,4,5-TRIMETHOXY-BENZOIC ACID (3-BROMOPHENYL)METHYL ESTER
CAS:1003813-05-5
Formula: C17H17BrO5
KIN05008721
2,4,5-TRIMETHOXY-BENZOIC ACID 2,2-DIPHENYLHYDRAZIDE
CAS:1147428-00-9
Formula: C22H22N2O4
KIN05195449
2,4,5-TRIMETHOXY-BENZOIC ACID 2-(CYCLOPENTYLAMINO)-2-OXOETHYL ESTER
CAS:380189-38-8
Formula: C17H23NO6
KIN03548159
2,4,5-TRIMETHOXY-BENZOIC ACID 2-[(3-ACETYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:400057-52-5
Formula: C20H21NO7
KIN03560874
2,4,5-TRIMETHOXY-BENZOIC ACID 2-[(4-ACETYLPHENYL)AMINO]-1-METHYL-2-OXOETHYL ESTER
CAS:438608-53-8
Formula: C21H23NO7
KIN03582144
2,4,5-TRIMETHOXY-BENZOIC ACID 2-[(4-IODO-2-METHYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:400058-72-2
Formula: C19H20INO6
KIN03560882
2,4,5-TRIMETHOXY-BENZOIC ACID 2-[(4-IODO-PHENYL)AMINO]-2-OXOETHYL ESTER
CAS:380177-98-0
Formula: C18H18INO6
KIN03548109
2,4,5-TRIMETHOXY-BENZOIC ANHYDRIDE
CAS:83813-97-2
Formula: C20H22O9
KIN02663593
2,4,5-TRIMETHOXY-BENZONITRILE
CAS:14894-77-0
Formula: C10H11NO3
KIN02036532
MFCD00017530
2,4,5-TRIMETHOXY-BENZOYL AZIDE
CAS:1152844-30-8
KIN05201878
2,4,5-TRIMETHOXY-BENZOYL CHLORIDE
CAS:42833-66-9
Formula: C10H11ClO4
KIN02280762
MFCD00829927
2,4,5-TRIMETHOXY-BETA-METHYLBETA-NITRO-STYRENE
CAS:134040-35-0
Formula: C12H15NO5
KIN03226433
2,4,5-TRIMETHOXY-BETA-OXO-BENZENEPROPANENITRILE
CAS:41318-06-3
KIN02270233
2,4,5-TRIMETHOXY-BETA-OXO-BENZENEPROPANOIC ACID
CAS:41318-08-5
Formula: C12H14O6
KIN02270234
2,4,5-TRIMETHOXY-BIPHENYL
CAS:55852-46-5
KIN02373426
2,4,5-TRIMETHOXY-DELTA-OXO-BENZENEPENTANOIC ACID
CAS:92865-60-6
Formula: C14H18O6
KIN02762410
MFCD09801780
2,4,5-TRIMETHOXY-N,N-DIMETHYLBENZAMIDE
CAS:149220-81-5
Formula: C12H17NO4
KIN03291743
2,4,5-TRIMETHOXY-N-(3-METHOXY-PHENYL)-BENZAMIDE
CAS:79966-74-8
KIN02640979
2,4,5-TRIMETHOXY-N-METHYL-ANILINE
CAS:1137557-37-9
Formula: C10H15NO3
KIN05187752
2,4,5-TRIMETHOXY-N-METHYLBENZENEACETAMIDE
CAS:125438-32-6
Formula: C12H17NO4
KIN03188632
2,4,5-TRIMETHOXY-N-METHYLBENZENEETHANAMINE
CAS:119522-45-1
Formula: C12H19NO3
KIN03159427
2,4,5-TRIMETHOXY-N-PYRIDIN-4-YLBENZAMIDE
CAS:113204-32-3
KIN03121039
2,4,5-TRIMETHOXY-N-PYRROLIDIN-3-YLBENZAMIDE
CAS:1154968-90-7
Formula: C14H20N2O4
KIN05221807
2,4,5-TRIMETHOXY-PHENOL
CAS:20491-91-2
Formula: C9H12O4
KIN02091512
2,4,5-TRIMETHOXY-PHENOL 1-FORMATE
CAS:30225-87-7
KIN02180351
2,4,5-TRIMETHOXY-PHENOXY
CAS:115061-04-6
Formula: C9H11O4
KIN03135041
2,4,5-TRIMETHOXY-PYRIDINE
CAS:57905-78-9
Formula: C8H11NO3
KIN02407243
2,4,5-TRIMETHOXY-PYRIDINE N1-OXIDE
CAS:57905-77-8
Formula: C8H11NO4
