ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

1-(4-HYDROXY-CYCLOHEXYL)-5-(3-METHYLBUTYL)-1,3-DIAZINANE-2,4,6-TRIONE
CAS:4401-04-1
KIN01106955
1-(4-HYDROXY-CYCLOHEXYL)-5-METHYL-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:4192-36-3
Formula: C15H24N2O4
KIN01102711
1-(4-HYDROXY-CYCLOHEXYL)-5-OCTYL-BARBITURIC ACID
CAS:4102-01-6
Formula: C16H18N2O4
KIN01101042
1-(4-HYDROXY-CYCLOHEXYL)-5-PENTYL-1,3-DIAZINANE-2,4,6-TRIONE
CAS:4192-55-6
KIN01102712
1-(4-HYDROXY-CYCLOHEXYL)-5-PHENYL-1,3-DIAZINANE-2,4,6-TRIONE
CAS:4102-02-7
Formula: C16H24N2O4
KIN01101043
1-(4-HYDROXY-CYCLOHEXYL)-5-PROP-2-ENYL-1,3-DIAZINANE-2,4,6-TRIONE
CAS:4256-35-3
Formula: C23H22O2
KIN01103944
1-(4-HYDROXY-CYCLOHEXYL)-5-PROPAN-2-YL-1,3-DIAZINANE-2,4,6-TRIONE
CAS:4101-98-8
Formula: C18H30N2O4
KIN01101041
1-(4-HYDROXY-CYCLOHEXYL)-5-PROPYL-1,3-DIAZINANE-2,4,6-TRIONE
CAS:21330-84-7
Formula: C13H20N2O4
KIN02099873
1-(4-HYDROXY-CYCLOHEXYL)-N-(3-METHYLBUTYL)-2-[[5-[2-(TRIFLUOROMETHOXY)-PHENYL]-1H-INDAZOL-3-YL]AMINO]BENZO[D]IMIDAZOL-5-CARBOXAMIDE
CAS:1012104-68-5
KIN05018654
1-(4-HYDROXY-CYCLOHEXYL)ETHANONE
CAS:15580-01-5
KIN02042786
1-(4-HYDROXY-ISOQUINOLIN-3-YL)ETHANONE
CAS:164717-90-2
Formula: C11H9NO2
KIN03336107
1-(4-HYDROXY-NAPHTHALEN-1-YL)-2,5-PYRROLIDINEDIONE
CAS:13247-81-9
KIN02016966
1-(4-HYDROXY-NAPHTHALEN-1-YL)-2-PHENYLETHANONE
CAS:3669-44-1
Formula: C18H14O2
KIN01093598
1-(4-HYDROXY-NAPHTHALEN-1-YL)ETHANONE
CAS:3669-59-8
Formula: C11H14O2
KIN01093604
1-(4-HYDROXY-PHENETHYL)GUANIDINE HCL
CAS:60-23-1
Formula: C2H7NS
KIN01000606
1-(4-HYDROXY-PHENOXY)-2-PROPANONE
CAS:13332-74-6
Formula: C9H10O3
KIN02018086
1-(4-HYDROXY-PHENOXY)-3,3-DIMETHYLBUTAN-2-ONE
CAS:96640-01-6
Formula: C12H16O3
KIN02802241
1-(4-HYDROXY-PHENYL)-1,2-DIPHENYL-1,4-BUTANEDIOL
CAS:89778-76-7
Formula: C22H22O3
KIN02716785
1-(4-HYDROXY-PHENYL)-1,2-DIPHENYL-1-BUTENE
CAS:68684-63-9
Formula: C22H20O
KIN02565042
1-(4-HYDROXY-PHENYL)-1,2-ETHENEDIOL
CAS:93835-84-8
Formula: C8H8O3
KIN02774225
1-(4-HYDROXY-PHENYL)-1,2-HYDRAZINEDICARBOXYLIC ACID BIS(2,2,2-TRICHLORO-ETHYL) ESTER
CAS:148678-87-9
Formula: C12H10Cl6N2O5
KIN03290067
1-(4-HYDROXY-PHENYL)-1,2-PROPANEDIONE
CAS:10087-36-2
Formula: C9H8O3
KIN02001659
1-(4-HYDROXY-PHENYL)-1,3,3-TRIMETHYL-2H-INDEN-5-OL
CAS:109252-41-7
Formula: C18H20O2
KIN03094123
1-(4-HYDROXY-PHENYL)-1,3-BUTANEDIONE
CAS:51944-08-2
Formula: C10H10O3
KIN02313782
1-(4-HYDROXY-PHENYL)-1,3-PENTANEDIONE
CAS:91143-26-9
Formula: C11H12O3
KIN02739395
1-(4-HYDROXY-PHENYL)-1-[3-(TRIFLUOROMETHYL)PHENYL]PROPAN-1,3-DIOL
CAS:111916-05-3
Formula: C16H15F3O3
KIN03111097
1-(4-HYDROXY-PHENYL)-1-HEXANOL
CAS:121384-26-7
Formula: C12H18O2
KIN03169446
1-(4-HYDROXY-PHENYL)-1-HEXANONE
CAS:2389-73-3
Formula: C7H6Cl2O2S
KIN01068428
1-(4-HYDROXY-PHENYL)-1-METHOXY-3-PHENYLPROPANE
CAS:132777-12-9
Formula: C16H18O2
KIN03220486
1-(4-HYDROXY-PHENYL)-1-OCTADECANONE
CAS:2589-78-8
Formula: C22H38O
KIN01072556
