Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

1-METHYL-1H-PYRROL-3-ETHANOL
CAS:420787-50-4
Formula: C7H11NO
KIN03573816
1-METHYL-1H-PYRROL-3-METHANAMINE
CAS:20863-72-3
Formula: C6H10N2
KIN02094639
1-METHYL-1H-PYRROL-3-METHANOL
CAS:68384-83-8
Formula: C6H9NO
KIN02562890
1-METHYL-1H-PYRROL-3-METHANOL 3-ACETATE
CAS:88054-28-8
Formula: C8H11NO2
KIN02692368
1-METHYL-1H-PYRROL-3-OL
CAS:107638-08-4
KIN03083864
1-METHYL-1H-PYRROL-3-PROPANENITRILE
CAS:150985-72-1
Formula: [C8H10N2
KIN03297816
1-METHYL-1H-PYRROL-3-PROPANOIC ACID
CAS:171858-12-1
Formula: C8H11NO2
KIN03349791
1-METHYL-1H-PYRROL-3-SULFONAMIDE
CAS:189062-99-5
Formula: [C5H8N2O2S
KIN03387310
1-METHYL-1H-PYRROL-3-SULFONYL CHLORIDE
CAS:142112-64-9
Formula: N1(C=CC(=C1)S(=O)(=O)Cl)C
KIN03263652
1-METHYL-1H-PYRROL-3-YLAMINE
CAS:72083-63-7
Formula: C5H8N2
KIN02588835
1-METHYL-1H-PYRROL-3-YLAMINE HCL
CAS:1194757-83-9
Formula: C5H9ClN2
KIN05335902
1-METHYL-1H-PYRROLE
CAS:96-55-9
Formula: C15H31NO2
KIN01002996
1-METHYL-1H-PYRROLE DICHLORO-DERIV
CAS:59284-04-7
Formula: C5H5Cl2N
KIN02429213
1-METHYL-1H-PYRROLECARBALDEHYDE
CAS:78249-88-4
Formula: C6H7NO
KIN02630334
1-METHYL-1H-PYRROLIDINE CONJUGATE ACID (2:1)
CAS:1174180-50-7
Formula: C5H11N.1/2H
KIN05265515
1-METHYL-1H-PYRROLIDINE HYDRATE
CAS:1174180-37-0
Formula: C5H11N.H2O.H
KIN05265513
1-METHYL-1H-PYRROLO[1,2-A]BENZO[D]IMIDAZOLE
CAS:59027-60-0
Formula: C11H10N2
KIN02425085
1-METHYL-1H-PYRROLO[1,2-A]PYRAZINE
CAS:64608-59-9
Formula: C8H8N2
KIN02512582
1-METHYL-1H-PYRROLO[1,2-C]PYRIMIDINE
CAS:251102-35-9
Formula: [C8H8N2
KIN03451235
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-2,3-DIONE
CAS:281192-94-7
Formula: [C8H6N2O2]
KIN03466941
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-2-CARBOXYLIC ACID ETHYL ESTER
CAS:172648-34-9
Formula: C11H12N2O2
KIN03351460
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-2-METHANOL
CAS:172648-56-5
Formula: C9H10N2O
KIN03351478
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-3,5-DICARBONITRILE
CAS:159831-34-2
Formula: C10H6N4
KIN03324407
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-3,5-DICARBOXYLIC ACID
CAS:199933-12-5
Formula: C10H8N2O4
KIN03406738
1-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-3-CARBALDEHYDE
CAS:171919-36-1
Formula: [C9H8N2O
KIN03350027
1-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:27257-15-4
Formula: C8H8N2
KIN02155621
1-METHYL-1H-PYRROLO[2,3-B]PYRIDINE 7-OXIDE
CAS:332875-32-8
Formula: [C8H8N2O
KIN03506116
1-METHYL-1H-PYRROLO[2,3-B]PYRIDINE-3-METHANAMINE
CAS:1092309-87-9
KIN05133492
1-METHYL-1H-PYRROLO[2,3-B]PYRIDINE-3-METHANOL
CAS:1097323-08-4
Formula: C9H10N2O
KIN05160386
1-METHYL-1H-PYRROLO[2,3-C]PYRIDIN-5-CARBALDEHYDE
CAS:478149-13-2
Formula: C9H8N2O
KIN03606238
1-METHYL-1H-PYRROLO[2,3-C]PYRIDIN-5-CARBOXYLIC ACID
CAS:478149-14-3
Formula: C9H8N2O2
KIN03606239
1-METHYL-1H-PYRROLO[2,3-D]PYRIDAZINE
CAS:19880-43-4
KIN02085815
1-METHYL-1H-PYRROLO[2,3-D]PYRIMIDIN-4-YLAMINE
CAS:81965-19-7
Formula: C7H8N4
KIN02652693
1-METHYL-1H-PYRROLO[2,3-D]PYRIMIDIN-4-YLAMINE HCL
CAS:78727-11-4
Formula: C7H8N4.ClH
KIN02633255
1-METHYL-1H-PYRROLO[2,3-D]PYRIMIDINE
CAS:159431-45-5
Formula: [C7H7N3
KIN03323285
1-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:153374-33-5
Formula: [C8H8N2
KIN03304912
1-METHYL-1H-PYRROLO[3,2-B]PYRIDINE, 4-OXIDE
CAS:1128075-82-0
KIN05181971
1-METHYL-1H-PYRROLO[3,2-C]PYRIDIN-3-CARBALDEHYDE
CAS:119910-38-2
Formula: [C9H8N2O
KIN03161283
1-METHYL-1H-PYRROLO[3,2-C]PYRIDIN-4-YLAMINE
CAS:102839-56-5
Formula: [C8H9N3
KIN03050242
1-METHYL-1H-PYRROLO[3,2-C]PYRIDIN-4-YLAMINE HCL
CAS:102839-64-5
Formula: C8H10ClN3
KIN03050245
1-METHYL-1H-PYRROLO[3,2-H]QUINOLINE
CAS:67509-90-4
Formula: C12H10N2
KIN02554371
1-METHYL-1H-TETRAZOL-5-ACETIC ACID
CAS:21743-76-0
Formula: C4H6N4O2
KIN02103866
1-METHYL-1H-TETRAZOL-5-ACETIC ACID ETHYL ESTER
CAS:5250-26-0
Formula: C26H26N4O6
KIN01123723
1-METHYL-1H-TETRAZOL-5-ACETIC ACID METHYL ESTER
CAS:121105-60-0
KIN03168026
1-METHYL-1H-TETRAZOL-5-CARBALDEHYDE
CAS:37468-62-5
Formula: C3H4N4O
KIN02239592
1-METHYL-1H-TETRAZOL-5-CARBALDEHYDE OXIME
CAS:37468-88-5
KIN02239605
1-METHYL-1H-TETRAZOL-5-CARBONITRILE
CAS:78984-95-9
Formula: C3H3N5
KIN02634899
1-METHYL-1H-TETRAZOL-5-CARBOXAMIDE
CAS:250645-56-8
Formula: C3H5N5O
KIN03450890
1-METHYL-1H-TETRAZOL-5-CARBOXYLIC ACID
CAS:77689-87-3
Formula: C3H4N4O2
KIN02626917
1-METHYL-1H-TETRAZOL-5-CARBOXYLIC ACID ETHYL ESTER
CAS:91616-41-0
Formula: C5H8N4O2
KIN02746429
1-METHYL-1H-TETRAZOL-5-CARBOXYLIC ACID METHYL ESTER
CAS:32366-17-9
Formula: C4H6N4O2
KIN02196333
1-METHYL-1H-TETRAZOL-5-ETHANAMINE
CAS:1103861-46-6
Formula: C4H9N5
KIN05169030
1-METHYL-1H-TETRAZOL-5-ETHANOL
CAS:15284-35-2
Formula: C4H8N4O
KIN02040108
1-METHYL-1H-TETRAZOL-5-METHANAMINE
CAS:131052-36-3
KIN03212621
1-METHYL-1H-TETRAZOL-5-METHANETHIOL
CAS:80473-16-1
Formula: C3H6N4S
KIN02644324
1-METHYL-1H-TETRAZOL-5-PENTANOIC ACID
CAS:80473-01-4
Formula: C7H12N4O2
KIN02644318
1-METHYL-1H-TETRAZOL-5-PENTANOIC ACID METHYL ESTER
CAS:80472-98-6
Formula: C8H14N4O2
KIN02644315
1-METHYL-1H-TETRAZOL-5-SULFENOTHIOIC ACID
CAS:262593-05-5
KIN03460082
1-METHYL-1H-TETRAZOL-5-SULFENYL CHLORIDE
CAS:61709-52-2
Formula: C2H3ClN4S
KIN02460371
1-METHYL-1H-TETRAZOL-5-SULFONIC ACID
CAS:327088-87-9
KIN03497409
1-METHYL-1H-TETRAZOL-5-SULFONYL CHLORIDE
CAS:87469-12-3
Formula: C2H3ClN4O2S
KIN02686991
1-METHYL-1H-TETRAZOLE
CAS:16681-77-9
Formula: C2H4N4
KIN02053874
MFCD00129972
1-METHYL-1H-THIENO[3,4-D]IMIDAZOL-2(3H)-ONE
CAS:1149809-57-3
Formula: C6H6N2OS
KIN05196761
1-METHYL-1H-XANTHENE-3,9(2H,4H)-DIONE
CAS:92254-42-7
Formula: C14H12O3
KIN02754772
1-METHYL-1L4-1,2-THIAZIN-4-CARBOXYLIC ACID 1-OXIDE
CAS:88628-87-9
Formula: C6H7NO3S
KIN02700579
1-METHYL-1L4-1,2-THIAZINE 1-OXIDE
CAS:88628-88-0
Formula: C5H7NOS
KIN02700580
1-METHYL-2',3'-O-(1-METHYLETHYLIDENE)-ADENOSINE
CAS:4285-22-7
Formula: C8H7N3O3S2.Na
KIN01104480
1-METHYL-2'-O,3'-O,5'-O-TRIS(TRIMETHYLSILYL)INOSINE
CAS:55556-96-2
KIN02368412
1-METHYL-2'-O-METHYL-INOSINE
CAS:65150-69-8
Formula: C12H16N4O5
KIN02522101
1-METHYL-2(1H)-IMIDAZOLIDINESELONE
CAS:66194-75-0
Formula: C4H8N2Se
KIN02538499
1-METHYL-2(1H)-IMIDAZOLIDINETHIONE LITHIUM SALT
CAS:62783-54-4
Formula: C4H8N2S.Li
KIN02480301
1-METHYL-2(1H)-IMIDAZOLIDINONE LITHIUM SALT
CAS:62783-53-3
Formula: C4H8N2O.Li
KIN02480300
1-METHYL-2(1H)-ISOQUINOLINECARBALDEHYDE
CAS:205596-60-7
Formula: C11H11NO
KIN03415188
1-METHYL-2(1H)-PTERIDINONE
CAS:102170-45-6
Formula: C7H6N4O
KIN03045023
1-METHYL-2(1H)-PYRAZINONE
CAS:3149-28-8
Formula: C5H6N2O
KIN01083299
1-METHYL-2(1H)-PYRIDINESELONE
CAS:2240-88-2
Formula: C3H5F3O
KIN01065558
1-METHYL-2(1H)-PYRIDINETHIONE-3,5-D2
CAS:51206-41-8
KIN02303032
1-METHYL-2(1H)-PYRIDINIMINE
CAS:86711-58-2
KIN02681995
1-METHYL-2(1H)-PYRIDINONE 2-PYRIDIN-2-YLHYDRAZONE
CAS:26639-51-0
KIN02150119
1-METHYL-2(1H)-PYRIDINONE COMPD. WITH,PICRATE
CAS:104742-77-0
Formula: C6H7NO.C6H3N3O7
KIN03063600
1-METHYL-2(1H)-PYRIDINONE DIMER
CAS:94071-56-4
Formula: C6H7NO
KIN02777293
1-METHYL-2(1H)-PYRIDINONE HYDRAZONE
CAS:28219-35-4
Formula: C6H9N3
KIN02164198
1-METHYL-2(1H)-PYRIMIDINETHIONE
CAS:73547-86-1
Formula: C5H6N2S
KIN02598994
1-METHYL-2(1H)-PYRIMIDINIMINE
CAS:1025693-77-9
KIN05059170
1-METHYL-2(1H)-PYRIMIDINONE HBR
CAS:73192-95-7
Formula: C5H6N2O.BrH
KIN02596568
1-METHYL-2(1H)-PYRIMIDINONE HCL
CAS:38353-10-5
Formula: C5H6N2O.ClH
KIN02247296
1-METHYL-2(1H)-PYRIMIDINONE PICRATE
CAS:96254-24-9
Formula: C6H3N3O7.C5H6N2O
KIN02799325
1-METHYL-2(1H)-PYRIMIDINONE-5-D
CAS:83004-49-3
Formula: C5H5DN2O
KIN02658795
1-METHYL-2(1H)-PYRIMIDINONE-P-NITRO-BENZALDEHYDEAZINE
CAS:95566-53-3
Formula: C12H11N5O2
KIN02792775
1-METHYL-2(1H)-QUINOXALINETHIONE
CAS:90418-02-3
Formula: C9H8N2S
KIN02727604
1-METHYL-2(3H)-INDOLIZINONE
CAS:75247-98-2
Formula: C9H9NO
KIN02611334
1-METHYL-2,2'-BI-1H-IMIDAZOLE
CAS:37570-85-7
Formula: C7H8N4
KIN02240634
1-METHYL-2,2'-BI-1H-PERIMIDINE
CAS:153960-51-1
Formula: C23H16N4
KIN03307041
1-METHYL-2,2'-BIPYRIDINIUM CHLORIDE
CAS:83892-29-9
Formula: C11H11N2.Cl
KIN02664115
1-METHYL-2,2'-BIPYRIDINIUM IODIDE
CAS:77972-47-5
Formula: C11H12I2N2
KIN02628572
1-METHYL-2,2(1H)-IMIDAZOLIDINEDITHIOL
CAS:343268-29-1
Formula: C4H10N2S2
KIN03517218
1-METHYL-2,2,3,3,4,4,5,5-OCTAPHENYL-1-(TRIMETHYLSILYL)CYCLOPENTASILANE
CAS:56706-07-1
Formula: C52H52Si6
KIN02387316
1-METHYL-2,2,3,3-TETRAFLUOROPROPYLCARBAMATE
CAS:756-60-5
KIN01028278
1-METHYL-2,2-AZIRIDINEDICARBOXAMIDE
CAS:95183-57-6
Formula: C5H9N3O2
KIN02788926
1-METHYL-2,2-AZIRIDINEDICARBOXYLIC ACID
CAS:1171247-16-7
Formula: C5H7NO4
KIN05262161
1-METHYL-2,2-DIPHENYL-1,2-AZAGERMETIDINE
CAS:67601-90-5
Formula: C15H17GeN
KIN02555559
1-METHYL-2,2-DIPHENYLCYCLOPROPAN-1-CARBONITRILE
CAS:56701-20-3
Formula: C17H15N
KIN02387203
1-METHYL-2,2-DIPHENYLCYCLOPROPAN-CARBALDEHYDE
CAS:56701-21-4
KIN02387204
1-METHYL-2,2-DIPHENYLCYCLOPROPAN-CARBOXYLIC ACID
CAS:35389-12-9
Formula: C17H16O2
KIN02222668
1-METHYL-2,2-DIPHENYLETHYLENE
CAS:778-67-6
KIN01029419
1-METHYL-2,3'-BIQUINOLINIUM IODIDE
CAS:67410-30-4
Formula: C19H15N2.I
KIN02553124
1-METHYL-2,3,3A,4-TETRAHYDRO-1H-INDENE
CAS:11079-08-6
Formula: C10H14
KIN02009340
1-METHYL-2,3,4(1H)-QUINOLINETRIONE
CAS:2291-50-1
KIN01066573
1-METHYL-2,3,4(1H)-QUINOLINETRIONE 3-OXIME
CAS:36412-07-4
Formula: C10H8N2O3
KIN02231675
1-METHYL-2,3,4,4A,5,6-HEXAHYDROCYCLOPENTA[B]PYRIDINE
CAS:87850-81-5
Formula: C9H15N
KIN02690266
1-METHYL-2,3,4,5,6,7-HEXAHYDROPHOSPHINDOLE, 1-OXIDE
CAS:57065-64-2
Formula: C9H15OP
KIN02393384
1-METHYL-2,3,4,5-TETRAHYDRO-1H-BENZO[B][1,4]DIAZEPINE
CAS:32900-36-0
Formula: C10H14N2
KIN02200873
MFCD09907834
1-METHYL-2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPIN-2,5-DIONE
CAS:1133-43-3
Formula: C10H7ClN2S
KIN01040946
1-METHYL-2,3,4,5-TETRAHYDROAZOCIN-6-ONE
CAS:108344-19-0
Formula: C8H13NO
KIN03088549
1-METHYL-2,3,4,5-TETRAKIS(METHYLTHIO)-1H-PYRROLE
CAS:136506-36-0
KIN03237228
1-METHYL-2,3,4,5-TETRANITRO-1H-PYRROLE
CAS:69726-67-6
Formula: C5H3N5O8
KIN02572377
1-METHYL-2,3,4,5-TETRANITRO-BENZENE
CAS:117972-99-3
Formula: C7H4N4O8
KIN03151890
1-METHYL-2,3,4,5-TETRAPHENYL-1H-BOROLE
CAS:62707-12-4
Formula: C29H23B
KIN02479019
1-METHYL-2,3,4,5-TETRAPHENYL-1H-PYRROLE
CAS:2406-04-4
Formula: C12H9NO
KIN01068813
1-METHYL-2,3,4,5-TETRAPHENYL-2,4-CYCLOPENTADIEN-1-OL
CAS:36052-85-4
Formula: C30H24O
KIN02228530
1-METHYL-2,3,4,5-TETRAPROPYLBENZENE
CAS:262860-66-2
Formula: C19H32
KIN03460231
1-METHYL-2,3,4,6-TETRAPHENYLPYRIDINIUM PERCHLORATE
CAS:51768-44-6
Formula: C30H24N.ClO4
KIN02311333
1-METHYL-2,3,4,9-TETRAHYDRO-1H-ALPHA-CARBOLINE
CAS:525-41-7
Formula: C12H12N2
KIN01018343
1-METHYL-2,3,4,9-TETRAHYDRO-1H-BETA-CARBOLIN-1-CARBOXYLIC ACID
CAS:6543-91-5
KIN01164631
1-METHYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOL-3-CARBOXYLIC ACID
CAS:5470-39-3
KIN01133542
1-METHYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOL-5,6-DIONE
CAS:137743-78-3
Formula: C12H12N2O2
KIN03243139
1-METHYL-2,3,4,9-TETRAHYDROPYRIDO[3,4-B]INDOL-1,3-DICARBOXYLIC ACID
CAS:18070-61-6
Formula: C14H14N2O4
KIN02068400
1-METHYL-2,3,4,9-TETRAHYDROPYRIDO[3,4-B]INDOL-7-ONE, TRIHYDRATE
CAS:6028-00-8
Formula: C12H12N2O.ClH.2H2O
KIN01147736
1-METHYL-2,3,4-PYRROLIDINETRIONE 3,4-DIOXIME
CAS:153946-80-6
KIN03307005
1-METHYL-2,3,4-PYRROLIDINETRIONE 4-OXIME
CAS:153946-79-3
KIN03307004
1-METHYL-2,3,4-TRINITRO-1H-PYRROLE
CAS:69726-53-0
Formula: C5H4N4O6
KIN02572364
1-METHYL-2,3,4-TRIPHENYL-AZETIDINE
CAS:286007-82-7
Formula: C22H21N
KIN03468422
1-METHYL-2,3,4-TRIS(METHYLTHIO)-1H-PYRROLE
CAS:102093-80-1
KIN03044392