KIN02407242
2,4,5-TRIMETHOXY-QUINOLINE
CAS:55934-23-1
Formula: C12H13NO3
KIN02374630
2,4,5-TRIMETHOXYAMPHETAMIN
CAS:1083-10-9
Formula: C11H10N2O3
KIN01039194
2,4,5-TRIMETHYL-[1,1'-BIPHENYL]-3-OL
CAS:100975-77-7
Formula: C15H16O
KIN03036158
2,4,5-TRIMETHYL-[1,2,4]-TRIAZOL-3-ONE
CAS:57626-52-5
Formula: C5H9N3O
KIN02402535
2,4,5-TRIMETHYL-[1,2,4]TRIAZINO[1,6-A]INDOLE
CAS:54916-54-0
Formula: C13H13N3
KIN02357499
2,4,5-TRIMETHYL-[1,3]DIOXOLANE
CAS:3299-38-5
Formula: C8H17NO
KIN01086289
2,4,5-TRIMETHYL-1,1'-BIPHENYL
CAS:91363-45-0
Formula: C15H16
KIN02742521
2,4,5-TRIMETHYL-1,3-BENZENEDIAMINE
CAS:90721-79-2
Formula: C9H14N2
KIN02732273
2,4,5-TRIMETHYL-1,3-BENZENEDICARBOXALDEHYDE
CAS:173734-22-0
Formula: C11H12O2
KIN03354169
2,4,5-TRIMETHYL-1,3-BENZENEDICARBOXYLIC ACID
CAS:10387-14-1
Formula: C11H12O4
KIN02005775
2,4,5-TRIMETHYL-1,3-BENZENEDIMETHANAMINE
CAS:65676-04-2
Formula: C11H18N2
KIN02530700
2,4,5-TRIMETHYL-1,3-BENZENEDIMETHANETHIOL
CAS:109779-52-4
Formula: C11H16S2
KIN03097331
2,4,5-TRIMETHYL-1,3-BENZENEDIMETHANOL
CAS:18237-75-7
Formula: C11H16O2
KIN02070115
2,4,5-TRIMETHYL-1,3-BENZENEDISULFONIC ACID
CAS:81212-01-3
Formula: C9H12O6S2
KIN02648506
2,4,5-TRIMETHYL-1,3-DITHIOLANE-2-CARBALDEHYDE O-(METHYLCARBAMOYL)OXIME
CAS:33160-78-0
Formula: C9H16N2O2S2
KIN02203080
2,4,5-TRIMETHYL-1,5-HEXANEDIOL
CAS:92340-76-6
Formula: C9H20O2
KIN02755702
2,4,5-TRIMETHYL-1,8-NAPHTHYRIDINE
CAS:19839-34-0
Formula: C11H12N2
KIN02085294
2,4,5-TRIMETHYL-1-(4-METHYLPHENYL)-1H-IMIDAZOLE
CAS:207505-84-8
Formula: C13H16N2
KIN03417408
2,4,5-TRIMETHYL-1-(4-METHYLPHENYL)-1H-IMIDAZOLE 3-OXIDE
CAS:172534-85-9
Formula: C13H16N2O
KIN03634119
2,4,5-TRIMETHYL-1-(BENZYL)-1H-IMIDAZOLE
CAS:69605-13-6
Formula: C13H16N2
KIN02571531
2,4,5-TRIMETHYL-1-(BENZYL)-1H-PYRROL-3-CARBALDEHYDE
CAS:1087611-39-9
Formula: C15H17NO
KIN05126522
2,4,5-TRIMETHYL-1-(BENZYL)-1H-PYRROL-3-CARBOXYLIC ACID
CAS:1018546-39-8
Formula: C15H17NO2
KIN05037839
2,4,5-TRIMETHYL-1-(TRIMETHYLSILYL)-1H-IMIDAZOLE
CAS:139261-06-6
KIN03251530
2,4,5-TRIMETHYL-1-PHENYL-1H-IMIDAZOLE
CAS:28030-93-5
Formula: C12H14N2
KIN02162616
2,4,5-TRIMETHYL-1-PHENYL-1H-PYRROL-3-CARBALDEHYDE
CAS:100710-49-4
KIN03017222
2,4,5-TRIMETHYL-1-PHENYL-1H-PYRROL-3-CARBOXYLIC ACID
CAS:1018298-71-9
Formula: C14H15NO2
KIN05036642
2,4,5-TRIMETHYL-1-PHENYL-1H-PYRROL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:3652-50-4
Formula: C11H17NO2
KIN01093269
2,4,5-TRIMETHYL-1-PIPERAZINECARBODITHIOIC ACID
CAS:26865-08-7
Formula: C8H16N2S2
KIN02151897
