Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

2,3-PENTANEDIONE 3-(O-METHYLOXIME)
CAS:138888-70-7
Formula: [C6H11NO2
KIN03249388
2,3-PENTANEDIONE, 2,3-DIOXIME
CAS:4775-87-5
Formula: C6H12N2O2
KIN01114464
2,3-PENTANEDIONE, 3-[(4-METHYLPHENYL)HYDRAZONE]
CAS:90251-33-5
Formula: C12H16N2O
KIN02724584
2,3-PENTANEDIONE, 3-HYDRAZONE
CAS:141939-94-8
Formula: C5H10N2O
KIN03262730
2,3-PENTANEDIONE, 4-(PROPYL-IMINO)-3-OXIME
CAS:143996-88-7
Formula: C8H14N2O2
KIN03273322
2,3-PENTANEDIONE, 4-[(BENZYL)IMINO]-3-OXIME
CAS:102826-92-6
Formula: C12H14N2O2
KIN03050147
2,3-PENTANEDIONE, BIS[(2,4-DINITROPHENYL)HYDRAZONE]
CAS:1180-60-5
Formula: C27H30O6
KIN01042310
2,3-PEROXY-2,3,5-TRIMETHYL-2H-FURO[3,2-G]CHROMEN-7(3H)-ONE
CAS:129812-24-4
Formula: C14H12O5
KIN03207460
2,3-PEROXY-2,3,6-TRIMETHYL-2H-FURO[3,2-H]CHROMEN-8(3H)-ONE
CAS:129833-00-7
Formula: C14H12O5
KIN03207600
2,3-PHENANTHRENEDIOL
CAS:605-78-7
Formula: C21H14O
KIN01021907
2,3-PHENAZINEDIYLBIS[PHENYL-METHANONE
CAS:65869-71-8
Formula: C26H16N2O2
KIN02533704
2,3-PHTHALAZINEDICARBOXIMIDE
CAS:4821-88-9
Formula: C10H10N2O3
KIN01115342
2,3-PHTHALOYLPYRROCOLINE
CAS:5649-79-6
Formula: C15H23N3O3
KIN01137794
2,3-PIPERAZINEDICARBOXYLIC ACID 2,3-DIMETHYL ESTER
CAS:98493-22-2
KIN02814407
2,3-PIPERAZINEDIOL
CAS:211620-43-8
Formula: C4H10N2O2
KIN03422940
2,3-PIPERAZINEDIONE
CAS:29990-68-9
Formula: C4H6N2O2
KIN02178345
2,3-PIPERIDINEDICARBOXYLIC ACID
CAS:17079-18-4
Formula: C7H11NO4
KIN02057966
MFCD09032959
2,3-PIPERIDINEDIONE 3-[(2-BROMO-5-METHOXY-PHENYL) HYDRAZONE]
CAS:26626-98-2
KIN02150037
2,3-PIPERIDINEDIONE 3-[2-(2-CHLOROPYRIDIN-3-YL)HYDRAZONE]
CAS:6506-96-3
Formula: C21H20O7
KIN01163874
2,3-PIPERIDINEDIONE 3-[2-[2-(1-HYDROXYETHYL) PHENYL]HYDRAZONE]
CAS:958-92-9
Formula: C17H21N
KIN01035415
2,3-PIPERIDINEDIONE 3-[2-[4-(1-OXO-PROPYL) PHENYL]HYDRAZONE]
CAS:3284-07-9
Formula: C36H30N2Si2
KIN01085963
2,3-PIPERIDINEDIONE, 3-[(2,5-DICHLOROPHENYL)HYDRAZONE]
CAS:5376-46-5
Formula: C11H8Cl2N2O
KIN01127965
2,3-PIPERIDINEDIONE, 3-[(2,5-DIMETHYLPHENYL)HYDRAZONE]
CAS:94850-62-1
Formula: C13H17N3O
KIN02786000
2,3-PIPERIDINEDIONE, 3-[(4-METHOXY-PHENYL) HYDRAZONE]
CAS:104742-98-5
Formula: C12H15N3O2
KIN03063606
2,3-PIPERIDINEDIONE, 3-[2-(2,5-DIFLUOROPHENYL)HYDRAZONE]
CAS:256353-69-2
KIN03622837
2,3-PIPERIDINEDIONE, 3-[2-(2-FLUOROPHENYL)HYDRAZONE]
CAS:173174-44-2
KIN03667974
2,3-PIPERIDINEDIONE, 3-[2-(4-ACETYLPHENYL)HYDRAZONE]
CAS:3283-93-0
KIN01085961
2,3-PIPERIDINEDIONE, 3-[2-(4-FLUOROPHENYL)HYDRAZONE]
CAS:721-60-8
Formula: C11H10F3NO
KIN01027365
2,3-PIPERIDINEDIONE, 3-[2-(4-IODO-PHENYL)HYDRAZONE]
CAS:91349-77-8
Formula: C11H12IN3O
KIN02742298
2,3-PIPERIDINEDIONE, 3-[2-(5-FLUORO-2-METHYLPHENYL)HYDRAZONE]
CAS:2264-80-4
Formula: C9H10ClFO2
KIN01066097
2,3-PIPERIDINEDIONE, 3-[2-PYRIDIN-3-YLHYDRAZONE]
CAS:46425-98-3
Formula: C10H12N4O
KIN02285887
2,3-PIPERIDINEDIONE, 3-[2-PYRIDIN-4-YLHYDRAZONE]
CAS:49837-10-7
Formula: C10H12N4O
KIN02290808
2,3-PIPERIDINEDIONE, 3-OXIME
CAS:53001-87-9
Formula: C5H8N2O2
KIN02328791
2,3-PROPAN-2-YLIDENE-D-GULONO-LACTONE
CAS:23843-32-5
Formula: C9H14O6
KIN02124049
2,3-PROPAN-2-YLIDENE-D-RIBONO-1,4-LACTONE
CAS:30275-00-9
KIN02180746
2,3-PROPAN-2-YLIDENEDIOXY-D-MANNONO-LACTONE
CAS:126354-67-4
Formula: C9H14O6
KIN03192633
2,3-PROPAN-2-YLIDENEGLYCEROL-1-PROPANOATE
CAS:129520-29-2
Formula: [C9H16O4
KIN03206176
2,3-PYRAZINEDIACETONITRILE
CAS:1142928-35-5
Formula: C8H6N4
KIN05191949
2,3-PYRAZINEDIAMINE
CAS:13134-31-1
Formula: C4H6N4
KIN02015251
MFCD07778385
2,3-PYRAZINEDIAMINE, 1-OXIDE
CAS:50441-74-2
KIN02293009
2,3-PYRAZINEDICARBALDEHYDE
CAS:194409-42-2
Formula: C6H4N2O2
KIN03398262
2,3-PYRAZINEDICARBONITRILE
CAS:13481-25-9
Formula: C6H2N4
KIN02020265
MFCD00059771
2,3-PYRAZINEDICARBONYL DICHLORIDE
CAS:52304-61-7
Formula: C6H2Cl2N2O2
KIN02319182
MFCD11617056
2,3-PYRAZINEDICARBONYL DICHLORIDE, POLYMER WITH1,1'-(1,3-PROPANEDIYL)BIS[PIPERAZINE]
CAS:55155-19-6
KIN02361733
2,3-PYRAZINEDICARBONYL DICHLORIDE, POLYMER WITH4,4'-(1,3-PROPANEDIYL)BIS[PIPERIDINE]
CAS:57062-12-1
KIN02393337
2,3-PYRAZINEDICARBONYL DICHLORIDE, POLYMER WITHTRANS-2,5-DIMETHYL-PIPERAZINE
CAS:52319-17-2
KIN02319375
2,3-PYRAZINEDICARBOXIMIDIC ACID 2,3-DIMETHYL ESTER
CAS:68572-99-6
Formula: C8H10N4O2
KIN02564347
2,3-PYRAZINEDICARBOXYLIC ACID 2,3-DIETHYL ESTER
CAS:2427-94-3
KIN01069285
2,3-PYRAZINEDICARBOXYLIC ACID 2,3-DIHYDRAZIDE
CAS:135691-54-2
KIN03233961
2,3-PYRAZINEDICARBOXYLIC ACID 2,3-DIMETHYL ESTER
CAS:6164-78-9
Formula: C6H6N4O2
KIN01151504
2,3-PYRAZINEDICARBOXYLIC ACID 2,3-DIPROPYL ESTER
CAS:73763-88-9
Formula: C12H16N2O4
KIN02600537
2,3-PYRAZINEDICARBOXYLIC ACID 2-(2-BENZOYLHYDRAZIDE)
CAS:1189247-94-6
Formula: C13H10N4O4
KIN05328722
2,3-PYRAZINEDICARBOXYLIC ACID 2-HYDRAZIDE
CAS:27145-47-7
KIN02154516
2,3-PYRAZINEDICARBOXYLIC ACID 2-METHYL ESTER
CAS:73763-86-7
Formula: C7H6N2O4
KIN02600535
2,3-PYRAZINEDICARBOXYLIC ACID BARIUM SALT
CAS:35984-57-7
Formula: C6H4N2O4.Ba
KIN02228005
2,3-PYRAZINEDICARBOXYLIC ACID DISODIUM SALT
CAS:61693-22-9
Formula: C6H4N2O4.2Na
KIN02459986
2,3-PYRAZINEDIMETHANOL
CAS:1092286-62-8
Formula: C6H8N2O2
KIN05132677
2,3-PYRAZINEDIMETHANOL, 1,4-DIOXIDE
CAS:38870-40-5
KIN02250942
2,3-PYRAZINEDIMETHANOL, 2,3-DIACETATE
CAS:38870-38-1
KIN02250940
2,3-PYRAZINEDIMETHANOL, 2,3-DIACETATE, 1,4-DIOXIDE
CAS:38870-39-2
KIN02250941
2,3-PYRAZINEDIOL
CAS:221303-71-5
KIN03436270
2,3-PYRIDINEDIACETIC ACID
CAS:1000544-44-4
Formula: C9H9NO4
KIN05002878
2,3-PYRIDINEDIACETONITRILE
CAS:1000513-45-0
Formula: C9H7N3
KIN05001437
2,3-PYRIDINEDIAMINE
CAS:452-61-9
Formula: C9H10
KIN01014958
2,3-PYRIDINEDICARBALDEHYDE
CAS:4663-94-9
Formula: C7H7N3O2
KIN01112245
2,3-PYRIDINEDICARBALDEHYDE, 1-OXIDE
CAS:18325-53-6
Formula: C7H5NO3
KIN02070916
2,3-PYRIDINEDICARBONITRILE
CAS:17132-78-4
Formula: C7H3N3
KIN02058560
MFCD00191682
2,3-PYRIDINEDICARBONITRILE, 1-OXIDE
CAS:188426-44-0
Formula: C7H3N3O
KIN03384808
2,3-PYRIDINEDICARBONYL DICHLORIDE
CAS:55155-23-2
KIN02361736
2,3-PYRIDINEDICARBONYL DICHLORIDE, POLYMER WITHTRANS-2,5-DIMETHYL-PIPERAZINE
CAS:55155-24-3
KIN02361737
2,3-PYRIDINEDICARBOXAMIDE
CAS:4663-95-0
Formula: C7H7N3O2
KIN01112246
2,3-PYRIDINEDICARBOXAMIDE, 1-OXIDE
CAS:38557-83-4
KIN02248818
Quinolinamide, 1-oxide
2,3-PYRIDINEDICARBOXYLIC ACID, 2-ETHYL ESTER
CAS:161522-42-5
Formula: C9H9NO4
KIN03329186
2,3-PYRIDINEDIMETHANOL
CAS:38070-79-0
Formula: C7H9NO2
KIN02245078
2,3-PYRIDINEDIMETHANOL, 2,3-DIACETATE
CAS:38070-56-3
Formula: C11H13NO4
KIN02245070
2,3-PYRIDINEDIMETHANOL, BIS(METHYLCARBAMATE)(ESTER)
CAS:52526-11-1
KIN02322294
2,3-PYRIDINEDIOL
CAS:84719-32-4
Formula: C5H5NO2
KIN02669498
MFCD00006271
2,3-PYRIDINEDIOL, 1-OXIDE
CAS:129999-94-6
Formula: C5H5NO3
KIN03208227
2,3-PYRIDINEDIOL, 2,3-DIACETATE
CAS:62920-55-2
Formula: C9H9NO4
KIN02482811
2,3-PYRIDINEDISULFENYL DICHLORIDE
CAS:1006873-63-7
Formula: C5H3Cl2NS2
KIN05013419
2,3-PYRIDINEDISULFONIC ACID
CAS:6602-54-6
Formula: C6H3ClN2
KIN01165801
2,3-PYRROLIDINEDICARBOXYLIC ACID
CAS:147235-95-8
Formula: C6H9NO4
KIN03285278
2,3-PYRROLIDINEDICARBOXYLIC ACID DIOCTYL ESTER
CAS:92687-44-0
Formula: C22H41NO4
KIN02760265
2,3-PYRROLIDINEDIONE
CAS:36069-76-8
Formula: C4H5NO2
KIN02228699
2,3-QUINOLINEDIAMINE
CAS:78105-39-2
Formula: C9H9N3
KIN02629344
2,3-QUINOLINEDICARBALDEHYDE
CAS:10222-53-4
Formula: C11H7NO2
KIN02003409
2,3-QUINOLINEDICARBALDEHYDE, 2,3-DIOXIME
CAS:32413-19-7
Formula: C11H9N3O2
KIN02196829
2,3-QUINOLINEDICARBONITRILE
CAS:119153-44-5
Formula: C11H5N3
KIN03157763
2,3-QUINOLINEDICARBOXAMIDE
CAS:129281-03-4
Formula: C11H9N3O2
KIN03205212
2,3-QUINOLINEDICARBOXYLIC ACID
CAS:643-43-6
Formula: C8H6N2O6
KIN01024186
2,3-QUINOLINEDICARBOXYLIC ACID DIETHYL ESTER 1-OXIDE
CAS:92525-68-3
Formula: C15H15NO5
KIN02757954
2,3-QUINOLINEDIMETHANOL
CAS:57032-14-1
Formula: C11H11NO2
KIN02392781
MFCD04972537
2,3-QUINOLINEDIMETHANOL, DIMETHANESULFONATE (ESTER)
CAS:56522-37-3
Formula: C13H15NO6S2
KIN02384273
2,3-QUINOXALINEDIACRYLIC ACID DIETHYL ESTER
CAS:3389-10-4
Formula: C12H18N2O
KIN01088219
2,3-QUINOXALINEDIAMINE
CAS:6640-49-9
Formula: C9H10N2O2
KIN01167684
2,3-QUINOXALINEDIAMINE, 1,4-DIOXIDE
CAS:32902-83-3
Formula: C8H8N4O2
KIN02200897
2,3-QUINOXALINEDICARBALDEHYDE
CAS:3138-80-5
Formula: C10H8N2S
KIN01083084
2,3-QUINOXALINEDICARBONITRILE
CAS:17132-92-2
Formula: C10H4N4
KIN02058561
2,3-QUINOXALINEDICARBONYL DICHLORIDE, POLYMERWITH TRANS-2,5-DIMETHYL-PIPERAZINE
CAS:55155-20-9
KIN02361734
2,3-QUINOXALINEDICARBOXYLIC ACID DISODIUM SALT
CAS:142352-14-5
Formula: C10H6N2O4.2Na
KIN03264763
2,3-QUINOXALINEDIMETHANOL
CAS:7065-98-7
Formula: C15H12N2O2
KIN01177981
2,3-QUINOXALINEDIMETHANOL DIACETATE
CAS:20128-12-5
Formula: C14H14N2O4
KIN02088395
2,3-QUINOXALINEDIMETHANOL, 1,4-DIOXIDE
CAS:17311-31-8
Formula: C10H10N2O4
KIN02060686
Dioxidine
MFCD00225753
2,3-QUINOXALINEDIOL, 1,4-DIOXIDE
CAS:68704-39-2
Formula: C8H6N2O4
KIN02565192
2,3-QUINOXALINEDIONE
CAS:63291-47-4
Formula: C8H4N2O2
KIN02489921
2,3-QUINOXALINEDITHIOL BENZENEMETHANAMINE SALT
CAS:73855-43-3
Formula: C15H15N3S2
KIN02601417
2,3-QUINOXALINEDITHIOL PYRROLIDINE SALT
CAS:73855-44-4
Formula: C12H15N3S2
KIN02601418
2,3-QUINOXALINEDITHIONE
CAS:86843-72-3
Formula: C8H4N2S2
KIN02682906
2,3-SECO-5-ANDROSTAN-17-ONE-2,3-DICARBOXYLIC ACID
CAS:1165-39-5
Formula: C17H12O7
KIN01042063
2,3-SECOANDROSTANE-2,3-DIOIC ACID
CAS:25532-38-1
Formula: C19H30O4
KIN02140667
2,3-SECOCHOLESTANE-2,3-DIOL
CAS:14124-56-2
Formula: C27H50O2
KIN02028495
2,3-TETRADECANEDIOL
CAS:88580-08-9
Formula: C14H30O2
KIN02700035
2,3-THIENEDIYLBIS[PHENYL-METHANONE
CAS:63599-99-5
Formula: C18H12O2S
KIN02495724
2,3-THIIRANEDIYLIDENETETRAKIS[PHENYL-METHANONE
CAS:63998-96-9
Formula: C30H20O4S
KIN02502686
2,3-THIOMORPHOLINEDIONE, 2-[O-[[METHYL(1-OXO-BUTYL) AMINO]CARBONYL]OXIME]
CAS:58536-87-1
Formula: C10H15N3O4S
KIN02417206
2,3-THIOMORPHOLINEDIONE, 2-[O-[[METHYL[(TRICHLOROMETHYL)THIO]AMINO]CARBONYL]OXIME]
CAS:58536-85-9
Formula: C7H8Cl3N3O3S2
KIN02417204
2,3-THIOMORPHOLINEDIONE, 2-OXIME
CAS:51546-48-6
Formula: C4H6N2O2S
KIN02308062
2,3-THIOPHENEDIACETONITRILE
CAS:38447-33-5
Formula: C8H6N2S
KIN02248077
2,3-THIOPHENEDIAMINE
CAS:78648-62-1
Formula: C4H6N2S
KIN02632868
2,3-THIOPHENEDICARBALDEHYDE
CAS:932-43-4
Formula: C9H18
KIN01034138
2,3-THIOPHENEDICARBALDEHYDE, 2,3-DIOXIME
CAS:41056-87-5
KIN02268293
2,3-THIOPHENEDICARBALDEHYDE, 2-OXIME
CAS:41057-08-3
KIN02268308
2,3-THIOPHENEDICARBALDEHYDE, 3-OXIME
CAS:41056-79-5
KIN02268286
2,3-THIOPHENEDICARBONITRILE
CAS:18853-42-4
Formula: C6H2N2S
KIN02075703
2,3-THIOPHENEDICARBONYL DICHLORIDE
CAS:63599-98-4
Formula: C6H2Cl2O2S
KIN02495723
2,3-THIOPHENEDICARBOXAMIDE
CAS:41056-96-6
KIN02268301
2,3-THIOPHENEDICARBOXYLIC ACID 2,3-DIMETHYL ESTER
CAS:14300-68-6
Formula: C8H8O4S
KIN02030443
MFCD06203890
2,3-THIOPHENEDICARBOXYLIC ACID 2-METHYL ESTER
CAS:115777-72-5
KIN03139019
2,3-THIOPHENEDICARBOXYLIC ACID 3-ETHYL ESTER
CAS:447422-55-1
KIN03589045
2,3-THIOPHENEDICARBOXYLIC ACID 3-METHYL ESTER
CAS:115777-73-6
Formula: C7H6O4S
KIN03139020
2,3-THIOPHENEDICARBOXYLIC ACID DIBUTYL ESTER
CAS:63068-91-7
Formula: C14H20O4S
KIN02485813
2,3-THIOPHENEDIMETHANOL
CAS:13250-85-6
KIN02017011
2,3-THIOPHENEDIOL, 1,1-DIOXIDE
CAS:89124-44-7
Formula: C4H4O4S
KIN02707364
2,3-THIOPHENEDIPROPANAL
CAS:343332-18-3
KIN03517523
2,3-THIOPHENEDIPROPANAMINE
CAS:1000547-44-3
Formula: C10H18N2S
KIN05003020
2,3-THIOPHENEDIPROPANOL
CAS:72326-83-1
Formula: C10H16O2S
KIN02590656
2,3-THIOPHENEDITHIOL
CAS:22511-29-1
KIN02111289
2,3-TRANS-3,4-CIS-2,4-DIPHENYL-3-P-(BETA-PYRROLIDIN-1-YLETHOXY) PHENYL-TETRAHYDROFURAN OXALATE
CAS:54282-47-2
Formula: C30H33NO6
KIN02347757
2,3-TRANS-3,4-CIS-4-CHLORO-3-FLAVANOL
CAS:13329-11-8
Formula: C15H13ClO2
KIN02018019
2,3-TRIDECANEDIONE
CAS:57644-91-4
Formula: C13H24O2
KIN02402883
2,3-TRIPHENYLENEDIAMINE
CAS:189014-58-2