1-(4-HYDROXY-PHENYL)-1-PROPANONE ION(I)
CAS:201607-95-6
KIN03409270
1-(4-HYDROXY-PHENYL)-1-PROPANONE OXIME
CAS:133595-72-9
Formula: C9H11NO2
KIN03224344
1-(4-HYDROXY-PHENYL)-1-PROPANONE POTASSIUM SALT
CAS:138660-02-3
Formula: C9H10O2.K
KIN03248070
1-(4-HYDROXY-PHENYL)-1-PROPANONE SODIUM SALT
CAS:108130-59-2
Formula: C9H10O2.Na
KIN03087068
1-(4-HYDROXY-PHENYL)-1H-INDOL-4-OL
CAS:1181566-71-1
Formula: C14H11NO2
KIN05292931
1-(4-HYDROXY-PHENYL)-1H-PYRAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:235109-68-9
Formula: C11H10N2O3
KIN03444235
1-(4-HYDROXY-PHENYL)-1H-PYRROL-2,3,4-TRICARBOXYLIC ACID
CAS:1036-11-9
Formula: C9H8N4O8
KIN01037836
1-(4-HYDROXY-PHENYL)-1H-PYRROL-2,5-DICARBOXYLIC ACID
CAS:216767-62-3
KIN03669608
1-(4-HYDROXY-PHENYL)-1H-PYRROL-2,5-DIONE
CAS:7300-93-8
Formula: C10H6N2O4
KIN01183883
1-(4-HYDROXY-PHENYL)-1H-PYRROL-2-CARBALDEHYDE
CAS:444077-56-9
Formula: C11H9NO2
KIN03586164
1-(4-HYDROXY-PHENYL)-1H-PYRROL-2-CARBALDEHYDE OXIME
CAS:444554-02-3
Formula: C11H10N2O2
KIN03005307
1-(4-HYDROXY-PHENYL)-1H-PYRROL-3,4-DICARBOXYLIC ACID
CAS:1026-55-7
Formula: C18H12
KIN01037572
1-(4-HYDROXY-PHENYL)-2,2-DIMETHYL-1-PROPANONE
CAS:72569-10-9
Formula: C11H14O2
KIN02592296
1-(4-HYDROXY-PHENYL)-2,2-PROPANEDIOL
CAS:90176-81-1
Formula: C9H12O3
KIN02723512
1-(4-HYDROXY-PHENYL)-2,3-BUTANEDIONE 2-OXIME
CAS:5440-27-7
Formula: C10H13NO
KIN01131277
1-(4-HYDROXY-PHENYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:26850-25-9
Formula: C9H8N2O3
KIN02151726
1-(4-HYDROXY-PHENYL)-2,4,6-TRIPHENYLPYRIDINIUM HYDROXIDE
CAS:123334-01-0
Formula: C29H21NO
KIN03179154
1-(4-HYDROXY-PHENYL)-2,4,6-TRIPHENYLPYRIDINIUM INNER SALT
CAS:17658-06-9
Formula: C29H21NO
KIN02064250
1-(4-HYDROXY-PHENYL)-2,4,6-TRIPHENYLPYRIDINIUM PERCHLORATE ( SALT )
CAS:56524-90-4
Formula: C29H22NO.ClO4
KIN02384327
1-(4-HYDROXY-PHENYL)-2,5-PYRROLIDINEDIONE
CAS:10187-21-0
Formula: C10H9NO3
KIN02002948
1-(4-HYDROXY-PHENYL)-2,6-DIMETHYL-4(1H)-PYRIDINONE
CAS:385374-16-3
Formula: C13H13NO2
KIN03552928
1-(4-HYDROXY-PHENYL)-2-(1-OXIDO-PYRIDIN-2-YL)ETHANONE
CAS:63262-55-5
Formula: C13H11NO3
KIN02489444
1-(4-HYDROXY-PHENYL)-2-(1H-IMIDAZOL-1-YL)ETHANONE
CAS:77234-59-4
Formula: C11H10N2O2
KIN02624308
1-(4-HYDROXY-PHENYL)-2-(2-METHOXY-PHENOXY)-1,3-PROPANEDIOL
CAS:56122-34-0
Formula: C16H18O5
KIN02377718
1-(4-HYDROXY-PHENYL)-2-(2-METHOXY-PHENOXY)-1-ETHANOL
CAS:106534-23-0
Formula: C15H16O4
KIN03076898
1-(4-HYDROXY-PHENYL)-2-(2-METHOXY-PHENOXY)-1-PROPANONE
CAS:64608-91-9
Formula: C16H16O4
KIN02512600
1-(4-HYDROXY-PHENYL)-2-(2-METHOXY-PHENOXY)ETHANONE
CAS:143486-72-0
Formula: C15H14O4
KIN03270538
1-(4-HYDROXY-PHENYL)-2-(4-METHOXY-PHENYL)ETHANONE
CAS:3669-47-4
Formula: C14H12O3
KIN01093600
1-(4-HYDROXY-PHENYL)-2-(4-PROPYLPIPERAZINE-1-YL)ETHANONE
CAS:1152873-84-1
Formula: C15H22N2O2
KIN05202370
1-(4-HYDROXY-PHENYL)-2-(METHYLAMINO)-1-PROPANONE
CAS:132224-98-7
Formula: C10H13NO2
KIN03217744