1-METHYL-2,3,5,6,7,8-HEXAHYDRO-QUINOLIN-1-IUM-4-YLAMINE, PERCHLORATE
CAS:16283-59-3
Formula: C10H17ClN2O4
KIN02049829
1-METHYL-2,3,5,6-TETRAPHENYLPYRIDIN-4-ONE
CAS:51787-63-4
Formula: C30H23NO
KIN02311655
1-METHYL-2,3,5-TRINITRO-1H-PYRROLE
CAS:69726-47-2
Formula: C5H4N4O6
KIN02572358
1-METHYL-2,3,5-TRIS(1-METHYLETHYL)-BENZENE
CAS:70930-48-2
Formula: C16H26
KIN02580686
1-METHYL-2,3,5-TRIS(METHYLTHIO)-1H-PYRROLE
CAS:102093-79-8
KIN03044391
1-METHYL-2,3,6-TRIPHENYL-4-HYDROXY-PIPERIDINE
CAS:124069-10-9
Formula: C24H25NO
KIN03182634
1-METHYL-2,3,6-TRIPHENYL-4-PIPERIDINAMINE
CAS:124069-21-2
Formula: C24H26N2
KIN03182642
1-METHYL-2,3,6-TRIPHENYL-PIPERIDIN-4-ONE
CAS:71864-80-7
Formula: C24H23NO
KIN02587466
1-METHYL-2,3,6-TRIPHENYL-PIPERIDIN-4-ONE OXIME
CAS:113849-85-7
Formula: C24H24N2O
KIN03126521
1-METHYL-2,3,7-TRIOXA-BICYCLO[2.2.1]HEPT-5-ENE
CAS:53179-36-5
Formula: C5H6O3
KIN02331376
1-METHYL-2,3-BIS(1-METHYLETHOXY) -BENZENE
CAS:287117-34-4
Formula: C13H20O2
KIN03468966
1-METHYL-2,3-BIS(2-PROPEN-1-YLOXY) -BENZENE
CAS:125884-50-6
Formula: C13H16O2
KIN03190641
1-METHYL-2,3-BIS(BENZYL)-BENZENE
CAS:115643-65-7
Formula: C21H20
KIN03138272
1-METHYL-2,3-BIS(METHYL-4-TOLYLAMINO)-9-PHENYL-1,9-DIHYDROIMIDAZO[1,2-A]PYRIDIN-5,6,7,8-TETRACARBOXYLIC ACID TETRAMETHYL ESTER
CAS:224641-03-6
Formula: C38H40N4O8
KIN03439644
1-METHYL-2,3-BIS(METHYLTHIO)-1H-INDOLE
CAS:120517-34-2
Formula: C11H13NS2
KIN03164789
1-METHYL-2,3-BIS(METHYLTHIO)-1H-PYRROLE
CAS:102093-76-5
Formula: C7H11NS2
KIN03044388
1-METHYL-2,3-BIS(TRIFLUOROMETHYL)-BENZENE
CAS:94807-90-6
Formula: C9H6F6
KIN02785443
1-METHYL-2,3-BIS(TRIFLUOROMETHYL)CYCLOBUTENE
CAS:1513-60-6
Formula: C7H6F6O2
KIN01048979
1-METHYL-2,3-DI-ALLYLBENZENE
CAS:374628-00-9
Formula: C13H16
KIN03544780
1-METHYL-2,3-DIAZABICYCLO[2.2.1]HEPTA-2,5-DIENE
CAS:175655-32-0
Formula: C6H8N2
KIN03359350
1-METHYL-2,3-DIAZABICYCLO[2.2.2]OCT-2-ENE
CAS:66343-91-7
Formula: C7H12N2
KIN02540708
1-METHYL-2,3-DIAZAPHENALENE
CAS:113522-08-0
Formula: C12H10N2
KIN03123798
1-METHYL-2,3-DIHYDRO-1-BENZAZEPINE, HBR
CAS:54620-91-6
Formula: C11H14BrN
KIN02352882
1-METHYL-2,3-DIHYDRO-1H-BENZO[A]ANTHRACEN-4-ONE
CAS:108370-27-0
Formula: C19H16O
KIN03088720
1-METHYL-2,3-DIHYDRO-1H-CYCLOPENTA[A]NAPHTHALENE
CAS:37977-36-9
Formula: C14H14
KIN02244287
1-METHYL-2,3-DIHYDRO-1H-INDEN-2-OL
CAS:50823-13-7
Formula: C10H12O
KIN02297852
1-METHYL-2,3-DIHYDRO-1H-INDEN-2-ONE
CAS:35587-60-1
Formula: C10H10O
KIN02224459
1-METHYL-2,3-DIHYDRO-1H-INDENE
CAS:19744-65-1
Formula: C10H12
KIN02084080
1-METHYL-2,3-DIHYDRO-1H-INDENE-1-CARBOXYLIC ACID
CAS:33223-78-8
Formula: C11H12O2
KIN02203603
1-METHYL-2,3-DIHYDRO-1H-INDOL-5-CARBOXYLIC ACID
CAS:380922-37-2
Formula: C10H11NO2
KIN03549926
1-METHYL-2,3-DIHYDRO-1H-INDOL-5-YLAMINE
CAS:64180-07-0
Formula: C9H12N2
KIN02505594
MFCD09035071
1-METHYL-2,3-DIHYDRO-1H-INDOL-6-YLAMINE
CAS:103796-62-9
Formula: C9H12N2
KIN03056241
1-METHYL-2,3-DIHYDRO-2-AZAPHENALENE
CAS:113522-09-1
Formula: C13H13N
KIN03123799
1-METHYL-2,3-DIHYDRO-BENZO[E][1,4]DIAZEPINE
CAS:140927-35-1
Formula: C10H12N2
KIN03257785
1-METHYL-2,3-DIHYDRO-ISOQUINOLINE HCL
CAS:5345-00-6
Formula: C18H30N2O2
KIN01126884
1-METHYL-2,3-DIHYDROBOROLE
CAS:102618-33-7
Formula: C5H9B
KIN03048883
1-METHYL-2,3-DIHYDROINDOL-5,6-DIONE
CAS:3736-31-0
Formula: C11H13NO3
KIN01094954
1-METHYL-2,3-DIHYDROPYRIDIN-4-THIONE
CAS:116414-44-9
Formula: C6H9NS
KIN03143433
1-METHYL-2,3-DINITRO-1H-PYRROLE
CAS:72795-78-9
Formula: C5H5N3O4
KIN02593894
1-METHYL-2,3-DIPHENYL-1H-IMIDAZOLIDINE
CAS:146980-87-2
Formula: C16H18N2
KIN03284309
1-METHYL-2,3-DIPHENYL-1H-INDENE
CAS:51310-25-9
Formula: C22H18
KIN02304711
1-METHYL-2,3-DIPHENYL-1H-INDOL-5-OL
CAS:127473-28-3
KIN03197505
1-METHYL-2,3-DIPHENYL-1H-INDOLE
CAS:6121-47-7
KIN01150270
1-METHYL-2,3-DIPHENYL-1H-PYRROLE
CAS:114325-24-5
Formula: C17H15N
KIN03129981
1-METHYL-2,3-DIPHENYL-3-PYRROLIDINOL 3-PROPANOATE
CAS:102156-69-4
Formula: C20H23NO2
KIN03044918
1-METHYL-2,3-DIPHENYL-AZETIDINE
CAS:54965-67-2
Formula: C16H17N
KIN02358425
1-METHYL-2,3-DIPHENYL-INDEN-1-OL
CAS:5418-22-4
Formula: C23H21N
KIN01129601
1-METHYL-2,3-DIPHENYL-PIPERAZINE
CAS:65464-26-8
Formula: C17H20N2
KIN02527258
1-METHYL-2,3-DIPHENYL-PIPERIDINE HCL
CAS:6267-66-9
Formula: C18H21NO2.ClH
KIN01154065
1-METHYL-2,3-DIPROPYLINDEN-1-OL
CAS:222041-04-5
Formula: C16H22O
KIN03436918
1-METHYL-2,3-INDOLIZINEDIONE 3-(2-PHENYLHYDRAZONE)
CAS:107934-03-2
KIN03006740
1-METHYL-2,3-PYRROLIDINEDIMETHANOL
CAS:53365-60-9
KIN02333990
1-METHYL-2,3-PYRROLIDINEDIMETHANOL 2,3-DIACETATE
CAS:53365-75-6
KIN02333991
1-METHYL-2,3-PYRROLIDINEDIONE 3-[2-[2-(PYRROLIDIN-1-YL)PHENYL]HYDRAZONE]
CAS:39221-35-7
KIN02253998
1-METHYL-2,3-PYRROLIDINEDIONE 3-[2-[4-(PYRROLIDIN-1-YL)PHENYL]HYDRAZONE]
CAS:39221-33-5
KIN02253997
1-METHYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:616-05-7
Formula: C6H11BrO2
KIN01022614
1-METHYL-2,4(1H)-IMIDAZOLIDINEDIONE ION(I)
CAS:133476-10-5
Formula: C4H5N2O2
KIN03223721
1-METHYL-2,4(1H,3H)-PTERIDINEDIONE
CAS:50256-18-3
Formula: C7H6N4O2
KIN02291066
1-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE 4-(O-METHYLOXIME)
CAS:20555-80-0
Formula: C6H9N3O2
KIN02091965
1-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE HBR
CAS:58052-66-7
Formula: C5H6N2O2.BrH
KIN02409754
1-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE SODIUM SALT
CAS:56653-08-8
Formula: C5H6N2O2.Na
KIN02386324
1-METHYL-2,4(1H,3H)-PYRIMIDINEDITHIONE
CAS:66819-94-1
Formula: C5H6N2S2
KIN02545979
1-METHYL-2,4(1H,3H)-QUINAZOLINEDIONE 2-HYDRAZONE
CAS:89098-90-8
Formula: C9H10N4O
KIN02706966
1-METHYL-2,4(1H,3H)-QUINOLINEDIONE
CAS:61469-95-2
Formula: C10H9NO2
KIN02456597
MFCD00024052
1-METHYL-2,4,5(1H)-IMIDAZOLIDINETRIONE 5-OXIME
CAS:34356-74-6
Formula: C4H5N3O3
KIN02213416
1-METHYL-2,4,5,6(1H,3H)-PYRIMIDINETETRONE
CAS:2757-85-9
Formula: C6H6N2O4
KIN01075599
1-METHYL-2,4,5,6(1H,3H)-PYRIMIDINETETRONE 5-OXIME
CAS:59048-06-5
Formula: C5H5N3O4
KIN02425374
1-METHYL-2,4,5-TRIIODO-1H-IMIDAZOLE
CAS:37067-97-3
Formula: C4H3I3N2
KIN02236766
1-METHYL-2,4,5-TRINITRO-1H-IMIDAZOLE
CAS:19183-20-1
Formula: C4H3N5O6
KIN02078840
1-METHYL-2,4,5-TRIOXO-PYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:51136-21-1
KIN02302326
1-METHYL-2,4,5-TRIPHENYL-1H-IMIDAZOLE
CAS:22397-44-0
Formula: C22H18N2
KIN02110275
1-METHYL-2,4,5-TRIS(1-METHYLETHYL)-BENZENE
CAS:16442-14-1
Formula: C16H26
KIN02051380
1-METHYL-2,4,5-TRIS(METHYLTHIO)-BENZENE
CAS:200813-24-7
KIN03408069
1-METHYL-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE 6-OXIME
CAS:65183-47-3
Formula: C5H7N3O3
KIN02522580
1-METHYL-2,4,6-CYCLOHEPTATRIEN-1-OL 1-ACETATE
CAS:36717-43-8
KIN02233551
1-METHYL-2,4,6-CYCLOHEPTATRIENE-1-CARBONITRILE
CAS:56306-80-0
Formula: C9H9N
KIN02380632
1-METHYL-2,4,6-CYCLOHEPTATRIENE-1-CARBOXYLIC ACID
CAS:52433-00-8
Formula: C9H10O2
KIN02321112
1-METHYL-2,4,6-CYCLOHEPTATRIENE-1-CARBOXYLIC ACID METHYL ESTER
CAS:52433-02-0
Formula: C10H12O2
KIN02321114
1-METHYL-2,4,6-CYCLOHEPTATRIENE-1-METHANOL
CAS:86318-21-0
KIN02679715
1-METHYL-2,4,6-CYCLOOCTATRIEN-1-OL
CAS:16326-87-7
KIN02050227
1-METHYL-2,4,6-TRIPHENYL-3-PROPYL-4-HYDROXY-PIPERIDINE
CAS:57162-41-1
Formula: C27H31NO
KIN02394957
1-METHYL-2,4,6-TRIPHENYL-4-HYDROXY-PIPERIDINE
CAS:17107-15-2
Formula: C24H25NO
KIN02058299
1-METHYL-2,4,6-TRIPHENYLPYRIDINIUM PERCHLORATE
CAS:1175-68-4
Formula: C23H27NO5S
KIN01042237
1-METHYL-2,4,6-TRIPHENYLPYRIDINIUM TETRAFLUOROBORATE
CAS:2355-57-9
Formula: C24H20F24O4
KIN01067609
1-METHYL-2,4,6-TRIS(4-METHYLPHENYL)-PYRIDINIUM TETRAFLUOROBORATE(I)
CAS:3887-83-0
Formula: C17H15FNO.I
KIN01097484
1-METHYL-2,4,9-TRIPHENYL-1H-BENZO[F]ARSINDOLE
CAS:61782-44-3
Formula: C31H23As
KIN02461920
1-METHYL-2,4-BIS(1-METHYLETHENYL)CYCLOHEXANE
CAS:61142-58-3
Formula: C13H22
KIN02451526
1-METHYL-2,4-BIS(1-METHYLETHYL)-1H-IMIDAZOL-5-METHANOL
CAS:54416-40-9
Formula: C11H20N2O
KIN02349741
1-METHYL-2,4-BIS(1-METHYLETHYL)-1H-IMIDAZOLE
CAS:37455-76-8
KIN02239454
1-METHYL-2,4-BIS(1-METHYLETHYL)-5-NITRO-1H-IMIDAZOLE
CAS:91918-24-0
Formula: C10H17N3O2
KIN02750566
1-METHYL-2,4-BIS(BENZYL)-BENZENE
CAS:94871-33-7
Formula: C21H20
KIN02786174
1-METHYL-2,4-BIS(METHYLTHIO)-1H-PYRROLE
CAS:102093-77-6
KIN03044389
1-METHYL-2,4-BIS(TRIFLUOROMETHYL)-QUINOLIN-7(1H)-ONE
CAS:91915-73-0
Formula: C12H7F6NO
KIN02750540
1-METHYL-2,4-BIS[(TRIFLUOROMETHYL)THIO]-1H-PYRROLE
CAS:62665-38-7
Formula: C7H5F6NS2
KIN02478242
1-METHYL-2,4-CYCLOHEXADIENCARBONIC ACID
CAS:32917-40-1
Formula: C8H10O2
KIN02201022
1-METHYL-2,4-CYCLOHEXADIENE-1,2-DICARBOXYLIC ACID
CAS:100523-81-7
Formula: C9H10O4
KIN03017190
1-METHYL-2,4-CYCLOPENTADIEN-1-OL 1-( TOSYLATE)
CAS:74503-31-4
Formula: C13H14O3S
KIN02606409
1-METHYL-2,4-CYCLOPENTADIENE-1-ACETYL CHLORIDE
CAS:106675-75-6
Formula: C8H9ClO
KIN03077830
1-METHYL-2,4-DI(PROP-1-EN-2-YL)-1-VINYLCYCLOHEXANE
CAS:11029-06-4
Formula: C15H24
KIN02009048
Elemene
1-METHYL-2,4-DI-ALLYLBENZENE
CAS:17592-61-9
Formula: C13H16
KIN02063476
1-METHYL-2,4-DINEOPENTYLBENZOL
CAS:129917-43-7
Formula: C17H28
KIN03207935
1-METHYL-2,4-DINITRO-1H-IMIDAZOLE
CAS:5213-82-1
Formula: C11H11N3OS
KIN01122981
1-METHYL-2,4-DINITRO-1H-PYRROLE
CAS:2948-76-7
Formula: C15H11O5.Cl
KIN01079608
1-METHYL-2,4-DINITRO-3-(PHENYLTHIO)-BENZENE
CAS:105788-31-6
KIN03071033
1-METHYL-2,4-DINITRO-5-(BENZENESULFONYL)-BENZENE
CAS:14677-57-7
KIN02034527
1-METHYL-2,4-DINITRO-5-(PHENYLTHIO)-BENZENE
CAS:14677-58-8
KIN02034528
1-METHYL-2,4-DINITRO-5-[(4-NITROPHENYL)THIO]BENZENE
CAS:92568-52-0
Formula: C13H9N3O6S
KIN02758618
1-METHYL-2,4-DINITRO-BENZENE
CAS:121-17-5
Formula: C7H3ClF3NO2
KIN01005009
1-METHYL-2,4-DINITRO-NAPHTHALENE
CAS:106776-14-1
Formula: C11H8N2O4
KIN03078456
1-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-THIENO[2,3-D]PYRIMIDIN-6-CARBOXYLIC ACID
CAS:448965-10-4
Formula: C8H6N2O4S
KIN03589683
1-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDIN-6-CARBOXYLIC ACID
CAS:449210-08-6
KIN03589894
1-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDIN-5-CARBONITRILE
CAS:7465-67-0
Formula: C23H36Cl3N
KIN01187764
1-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDIN-5-CARBOXYLIC ACID
CAS:14383-42-7
Formula: C6H6N2O4
KIN02031387
MFCD11099499
1-METHYL-2,4-DIOXO-3-AZABICYCLO[3.1.0]HEXAN-3-ACETONITRILE
CAS:426818-33-9
Formula: C8H8N2O2
KIN03576557
1-METHYL-2,4-DIOXO-3-PHENYL-3-AZETIDINEACETIC ACID ETHYL ESTER
CAS:158991-55-0
Formula: C14H15NO4
KIN03322059
1-METHYL-2,4-DIOXO-HEXAHYDROPYRIMIDIN-5-CARBOXIMIDAMIDE
CAS:446276-07-9
Formula: C6H10N4O2
KIN03588475
1-METHYL-2,4-DIPHENYL-1,3-DIHYDROTRIAZOL-1-IUM, PERCHLORATE
CAS:113334-03-5
Formula: C15H14N3.ClO4
KIN03122047
1-METHYL-2,4-DIPHENYL-1H-IMIDAZOLE
CAS:109277-31-8
Formula: C16H14N2
KIN03094273
1-METHYL-2,4-DIPHENYL-1H-PERIMIDINE
CAS:60262-31-9
Formula: C24H18N2
KIN02443011
1-METHYL-2,4-DIPHENYL-1H-PYRROL-3-CARBOXYLIC ACID
CAS:487000-34-0
Formula: C18H15NO2
KIN03027408
1-METHYL-2,4-DIPHENYL-1H-PYRROLE
CAS:17165-01-4
Formula: C17H15N
KIN02058904
1-METHYL-2,4-DIPHENYL-3-AZABICYCLO[3.3.1]NONAN-9-ONE
CAS:76335-71-2
Formula: C21H23NO
KIN02618573
1-METHYL-2,4-DIPHENYL-6-PHENYLTHIO-3H-1,2,4,5-TETRAZINE
CAS:51808-05-0
Formula: C21H20N4S
KIN02312065
1-METHYL-2,4-DIPHENYL-PHTHALAZINIUM IODIDE
CAS:94637-22-6
KIN02783681
1-METHYL-2,4-DIPROPYL-1H-IMIDAZOLE
CAS:37455-72-4
KIN02239450
1-METHYL-2,4-DITHIOBIURET
CAS:6939-46-4
Formula: C14H15ClN4O2S
KIN01173247
1-METHYL-2,4-HEXADIENYLIUM
CAS:92056-18-3
Formula: C7H11
KIN02752331
1-METHYL-2,4-PIPERIDINEDIONE
CAS:118263-97-1
Formula: C6H9NO2
KIN03153381
1-METHYL-2,4-PYRROLIDINEDIONE
CAS:37772-91-1
Formula: C5H7NO2
KIN02242527
1-METHYL-2,4-PYRROLIDINEDIONE 4-[2-(2,4-DINITROPHENYL)HYDRAZONE]