Formula: C18H14N2
KIN03387126
2,3-TRIPHENYLENEDICARBALDEHYDE
CAS:110328-04-6
Formula: C20H12O2
KIN03100819
2,3-TRIPHENYLENEDICARBONITRILE
CAS:60387-50-0
Formula: C20H10N2
KIN02444020
2,3-Dicyanotriphenylene
2,3-TRIPHENYLENEDICARBOXYLIC ACID 2,3-DIMETHYL ESTER
CAS:42506-85-4
KIN02278998
2,3-XYLENOL, ALLOPHANATE
CAS:114166-23-3
Formula: C10H12N2O3
KIN03128971
2,3:11,12-DIDECALINO-16-CROWN-5
CAS:172883-29-3
Formula: C27H46O5
KIN03352133
2,3:11,12-DIDEEPOXY-2,3,11,12-TETRADEHYDRO-RHIZOXIN
CAS:103528-77-4
Formula: C35H47NO7
KIN03678608
2,3:4,5-BIS(1,2-NAPHTHO)-1,6,9,12,15,18,21-HEPTAOXACYCLOTRICOSA-2,4-DIENE
CAS:41024-79-7
Formula: C32H36O7
KIN02267978
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-1-THIO-D-XYLITOL
CAS:109748-21-2
Formula: C11H20O4S
KIN03678607
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-ARABINITOL
CAS:19139-74-3
Formula: C11H20O5
KIN02078343
2,3:4,5-Bis-o-(isopropylidene)-D-arabinitol
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-ARABINONIC ACID
CAS:30694-81-6
Formula: C11H18O6
KIN02184097
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-ARABINOSE
CAS:13039-93-5
Formula: C11H18O5
KIN02013862
D-2,3:4,5-di-o-Isopropylidene-arabinose; 2,3:4,5-D
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-ARABINOSE OXIME
CAS:32795-40-7
Formula: C11H19NO5
KIN02200011
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-LYXOSE
CAS:81801-10-7
Formula: C11H18O5
KIN02651819
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-RIBITOL
CAS:100484-23-9
Formula: C11H20O5
KIN03032178
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-RIBONIC ACID
CAS:145649-98-5
Formula: C11H18O6
KIN03021064
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-RIBOSE
CAS:50866-82-5
Formula: C11H18O5
KIN02298521
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-XYLITOL
CAS:30737-85-0
Formula: C11H20O5
KIN02184403
2,3:4,5-Bis-o-(1-methylethylidene)-D-xylitol
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-XYLOSE
CAS:13039-94-6
Formula: C11H18O5
KIN02013863
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-XYLOSE 1-HYDRATE
CAS:102804-13-7
Formula: C11H20O6
KIN03050026
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-D-XYLOSE OXIME
CAS:91422-64-9
Formula: C11H19NO5
KIN02743436
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-ARABINITOL
CAS:84709-35-3
Formula: C11H20O5
KIN02669416
2,3:4,5-Di-O-Isopropyliden-L-arabitol
MFCD00070332
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-ARABINONIC ACID
CAS:65758-70-5
Formula: C11H18O6
KIN02531982
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-ARABINONONITRILE
CAS:1004764-89-9
Formula: C11H17NO4
KIN05009848
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-ARABINOSE
CAS:23568-31-2
Formula: C11H18O5
KIN02121262
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-LYXOSE
CAS:120522-09-0
Formula: C11H18O5
KIN03164807
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-RIBOSE
CAS:120522-08-9
Formula: C11H18O5
KIN03164806
2,3:4,5-BIS-O-(1-METHYLETHYLIDENE)-L-XYLOSE
CAS:120522-10-3
Formula: C11H18O5
KIN03164808
2,3:4,5-BIS-O-(PHENYLMETHYLENE)-D-MANNITOL
CAS:35827-52-2
Formula: C20H22O6
KIN02226639
2,3:4,5-BIS-O-(PROPAN-2-YLIDENE)-D-MANNO-HEXODIALDOSE
CAS:280745-35-9
Formula: [C12H18O6
KIN03466805
2,3:4,5-BIS-O-(PROPAN-2-YLIDENE)-L-MANNO-HEXODIALDOSE
CAS:280745-38-2
Formula: [C12H18O6
KIN03466808
2,3:4,5-DI-O-BENZYLIDENE-(3R,4R)-DIHYDROXY-(2S,5S)-BIS(HYDROXYMETHYL)-PYRROLIDINE
CAS:111248-47-6
Formula: C20H21NO4
KIN03106670
2,3:4,5-DI-O-CYCLOHEXYLIDENE-6-O-(BENZYL)-D-MYO-INOSITOL (1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL CARBONATE
CAS:190513-83-8
Formula: C36H52O8
KIN03391164
2,3:4,5-DI-O-CYCLOHEXYLIDENE-D-MYO-INOSITOL 1-[(1R,2S,5R)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXYL CARBONATE]
CAS:153996-48-6
Formula: C29H46O8
KIN03307144
2,3:4,5-DI-O-ISOPROPYLIDENE-XYLOSE
CAS:3673-28-7
KIN01093685
2,3:4,5-DI-O-METHYLENE-D-MANNITOL
CAS:58525-56-7
Formula: C8H14O6
KIN02417006
2,3:4,5-DI-O-PROPAN-2-YLIDENE-1-O-VINYLBETA-D-FRUCTOPYRANOSE
CAS:127558-50-3
Formula: C14H22O6
KIN03197831
2,3:4,5-DI-O-PROPAN-2-YLIDENE-2-OXO-D-GLUCONIC ACID
CAS:32786-03-1
Formula: C12H18O7
KIN02199923
2,3:4,5-DI-O-PROPAN-2-YLIDENE-MANNITOL
CAS:92142-08-0
Formula: C21H35NO3
KIN02753364
2,3:4,5-DIANHYDRO-1,6-DIDEOXY-2-C-[7,12-DIHYDRO-11-HYDROXY-5-METHYL-4,7,12-TRIOXO-8-[2,3,6-TRIDEOXY-3-(DIMETHYLAMINO)-D-ARABINO-HEX-1-ENOPYRANOSYL]-10-[2,3,6-TRIDEOXY-3-(DIMETHYLAMINO)-5-C-HYDROXY-3-C-METHYL-BETA-D-RIBO-HEXOPYRANOSYL]-4H-ANTHRA[1,2-B]PYRAN-2-YL]-5-C-METHYL-HEXITOL
CAS:116988-29-5
Formula: C42H50N2O12
KIN03146834
2,3:4,5-DIANHYDRO-1,6-DIDEOXY-GALACTITOL
CAS:51065-35-1
Formula: C6H10O2
KIN02301126
2,3:4,5-DIANHYDRO-1,6-DIDEOXY-MANNITOL
CAS:51153-45-8
Formula: C6H10O2
KIN02302515
2,3:4,5-DIANHYDRO-6-DEOXY-GALACTONAMIDE
CAS:144300-05-0
Formula: C6H9NO3
KIN03275015
2,3:4,5-DIANHYDRO-6-DEOXY-IDONAMIDE
CAS:144221-95-4
Formula: C6H9NO3
KIN03274649
2,3:4,5-DIANHYDRO-D-IDITOL
CAS:20706-76-7
Formula: C6H10O4
KIN02093174
2,3:4,5-DIANHYDRO-L-IDITOL 1,6-DIMETHANESULFONATE
CAS:29171-77-5
Formula: C8H14O8S2
KIN02172040
2,3:4,6-BIS-O-(1-METHYLETHYLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (R)-ALPHA-METHYL-1-NAPHTHALENEMETHANAMINE
CAS:28301-01-1
KIN02164972
2,3:4,6-BIS-O-(1-METHYLETHYLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (S)-ALPHA-METHYL-1-NAPHTHALENEMETHANAMINE
CAS:28301-00-0
KIN02164971
2,3:4,6-BIS-O-(1-METHYLETHYLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH [R-(R*,R*)]-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL
CAS:28300-98-3
Formula: C12H18O7.C9H12N2O4
KIN02164969
2,3:4,6-BIS-O-(1-METHYLETHYLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH [S-(R*,R*)]-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL
CAS:28300-99-4
Formula: C12H18O7.C9H12N2O4
KIN02164970
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID
CAS:18467-77-1
Formula: C12H18O7
KIN02072279
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD WITH (S)-ALPHA-METHYLBENZENEMETHANAMINE
CAS:28300-97-2
KIN02164968
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (4AR,7AS)-TETRAHYDRO-6-(BENZYL)-1H-PYRROLO[3,4-B]PYRIDIN-5,7(2H,6H)-DIONE
CAS:313639-96-2
Formula: C14H16N2O2.C12H18O7
KIN03488398
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (4AS,7AR)-TETRAHYDRO-6-(BENZYL)-1H-PYRROLO[3,4-B]PYRIDIN-5,7(2H,6H)-DIONE
CAS:313639-97-3
Formula: C14H16N2O2.C12H18O7
KIN03488399
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (R)-1,2,3,4-TETRAHYDRO-6,7-DIMETHOXY-1-[3-METHOXY-4-(BENZYLOXY)PHENYL]ISOQUINOLINE
CAS:41396-22-9
Formula: C25H27NO4.C12H18O7
KIN02270846
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH (R)-ALPHA-METHYLBENZENEMETHANAMINE
CAS:28300-96-1
KIN02164967
2,3:4,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID COMPD. WITH 2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL
CAS:57849-19-1
KIN02406379
2,3:4,6-DI-O-PROPAN-2-YLIDEN-ALPHA-L-SORBOFURANOSE
CAS:17682-70-1
Formula: C12H20O6
KIN02064462
MFCD00132929
2,3:4,6-DI-O-PROPAN-2-YLIDENEMANNOPYRANOSYL BROMIDE
CAS:224778-46-5
Formula: C12H19BrO5
KIN03439696
2,3:5,6-BIS(HEXAMETHYLEN) -1,4-BENZOCHINON
CAS:33045-97-5
Formula: C18H24O2
KIN02202051
2,3:5,6-BIS-O-(1-METHYLETHYLIDENE)-4-THIO-D-MANNOSE
CAS:117299-83-9
KIN03148282
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-1-C-PYRIDIN-2-YL-BETA-L-GULOFURANOSE
CAS:51057-41-1
KIN02301015
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-D-MANNOFURANOSE 1-ACETATE
CAS:14440-57-4
Formula: C14H22O7
KIN02031975
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-ALPHA-D-MANNOFURANOSE 2-METHYLACRYLATE
CAS:28814-79-1
KIN02168980
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-D-GLUCOSE DIMETHYL ACETAL TOSYLATE
CAS:28441-61-4
Formula: C21H32O9S
KIN02166074
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-D-GULOSE OXIME
CAS:260441-81-4
KIN03458398
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-D-TALOFURANOSE BENZOATE
CAS:403604-98-8
Formula: C19H24O7
KIN03564297
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-L-GULOSE OXIME
CAS:420846-29-3
Formula: C12H21NO6
KIN03573989
2,3:5,6-BIS-O-(PROPAN-2-YLIDENE)-L-MANNOSE
CAS:84857-03-4
Formula: C12H20O6
KIN02670323
2,3:5,6-Bis-O-(isopropylidene)-L-mannose
2,3:5,6-DI-O-CYCLOHEXYLIDEN-D-MANNOLACTONE
CAS:40656-50-6
Formula: C18H26O6
KIN02264695
MFCD00142787
2,3:5,6-DI-O-PROPAN-2-YLIDEN-4-(4-METHOXYTETRAHYDROPYRAN-4-YL) MYO-INOSITOL
CAS:142795-23-1
Formula: C18H30O8
KIN03266721
2,3:5,6-DI-O-PROPAN-2-YLIDEN-D-MANNOFURANOSE)
CAS:78964-16-6
Formula: C12H20O6
KIN02634772
2,3:5,6-DI-O-PROPAN-2-YLIDEN-D-MANNONIC ACID 1,4-LACTONE
CAS:14440-56-3
Formula: C12H18O6
KIN02031974
MFCD09750738
2,3:5,6-DI-O-PROPAN-2-YLIDENE-4-O-(TERT-BUTYLDIMETHYLSILYL)-ALDEHYDO-D-GLUCOSE
CAS:102487-54-7
Formula: C18H34O6Si
KIN03047532
2,3:5,6-DI-O-PROPAN-2-YLIDENE-D-GULOFURANOSE
CAS:34685-42-2
KIN02216096
2,3:5,6-DI-O-PROPAN-2-YLIDENE-D-MANNOSE OXIME
CAS:35023-80-4
Formula: C12H21NO6
KIN02219078
2,3:5,6-DI-O-PROPAN-2-YLIDENE-L-GULOFURANOSE
CAS:137126-23-9
Formula: C12H20O6
KIN03240191
2,3:5,6-DIANHYDRO-D-ALLONAMIDE
CAS:157598-79-3
Formula: C6H9NO4
KIN03318445
2,3:5,6-DIANHYDRO-D-GLUCITOL
CAS:124379-07-3
Formula: C6H10O4
KIN03183703
2,3:5,6-DIEPOXY-7,8-DIOXA-BICYCLO[2.2.2]-OCTANE
CAS:56411-67-7
Formula: C6H6O4
KIN02382333
2,3:5,6-O-DIPROPAN-2-YLIDENE-4-O-(TERT-BUTYLDIMETHYLSILYL)-D-MYO-INOSITOL
CAS:151637-22-8
KIN03299983
2,3:6,7-BIS[1,3]BUTADIENO-BIPHENYLENE
CAS:258-57-1
Formula: C20H12N2
KIN01008384
2,3:6,7-DIPROPAN-2-YLIDEN-D-GLYCERO-D-GULOHEPTOSE
CAS:19285-94-0
Formula: C13H22O7
KIN02079940
2,3:7,8-DIBENZOTRICYCLO[4.4.1.01,6]UNDECAN-4,9-DIONE
CAS:111977-22-1
Formula: C19H14O2
KIN03111605
2,3:8,9-DIBENZOPERYLENE
CAS:198-10-7
Formula: C20H12O
KIN01007354
2,3A,4,4A,6,8-HEXAHYDRO-BENZO[1,2-C:5,4-C']DIPYRAZOL-3,5-DIONE
CAS:36412-15-4
KIN02231677
2,3A,4,5,5A,7-HEXAHYDRO-BENZO[2,1-C:3,4-C']DIPYRAZOL-3,6-DIONE
CAS:30196-40-8
KIN02180071
2,3A,4,5,6,7,8,9-OCTAHYDRO-3H-CYCLOOCTA[C]PYRAZOL-3-ONE
CAS:19462-64-7
Formula: C9H14N2O
KIN02081551
2,3A,4,5,6,7-HEXAHYDRO-2,3A-DIMETHYL-3H-INDAZOL-3-ONE
CAS:89209-30-3
Formula: C9H14N2O
KIN02708573
2,3A,4,5,6,7-HEXAHYDRO-2-(1-PHENYLETHYL)-3H-INDAZOL-3-ONE
CAS:3381-02-0
Formula: C9H14N2
KIN01088067
2,3A,4,5,6,7-HEXAHYDRO-2-PHENYL-3H-INDAZOL-3-ONE
CAS:16181-60-5
Formula: C13H14N2O
KIN02048604
2,3A,4,5,6,7-HEXAHYDRO-3A-HYDROXY-3H-INDAZOL-3-ONE
CAS:107398-92-5
Formula: C7H10N2O2
KIN03082445
2,3A,4,5,6,7-HEXAHYDRO-3H-INDAZOL-3-ONE
CAS:1587-15-1
Formula: C6H10O5
KIN01050867
2,3A,4,5-TETRAHYDRO-3H-BENZO[G]INDAZOL-3-ONE
CAS:116055-53-9
Formula: C11H10N2O
KIN03140625
2,3A,4,5-TETRAHYDRO-6,7,8-TRIMETHOXY-3H-BENZO[G]INDAZOL-3-ONE
CAS:57897-24-2
Formula: C14H16N2O4
KIN02407126
2,3A,4,5-TETRAHYDRO-6-(2-HYDROXY-4,6-DIMETHOXY-PHENYL) -4-(4-METHOXY-PHENYL)-3H-INDAZOL-3-ONE
CAS:111570-61-7
Formula: C22H22N2O5
KIN03108657
2,3A,4,5-TETRAHYDRO-6-(2-HYDROXY-4,6-DIMETHOXY-PHENYL) -4-[4-METHOXY-3-(BENZYLOXY)PHENYL]-3H-INDAZOL-3-ONE
CAS:111570-65-1
Formula: C29H28N2O6
KIN03108660
2,3A,4,5-TETRAHYDRO-6-(2-HYDROXY-4-METHOXY-PHENYL) -4-(4-METHOXY-PHENYL)-3H-INDAZOL-3-ONE
CAS:101986-21-4
Formula: C21H20N2O4
KIN03043484
2,3A,4,5-TETRAHYDRO-6-(2-HYDROXY-4-METHOXY-PHENYL) -4-PHENYL-3H-INDAZOL-3-ONE
CAS:101986-20-3
Formula: C20H18N2O3
KIN03043483
2,3A,4,5-TETRAHYDRO-7,8-DIMETHOXY-3H-BENZO[G]INDAZOL-3-ONE
CAS:57595-78-5
Formula: C13H14N2O3
KIN02402076
2,3A,4,5-TETRAHYDRO-7-METHOXY-3-METHYL-1H-BENZO[E]PHOSPHINDOLE, 3-OXIDE
CAS:344307-01-3
Formula: C14H17O2P
KIN03519599
2,3A,4,5-TETRAHYDRO-7-METHOXY-3H-BENZO[G]INDAZOL-3-ONE
CAS:57595-82-1
Formula: C12H12N2O2
KIN02402077
2,3A,4,6,7A,8-HEXAHYDRO-BENZO[1,2-C:4,5-C']DIPYRAZOL-3,7-DIONE
CAS:30196-38-4