1-(4-HYDROXY-PHENYL)-2-(METHYLTHIO)ETHANONE
CAS:88310-61-6
Formula: C9H10O2S
KIN02696241
1-(4-HYDROXY-PHENYL)-2-(PYRIDIN-2-YLTHIO)ETHANONE
CAS:1156763-43-7
Formula: C13H11NO2S
KIN05238167
1-(4-HYDROXY-PHENYL)-2-(PYRIMIDIN-2-YLTHIO)ETHANONE
CAS:1152613-81-4
Formula: C12H10N2O2S
KIN05200455
1-(4-HYDROXY-PHENYL)-2-(PYRROLIDIN-2-YL)ETHANONE
CAS:62024-32-2
Formula: C12H15NO2
KIN02466377
1-(4-HYDROXY-PHENYL)-2-(THIOPHEN-2-YL)ETHANONE
CAS:412051-25-3
KIN03570250
1-(4-HYDROXY-PHENYL)-2-[(1-METHYL-1H-IMIDAZOL-2-YL)THIO]-ETHANONE
CAS:313666-46-5
Formula: C12H12N2O2S
KIN03488583
1-(4-HYDROXY-PHENYL)-2-IODO-ETHANONE
CAS:99233-31-5
Formula: C8H7IO2
KIN02819093
1-(4-HYDROXY-PHENYL)-2-METHYL-1,3-BUTANEDIONE
CAS:91142-94-8
Formula: C11H12O3
KIN02739390
1-(4-HYDROXY-PHENYL)-2-METHYL-1-BUTANONE
CAS:123020-88-2
KIN03177775
1-(4-HYDROXY-PHENYL)-2-METHYL-1-PROPANONE
CAS:34917-91-4
Formula: C10H12O2
KIN02218148
1-(4-HYDROXY-PHENYL)-2-METHYL-1-PROPANONE OXIME
CAS:103028-93-9
KIN03051354
1-(4-HYDROXY-PHENYL)-2-METHYL-2-PROPEN-1-ONE
CAS:60644-65-7
Formula: C10H10O2
KIN02446435
1-(4-HYDROXY-PHENYL)-2-MORPHOLIN-4-YL-3-PHENYL-1-PROPANONE HCL
CAS:102612-79-3
Formula: C19H21NO3.ClH
KIN03048763
1-(4-HYDROXY-PHENYL)-2-MORPHOLIN-4-YLETHANONEHBR
CAS:1052429-88-5
KIN05100515
1-(4-HYDROXY-PHENYL)-2-NITROSO-ETHANONE
CAS:143527-88-2
Formula: C8H7NO3
KIN03270765
1-(4-HYDROXY-PHENYL)-2-PHENOXY-ETHANONE
CAS:41978-29-4
Formula: C14H12O3
KIN02274951
1-(4-HYDROXY-PHENYL)-2-PHENYL-1-BUTANONE
CAS:6966-22-9
Formula: C17H20O10
KIN01175064
1-(4-HYDROXY-PHENYL)-2-PHENYL-1-PROPANONE
CAS:724-88-9
Formula: C14H11FOS
KIN01027485
1-(4-HYDROXY-PHENYL)-2-PHENYL-2-PROPEN-1-ONE
CAS:63186-98-1
Formula: C15H12O2
KIN02487932
1-(4-HYDROXY-PHENYL)-2-PHENYL-4-(2-(PHENYLTHIO)ETHYL)-3,5(1H)-PYRAZOLIDINEDIONE
CAS:1174-99-8
Formula: C26H22O3
KIN01042219
1-(4-HYDROXY-PHENYL)-2-PHENYL-4-[2-(BENZENESULFONYL)ETHYL]-3,5(1H)-PYRAZOLIDINEDIONE
CAS:1107-57-9
Formula: C27H47NO3
KIN01039671
1-(4-HYDROXY-PHENYL)-2-PHENYLBENZO[F]CHROMEN-3-ONE
CAS:30982-61-7
Formula: C25H16O3
KIN02186203
1-(4-HYDROXY-PHENYL)-2-PHENYLETHANE-1,2-DIONE
CAS:38469-73-7
Formula: C14H10O3
KIN02248262
4-Hydroxy-benzil
1-(4-HYDROXY-PHENYL)-2-PROPANONE
CAS:770-40-1
Formula: C9H12ClN
KIN01028956
1-(4-HYDROXY-PHENYL)-2-PROPANONE OXIME
CAS:50563-19-4
Formula: C9H11NO2
KIN02294484
MFCD01076405
1-(4-HYDROXY-PHENYL)-2-PROPEN-1-ONE
CAS:95605-38-2
Formula: C9H8O2
KIN02793278
1-(4-HYDROXY-PHENYL)-2-PYRIDIN-3-YL-3H-INDEN-5-OL
CAS:114584-09-7
Formula: C20H15NO2
KIN03131909
1-(4-HYDROXY-PHENYL)-2-PYRIDIN-3-YLETHANONE
CAS:412051-27-5
Formula: C13H11NO2
KIN03570252
1-(4-HYDROXY-PHENYL)-2-PYRIDIN-4-YLETHANONE
CAS:412051-26-4
Formula: C13H11NO2
KIN03570251
1-(4-HYDROXY-PHENYL)-2-PYRROLIDINETHIONE
CAS:58973-32-3
KIN02424121
1-(4-HYDROXY-PHENYL)-2-THIOETHANONE
CAS:23081-13-2
KIN02116587
1-(4-HYDROXY-PHENYL)-3,3-DIMETHYL-2,5-PYRROLIDINEDIONE
CAS:114450-97-4