CAS:37772-92-2
KIN02242528
1-METHYL-2,5,8(1H)-QUINOLINETRIONE
CAS:137265-26-0
Formula: C10H7NO3
KIN03240680
1-METHYL-2,5-BIS(1-METHYLETHYL)-1H-PYRROLE
CAS:21407-97-6
Formula: C11H19N
KIN02100560
1-METHYL-2,5-BIS(1-METHYLETHYL)-4-NITRO-1H-IMIDAZOLE
CAS:93624-31-8
Formula: C10H17N3O2
KIN02771481
1-METHYL-2,5-BIS(4-METHYLPHENYL)-1H-PYRROLE
CAS:104891-44-3
KIN03064721
1-METHYL-2,5-BIS(4-METHYLPHENYL)-3-NITROSO-1H-PYRROLE
CAS:266682-29-5
KIN03657363
1-METHYL-2,5-BIS(METHYLTHIO)-1H-IMIDAZOLE
CAS:87946-06-3
Formula: C6H10N2S2
KIN02690980
1-METHYL-2,5-BIS(METHYLTHIO)-1H-PYRROLE
CAS:102093-75-4
KIN03044387
1-METHYL-2,5-BIS(METHYLTHIO)-4-[(1E)-2-NITRO-ETHENYL]BENZENE
CAS:345640-38-2
Formula: C11H13NO2S2
KIN03521889
1-METHYL-2,5-BIS(PYRROLIDIN-1-YLMETHYL)-1H-PYRROLE
CAS:119836-07-6
KIN03007859
1-METHYL-2,5-BIS(TRIFLUOROMETHYL)-1H-PYRROLE
CAS:135790-57-7
KIN03234341
1-METHYL-2,5-BIS(TRIMETHYLSILYL)-1H-IMIDAZOLE
CAS:50694-52-5
Formula: C10H22N2Si2
KIN02296425
1-METHYL-2,5-BIS(TRIMETHYLSILYL)-1H-PYRROLE
CAS:5833-57-8
Formula: C7H14O4Si
KIN01142941
1-METHYL-2,5-BIS[(TRIFLUOROMETHYL)THIO]-1H-PYRROLE
CAS:62665-37-6
Formula: C7H5F6NS2
KIN02478241
1-METHYL-2,5-BIS[(TRIMETHYLSILYLOXY) ]-1H-PYRROLE
CAS:91210-73-0
Formula: C11H23NO2Si2
KIN02740301
1-METHYL-2,5-CYCLOHEXADIENE-1-CARBONYL CHLORIDE
CAS:85215-58-3
Formula: C8H9ClO
KIN02672730
1-METHYL-2,5-CYCLOHEXADIENE-1-CARBOXYLIC ACID
CAS:52457-01-9
Formula: C8H10O2
KIN02321395
1-METHYL-2,5-CYCLOHEXADIENE-1-CARBOXYLIC ACID METHYL ESTER
CAS:59034-54-7
Formula: C9H12O2
KIN02425165
1-METHYL-2,5-CYCLOHEXADIENE-1-METHANOL 1-( TOSYLATE)
CAS:108299-84-9
KIN03668738
1-METHYL-2,5-DI-THIOPHEN-2-YL-1H-PYRROL-3-CARBALDEHYDE
CAS:1165949-69-8
Formula: C14H11NOS2
KIN05259975
1-METHYL-2,5-DIHYDRO-1L^{5}-PHOSPHOLE, 1-OXIDE
CAS:930-39-2
Formula: C6H12O
KIN01033999
1-METHYL-2,5-DIHYDROPYRAZOLO[3,4-C]QUINOLIN-4-ONE
CAS:56908-72-6
Formula: C11H9N3O
KIN02390600
1-METHYL-2,5-DINITRO-1H-IMIDAZOLE
CAS:67019-81-2
Formula: C4H4N4O4
KIN02547767
1-METHYL-2,5-DINITRO-1H-PYRROL-3-CARBONITRILE
CAS:89998-65-2
Formula: C6H4N4O4
KIN02720643
1-METHYL-2,5-DINITRO-1H-PYRROLE
CAS:56350-95-9
KIN02381354
1-METHYL-2,5-DIOXO-3,4-PYRROLIDINEDIACETIC ACID 3,4-DIMETHYL ESTER
CAS:18853-50-4
KIN02075708
1-METHYL-2,5-DIOXO-3-(BENZYL)-4(1H)-IMIDAZOLIDINECARBOXYLIC ACID ETHYL ESTER
CAS:56598-94-8
Formula: C14H16N2O4
KIN02385337
1-METHYL-2,5-DIOXO-3-PYRROLIDINEACETIC ACID
CAS:58607-96-8
KIN02418428
1-METHYL-2,5-DIOXO-4(1H)-IMIDAZOLIDINEACETIC ACID
CAS:26972-47-4
Formula: C6H8N2O4
KIN02152839
1-METHYL-2,5-DIOXO-4(1H)-IMIDAZOLIDINECARBOXYLIC ACID ETHYL ESTER
CAS:21823-24-5
Formula: C7H10N2O4
KIN02104537
1-METHYL-2,5-DIOXO-4(1H)-IMIDAZOLIDINECARBOXYLIC ACID METHYL ESTER
CAS:54001-39-7
Formula: C6H8N2O4
KIN02343607
1-METHYL-2,5-DIOXO-4,4-DIPHENYLPYRROLIDINE-3-CARBONITRILE
CAS:5722-11-2
Formula: C6H9N
KIN01139998
1-METHYL-2,5-DIOXO-4-(2-PHENYLETHYL)-4(1H)-IMIDAZOLIDINECARBALDEHYDE
CAS:6630-56-4
Formula: C13H18ClN3O3
KIN01166927
1-METHYL-2,5-DIOXO-4-PHENYL-1H-IMIDAZOLIDINE-4-CARBOXYLIC ACID
CAS:7507-26-8
Formula: C11H10N2O4
KIN01190035
1-METHYL-2,5-DIOXO-4-PROPYL-1H-IMIDAZOLIDINE-4-CARBALDEHYDE
CAS:5471-58-9
Formula: C9H14N2O3
KIN01133647
1-METHYL-2,5-DIOXO-6-METHYLENE-PIPERAZIN-3-SPIRO-3'-(N-METHYL-1H-INDOL-3-YL)-2'-OXIRANE
CAS:111192-64-4
Formula: C16H15N3O3
KIN03106222
1-METHYL-2,5-DIOXO-CYCLOPENTANEPROPANENITRILE
CAS:6075-30-5
KIN01149116
1-METHYL-2,5-DIOXO-PYRROLIDINE-3-CARBONITRILE
CAS:31591-67-0
Formula: C6H6N2O2
KIN02190553
1-METHYL-2,5-DIPHENYL-1,3-AZAPHOSPHOLE
CAS:118806-68-1
Formula: C16H14NP
KIN03156137
1-METHYL-2,5-DIPHENYL-1,4-DITHIIN-1-IUM,TETRAFLUOROBORATE
CAS:17250-79-2
Formula: C17H15BF4S2
KIN02059883
1-METHYL-2,5-DIPHENYL-1H-IMIDAZOL-4-CARBALDEHYDE
CAS:153387-80-5
Formula: C17H14N2O
KIN03304936
1-METHYL-2,5-DIPHENYL-1H-IMIDAZOLE
CAS:15994-89-5
Formula: C16H14N2
KIN02046460
1-METHYL-2,5-DIPHENYL-1H-IMIDAZOLE 3-OXIDE
CAS:1127563-25-0
Formula: C16H14N2O
KIN05181382
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3,4-DICARBOXYLIC ACID DIMETHYL ESTER
CAS:13901-76-3
Formula: C21H19NO4
KIN02025680
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3,4-DIMETHANOL
CAS:72572-67-9
Formula: C19H19NO2
KIN02592333
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-CARBALDEHYDE
CAS:104143-77-3
KIN03059028
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-CARBONITRILE
CAS:438539-29-8
Formula: C18H14N2
KIN03581968
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-CARBOXYLIC ACID
CAS:130850-55-4
KIN03019980
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-CARBOXYLIC ACID METHYL ESTER
CAS:13901-79-6
KIN02025681
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-OL 3-ACETATE
CAS:28750-86-9
KIN02168600
1-METHYL-2,5-DIPHENYL-1H-PYRROL-3-YLAMINE
CAS:127394-94-9
KIN03197177
1-METHYL-2,5-DIPHENYL-1H-PYRROLE
CAS:840-05-1
Formula: C11H8N2O5
KIN01031566
1-METHYL-2,5-DIPHENYL-4(1H)-PYRAZOLIN-3-ONE
CAS:6632-13-9
Formula: C16H15NO3S
KIN01167056
1-METHYL-2,5-DIPHENYL-4-(PIPERIDIN-1-YLMETHYL)-1,2-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:6629-14-7
Formula: C23H30ClN2O4-
KIN01166810
1-METHYL-2,5-DIPHENYL-4-[(TRIMETHYLSILYLOXY) ]-1H-1,3-AZAPHOSPHOLE
CAS:113545-93-0
Formula: C19H22NOPSi
KIN03124014
1-METHYL-2,5-DIPHENYL-SILACYCLOPENTA-2,4-DIENE
CAS:76713-22-9
Formula: C17H16Si
KIN02621096
1-METHYL-2,5-DIPHENYLCYCLOHEXAN
CAS:110047-19-3
Formula: C19H22
KIN03098927
1-METHYL-2,5-DITHIOBIUREA
CAS:34725-32-1
Formula: C3H8N4S2
KIN02216474
1-METHYL-2,5-PIPERIDINEDIONE
CAS:408309-25-1
Formula: C6H9NO2
KIN03568052
1-METHYL-2,5-PYRROLIDINEDIACETIC ACID 2,5-DIETHYL ESTER
CAS:5690-91-5
KIN01139107
1-METHYL-2,5-PYRROLIDINEDIONE 2-(2-PHENYLHYDRAZONE)
CAS:25291-52-5
KIN02138108
1-METHYL-2,5-PYRROLIDINEDITHIONE
CAS:3889-20-1
Formula: C11H11NOS2
KIN01097499
1-METHYL-2,5-PYRROLIDINEDIYL
CAS:1041636-30-9
Formula: C5H9N
KIN05088433
1-METHYL-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTAN-4-METHANOL
CAS:19309-39-8
Formula: C7H12O4
KIN02080113
1-METHYL-2,6-BIS(P-DIMETHYLAMINO-STYRYL)-PYRIDINIUM -IODIDE
CAS:30512-90-4
KIN02182908
1-METHYL-2,6-BIS(P-DIMETHYLAMINO-STYRYL)-PYRIDINIUM IODIDE
CAS:3785-07-7
KIN01095917
1-METHYL-2,6-BISBENZYLCYCLOHEXANOL
CAS:53774-86-0
Formula: C21H26O
KIN02340366
1-METHYL-2,6-CYCLOHEPTADIEN-1-OL
CAS:65034-55-1
Formula: C8H12O
KIN02519944
1-METHYL-2,6-DIAZABICYCLO[2.2.2]OCTAN-3,5-DIONE
CAS:87581-37-1
Formula: C7H10N2O2
KIN02687830
1-METHYL-2,6-DIOXO-CYCLOHEXANEACETIC ACID ETHYL ESTER
CAS:55981-33-4
Formula: C11H16O4
KIN02375373
1-METHYL-2,6-DIPHENYL-3-PROPYL-4-HYDROXY-PIPERIDINE
CAS:64292-72-4
Formula: C21H27NO
KIN02507566
1-METHYL-2,6-DIPHENYL-3-PROPYL-PIPERIDIN-4-ONE
CAS:57162-39-7
Formula: C21H25NO
KIN02394955
1-METHYL-2,6-DIPHENYL-4(1H)-PYRIDINONE
CAS:19792-54-2
Formula: C18H15NO
KIN02084641
1-METHYL-2,6-DIPHENYL-4-(2-PHENYLETHYNYL)-4-HYDROXY-PIPERIDINE
CAS:40583-71-9
Formula: C26H25NO
KIN02264026
1-METHYL-2,6-DIPHENYL-4-(2-PHENYLETHYNYL)PIPERIDIN-4-OL
CAS:5964-78-3
Formula: C18H15N3O3S
KIN01146234
1-METHYL-2,6-DIPHENYL-4-HYDROXY-PIPERIDINE
CAS:2403-94-3
Formula: C19H23NO
KIN01068776
1-METHYL-2,6-DIPHENYL-PIPERIDIN-4-ONE
CAS:5554-57-4
Formula: C17H17N3O3S2
KIN01135515
1-METHYL-2,6-DIPHENYL-PIPERIDIN-4-ONE OXIME
CAS:67667-99-6
Formula: C18H20N2O
KIN02556543
1-METHYL-2,6-DIPROPYL-PIPERIDINE
CAS:33355-10-1
KIN02204948
1-METHYL-2,6-PIPERIDINEDIACETIC ACID 2,6-DIETHYL ESTER
CAS:100878-09-9
Formula: C14H25NO4
KIN03646075
1-METHYL-2,6-PIPERIDINEDICARBONITRILE
CAS:90090-68-9
Formula: C8H11N3
KIN02722226
1-METHYL-2,6-PIPERIDINEDICARBOXAMIDE
CAS:1194875-80-3
Formula: C8H15N3O2;C8H15N3O2
KIN05336175
1-METHYL-2,6-PIPERIDINEDICARBOXAMIDE HCL
CAS:1194798-94-1
Formula: C8H15N3O2.ClH
KIN05336040
1-METHYL-2,6-PIPERIDINEDIOL
CAS:199433-21-1
Formula: [C6H13NO2]
KIN03405851
1-METHYL-2,6-PIPERIDINEDIONE
CAS:25077-25-2
Formula: C6H9NO2
KIN02136173
1-METHYL-2,7-NAPHTHYRIDINE-4-CARBOXYLIC ACID METHYL ESTER
CAS:112561-62-3
Formula: C11H10N2O2
KIN03116388
1-METHYL-2,8,9-TRIOXA-5-AZA-1-SILABICYCLO[3.3.3]UNDECAN-3-ONE
CAS:53883-49-1
Formula: C7H13NO4Si
KIN02341782
1-METHYL-2,8,9-TRIOXA-5-AZA-1-SILABICYCLO[3.3.3]UNDECANE
CAS:2288-16-6
Formula: C14H11N3O
KIN01066515
1-METHYL-2,8,9-TRIOXA-BICYCLO[3.3.1]NONANE
CAS:96923-34-1
Formula: C7H12O3
KIN02803631
1-METHYL-2,8-DIOXA-5-AZA-1-GERMABICYCLO[3.3.3]UNDECANE
CAS:78645-24-6
Formula: C8H17GeNO2
KIN02632841
1-METHYL-2,8-DIOXA-6-THIA-BICYCLO[3.2.1]OCTANE
CAS:31816-92-9
Formula: C6H10O2S
KIN02192287
1-METHYL-2,9-DIHYDROPYRIDO[3,4-B]INDOL-5-ONE
CAS:135299-06-8
Formula: C12H10N2O
KIN03232181
1-METHYL-2,ALPHA:5,ALPHA'-PYRROLIDINEDIACETIC ACID DIETHYL ESTER
CAS:5690-86-8
KIN01139103
1-METHYL-2,ALPHA:5,ALPHA'-PYRROLIDINEDIACETIC ACID DIMETHYL ESTER
CAS:5690-88-0
KIN01139105
1-METHYL-2-(((6,7,8,9-TETRAHYDRO-5H-BENZOCYCLOHEPTEN-5-YLOXY) )METHYL)PIPERIDINE
CAS:40494-47-1
Formula: C18H27NO
KIN02263279
1-METHYL-2-((1Z,3Z)-3-(1-METHYLNAPHTHO[1,2-D]THIAZOL-2(1H)-YLIDENE)-2-PHENYLPROP-1-EN-1-YL)-NAPHTHO[1,2-D]THIAZOL-1-IUM CHLORIDE
CAS:1064-06-8
Formula: C25H20O12
KIN01038306
1-METHYL-2-((3-METHYLBENZO[D]THIAZOL-2(3H)-YLIDENE)METHYL)-QUINOLINIUM IODIDE
CAS:16768-72-2
Formula: C19H17IN2S
KIN02054736
1-METHYL-2-((TRIMETHYLSILYLOXY) )BICYCLO[2.1.1]HEXAN-2-CARBONITRILE
CAS:344413-20-3
Formula: C11H19NOSi
KIN03520208
1-METHYL-2-(-PYRIDINIUM-1-YLMETHYL)-PYRIDINIUM DIIODIDE
CAS:6291-06-1
Formula: C9H11NO2
KIN01155857
1-METHYL-2-(1,2,2-TRIMETHYLCYCLOPENTYL)-BENZENE
CAS:79627-86-4
Formula: C15H22
KIN02638872
1-METHYL-2-(1,2,2-TRIMETHYLPROPYL)-BENZENE
CAS:63446-93-5
Formula: C13H20
KIN02492834
1-METHYL-2-(1,2-PROPADIENYL)-BENZENE
CAS:71345-82-9
Formula: C10H10
KIN02583721
1-METHYL-2-(1,3,3-TRIETHOXY-PROPYL) CYCLOPROPANE
CAS:59226-80-1
Formula: C13H26O3
KIN02428384
1-METHYL-2-(1,3-PENTADIENYL)-1H-PYRROLE
CAS:63335-40-0
Formula: C10H13N
KIN02490817
1-METHYL-2-(1,5-DIOXASPIRO[5.5]UNDECAN-3-YL) -PYRIDIN-1-IUM, IODIDE
CAS:111504-46-2
Formula: C15H22INO2
KIN03108250
1-METHYL-2-(1-ETHYLPROPYL)-BENZENE
CAS:54410-74-1
Formula: C12H18
KIN02349556
1-METHYL-2-(1-METHYL-1-PROPEN-1-YL)-DIAZENE
CAS:4068-52-4
Formula: C17H17Br2NO2
KIN01100389
1-METHYL-2-(1-METHYL-1H-IMIDAZOL-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:188799-42-0
Formula: C12H12N4
KIN03386108
1-METHYL-2-(1-METHYL-2-PHENYLETHYL)HYDRAZINE
CAS:14198-18-6
Formula: C10H16N2
KIN02029330
1-METHYL-2-(1-METHYL-ALLYL)-BENZENE
CAS:97664-19-2
Formula: C11H14
KIN02807139
1-Methyl-2-(1-methyl-allyl)-benzene
1-METHYL-2-(1-METHYLBENZO[D]IMIDAZOL-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:3878-70-4
KIN01097338
1-METHYL-2-(1-METHYLBUTYL)-1H-IMIDAZOLE
CAS:164062-95-7
KIN03334972
1-METHYL-2-(1-METHYLBUTYL)-1H-PERIMIDINE
CAS:168472-74-0
Formula: C17H20N2
KIN03342958
1-METHYL-2-(1-METHYLBUTYL)-DIAZENE
CAS:27793-39-1
Formula: C6H14N2
KIN02160340
1-METHYL-2-(1-METHYLCYCLOHEXYL) -BENZENE
CAS:14962-10-8
Formula: C14H20
KIN02037124
1-METHYL-2-(1-METHYLCYCLOPENTYL)-BENZENE
CAS:94611-20-8
Formula: C13H18
KIN02783373
1-METHYL-2-(1-METHYLCYCLOPENTYL)CYCLOPENTENE
CAS:78846-99-8
KIN02633999
1-Methyl-2-(1-methyl-cyclopentyl)cyclopentene
1-METHYL-2-(1-METHYLENEPROPYL)-BENZENE
CAS:82902-62-3
Formula: C11H14
KIN02658246
1-Methyl-2-(1-methylenepropyl)-benzene
1-METHYL-2-(1-METHYLETHENYL)-1H-BENZO[D]IMIDAZOLE
CAS:182000-63-1
Formula: C11H12N2
KIN03371930
1-METHYL-2-(1-METHYLETHENYL)-1H-INDOLE
CAS:29124-07-0
Formula: C12H13N
KIN02171640
1-METHYL-2-(1-METHYLETHENYL)-1H-PYRROLE
CAS:81852-81-5
Formula: C8H11N
KIN02652142
1-Methyl-2-(1-methylvinyl)-1H-pyrrole; 2-(1-Methyl