KIN02180070
2,3A,4,6-TETRAHYDRO-3A-METHYL-2-PHENYL-3H-THIENO[3,4-C]PYRAZOL-3-ONE 5-OXIDE
CAS:33168-95-5
KIN02203181
2,3A,4,6-TETRAHYDRO-3H-THIENO[3,4-C]PYRAZOL-3-ONE
CAS:53826-90-7
KIN02341046
2,3A,5,7-TETRAETHOXYHEXAHYDRO-2,5-METHANO-2H-FURO[3,2-B]PYRAN
CAS:17982-33-1
Formula: C16H28O6
KIN02067644
2,3A,5-TRIPHENYL-3,3A-DIHYDROPYRAZOLO[1,5-A]QUINOLINE
CAS:27241-23-2
Formula: C29H22N2
KIN02155437
2,3A-DIHYDRO-3H-FURO[3,4-C]PYRAZOL-4,6-DIONE
CAS:5677-75-8
KIN01138717
2,3A-DIHYDRO-4,6-BIS(TRIFLUOROMETHYL)-3H-PYRAZOLO[3,4-B]PYRIDIN-3-ONE
CAS:380627-09-8
Formula: C8H3F6N3O
KIN03549434
2,3A-DIHYDRO-6-(5-METHOXY-2,3-DIPHENYLBENZOFURAN-6-YL) -4-METHYL-2-PHENYL-3H-PYRAZOLO[3,4-B]PYRIDIN-3-ONE
CAS:118825-65-3
KIN03156248
2,3A-DIHYDROXY-3-(4-METHYLBENZOYL)-1H-PYRROLO[2,1-C][1,4]BENZOXAZIN-1,4(3AH)-DIONE
CAS:152034-45-2
Formula: C19H13NO6
KIN03301031
2,3A-DIPHENYLPYRANO[2,3-D]THIAZOLE
CAS:86223-88-3
Formula: C18H13NOS
KIN02679087
2,3BETA,4,4ABETA,5,6-HEXAHYDRO-2,2,4BETA,6-TETRAMETHYL-1,3-METHANONAPHTHALEN-7(1BETAH)-ONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:24739-60-4
KIN02133421
2,3BETA,6,23-TETRAHYDROXYURS-24-OIC ACID METHYL ESTER
CAS:55517-91-4
KIN02367826
2,3DIHYDRO-5-NITRO-6-P-TOLYL-IMIDAZO[2,1-B]THIAZOLE
CAS:106636-50-4
Formula: [C12H11N3O2S
KIN03077566
2,3T-DIPHENYLACRYLIC ACID PHENYL ESTER
CAS:32175-23-8
Formula: C21H16O2
KIN02194848
2,4 - DICHLORO-8- METHYL - 2 - PHENYL -4- QUINOLINE, CARBOXYLIC ACID
CAS:355421-43-1
Formula: C23H15Cl2NO2
KIN03532606
2,4 -DIFLUORO-4,5-DIHYDROXY-BIPHENYL-3-CARBOXYLIC ACID
CAS:138473-86-6
Formula: C13H8F2O4
KIN03246967
2,4 DIFLUOROPHENYLBORONIC ACID
CAS:44025-03-8
KIN02283640
2,4',5-TRIBROMO-BIPHENYL
CAS:59080-36-3
Formula: C12H7Br3
KIN02425867
2,4',5-TRICHLORO-3'-(METHYLSULFONYL)-BIPHENYL
CAS:66640-71-9
Formula: C13H9Cl3O2S
KIN02544347
2,4',5-TRICHLORO-3'-METHYL-BIPHENYL
CAS:59403-62-2
Formula: C13H9Cl3
KIN02431083
2,4',5-TRICHLORO-3-(METHYLSULFONYL)-BIPHENYL
CAS:66640-62-8
Formula: C13H9Cl3O2S
KIN02544342
2,4',5-TRICHLORO-3-METHOXY-BIPHENYL
CAS:60082-91-9
Formula: C13H9Cl3O
KIN02441486
2,4',5-TRICHLORO-4-METHOXY-BIPHENYL
CAS:60082-92-0
Formula: C13H9Cl3O
KIN02441487
2,4',5-TRICHLORO-BIPHENYL
CAS:16606-02-3
Formula: C12H7Cl3
KIN02053095
MFCD00078742
2,4',5-TRIETHOXY-4-BIPHENYLDIAZOSULFONIC ACID COMPD. WITH 3-DIBENZO[B]FURANAMINE
CAS:1873-07-0
KIN01057826
2,4',5-TRIETHYL-BIPHENYL
CAS:152463-74-6
KIN03302177
2,4',5-TRIFLUORO-BIPHENYL
CAS:41860-55-3
Formula: C12H7F3
KIN02274005
2,4',5-TRIMETHOXY-BIPHENYL
CAS:66731-04-2
KIN02545159
2,4',5-TRIMETHYL-6-NITROSO-BIPHENYL-3-OL
CAS:69688-89-7
KIN02572105
2,4',5-TRIMETHYL-BIPHENYL
CAS:33954-03-9
Formula: C15H16
KIN02210131
2,4',5-TRIMETHYL-BIPHENYL-4-CARBALDEHYDE
CAS:111221-66-0
Formula: C16H16O
KIN03106458
2,4',6-TRIBROMO-BIPHENYL
CAS:64258-03-3
Formula: C12H7Br3
KIN02506861
2,4',6-TRICHLORO-BIPHENYL
CAS:38444-77-8
Formula: C12H7Cl3
KIN02248046
2,4',6-TRIMETHOXY-BIPHENYL
CAS:54960-98-4
Formula: C15H16O3
KIN02358283
2,4',6-TRIMETHYL-1,1'-BIPHENYL
CAS:76708-76-4
Formula: C15H16
KIN02621059
2,4',6-TRINITRO-BIPHENYL
CAS:22001-00-9
Formula: C12H7N3O6
KIN02106274
2,4'-(ETHANE-1,2-DIYL)BIS(METHOXY-BENZENE)
CAS:108840-09-1
Formula: C16H18O2
KIN03091666
2,4'-BI-1H-IMIDAZOLE
CAS:144648-45-3
Formula: C6H6N4
KIN03276647
2,4'-BI-PYRIDINE
CAS:581-49-7
Formula: C10H12N2
KIN01020668
2,4'-BINAPHTHALEN-1,1'-DIOL
CAS:36378-05-9
Formula: C20H14O2
KIN02231416
2,4'-BIPYRIDINE-6-CARBOXIMIDAMIDE HCL
CAS:1179359-76-2
Formula: C11H10N4.ClH;C11H11ClN4
KIN05284542
2,4'-BIS(1-METHYLETHYL)-BIPHENYL
CAS:61434-45-5
Formula: C18H22
KIN02455962
2,4'-BIS(BENZYLOXY) -3'-IODO-6'-(METHOXYMETHOXY)-ACETOPHENONE
CAS:321569-81-7
Formula: C24H23IO5
KIN03493149
2,4'-BIS(METHOXYMETHYL) -BIPHENYL
CAS:180092-92-6
KIN03368477
2,4'-BIS(PHENYLTHIO)-BIPHENYL
CAS:92050-38-9
Formula: C24H18S2
KIN02752295
2,4'-BIS(TERT-BUTYL)-BIPHENYL
CAS:76783-54-5
Formula: C20H26
KIN02621447
2,4'-BIS(TETRAHYDROPYRAN-2-YLOXY) -ACETOPHENONE
CAS:136258-01-0
Formula: C18H24O5
KIN03236122
2,4'-BIS-METHOXYMETHOXY-3,4-METHYLENEDIOXY-TRANS-CHALCONE
CAS:111413-79-7
Formula: C20H20O7
KIN03107655
2,4'-DI-O-ACETYL-4'-O-ISOVALERYLTYLOSIN
CAS:122825-65-4
Formula: C55H89NO20
KIN03176843
2,4'-DI-O-ACETYLCLARITHROMYCIN
CAS:152235-55-7
Formula: C42H73NO15
KIN03301474
2,4'-DIACETOXY-BIPHENYL
CAS:111625-10-6
Formula: C16H14O4
KIN03109007
2,4'-DIAMINO-3'-HYDROXY-ACETOPHENONE
CAS:106782-25-6
Formula: C8H10N2O2
KIN03078495
2,4'-DIAMINO-5-CHLOROBENZOPHENONE
CAS:3025-14-7
KIN01081072
2,4'-DIAMINO-BIPHENYL-4-SULFONIC ACID
CAS:69938-59-6
Formula: C12H12N2O3S
KIN02574007
2,4'-DIBENZYLOXY-3,4-DIMETHOXYCHALCONE
CAS:144632-78-0
Formula: C31H28O5
KIN03276553
2,4'-DIBROMO-3'-FLUOROPROPIOPHENONE
CAS:1122515-87-0
KIN05178372
2,4'-DIBROMO-ACETOPHENONE
CAS:99-75-2
Formula: C9H10O2
KIN01003283
2,4'-DIBROMO-BIPHENYL
CAS:49602-91-7
Formula: C12H8Br2
KIN02289040
2,4'-DIBROMOPROPIOPHENONE
CAS:38786-67-3
Formula: C9H8Br2O
KIN02250385
MFCD00209571
2,4'-DICHLOR-6'-HYDROXY-BUTYROPHENON
CAS:1133-36-4
KIN01040943
2,4'-DICHLORO(1-METHYLETHENYL)-BIPHENYL
CAS:65493-95-0
Formula: C15H12Cl2
KIN02527784
2,4'-DICHLORO-4-ETHYNYL-BIPHENYL
CAS:313511-03-4
Formula: C14H8Cl2
KIN03488139
2,4'-DICHLORO-ACETOPHENONE
CAS:937-21-3
Formula: C8H8O3
KIN01034440
2,4'-DICHLORO-BIPHENYL
CAS:34883-43-7
Formula: C12H8Cl2
KIN02217784
MFCD00152399
2,4'-DICHLORO-BIPHENYL LABELED WITH CARBON-14
CAS:52399-58-3
KIN02320597
2,4'-DICHLORO-BIPHENYL-14C
CAS:67729-49-1
KIN02557202
2,4'-DICHLORO-BIPHENYL-3-OL
CAS:79881-38-2
Formula: C12H8Cl2O
KIN02640440
2,4'-DICHLORO-BIPHENYL-4-OL
CAS:53905-32-1
Formula: C12H8Cl2O
KIN02342123
2,4'-DICHLORO-BIPHENYL-4-OL 4-ACETATE
CAS:54519-30-1
Formula: C14H10Cl2O2
KIN02351211
2,4'-DICHLORO-BIPHENYL-4-YLAMINE
CAS:138588-57-5
Formula: C12H9Cl2N
KIN03247674
2,4'-DICHLORO-DIMETHOXY-BIPHENYL
CAS:65493-88-1
Formula: C14H12Cl2O2
KIN02527781
2,4'-DICHLORO-ETHENYL-BIPHENYL
CAS:65493-79-0
Formula: C14H10Cl2
KIN02527779
2,4'-DICHLOROBENZAMIL HCL
CAS:2088-71-3
Formula: C26H32O3
KIN01062428
2,4'-DICHLOROBENZOPHENONE
CAS:85-30-3
Formula: C10H13N5O5
KIN01001993
2,4'-DICHLOROMETHOXY-BIPHENYL
CAS:65493-90-5
Formula: C13H10Cl2O
KIN02527783
2,4'-DICHLOROMETHOXY-PROPYL-BIPHENYL
CAS:65493-77-8
Formula: C16H16Cl2O
KIN02527778
2,4'-DICHLOROMETHOXYDIPROPYL-BIPHENYL
CAS:65493-86-9
Formula: C19H22Cl2O
KIN02527780
2,4'-DICHLOROTRIMETHOXY-BIPHENYL
CAS:65493-89-2
Formula: C15H14Cl2O3
KIN02527782
2,4'-DIETHOXY-4-DIETHYLAMINOBENZOPHENONE
CAS:119923-02-3
Formula: C21H27NO3
KIN03161370
2,4'-DIETHYL-BIPHENYL
CAS:13049-37-1
Formula: C16H18
KIN02013996
2,4'-DIFLUORO-1'-ACETONAPHTHONE
CAS:316-00-7
Formula: C12H6F2N2O4
KIN01010020
2,4'-DIFLUORO-1'-ACETONAPHTHONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:439-52-1
Formula: C16H20FNO.ClH
KIN01014546
2,4'-DIFLUORO-4-(1-METHYLETHENYL)-BIPHENYL
CAS:55258-84-9
KIN02363384
2,4'-DIFLUORO-4-(1-METHYLETHYL)-BIPHENYL
CAS:55258-61-2
KIN02363370
2,4'-DIFLUORO-4-(2-CHLORO-ETHOXY) -BIPHENYL
CAS:131612-88-9
Formula: C14H11ClF2O
KIN03214934
2,4'-DIFLUORO-4-PROPYL-BIPHENYL
CAS:147072-32-0
KIN03284719
2,4'-DIFLUORO-ACETOPHENONE
CAS:369-42-6
KIN01012337
2,4'-DIFLUORO-BIPHENYL
CAS:2285-29-2
Formula: C12H8F2
KIN01066466
2,4'-DIFLUORO-BIPHENYL-4-ACETIC ACID
CAS:53591-85-8
KIN02337503
2,4'-DIFLUORO-BIPHENYL-4-CARBOXYLIC ACID METHYL ESTER
CAS:268746-75-4
Formula: C14H10F2O2
KIN03463329
2,4'-DIFLUORO-BIPHENYL-4-OL
CAS:349665-92-5
Formula: C12H8F2O
KIN03527258
2,4'-DIFLUOROBENZOPHENONE
CAS:342-27-8
KIN01011049
2,4'-DIHYDROXY-3'-((2-HYDROXY-PHENYL) -(1-PIPERIDIN-1-YL)METHYL)-6'-METHOXY-ACETOPHENONE
CAS:102104-07-4
Formula: C21H25NO5
KIN03044425
2,4'-DIHYDROXY-3,3'-DIMETHOXY-5-(3-HYDROXY-PROPYL) STILBENE
CAS:15429-94-4
Formula: C19H22O5
KIN02041375
2,4'-DIHYDROXY-4,6-DIMETHOXY-2'-METHYLBENZOPHENONE
CAS:4650-79-7
Formula: C20H34O6
KIN01111966
2,4'-DIHYDROXY-4,6-DIMETHOXYDIHYDROCHALCONE
CAS:151752-07-7
Formula: C17H18O5
KIN03300356
2,4'-DIHYDROXY-4-METHYLBENZOPHENONE
CAS:107410-05-9
Formula: C14H12O3
KIN03082540
2,4'-DIHYDROXY-6'-METHOXY-5-METHYL-SPIRO[CYCLOPENT-4-EN-1,1'(3'H)-ISOBENZOFURAN]-3,3'-DIONE
CAS:130838-22-1
Formula: C14H12O6
KIN03211748
2,4'-DIHYDROXY-ACETOPHENONE
CAS:5706-86-5
Formula: C26H25NO2
KIN01139633
2,4'-DIHYDROXY-BENZOPHENONE
CAS:606-13-3
Formula: C9H11NO3
KIN01021932
2,4'-DIHYDROXY-BIPHENYL-3,3'-DICARBOXYLIC ACID
CAS:4445-58-3
Formula: C14H10O4
KIN01108229
2,4'-DIIODO-BIPHENYL
CAS:36262-74-5
Formula: C12H8I2
KIN02230366
2,4'-DIISOCYANATO-BIPHENYL
CAS:46881-07-6
Formula: C14H8N2O2
KIN02286511
2,4'-DIMETHOXY-3,3'-BIPYRIDINE
CAS:142929-21-3
Formula: C12H12N2O2
KIN03267357
2,4'-DIMETHOXY-4-METHYLDIPHENYL ETHER
CAS:23990-91-2
Formula: C15H16O3
KIN02125723
2,4'-DIMETHOXY-5-NITRODIPHENYL ETHER
CAS:14064-92-7
Formula: C14H13NO5
KIN02027825
2,4'-DIMETHOXY-BIPHENYL
CAS:49602-47-3
Formula: C14H14O2
KIN02289002
2,4'-DIMETHOXY-BIPHENYL-4-YLAMINE
CAS:1177096-13-7
KIN05270599
2,4'-DIMETHOXY-PHENYL-4-(2'-THIENYL)-4-OXO-BUTYRAMIDE
CAS:371149-33-6
Formula: C16H17NO4S
KIN03542712
2,4'-DIMETHYL-[4,5'-BITHIAZOL]-2'-AMINE
CAS:1082465-16-4
Formula: C8H9N3S2
KIN05120430
2,4'-DIMETHYL-2'-PHENYL-4,5'-BITHIAZOLE
CAS:61108-25-6
Formula: C14H12N2S2
KIN02451049
2,4'-DIMETHYL-4,5'-BITHIAZOLE
CAS:89977-41-3
Formula: C8H8N2S2
KIN02720200
2,4'-DIMETHYL-5-(1-METHYLETHYL)-BIPHENYL
CAS:71522-80-0
KIN02584940
2,4'-DIMETHYL-5-NITRO-BIPHENYL
CAS:70689-97-3
KIN02579190
2,4'-DIMETHYL-6-NITRO-BIPHENYL
CAS:79242-77-6
KIN02636427
2,4'-DIMETHYL-BIPHENYL
CAS:611-62-1
Formula: C12H10O2
KIN01022292
2,4'-DIMETHYL-BIPHENYL-3,5-DICARBALDEHYDE
CAS:116470-55-4
Formula: C16H14O2
KIN03143867
2,4'-DIMETHYL-BIPHENYL-3,5-DIMETHANOL
CAS:116470-58-7
KIN03143868
2,4'-DIMETHYL-DEOXY-BENZOIN
CAS:4779-67-3
KIN01114540
2,4'-DIMETHYLBENZOPHENONE, OXIME
CAS:108714-80-3
Formula: C15H15NO
KIN03090720
2,4'-DINITRO-BIPHENYL
CAS:606-82-6
KIN01021975
2,4'-DINITRO-BIPHENYL-2-OL
CAS:106961-16-4
Formula: C12H8N2O5
KIN03080014
2,4'-DINITROBIPHENYL-4-YL METHYL ETHER
CAS:86111-48-0
Formula: C13H10N2O5
KIN02678424
2,4'-DINITROPHENYL 3,4,6-TRI-O-ACETYL-2-DEOXY-2-FLUORO-BETA-D-GLUCOPYRANOSIDE
CAS:111524-65-3
Formula: C18H19FN2O12
KIN03108402
2,4'-O-BIS(TERT-BUTYLDIMETHYLSILYL)-6'-HYDROXY-ACETOPHENONE
CAS:108956-90-7
Formula: C20H36O4Si2
KIN03092345
2,4'-OXY-DI-BENZOYL CHLORIDE
CAS:37407-17-3
Formula: C14H8Cl2O3
KIN02239037
2,4'-OXYDI-PHENYLBORONIC ACID
CAS:19027-12-4
KIN02077297
2,4(1H)-IMIDAZOLIDINEDIONE
CAS:461-73-4
Formula: C7H11F3O2
KIN01015390
2,4(1H)-IMIDAZOLIDINEDIONE, 3-[3-[4-(DIPHENYLMETHYL)PIPERAZIN-1-YL]PROPYL]-5-PHENYL-,
CAS:109758-03-4
Formula: C29H32N4O2
KIN03097206
2,4(1H)-IMIDAZOLIDINEDIONE, ION(I)
CAS:133476-09-2
Formula: C3H3N2O2
KIN03223720
2,4(1H)-IMIDAZOLIDINEDIONE, MONOPOTASSIUM SALT
CAS:98634-73-2
Formula: C3H4N2O2.K
KIN02815525
2,4(1H)-IMIDAZOLIDINEDIONE, MONOSILVER(I) SALT
CAS:115399-80-9
Formula: C3H4N2O2.Ag
KIN03137013
2,4(1H)-IMIDAZOLIDINEDITHIONE
CAS:5789-21-9
Formula: C11H12N2O2S
KIN01141758
2,4(1H,3H)-PTERIDINEDIONE
CAS:27899-40-7
KIN02161449
2,4(1H,3H)-PTERIDINEDIONE, HYDRATE (1:1)
CAS:1087725-68-5
KIN05126735
2,4(1H,3H)-PTERIDINEDIONE, HYDRATE (2:3)
CAS:35864-96-1
KIN02226941
2,4(1H,3H)-PTERIDINEDITHIONE
CAS:54058-49-0
Formula: C6H4N4S2
KIN02344523
2,4(1H,3H)-PYRIDINEDIONE
CAS:50607-28-8
Formula: C5H5NO2
KIN02295072
2,4(1H,3H)-PYRIMIDINEDIONE, 1-[(5R,6R,8R,9R)-4-AMINO-9-[[(TERT-BUTYL)DIMETHYLSILYL]OXY]-6-[[[(TERT-BUTYL)DIMETHYLSILYL]OXY]METHYL]-2,2-DIOXIDO-1,7-DIOXA-2-THIASPIRO[4.4]NON-3-EN-8-YL]-5-METHYL-3-(3-METHYLBUT-2-EN-1-YL)-,
CAS:142102-82-7
Formula: C29H51N3O8SSi2
KIN03263629
2,4(1H,3H)-PYRIMIDINEDIONE, 4-(O-PHOSPHONOOXIME)
CAS:76137-59-2
Formula: C4H6N3O5P
KIN02617147
2,4(1H,3H)-PYRIMIDINEDIONE, 4-[(1,2-DIHYDRO-2-OXO-PYRIMIDIN-4-YL)HYDRAZONE]