KIN03647009
1-(4-HYDROXY-PHENYL)-3,5-DINITRO-4(1H)-PYRIDINONE
CAS:79228-86-7
Formula: C11H7N3O6
KIN02636339
1-(4-HYDROXY-PHENYL)-3,5-PYRAZOLIDINEDIONE
CAS:108128-40-1
KIN03087016
1-(4-HYDROXY-PHENYL)-3-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-2-PROPEN-1-ONE
CAS:31435-59-3
Formula: C13H11N3O4
KIN02189455
1-(4-HYDROXY-PHENYL)-3-(2-ISOXAZOLIDINYL)-1-PROPANONE HCL
CAS:6394-44-1
KIN01161215
1-(4-HYDROXY-PHENYL)-3-(2-METHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:6607-95-0
Formula: C10H12N2O3
KIN01165934
1-(4-HYDROXY-PHENYL)-3-(3,4,5-TRIMETHOXY-PHENYL)-PROP-2-EN-1-ONE
CAS:108132-05-4
Formula: O=C(c1ccc(cc1)O)C=Cc1cc(c(c(c1)OC)OC)OC
KIN03087072
1-(4-HYDROXY-PHENYL)-3-(3-METHYL-PIPERIDIN-1-YL)-1-PROPANONE
CAS:7510-42-1
Formula: C14H14N4O7
KIN01190292
1-(4-HYDROXY-PHENYL)-3-(4-METHYLPHENYL)-2-PROPEN-1-ONE
CAS:88521-99-7
Formula: C16H14O2
KIN02699358
1-(4-HYDROXY-PHENYL)-3-(4-NITROPHENYL)-2-PHENYLPROP-2-EN-1-ONE
CAS:24845-09-8
Formula: C21H15NO4
KIN02134376
1-(4-HYDROXY-PHENYL)-3-(4-PROPAN-2-YLPHENYL)-2-PROPEN-1-ONE
CAS:155269-25-3
Formula: C18H18O2
KIN03311688
1-(4-HYDROXY-PHENYL)-3-(THIOPHEN-2-YL)-2-PROPEN-1-ONE
CAS:97727-87-2
Formula: C13H10O2S
KIN02807417
1-(4-HYDROXY-PHENYL)-3-HYDROXY-PIPERIDINE
CAS:39104-02-4
Formula: C11H15NO2
KIN02252907
1-(4-HYDROXY-PHENYL)-3-METHOXY-2-METHYL-1-PROPANONE
CAS:92207-35-7
Formula: C11H14O3
KIN02754184
1-(4-HYDROXY-PHENYL)-3-METHYL-1H-PYRROL-2,5-DIONE
CAS:129698-36-8
KIN03019879
1-(4-HYDROXY-PHENYL)-3-METHYL-2,5-PYRROLIDINEDIONE
CAS:99843-30-8
Formula: C11H11NO3
KIN02822802
1-(4-HYDROXY-PHENYL)-3-METHYLBUT-2-EN-1-ONE
CAS:99865-12-0
Formula: C11H12O2
KIN02823249
1-(4-HYDROXY-PHENYL)-3-METHYLENE-2,5-PYRROLIDINEDIONE
CAS:139114-33-3
KIN03658330
1-(4-HYDROXY-PHENYL)-3-OCTADECYL-UREA
CAS:102253-20-3
Formula: C25H44N2O2
KIN03045825
1-(4-HYDROXY-PHENYL)-3-PHENYL-1-PROPANONE
CAS:36941-00-1
Formula: C15H14O2
KIN02235552
1-(4-HYDROXY-PHENYL)-3-PHENYL-2,5-PYRROLIDINEDIONE
CAS:65116-64-5
Formula: C16H13NO3
KIN02521339
1-(4-HYDROXY-PHENYL)-3-PHENYL-2-PROPEN-1-ONE
CAS:2657-28-5
Formula: C9H10O4
KIN01073910
1-(4-HYDROXY-PHENYL)-3-PHENYL-2-PROPEN-1-ONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:55947-42-7
Formula: C21H16N4O5
KIN02374799
1-(4-HYDROXY-PHENYL)-3-PHENYL-OCTAN-1,4-DIONE
CAS:475659-87-1
Formula: C20H22O3
KIN03602835
1-(4-HYDROXY-PHENYL)-3-PHENYLPROPAN-1,3-DIONE
CAS:52046-71-6
Formula: C15H12O3
KIN02315292
1-(4-HYDROXY-PHENYL)-3-PHENYLTHIOUREA
CAS:6986-81-8
Formula: C17H13ClO2S
KIN01175918
1-(4-HYDROXY-PHENYL)-3-PIPERIDIN-1-YL-1-PROPANONE HCL
CAS:4006-72-8
Formula: C17H23NO4
KIN01099369
1-(4-HYDROXY-PHENYL)-3-PROP-2-ENYLTHIOUREA
CAS:20680-01-7
Formula: C10H12N2OS
KIN02092995
1-(4-HYDROXY-PHENYL)-3-PYRROLIDINOL
CAS:39104-00-2
Formula: C10H13NO2
KIN02252905
1-(4-HYDROXY-PHENYL)-4-((1-METHYL-1H-IMIDAZOL-4-YL)SULFONYL)PIPERAZINE
CAS:137048-48-7
Formula: [C14H18N4O3S
KIN03239873