1-METHYL-2-(1-METHYLETHENYL)-3,5(1H)-PYRAZOLIDINEDIONE
CAS:1135260-66-0
Formula: C7H10N2O2
KIN05186079
1-METHYL-2-(1-METHYLETHENYL)-4-(1-METHYLETHYL)-BENZENE
CAS:38031-45-7
KIN02244710
1-METHYL-2-(1-METHYLETHENYL)-4-NITRO-3-PHENYL-1H-PYRROLE
CAS:180282-02-4
KIN03623560
1-METHYL-2-(1-METHYLETHENYL)-5-NITRO-1H-IMIDAZOLE
CAS:36365-27-2
Formula: C7H9N3O2
KIN02231290
1-METHYL-2-(1-METHYLETHENYL)-DIAZENE 2-OXIDE
CAS:10235-69-5
Formula: C4H8N2O
KIN02003592
1-METHYL-2-(1-METHYLETHOXY) -3,5-DINITRO-BENZENE
CAS:29516-76-5
KIN02174610
1-METHYL-2-(1-METHYLETHOXY) -4-NITRO-BENZENE
CAS:136187-51-4
KIN03235878
1-METHYL-2-(1-METHYLETHOXY) -BENZENE
CAS:33426-60-7
Formula: C10H14O
KIN02205568
MFCD08276207
1-METHYL-2-(1-METHYLETHYL)-1H-IMIDAZOL-4-ETHANAMINE
CAS:479408-65-6
Formula: C9H17N3
KIN03607887
1-METHYL-2-(1-METHYLETHYL)-1H-IMIDAZOL-4-METHANAMINE
CAS:1083368-71-1
Formula: C8H15N3
KIN05124574
1-METHYL-2-(1-METHYLETHYL)-1H-IMIDAZOL-5-YLAMINE
CAS:124032-73-1
KIN03182465
1-METHYL-2-(1-METHYLETHYL)-1H-IMIDAZOLE
CAS:22509-02-0
Formula: C7H12N2
KIN02111243
MFCD11053674
1-METHYL-2-(1-METHYLETHYL)-1H-PYRROLE
CAS:190065-71-5
Formula: [C8H13N
KIN03390398
1-METHYL-2-(1-METHYLETHYL)-3-NITRO-BENZENE
CAS:175540-88-2
KIN03359158
1-METHYL-2-(1-METHYLETHYL)-3-PENTYLBENZENE
CAS:1071674-97-9
KIN05113334
1-METHYL-2-(1-METHYLETHYL)-4-NITRO-1H-IMIDAZOLE
CAS:35179-50-1
Formula: C7H11N3O2
KIN02220521
1-METHYL-2-(1-METHYLETHYL)-4-NITRO-BENZENE
CAS:103096-00-0
KIN03051848
1-METHYL-2-(1-METHYLETHYL)-4-PIPERIDIN-4-YL-PIPERAZINE
CAS:202991-73-9
Formula: C13H27N3
KIN03646081
1-METHYL-2-(1-METHYLETHYL)-4-PROPYL-1H-IMIDAZOLE
CAS:37455-75-7
KIN02239453
1-METHYL-2-(1-METHYLETHYL)-5-NITRO-1H-IMIDAZOLE
CAS:14885-29-1
Formula: C7H11N3O2
KIN02036448
ipronidazole
MFCD00866597
1-METHYL-2-(1-METHYLETHYL)-5-NITRO-1H-PYRROLE
CAS:122131-96-8
KIN03173382
1-METHYL-2-(1-METHYLETHYL)-L-HISTIDINE
CAS:479408-59-8
Formula: C10H17N3O2
KIN03607886
1-METHYL-2-(1-METHYLETHYL)CYCLOHEPTATRIENYLIUM
CAS:71877-87-7
Formula: C11H15
KIN02587577
1-METHYL-2-(1-METHYLETHYL)CYCLOHEXENE
CAS:15582-48-6
Formula: C10H18
KIN02042797
1-METHYL-2-(1-METHYLETHYLIDENE)CYCLOBUTANOL
CAS:4666-91-5
KIN01112303
1-METHYL-2-(1-METHYLPENTYL)CYCLOPROPANE
CAS:62238-06-6
KIN02470642
1-Methyl-2-(1-methylpentyl)cyclopropane
1-METHYL-2-(1-METHYLPROPYL)-1H-IMIDAZOLE
CAS:54001-59-1
Formula: C8H14N2
KIN02343611
1-METHYL-2-(1-METHYLPROPYL)-1H-PYRROLE
CAS:71707-53-4
Formula: C9H15N
KIN02586302
1-Methyl-2-(1-methylpropyl)-1H-pyrrole
1-METHYL-2-(1-METHYLPROPYL)-5-NITRO-1H-IMIDAZOLE
CAS:54001-58-0
Formula: C8H13N3O2
KIN02343610
1-METHYL-2-(1-METHYLPROPYL)CYCLOPENTANE
CAS:95572-75-1
Formula: C10H20
KIN02792822
1-Methyl-2-(1-methylpropyl)cyclopentane
1-METHYL-2-(1-METHYLPROPYL)CYCLOPENTANOL
CAS:65888-91-7
Formula: C10H20O
KIN02534005
1-Methyl-2-(1-methylpropyl)cyclopentanol
1-METHYL-2-(1-METHYLVINYL) -1H-IMIDAZOLE
CAS:127782-73-4
Formula: [C7H10N2]
KIN03198837
1-METHYL-2-(1-METHYLVINYL) CYCLOBUTANEACETIC ACID
CAS:55760-16-2
KIN02371704
1-METHYL-2-(1-NITRO-ETHYL)-BENZENE
CAS:79101-78-3
Formula: C9H11NO2
KIN02635642
1-METHYL-2-(1-OXIDO-2-PHENYLDIAZENYL) -6-PHENYL-1H-IMIDAZO[4,5-B]PYRIDINE
CAS:133763-19-6
Formula: C19H15N5O
KIN03225282
1-METHYL-2-(1-OXO-PROPYL) -1H-INDOL-3-CARBALDEHYDE
CAS:34016-35-8
Formula: C13H13NO2
KIN02210607
1-METHYL-2-(1-PHENYL-1-PROPEN-1-YL)-1H-IMIDAZOLE
CAS:138524-08-0
Formula: C13H14N2
KIN03247232
1-METHYL-2-(1-PHENYLETHENYL)-1H-IMIDAZOLE
CAS:127782-65-4
KIN03198832
1-METHYL-2-(1-PHENYLETHENYL)-1H-INDOLE
CAS:66643-64-9
Formula: C17H15N
KIN02544373
1-METHYL-2-(1-PHENYLETHENYL)-1H-PYRROLE
CAS:66643-66-1
Formula: C13H13N
KIN02544374
1-METHYL-2-(1-PHENYLETHOXY) -BENZENE
CAS:94001-47-5
Formula: C15H16O
KIN02776371
1-METHYL-2-(1-PHENYLETHYL)-2H-ISOINDOLE
CAS:484027-19-2
KIN03609852
1-METHYL-2-(1-PHENYLETHYL)-BENZENE
CAS:32341-92-7
Formula: C15H16
KIN02196107
1-METHYL-2-(1-PHENYLETHYL)-BENZO[D]THIAZOLE
CAS:111259-61-1
Formula: C15H13NS
KIN03106780
1-METHYL-2-(1-PHENYLETHYL)CYCLOHEXANOL
CAS:65817-89-2
Formula: C15H22O
KIN02532808
1-METHYL-2-(1-PHENYLPROPA-1,2-DIENYL)-BENZENE
CAS:420121-32-0
Formula: C16H14
KIN03573736
1-METHYL-2-(1-PROPEN-1-YL)-1H-INDOLE
CAS:176690-29-2
Formula: C12H13N
KIN03361166
1-METHYL-2-(1-PROPEN-1-YL)-1H-PYRROLE
CAS:123647-12-1
Formula: C8H11N
KIN03180554
1-METHYL-2-(1-PROPYLPENTYL)-1H-IMIDAZOLE
CAS:120642-28-6
KIN03165551
1-METHYL-2-(1-PROPYN-1-YL)-1H-BENZO[D]IMIDAZOLE
CAS:55476-11-4
Formula: C11H10N2
KIN02367026
1-METHYL-2-(1-PROPYNYL)-BENZENE
CAS:57497-13-9
Formula: C10H10
KIN02400585
1-METHYL-2-(1-PROPYNYL)-PYRROLIDINE
CAS:125038-97-3
Formula: [C8H13N]
KIN03186830
1-METHYL-2-(1-PROPYNYL)PIPERIDINE
CAS:51498-57-8
Formula: C9H15N
KIN02307373
1-METHYL-2-(1-PROPYNYL)PIPERIDINE PICRATE
CAS:67385-92-6
Formula: C9H15N.C6H3N3O7
KIN02552676
1-METHYL-2-(1E)-1-OCTEN-1-YL-1H-IMIDAZOLE
CAS:192063-34-6
KIN03393441
1-METHYL-2-(1E)-1-PROPEN-1-YL-1H-INDOLE
CAS:89374-82-3
Formula: C12H13N
KIN02710927
1-METHYL-2-(1E,5Z)-1,5-OCTADIEN-1-YL-1H-IMIDAZOLE
CAS:191110-36-8
KIN03023330
1-METHYL-2-(1H-1,2,3-TRIAZOL-1-YL)-1H-BENZO[D]IMIDAZOLE
CAS:30597-99-0
Formula: C10H9N5
KIN02183451
1-METHYL-2-(1H-PYRAZOL-1-YL)-1H-BENZO[D]IMIDAZOL-5-YLAMINE
CAS:23861-07-6
KIN02124240
1-METHYL-2-(1H-PYRAZOL-1-YL)-1H-BENZO[D]IMIDAZOLE
CAS:6489-09-4
KIN01163480
1-METHYL-2-(1H-PYRAZOL-1-YLMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:26558-93-0
KIN02149399
1-METHYL-2-(1H-PYRROL-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:73725-25-4
Formula: C12H11N3
KIN02600233
1-METHYL-2-(1H-PYRROL-2-YL)ETHANAMINE
CAS:90000-40-1
Formula: C7H12N2
KIN02720690
1-Methyl-2-(1H-pyrrol-2-yl)ethanamine
1-METHYL-2-(1H-TETRAZOL-5-YL)-4(1H)-QUINAZOLINONE
CAS:88267-84-9
Formula: C10H8N6O
KIN02695694
1-METHYL-2-(1Z)-1-PROPEN-1-YL-1H-INDOLE
CAS:89374-67-4
Formula: C12H13N
KIN02710920
1-METHYL-2-(1Z)-1-PROPEN-1-YLBENZENE
CAS:2077-34-1
Formula: C10H12
KIN01062208
1-METHYL-2-(2,2,2-TRIFLUORO-ETHOXY) CYCLOBUTENE
CAS:53968-68-6
Formula: C7H9F3O
KIN02343115
1-METHYL-2-(2,2,2-TRIFLUORO-ETHOXY) CYCLOHEXENE
CAS:85355-25-5
Formula: C9H13F3O
KIN02673775
1-METHYL-2-(2,2,2-TRIFLUORO-ETHYL)-BENZENE
CAS:158884-40-3
KIN03321765
1-METHYL-2-(2,3,4,5,6-PENTAFLUOROPHENYL)-1H-PERIMIDINE
CAS:79457-15-1
Formula: C18H9F5N2
KIN02637842
1-METHYL-2-(2,3,4,5,6-PENTAFLUOROPHENYL)-1H-PYRROLE
CAS:147439-19-8
KIN03679171
1-METHYL-2-(2,3,4,5-TETRACHLOROPHENYL)-1H-PYRROLE
CAS:54989-20-7
KIN02358845
1-METHYL-2-(2,3,4,5-TETRAFLUOROPHENYL)-1H-PYRROLE
CAS:33795-82-3
Formula: C11H7F4N
KIN02208869
1-METHYL-2-(2,4,4,4-TETRACHLORO-BUTYL)-BENZENE
CAS:103859-79-6
Formula: C11H12Cl4
KIN03056771
1-METHYL-2-(2,4,4-TRIMETHYLPENTYL)-1H-IMIDAZOLE
CAS:164062-96-8
KIN03334973
1-METHYL-2-(2,4,4-TRIMETHYLPENTYL)-1H-PERIMIDINE
CAS:168472-75-1
Formula: C20H26N2
KIN03342959
1-METHYL-2-(2,4,6-TRIMETHYLPHENYL)-PYRROLIDINE
CAS:92321-36-3
Formula: C14H21N
KIN02755510
1-METHYL-2-(2,5,6-TRIFLUOROPYRIMIDIN-4-YL)-1H-INDOLE
CAS:144654-21-7
KIN03668742
1-METHYL-2-(2-((MORPHOLIN-4-YL)ETHYL)THIO)-5-NITRO-BENZO[D]IMIDAZOLE
CAS:36911-74-7
Formula: C14H18N4O3S
KIN02235253
1-METHYL-2-(2-(3-METHYLTHIOPHEN-2-YL)VINYL)-1,4,5,6-TETRAHYDROPYRIMIDINE 2,3-DIHYDROXYSUCCINATE; 1,4,5,6-TETRAHYDRO-1-METHYL-2-(2-(3-METHYLTHIOPHEN-2-YL)VINYL)-PYRIMIDINE TARTRATE; 1,4,5,6-TETRAHYDRO-1-METHYL-2-(2-(3-METHYLTHIOPHEN-2-YL)VINYL)-PYRIMIDINE TARTRATE
CAS:26155-31-7
Formula: C12H16N2S.C4H6O6
KIN02145855
Morantel tartrate
MFCD00079449
1-METHYL-2-(2-(4-(3-(TRIFLUOROMETHYL)PHENYL)PIPERAZIN-1-YL)ETHYL)-1H-NAPHTHO[1,2-D]IMIDAZOLECITRATE
CAS:110545-39-6
Formula: C31H33F3N4O7
KIN03102273
1-METHYL-2-(2-(4-METHYL-PIPERAZIN-1-YL)ETHYLTHIO)-5-NITRO-BENZO[D]IMIDAZOLE
CAS:36911-75-8
Formula: C15H21N5O2S
KIN02235254
1-METHYL-2-(2-(METHYLTHIO)-2-(MORPHOLIN-4-YL)VINYL)-PYRIDINIUM IODIDE
CAS:54254-80-7
Formula: C13H19IN2OS
KIN02347366
1-METHYL-2-(2-(METHYLTHIO)-2-PIPERIDIN-1-YLVINYL)-PYRIDINIUM IODIDE
CAS:104664-43-9
Formula: [C14H21IN2S
KIN03062894
1-METHYL-2-(2-(NAPHTHALEN-1-YL)VINYL)-PYRIDINIUM IODIDE
CAS:21915-05-9
Formula: C18H16IN
KIN02105479
1-METHYL-2-(2-(TRIMETHYLAMMONIO)ETHYL)-PYRIDIN-1-IUM IODIDE
CAS:7279-52-9
Formula: C15H28I2N2
KIN01183491
1-METHYL-2-(2-ALLYLOXY) -1H-BENZO[D]IMIDAZOLE
CAS:19382-39-9
Formula: C11H12N2O
KIN02080863
1-METHYL-2-(2-METHYL-[1,3]DIOXOLAN-4-YL) -PYRROLIDINE
CAS:65344-73-2
Formula: C9H17NO2
KIN02525213
1-METHYL-2-(2-METHYL-1-PROPEN-1-YL)-1H-IMIDAZOL-5-CARBONITRILE
CAS:121802-99-1
Formula: C9H11N3
KIN03171665
1-METHYL-2-(2-METHYL-1-PROPEN-1-YL)-1H-IMIDAZOLE
CAS:77280-54-7
Formula: C8H12N2
KIN02624548
1-METHYL-2-(2-METHYL-1-PROPEN-1-YL)-4-NITRO-1H-IMIDAZOLE
CAS:118467-53-1
Formula: C8H11N3O2
KIN03154352
1-METHYL-2-(2-METHYL-2-NITRO-PROPYL)-1H-IMIDAZOLE
CAS:124312-75-0
KIN03019381
1-METHYL-2-(2-METHYL-2-NITRO-PROPYL)-5-NITRO-1H-IMIDAZOLE
CAS:141363-20-4
Formula: [C8H12N4O4
KIN03259845
1-METHYL-2-(2-METHYL-ALLYL)PIPERIDINE
CAS:65819-82-1
Formula: C10H19N
KIN02532871
1-METHYL-2-(2-METHYLBUTAN-2-YL)CYCLOHEXANOL
CAS:106615-13-8
Formula: C12H24O
KIN03077434
1-METHYL-2-(2-METHYLBUTYL)-BENZENE
CAS:96857-14-6
Formula: C12H18
KIN02803317
1-METHYL-2-(2-METHYLCYCLOHEXYL) -BENZENE
CAS:92299-07-5
Formula: C14H20
KIN02755298
1-METHYL-2-(2-METHYLCYCLOHEXYL) CYCLOHEXANE
CAS:54823-94-8
Formula: C14H26
KIN02355986
1-METHYL-2-(2-METHYLCYCLOPROPYL)-1H-BENZO[D]IMIDAZOLE
CAS:167483-60-5
Formula: [C12H14N2
KIN03340736
1-METHYL-2-(2-METHYLCYCLOPROPYL)-1H-IMIDAZOLE
CAS:164063-10-9
Formula: [C8H12N2
KIN03334980
1-METHYL-2-(2-METHYLCYCLOPROPYL)-1H-PERIMIDINE
CAS:168472-85-3
Formula: C16H16N2
KIN03342968
1-METHYL-2-(2-METHYLPENT-3-ENYL)-BENZENE
CAS:163489-55-2
Formula: C13H18
KIN03333807
1-METHYL-2-(2-METHYLPHENYL)-1H-INDOL-3-CARBALDEHYDE
CAS:217468-58-1
Formula: C17H15NO
KIN03430065
1-METHYL-2-(2-METHYLPHENYL)PIPERAZINE
CAS:1018645-75-4
Formula: C12H18N2
KIN05039401
1-METHYL-2-(2-METHYLPHENYL)PIPERIDINE
CAS:88081-24-7
KIN02692849
1-METHYL-2-(2-METHYLPHENYL)PIPERIDINE HCL
CAS:1089705-39-4
Formula: C13H19N.ClH
KIN05129508
1-METHYL-2-(2-METHYLPHENYL)PIPERIDINE PICRATE
CAS:102161-36-4
Formula: C13H19N.C6H3N3O7
KIN03044936
1-METHYL-2-(2-METHYLPHENYLOXY) ETHYL CARBAMATE
CAS:63716-26-7
Formula: C11H15NO3
KIN02497622
1-METHYL-2-(2-METHYLPROP-2-ENYL)CYCLOPROPENE
CAS:103739-33-9
Formula: C8H12
KIN03055763
1-METHYL-2-(2-METHYLPROPOXY) -2-OXOETHYL BUTYRATE
CAS:84681-87-8
Formula: C11H20O4
KIN02669245
1-METHYL-2-(2-METHYLPROPYL)-1H-BENZO[D]IMIDAZOLE
CAS:477502-35-5
Formula: C12H16N2
KIN03604542
1-METHYL-2-(2-METHYLPROPYL)-1H-IMIDAZOLE
CAS:120624-83-1
Formula: C8H14N2
KIN03165439
1-METHYL-2-(2-METHYLPROPYL)-1H-INDOLE
CAS:68051-17-2
Formula: C13H17N
KIN02560332
1-METHYL-2-(2-METHYLPROPYL)-1H-PYRROLE
CAS:71707-52-3
Formula: C9H15N
KIN02586301
1-METHYL-2-(2-METHYLPROPYL)-3-PROPAN-2-YL-1H-INDOLE
CAS:113606-74-9
Formula: C16H23N
KIN03124508
1-METHYL-2-(2-METHYLPROPYL)-4,5-DIPHENYL-1H-IMIDAZOLE
CAS:16340-61-7
Formula: C20H22N2
KIN02050382
1-METHYL-2-(2-METHYLPROPYL)-PYRIDINIUM IODIDE
CAS:65819-89-8
Formula: C10H16N.I
KIN02532878
1-METHYL-2-(2-METHYLPROPYL)PIPERIDINE
CAS:65819-83-2
Formula: C10H21N
KIN02532872
1-METHYL-2-(2-NITRO-1-PHENYLETHYL)-1H-PYRROLE
CAS:87520-05-6
Formula: C13H14N2O2
KIN02687414
1-METHYL-2-(2-NITRO-1-PROPEN-1-YL)-BENZENE
CAS:103205-27-2
Formula: C10H11NO2
KIN03052392
1-METHYL-2-(2-NITRO-ETHENYL)-1H-INDOLE
CAS:7171-89-3
Formula: C11H14N8.2ClH
KIN01180584
1-METHYL-2-(2-NITRO-ETHENYL)-9H-CARBAZOLE
CAS:5531-70-4
Formula: C15H16N2
KIN01134918
1-METHYL-2-(2-NITRO-ETHYL)-1H-PYRROLE
CAS:71747-50-7