CAS:3310-43-8
Formula: C6H3N3O7.C4H6N4O
KIN01086530
2,4(1H,3H)-PYRIMIDINEDIONE, COMPD. WITH 1H-PURIN-6-YLAMINE
CAS:26933-21-1
KIN02152534
2,4(1H,3H)-PYRIMIDINEDIONE, COMPD. WITH 9H-PURIN-2,6-DIAMINE (2:1)
CAS:17638-18-5
KIN02063991
2,4(1H,3H)-PYRIMIDINEDIONE, COMPD. WITH 9H-PURIN-6-YLAMINE (2:1)
CAS:17638-19-6
KIN02063992
2,4(1H,3H)-PYRIMIDINEDIONE, DIMER
CAS:28806-15-7
Formula: (C4H4N2O2)2
KIN02168932
2,4(1H,3H)-PYRIMIDINEDIONE, LABELED WITH TRITIUM
CAS:16908-84-2
Formula: C4H4N2O2
KIN02056233
2,4(1H,3H)-PYRIMIDINEDIONE, MONOPOTASSIUM SALT
CAS:79069-71-9
Formula: C4H4N2O2.K
KIN02635429
2,4(1H,3H)-PYRIMIDINEDIONE, MONOSODIUM SALT
CAS:42563-71-3
Formula: C4H4N2O2.Na
KIN02279418
2,4(1H,3H)-PYRIMIDINEDIONE, PHOSPHATE
CAS:72758-50-0
Formula: C4H7N2O6P
KIN02593561
2,4(1H,3H)-PYRIMIDINEDIONE, SILVER(I) SALT
CAS:16751-42-1
Formula: C4H4N2O2.Ag
KIN02054553
2,4(1H,3H)-PYRIMIDINEDIONE, SODIUM SALT
CAS:53006-96-5
Formula: C4H4N2O2.xNa
KIN02328914
2,4(1H,3H)-PYRIMIDINEDIONE-6-D
CAS:24897-51-6
Formula: C4H3DN2O2
KIN02134848
2,4(1H,3H)-PYRIMIDINEDISELONE
CAS:10443-86-4
Formula: C4H4N2Se2
KIN02006455
2,4(1H,3H)-PYRIMIDINEDITHIONE, DISODIUM SALT
CAS:60117-94-4
Formula: C4H4N2S2.2Na
KIN02441767
2,4(1H,3H)-PYRIMIDINEDITHIONE, PALLADIUM(II) SALT (2:1)
CAS:48167-77-7
Formula: C4H4N2S2.1/2Pd
KIN02288336
2,4(1H,3H)-QUINAZOLINEDIONE
CAS:86-97-5
Formula: C10H9NO
KIN01002135
2,4(1H,3H)-QUINAZOLINEDIONE, 3-ETHYL-6-METHOXY-2-HYDRAZONE
CAS:132407-49-9
Formula: C11H14N4O2
KIN03218670
2,4(1H,3H)-QUINAZOLINEDIONE, 6-BROMO-3-(BENZYL)-2-HYDRAZONE
CAS:305804-86-8
Formula: C15H13BrN4O
KIN03481933
2,4(1H,3H)-QUINAZOLINEDIONE, 7-CHLORO-3-METHYL-2-HYDRAZONE
CAS:132407-47-7
Formula: C9H9ClN4O
KIN03218669
2,4(1H,3H)-QUINAZOLINEDIONE, SODIUM SALT
CAS:66868-15-3
Formula: C8H6N2O2.na
KIN02546381
2,4(1H,3H)-QUINAZOLINEDITHIONE
CAS:5993-70-4
Formula: C13H15N3S2
KIN01146906
2,4(1H,3H)-QUINOLINEDIONE
CAS:52851-41-9
Formula: C9H7NO2
KIN02326808
2,4(1H,3H)-QUINOLINEDIONE, 7-METHOXY-1,3,3-TRIMETHYL
CAS:53207-47-9
Formula: C13H15NO3
KIN02331722
2,4(2,6 OR 3,5)-DIMETHYLBENZENEMETHANOL
CAS:86189-28-8
KIN02678890
2,4(2,6 OR 3,5)-DIMETHYLBENZOIC ACID
CAS:1110705-90-2
Formula: C9H10O2
KIN05172607
2,4(3H,5H)-PYRIDINEDIONE
CAS:59969-37-8
Formula: C5H5NO2
KIN02440264
2,4(3H,5H)-PYRIMIDINEDIONE
CAS:4433-24-3
KIN01107801
2,4(3H,5H)-THIOPHENEDIONE
CAS:51338-33-1
Formula: C4H4O2S
KIN02305179
2,4(OR 2,5)-DIMETHYL-NAPHTHO[1,8-BC]PYRAN-6,7-DIOL
CAS:109289-17-0
Formula: C14H12O3
KIN03006894
2,4(OR 3,5)-DIMETHYL-3-CYCLOHEXEN-1-CARBALDEHYDE
CAS:68737-61-1
Formula: C9H14O
KIN02565415
2,4(OR 4,6)-DIETHYL-6(OR 2)METHYL-3-AMINO-ANILINE
CAS:1027004-80-3
Formula: C11H18N2
KIN05061781
2,4(OR 4,6)-DIETHYL-6-METHYL-3-AMINO-ANILINE
CAS:144246-16-2
Formula: C11H18N2
KIN03274753
2,4(OR2,5)-DIMETHYLPHENOL
CAS:71975-58-1
Formula: C8H10O
KIN02588143
2,4,10,14-TETRAMETHYL-HEPTADECANE
CAS:185756-37-0
Formula: C21H44
KIN03380423
2,4,10,15,19,23-HEXAMETHYL-TETRACOSANE
CAS:90492-16-3
Formula: C30H62
KIN02728816
2,4,10-DODECATRIENE-6,8-DIYN-1-OL, 1-ACETATE
CAS:64185-63-3
Formula: C14H14O2
KIN02505712
2,4,10-TRIMETHYL-10H-PHENOTHIAZINE
CAS:1071162-61-2
KIN05111948
2,4,10-TRIMETHYLDODECANE
CAS:189380-74-3
Formula: C15H32
KIN03388942
2,4,10-TRIMETHYLPYRIMIDO[1,2-A]-1H-BENZO[D]IMIDAZOL-5-IUM PERCHLOROATE
CAS:57667-63-7
Formula: C13H14ClN3O4
KIN02403333
2,4,10-TRIOXA-BICYCLO[4.3.1]DECANE
CAS:142636-76-8
Formula: C7H12O3
KIN03265908
2,4,10-TRIOXATRICYCLO[3.3.1.13,7]DECAN-3-CARBONITRILE
CAS:93563-69-0
Formula: C8H9NO3
KIN02770686
2,4,10-TRIOXATRICYCLO[3.3.1.13,7]DECANE
CAS:281-33-4
Formula: C6H9O3P
KIN01009023
2,4,10BETA-TRICHLORO-17BETA-HYDROXYESRA-1,4-DIEN-3-ONE
CAS:116382-87-7
Formula: C18H21Cl3O2
KIN03143189
2,4,11,12,13,14,15,17-OCTAHYDRO-1H-CYCLOPENTA[A]PHENANTHRENE-3,16-DIONE
CAS:28527-83-5
Formula: C17H18O2
KIN02166769
2,4,13,15-TETRAOXA-8,9-DITHIAHEXADECANE
CAS:94537-89-0
Formula: C10H22O4S2
KIN02782905
2,4,16,18-NONADECANETETRONE
CAS:1595-34-2
Formula: C7H12S
KIN01051036
2,4,2',4'-TETRAHYDROXYCHALCONE
CAS:123702-96-5
Formula: C15H12O5
KIN03180742
2,4,2',4'-TETRANITRO-6-CARBOXY-6'-AMINOCARBOXYL-BIPHENYL
CAS:153341-03-8
Formula: [C14H7N5O12
KIN03304844
2,4,2',4'-TETRANITRO-BIPHENYL
CAS:1820-73-1
Formula: C5H11N3O3
KIN01056579
2,4,2'-TRIHYDROXY-6 ,6 -DIMETHYL-3'-PRENYLPYRANO[2 ,3 :4',5']CHALCONE
CAS:50773-29-0
Formula: C25H26O5
KIN02297282
2,4,2'-TRIS-(TRIFLUOROMETHYL)-BIPHENYL
CAS:176714-77-5
KIN03361242
2,4,2,4'-TETRAKIS(BENZYLOXY) -6'-BENZOYLOXY-3'-IODO-CHALCONE
CAS:321569-89-5
Formula: C50H39IO7
KIN03493151
2,4,2,4'-TETRAKIS(BENZYLOXY) -6'-HYDROXY-3'-IODO-CHALCONE
CAS:321569-86-2
Formula: C43H35IO6
KIN03493150
2,4,2,4'-TETRAMETHYL-STILBENE
CAS:28120-49-2
Formula: C18H20
KIN02163375
2,4,2,4'-TETRAPHENYL-BIPHENYL
CAS:34203-49-1
Formula: C36H26
KIN02212103
2,4,2,4,2,4,2,4'-OCTAMETHYL-5,5,5,5'-ETHANEDIYLIDENE-TETRAKIS-PYRROL-3-CARBOXYLIC ACID TETRAETHYL ESTER
CAS:120830-51-5
Formula: C38H50N4O8
KIN03166616
2,4,20-TRI-O-ACETYL-2,3'-DIDEHYDRO-2'-DEMETHOXY-4'-DEOXY-4'-OXOTYLOSIN 3,20-HEMIACETAL
CAS:121530-10-7
Formula: C51H77NO19
KIN03170143
2,4,3'-TRIHYDROXYDIPHENYL
CAS:4190-06-1
Formula: C8H12
KIN01102678
2,4,3'-TRINITRO-BIPHENYL
CAS:102873-32-5
Formula: [C12H7N3O6
KIN03050550
2,4,3,4'-TETRAMETHOXY-BIPHENYL
CAS:170649-97-5
Formula: C16H18O4
KIN03347074
2,4,3,5'-TETRAMETHOXY-DEOXY-BENZOIN
CAS:24082-46-0
Formula: C18H20O5
KIN02126698
2,4,3-BENZODIOXATHIEPIN-1,5-DIONE, 3-OXIDE
CAS:94149-26-5
Formula: C8H4O5S
KIN02778544
2,4,3-TRIHYDROXY-4-METHOXYCHALCONE
CAS:104236-79-5
Formula: C16H14O5
KIN03059855
2,4,4',5,5',8,8'-HEPTAHYDROXY-7,7'-DIMETHYL-[1,1'-BIANTHRACENE]-9,9',10,10'-TETRONE HEPTAACETATE
CAS:18701-02-5
KIN02074356
2,4,4',5,5'-PENTAHYDROXY-2',7-DIMETHYL-[9,9'-BIANTHRACENE]-10,10'(9H,9'H)-DIONE
CAS:17177-86-5
Formula: C30 H22 O7
KIN02059049
Palmidin C
2,4,4',5,5'-PENTAHYDROXY-7,7'-DIMETHYL-[1,1'-BIANTHRACENE]-9,9',10,10'-TETRONE PENTAACETATE
CAS:18701-03-6
KIN02074357
2,4,4',5-TETRACHLORO-2'-(METHYLSULFONYL)-BIPHENYL
CAS:104086-06-8
Formula: [C13H8Cl4O2S
KIN03058496
2,4,4',5-TETRACHLORO-BIPHENYL
CAS:32690-93-0
Formula: C12H6Cl4
KIN02199188
2,4,4',6-TETRABROMO-BIPHENYL
CAS:64258-02-2
Formula: C12H6Br4
KIN02506860
2,4,4',6-TETRABROMO-DIPHENYL ETHER
CAS:189084-63-7
Formula: [C12H6Br4O
KIN03387472
2,4,4',6-TETRACHLORO-BIPHENYL
CAS:32598-12-2
Formula: C12H6Cl4
KIN02198479
2,4,4',6-TETRAMETHYL-BIPHENYL
CAS:3976-69-0
Formula: C5H10O3
KIN01098895
2,4,4'-HYDROXYMETHANETRIYL-TRI-BENZOIC ACID
CAS:100698-65-5
Formula: C22H16O7
KIN03033979
2,4,4'-TRI-TERT-BUTYLBENZOPHENONE
CAS:139214-95-2
Formula: C25H34O
KIN03251304
2,4,4'-TRIBROMO-BIPHENYL
CAS:6430-91-7
KIN01162202
2,4,4'-TRIBROMO-DIPHENYL ETHER
CAS:41318-75-6
Formula: C12H7Br3O
KIN02270236
2,4,4'-TRICHLORO-2'-METHOXY-AZOBENZENE
CAS:20039-18-3
Formula: C13H9Cl3N2O
KIN02087539
2,4,4'-TRICHLORO-BIPHENYL
CAS:7012-38-6
Formula: C8H14Cl2O
KIN01176370
2,4,4'-TRICHLORO-BIPHENYL-3-CARBALDEHYDE
CAS:1175873-42-3
Formula: C13H7Cl3O;C13H7Cl3O
KIN05267891
2,4,4'-TRIFLUORO-3',5-DIMETHYL-BIPHENYL
CAS:394-78-5
Formula: C12H8F2O2
KIN01013311
2,4,4'-TRIFLUORO-5-NITROBIPHENYL
CAS:2339-53-9
Formula: C7H9FN2
KIN01067285
2,4,4'-TRIHYDROXY-BENZOPHENONE
CAS:1470-81-1
Formula: C4H6O6.Mg
KIN01047834
2,4,4'-TRIHYDROXYDIHYDROCHALCONE
CAS:15097-74-2
Formula: C15H14O4
KIN02038428
2,4,4'-TRIISOCYANATO-BIPHENYL
CAS:34958-68-4
Formula: C15H7N3O3
KIN02218510
2,4,4'-TRIMETHOXYCHALCONE
CAS:18493-34-0
Formula: C18H18O4
KIN02072479
2,4,4'-TRIMETHYL-[1,1'-BIPHENYL]-3-AMINE
CAS:83011-77-2
Formula: C15H17N
KIN02658834
2,4,4'-TRIMETHYL-1,1'-BIPHENYL
CAS:76708-79-7
Formula: C15H16
KIN02621062
2,4,4'-TRINITRO-2'-CARBOXY-BIPHENYL
CAS:63636-76-0
Formula: C13H7N3O8
KIN02496358
2,4,4'-TRINITRO-BIPHENYL
CAS:36712-34-2
Formula: C12H7N3O6
KIN02233498
2,4,4'-TRIS(2,3-EPOXY-PROPOXY) -BIPHENYL
CAS:49791-98-2
Formula: C21H22O6
KIN02290491
2,4,4'-TRIS(BENZYLOXY) CHALCONE
CAS:148356-55-2
Formula: C36H30O4
KIN03289183
2,4,4,4-TETRABROMO-1,1,1-TRIFLUORO-BUTANE
CAS:111398-13-1
Formula: C4H3Br4F3
KIN03107571
2,4,4,4-TETRABROMO-2-METHYLBUTANOIC ACID METHYL ESTER
CAS:118373-88-9
Formula: C6H8Br4O2
KIN03153889
2,4,4,4-TETRACHLORBUTTERSAURE-AETHYL ESTER
CAS:25335-12-0
Formula: C6H8Cl4O2
KIN02138598
2,4,4,4-TETRACHLORO-1,1,3,3-TETRAFLUORO-BUT-1-ENE
CAS:337-18-8
Formula: C4Cl3F5
KIN01010891
2,4,4,4-TETRACHLORO-1-BUTANOL ACETATE
CAS:1561-48-4
Formula: C9H16Cl4
KIN01050151
2,4,4,4-TETRACHLORO-1-BUTANOL PHOSPHATE (3:1)
CAS:56440-53-0
Formula: C12H15Cl12O4P
KIN02382922
2,4,4,4-TETRACHLORO-2-METHYLBUTANOIC ACID ALLYL ESTER
CAS:61856-23-3
Formula: C8H10Cl4O2
KIN02463204
2,4,4,4-TETRACHLORO-BUT-2-ENAL
CAS:19429-51-7
Formula: C4H2Cl4O
KIN02081275
2,4,4,4-TETRACHLORO-BUTANOIC ACID 1,4-BUTANEDIYL ESTER
CAS:61856-16-4
Formula: C12H14Cl8O4
KIN02463201
2,4,4,4-TETRACHLORO-BUTANOL
CAS:3290-74-2
Formula: C11H12O2
KIN01086127
2,4,4,4-TETRACHLORO-BUTANOYL CHLORIDE
CAS:68121-36-8
Formula: C4H3Cl5O-
KIN02560871
2,4,4,4-TETRAFLUORO-1-BUTENE-1,1,3,3-TETRACARBOXYLIC ACID TETRAMETHYL ESTER
CAS:7108-78-3
KIN01178796
2,4,4,4-TETRAFLUORO-BUTANENITRILE
CAS:5522-63-4
Formula: C40H46N4O8
KIN01134700
2,4,4,4-TETRAHYDRO-2-(4-METHYLPHENYL)-4,4,4,6-TETRAPHENYL-[1,2]OXAPHOSPHOLO[3,4-D]-1,2,3-OXADIAZOLE
CAS:300697-92-1
Formula: C34H27N2O2P
KIN03476283
2,4,4,5,5,6,6,8,9,9,11-UNDECAFLUORO-12-OXO-2,8,11-TRIS(TRIFLUOROMETHYL)-3,7,10,13-TETRAOXATETRADECANOIC ACIDMETHYL ESTER
CAS:50733-68-1
Formula: C14H6F20O7
KIN02296898
2,4,4,5,5,6,6-HEPTAFLUOR-1-PROPAN-2-YLAMINO-3-PROPAN-2-YL-IMINO-CYCLOHEXEN
CAS:1696-40-8
KIN01053603
2,4,4,5,5,6-HEXAMETHYL-1,3-DIOXANE
CAS:67520-75-6
Formula: C10H20O2
KIN02554578
2,4,4,5,5,7-HEXACHLORO-2,7-DIMETHYL-OCTANE
CAS:99192-48-0
KIN02818902
2,4,4,5,5,7-HEXAMETHYL-2,6-OCTADIENE
CAS:61499-92-1
Formula: C14H26
KIN02457022
2,4,4,5,5,7-HEXAMETHYL-3,6-OCTANEDIONE
CAS:51513-36-1
Formula: C14H26O2
KIN02307622
2,4,4,5,5,7-HEXAMETHYL-OCTANE
CAS:76426-52-3
Formula: C14H30
KIN02619192
2,4,4,5,5-PENTACHLORO-3-PHENOXY-CYCLOPENT-2-EN-1-ONE
CAS:18242-50-7
Formula: C11H5Cl5O2
KIN02070179
2,4,4,5,5-PENTAFLUORO-3-HYDROXY-2-CYCLOPENTEN-1-ONE
CAS:66463-35-2
Formula: C5HF5O2
KIN02542284
2,4,4,5,5-PENTAFLUORO-N-METHYL-3-(METHYL-IMINO)-1-CYCLOPENTEN-1-YLAMINE
CAS:4045-72-1
Formula: C2HN3O
KIN01100028
2,4,4,5,5-PENTAMETHYL-[1,3]DIOXOLAN-2-OL
CAS:76937-02-5
Formula: C8H16O3
KIN02622408
2,4,4,5,5-PENTAMETHYL-[1,3]DIOXOLANE
CAS:4360-60-5
Formula: C11H14O2
KIN01105864
2,4,4,5,5-PENTAMETHYL-1,3,2-DIOXABOROLANE
CAS:94242-85-0
Formula: C7H15BO2
KIN02779629
Methylboronic acid pinacol ester
MFCD09027082
2,4,4,5,5-PENTAMETHYL-2-(PHENYLETHYNYL)-[1,3]DIOXOLANE
CAS:93555-27-2
Formula: C16H20O2
KIN02770550
2,4,4,5,5-PENTAMETHYL-2-PHENYL-1,3-DIOXA-2-SILACYCLOPENTANE
CAS:6766-43-4
Formula: C30H44O8
KIN01169964
2,4,4,5,5-PENTAMETHYL-HEPT-2-ENE
CAS:105946-09-6
Formula: C12H24
KIN03072363
2,4,4,5,5-PENTAMETHYL-HEPTANE
CAS:62199-73-9
Formula: C12H26
KIN02469934
2,4,4,5,5-PENTAMETHYL-HEXAN-3-ONE
CAS:20669-09-4
Formula: C11H22O
KIN02092937
2,4,4,5,5-PENTAPHENYL-1,3,2-DIOXABOROLANE
CAS:53484-85-8
KIN02335917
2,4,4,5,5-PENTAPHENYL-1,3,2-DIOXAPHOSPHOLANE 2-OXIDE
CAS:329706-92-5
KIN03667973
2,4,4,5,6-PENTACHLORO-3,6-DIMETHYLCYCLOHEX-2-ENONE
CAS:36433-33-7
Formula: C8H7Cl5O
KIN02231807
2,4,4,5,7,7,8,10,10,11,13,13,14,14,15,15,15-HEPTADECAFLUORO-2,5,8,11-TETRAKIS(TRIFLUOROMETHYL)-3,6,9,12-TETRAOXAPENTADECAN-1-OL
CAS:141977-66-4
Formula: C15H3F29O5
KIN03262939
2,4,4,5,7,7,8,10,10,11,13,13,14,14,15,15,15-HEPTADECAFLUORO-2,5,8,11-TETRAKIS(TRIFLUOROMETHYL)-3,6,9,12-TETRAOXAPENTADECANENITRILE
CAS:53278-25-4
Formula: C15F29NO4
KIN02332686
2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,20,21,21,21-TRICOSAFLUORO-2,5,8,11,14,17-HEXAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18-HEXAOXAHENICOSAN-1-OL