1-(4-HYDROXY-PHENYL)-4-(PIPERIDIN-1-YLCARBONYL)-PYRROLIDINE-2-ONE
CAS:5477-99-6
Formula: C15H20N2O5
KIN01133861
1-(4-HYDROXY-PHENYL)-4-HEXEN-2-ONE
CAS:61345-74-2
Formula: C12H14O2
KIN02454665
1-(4-HYDROXY-PHENYL)-4-IODO-1-BUTANONE
CAS:165335-03-5
Formula: C10H11IO2
KIN03337117
1-(4-HYDROXY-PHENYL)-4-PENTYL-2-PHENYL-3,5-PYRAZOLIDINEDIONE
CAS:22204-76-8
Formula: C20H22N2O3
KIN02108411
1-(4-HYDROXY-PHENYL)-4-PROPAN-2-YL-2-PHENYL-3,5-PYRAZOLIDINEDIONE
CAS:14845-08-0
Formula: C18H18N2O3
KIN02036125
1-(4-HYDROXY-PHENYL)-4-PYRIDIN-4-YL-PIPERAZIN-2-ONE%
CAS:166954-74-1
Formula: C15H15N3O2
KIN03669607
1-(4-HYDROXY-PHENYL)-5-(4-METHOXY-PHENYL)PENTA-1,4-DIEN-3-ONE
CAS:371246-71-8
Formula: C18H16O3
KIN03543041
1-(4-HYDROXY-PHENYL)-5-[[3-IODO-5-METHOXY-4-[(4-NITROPHENYL)METHOXY]PHENYL]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:365446-38-4
Formula: C25H18IN3O8
KIN03539946
1-(4-HYDROXY-PHENYL)-5-METHYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1005736-93-5
Formula: C11H10N2O2
KIN05010991
1-(4-HYDROXY-PHENYL)-5-METHYLPYRROLIDIN-2-ONE
CAS:91596-74-6
Formula: C11H13NO2
KIN02746184
1-(4-HYDROXY-PHENYL)-5-OXO-PYRROLIDIN-3-CARBOXYLIC ACID
CAS:39629-88-4
Formula: C11H11NO4
KIN02256292
MFCD01422913
1-(4-HYDROXY-PHENYL)-5-OXO-PYRROLIDINE-3-CARBONITRILE
CAS:1181630-43-2
Formula: C11H10N2O2
KIN05293800
1-(4-HYDROXY-PHENYL)-5-OXO-PYRROLIDINE-3-CARBONYL CHLORIDE
CAS:1181608-32-1
KIN05293551
1-(4-HYDROXY-PHENYL)-5-OXO-PYRROLIDINE-3-CARBOXAMIDE
CAS:309744-93-2
KIN03669606
1-(4-HYDROXY-PHENYL)-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID METHYL ESTER
CAS:133748-30-8
Formula: C12H13NO4
KIN03225220
1-(4-HYDROXY-PHENYL)-5-PENTYLPYRROLIDIN-2-ONE
CAS:73489-92-6
KIN02598665
1-(4-HYDROXY-PHENYL)-IMIDAZO[1,5-A]PYRIDINE-3(2H)-THIONE
CAS:1039745-71-5
Formula: C13H10N2OS
KIN05079620
1-(4-HYDROXY-PHENYL)-PYRROLIDINE-2-ONE
CAS:7517-12-6
Formula: C20H44O2P2
KIN01190548
1-(4-HYDROXY-PHENYL)BUT-3-EN-1-ONE
CAS:1056465-52-1
Formula: C10H10O2
KIN05102804
1-(4-HYDROXY-PHENYL)BUTAN-2-ONE
CAS:91060-98-9
Formula: C10H12O2
KIN02738058
1-(4-HYDROXY-PHENYL)CYCLOBUTANE-CARBONITRILE
CAS:1196125-36-6
Formula: C11H11NO
KIN05338993
1-(4-HYDROXY-PHENYL)CYCLOPROPANE-CARBONITRILE
CAS:1073477-06-1
Formula: C10H9NO
KIN05115265
1-(4-HYDROXY-PHENYL)DODECAN-1-ONE
CAS:2589-77-7
KIN01072555
1-(4-HYDROXY-PHENYL)ETHAN-1,2-DIOL
CAS:2380-78-1
Formula: C9H12O3
KIN01068211
1-(4-HYDROXY-PHENYL)ETHANONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:3797-36-2
KIN01096113
1-(4-HYDROXY-PHENYL)ETHANONE (4-NITROPHENYL)HYDRAZONE
CAS:7746-51-2
KIN01194406
1-(4-HYDROXY-PHENYL)ETHANONE 2-(3-FLUOROPHENYL)HYDRAZONE
CAS:104815-80-7
KIN03624461
1-(4-HYDROXY-PHENYL)ETHANONE 2-(4-FLUOROPHENYL)HYDRAZONE
CAS:104815-79-4
KIN03624460
1-(4-HYDROXY-PHENYL)ETHANONE 2-(4-HYDROXY-PHENYL)HYDRAZONE
CAS:30613-43-5
KIN02183514
1-(4-HYDROXY-PHENYL)ETHANONE 2-(4-METHYLPHENYL)HYDRAZONE
CAS:219538-56-4