Formula: C7H10N2O2
KIN02586598
1-METHYL-2-(2-NITRO-ETHYL)-BENZENE
CAS:76024-92-5
Formula: C9H11NO2
KIN02616486
1-METHYL-2-(2-NITROCYCLOHEXYL) -BENZENE
CAS:92041-30-0
KIN02752197
1-METHYL-2-(2-NITROETHENYL)-3-PHENYL-1H-PYRROLE
CAS:1112183-09-1
Formula: C13H12N2O2
KIN05174996
1-METHYL-2-(2-NITROETHENYL)-3-PROPOXY-1H-PYRROLE
CAS:1112182-90-7
Formula: C10H14N2O3
KIN05174988
1-METHYL-2-(2-NITROETHENYL)-3H-BENZO[E]INDOLE
CAS:54544-17-1
Formula: C15H12N2O2
KIN02351688
1-METHYL-2-(2-NITROETHENYL)-4-PHENYL-1H-PYRROLE
CAS:1112183-56-8
Formula: C13H12N2O2
KIN05175009
1-METHYL-2-(2-NITROETHENYL)-4-PROPOXY-1H-PYRROLE
CAS:1112183-30-8
Formula: C10H14N2O3
KIN05175001
1-METHYL-2-(2-NITROETHENYL)-5-PHENYL-1H-PYRROLE
CAS:1112184-16-3
Formula: C13H12N2O2
KIN05175023
1-METHYL-2-(2-NITROETHENYL)-5-PROPOXY-1H-PYRROLE
CAS:1112183-91-1
Formula: C10H14N2O3
KIN05175015
1-METHYL-2-(2-NITROPHENOXY) -BENZENE
CAS:54106-40-0
Formula: C13H11NO3
KIN02345103
1-METHYL-2-(2-NITROPHENYL)-1-PHENYLHYDRAZINE
CAS:62054-65-3
Formula: C13H13N3O2
KIN02466952
1-METHYL-2-(2-NITROPHENYL)-1H-BENZO[D]IMIDAZOL-4-CARBALDEHYDE
CAS:412008-72-1
Formula: C15H11N3O3
KIN03569975
1-METHYL-2-(2-NITROPHENYL)-1H-BENZO[D]IMIDAZOLE
CAS:60418-14-6
Formula: C14H11N3O2
KIN02444231
1-METHYL-2-(2-NITROPHENYL)-1H-IMIDAZOLE
CAS:87488-91-3
Formula: C10H9N3O2
KIN02687200
1-METHYL-2-(2-NITROPHENYL)-1H-PERIMIDINE
CAS:63656-66-6
Formula: C18H13N3O2
KIN02496742
1-METHYL-2-(2-NITROPHENYL)-1H-PYRROLE
CAS:305811-27-2
KIN03481972
1-METHYL-2-(2-NITROPHENYL)-2,3-DIHYDRO-BENZO[D]IMIDAZOLE
CAS:3718-03-4
Formula: C14H11N3O2
KIN01094590
1-METHYL-2-(2-OXO-2-PHENYLETHYLIDENE) -HYDRAZINECARBOTHIOAMIDE
CAS:56406-76-9
Formula: C10H11N3OS
KIN02382259
1-METHYL-2-(2-PHENOXYETHOXY) -BENZENE
CAS:53223-39-5
KIN02331983
1-METHYL-2-(2-PHENYL-ACETYL)-3-PYRAZOLIDINECARBONITRILE
CAS:25647-39-6
Formula: C13H15N3O
KIN02141656
1-METHYL-2-(2-PHENYL-ACETYL)-4-PYRAZOLIDINECARBONITRILE
CAS:25647-40-9
Formula: C13H15N3O
KIN02141657
1-METHYL-2-(2-PHENYLBENZO[D][1,3]OXATHIOL-2-YL) -1H-PYRROLE
CAS:112925-40-3
Formula: C18H15NOS
KIN03119175
1-METHYL-2-(2-PHENYLCYCLOPROPYL)-DIAZENE
CAS:95210-45-0
Formula: C10H12N2
KIN02789330
1-METHYL-2-(2-PHENYLDIAZENYL)-1H-IMIDAZOLE
CAS:72908-92-0
Formula: C10H10N4
KIN02594634
1-METHYL-2-(2-PHENYLETHENYL)-1H-BENZO[D]IMIDAZOLE
CAS:2563-04-4
Formula: C9H12O2
KIN01072011
1-METHYL-2-(2-PHENYLETHENYL)-1H-IMIDAZOLE
CAS:181486-42-0
KIN03371134
1-METHYL-2-(2-PHENYLETHENYL)-1H-PERIMIDINE
CAS:51784-20-4
Formula: C20H16N2
KIN02311575
1-METHYL-2-(2-PHENYLETHENYL)-1H-PERIMIDINE HCL
CAS:60315-56-2
Formula: C20H16N2.HCl
KIN02443503
1-METHYL-2-(2-PHENYLETHENYL)-PYRIDINIUM METHYLSULFATE
CAS:97320-86-0
Formula: C14H14N.CH3O4S
KIN02805515
1-METHYL-2-(2-PHENYLETHENYL)-QUINOLINIUM IODIDE
CAS:6286-06-2
Formula: C20H22INO2
KIN01155519
1-METHYL-2-(2-PHENYLETHYL)-1H-IMIDAZOL-5-YLAMINE
CAS:145798-99-8
Formula: C12H15N3
KIN03280666
1-METHYL-2-(2-PHENYLETHYL)-1H-IMIDAZOLE
CAS:163035-64-1
KIN03332789
1-METHYL-2-(2-PHENYLETHYL)-1H-PERIMIDINE
CAS:168472-76-2
Formula: C20H18N2
KIN03342960
1-METHYL-2-(2-PHENYLETHYL)-1H-PYRROLE
CAS:92454-15-4
Formula: C13H15N
KIN02756901
1-METHYL-2-(2-PHENYLETHYL)-BENZENE
CAS:34403-05-9
Formula: C15H16
KIN02213750
1-METHYL-2-(2-PHENYLETHYL)-PYRROLIDINE
CAS:106366-33-0
Formula: C13H19N
KIN03076089
1-METHYL-2-(2-PHENYLETHYNYL)-1H-IMIDAZOLE
CAS:111600-87-4
KIN03108810
1-METHYL-2-(2-PHENYLETHYNYL)-1H-PYRROLE
CAS:144912-17-4
Formula: C13H11N
KIN03277697
1-METHYL-2-(2-PHENYLETHYNYL)-3-(3-PHENYLPROP-2-YNYL)-1H-BENZO[D]IMIDAZOL-1-IUM
CAS:255716-40-6
Formula: C25H19N2
KIN03454772
1-METHYL-2-(2-PHENYLETHYNYL)-3-(3-PHENYLPROP-2-YNYL)-1H-BENZO[D]IMIDAZOL-1-IUM, TETRAFLUOROBORATE
CAS:255716-41-7
Formula: C25H19BF4N2
KIN03454773
1-METHYL-2-(2-PHENYLETHYNYL)-3-ALLYLPYRROLIDINE
CAS:344306-31-6
Formula: C16H19N
KIN03519592
1-METHYL-2-(2-PHENYLETHYNYL)-PYRROLIDINE
CAS:125038-91-7
Formula: C13H15N
KIN03186828
1-METHYL-2-(2-PHENYLVINYL) -PYRIDINIUM IODIDE
CAS:2787-09-9
Formula: C11H12Cl2N2O5
KIN01076128
1-METHYL-2-(2-PHOSPHONOETHYL)-PYRIDINIUM IODIDE DIBUTYL ESTER
CAS:6460-27-1
Formula: C4H9Cl2P
KIN01162780
1-METHYL-2-(2-PROPEN-1-YL)-3-(2-PROPEN-1-YLOXY)-BENZENE
CAS:107203-30-5
Formula: C13H16O
KIN03634788
1-METHYL-2-(2-PROPYL-3H-BENZO[D]IMIDAZOL-5-YL)-1H-BENZO[D]IMIDAZOLE
CAS:141838-52-0
Formula: C18H18N4
KIN03262249
1-METHYL-2-(2H-TETRAZOL-5-YL)-1H-BENZO[D]IMIDAZOLE
CAS:43102-22-3
Formula: C9H8N6
KIN02282659
1-METHYL-2-(2H-TETRAZOL-5-YL)-1H-BENZO[D]IMIDAZOLE 3-OXIDE
CAS:19808-85-6
KIN02084860
1-METHYL-2-(3,4,5-TRIMETHOXY-PHENYL) -1H-PERIMIDINE
CAS:63656-62-2
Formula: C21H20N2O3
KIN02496738
1-METHYL-2-(3,4,5-TRIMETHOXY-PHENYL) -1H-PERIMIDINE HCL
CAS:63656-78-0
Formula: C21H20N2O3.HCl
KIN02496751
1-METHYL-2-(3,4,5-TRIMETHOXY-PHENYL) PIPERAZINE
CAS:1018646-23-5
Formula: C14H22N2O3
KIN05039414
1-METHYL-2-(3-(1-METHYLNAPHTHO[1,2-D]THIAZOL-2(1H)-YLIDENE)-ALLYL)-NAPHTHO[1,2-D]THIAZOL-1-IUM IODIDE
CAS:2785-02-6
KIN01076075
1-METHYL-2-(3-FORMYL-FURYL-2)-1H-BENZO[D]IMIDAZOLE
CAS:147591-73-9
Formula: C13H10N2O2
KIN03286561
1-METHYL-2-(3-METHYL-1,2,4-OXADIAZOL-5-YL) -1H-INDOLE
CAS:168201-45-4
KIN03668741
1-METHYL-2-(3-METHYL-1H-[1,2,4]-TRIAZOL-5-YL)-1H-BENZO[D]IMIDAZOLE
CAS:50313-67-2
KIN02291617
1-METHYL-2-(3-METHYL-3-BUTENYL)-1H-INDOLE
CAS:1158986-67-4
Formula: C14H17N
KIN05254584
1-METHYL-2-(3-METHYL-3-PHENYLCYCLOBUTYLIDENE)-HYDRAZINECARBODITHIOIC ACID METHYL ESTER
CAS:189443-33-2
Formula: C14H18N2S2
KIN03389044
1-METHYL-2-(3-METHYLBUT-2-EN-1-YL)-1H-IMIDAZOLE
CAS:146697-98-5
KIN03283296
1-METHYL-2-(3-METHYLBUT-2-ENYL)-1H-PYRROLE
CAS:87728-87-8
Formula: C10H15N
KIN02689092
1-METHYL-2-(3-METHYLBUT-2-ENYL)-2-PHENYLPYRROLIDINE
CAS:80326-42-7
Formula: C16H23N
KIN02643370
1-METHYL-2-(3-METHYLBUTYL)-4-(1-METHYLETHYL)-BENZENE
CAS:57079-77-3
Formula: C15H24
KIN02393833
1-METHYL-2-(3-METHYLBUTYL)-BENZENE
CAS:62701-92-2
Formula: C12H18
KIN02478896
1-METHYL-2-(3-METHYLBUTYL)CYCLOBUTANE
CAS:95572-71-7
Formula: C10H20
KIN02792818
1-METHYL-2-(3-METHYLCYCLOHEXYL) -BENZENE
CAS:339547-67-0
KIN03513360
1-METHYL-2-(3-METHYLPENTYL)CYCLOPROPANE
CAS:62238-07-7
Formula: C10H20
KIN02470643
1-METHYL-2-(3-METHYLPHENOXY) -BENZENE
CAS:66658-61-5
Formula: C14H14O
KIN02544537
1-METHYL-2-(3-METHYLPHENYL)-1,2-CYCLOPENTANEDIOL
CAS:208457-86-7
Formula: C13H18O2
KIN03672003
1-METHYL-2-(3-METHYLPHENYL)-1H-IMIDAZOLE
CAS:1021602-59-4
Formula: C11H12N2
KIN05055364
1-METHYL-2-(3-METHYLPHENYL)PIPERAZINE
CAS:1018610-68-8
Formula: C12H18N2
KIN05038853
1-METHYL-2-(3-METHYLPHENYL)PIPERIDINE
CAS:61858-23-9
Formula: C13H19N
KIN02463246
1-METHYL-2-(3-NITROPHENYL)-INDOLIZINE
CAS:1088-34-2
Formula: C16H12N2O
KIN01039372
1-METHYL-2-(3-OXO-3-PHENYLPROPYL) -PYRIDINIUM IODIDE
CAS:71858-76-9
Formula: C15H16INO
KIN02587408
1-METHYL-2-(3-OXO-3H-INDOL-2-YL) HYDRAZINECARBOTHIOAMIDE
CAS:54289-64-4
Formula: C10H10N4OS
KIN02347866
1-METHYL-2-(3-PHENYL-1-CYCLOHEXEN-1-YL) -BENZENE
CAS:91739-55-8
Formula: C19H20
KIN02748162
1-METHYL-2-(3-PHENYL-2-CYCLOHEXEN-1-YL) -BENZENE
CAS:91739-56-9
Formula: C19H20
KIN02748163
1-METHYL-2-(3-PHENYLPROPYL)-1H-IMIDAZOLE
CAS:1141497-98-4
Formula: C13H16N2
KIN05189773
1-METHYL-2-(3-PHENYLPROPYL)-BENZENE
CAS:1520-41-8
Formula: C23H24
KIN01049181
1-METHYL-2-(3-PHENYLPROPYL)DISULFANE
CAS:114764-12-4
Formula: C10H14S2
KIN03133168
1-METHYL-2-(3-SULFOBENZOYL)-PYRIDINIUM INNER SALT
CAS:3340-31-6
Formula: C11H12N2
KIN01087131
1-METHYL-2-(4'-METHYL-BIPHENYL-2-YL)-1H-IMIDAZOLE
CAS:1046784-29-5
Formula: C17H16N2
KIN05095565
1-METHYL-2-(4-((PYRIDIN-2-YLHYDRAZONO)METHYL)PHENYL)-IMIDAZO[1,2-A]PYRIDINIUM TOSYLATE
CAS:123510-67-8
Formula: [C27H25N5O3S
KIN03180004
1-METHYL-2-(4-((PYRIMIDIN-2-YLHYDRAZONO)METHYL)PHENYL)-IMIDAZO[1,2-A]PYRIDINIUM BROMIDE HBR
CAS:123510-68-9
Formula: [C19H18Br2N6]
KIN03180005
1-METHYL-2-(4-(4-(3-(4-(1-METHYLPYRIDINIUM-3-YLCARBAMOYL)PHENYLAMINO)-3-OXO-PROP-1-ENYL)-BENZAMIDO)-BENZAMIDO)-PYRIDINIUM TOSYLATE
CAS:19060-42-5
Formula: C50H46N6O10S2
KIN02077597
1-METHYL-2-(4-(4-(3-(4-(1-METHYLPYRIDINIUM-4-YLAMINO)PHENYLAMINO)-3-OXO-PROP-1-ENYL)-BENZAMIDO)PHENYLAMINO)-PYRIDINIUM TOSYLATE
CAS:20719-22-6
Formula: C48H46N6O8S2
KIN02093288
1-METHYL-2-(4-CHLOROPHENYL)AZIRIDINE
CAS:66295-99-6
Formula: C9H10ClN
KIN02540031
1-METHYL-2-(4-METHYL-3-NITROPHENYL)-5-NITRO-1H-IMIDAZOLE
CAS:4204-96-0
Formula: C12H12N4O3
KIN01102946
1-METHYL-2-(4-METHYL-PIPERAZIN-1-YL)-1H-BENZO[D]IMIDAZOLE
CAS:57897-97-9
KIN02407141
1-METHYL-2-(4-METHYLBENZOYL)-1H-INDOL-3-CARBALDEHYDE
CAS:205520-05-4
KIN03415078
1-METHYL-2-(4-METHYLBENZOYL)-1H-PYRROL-3-CARBALDEHYDE
CAS:1071109-08-4
Formula: C14H13NO2
KIN05111753
1-METHYL-2-(4-METHYLCYCLOHEXYL) -BENZENE
CAS:92299-08-6
Formula: C14H20
KIN02755299
1-METHYL-2-(4-METHYLCYCLOHEXYL) PIPERIDINE
CAS:85237-74-7
Formula: C13H25N
KIN02672924
1-METHYL-2-(4-METHYLPENTYL)CYCLOPROPANE
CAS:95572-64-8
Formula: C10H20
KIN02792811
1-METHYL-2-(4-METHYLPHENYL)-[1,2,4]-TRIAZOLIDINE-3,5-DIONE
CAS:5647-70-1
Formula: C24H30N2OS
KIN01137742
1-METHYL-2-(4-METHYLPHENYL)-1,2-CYCLOPENTANEDIOL
CAS:364603-09-8
Formula: C13H18O2
KIN03672002
1-METHYL-2-(4-METHYLPHENYL)-1H-BENZO[D]IMIDAZOLE
CAS:2620-79-3
KIN01073123
1-METHYL-2-(4-METHYLPHENYL)-1H-IMIDAZOLE
CAS:122428-20-0
KIN03174712
1-METHYL-2-(4-METHYLPHENYL)-1H-INDOL-3-CARBALDEHYDE
CAS:137206-91-8
Formula: C17H15NO
KIN03240481
1-METHYL-2-(4-METHYLPHENYL)-2-OXOETHYLIDENE
CAS:1149352-76-0
Formula: C10H10O
KIN05196518
1-METHYL-2-(4-METHYLPHENYL)-2-OXOETHYLIUM
CAS:1149352-82-8
Formula: C10H11O
KIN05196521
1-METHYL-2-(4-METHYLPHENYL)-3-PHENYL-1H-INDENE
CAS:95532-91-5
Formula: C23H20
KIN02792460
1-METHYL-2-(4-METHYLPHENYL)-3-PHENYL-1H-PYRROLE
CAS:224434-77-9
KIN03439477
1-METHYL-2-(4-METHYLPHENYL)-4-NITRO-1H-IMIDAZOLE
CAS:37115-94-9
Formula: C11H11N3O2
KIN02237200
1-METHYL-2-(4-METHYLPHENYL)-5-NITRO-1H-IMIDAZOLE
CAS:4308-43-4
Formula: C10H8N4O4
KIN01104897
1-METHYL-2-(4-METHYLPHENYL)-5-OXO-2,3-DIHYDROIMIDAZO[1,2-A]PYRIMIDIN-6-CARBOXYLIC ACID
CAS:141234-28-8
Formula: C15H15N3O3
KIN03258948
1-METHYL-2-(4-METHYLPHENYL)-6-PHENYLPYRIDIN-4-THIONE
CAS:109346-34-1
Formula: C19H17NS
KIN03094762
1-METHYL-2-(4-METHYLPHENYL)-DIAZENE
CAS:242457-75-6
Formula: C8H10N2
KIN03446235
1-METHYL-2-(4-METHYLPHENYL)-DIAZENE 2-OXIDE
CAS:242457-74-5
Formula: C8H10N2O
KIN03446234
1-METHYL-2-(4-METHYLPHENYL)-INDOLIZINE
CAS:92962-24-8
Formula: C16H15N
KIN02763593
1-METHYL-2-(4-METHYLPHENYL)-PYRROLIDINE
CAS:91562-63-9
Formula: C12H17N
KIN02745654
1-METHYL-2-(4-METHYLPHENYL)-QUINAZOLIN-4-THIONE
CAS:396716-29-3
Formula: C16H14N2S
KIN03559367
1-METHYL-2-(4-METHYLPHENYL)AZIRIDINE
CAS:58777-94-9
Formula: C10H13N
KIN02421049
1-METHYL-2-(4-METHYLPHENYL)ETHYLIDENE
CAS:66343-75-7
Formula: C10H12
KIN02540705
1-METHYL-2-(4-METHYLPHENYL)PIPERIDINE
CAS:3358-48-3
Formula: C13H19N.C6H3N3O7
KIN01087557
1-METHYL-2-(4-METHYLPHENYL)PIPERIDINE 1-OXIDE
CAS:3358-67-6
Formula: C12H16ClNO
KIN01087561
1-METHYL-2-(4-METHYLPHENYL)PIPERIDINE PICRATE
CAS:3358-63-2
KIN01087558
1-METHYL-2-(4-METHYLPHENYL)SULFONYL-1-NITROSO-GUANIDINE
CAS:189556-52-3
Formula: C9H12N4O3S
KIN03389218
1-METHYL-2-(4-METHYLSTYRYL)-PYRIDINIUM IODIDE
CAS:97175-46-7
Formula: C15H16IN
KIN02804809
1-METHYL-2-(4-NITROPHENOXY) -BENZENE
CAS:2444-36-2
Formula: C8H7ClO2
KIN01069674
1-METHYL-2-(4-NITROPHENYL)-1H-BENZO[D]IMIDAZOLE
CAS:3718-04-5
Formula: C5H6N2
KIN01094591
1-METHYL-2-(4-NITROPHENYL)-1H-IMIDAZOLE
CAS:334952-04-4
Formula: C10H9N3O2
KIN03508157
1-METHYL-2-(4-NITROPHENYL)-1H-PERIMIDINE
CAS:51784-21-5
Formula: C18H13N3O2
KIN02311576
1-METHYL-2-(4-NITROPHENYL)-1H-PYRROLE
CAS:149052-66-4
KIN03291211