CAS:167631-99-4
Formula: C21H3F41O7
KIN03340993
2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,22,22,23,25,25,26,26,27,27,27-NONACOSAFLUORO-2,5,8,11,14,17,20,23-OCTAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18,21,24-OCTAOXAHEPTACOSANOYL FLUORIDE
CAS:13140-26-6
Formula: C27F54O9
KIN02015363
2,4,4,5,7,7,8,8,9,9,11,12,12,14-TETRADECAFLUORO-2,5,11,14-TETRAKIS(TRIFLUOROMETHYL)-3,6,10,13-TETRAOXAPENTADECANEDIOIC ACID1,15-DIMETHYL ESTER
CAS:51852-23-4
Formula: C17H6F26O8
KIN02312639
2,4,4,5-TETRAMETHYL-1,3-DIOXANE
CAS:64269-41-6
Formula: C8H16O2
KIN02507080
2,4,4,5-TETRAMETHYL-2-CYCLOPENTEN-1-ONE
CAS:36461-45-7
Formula: C9H14O
KIN02232064
2,4,4,5-TETRAMETHYL-2-HEXENE
CAS:65132-96-9
Formula: C10H20
KIN02521788
2,4,4,5-TETRAMETHYL-2-PROPAN-2-YL-[1,3]DIOXOLANE
CAS:24085-97-0
Formula: C10H20O2
KIN02126735
2,4,4,5-TETRAMETHYL-3-HEXANOL
CAS:66256-68-6
Formula: C10H22O
KIN02539415
2,4,4,5-TETRAMETHYL-5-(METHYLSELENO)-3-HEXANONE
CAS:94417-63-7
Formula: C11H22OSe
KIN02781731
2,4,4,5-TETRAMETHYL-5-(PHENYLSELENO)-3-HEXANONE
CAS:102578-14-3
Formula: C16H24OSe
KIN03048296
2,4,4,5-TETRAMETHYL-HEPT-2-ENE
CAS:103982-57-6
Formula: C11H22
KIN03057746
2,4,4,5-TETRAMETHYL-HEPTANE
CAS:61868-56-2
Formula: C11H24
KIN02463528
2,4,4,5-TETRAMETHYL-OCT-2-ENE
CAS:105903-59-1
Formula: C12H24
KIN03071972
2,4,4,5-TETRAMETHYL-OCTANE
CAS:62199-34-2
Formula: C12H26
KIN02469898
2,4,4,5-TETRAPHENYL-4H-IMIDAZOLE
CAS:7189-80-2
KIN01180890
2,4,4,6,6,6-HEXACHLORO-1-HEXANOL ACETATE
CAS:88544-03-0
Formula: C8H12Cl6O3
KIN02699606
2,4,4,6,6,8,8-HEPTAMETHYL-1-NONENE
CAS:15796-04-0
Formula: C16H32
KIN02044260
2,4,4,6,6,8,8-HEPTAMETHYLCYCLOTETRASILOXAN-2-OL
CAS:5290-24-4
Formula: C6H12Cl2O2Si
KIN01124767
2,4,4,6,6,8-HEXACHLORO-5,5-DIFLUORONONANE-1,9-DIOL
CAS:77304-50-8
Formula: C9H12Cl6F2O2
KIN02624708
2,4,4,6,6-HEXAHYDRO-1,3,5,2,4,6-TRIAZATRIPHOSPHORINE
CAS:86118-72-1
Formula: C60H36N9O18P3
KIN02678463
2,4,4,6,6-PENTAAZIRIDIN-1-YL-N-METHYL-1,3,5-TRIAZA-2L^C11H24N9P3,4L^C11H24N9P3,6L^C11H24N9P3-TRIPHOSPHACYCLOHEXA-1,3,5-TRIEN-2-YLAMINE
CAS:3996-28-9
Formula: C14H10N2O4
KIN01099218
2,4,4,6,6-PENTACHLORO-7-(DICHLOROMETHYLENE)-1-OXASPIRO[2.4]HEPT-5-OL
CAS:122022-77-9
Formula: C7H3Cl7O2
KIN03172828
2,4,4,6,6-PENTAMETHYL-1,3-DIOXANE
CAS:5663-29-6
Formula: C9H18O2
KIN01138269
2,4,4,6,6-PENTAMETHYL-1-HEPTENE
CAS:14031-86-8
Formula: C12H24
KIN02027343
2,4,4,6,6-PENTAMETHYL-2-HEPTANOL
CAS:97994-56-4
Formula: C12H26O
KIN02809541
2,4,4,6,6-PENTAMETHYL-2-HEPTENE
CAS:39761-68-7
Formula: C12H24
KIN02257230
2,4,4,6,6-PENTAMETHYL-HEPT-2-YL-UREA
CAS:494209-63-1
Formula: C13H28N2O
KIN03613486
2,4,4,6,7-PENTACHLORO-HEPTANOIC ACID METHYL ESTER
CAS:67001-96-1
Formula: C8H11Cl5O2
KIN02547580
2,4,4,6,8,8-HEXACHLORO-N,N-DI-TERT-BUTYL-1,3,5,7-TETRAZA-2L^C8H20CL6N6P4,4L^{5},6L^C8H20CL6N6P4,8L^C8H20CL6N6P4-TETRAPHOSPHACYCLOOCTA-1,3,5,7-TETRAENE-2,6-DIAMINE
CAS:6944-50-9
Formula: C10H20Cl6N6P4
KIN01173612
2,4,4,6,8,8-HEXACHLORO-N2,N6-DIMETHYL-N2,N6-DIPHENYL-1,3,5,7,2.LAMBDA.5,4.LAMBDA.5,6.LAMBDA.5,8.LAMBDA.5-TETRAAZA-TETRAPHOSPHOCINE-2,6-DIAMINE
CAS:7460-34-6
Formula: C12H11NO3
KIN01187330
2,4,4,6,8-PENTAMETHYL-3,7-NONANEDIONE
CAS:65738-41-2
Formula: C14H26O2
KIN02531607
2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE
CAS:20244-61-5
Formula: C6H2Br4O
KIN02089418
MFCD00001589
2,4,4,6-TETRABROMO-DECANE
CAS:90278-17-4
Formula: C10H18Br4
KIN02725141
2,4,4,6-TETRABROMO-HEPTANE
CAS:86405-88-1
Formula: C7H12Br4
KIN02680238
2,4,4,6-TETRACHLORO-3,5-DIMETHYLCYCLOHEXA-2,5-DIENONE
CAS:13821-82-4
Formula: C8H6Cl4O
KIN02024806
2,4,4,6-TETRACHLORO-3-METHYL-5-PROPAN-2-YL-2,5-CYCLOHEXADIEN-1-ONE
CAS:51202-04-1
Formula: C10H10Cl4O
KIN02302991
2,4,4,6-TETRACHLORO-6-CYANO-HEXANOIC ACID METHYL ESTER
CAS:67001-94-9
Formula: C8H9Cl4NO2
KIN02547579
2,4,4,6-TETRACHLORO-7-HYDROXY-HEPTANENITRILE
CAS:67001-98-3
Formula: C7H9Cl4NO
KIN02547582
2,4,4,6-TETRACHLORO-CYCLOHEXA-2,5-DIEN-1-ONE
CAS:20244-55-7
Formula: C6H2Cl4O
KIN02089417
2,4,4,6-TETRACHLORO-HEPTANE-1,7-DIOL
CAS:34909-89-2
Formula: C7H12Cl4O2
KIN02218044
2,4,4,6-TETRACHLORO-HEPTANEDIOIC ACID DIMETHYL ESTER
CAS:34909-87-0
Formula: C9H12Cl4O4
KIN02218043
2,4,4,6-TETRAMETHYL-1,3-DIOXANE
CAS:5182-43-4
Formula: C8H8Cl2
KIN01122359
2,4,4,6-TETRAMETHYL-2,5-CYCLOHEXADIEN-1-ONE
CAS:53950-85-9
Formula: C10H14O
KIN02342813
2,4,4,6-TETRAMETHYL-4H-1,3,5-THIADIAZINE
CAS:64269-71-2
Formula: C7H12N2S
KIN02507099
2,4,4,6-TETRAMETHYL-6-HEPTEN-3-ONE
CAS:88031-83-8
Formula: C11H20O
KIN02692045
2,4,4,6-TETRAMETHYL-6-HEPTEN-3-ONE OXIME
CAS:88031-90-7
Formula: C11H21NO
KIN02692052
2,4,4,6-TETRAMETHYL-6-PHENYL-1,3-DIOXANE
CAS:66156-26-1
Formula: C14H20O2
KIN02537842
2,4,4,6-TETRAMETHYL-HEPT-2-ENE
CAS:103982-58-7
Formula: C11H22
KIN03057747
2,4,4,6-TETRAMETHYL-HEPTANE
CAS:61868-57-3
Formula: C11H24
KIN02463529
2,4,4,6-TETRAMETHYL-OCTANE
CAS:62199-35-3
Formula: C12H26
KIN02469899
2,4,4,6-TETRAMETHYLCYCLOHEXANONE
CAS:65638-63-3
Formula: C10H18O
KIN02530006
2,4,4,6-TETRAMETHYLMORPHOLINIUM CHLORIDE
CAS:64632-16-2
Formula: C8H18NO.Cl
KIN02512955
2,4,4,6-TETRAMETHYLMORPHOLINIUM IODIDE
CAS:64632-11-7
Formula: C8H18NO.I
KIN02512952
2,4,4,6-TETRAMETHYLTRICYCLO[6.4.0.02,7]DODECAN-3-OL
CAS:97890-10-3
Formula: C16H28O
KIN02808533
2,4,4,6-TETRAPHENYL-3(4H)-PYRIDINONE
CAS:86786-13-2
Formula: C29H21NO
KIN02682558
2,4,4,6-TETRAPHENYL-4H-1,4-OXAPHOSPHORINIUM BROMIDE
CAS:21680-84-2
Formula: C28H22OP+
KIN02103186
2,4,4,6-TETRAPHENYL-4H-THIOPYRAN
CAS:96271-76-0
Formula: C29H22S
KIN02799388
2,4,4,7,7-PENTAMETHYL-1,3-DIOXEPANE
CAS:112036-97-2
Formula: C10H20O2
KIN03112120
2,4,4,7-TETRAMETHYL-4H,5H-PYRANO[4,3-B]PYRAN-5-ONE
CAS:94123-37-2
Formula: C12H14O3
KIN02778079
2,4,4,7-TETRAMETHYL-6,8-NONADIEN-3-ONE
CAS:81782-89-0
Formula: C13H22O
KIN02651695
2,4,4,7-TETRAMETHYL-6-OCTEN-3-ONE
CAS:74338-72-0
Formula: C12H22O
KIN02605095
2,4,4,7-TETRAMETHYL-6-OCTEN-3-ONE OXIME
CAS:88031-88-3
Formula: C12H23NO
KIN02692050
2,4,4,7-TETRAMETHYL-OCTANE
CAS:35866-96-7
Formula: C12H26
KIN02226947
2,4,4,8-TETRACHLORO-6-METHYL NONANE
CAS:51500-53-9
KIN02307426
2,4,4,8-TETRAMETHYL-2H-3,1-BENZOXAZIN-1(4H)-CARBONYL BROMIDE
CAS:57772-35-7
Formula: C13H16BrNO2
KIN02405130
2,4,4-HEXANETRICARBOXYLIC ACID
CAS:4388-97-0
Formula: C4H9NO2
KIN01106692
2,4,4-PYRROLIDINETRICARBOXYLIC ACID
CAS:87828-56-6
Formula: C7H9NO6
KIN02690018
2,4,4-TRIALLYL-1,3(2H,4H)-ISOQUINOLINEDIONE
CAS:94164-60-0
Formula: C18H19NO2
KIN02778769
2,4,4-TRIBROMO-6-METHYL-2,5-CYCLOHEXADIEN-1-ONE
CAS:77339-18-5
Formula: C7H5Br3O
KIN02624947
2,4,4-TRICHLORO-1(4H)-NAPHTHALENONE
CAS:1133-42-2
Formula: C10H10N2O2
KIN01040945
2,4,4-TRICHLORO-1,3-BIS(TRIMETHYLSILYL)-1,3-DIAZA-2-PHOSPHA-4-SILACYCLOBUTANE
CAS:58971-97-4
Formula: C6H18Cl3N2PSi3
KIN02424091
2,4,4-TRICHLORO-1-BUTENE
CAS:52198-51-3
KIN02317766
2,4,4-TRICHLORO-2,5-CYCLOHEXADIEN-1-ONE
CAS:97948-10-2
Formula: C6H3Cl3O
KIN02809023
2,4,4-TRICHLORO-3-(DICHLOROMETHYL)BUT-2-ENOIC ACID
CAS:97055-37-3
Formula: C5H3Cl5O2
KIN02804303
2,4,4-TRICHLORO-3-(MORPHOLIN-4-YL)-2-CYCLOBUTEN-1-ONE
CAS:68239-28-1
Formula: C8H8Cl3NO2
KIN02561737
2,4,4-TRICHLORO-3-FORMYLBUT-2-ENOIC ACID
CAS:135679-99-1
Formula: C5H3Cl3O3
KIN03233908
2,4,4-TRICHLORO-3-FORMYLBUT-2-ENOIC ACID METHYL ESTER
CAS:132758-14-6
Formula: C6H5Cl3O3
KIN03220365
2,4,4-TRICHLORO-4-CYANO-BUTANOIC ACID METHYL ESTER
CAS:13026-88-5
Formula: C6H6Cl3NO2
KIN02013691
2,4,4-TRICHLORO-4-CYANO-BUTANOYL CHLORIDE
CAS:98775-56-5
Formula: C5H3Cl4NO
KIN02815988
2,4,4-TRICHLORO-5,5,5-TRIFLUOROPENTANOIC ACID
CAS:68121-35-7
Formula: C5H4Cl3F3O2
KIN02560870
2,4,4-TRICHLORO-5-OXO-PENTANENITRILE
CAS:75272-53-6
Formula: C5H4Cl3NO
KIN02611500
2,4,4-TRICHLORO-BUTAN-2-YLBENZENE
CAS:116448-25-0
Formula: C10H11Cl3
KIN03143717
2,4,4-TRICHLORO-OCTANE
CAS:63616-37-5
Formula: C8H15Cl3
KIN02496007
2,4,4-TRICHLOROPENTAFLUORO-BUT-1-ENE
CAS:337-20-2
Formula: C4F8O
KIN01010892
2,4,4-TRICYANO-3-MERCAPTO-BUT-2-ENOIC ACID ETHYL ESTER
CAS:91206-61-0
Formula: C9H7N3O2S
KIN02740265
2,4,4-TRICYANOBUT-1-ENYLIDENEAZANIDE
CAS:7238-48-4
Formula: C18H15Cl2Sn
KIN01182324
2,4,4-TRIETHOXY-BUTAN-2-YLBENZENE
CAS:101448-09-3
Formula: C16H26O3
KIN03039480
2,4,4-TRIETHYL-4H-1,3-BENZOTHIAZINE HCL
CAS:61982-22-7
Formula: C14H19NS.ClH
KIN02465620
2,4,4-TRIFLUORO-2-(TRIFLUOROMETHYL)-1,3-BENZODIOXENE
CAS:25857-80-1
Formula: C9H4F6O2
KIN02143559
2,4,4-TRIFLUORO-3-IODO-2-CYCLOBUTEN-1-ONE
CAS:65361-38-8
Formula: C4F3IO
KIN02525498
2,4,4-TRIFLUORO-3-METHOXY-2-CYCLOBUTEN-1-ONE
CAS:60407-10-5
Formula: C5H3F3O2
KIN02444164
2,4,4-TRIFLUORO-ACETOACETIC ACID
CAS:2366-01-0
Formula: C4H3BrF6
KIN01067870
2,4,4-TRIIODO-BUTANOIC ACID METHYL ESTER
CAS:87375-62-0
Formula: C5H7I3O2
KIN02686190
2,4,4-TRIMETHOXY-2,5-CYCLOHEXADIEN-1-ONE
CAS:95338-37-7
Formula: C9H12O4
KIN02790574
2,4,4-TRIMETHOXY-BIPHENYL
CAS:208652-72-6
Formula: [C15H17O3
KIN03419057
2,4,4-TRIMETHOXY-BUTANENITRILE
CAS:112890-36-5
Formula: C7H13NO3
KIN03118824
2,4,4-TRIMETHYL-[1,3]DIOXOLANE
CAS:5660-74-2
Formula: C24H23N3O5S
KIN01138169
2,4,4-TRIMETHYL-1,1-DIPHENYL-1-PENTEN-3-ONE
CAS:95546-13-7
Formula: C20H22O
KIN02792660
2,4,4-TRIMETHYL-1,2-BENZOSELENAZIN-3-ONE
CAS:143364-08-3
Formula: C11H13NOSe
KIN03269866
2,4,4-TRIMETHYL-1,2-DINITRO-PENTANE
CAS:59550-05-9
Formula: C8H16N2O4
KIN02433240
2,4,4-TRIMETHYL-1,3,3A,5,6,6A-HEXAHYDROCYCLOPENTA[C]PYRROLE
CAS:87390-59-8
Formula: C10H19N
KIN02686391
2,4,4-TRIMETHYL-1,3-CYCLOHEXANEDIONE
CAS:63184-86-1
Formula: C9H14O2
KIN02487882
2,4,4-TRIMETHYL-1,3-OXATHIANE
CAS:72472-02-7
Formula: C7H14OS
KIN02591611
2,4,4-TRIMETHYL-1,5-DIAZASPIRO[5.5]UNDEC-1-ENE
CAS:68784-94-1
Formula: C12H22N2
KIN02565704
2,4,4-TRIMETHYL-1,5-DINITRO-PENTAN-2-OL
CAS:31710-59-5
Formula: C8H16N2O5
KIN02191570
2,4,4-TRIMETHYL-1,5-HEXADIEN-3-OL
CAS:77963-77-0
Formula: C9H16O
KIN02628523
2,4,4-TRIMETHYL-1,6-HEXANEDIAMINE 2HCL
CAS:92238-38-5
Formula: C9H22N2.2ClH
KIN02754546
2,4,4-TRIMETHYL-1,6-HEXANEDIOL
CAS:3089-55-2
Formula: C21H32O4
KIN01082212
2,4,4-TRIMETHYL-1-HEPTENE
CAS:90895-53-7
Formula: C10H20
KIN02735280
2,4,4-TRIMETHYL-1-HEXANOL
CAS:67468-87-5
Formula: C9H20O
KIN02553943
2,4,4-TRIMETHYL-1-HEXENE
CAS:51174-12-0
Formula: C9H18
KIN02302791
MFCD00048626
2,4,4-TRIMETHYL-1-MORPHOLIN-4-YLPENT-2-EN-1-ONE
CAS:288093-77-6
Formula: C12H21NO2
KIN03469678
2,4,4-TRIMETHYL-1-NITRO-1-PENTENE
CAS:27838-96-6
Formula: C8H15NO2
KIN02160791
2,4,4-TRIMETHYL-1-NITRO-PENTAN-2-OL
CAS:35223-67-7
Formula: C8H17NO3
KIN02221005
2,4,4-TRIMETHYL-1-OXA-3-AZASPIRO[4.5]DEC-2-ENE
CAS:91875-85-3
Formula: C11H19NO
KIN02749942
2,4,4-TRIMETHYL-1-OXASPIRO[2.4]HEPT-2-OL ACETATE
CAS:63861-36-9
Formula: C11H18O3
KIN02500098
2,4,4-TRIMETHYL-1-PENTANETHIOL
CAS:110502-19-7
Formula: C8H18S
KIN03101977
2,4,4-TRIMETHYL-1-PHENYL-1-OCTANONE
CAS:97467-25-9
Formula: C17H26O
KIN02806204
2,4,4-TRIMETHYL-1-PHENYL-1-PENTEN-3-ONE
CAS:95546-11-5
Formula: C14H18O
KIN02792658
2,4,4-TRIMETHYL-1-PHENYL-7-OCTEN-1-ONE
CAS:89746-00-9
Formula: C17H24O
KIN02716370
2,4,4-TRIMETHYL-1-PHENYLPENTANE-1,3-DIONE
CAS:106596-69-4
Formula: C14H18O2
KIN03077334
2,4,4-TRIMETHYL-1-PHENYLPYRROLIDINE
CAS:1015419-88-1
KIN05020717
2,4,4-TRIMETHYL-1-PROPAN-2-YLPYRROLIDINE
CAS:155788-86-6
Formula: C10H21N
KIN03313354
2,4,4-TRIMETHYL-2,3,6,7,8,9-HEXAHYDROPYRIDO[2,1-B][1,3]OXAZIN-5-IUM, PERCHLORATE
CAS:36867-40-0
Formula: C11H20ClNO5
KIN02234907
2,4,4-TRIMETHYL-2,3-PENTANEDIOL
CAS:73174-88-6
KIN02596447
2,4,4-TRIMETHYL-2,5-CYCLOHEXADIEN-1-ONE
CAS:38441-63-3
KIN02248029
2,4,4-TRIMETHYL-2-(1-METHYL-1-NITRO-ETHYL)-3-OXO-PENTANENITRILE
CAS:34916-44-4
KIN02218125
2,4,4-TRIMETHYL-2-(3-OXO-BUTYL) -1,3-CYCLOPENTANEDIONE
CAS:92952-88-0
Formula: C12H18O3
KIN02763444
2,4,4-TRIMETHYL-2-(ALLYL)CYCLOHEXANONE
CAS:87394-39-6
Formula: C12H20O
KIN02686410