KIN03624459
1-(4-HYDROXY-PHENYL)ETHANONE 2-(BENZYL)HYDRAZONE
CAS:450360-78-8
KIN03591671
1-(4-HYDROXY-PHENYL)ETHANONE 2-[1-(4-HYDROXY-PHENYL)ETHYLIDENE]HYDRAZONE
CAS:5466-25-1
Formula: C10H13N5O.ClH
KIN01133214
1-(4-HYDROXY-PHENYL)ETHANONE 2-[6-(1,1-DIMETHYLPROPYL)-5,6,7,8-TETRAHYDRO[1]BENZOTHIENO[2,3-D]PYRIMIDIN-4-YL]HYDRAZONE
CAS:314770-34-8
Formula: C23H28N4OS
KIN03489830
1-(4-HYDROXY-PHENYL)ETHANONE 2-PHENYLHYDRAZONE
CAS:69116-35-4
Formula: C14H14N2O
KIN02568060
1-(4-HYDROXY-PHENYL)ETHANONE 2-PYRIDIN-2-YLHYDRAZONE
CAS:400839-34-1
Formula: C13H13N3O
KIN03669605
1-(4-HYDROXY-PHENYL)ETHANONE DIPHENYLHYDRAZONE
CAS:380323-55-7
Formula: C20H18N2O
KIN03548402
1-(4-HYDROXY-PHENYL)ETHANONE LITHIUM SALT
CAS:62037-04-1
Formula: C8H8O2.Li
KIN02466643
1-(4-HYDROXY-PHENYL)ETHANONE O-METHYLOXIME
CAS:93249-64-0
Formula: C9H11NO2
KIN02767231
1-(4-HYDROXY-PHENYL)ETHANONE OXIME
CAS:34523-34-7
Formula: C8H9NO2
KIN02214564
1-(4-HYDROXY-PHENYL)ETHANONE POTASSIUM SALT
CAS:62037-05-2
Formula: C8H8O2.K
KIN02466644
1-(4-HYDROXY-PHENYL)ETHANONE SODIUM SALT
CAS:3019-87-2
Formula: C8H8O2.Na
KIN01081009
1-(4-HYDROXY-PHENYL)ETHANONE THALLIUM(I) SALT
CAS:65302-13-8
Formula: C8H8O2.Tl
KIN02524517
1-(4-HYDROXY-PHENYL)ETHYLIUM
CAS:183873-35-0
Formula: C8H9O
KIN03375744
1-(4-HYDROXY-PHENYL)GUANIDINE HCL
CAS:24067-10-5
Formula: C7H10ClN3O
KIN02126562
1-(4-HYDROXY-PHENYL)HEPTANE-1,3-DIONE
CAS:1137261-89-2
KIN05187515
1-(4-HYDROXY-PHENYL)PENTADECAN-1-ONE
CAS:110662-32-3
Formula: C21H34O2
KIN03103005
1-(4-HYDROXY-PHENYL)PENTAN-1-ONE
CAS:2589-72-2
Formula: C13H18O2
KIN01072552
1-(4-HYDROXY-PHENYL)PIPERIDIN-2,6-DIONE
CAS:423737-09-1
Formula: C11H11NO3
KIN03575056
1-(4-HYDROXY-PHENYL)PIPERIDIN-2-ONE
CAS:79557-03-2
Formula: C11H13NO2
KIN02638435
MFCD09753431
1-(4-HYDROXY-PHENYL)PIPERIDIN-4-ONE
CAS:113760-00-2
KIN03125775
1-(4-HYDROXY-PHENYL)THIOUREA
CAS:1520-31-6
Formula: C2H7NOS
KIN01049179
1-(4-HYDROXY-PHENYL-2-D)ETHANONE OXIME
CAS:497069-68-8
Formula: C8H8DNO2
KIN03615668
1-(4-HYDROXY-PIPERIDIN-1-YL)-1-BUTANONE
CAS:202647-18-5
Formula: C9H17NO2
KIN03410843
1-(4-HYDROXY-PIPERIDIN-1-YL)-1-DODECANONE
CAS:154544-40-8
Formula: C17H33NO2
KIN03309162
1-(4-HYDROXY-PIPERIDIN-1-YL)-1-HEXANONE
CAS:202647-20-9
Formula: C11H21NO2
KIN03410845
1-(4-HYDROXY-PIPERIDIN-1-YL)-1-PENTANONE
CAS:202647-19-6
Formula: C10H19NO2
KIN03410844
1-(4-HYDROXY-PIPERIDIN-1-YL)-1-PROPANONE
CAS:202647-17-4
Formula: C8H15NO2
KIN03410842
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-(2-METHYLPHENYL)ETHANONE
CAS:1156929-64-4
Formula: C14H19NO2
KIN05240466
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-(4-METHYLPHENYL)ETHANONE
CAS:1155004-72-0
Formula: C14H19NO2
KIN05222316
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-(PIPERAZIN-1-YL)ETHANONE
CAS:1038729-95-1
Formula: C11H21N3O2
KIN05077730
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-MERCAPTO-1-PROPANONE
CAS:365454-25-7