1-METHYL-2-(4-NITROPHENYL)-4,5-DIPHENYL-1H-IMIDAZOLE
CAS:36783-81-0
Formula: C22H17N3O2
KIN02234205
1-METHYL-2-(4-NITROPHENYL)-INDOLIZINE
CAS:1029-04-5
KIN01037649
1-METHYL-2-(4-PENTEN-1-YL)-1H-IMIDAZOLE
CAS:120624-82-0
KIN03165438
1-METHYL-2-(4-PHENYLBUTA-1,3-DIENYL)-PYRIDIN-1-IUM IODIDE
CAS:7466-17-3
Formula: C17H16INO3
KIN01187803
1-METHYL-2-(4-PROPYLPHENOXY) -BENZENE
CAS:374068-08-3
Formula: C16H18O
KIN03544421
1-METHYL-2-(5'-METHYL-2'-SELENIENYL)-1H-BENZO[D]IMIDAZOLE
CAS:115174-22-6
Formula: C13H12N2Se
KIN03135780
1-METHYL-2-(5'-METHYL-4'-NITRO-2'-SELENIENYL)-1H-BENZO[D]IMIDAZOLE
CAS:115174-23-7
Formula: C13H11N3O2Se
KIN03135781
1-METHYL-2-(5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)-AZIRIDINE
CAS:40807-81-6
KIN02266006
1-METHYL-2-(5-METHYL-1,2,4-OXADIAZOL-3-YL) -1H-INDOLE
CAS:168201-46-5
KIN03668740
1-METHYL-2-(5-METHYL-1,3,4-OXADIAZOL-2-YL) -1H-BENZO[D]IMIDAZOLE
CAS:26286-47-5
KIN02147060
1-METHYL-2-(5-METHYL-1,3,4-OXADIAZOL-2-YL) -1H-INDOLE
CAS:93397-65-0
Formula: C12H11N3O
KIN02768956
1-METHYL-2-(5-METHYL-5-NITRO-2-OXIDO-1,3,2-DIOXAPHOSPHORINAN-2-YL) HYDRAZINE HCL
CAS:20926-53-8
Formula: C5H12N3O5P.HCl
KIN02095481
1-METHYL-2-(5-METHYLTHIAZOL-2-YL)-1H-INDOLE HCL
CAS:65248-03-5
Formula: C13H12N2S.ClH
KIN02523603
1-METHYL-2-(5-NITRO-1H-PYRROL-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:13349-46-7
KIN02018294
1-METHYL-2-(5-NITRO-FURAN-2-YL)-1H-IMIDAZOLE
CAS:127702-54-9
Formula: C8H7N3O3
KIN03198470
1-METHYL-2-(5-NITRO-FURAN-2-YL)-1H-PERIMIDINE
CAS:51784-22-6
Formula: C16H11N3O3
KIN02311577
1-METHYL-2-(5-NITRO-THIOPHEN-2-YL)-1H-IMIDAZOLE
CAS:141989-41-5
Formula: C8H7N3O2S
KIN03263011
1-METHYL-2-(5-PHENYL-1,2,4-TRIAZIN-3-YL)HYDRAZINE
CAS:69466-49-5
Formula: C10H11N5
KIN02570500
1-METHYL-2-(6,10-DIOXASPIRO[4.5]DECAN-8-YL) -PYRIDIN-1-IUM, IODIDE
CAS:111504-47-3
Formula: C14H20INO2
KIN03108251
1-METHYL-2-(6-METHYLPYRIDIN-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:143266-97-1
Formula: C14H13N3
KIN03269193
1-METHYL-2-(7-METHYL-1H-INDOL-3-YL)ETHANAMINE
CAS:1013-48-5
Formula: C11H13ClN2.ClH
KIN01037065
1-METHYL-2-(7-METHYL-1H-INDOL-3-YL)ETHANAMINE HCL
CAS:4765-10-0
Formula: C13H18N2O
KIN01114225
1-METHYL-2-(7-METHYL-1H-INDOL-3-YL)ETHANAMINE MALEATE
CAS:100197-26-0
KIN03657365
1-METHYL-2-(ACI-NITROMETHYL)-BENZENE
CAS:36206-82-3
Formula: C8H9NO2
KIN02229960
1-METHYL-2-(ALLYL)HYDRAZINE
CAS:55210-81-6
Formula: C4H10N2
KIN02362437
1-METHYL-2-(ALLYL)PIPERIDINE
CAS:51862-14-7
Formula: C9H17N
KIN02312799
1-METHYL-2-(ALLYLDITHIO)ETHYL ALLYL TRISULFIDE
CAS:116669-30-8
Formula: C9H16S5
KIN03145314
1-METHYL-2-(ALLYLOXY) -BENZENE
CAS:936-73-2
KIN01034409
1-METHYL-2-(ALLYLOXY) -PHOSPHOLANE 1-OXIDE
CAS:63923-87-5
Formula: C8H15O2P
KIN02501463
1-METHYL-2-(ALLYLSULFINYL)-1H-PYRROLE
CAS:126093-79-6
KIN03191410
1-METHYL-2-(ALLYLSULFONYL)-1H-PYRROLE
CAS:66785-88-4
Formula: C8H11NO2S
KIN02545636
1-METHYL-2-(ALLYLTHIO)-1H-IMIDAZOLE
CAS:63348-54-9
Formula: C7H10N2S
KIN02491015
1-METHYL-2-(ALLYLTHIO)-1H-PYRROLE
CAS:66785-86-2
Formula: C8H11NS
KIN02545634
1-METHYL-2-(ALLYLTHIO)ETHYL ALLYL TRISULFIDE
CAS:193625-60-4
Formula: C9H16S4
KIN03396858
1-METHYL-2-(ALPHA-HYDROXY-4-METHYLBENZYL) -1H-BENZO[D]IMIDAZOLE
CAS:187875-25-8
Formula: C16H16N2O
KIN03384001
1-METHYL-2-(BENZENESULFONYL)-BENZENE
CAS:7018-92-0
Formula: C11H20O2
KIN01176526
1-METHYL-2-(BENZENESULFONYLMETHYL)-PYRIDINIUM IODIDE
CAS:1804-22-4
Formula: C9H9N3O4S
KIN01056234
1-METHYL-2-(BENZYL)-1H-BENZO[D]IMIDAZOL-6-CARBOXYLIC ACID
CAS:193013-53-5
KIN03395493
1-METHYL-2-(BENZYL)-1H-IMIDAZOLE
CAS:92506-23-5
Formula: C11H12N2
KIN02757565
1-METHYL-2-(BENZYL)-1H-PYRROLE
CAS:81852-70-2
Formula: C12H13N
KIN02652141
1-METHYL-2-(BENZYL)-2H-ISOINDOLE
CAS:58083-61-7
Formula: C16H15N
KIN02410077
1-METHYL-2-(BENZYL)-3,5-PYRAZOLIDINEDIONE
CAS:98380-76-8
Formula: C11H12N2O2
KIN02813291
1-METHYL-2-(BENZYL)-4-PYRAZOLIDINAMINE
CAS:75375-85-8
Formula: C11H17N3
KIN02612231
1-METHYL-2-(BENZYL)-4-PYRAZOLIDINOL
CAS:30720-02-6
Formula: C11H16N2O
KIN02184274
1-METHYL-2-(BENZYL)-PYRROLIDINE
CAS:4266-04-0
KIN01104094
1-METHYL-2-(BENZYL)CYCLOPENTANAMINE
CAS:80649-71-4
KIN02645450
1-METHYL-2-(BENZYL)CYCLOPENTANOL
CAS:80649-68-9
Formula: C13H18O
KIN02645448
1-METHYL-2-(BENZYL)HYDRAZINE
CAS:10309-79-2
Formula: C8H12N2
KIN02004697
Hydrazine, 1-benzyl-2-methyl- ; 1-Benzyl-2-methylh
1-METHYL-2-(BENZYL)HYDRAZINE 2HCL
CAS:26253-99-6
Formula: C8H12N2.2ClH
KIN02146776
1-METHYL-2-(BENZYL)HYDRAZINE HCL
CAS:26253-98-5
Formula: C8H12N2.ClH
KIN02146775
1-METHYL-2-(BENZYL)HYDRAZINE PHOSPHATE
CAS:2817-96-1
Formula: C10H14O
KIN01076722
1-METHYL-2-(BENZYL)HYDRAZINECARBOXIMIDAMIDE HCL
CAS:2168-61-8
Formula: C19H24O4
KIN01064083
1-METHYL-2-(BENZYL)PIPERIDINE
CAS:31414-56-9
Formula: C13H19N
KIN02189278
1-METHYL-2-(BENZYLOXY) -3-INDOLIZINECARBALDEHYDE
CAS:86842-94-6
Formula: C17H15NO2
KIN02682897
1-METHYL-2-(BENZYLOXY) -3-PROP-2-ENYLBENZENE
CAS:122030-12-0
Formula: C17H18O
KIN03172852
1-METHYL-2-(BENZYLOXY) -6-OXA-BICYCLO[3.1.0]HEXANE
CAS:190895-88-6
KIN03023324
1-METHYL-2-(BENZYLOXY) -AZETIDINE
CAS:344306-11-2
KIN03519591
1-METHYL-2-(BENZYLOXY) -BENZENE
CAS:19578-70-2
Formula: C8H12N2O
KIN02082509
1-METHYL-2-(BENZYLOXY) -DIAZENE 2-OXIDE
CAS:36342-31-1
Formula: C8H10N2O2
KIN02231161
1-METHYL-2-(DITHIOCARBOXYMETHYLENE) -1,2-DIHYDROPYRIDINE
CAS:21695-44-3
Formula: C8H9NS2
KIN02103311
1-METHYL-2-(ISOPROPOXY) -2-OXOETHYL
CAS:85598-42-1
Formula: C6H11O2
KIN02675340
1-METHYL-2-(ISOPROPOXY) -PHOSPHOLANE 1-OXIDE
CAS:63924-04-9
Formula: C8H17O2P
KIN02501480
1-METHYL-2-(METHYLAMINO)-1H-BENZO[D]IMIDAZOL-4,7-DIOL
CAS:112363-28-7
Formula: C9H11N3O2
KIN03114760
1-METHYL-2-(METHYLAMINO)-1H-BENZO[D]IMIDAZOL-4-OL
CAS:177478-32-9
Formula: C9H11N3O
KIN03362420
1-METHYL-2-(METHYLAMINO)-1H-BENZO[D]IMIDAZOLE
CAS:6595-23-9
KIN01165625
1-METHYL-2-(METHYLAMINO)-4(1H)-PYRIMIDINONE
CAS:64359-57-5
Formula: C6H9N3O
KIN02508720
1-METHYL-2-(METHYLAMINO)-4(1H)-QUINAZOLINONE
CAS:5544-12-7
KIN01135273
1-METHYL-2-(METHYLCARBONYLAMINO)ETHANAMINE
CAS:35397-63-8
Formula: C5H12N2O
KIN02222760
1-METHYL-2-(METHYLDITHIO)-1H-IMIDAZOLE
CAS:136022-19-0
KIN03235234
1-METHYL-2-(METHYLDITHIO)-BENZENE
CAS:35379-09-0
Formula: C8H10S2
KIN02222600
1-METHYL-2-(METHYLPHENYL)-1H-PERIMIDINE
CAS:168705-92-8
Formula: C19H16N2
KIN03343295
1-METHYL-2-(METHYLSELENO)CYCLOHEXENE
CAS:66030-48-6
Formula: C8H14Se
KIN02535868
1-METHYL-2-(METHYLSULFINYL)-1H-IMIDAZOL-4,5-DIMETHANOL
CAS:133778-38-8
Formula: C7H12N2O3S
KIN03646080
1-METHYL-2-(METHYLSULFINYL)-1H-IMIDAZOL-4,5-DIMETHANOL BIS(METHYLCARBAMATE) (ESTER)
CAS:152591-38-3
Formula: C11H18N4O5S
KIN03302734
1-METHYL-2-(METHYLSULFINYL)-1H-IMIDAZOL-5-CARBALDEHYDE
CAS:107718-02-5
Formula: C6H8N2O2S
KIN03084478
1-METHYL-2-(METHYLSULFINYL)-1H-IMIDAZOL-5-METHANOL
CAS:263159-55-3
Formula: C6H10N2O2S
KIN03013906
1-METHYL-2-(METHYLSULFINYL)-1H-IMIDAZOLE
CAS:142132-87-4
KIN03263735
1-METHYL-2-(METHYLSULFINYL)-4-NITRO-1H-IMIDAZOLE
CAS:111535-76-3
Formula: C5H7N3O3S
KIN03108462
1-METHYL-2-(METHYLSULFINYL)-5-NITRO-1H-IMIDAZOLE
CAS:56302-26-2
Formula: C5H7N3O3S
KIN02380546
1-METHYL-2-(METHYLSULFONYL)-1H-IMIDAZOL-5-CARBALDEHYDE
CAS:107718-04-7
Formula: C6H8N2O3S
KIN03646079
1-METHYL-2-(METHYLSULFONYL)-1H-IMIDAZOL-5-YLAMINE
CAS:86008-45-9
Formula: C5H9N3O2S
KIN02677980
1-METHYL-2-(METHYLSULFONYL)-1H-IMIDAZOLE
CAS:71691-71-9
Formula: C5H8N2O2S
KIN02586147
1-METHYL-2-(METHYLSULFONYL)-3-NITRO-BENZENE
CAS:90222-84-7
Formula: C8H9NO4S
KIN02724228
1-METHYL-2-(METHYLSULFONYL)-4-NITRO-1H-IMIDAZOLE
CAS:86072-17-5
Formula: C5H7N3O4S
KIN02678239
1-METHYL-2-(METHYLSULFONYL)-4-NITRO-BENZENE
CAS:90222-83-6
Formula: C8H9NO4S
KIN02724227
1-METHYL-2-(METHYLSULFONYL)-5-NITRO-1H-IMIDAZOLE
CAS:1615-57-2
Formula: C5H6N4O3
KIN01051566
1-METHYL-2-(METHYLSULFONYL)-BENZENE
CAS:23276-69-9
Formula: C8H10O2S
KIN02118532
MFCD09031074
1-METHYL-2-(METHYLTHIO)-1H-1,3-BENZAZARSOLE
CAS:89005-48-1
Formula: C9H10AsNS
KIN02705588
1-METHYL-2-(METHYLTHIO)-1H-BENZO[D]IMIDAZOLE
CAS:4344-62-1
Formula: C9H19NO2
KIN01105539
1-METHYL-2-(METHYLTHIO)-1H-BENZO[D]IMIDAZOLE HI
CAS:73688-75-2
Formula: C9H11IN2S
KIN02600010
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZO[4,5-C]PYRIDINE
CAS:7321-98-4
Formula: C8H11N3S2
KIN01184270
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DICARBALDEHYDE
CAS:145083-36-9
Formula: C7H8N2O2S
KIN03646078
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL
CAS:117121-05-8
Formula: C7H12N2O2S
KIN03147497
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL 4-(METHYLCARBAMATE)
CAS:117121-11-6
Formula: C9H15N3O3S
KIN03147500
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL 5-(METHYLCARBAMATE)
CAS:117121-12-7
Formula: C9H15N3O3S
KIN03147501
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL BIS(METHYLCARBAMATE) (ESTER)
CAS:117120-88-4
Formula: C11H18N4O4S
KIN03147486
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL BIS(METHYLCARBAMATE) HCL
CAS:123298-15-7
Formula: [C11H19ClN4O4S
KIN03178920
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4-CARBALDEHYDE
CAS:149806-15-5
Formula: [C6H8N2OS
KIN03294018
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:149806-14-4
Formula: C8H12N2O2S
KIN03294017
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-4-METHANOL
CAS:149806-16-6
Formula: C6H10N2OS
KIN03294019
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-CARBALDEHYDE
CAS:105956-24-9
Formula: C6H8N2OS
KIN03006544
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-CARBONITRILE
CAS:348637-53-6
KIN03015293
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-CARBOXYLIC ACID ETHYL ESTER
CAS:108925-05-9
Formula: C8H12N2O2S
KIN03092170
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-METHANAMINE
CAS:1177350-25-2
Formula: C6H11N3S
KIN05271548
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-METHANOL
CAS:107718-01-4
Formula: C6H10N2OS
KIN03084477
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOL-5-OL
CAS:64948-69-2
Formula: C5H8N2OS
KIN02518357
1-METHYL-2-(METHYLTHIO)-1H-IMIDAZOLE
CAS:14486-52-3
Formula: C5H8N2S
KIN02032517
1-METHYL-2-(METHYLTHIO)-1H-INDOLE
CAS:13637-44-0
KIN02022547
1-METHYL-2-(METHYLTHIO)-1H-PERIMIDINE
CAS:115923-94-9
Formula: C13H12N2S
KIN03139845
1-METHYL-2-(METHYLTHIO)-1H-PYRROL-3-OL
CAS:325828-22-6
KIN03495779
1-METHYL-2-(METHYLTHIO)-1H-PYRROL-3-SULFONAMIDE
CAS:142112-56-9
KIN03263650
1-METHYL-2-(METHYLTHIO)-1H-PYRROLE
CAS:73671-59-7
Formula: C6H9NS
KIN02599870
1-METHYL-2-(METHYLTHIO)-3-(PHENYLTHIO)-BENZENE
CAS:156631-27-5
KIN03315998
1-METHYL-2-(METHYLTHIO)-3-[(4-PHENYL-PIPERAZIN-1-YL)METHYL]INDOLE
CAS:32952-78-6
Formula: C21H25N3S
KIN02201224
1-METHYL-2-(METHYLTHIO)-4(1H)-PYRIMIDINIMINE HCL
CAS:62765-27-9
Formula: C6H9N3S.ClH
KIN02480079
1-METHYL-2-(METHYLTHIO)-4,5-DIPHENYL-1H-IMIDAZOLE
CAS:17170-82-0
Formula: C17H16N2S
KIN02058956
1-METHYL-2-(METHYLTHIO)-4,6-DIPHENYLPYRIDINIUM IODIDE
CAS:83318-99-4
Formula: C19H18INS
KIN02660466
1-METHYL-2-(METHYLTHIO)-4-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:135790-54-4
Formula: C6H7F3N2S
KIN03623559
1-METHYL-2-(METHYLTHIO)-4-NITRO-1H-IMIDAZOLE
CAS:86072-16-4
Formula: C5H7N3O2S
KIN02678238
1-METHYL-2-(METHYLTHIO)-4-NITRO-BENZENE
CAS:90005-73-5
Formula: C8H9NO2S
KIN02720889
1-METHYL-2-(METHYLTHIO)-4-PHENYL-1H-IMIDAZOLE
CAS:25433-11-8
Formula: C11H12N2S
KIN02139656
1-METHYL-2-(METHYLTHIO)-4-PHENYL-QUINOLINIUM IODIDE
CAS:2584-37-4
Formula: C16H13NO
KIN01072430
1-METHYL-2-(METHYLTHIO)-5-(2-NITRO-ETHENYL)-1H-IMIDAZOLE
CAS:108026-71-7
Formula: C7H9N3O2S
KIN03623558
1-METHYL-2-(METHYLTHIO)-5-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:135790-55-5