2,4,4-TRIMETHYL-2-(THIOPHEN-2-YL)-1,3,2-DIOXASILINANE
CAS:134403-47-7
Formula: C10H16O2SSi
KIN03228093
2,4,4-TRIMETHYL-2-CYCLOBUTEN-1-ONE
CAS:55701-64-9
Formula: C7H10O
KIN02370622
2,4,4-TRIMETHYL-2-CYCLOHEXEN-1-OL ACETATE
CAS:54345-57-2
KIN02348568
2,4,4-TRIMETHYL-2-CYCLOPENTEN-1-ONE
CAS:17190-21-5
Formula: C8H12O
KIN02059196
2,4,4-TRIMETHYL-2-HEXANOL
CAS:66793-91-7
Formula: C9H20O
KIN02545749
2,4,4-TRIMETHYL-2-OXETANE-CARBONITRILE
CAS:35822-66-3
KIN02226586
2,4,4-TRIMETHYL-2-OXETANEMETHANOL
CAS:84921-51-7
KIN02670730
2,4,4-TRIMETHYL-2-OXETANOL
CAS:57254-26-9
KIN02396540
2,4,4-TRIMETHYL-2-PENTANOL
CAS:690-39-1
Formula: C3H2F6
KIN01025655
2,4,4-TRIMETHYL-2-PENTANOL 4-NITRO-BENZOATE
CAS:55705-72-1
Formula: C15H21NO4
KIN02370726
2,4,4-TRIMETHYL-2-PENTANOL HYDROGEN PHOSPHATE
CAS:20328-55-6
Formula: C16H35O4P
KIN02090160
2,4,4-TRIMETHYL-2-PENTANOL PHOSPHATE (3:1)
CAS:4486-59-3
Formula: C8H14O2
KIN01109122
2,4,4-TRIMETHYL-2-PENTENAL
CAS:53907-61-2
Formula: C8H14O
KIN02342155
2,4,4-TRIMETHYL-2-PENTYL-3-OXAZOLIDINYLOXY
CAS:16263-51-7
Formula: C11H22NO2
KIN02049601
2,4,4-TRIMETHYL-2-PENTYL-OXAZOLIDINE
CAS:5210-50-4
Formula: C7H13N3O4
KIN01122897
2,4,4-TRIMETHYL-2-PHENYL-1,3,2-DIOXASILINANE
CAS:106814-50-0
Formula: C12H18O2Si
KIN03078706
2,4,4-TRIMETHYL-2-PHENYL-1,3-CYCLOPENTANEDIONE
CAS:202202-98-0
Formula: C14H16O2
KIN03012695
2,4,4-TRIMETHYL-2-PHOSPHONOADIPIC ACID
CAS:67492-83-5
Formula: C9H17O7P
KIN02554221
2,4,4-TRIMETHYL-2-PROP-2-ENYLCYCLOPENTAN-1-ONE
CAS:118075-31-3
Formula: C11H18O
KIN03152447
2,4,4-TRIMETHYL-2-PROPAN-2-YLTHIO-1,3,2-DIOXASILINANE
CAS:188564-80-9
Formula: C9H20O2SSi
KIN03385118
2,4,4-TRIMETHYL-3,5-DIHYDRO-BENZO[H][1,5]BENZODIAZEPINE
CAS:434339-59-0
Formula: C16H18N2
KIN03579805
2,4,4-TRIMETHYL-3,5-DINITRO-PENTAN-2-OL
CAS:35223-62-2
Formula: C8H16N2O5
KIN02221004
2,4,4-TRIMETHYL-3-(1-OXO-3-BUTENYL) -2-CYCLOHEXEN-1-ONE
CAS:94391-17-0
Formula: C13H18O2
KIN02781328
2,4,4-TRIMETHYL-3-(1-OXO-BUT-2-ENYL) -2-CYCLOHEXEN-1-ONE
CAS:53398-08-6
Formula: C13H18O2
KIN02334571
2,4,4-TRIMETHYL-3-(2-OXOETHYL) -2-CYCLOHEXEN-1-ONE
CAS:186451-82-1
Formula: C11H16O2
KIN03381612
2,4,4-TRIMETHYL-3-(3-METHYLBUTYL)-2-CYCLOHEXEN-1-ONE
CAS:88725-82-0
Formula: C14H24O
KIN02701844
2,4,4-TRIMETHYL-3-(3-OXO-BUT-1-ENYL) CYCLOHEX-2-ENONE
CAS:27185-77-9
Formula: C13H18O2
KIN02154963
2,4,4-TRIMETHYL-3-(3-OXO-BUTYL) -2-CYCLOHEXEN-1-ONE
CAS:72008-46-9
Formula: C13H20O2
KIN02588390
2,4,4-TRIMETHYL-3-(ACRYLOYL)-2-CYCLOHEXEN-1-ONE
CAS:94391-25-0
Formula: C12H16O2
KIN02781333
2,4,4-TRIMETHYL-3-[(4-METHYLPHENYL)SULFONYLMETHYL]CYCLOHEX-2-EN-1-ONE
CAS:252568-31-3
Formula: C17H22O3S
KIN03452511
2,4,4-TRIMETHYL-3-[(BENZENESULFONYL)METHYL]-2-CYCLOHEXEN-1-OL
CAS:59482-67-6
Formula: C16H22O3S
KIN02432145
2,4,4-TRIMETHYL-3-ETHYLHEXANE
CAS:61868-83-5
Formula: C11H24
KIN02463555
2,4,4-TRIMETHYL-3-HEXANOL
CAS:66793-92-8
Formula: C9H20O
KIN02545750
2,4,4-TRIMETHYL-3-ISOXAZOLIDINONE
CAS:81777-93-7
Formula: C6H11NO2
KIN02651666
2,4,4-TRIMETHYL-3-NITROSO-PENTAN-2-YL NITRATE
CAS:65152-04-7
Formula: C8H16N2O4
KIN02522138
2,4,4-TRIMETHYL-3-NITROSOPENTAN-2-YL NITRATE
CAS:67608-06-4
Formula: C8H16N2O4
KIN02555634
2,4,4-TRIMETHYL-3-OXAZOLIDINECARBALDEHYDE
CAS:174656-71-4
Formula: [C7H13NO2
KIN03356433
2,4,4-TRIMETHYL-3-OXAZOLIDINECARBOXAMIDE
CAS:86291-01-2
Formula: C7H14N2O2
KIN02679558
2,4,4-TRIMETHYL-3-OXO-CYCLOHEXAN-CARBONITRILE
CAS:65534-76-1
Formula: C10H15NO
KIN02528356
2,4,4-TRIMETHYL-3-OXO-N,N-BIS(BENZYL)PENTANAMIDE
CAS:90033-12-8
Formula: C22H27NO2
KIN02721306
2,4,4-TRIMETHYL-3-OXO-PENTANENITRILE
CAS:29509-04-4
Formula: C8H13NO
KIN02174522
2,4,4-TRIMETHYL-3-OXO-PENTANOIC ACID
CAS:53333-24-7
Formula: C8H14O3
KIN02333511
2,4,4-TRIMETHYL-3-PHENYL-ISOXAZOLIDIN-5-ONE
CAS:33934-08-6
Formula: C12H15NO2
KIN02209991
2,4,4-TRIMETHYL-3-PROPAN-2-YLHEXANE
CAS:62199-86-4
Formula: C12H26
KIN02469947
2,4,4-TRIMETHYL-4,5-DIHYDROOXAZOLE
CAS:1772-45-8
Formula: C9H7ClN2
KIN01055461
2,4,4-TRIMETHYL-4H-1,3-BENZOTHIAZINE
CAS:58435-40-8
Formula: C11H13NS
KIN02415543
2,4,4-TRIMETHYL-4H-1,3-BENZOTHIAZINE HCL
CAS:58435-41-9
Formula: C11H13NS.ClH
KIN02415544
2,4,4-TRIMETHYL-4H-BENZO[1,3]DIOXINE
CAS:82466-10-2
Formula: C11H14O2
KIN02655698
2,4,4-TRIMETHYL-4H-IMIDAZOL-5-CARBONITRILE 3-OXIDE
CAS:1193304-32-3
Formula: C7H9N3O
KIN05334862
2,4,4-TRIMETHYL-4H-IMIDAZOLE
CAS:89002-67-5
Formula: C6H10N2
KIN02705503
2,4,4-TRIMETHYL-5(4H)-OXAZOLONE
CAS:24503-23-9
Formula: C6H9NO2
KIN02131102
2,4,4-TRIMETHYL-5,6-HEPTADIENE-3-THIONE
CAS:65880-63-9
Formula: C10H16S
KIN02533840
2,4,4-TRIMETHYL-5-(TRIMETHYLSILYL)-1-PENTEN-3-OL
CAS:98204-82-1
Formula: C11H24OSi
KIN02811859
2,4,4-TRIMETHYL-5-ETHYL-HEPTANE
CAS:62198-64-5
Formula: C12H26
KIN02469828
2,4,4-TRIMETHYL-5-METHYLENE-4,5-DIHYDRO-FURAN-3-CARBOXYLIC ACID
CAS:118768-39-1
Formula: C9H12O3
KIN03155868
2,4,4-TRIMETHYL-5-OXO-PYRROLIDIN-2-CARBOXAMIDE
CAS:86366-46-3
Formula: C8H14N2O2
KIN02680028
2,4,4-TRIMETHYL-5-OXO-PYRROLIDINE-2-CARBONITRILE
CAS:29777-62-6
Formula: C8H12N2O
KIN02176457
2,4,4-TRIMETHYL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:4027-46-7
KIN01099692
2,4,4-TRIMETHYL-5-PHENYL-3-HEXANONE
CAS:74338-65-1
Formula: C15H22O
KIN02605093
2,4,4-TRIMETHYL-5-PHENYL-3-NONANONE
CAS:88834-69-9
Formula: C18H28O
KIN02703350
2,4,4-TRIMETHYL-5-PHENYL-4H-IMIDAZOLE 1-OXIDE
CAS:38870-60-9
KIN02250952
2,4,4-TRIMETHYL-5-PHENYL-4H-IMIDAZOLE 3-OXIDE
CAS:38870-67-6
KIN02250954
2,4,4-TRIMETHYL-6-(3-OXO-1-BUTENYL) CYCLOHEXANONE
CAS:120166-32-7
Formula: C13H20O2
KIN03162846
2,4,4-TRIMETHYL-6-(PHENYLTHIO)-5-HEXYN-3-ONE
CAS:83188-28-7
Formula: C15H18OS
KIN02659762
2,4,4-TRIMETHYL-6-HEPTENE-3-THIONE
CAS:59104-37-9
Formula: C10H18S
KIN02426323
2,4,4-TRIMETHYL-6-NITRO-4H-1,3-BENZOTHIAZINE
CAS:67510-20-7
Formula: C11H12N2O2S
KIN02554375
2,4,4-TRIMETHYL-6-OXO-1-CYCLOHEXENE-1-ACETIC ACID
CAS:56671-89-7
Formula: C11H16O3
KIN02386726
2,4,4-TRIMETHYL-6-OXO-1-CYCLOHEXENE-1-ACETIC ACID METHYL ESTER
CAS:56671-90-0
Formula: C12H18O3
KIN02386727
2,4,4-TRIMETHYL-6-OXO-1-CYCLOHEXENE-1-CARBONITRILE
CAS:369397-37-5
Formula: C10H13NO
KIN03015608
2,4,4-TRIMETHYL-6-OXO-CYCLOHEXAN-CARBALDEHYDE
CAS:64798-86-3
Formula: C10H16O2
KIN02515877
2,4,4-TRIMETHYL-6-OXO-CYCLOHEXANE-CARBOXYLIC ACID METHYL ESTER
CAS:54576-10-2
Formula: C11H18O3
KIN02352160
2,4,4-TRIMETHYL-6-OXOCYCLOHEX-1-EN-1-YL ACETATE
CAS:2078-83-3
KIN01062252
2,4,4-TRIMETHYL-6-OXOCYCLOHEX-1-ENYL ACETATE
CAS:17304-81-3
Formula: C11H16O3
KIN02060620
2,4,4-TRIMETHYL-6-PHENYL-6-HEPTEN-3-ONE
CAS:66388-83-8
Formula: C16H22O
KIN02541409
2,4,4-TRIMETHYL-7-(3-METHYL-OCTAN-2-YL)-1,2-DIHYDRO-THIENO[2,3-C]CHROMEN-9-OL
CAS:56291-44-2
Formula: C23H34O2S
KIN02380397
2,4,4-TRIMETHYL-7-(3-METHYL-OCTAN-2-YL)-2,3-DIHYDRO-1H-CYCLOPENTA[C]CHROMEN-9-OL
CAS:55877-04-8
Formula: C24H36O2
KIN02373756
2,4,4-TRIMETHYL-7-AZABICYCLO[4.1.0]HEPT-2-ENE
CAS:52378-83-3
Formula: C9H15N
KIN02320295
2,4,4-TRIMETHYL-7-AZABICYCLO[4.1.0]HEPTANE
CAS:55903-16-7
Formula: C9H17N
KIN02374153
2,4,4-TRIMETHYL-7-NITRO-ISOQUINOLIN-1,3-DIONE
CAS:213765-60-7
Formula: C12H12N2O4
KIN03425547
2,4,4-TRIMETHYL-8-METHYLENE-1-OXASPIRO[2.5]OCTANE
CAS:54345-62-9
KIN02348573
2,4,4-TRIMETHYL-BICYCLO[3.1.0]HEX-2-EN-6-ONE
CAS:50549-49-0
KIN02294315
2,4,4-TRIMETHYL-BICYCLO[3.1.1]HEPT-2-EN-6-ONE
CAS:50585-71-2
Formula: C10H14O
KIN02294667
2,4,4-TRIMETHYL-HEPT-1-ENE
CAS:1192-50-3
Formula: C4H3BrO3
KIN01042685
2,4,4-TRIMETHYL-HEPT-6-EN-3-OL
CAS:141482-72-6
Formula: C10H20O
KIN03260468
2,4,4-TRIMETHYL-HEPTANE
CAS:4032-93-3
Formula: C10H22
KIN01099793
2,4,4-TRIMETHYL-HEPTANE-3,5-DIOL
CAS:27122-59-4
Formula: C10H22O2
KIN02154271
2,4,4-TRIMETHYL-HEXAN-1,6-DIAMINE
CAS:3236-55-3
Formula: C10H12N2O2
KIN01085036
2,4,4-TRIMETHYL-HEXAN-3-ONE
CAS:34575-34-3
Formula: C9H18O
KIN02214940
2,4,4-TRIMETHYL-HEXAN-3-YL N-NAPHTHALEN-1-YLCARBAMATE
CAS:7770-06-1
Formula: C6H9N2O3+
KIN01194777
2,4,4-TRIMETHYL-HEXANAL
CAS:50902-73-3
Formula: C9H18O
KIN02299171
2,4,4-TRIMETHYL-HEXANE
CAS:16747-30-1
Formula: C9H20
KIN02054510
MFCD00061012
2,4,4-TRIMETHYL-HEXANEDIOIC ACID
CAS:3937-66-4
KIN01098217
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 1,6-BIS(2-OXIRANYLMETHYL) ESTER
CAS:25677-83-2
Formula: C15H24O6
KIN02141899
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 1-DECYL 6-OCTYL ESTER
CAS:68425-97-8
Formula: C27H52O4
KIN02563193
2,4,4-TRIMETHYL-HEXANEDIOIC ACID 6-DECYL 1-OCTYL ESTER
CAS:67873-93-2
Formula: C27H52O4
KIN02558959
2,4,4-TRIMETHYL-HEXANEDIOIC ACID DIDECYL ESTER
CAS:95258-38-1
Formula: C29H56O4
KIN02789766
2,4,4-TRIMETHYL-N,N-BIS[(NAPHTHALEN-2-YLTHIO)METHYL]-2-PENTANAMINE
CAS:28926-16-1
Formula: C30H35NS2
KIN02169956
2,4,4-TRIMETHYL-OCT-2-ENE
CAS:103982-60-1
Formula: C11H22
KIN03057749
2,4,4-TRIMETHYL-OCTANE
CAS:62016-35-7
Formula: C11H24
KIN02466179
2,4,4-TRIMETHYL-OXAZOLIDINE
CAS:31720-56-6
Formula: C6H13NO
KIN02191620
2,4,4-TRIMETHYLCYCLOHEPTA[CD]BENZOFURAN-6(3H)-ONE
CAS:64437-97-4
KIN02509884
2,4,4-TRIMETHYLCYCLOHEX-1-ENECARBALDEHYDE
CAS:5939-91-3
Formula: C19H17Cl2N3OS
KIN01145610
2,4,4-TRIMETHYLCYCLOHEX-2-EN-1-OL
CAS:134736-78-0
Formula: C9H16O
KIN03229543
2,4,4-TRIMETHYLCYCLOHEX-2-ENONE
CAS:13395-71-6
Formula: C9H14O
KIN02018961
2,4,4-TRIMETHYLCYCLOHEXAN-1-ONE
CAS:2230-79-7
KIN01065384
2,4,4-TRIMETHYLCYCLOHEXAN-CARBALDEHYDE
CAS:64825-17-8
Formula: C10H18O
KIN02516369
2,4,4-TRIMETHYLCYCLOPENTANONE
CAS:4694-17-1
Formula: C8H12O
KIN01112761
2,4,4-TRIMETHYLCYCLOPENTANONE (TERT-BUTYL)HYDRAZONE
CAS:62204-22-2
Formula: C12H24N2
KIN02470000
2,4,4-TRIMETHYLHEXAN-1,6-DIOL
CAS:32305-38-7
Formula: C9H20O2
KIN02195804
2,4,4-TRIMETHYLNONA-6,8-DIEN-3-ONE OXIME
CAS:84625-53-6
Formula: C12H21NO
KIN02668842
2,4,4-TRIMETHYLNONANE
CAS:62184-61-6
Formula: C12H26
KIN02469549
2,4,4-TRIMETHYLPENT-1-EN-3-OL
CAS:7432-49-7
Formula: C7H12O
KIN01186797
2,4,4-TRIMETHYLPENT-1-ENE
CAS:107-40-4
Formula: C8H16
KIN01003986
2,4,4-TRIMETHYLPENT-2-ENE
CAS:107-41-5
Formula: C6H14O2
KIN01003987
2,4,4-TRIMETHYLPENTAN-1-OL
CAS:16325-63-6
Formula: C8H18O
KIN02050213
MFCD00004741
2,4,4-TRIMETHYLPENTAN-1-OL PHOSPHATE (3:1)
CAS:129877-64-1
Formula: C24H51O4P
KIN03207784
2,4,4-TRIMETHYLPENTAN-2,3-DIOL
CAS:64512-96-5
Formula: C8H18O2
KIN02511096
2,4,4-TRIMETHYLPENTAN-2-YL 2,2-DIMETHYLPROPANEPEROXOATE
CAS:22288-41-1
Formula: C13H26O3
KIN02109288
2,4,4-TRIMETHYLPENTAN-2-YL 3,5,5-TRIMETHYLHEXANEPEROXOATE
CAS:207851-10-3
KIN03417963
2,4,4-TRIMETHYLPENTAN-2-YL 6,6-DIMETHYL-HEPTANEPEROXOATE
CAS:136829-88-4
Formula: C17H34O3
KIN03238890
2,4,4-TRIMETHYLPENTAN-2-YL BENZENECARBODITHIOATE
CAS:201611-86-1
Formula: C15H22S2
KIN03409307
2,4,4-TRIMETHYLPENTAN-2-YL HEXANEPEROXOATE
CAS:220290-81-3
Formula: C14H28O3
KIN03433585
2,4,4-TRIMETHYLPENTAN-2-YL OCTANEPEROXOATE
CAS:175426-14-9
Formula: C16H32O3
KIN03358971
2,4,4-TRIMETHYLPENTAN-2-YLAMINE
CAS:107-46-0
Formula: C6H18OSi2
KIN01003991
2,4,4-TRIMETHYLPENTAN-2-YLAMINE ACETATE
CAS:43077-72-1
Formula: C10H23NO2
KIN02282509
2,4,4-TRIMETHYLPENTAN-2-YLAMINE, BENZOATE
CAS:6281-49-8
Formula: C9H18N2O2S
KIN01155193
2,4,4-TRIMETHYLPENTANAL
CAS:17414-46-9
Formula: C8H16O
KIN02061792
2,4,4-TRIMETHYLPENTANAL OXIME
CAS:56267-23-3
Formula: C8H17NO
KIN02380029
2,4,4-TRIMETHYLPENTANE-1,2-DIOL
CAS:64484-85-1
Formula: C8H18O2
KIN02510569
2,4,4-TRIMETHYLPENTANOIC ACID
CAS:3302-10-1
Formula: C9H18O2
KIN01086352
2,4,4-TRIMETHYLPENTANOIC ACID ETHYL ESTER
CAS:60302-30-9
Formula: C10H20O2
KIN02443395
2,4,4-TRIMETHYLPENTANOIC ACID METHYL ESTER
CAS:64198-22-7
Formula: C9H18O2
KIN02505945
2,4,4-TRIMETHYLPENTANOYL CHLORIDE
CAS:5340-44-3
KIN01126698
2,4,4-TRIMETHYLPENTENE
CAS:25167-70-8
Formula: C8H16
KIN02136969
2,4,4-TRIMETHYLPENTENE EPOXIDE
CAS:63919-00-6
Formula: C8H16O
KIN02501354
2,4,4-TRIMETHYLPENTENE REACTION PRODUCTS WITH NITRO-GEN OXIDE (N2O4)
CAS:474266-68-7
KIN03601014