Formula: C8H15NO2S
KIN03679961
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-METHYL-2-PROPEN-1-ONE
CAS:177856-65-4
Formula: C9H15NO2
KIN03669604
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-PHENYLETHANONE
CAS:1082883-00-8
Formula: C13H17NO2
KIN05123196
1-(4-HYDROXY-PIPERIDIN-1-YL)-2-PROPEN-1-ONE
CAS:139252-43-0
Formula: C8H13NO2
KIN03251450
1-(4-HYDROXY-PIPERIDIN-1-YL)-3-PHENYL-1-PROPANONE
CAS:321597-49-3
Formula: C14H19NO2
KIN03025418
1-(4-HYDROXY-PIPERIDIN-1-YL)CYCLOHEXAN-CARBONITRILE
CAS:60756-86-7
Formula: C12H20N2O
KIN02447453
1-(4-HYDROXY-PIPERIDIN-4-YL)-2-PROPANONE
CAS:1742-68-3
Formula: C12H23NO2.C6H8O7
KIN01054742
1-(4-HYDROXY-PIPERIDIN-4-YL)ETHANONE
CAS:265107-16-2
Formula: [C7H13NO2
KIN03461821
1-(4-HYDROXY-PIPERIDINE-1-YL)-1,3-BUTANEDIONE
CAS:1179833-40-9
Formula: C9H15NO3
KIN05287810
1-(4-HYDROXY-PIPERIDINE-1-YL)-1-HEPTANONE
CAS:1155613-97-0
Formula: C12H23NO2
KIN05226652
1-(4-HYDROXY-PIPERIDINE-1-YL)-1-OCTANONE
CAS:1155613-83-4
Formula: C13H25NO2
KIN05226651
1-(4-HYDROXY-PIPERIDINE-1-YL)-2,4-HEXADIEN-1-ONE
CAS:1158110-46-3
Formula: C11H17NO2
KIN05252735
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(1H-PYRAZOL-1-YL)-1-PROPANONE
CAS:1155049-03-8
Formula: C11H17N3O2
KIN05222808
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(2-METHOXYETHOXY)ETHANONE
CAS:1154156-14-5
Formula: C10H19NO4
KIN05214872
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(4-NITROPHENYL)ETHANONE
CAS:1156758-30-3
KIN05238118
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(METHYLAMINO)ETHANONE
CAS:1016506-29-8
Formula: C8H16N2O2
KIN05022176
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(METHYLAMINO)ETHANONE HCL
CAS:1181868-02-9
Formula: C8H17ClN2O2
KIN05295241
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(METHYLTHIO)ETHANONE
CAS:1156148-57-0
Formula: C8H15NO2S
KIN05230139
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-(PHENYLAMINO)ETHANONE
CAS:1182962-60-2
Formula: C13H18N2O2
KIN05298931
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-METHYL-1-BUTANONE
CAS:1154152-66-5
Formula: C10H19NO2
KIN05214773
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-METHYL-1-PENTANONE
CAS:1154151-62-8
Formula: C11H21NO2
KIN05214756
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-METHYL-1-PROPANONE
CAS:1082928-57-1
Formula: C9H17NO2;C9H17NO2
KIN05123591
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-METHYL-2-PENTEN-1-ONE
CAS:1158092-96-6
Formula: C11H19NO2
KIN05252531
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-PIPERIDINE-2-YLETHANONE
CAS:1038369-43-5
Formula: C12H22N2O2
KIN05076633
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-PROPYN-1-ONE
CAS:1156132-01-2
Formula: C8H11NO2;C8H11NO2
KIN05229968
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-PYRIDINE-2-YLETHANONE
CAS:1155927-51-7
Formula: C12H16N2O2
KIN05227965
1-(4-HYDROXY-PIPERIDINE-1-YL)-2-PYRIDINE-4-YLETHANONE