Formula: C6H7F3N2S
KIN03623557
1-METHYL-2-(METHYLTHIO)-5-(TRIFLUOROMETHYL)-1H-PYRROLE
CAS:135790-58-8
KIN03646077
1-METHYL-2-(METHYLTHIO)-5-NITRO-1H-IMIDAZOLE
CAS:1615-42-5
Formula: C5H4N4O2
KIN01051564
1-METHYL-2-(METHYLTHIO)-5-PHENYL-1H-IMIDAZOLE
CAS:25433-15-2
Formula: C11H12N2S
KIN02139659
1-METHYL-2-(METHYLTHIO)-IMIDAZOLIDINE
CAS:65064-17-7
Formula: C5H12N2S
KIN02520478
1-METHYL-2-(METHYLTHIO)-PYRIDINIUM IODIDE
CAS:41681-14-5
Formula: C7H10INS
KIN02272769
1-METHYL-2-(METHYLTHIO)-QUINAZOLIN-4(1H)-ONE
CAS:5544-05-8
Formula: C9H9N3O
KIN01135271
1-METHYL-2-(NAPHTHALEN-1-YL)-1H-BENZO[D]IMIDAZOLE
CAS:2562-83-6
KIN01072004
1-METHYL-2-(NAPHTHALEN-1-YL)-1H-IMIDAZOL-5-CARBOXYLIC ACID
CAS:1001757-06-7
Formula: [C15H12N2O2]
KIN05006282
1-METHYL-2-(NAPHTHALEN-1-YL)-1H-IMIDAZOLE
CAS:1001755-52-7
Formula: C14H12N2
KIN05006256
1-METHYL-2-(NAPHTHALEN-1-YL)-1H-PERIMIDINE
CAS:64376-10-9
Formula: C22H16N2
KIN02508923
1-METHYL-2-(NAPHTHALEN-1-YL)-INDOLIZINE
CAS:380448-87-3
KIN03548865
1-METHYL-2-(NAPHTHALEN-2-YL)-AZIRIDINE
CAS:28494-15-7
Formula: C13H13N
KIN02166570
1-METHYL-2-(NAPHTHALEN-2-YL)-INDOLIZINE
CAS:76949-58-1
Formula: C19H15N
KIN02622503
1-METHYL-2-(NAPHTHALEN-2-YLTHIO)-NAPHTHO[2,1-B]THIOPHENE
CAS:1069128-10-4
Formula: C23H16S2
KIN05110566
1-METHYL-2-(NITRO-METHYL)CYCLOPENTENE
CAS:104488-99-5
Formula: C7H11NO2
KIN03061578
1-METHYL-2-(NITROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:36097-98-0
Formula: C9H9N3O2
KIN02228902
1-METHYL-2-(NITROMETHYL)-BENZENE
CAS:38362-89-9
Formula: C8H9NO2
KIN02247398
1-METHYL-2-(NITROMETHYL)-BENZENE ION(I) SODIUM
CAS:66045-07-6
Formula: C8H8NO2.Na
KIN02536072
1-METHYL-2-(NITROMETHYL)-PYRIDINIUM INNER SALT
CAS:54436-61-2
Formula: C7H8N2O2
KIN02350046
1-METHYL-2-(NITROMETHYLENE)-IMIDAZOLIDINE
CAS:56611-79-1
Formula: C5H9N3O2
KIN02385602
1-METHYL-2-(NITROSO-PHENYLMETHYLENE)-PYRROLIDINE
CAS:228105-12-2
Formula: C12H14N2O
KIN03441572
1-METHYL-2-(NONAFLUORO-BUTYL)-BENZENE
CAS:93697-09-7
Formula: C11H7F9
KIN02772560
1-METHYL-2-(NONYLTHIO)-1H-PERIMIDINE
CAS:168472-90-0
Formula: C21H28N2S
KIN03342972
1-METHYL-2-(OCT-1-EN-1-YL)CYCLOHEX-1-ENE
CAS:107514-40-9
Formula: C15H26
KIN03083182
1-METHYL-2-(OCTYLOXY) -BENZENE
CAS:66583-73-1
Formula: C15H24O
KIN02543768
1-METHYL-2-(P-TOLYL)-IMIDAZOLIDINE
CAS:83521-89-5
Formula: C11H16N2
KIN02661673
1-METHYL-2-(PENTAFLUORO-ETHYL)-BENZENE
CAS:123524-60-7
KIN03180055
1-METHYL-2-(PENTYLSULFINYL)-1H-IMIDAZOLE
CAS:327181-81-7
Formula: C9H16N2OS
KIN03497592
1-METHYL-2-(PHENOXYCARBONYL) -QUINOLINIUM
CAS:145298-98-2
Formula: C17H14NO2+
KIN03279187
1-METHYL-2-(PHENOXYCARBONYL) -QUINOLINIUMFLUOROSULFATE
CAS:145298-99-3
Formula: C17H14FNO5S
KIN03657364
1-METHYL-2-(PHENOXYMETHYL) -1H-PERIMIDINE
CAS:120189-94-8
Formula: C19H16N2O
KIN03162953
1-METHYL-2-(PHENOXYMETHYL) -AZIRIDINE
CAS:59624-71-4
KIN02434349
1-METHYL-2-(PHENOXYMETHYL) -BENZENE
CAS:57076-47-8
Formula: C14H14O
KIN02393773
1-METHYL-2-(PHENYL-IMINO)-PYRROLIDINE
CAS:7544-97-0
Formula: C11H14N2.ClH
KIN01191021
1-METHYL-2-(PHENYLAMINO)CYCLOPENTANOL
CAS:65349-41-9
Formula: C12H17NO
KIN02525307
1-METHYL-2-(PHENYLAZO)-PYRIDINIUM TETRAFLUOROBORATE
CAS:16600-14-9
Formula: C12H12BF4N3
KIN02053002
1-METHYL-2-(PHENYLAZO)-QUINOLINIUM PERCHLOROATE
CAS:16600-11-6
Formula: C16H14ClN3O4
KIN02053000
1-METHYL-2-(PHENYLETHYNYL)-1H-INDOL-3-CARBALDEHYDE
CAS:95104-17-9
Formula: C18H13NO
KIN02788303
1-METHYL-2-(PHENYLETHYNYL)-PYRIDINIUM IODIDE
CAS:95412-81-0
Formula: C14H12N.I
KIN02791283
1-METHYL-2-(PHENYLETHYNYL)PIPERIDINE
CAS:51498-55-6
Formula: C14H17N
KIN02307371
1-METHYL-2-(PHENYLETHYNYL)PIPERIDINE PICRATE
CAS:67385-94-8
Formula: C14H17N.C6H3N3O7
KIN02552678
1-METHYL-2-(PHENYLMETHYL)-L-PROLINE METHYL ESTER
CAS:229964-76-5
Formula: C14H19NO2
KIN03672001
1-METHYL-2-(PHENYLMETHYLENE)-HYDRAZINECARBOTHIOAMIDE
CAS:2613-12-9
Formula: C9H11N3S
KIN01072987
1-METHYL-2-(PHENYLSELANYL)CYCLOHEPTANOL
CAS:120007-34-3
Formula: C14H20OSe
KIN03161854
1-METHYL-2-(PHENYLSELENO)-BENZENE
CAS:94800-50-7
Formula: C13H12Se
KIN02785358
1-METHYL-2-(PHENYLSULFINYL)-1H-PYRROLE
CAS:75421-81-7
Formula: C11H11NOS
KIN02612552
1-METHYL-2-(PHENYLSULFINYL)-BENZENE
CAS:50986-89-5
KIN02299988
1-METHYL-2-(PHENYLTHIO)-1H-IMIDAZOL-5-CARBALDEHYDE
CAS:460990-29-8
Formula: C11H10N2OS
KIN03016671
1-METHYL-2-(PHENYLTHIO)-1H-IMIDAZOLE
CAS:79487-95-9
Formula: C10H10N2S
KIN02638013
1-METHYL-2-(PHENYLTHIO)-1H-PYRROLE
CAS:82511-48-6
Formula: C11H11NS
KIN02656031
1-METHYL-2-(PHENYLTHIO)-BENZENE
CAS:13963-35-4
Formula: C13H12S
KIN02026529
MFCD00216265
1-METHYL-2-(PHENYLTHIO)-INDOLE
CAS:120517-32-0
Formula: C15H13NS
KIN03164787
1-METHYL-2-(PHENYLTHIO)-NAPHTHALENE
CAS:93322-80-6
Formula: C17H14S
KIN02768082
1-METHYL-2-(PIPERAZIN-1-YLMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:59037-72-8
KIN02425191
1-METHYL-2-(PIPERIDIN-1-YLMETHYL)-1H-PERIMIDINE
CAS:120189-96-0
Formula: C18H21N3
KIN03162955
1-METHYL-2-(PIPERIDIN-1-YLMETHYL)-BENZOTHIOPYRANO[3,4-D]IMIDAZOL-4(1H)-ONE
CAS:101018-79-5
Formula: [C17H19N3OS
KIN03036516
1-METHYL-2-(PIPERIDIN-1-YLMETHYL)PIPERIDINE
CAS:4853-66-1
Formula: C8H16N2O2
KIN01115929
1-METHYL-2-(PIPERIDIN-1-YLMETHYL)PIPERIDINE DIPICRATE
CAS:97488-09-0
KIN02806330
1'-Methyl-1,2'-methylenedi-piperidine dipi
1-METHYL-2-(PIPERIDIN-4-YL)-1H-BENZO[D]IMIDAZOLE
CAS:180160-86-5
Formula: C13H17N3
KIN03368590
1-METHYL-2-(PIPERIDINE-3-YLMETHOXY) -1H-BENZO[D]IMIDAZOLE HCL
CAS:1185311-12-9
Formula: C14H20ClN3O
KIN05319294
1-METHYL-2-(PIPERIDINE-3-YLOXY) -1H-BENZO[D]IMIDAZOLE HCL
CAS:1185313-72-7
Formula: C13H18ClN3O
KIN05319408
1-METHYL-2-(PIPERIDINE-4-YLOXY) -1H-BENZO[D]IMIDAZOLE
CAS:1185539-01-8
Formula: C13H17N3O
KIN05320034
1-METHYL-2-(PIPERIDINE-4-YLOXY) -1H-BENZO[D]IMIDAZOLE HCL
CAS:1185311-04-9
Formula: C13H18ClN3O
KIN05319289
1-METHYL-2-(PROP-1-EN-2-YL)-BENZENE
CAS:26444-18-8
Formula: C1OH12
KIN02148293
1-METHYL-2-(PROP-1-YNYL)-1,2,3,6-TETRAHYDROPYRIDINE
CAS:81585-26-4
Formula: C9H13N
KIN02650645
1-METHYL-2-(PROP-2-YNYL)THIO-BENZO[D]IMIDAZOLE HBR
CAS:66156-63-6
Formula: C11H11BrN2S
KIN02537851
1-METHYL-2-(PROP-2-YNYLTHIO)-1H-IMIDAZOLE HBR
CAS:66156-62-5
Formula: C7H9BrN2S
KIN02537850
1-METHYL-2-(PROPAN-2-YL)-ALPHA-NAPHTHALEN-1-YL-1H-IMIDAZOL-5-METHANOL
CAS:309724-79-6
Formula: C18H20N2O
KIN03484517
1-METHYL-2-(PROPAN-2-YL)-ALPHA-PHENYL-1H-IMIDAZOL-5-METHANOL
CAS:159859-14-0
Formula: C14H18N2O
KIN03324516
1-METHYL-2-(PROPAN-2-YL)-ALPHA[4-PROPAN-2-YLPHENYL]-1H-IMIDAZOL-5-METHANOL
CAS:364338-55-6
Formula: C17H24N2O
KIN03538882
1-METHYL-2-(PROPAN-2-YLIDENE)CYCLOBUTANEACETONITRILE
CAS:53171-68-9
Formula: C10H15N
KIN02331255
1-METHYL-2-(PROPARGYL)-BENZENE
CAS:37982-72-2
Formula: C10H10
KIN02244320
1-METHYL-2-(PROPARGYLOXY) -1H-IMIDAZOL-4,5-DICARBONITRILE
CAS:307502-55-2
Formula: C9H6N4O
KIN03623556
1-METHYL-2-(PROPARGYLOXY) -BENZENE
CAS:5652-25-5
Formula: C9H12NO5P
KIN01137899
1-METHYL-2-(PROPARGYLOXY) CYCLOHEXENE
CAS:127938-87-8
Formula: [C10H14O]
KIN03199676
1-METHYL-2-(PROPARGYLTHIO)-BENZENE
CAS:5651-86-5
Formula: C10H8O2
KIN01137886
1-METHYL-2-(PROPOXYMETHYL) -BENZENE
CAS:91967-69-0
Formula: C11H16O
KIN02751112
1-METHYL-2-(PROPYLDITHIO)-1H-IMIDAZOLE
CAS:63435-00-7
Formula: C7H12N2S2
KIN02492589
1-METHYL-2-(PROPYLSULFINYL)-1H-IMIDAZOL-4,5-DIMETHANOL BIS(METHYLCARBAMATE) (ESTER)
CAS:152591-39-4
Formula: C13H22N4O5S
KIN03302735
1-METHYL-2-(PROPYLSULFINYL)-4-(PROPARGYLOXY)-BENZENE
CAS:59485-37-9
Formula: C13H16O2S
KIN02432224
1-METHYL-2-(PROPYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL
CAS:152591-47-4
Formula: C9H16N2O2S
KIN03010353
1-METHYL-2-(PROPYLTHIO)-1H-IMIDAZOL-4,5-DIMETHANOL BIS(METHYLCARBAMATE) (ESTER)
CAS:152591-54-3
Formula: C13H22N4O4S
KIN03302738
1-METHYL-2-(PROPYLTHIO)-1H-IMIDAZOL-5-CARBALDEHYDE
CAS:191411-49-1
Formula: C8H12N2OS
KIN03012360
1-METHYL-2-(PROPYLTHIO)-1H-IMIDAZOL-5-METHANOL
CAS:191411-46-8
Formula: C8H14N2OS
KIN03392466
1-METHYL-2-(PROPYLTHIO)-1H-IMIDAZOLE
CAS:50968-17-7
KIN02299754
1-METHYL-2-(PROPYLTHIO)-4-(PROPARGYLOXY)-BENZENE
CAS:59485-36-8
Formula: C13H16OS
KIN02432223
1-METHYL-2-(PROPYLTHIO)CYCLOHEXENE
CAS:60176-74-1
Formula: C10H18S
KIN02442259
1-METHYL-2-(PYRIDIN-1-IUM-1-YLMETHYL)-QUINOLIN-1-IUM, IODIDE
CAS:40123-69-1
Formula: C16H16IN2+
KIN02260227
1-METHYL-2-(PYRIDIN-2-YL)PIPERAZINE
CAS:1018610-60-0
Formula: C10H15N3
KIN05038851
1-METHYL-2-(PYRIDIN-2-YLMETHYLENE)-HYDRAZINECARBOTHIOAMIDE
CAS:51984-11-3
Formula: C8H10N4S
KIN02314320
1-METHYL-2-(PYRIMIDIN-4-YL)-1H-INDOLE
CAS:63463-00-3
Formula: C13H11N3
KIN02493237
1-METHYL-2-(PYRROLIDIN-1-YL)-1H-IMIDAZOLE
CAS:92478-86-9
Formula: C8H13N3
KIN02757206
1-METHYL-2-(PYRROLIDIN-1-YLMETHYL)PIPERIDINE
CAS:91823-94-8
KIN02749232
1-METHYL-2-(PYRROLIDINE-1-YL)CYCLOPENT-2-ENOL
CAS:1025884-08-5
Formula: C10H17NO
KIN05059433
1-METHYL-2-(PYRROLIDINE-1-YL)PIPERIDINE
CAS:100158-63-2
Formula: C10H20N2
KIN03029250
1-METHYL-2-(PYRROLIDINE-2-YL)PIPERIDINE
CAS:383127-17-1
Formula: C10H20N2
KIN03550955
1-METHYL-2-(SEC-BUTYL)CYCLOHEXYL ACETATE
CAS:72183-75-6
Formula: C13H24O2
KIN02589643
1-METHYL-2-(THIAZOL-4-YL)-1H-BENZO[D]IMIDAZOLE
CAS:32594-70-0
Formula: C11H9N3S
KIN02198444
1-METHYL-2-(THIAZOL-5-YL)-1H-BENZO[D]IMIDAZOLE
CAS:60746-62-5
Formula: C11H9N3S
KIN02447381
1-METHYL-2-(THIOPHEN-2-YL)-1H-BENZO[D]IMIDAZOLE
CAS:3878-31-7
Formula: C10H7N3O6
KIN01097329
1-METHYL-2-(THIOPHEN-2-YL)-1H-IMIDAZO[4,5-C]PYRIDINE
CAS:113311-92-5
KIN03668739
1-METHYL-2-(THIOPHEN-2-YL)-1H-IMIDAZOLE
CAS:141989-36-8
Formula: C8H8N2S
KIN03263008
1-METHYL-2-(THIOPHEN-2-YL)-1H-INDOLE
CAS:130000-09-8
KIN03208230
1-METHYL-2-(THIOPHEN-2-YL)-1H-PERIMIDINE
CAS:59283-23-7
Formula: C16H12N2S
KIN02429180
1-METHYL-2-(THIOPHEN-2-YL)-1H-PYRROLE
CAS:34671-27-7
Formula: C9H9NS
KIN02215953
1-METHYL-2-(THIOPHEN-2-YL)-PYRROLIDINE
CAS:98960-71-5
Formula: C9H13NS
KIN02816899
1-METHYL-2-(THIOPHEN-2-YL)PIPERAZINE
CAS:1018645-67-4
Formula: C9H14N2S
KIN05039399
1-METHYL-2-(THIOPHEN-2-YLMETHYL)-PYRIDINIUM, IODIDE
CAS:106584-07-0
Formula: C11H12INS
KIN03077229
1-METHYL-2-(THIOPHEN-2-YLMETHYL)HYDRAZINE
CAS:89601-17-2
Formula: C6H10N2S
KIN02714181
1-METHYL-2-(THIOPHEN-3-YL)-1H-INDOLE
CAS:120986-98-3
KIN03167308
1-METHYL-2-(THIOPHEN-3-YL)-1H-PYRROLE
CAS:34671-52-8
KIN02215960
1-METHYL-2-(THIOPHEN-3-YL)-PYRROLIDINE
CAS:113348-26-8
KIN03122231
1-METHYL-2-(TRIBUTYL-STANNYL)-1H-IMIDAZOLE
CAS:105494-69-7
Formula: C16H32N2Sn
KIN03068647
1-METHYL-2-(TRIBUTYL-STANNYL)-1H-INDOLE
CAS:157427-46-8
Formula: C21H35NSn
KIN03318066
1-METHYL-2-(TRIBUTYL-STANNYL)-1H-PYRROLE
CAS:118486-97-8
Formula: C17H33NSn
KIN03154454
1-METHYL-2-(TRICHLORO-ACETYL)-1H-PYRROLE
CAS:21898-65-7
Formula: C7H6Cl3NO
KIN02105235
MFCD00052521
1-METHYL-2-(TRICHLOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:14468-46-3
Formula: C9H7Cl3N2
KIN02032323
1-METHYL-2-(TRICHLOROMETHYL)-BENZENE
CAS:3335-34-0
KIN01086992
1-METHYL-2-(TRIETHYLSILYL)-1H-IMIDAZOLE
CAS:371764-99-7
KIN03543153
1-METHYL-2-(TRIETHYLSILYL)-PROPYL
CAS:88973-30-2
Formula: C10H23Si
KIN02705134
1-METHYL-2-(TRIFLUORO-ACETYL)-PYRIDINIUM CHLORIDE OXIME
CAS:37744-98-2
Formula: C8H8ClF3N2O
KIN02242215
1-METHYL-2-(TRIFLUOROMETHOXY) -BENZENE
CAS:42908-77-0
Formula: C8H7F3O
KIN02281405
MFCD06410918
1-METHYL-2-(TRIFLUOROMETHOXY) ETHYL
CAS:52044-04-9
Formula: C4H6F3O
KIN02315264
1-METHYL-2-(TRIFLUOROMETHYL)-10H-PHENOTHIAZINE
CAS:97055-29-3
KIN02804302
1-METHYL-2-(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:384-48-5
KIN01012963
1-METHYL-2-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:70631-94-6
Formula: C5H5F3N2
KIN02578769
1-METHYL-2-(TRIFLUOROMETHYL)-1H-PERIMIDINE