2,4,4-TRIMETHYLPENTYL 2-PEROXY-PHENOXY-ACETATE
CAS:59382-51-3
Formula: C16H24O4
KIN02430646
2,4,4-TRIMETHYLPENTYL 4-CYANOBENZOATE
CAS:86590-88-7
Formula: C16H21NO2
KIN02681298
2,4,4-TRIMETHYLPENTYL-PHOSPHINE
CAS:82164-75-8
Formula: CH3C(CH3)2CH2CH(CH3)CH2PH2
KIN02653900
MFCD00269836
2,4,4-TRIMETHYLPENTYL-PHOSPINE
CAS:82164-76-9
KIN02653901
2,4,4-TRIMETHYLPYRROLIDIN-2-CARBONITRILE
CAS:86351-39-5
Formula: C8H14N2
KIN02679921
2,4,4-TRIMETHYLPYRROLIDINE
CAS:73604-52-1
Formula: C7H15N
KIN02599351
MFCD09032720
2,4,4-TRIPHENYL-[1,2]OXAZETIDIN-3-ONE
CAS:17003-58-6
Formula: C20H15NO2
KIN02057112
2,4,4-TRIPHENYL-1,4-BENZOXAPHOSPHININ-4-IUM, BROMIDE
CAS:72596-47-5
Formula: C26H20BrOP
KIN02592487
2,4,4-TRIPHENYL-2-PROPOXY-4H-BENZO[1,3]DIOXIN
CAS:61768-12-5
Formula: C29H26O3
KIN02461644
2,4,4-TRIPHENYL-4H-BENZO[1,3]DIOXIN-1-IUM PERCHLORATE
CAS:56228-47-8
Formula: C26H19O2.ClO4
KIN02379418
2,4,4-TRIPHENYL-4H-BENZO[1,3]DIOXIN-2-OL
CAS:61768-11-4
Formula: C26H20O3
KIN02461643
2,4,4-TRIPHENYL-5(4H)-OXAZOLONE
CAS:61365-94-4
Formula: C21H15NO2
KIN02455048
2,4,4-TRIPHENYL-6-[(4,4,6-TRIPHENYL-1,4-OXAPHOSPHININ-4-IUM-2-YL) METHYL]-1,4-OXAPHOSPHININ-4-IUM, BROMIDE
CAS:21680-89-7
Formula: C45H36BrO2P2+
KIN02103190
2,4,4-TRIS(ETHYLTHIO)BUTANOIC ACID
CAS:94014-39-8
Formula: C10H20O2S3
KIN02776522
2,4,4A,5,6,7-HEXAHYDRO-2-(4-METHOXY-PHENYL) -9-METHYL-3H-THIENO[2',3':6,7]CYCLOHEPTA[1,2-C]PYRIDAZIN-3-ONE
CAS:129477-46-9
Formula: C19H20N2O2S
KIN03206010
2,4,4A,5,6,7-HEXAHYDRO-3H-BENZO[6,7]CYCLOHEPTA[1,2-C]PYRIDAZIN-3-ONE
CAS:25742-87-4
Formula: C13H14N2O
KIN02142430
2,4,4A,5,6,7-HEXAHYDRO-3H-CYCLOPENTA[C]PYRIDAZIN-3-ONE
CAS:94767-50-7
Formula: C7H10N2O
KIN02784867
2,4,4A,5-TETRAHYDRO-7-(METHYLAMINO)-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-73-0
Formula: C12H13N3O
KIN03134142
2,4,4A,5-TETRAHYDRO-7-HYDROXY-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-72-9
Formula: C11H10N2O2
KIN03134141
2,4,4A,5-TETRAHYDRO-8-NITRO-3H-INDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:114915-66-1
Formula: C11H9N3O3
KIN03134137
2,4,4A,5-TETRAHYDROINDENO[1,2-C]PYRIDAZIN-3-ONE
CAS:69099-74-7
Formula: C11H10N2O
KIN02567943
2,4,4A,8-TETRAHYDRO-4-HYDROXY-4A-1H-INDOL-3-YL-6,8-DIMETHYLPYRIMIDO[5,4-E][1,2,4]-TRIAZIN-3,5,7(6H)-TRIONE
CAS:110621-93-7
Formula: C15H14N6O4
KIN03102756
2,4,4A,8-TETRAHYDRO-4A-1H-INDOL-3-YL-6,8-DIMETHYLPYRIMIDO[5,4-E][1,2,4]-TRIAZIN-3,5,7(6H)-TRIONE
CAS:113458-63-2
Formula: C15H14N6O3
KIN03123193
2,4,4A,9-TETRAHYDRO-3H-INDENO[2,1-C]PYRIDAZIN-3-ONE
CAS:100595-18-4
Formula: C11H10N2O
KIN03033142
2,4,5 -TRIBROMO-2,2,5,2 -TERTHIOPHENE
CAS:118824-91-2
Formula: C12H5Br3S3
KIN03156225
2,4,5,10-TETRAHYDRO-1H-PYRAZOLO[3,4-A]CARBAZOLE
CAS:169136-33-8
Formula: C13H11N3
KIN03344034
2,4,5,10-TETRAHYDRO-7-METHYL-1H-PYRAZOLO[3,4-A]CARBAZOLE
CAS:169136-32-7
Formula: C14H13N3
KIN03622835
2,4,5,10-TETRAHYDRO-AZEPINO[2,3-B]INDOL-5A(3H)-OL
CAS:23240-60-0
KIN02118185
2,4,5,12-TETRAHYDRO-12-(BENZYL)-[1,3]DIAZEPINO[2,1-B]QUINAZOLIN-7(3H)-ONE
CAS:55536-52-2
Formula: C19H19N3O
KIN02368133
2,4,5,2',4',5'-HEXABROMO-BIPHENYL
CAS:59080-40-9
Formula: *C12H4Br6
KIN02425871
2,4,5,2',5'-PENTACHLORO-BIPHENYL
CAS:37680-73-2
Formula: *C12H5Cl5
KIN02241689
MFCD00055553
2,4,5,2,4,5'-HEXABROMO[3,3 ]BITHIOPHENYL
CAS:35070-39-4
Formula: C8Br6S2
KIN02219533
2,4,5,3',4',5'-HEXACHLORO-BIPHENYL
CAS:52663-72-6
Formula: C12H4Cl6
KIN02323869
2,4,5,3',4'-PENTABROMO-BIPHENYL
CAS:67888-97-5
Formula: C12H5Br5
KIN02559106
2,4,5,5-TETRAETHYL-2,5-DIHYDRO-2,3-DIMETHYL-1-(TRIMETHYL-STANNYL)-1,2,5-OXONIASILABORATOLE
CAS:132126-05-7
Formula: C15H35BOSiSn
KIN03217321
2,4,5,5-TETRAMETHYL-[1,2,4]-TRIAZOLIDINE-3-THIONE
CAS:115029-47-5
Formula: C6H13N3S
KIN03134844
2,4,5,5-TETRAMETHYL-2,3-OCTADIEN-6-YNE
CAS:65150-08-5
Formula: C12H18
KIN02522094
2,4,5,5-TETRAMETHYL-2,6-OCTADIENE
CAS:65132-94-7
Formula: C12H22
KIN02521786
2,4,5,5-TETRAMETHYL-2-[2-(1-HYDROXY-3,5-DI-TERT-BUTYLCYCLOHEXADIEN-2,5-ONYL) -1-ETHYL]-3(1H)-IMIDAZOLINE, 3-OXIDE
CAS:105654-17-9
Formula: C23H38N2O3
KIN03070024
2,4,5,5-TETRAMETHYL-2-PHENYL-1,3-DIOXANE
CAS:24571-27-5
Formula: C14H20O2
KIN02131721
2,4,5,5-TETRAMETHYL-3-CYCLOHEPTEN-1-ONE
CAS:65371-62-2
Formula: C11H18O
KIN02525699
2,4,5,5-TETRAMETHYL-4-PROPAN-2-YL-3-HEXANONE
CAS:79964-62-8
Formula: C13H26O
KIN02640944
2,4,5,5-TETRAMETHYL-HEPTANE
CAS:61868-58-4
Formula: C11H24
KIN02463530
2,4,5,5-TETRAMETHYL-OCTANE
CAS:62199-36-4
Formula: C12H26
KIN02469900
2,4,5,6(1H,3H)-PYRIMIDINETETRONE
CAS:50-73-7
Formula: C7H3Cl3O2
KIN01000064
2,4,5,6(1H,3H)-PYRIMIDINETETRONE 5-[(3,7-DIMETHYL-2,6-DIOXO-2,3,6,7-TETRAHYDRO-1H-PURIN-8-YL)HYDRAZONE]
CAS:476481-27-3
Formula: C11H10N8O5
KIN03603638
2,4,5,6(1H,3H)-PYRIMIDINETETRONE 5-[(7-BENZYL-1,3-DIMETHYL-2,6-DIOXO-2,3,6,7-TETRAHYDRO-1H-PURIN-8-YL)HYDRAZONE]
CAS:476481-71-7
Formula: C18H16N8O5
KIN03603647
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(2-METHYLPHENYL)HYDRAZONE]
CAS:111709-59-2
Formula: C11H10N4O3
KIN03109480
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(2-NITROPHENYL)HYDRAZONE]
CAS:111709-57-0
Formula: C10H7N5O5
KIN03109479
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(3-NITROPHENYL)HYDRAZONE]
CAS:19849-54-8
Formula: C10H7N5O5
KIN02085451
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-CHLOROPHENYL)HYDRAZONE]
CAS:7293-32-5
Formula: C10H8N2O3S
KIN01183719
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-METHOXY-PHENYL)HYDRAZONE]
CAS:19849-56-0
Formula: C11H10N4O4
KIN02085453
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[(4-METHYLPHENYL)HYDRAZONE]
CAS:19849-57-1
Formula: C11H10N4O3
KIN02085454
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(3-ACETYLPHENYL)HYDRAZONE]
CAS:314758-51-5
Formula: C12H10N4O4
KIN03489713
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(4-ACETYLPHENYL)HYDRAZONE]
CAS:342783-96-4
Formula: C12H10N4O4
KIN03516694
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-(4-IODO-PHENYL)HYDRAZONE]
CAS:314758-35-5
Formula: C10H7IN4O3
KIN03489712
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-[2,3,6,7-TETRAHYDRO-3-METHYL-7-(3-METHYLBUTYL)-2,6-DIOXO-1H-PURIN-8-YL]HYDRAZONE]
CAS:476481-33-1
Formula: C15H18N8O5
KIN03603639
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-[7-(3-CHLORO-BUT-2-EN-1-YL)-2,3,6,7-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-1H-PURIN-8-YL]HYDRAZONE]
CAS:478253-38-2
Formula: C15H15ClN8O5
KIN03606499
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-[2-PYRIDIN-3-YLHYDRAZONE]
CAS:327087-31-0
KIN03497403
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-HYDRAZONE
CAS:89603-59-8
Formula: C4H4N4O3
KIN02714205
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME
CAS:87-40-1
Formula: C7H5Cl3O
KIN01002171
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME MONOPOTASSIUM SALT DIHYDRATE
CAS:5138-04-5
Formula: C25H20Cl2FN5O4S
KIN01121473
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, 5-OXIME, SODIUM SALT
CAS:825-30-9
KIN01030808
2,4,5,6(1H,3H)-PYRIMIDINETETRONE, TRIHYDRATE
CAS:75870-79-0
Formula: C4H8N2O7
KIN02615392
2,4,5,6(1H,3H)-PYRIMIDINETETRONE,5-[[3-(DIFLUOROMETHOXY)PHENYL]HYDRAZONE]
CAS:302583-86-4
Formula: C11H8F2N4O4
KIN03478163
2,4,5,6(1H,3H)-PYRIMIDINETETRONE,5-[[4-(DIFLUOROMETHOXY)PHENYL]HYDRAZONE]
CAS:302935-80-4
Formula: C11H8F2N4O4
KIN03478655
2,4,5,6,7,7-HEXAMETHYL-4-OCTEN-3-ONE
CAS:81786-84-7
Formula: C14H26O
KIN02651743
2,4,5,6,7,7-HEXAMETHYL-5-OCTEN-3-ONE
CAS:81786-86-9
Formula: C14H26O
KIN02651745
2,4,5,6,7,7A-HEXAHYDRO-1,1-DIMETHYL-1H-PHOSPHINDOLIUM IODIDE
CAS:57065-73-3
Formula: C10H18P.I
KIN02393385
2,4,5,6,7,7A-HEXAHYDRO-1-HYDROXY-2,2,7A-TRIMETHYL-1H-BENZO[D]IMIDAZOLE 3-OXIDE
CAS:29522-49-4
Formula: C10H18N2O2
KIN02174646
2,4,5,6,7,7A-HEXAHYDRO-1H-INDEN-6-YLIUM
CAS:67731-45-7
Formula: C9H13
KIN02557249
2,4,5,6,7,7A-HEXAHYDRO-2,2,3-TRIFLUORO-7A-METHYLBENZO[B]THIOPHENE
CAS:100333-45-7
Formula: [C9H11F3S
KIN03030690
2,4,5,6,7,7A-HEXAHYDRO-2-[(1E,3E,5E,7E,9E,11E)-13-HYDROXY-1,5,10-TRIMETHYL-1,3,5,7,9,11-TRIDECAHEXAENYL]-4,4,7A-TRIMETHYL-6-BENZOFURANOL
CAS:53905-15-0
Formula: C27H38O3
KIN02342116
2,4,5,6,7,7A-HEXAHYDRO-2-OXO-3-BENZOFURANCARBONITRILE
CAS:103324-80-7
Formula: C9H9NO2
KIN03656619
2,4,5,6,7,7A-HEXAHYDRO-3-BENZOFURANCARBALDEHYDE
CAS:252721-65-6
Formula: [C9H12O2
KIN03452654
2,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDENE
CAS:87238-76-4
Formula: C10H14
KIN02685309
2,4,5,6,7,7ALPHA-HEXAHYDRO-1-(1-METHYLETHYL)-1H-INDEN-1-OL
CAS:143398-18-9
Formula: C12H20O
KIN03270009
2,4,5,6,7,8,8-HEPTACHLORO-3A,4,7,7A-TETRAHYDRO-4,7-METHANO-1H-INDENE
CAS:5103-66-2
Formula: C12H8Cl6O4
KIN01120771
2,4,5,6,7,8-HEXAFLUORO-1(4H)-NAPHTHALENONE
CAS:57070-24-3
KIN02393590
2,4,5,6,7,8-HEXAFLUORO-1,3-NAPHTHALENEDIOL
CAS:41481-27-0
KIN02271487
2,4,5,6,7,8-HEXAFLUORO-3-METHOXY-NAPHTHALEN-1-OL
CAS:72793-89-6
KIN02593879
2,4,5,6,7,8-HEXAFLUORO-3-METHYL-NAPHTHALEN-1-OL
CAS:54835-51-7
KIN02356214
2,4,5,6,7,8-HEXAFLUORO-3-PHENOXY-NAPHTHALEN-1-OL
CAS:57070-19-6
KIN02393587
2,4,5,6,7,8-HEXAFLUORO-QUINAZOLINE
CAS:28734-87-4
Formula: C8F6N2
KIN02168383
2,4,5,6,7,8-HEXAHYDRO-1,4,6-TRIMETHYL-3H-3A,6-EPOXYAZULENE
CAS:51334-45-3
Formula: C13H20O
KIN02305083
2,4,5,6,7,8-HEXAHYDRO-1,4-DIMETHYL-3H-3A,6-EPOXYAZULENE
CAS:51334-55-5
Formula: C12H18O
KIN02305089
2,4,5,6,7,8-HEXAHYDRO-3-CYCLOHEPTA-1H-PYRAZOLOL
CAS:117891-68-6
Formula: C8H12N2O
KIN03151362
2,4,5,6,7,8-HEXAHYDRO-3-CYCLOHEPTAPYRAZOLAMINE
CAS:54162-24-2
Formula: C8H13N3
KIN02346048
2,4,5,6,7,8-HEXAHYDRO-3-METHYLCYCLOHEPTA-1H-PYRAZOLE
CAS:114425-71-7
Formula: [C9H14N2
KIN03130688
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[4,5-C]AZEPIN-3-ONE
CAS:65202-72-4
Formula: C7H10N2O2
KIN02522968
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[4,5-D]AZEPIN-3-ONE
CAS:53658-58-5
Formula: C7H10N2O2
KIN02338515
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[5,4-B]AZEPIN-3-ONE
CAS:121379-66-6
Formula: C7H10N2O2
KIN03169434
2,4,5,6,7,8-HEXAHYDRO-3H-ISOXAZOLO[5,4-C]AZEPIN-3-ONE
CAS:65202-67-7
Formula: C7H10N2O2
KIN02522967
2,4,5,6,7,8-HEXAHYDRO-CYCLOHEPTA[C]PYRROLE
CAS:113880-83-4
Formula: C9H13N
KIN03126767
2,4,5,6,7,8-HEXAHYDRO-N,N,2-TRIMETHYL-3-CYCLOHEPTAPYRAZOLAMINE
CAS:51658-39-0
KIN02309787
2,4,5,6,7,8-HEXAHYDROAZULEN-2-YL-[2,4,5,6,7,8-HEXAHYDROAZULEN-2-YL-(DIMETHYL)SILYL]-DIMETHYLSILANE
CAS:209738-77-2
Formula: C24H38Si2
KIN03420368
2,4,5,6,7,8-HEXAHYDROPYRAZOLO[3,4-D]AZEPINE
CAS:111416-15-0
Formula: C7H11N3
KIN03107666
2,4,5,6,7,8-HEXAHYDROPYRAZOLO[4,3-C]AZEPINE
CAS:111416-17-2
Formula: C7H11N3
KIN03107667
2,4,5,6,7,8-HEXAMETHYL-AZULENE
CAS:63297-21-2
Formula: C16H20
KIN02490036
2,4,5,6,7,9-HEXATHIADECANE
CAS:88496-85-9
Formula: C4H10S6
KIN02699035
2,4,5,6,7-PENTABROMO-1H-BENZO[D]IMIDAZOLE
CAS:16865-25-1
Formula: C7HBr5N2
KIN02055781
MFCD07776823
2,4,5,6,7-PENTACHLORO-1H-BENZO[D]IMIDAZOLE
CAS:7682-38-4
Formula: C3HCl3N2
KIN01193321
2,4,5,6,7-PENTAFLUOROBENZOFURAN
CAS:337958-55-1
KIN03510254
2,4,5,6,7-PENTAMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:69700-34-1
Formula: C12H16N2
KIN02572208
2,4,5,6,7-PENTAMETHYL-2H-ISOINDOLE
CAS:126134-14-3
Formula: C13H17N
KIN03191575
2,4,5,6,7-PENTAMETHYL-QUINOLINE
CAS:1639-31-2
Formula: C9H13N
KIN01052232
2,4,5,6,7-PENTAMETHYLINDEN-1-ONE
CAS:147834-98-8
Formula: C14H16O
KIN03287525
2,4,5,6,8-PENTAMETHYL-QUINOLINE
CAS:50519-33-0
Formula: C14H17N
KIN02293876
2,4,5,6-PYRIMIDINETETRAMINE, 2HBR
CAS:158754-80-4
Formula: C4H8N6.2BrH
KIN03321416
2,4,5,6-PYRIMIDINETETRAMINE, 2HCL
CAS:52980-67-3
Formula: C4H9ClN6
KIN02328445
MFCD00859060
2,4,5,6-PYRIMIDINETETRAMINE, 3HCL
CAS:51093-30-2
Formula: C4H8N6.3ClH
KIN02301588
2,4,5,6-PYRIMIDINETETRAMINE, ACETATE (1:)
CAS:101511-84-6
Formula: C4H8N6.xC2H4O2
KIN03039960
2,4,5,6-PYRIMIDINETETRAMINE, HBR (1:3)
CAS:278800-37-6