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-BUTANAMINE
CAS:325491-26-7
Formula: C10H19N3
KIN03495198
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-CARBONITRILE
CAS:412278-72-9
Formula: C7H9N3
KIN03570335
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-ETHANOL
CAS:26860-46-8
Formula: C8H14N2O
KIN02151797
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-HEXANAMINE
CAS:26860-50-4
Formula: C12H23N3
KIN02151799
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-PROPANAMINE
CAS:88933-46-4
Formula: C9H17N3
KIN02704540
2,4,5-TRIMETHYL-1H-IMIDAZOL-1-PROPANOL
CAS:97801-06-4
Formula: C9H16N2O
KIN02807822
2,4,5-TRIMETHYL-1H-IMIDAZOLE
CAS:822-93-5
Formula: C8H12
KIN01030670
2,4,5-TRIMETHYL-1H-IMIDAZOLE 3-OXIDE
CAS:29982-09-0
KIN02178265
2,4,5-TRIMETHYL-1H-IMIDAZOLE HCL
CAS:70807-89-5
Formula: C6H10N2.ClH
KIN02580039
2,4,5-TRIMETHYL-1H-PYRROL-3-ACETIC ACID ETHYL ESTER
CAS:104178-08-7
KIN03678518
2,4,5-TRIMETHYL-1H-PYRROL-3-ACETIC ACID METHYL ESTER
CAS:130602-63-0
KIN03667970
2,4,5-TRIMETHYL-1H-PYRROL-3-BUTANOL
CAS:69413-74-7
Formula: C11H19NO
KIN02570221
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBALDEHYDE
CAS:288089-52-1
Formula: C8H11NO
KIN03469662
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBONITRILE
CAS:26187-31-5
Formula: C8H10N2
KIN02146208
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXAMIDE
CAS:70451-29-5
Formula: C8H12N2O
KIN02577668
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID
CAS:34294-61-6
Formula: C8H11NO2
KIN02212920
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID ANHYDRIDE WITH ETHYL HYDROGEN CARBONATE
CAS:23529-49-9
KIN02120945
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID ANHYDRIDE WITH FORMIC ACID
CAS:30980-90-6
KIN02186186
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:2199-55-5
Formula: C12H17NO4
KIN01064610
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID METHYL ESTER
CAS:27093-37-4
Formula: C9H13NO2
KIN02153970
2,4,5-TRIMETHYL-1H-PYRROL-3-CARBOXYLIC ACID PHENYLMETHYL ESTER
CAS:27093-39-6
KIN02153972
2,4,5-TRIMETHYL-1H-PYRROL-3-PENTANOL
CAS:69366-58-1
Formula: C12H21NO
KIN02569786
2,4,5-TRIMETHYL-1H-PYRROL-3-PROPANOIC ACID
CAS:100132-26-1
Formula: C10H15NO2
KIN03028934
2,4,5-TRIMETHYL-1H-PYRROL-3-PROPANOIC ACID METHYL ESTER
CAS:53969-06-5
KIN02343119
2,4,5-TRIMETHYL-2,3,5-HEXATRIEN-1-OL
CAS:89524-89-0
Formula: C9H14O
KIN02713011
2,4,5-TRIMETHYL-2,3,5-HEXATRIEN-1-OL ACETATE
CAS:89524-97-0
Formula: C11H18O3
KIN02713014
2,4,5-TRIMETHYL-2,3-HEXADIENE
CAS:997-42-2
Formula: C5H9NO4.K
KIN01036225