CAS:70357-46-9
Formula: C13H9F3N2
KIN02576963
1-METHYL-2-(TRIFLUOROMETHYL)-1H-PYRROL-3-CARBOXYLIC ACID
CAS:147642-15-7
KIN03623555
1-METHYL-2-(TRIFLUOROMETHYL)-1H-PYRROLE
CAS:67095-61-8
Formula: C6H6F3N
KIN02548535
1-METHYL-2-(TRIFLUOROMETHYL)-4(1H)-PYRIDINONE
CAS:1065103-68-5
Formula: C7H6F3NO
KIN05109268
1-METHYL-2-(TRIFLUOROMETHYL)-4,5-DIHYDRO-1H-IMIDAZOLE
CAS:1069085-45-5
KIN05110518
1-METHYL-2-(TRIFLUOROMETHYL)-AZIRIDINE
CAS:160921-12-0
Formula: [C4H6F3N
KIN03327497
1-METHYL-2-(TRIFLUOROMETHYL)-QUINOLIN-4-ONE
CAS:139439-36-4
Formula: C11H8F3NO
KIN03252785
1-METHYL-2-(TRIFLUOROMETHYL)DISULFANE
CAS:14410-21-0
Formula: C2H3F3S2
KIN02031731
1-METHYL-2-(TRIMETHOXYMETHYL) -BENZENE
CAS:60743-19-3
Formula: C11H16O3
KIN02447370
1-METHYL-2-(TRIMETHYL-STANNYL)-1H-INDOLE
CAS:144951-44-0
Formula: C12H17NSn
KIN03277843
1-METHYL-2-(TRIMETHYL-STANNYL)-1H-PYRROLE
CAS:107311-71-7
Formula: C8H15NSn
KIN03081935
1-METHYL-2-(TRIMETHYLSILYL)-1H-BENZO[D]IMIDAZOLE
CAS:35342-95-1
Formula: C11H16N2Si
KIN02222190
1-METHYL-2-(TRIMETHYLSILYL)-1H-IMIDAZOLE
CAS:35342-89-3
Formula: C7H14N2Si
KIN02222187
1-METHYL-2-(TRIMETHYLSILYL)-1H-INDOL-3-CARBOXYLIC ACID
CAS:135039-81-5
Formula: C13H17NO2Si
KIN03646076
1-METHYL-2-(TRIMETHYLSILYL)-1H-PYRROLE
CAS:5833-54-5
Formula: C11H23NSi2
KIN01142940
1-METHYL-2-(TRIMETHYLSILYL)-1H-PYRROLO[2,3-B]PYRIDIN-3-METHANOL
CAS:203635-57-8
KIN03412376
1-METHYL-2-(TRIMETHYLSILYL)-ALLYL HYDROPEROXIDE
CAS:156518-06-8
Formula: C7H16O2Si
KIN03315684
1-METHYL-2-(TRIMETHYLSILYL)ETHYL
CAS:89499-86-5
Formula: C6H15Si
KIN02712626
1-METHYL-2-(TRIOXIDOCHLORO) -BENZENE
CAS:70895-46-4
Formula: C7H7ClO3
KIN02580519
1-METHYL-2-(Z)-1-PROPEN-1-YL-1H-PYRROLE
CAS:1059171-98-0
Formula: C8H11N
KIN05105441
1-METHYL-2-[(1,2,2-TRIMETHYL-BICYCLO[3.1.0]HEX-3-YL) METHYL]CYCLOPROPANEMETHANOL
CAS:198404-98-7
Formula: C15H26O
KIN03404377
1-METHYL-2-[(1-METHYL-1,3-DIHYDRO-BENZO[F][1,3]BENZOXAZIN-2-YL) METHYL]-1,3-DIHYDRO-BENZO[F][1,3]BENZOXAZINE
CAS:7504-57-6
Formula: C12H14N2O5
KIN01189828
1-METHYL-2-[(1-METHYL-1-NITRO-ETHYL)THIO]-1H-IMIDAZOLE
CAS:95106-82-4
Formula: C7H11N3O2S
KIN02788337
1-METHYL-2-[(1-METHYL-2-OXO-PYRROLIDIN-3-YLIDENE) METHYL]-1H-IMIDAZOL-5-CARBONITRILE
CAS:141363-27-1
Formula: C11H12N4O
KIN03259852
1-METHYL-2-[(1-METHYL-ALLYL)THIO]-1H-IMIDAZOLE
CAS:74510-52-4
Formula: C8H12N2S
KIN02606437
1-METHYL-2-[(1-METHYL-ALLYLOXY) ]-1H-BENZO[D]IMIDAZOLE
CAS:71263-45-1
KIN02583111
1-METHYL-2-[(1-METHYL-PIPERIDIN-4-YL)METHYL]-1,2,4,5-CYCLOHEXANETETROL
CAS:56635-69-9
Formula: C14H27NO4
KIN02386046
1-METHYL-2-[(1-METHYL-PIPERIDIN-4-YL)METHYL]-1,2,4,5-CYCLOHEXANETETROL TETRAACETATE (ESTER)
CAS:56635-73-5
Formula: C22H35NO8
KIN02386050
1-METHYL-2-[(1-METHYL-QUINOLIN-2(1H)-YLIDENE)METHYL]-QUINOLINIUM IODIDE
CAS:15763-23-2
Formula: C21H19N2.I
KIN02043899
1-METHYL-2-[(1-METHYLBUTYL)THIO]-1H-IMIDAZOLE
CAS:85694-87-7
Formula: C9H16N2S
KIN02676116
1-METHYL-2-[(1-METHYLBUTYL)THIO]-1H-PERIMIDINE
CAS:168472-93-3
Formula: C17H20N2S
KIN03342975
1-METHYL-2-[(1-METHYLCYCLOPENTYL)METHYL]BENZENE
CAS:20049-07-4
KIN02087648
1-METHYL-2-[(1-METHYLETHOXY) METHYL]BENZENE
CAS:91967-67-8
KIN02751110
1-METHYL-2-[(1-METHYLETHYL)AMINO]-1H-IMIDAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:148741-72-4
Formula: [C9H15N3O2
KIN03290295
1-METHYL-2-[(1-METHYLETHYL)AMINO]-2-OXOETHYL
CAS:214840-55-8
Formula: C6H12NO
KIN03427147
1-METHYL-2-[(1-METHYLETHYL)DITHIO]-1H-IMIDAZOLE
CAS:63434-97-9
Formula: C7H12N2S2
KIN02492586
1-METHYL-2-[(1-METHYLETHYL)THIO]-1H-IMIDAZOLE
CAS:63348-50-5
Formula: C7H12N2S
KIN02491011
1-METHYL-2-[(1-METHYLPROPARGYLOXY) ]-NAPHTHALENE
CAS:65411-52-1
Formula: C15H14O
KIN02526221
1-METHYL-2-[(1-METHYLPROPYL)DITHIO]-1H-IMIDAZOLE
CAS:205104-63-8
KIN03414480
1-METHYL-2-[(1-OXOALLYLOXY) ]-ETHYL-ACETOACETATE
CAS:29818-16-4
Formula: C10H14O5
KIN02176897
1-METHYL-2-[(1-PHENYLETHENYLOXY) ]BENZENE
CAS:92548-75-9
Formula: C15H14O
KIN02758272
1-METHYL-2-[(1-PROPYN-1-YLTHIO)METHYL]BENZENE
CAS:296789-38-3
KIN03473980
1-METHYL-2-[(1E)-1-PROPYL-1-PENTEN-1-YL]-1H-IMIDAZOLE
CAS:1170113-48-0
Formula: C12H20N2
KIN05260976
1-METHYL-2-[(1E)-2-NITRO-1-PROPEN-1-YL]BENZENE
CAS:147102-54-3
Formula: C10H11NO2
KIN03284835
1-METHYL-2-[(1E)-2-NITRO-ETHENYL]-1H-PYRROLE
CAS:100446-35-3
Formula: C7H8N2O2
KIN03031828
1-METHYL-2-[(1E)-2-PHENYLDIAZENYL]-1H-IMIDAZOLE
CAS:93937-86-1
Formula: C10H10N4
KIN02775525
1-METHYL-2-[(1E)-2-PHENYLETHENYL]-1H-IMIDAZOLE
CAS:175286-83-6
Formula: C12H12N2
KIN03358667
1-METHYL-2-[(1E)-3-PHENYL-1-PROPENYL]BENZENE
CAS:83135-54-0
Formula: C16H16
KIN02659448
1-METHYL-2-[(1R)-1-[(TRIMETHYLSILYLOXY)]-ETHYL]BENZENE
CAS:251644-55-0
KIN03646074
1-METHYL-2-[(1R,2S)-2-PHENYLCYCLOPROPYL]BENZENE
CAS:444022-28-0
KIN03586086
1-METHYL-2-[(1S,2R)-2-PHENYLCYCLOPROPYL]BENZENE
CAS:444022-27-9
KIN03586085
1-METHYL-2-[(1Z)-1-PROPYL-1-PENTEN-1-YL]-1H-IMIDAZOLE
CAS:1170113-53-7
Formula: C12H20N2
KIN05260977
1-METHYL-2-[(1Z)-2-PHENYLETHENYL]-1H-IMIDAZOLE
CAS:302917-14-2
Formula: C12H12N2
KIN03478569
1-METHYL-2-[(1Z)-2-PHENYLETHENYL]PYRIDINIUM IODIDE
CAS:1519-59-1
Formula: C13H11N
KIN01049169
1-METHYL-2-[(2,3,4,5,6-PENTAFLUOROPHENYL)THIO]-1H-PYRROLE
CAS:112632-82-3
Formula: C11H6F5NS
KIN03116901
1-METHYL-2-[(2,4,4-TRIMETHYLPENTYL)THIO]-1H-PERIMIDINE
CAS:168472-94-4
Formula: C20H26N2S
KIN03646073
1-METHYL-2-[(2-METHYL-1-OXO-2-ALLYLOXY) ]-ETHYL-1,3-BUTADIENE,MALEATED
CAS:168612-08-6
KIN03343120
1-METHYL-2-[(2-METHYL-ALLYL)THIO]-1H-IMIDAZOLE
CAS:208713-45-5
KIN03419132
1-METHYL-2-[(2-METHYL-ALLYLOXY) ]-1H-BENZO[D]IMIDAZOLE
CAS:72128-70-2
KIN02589288
1-METHYL-2-[(2-METHYLCYCLOPROPYL)THIO]-1H-IMIDAZOLE
CAS:164063-22-3
Formula: C8H12N2S
KIN03679170
1-METHYL-2-[(2-METHYLCYCLOPROPYL)THIO]-1H-PERIMIDINE
CAS:168473-04-9
Formula: C16H16N2S
KIN03668737
1-METHYL-2-[(2-METHYLISOPROPOXY) ]CYCLOHEXENE
CAS:40648-26-8
Formula: C11H20O
KIN02264650
1-METHYL-2-[(2-METHYLPHENYL)AMINO]CYCLOPENTANOL
CAS:65349-42-0
Formula: C13H19NO
KIN02525308
1-METHYL-2-[(2-METHYLPHENYL)METHYL]-4-NITRO-BENZENE
CAS:1100053-98-2
Formula: C15H15NO2
KIN05166196
1-METHYL-2-[(2-METHYLPHENYL)METHYL]PIPERAZINE
CAS:50290-90-9
KIN02291423
1-METHYL-2-[(2-METHYLPHENYL)PHENYLPHOSPHORYL]BENZENE
CAS:18803-11-7
Formula: C20H19OP
KIN02075340
1-METHYL-2-[(2-METHYLPHENYL)THIO]-3-NITRO-BENZENE
CAS:175794-58-8
KIN03022701
1-METHYL-2-[(2-METHYLPROPOXY) METHYL]-3-[[1-(1-PROPYN-1-YL)CYCLOHEXYL]OXY]PIPERIDINE
CAS:118383-02-1
KIN03153924
1-METHYL-2-[(2-NITROPHENYL)METHYL]-1-PHENYLHYDRAZINE
CAS:90631-88-2
Formula: C14H15N3O2
KIN02730957
1-METHYL-2-[(2-NITROPHENYL)METHYL]BENZENE
CAS:421571-70-2
Formula: C14H13NO2
KIN03574156
1-METHYL-2-[(2-NITROPHENYL)SULFONYL]BENZENE
CAS:61174-13-8
Formula: C13H11NO4S
KIN02452086
1-METHYL-2-[(2-NITROPHENYL)THIO]-1H-PYRROLE
CAS:295360-27-9
KIN03473537
1-METHYL-2-[(2-NITROPHENYL)THIO]BENZENE
CAS:6640-55-7
Formula: C9H12N2
KIN01167689
1-METHYL-2-[(2-OXIRANYLMETHYL) THIO]-1H-IMIDAZOLE
CAS:476211-40-2
Formula: C7H10N2OS
KIN03603039
1-METHYL-2-[(2-PHENYLETHYL)THIO]-1H-IMIDAZOLE
CAS:164063-14-3
Formula: C12H14N2S
KIN03334982
1-METHYL-2-[(2-PHENYLETHYL)THIO]-1H-PERIMIDINE
CAS:168472-95-5
Formula: C20H18N2S
KIN03342976
1-METHYL-2-[(2-PHENYLETHYL)THIO]PYRIDINIUM BROMIDE
CAS:62058-66-6
Formula: C14H16NS.Br
KIN02467049
1-METHYL-2-[(2-PHENYLPROPYL)THIO]PYRIDINIUM BROMIDE
CAS:77148-70-0
Formula: C15H18BrNS
KIN02623573
1-METHYL-2-[(3-METHYLBUTYL)THIO]-1H-IMIDAZOLE
CAS:66165-17-1
Formula: C9H16N2S
KIN02538031
1-METHYL-2-[(3-METHYLPHENYL)AMINO]CYCLOPENTANOL
CAS:65349-43-1
Formula: C13H19NO
KIN02525309
1-METHYL-2-[(3-METHYLPHENYL)METHYL]-4-NITRO-BENZENE
CAS:1100054-00-9
Formula: C15H15NO2
KIN05166197
1-METHYL-2-[(3-METHYLPHENYL)METHYL]BENZENE
CAS:21895-13-6
Formula: C15H16
KIN02105184
Benzene, 1-methyl-2-[(3-methyl)
1-METHYL-2-[(3-METHYLPHENYL)METHYL]PYRROLIDINE
CAS:66162-91-2
Formula: C13H19N
KIN02537976
1-METHYL-2-[(3-METHYLPHENYL)METHYL]PYRROLIDINE PICRATE
CAS:66162-92-3
Formula: C13H19N.C6H3N3O7
KIN02537977
1-METHYL-2-[(3-METHYLPHENYL)SULFONYL]-3,5-DINITRO-BENZENE
CAS:14677-35-1
KIN02034525
1-METHYL-2-[(3-METHYLPHENYL)SULFONYL]BENZENE
CAS:61097-48-1
Formula: C14H14O2S
KIN02450880
1-METHYL-2-[(3-METHYLPHENYL)THIO]BENZENE
CAS:107771-85-7
KIN03084843
1-METHYL-2-[(3-PHENYL-ALLYL)THIO]PYRIDINIUM BROMIDE
CAS:77148-77-7
Formula: C15H16BrNS
KIN02623575
1-METHYL-2-[(3-PHENYLPROPYL)THIO]PYRIDINIUM BROMIDE
CAS:77148-69-7
Formula: C15H18BrNS
KIN02623572
1-METHYL-2-[(4-METHYL-PIPERAZIN-1-YL)METHYL]-1,2,4,5-CYCLOHEXANETETROL TETRAACETATE (ESTER)
CAS:56635-65-5
Formula: C21H34N2O8
KIN02386042
1-METHYL-2-[(4-METHYL-PIPERAZIN-1-YL)METHYL]PIPERAZINE
CAS:202991-94-4
KIN03646072
1-METHYL-2-[(4-METHYLPHENYL)AMINO]CYCLOPENTANOL
CAS:65349-44-2
Formula: C13H19NO
KIN02525310
1-METHYL-2-[(4-METHYLPHENYL)METHYL]-4-NITRO-BENZENE
CAS:1100054-01-0
Formula: C15H15NO2
KIN05166198
1-METHYL-2-[(4-METHYLPHENYL)METHYL]BENZENE
CAS:21895-17-0
Formula: C15H16
KIN02105187
Benzene, 1-methyl-2-[(4-methyl)
1-METHYL-2-[(4-METHYLPHENYL)SULFINYL]-1H-PYRROLE
CAS:75421-82-8
Formula: C12H13NOS
KIN02612553
1-METHYL-2-[(4-METHYLPHENYL)SULFINYL]BENZENE
CAS:10381-68-7
Formula: C14H14OS
KIN02005720
1-METHYL-2-[(4-METHYLPHENYL)SULFONYL]BENZENE
CAS:41908-97-8
Formula: C14H14O2S
KIN02274341
1-METHYL-2-[(4-METHYLPHENYL)THIO]-1H-IMIDAZOLE
CAS:347356-47-2
Formula: C11H12N2S
KIN03524222
1-METHYL-2-[(4-METHYLPHENYL)THIO]-3-NITRO-1H-PYRROLE
CAS:101493-74-7
Formula: C12H12N2O2S
KIN03668736
1-METHYL-2-[(4-METHYLPHENYL)THIO]-5-NITRO-1H-IMIDAZOLE
CAS:65917-62-6
Formula: C11H11N3O2S
KIN02534321
1-METHYL-2-[(4-METHYLPHENYL)THIO]-5-NITRO-1H-PYRROLE
CAS:63059-30-3
Formula: C12H12N2O2S
KIN02485632
1-METHYL-2-[(4-METHYLPHENYL)THIO]BENZENE
CAS:4279-74-7
KIN01104354
1-METHYL-2-[(4-NITROPHENOXY) METHYL]BENZENE
CAS:92199-99-0
Formula: C14H13NO3
KIN02754113
1-METHYL-2-[(4-NITROPHENYL)AZO]-1H-IMIDAZOLE
CAS:72908-94-2
Formula: C10H9N5O2
KIN02594636
1-METHYL-2-[(4-NITROPHENYL)METHYL]BENZENE
CAS:92199-60-5
Formula: C14H13NO2
KIN02754102
1-METHYL-2-[(4-NITROPHENYL)METHYL]PYRROLIDINE
CAS:66162-85-4
Formula: C12H16N2O2
KIN02537971
1-METHYL-2-[(4-NITROPHENYL)METHYL]PYRROLIDINE FUMARATE
CAS:66162-86-5
Formula: C12H16N2O2.C4H4O4
KIN02537972
1-METHYL-2-[(4-NITROPHENYL)METHYLENE]PYRROLIDINE
CAS:66162-53-6
Formula: C12H14N2O2
KIN02537956
1-METHYL-2-[(4-NITROPHENYL)SULFINYL]BENZENE
CAS:50986-95-3
KIN02299994
1-METHYL-2-[(4-NITROPHENYL)SULFONYL]BENZENE
CAS:42085-91-6
Formula: C13H11NO4S
KIN02275880
Sulfone, 4-nitrophenyl o-tolyl
1-METHYL-2-[(4-NITROPHENYL)THIO]-1H-IMIDAZOLE
CAS:84314-59-0
Formula: C10H9N3O2S
KIN02666611
1-METHYL-2-[(4-NITROPHENYL)THIO]BENZENE
CAS:6640-57-9
KIN01167691
1-METHYL-2-[(4-NITROPHENYLOXY) AMINO]-ETHYL
CAS:481657-94-7
Formula: C9H10N2O3
KIN03608819
1-METHYL-2-[(4-PHENOXY-BUTYL) THIO]-1H-IMIDAZOLE HBR
CAS:64444-70-8
Formula: C14H18N2OS.BrH
KIN02509919
1-METHYL-2-[(4-PHENYLBUTYL)THIO]PYRIDINIUM BROMIDE
CAS:77148-98-2
Formula: C16H20BrNS
KIN02623583
1-METHYL-2-[(6-METHYLPYRIDIN-2-YL)METHYLENE]HYDRAZINECARBOTHIOAMIDE
CAS:54321-46-9
Formula: C9H12N4S
KIN02348302
1-METHYL-2-[(ALLYLOXY) METHYL]BENZENE
CAS:118405-77-9
Formula: C11H14O
KIN03153997
1-METHYL-2-[(BENZENESULFONYL)METHYL]-1H-PYRROLE
CAS:63487-25-2
Formula: C12H13NO2S
KIN02493810
1-METHYL-2-[(BENZENESULFONYL)METHYL]BENZENE
CAS:71996-48-0
Formula: C14H14O2S
KIN02588306
MFCD00012365
1-METHYL-2-[(BENZYL)DITHIO]-1H-IMIDAZOLE
CAS:83893-08-7
KIN02664117
1-METHYL-2-[(BENZYL)SULFINYL]-1H-IMIDAZOLE
CAS:327181-84-0
KIN03497593
1-METHYL-2-[(BENZYL)SULFINYL]-1H-PYRROLE
CAS:75421-87-3
Formula: C12H13NOS
KIN02612558