Formula: C4H8N6.3BrH
KIN03466174
2,4,5,6-PYRIMIDINETETRAMINE, HCL
CAS:65540-06-9
Formula: C4H9ClN6
KIN02528502
2,4,5,6-PYRIMIDINETETRAMINE, HCL (1:)
CAS:39944-62-2
Formula: C4H8N6.x(HCl)
KIN02258711
MFCD01310538
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE
CAS:5392-30-3
Formula: C17H14N2O5
KIN01128364
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE (1:)
CAS:49647-58-7
Formula: C4H8N6.H2SO4
KIN02289422
MFCD00012786
2,4,5,6-PYRIMIDINETETRAMINE, SULFATE (1:4)
CAS:1004297-42-0
Formula: C4H8N6.4H2O4S
KIN05009401
2,4,5,6-PYRIMIDINETETRAMINE, SULFITE
CAS:65003-86-3
Formula: C4H8N6.H2O3S
KIN02519472
2,4,5,6-PYRIMIDINETETRAMINE, TOSYLATE
CAS:39232-37-6
Formula: C7H8O3S.C4H8N6
KIN02254084
2,4,5,6-QUINAZOLINETETRAMINE
CAS:215182-74-4
Formula: C8H10N6
KIN03427589
2,4,5,6-TETRAAMINOPYRIMIDE, SULFATE
CAS:103661-14-9
KIN03055333
2,4,5,6-TETRAAMINOPYRIMIDINE
CAS:1004-75-7
Formula: C5H8N4O
KIN01036585
2,4,5,6-TETRACARBOXY-BENZENE-1,3-DICARBOXYLATE
CAS:7235-74-7
Formula: C20H16F3N3O
KIN01182184
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONITRILE
CAS:216082-57-4
Formula: C8Cl4N2
KIN03428779
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONITRILE MIXT. WITH 4-[(2R)-2-[(1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL]-2-HYDROXYETHYL]-2,6-PIPERIDINEDIONE
CAS:37301-48-7
KIN02238480
2,4,5,6-TETRACHLORO-1,3-BENZENEDICARBONYL DICHLORIDE
CAS:77450-97-6
Formula: C8Cl6O2
KIN02625697
2,4,5,6-TETRACHLORO-2-CYCLOHEXEN-1-OL
CAS:78137-69-6
Formula: C6H6Cl4O
KIN02629521
2,4,5,6-TETRACHLORO-3-AMINO-ANILINE
CAS:26288-19-7
Formula: C6H4Cl4N2
KIN02147088
2,4,5,6-TETRACHLORO-3-FORMYLBENZALDEHYDE
CAS:40860-93-3
Formula: C8H2Cl4O2
KIN02266395
2,4,5,6-TETRACHLORO-3-HYDROXY-PHENOL
CAS:28520-00-5
Formula: C6H2Cl4O2
KIN02166697
2,4,5,6-TETRACHLORO-3-HYDROXY-PHENOL DIACETATE
CAS:69158-26-5
Formula: C10H6Cl4O4
KIN02568376
2,4,5,6-TETRACHLORO-3-METHYL-TOLUEN-ALPHA,ALPHA'-DIAMINE
CAS:16969-06-5
Formula: C8H8Cl4N2
KIN02056846
MFCD00025573
2,4,5,6-TETRACHLORO-3-METHYL-TOLUENE
CAS:877-10-1
Formula: C8H6Cl4
KIN01032568
2,4,5,6-TETRACHLORO-3-PYRIDINECARBONYL CHLORIDE
CAS:35592-28-0
KIN02224511
2,4,5,6-TETRACHLORO-3-PYRIDINETHIOL
CAS:75723-81-8
Formula: C5HCl4NS
KIN02614427
2,4,5,6-TETRACHLORO-ISOPHTHALAMIDE
CAS:1786-87-4
Formula: C8H6O6
KIN01055839
2,4,5,6-TETRACHLOROBENZENE-1,3-DICARBONITRILE
CAS:1897-46-7
KIN01058358
2,4,5,6-TETRACHLOROBENZENE-1,3-DICARBOXYLIC ACID
CAS:7401-91-4
Formula: C5H11ClHgO
KIN01186054
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBONITRILE
CAS:17824-82-7
Formula: C6Cl4N2
KIN02066023
MFCD00624086
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXAMIDE
CAS:70593-60-1
Formula: C6H2Cl4N2O
KIN02578490
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID
CAS:35592-22-4
KIN02224506
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID ETHYL ESTER
CAS:180298-66-2
KIN03622834
2,4,5,6-TETRACHLOROPYRIDIN-3-CARBOXYLIC ACID METHYL ESTER
CAS:35592-30-4
KIN02224513
2,4,5,6-TETRACHLOROPYRIDIN-3-YLAMINE
CAS:447433-84-3
Formula: C5H2Cl4N2
KIN03589099
2,4,5,6-TETRACHLOROPYRIMIDINE
CAS:1780-42-3
Formula: C7H7Cl3N2
KIN01055658
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIACETONITRILE
CAS:1000535-81-8
Formula: C10H4F4N2
KIN05002489
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBONITRILE
CAS:2377-85-7
Formula: C8F12
KIN01068120
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBONYL DICHLORIDE
CAS:110649-97-3
Formula: C8Cl2F4O2
KIN03102910
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXAMIDE
CAS:153279-27-7
Formula: C8H4F4N2O2
KIN03304655
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID BIS(2-METHYL-ALLYL) ESTER
CAS:114645-84-0
KIN03132373
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID DIETHYL ESTER
CAS:119947-29-4
KIN03161506
2,4,5,6-TETRAFLUORO-1,3-BENZENEDICARBOXYLIC ACID ION(II)
CAS:437756-92-8
Formula: C8F4O4
KIN03622833
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIETHANAMINE
CAS:1000550-58-2
Formula: C10H12F4N2
KIN05003150
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANAMINE
CAS:478912-17-3
Formula: C8H8F4N2
KIN03607329
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANETHIOL
CAS:119947-36-3
KIN03161509
2,4,5,6-TETRAFLUORO-1,3-BENZENEDIMETHANOL
CAS:119947-30-7
Formula: C8H6F4O2
KIN03161507
2,4,5,6-TETRAFLUORO-1-N 3-N-BIS(TRIMETHYLSILYL)-BENZENE-1,3-DIAMINE
CAS:141551-68-0
Formula: C12H20F4N2Si2
KIN03260812
2,4,5,6-TETRAFLUORO-2,4-CYCLOHEXADIEN-1-ONE
CAS:57070-22-1
Formula: C6H2F4O
KIN02393588
2,4,5,6-TETRAFLUORO-3-(PENTAFLUOROPHENOXY) -6-PHENYL-2,4-CYCLOHEXADIEN-1-ONE
CAS:152342-45-5
Formula: C18H5F9O2
KIN03301760
2,4,5,6-TETRAFLUORO-3-AMINO-ANILINE
CAS:1198-64-7
Formula: C6H4F4N2
KIN01043046
2,4,5,6-TETRAFLUORO-3-AMINO-ANILINE 2HCL
CAS:63886-77-1
Formula: C6H4F4N2.2HCl
KIN02500645
2,4,5,6-TETRAFLUORO-3-FORMYLBENZALDEHYDE
CAS:137593-09-0
Formula: C8H2F4O2
KIN03242288
2,4,5,6-TETRAFLUORO-3-HYDROXY-PHENOL
CAS:16840-25-8
Formula: C6H2F4O2
KIN02055514
Tetrafluoro-resorcinol
MFCD00040202
2,4,5,6-TETRAFLUORO-3-HYDROXY-PHENOL HYDRATE
CAS:207738-03-2
Formula: C6H2F4O2.xH2O
KIN03417774
2,4,5,6-TETRAFLUORO-3-PYRIDINECARBALDEHYDE
CAS:24306-75-0
Formula: C6HF4NO
KIN02129126
2,4,5,6-TETRAFLUORO-3-PYRIDINOL
CAS:74199-51-2
Formula: C5HF4NO
KIN02604049
2,4,5,6-TETRAFLUORO-4-ALLYL-3(4H)-PYRIDINONE
CAS:1071193-17-3
Formula: C8H5F4NO
KIN05112048
2,4,5,6-TETRAFLUORO-ALPHA-PHENYL-3-PYRIDINEMETHANOL
CAS:259675-89-3
Formula: C12H7F4NO
KIN03678528
2,4,5,6-TETRAFLUORO-ISOPHTHALIC ACID
CAS:1551-41-3
Formula: C15H28O2
KIN01049904
2,4,5,6-TETRAFLUORO-N1,N1,N3,N3-TETRAMETHYL-3-AMINO-ANILINE
CAS:2241-50-1
Formula: C8H8F3N3O2
KIN01065565
2,4,5,6-TETRAFLUOROPYRIDIN-3-CARBONITRILE
CAS:35720-79-7
Formula: C6F4N2
KIN02225765
2,4,5,6-TETRAFLUOROPYRIDIN-3-CARBOXYLIC ACID
CAS:3512-16-1
Formula: C5HF4N
KIN01090595
2,4,5,6-TETRAFLUOROPYRIMIDINE
CAS:767-80-6
Formula: C4H3FN2O3
KIN01028780
2,4,5,6-TETRAHYDRO-1,2,3,4,6,6-HEXAMETHYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-84-6
Formula: C14H22N2O
KIN02352671
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(2-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-00-3
Formula: C20H26N2O
KIN02352682
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(3-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-98-2
Formula: C20H26N2O
KIN02352680
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(4-METHYLPHENYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-94-8
Formula: C20H26N2O
KIN02352677
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-(BENZYL)CYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-92-6
Formula: C20H26N2O
KIN02352676
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-27-7
Formula: C19H22N2
KIN02352661
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-89-1
Formula: C19H24N2O
KIN02352673
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPAN-2-YLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-07-0
Formula: C16H26N2O
KIN02352685
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-29-9
Formula: C16H24N2
KIN02352662
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYL-2-PROPYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-91-5
Formula: C16H26N2O
KIN02352675
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYLCYCLOPENTA[C]PYRROL-4-CARBONITRILE
CAS:54609-24-4
Formula: C13H18N2
KIN02352660
2,4,5,6-TETRAHYDRO-1,3,4,6,6-PENTAMETHYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54609-85-7
Formula: C13H20N2O
KIN02352672
2,4,5,6-TETRAHYDRO-1-(HYDROXYMETHYL) -4,6,6-TRIMETHYL-2-PHENYLCYCLOPENTA[C]PYRROL-4-CARBOXAMIDE
CAS:54610-34-3
Formula: C18H22N2O2
KIN02352691
2,4,5,6-TETRAHYDRO-1-METHYLCYCLOPENTA[C]PYRROLE
CAS:151464-92-5
Formula: C8H11N
KIN03299446
2,4,5,6-TETRAHYDRO-1H-CYCLOBUTA[F]INDENE
CAS:60582-10-7
Formula: C11H12
KIN02445808
2,4,5,6-TETRAHYDRO-1H-PYRAZINO[3,2,1-JK]CARBAZOLE
CAS:56903-46-9
KIN02390494
2,4,5,6-TETRAHYDRO-2,5,6-TRIMETHYL-7-(NAPHTHALEN-1-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:36981-18-7
KIN02235910
2,4,5,6-TETRAHYDRO-2,5,6-TRIMETHYL-7-(NAPHTHALEN-2-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:36981-17-6
KIN02235909
2,4,5,6-TETRAHYDRO-2,5-DIMETHYL-3-CYCLOPENTAPYRAZOLECARBONYL CHLORIDE
CAS:132529-87-4
Formula: C9H11ClN2O
KIN03219259
2,4,5,6-TETRAHYDRO-2,6-DIMETHYL-3-CYCLOPENTAPYRAZOLECARBONYL CHLORIDE
CAS:146979-79-5
Formula: C9H11ClN2O
KIN03284305
2,4,5,6-TETRAHYDRO-2-METHYL-1,7-ETHENOCYCLOHEPTA[C]PYRROLE
CAS:59138-80-6
Formula: C12H13N
KIN02426786
2,4,5,6-TETRAHYDRO-2-METHYL-1H-BENZO[DE]ISOQUINOLIN-1-ONE
CAS:142944-63-6
KIN03267459
2,4,5,6-TETRAHYDRO-2-METHYL-3-CYCLOPENTAPYRAZOLECARBOXYLIC ACID
CAS:129560-01-6
Formula: C8H10N2O2
KIN03206350
2,4,5,6-TETRAHYDRO-2-METHYL-6-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:53277-31-9
KIN02332675
2,4,5,6-TETRAHYDRO-2-METHYL-7-(THIOPHEN-2-YL)-3H-1,2-DIAZEPIN-3-ONE
CAS:35641-80-6
KIN02224980
2,4,5,6-TETRAHYDRO-2-METHYL-7-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:29953-91-1
KIN02178008
2,4,5,6-TETRAHYDRO-2-METHYLCYCLOPENTAPYRAZOLE
CAS:84597-86-4
KIN02668626
2,4,5,6-TETRAHYDRO-3-CYCLOPENTAPYRAZOLAMINE
CAS:1092301-31-9
Formula: C6H9N3
KIN05133162
2,4,5,6-TETRAHYDRO-3-CYCLOPENTAPYRAZOLEETHANAMINE
CAS:1083368-50-6
Formula: C8H13N3
KIN05124565
2,4,5,6-TETRAHYDRO-3-METHYLCYCLOPENTAPYRAZOLE
CAS:84597-98-8
KIN02668627
2,4,5,6-TETRAHYDRO-3-PYRIDIN-4-YLBENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:52837-82-8
Formula: C17H15N3
KIN02326604
2,4,5,6-TETRAHYDRO-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-43-1
KIN02346421
2,4,5,6-TETRAHYDRO-5,5,7-TRIMETHYL-3H-1,2,4-TRIAZEPINE-3-THIONE
CAS:58488-41-8
Formula: C7H13N3S
KIN02416419
2,4,5,6-TETRAHYDRO-5,5-DIMETHYLCYCLOPENTA[C]PYRROLE
CAS:95014-44-1
Formula: C9H13N
KIN02787180
2,4,5,6-TETRAHYDRO-5-METHYL-7-PHENYL-3H-1,2-DIAZEPIN-3-ONE
CAS:35641-79-3
KIN02224979
2,4,5,6-TETRAHYDRO-6-(4-METHYLPHENYL)-3-PHENYL-7H-PYRAZOLO[3,4-C]PYRIDIN-7-ONE
CAS:6506-36-1
Formula: C27H28ClN3
KIN01163862
2,4,5,6-TETRAHYDRO-7-METHYL-2-[2-(MORPHOLIN-4-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE
CAS:58191-92-7
Formula: C12H21N3O2
KIN02411976
2,4,5,6-TETRAHYDRO-7-METHYL-2-[2-(MORPHOLIN-4-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE MALEATE
CAS:58191-93-8
Formula: C12H21N3O2.C4H4O4
KIN02411977
2,4,5,6-TETRAHYDRO-7-PHENYL-2-[2-(4-PHENYL-PIPERAZIN-1-YL)ETHYL]-3H-1,2-DIAZEPIN-3-ONE OXALATE
CAS:58191-85-8
Formula: C23H28N4O
KIN02411972
2,4,5,6-TETRAHYDRO-7H-INDAZOL-7-ONE
CAS:165686-41-9
Formula: C7H8N2O
KIN03337767
2,4,5,6-TETRAHYDRO-8-METHOXY-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-45-3
Formula: C15H17N3O
KIN02346422
2,4,5,6-TETRAHYDRO-8-PHENYL-1H-PYRAZINO[3,2,1-JK]CARBAZOLE MONOMETHANESULFONATE
CAS:134285-31-7
Formula: [C21H22N2O3S
KIN03227532
2,4,5,6-TETRAHYDRO-9-METHOXY-3-PYRIDIN-4-YLBENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:52837-87-3
Formula: C18H17N3O
KIN02326605
2,4,5,6-TETRAHYDRO-9-METHOXY-4-METHYL-1H-3,4,6A-TRIAZAFLUORANTHENE
CAS:54188-38-4
Formula: C15H17N3O
KIN02346419
2,4,5,6-TETRAHYDRO-AZEPINO[3,2-B]INDOL-5A(3H)-OL
CAS:14296-23-2
KIN02030378
2,4,5,6-TETRAHYDRO-BENZO[3,4]CYCLOHEPTA[1,2]TRIAZOLE
CAS:96733-25-4
Formula: C11H11N3
KIN02802755
2,4,5,6-TETRAHYDRO-BENZO[6,7]CYCLOHEPTA[1,2-C]PYRAZOLE
CAS:108650-93-7
Formula: C12H12N2
KIN03645306
2,4,5,6-TETRAHYDRO-CYCLOPENTA-1H-PYRAZOL-3-OL
CAS:364746-32-7
Formula: C6H8N2O
KIN03539260
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROL-1-CARBOXYLIC ACID
CAS:144791-44-6
Formula: C8H9NO2
KIN03277276
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROL-1-CARBOXYLIC ACID ETHYL ESTER
CAS:128812-35-1
Formula: [C10H13NO2
KIN03203160
2,4,5,6-TETRAHYDRO-CYCLOPENTA[C]PYRROLE
CAS:95014-37-2
Formula: C7H9N
KIN02787179