CAS:1155927-44-8
Formula: C12H16N2O2
KIN05227964
1-(4-HYDROXY-PIPERIDINE-1-YL)-3,3-DIMETHYL-1-BUTANONE
CAS:1090820-28-2
Formula: C11H21NO2
KIN05131538
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-(METHYLTHIO)-1-PROPANONE
CAS:1154156-78-1
Formula: C9H17NO2S
KIN05214888
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-METHYL-1-BUTANONE
CAS:1082804-64-5
Formula: C10H19NO2;C10H19NO2
KIN05122445
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-METHYLBUT-2-EN-1-ONE
CAS:1154687-35-0
Formula: C10H17NO2
KIN05219393
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-PHENYL-2-PROPEN-1-ONE
CAS:1158114-35-2
Formula: C14H17NO2
KIN05252769
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-PHENYL-2-PROPYN-1-ONE
CAS:1156099-58-9
Formula: C14H15NO2
KIN05229508
1-(4-HYDROXY-PIPERIDINE-1-YL)-3-PYRIDINE-3-YL-1-PROPANONE
CAS:1153277-59-8
Formula: C13H18N2O2
KIN05207749
1-(4-HYDROXY-PIPERIDINE-1-YL)-4-(METHYLAMINO)-1-BUTANONE
CAS:1183767-23-8
Formula: C10H20N2O2
KIN05307676
1-(4-HYDROXY-PIPERIDINE-1-YL)-4-METHYL-1-PENTANONE
CAS:1155001-96-9
Formula: C11H21NO2
KIN05222293
1-(4-HYDROXY-PIPERIDINE-1-YL)-4-PENTYN-1-ONE
CAS:1197226-69-9
Formula: C10H15NO2
KIN05340355
1-(4-HYDROXY-PIPERIDINE-1-YL)-5-HEXYN-1-ONE
CAS:1197236-23-9
Formula: C11H17NO2
KIN05340485
1-(4-HYDROXY-PIPERIDINE-1-YL)-6-HEPTYN-1-ONE
CAS:1197238-68-8
Formula: C12H19NO2
KIN05340528
1-(4-HYDROXY-PIPERIDINE-1-YL)BUT-2-EN-1-ONE
CAS:1158140-26-1
Formula: C9H15NO2
KIN05253053
1-(4-HYDROXY-PIPERIDINE-1-YL)CYCLOPENTANE-CARBONITRILE
CAS:1018337-53-5
Formula: C11H18N2O
KIN05036933
1-(4-HYDROXY-QUINOLIN-3-YL)ETHANONE
CAS:6622-20-4
Formula: C20H15NO4
KIN01166261
1-(4-HYDROXY-QUINOLIN-6-YL)ETHANONE
CAS:15900-88-6
Formula: C11H9NO2
KIN02045349
1-(4-HYDROXY-QUINOLIN-6-YL)ETHANONE OXIME
CAS:1071597-30-2
Formula: C11H10N2O2
KIN05112985
1-(4-HYDROXY-QUINOLIN-7-YL)ETHANONE
CAS:35970-45-7
Formula: C11H9NO2
KIN02227788
1-(4-HYDROXY-THIAZOL-2-YL)-3,3-DIMETHYLBUTAN-2-ONE
CAS:320424-47-3
KIN03014606
1-(4-HYDROXY-THIOPHEN-3-YL)ETHANONE
CAS:5556-17-2
Formula: C15H24O4S
KIN01135573
1-(4-HYDROXYBICYCLO[2.2.2]OCTAN-1-YL)ETHANONE
CAS:72948-96-0
KIN02594889
1-(4-HYDROXYMETHYLPHENYL)-3-BUTEN-1-OL
CAS:173411-32-0
Formula: C11H14O2
KIN03353542
1-(4-HYDROXYMETHYLPHENYL)-PROPAN-1-OL
CAS:1004992-92-0
Formula: C10H14O2
KIN05010034
1-(4-HYDROXYPHENYL)-2-(3-METHYL-4-MORPHOLINYL)-ETHANONE
CAS:1157773-33-5
Formula: C13H17NO3
KIN05250084
1-(4-HYDROXYPHENYL)-CYCLOPENTANECARBONITRILE
CAS:81324-97-2
Formula: C12H13NO
KIN02649179
1-(4-HYDROXYPHENYL)-CYCLOPENTANECARBOXAMIDE
CAS:165119-38-0
Formula: C12H15NO2
KIN03336716
1-(4-HYDROXYPHENYL)-CYCLOPENTANECARBOXYLIC ACID
CAS:91496-64-9
Formula: C12H14O3
KIN02744628
MFCD00455268
1-(4-HYDROXYPYRROLIDINE-2-CARBONYL)PYRROLIDINE-2-CARBOXAMIDE
CAS:1132836-44-2
Formula: C10H17N3O3
KIN05184405
1-(4-HYDROXYTHIENO[2,3-B]PYRIDIN-5-YL)ETHANONE
CAS:65076-04-2
Formula: C9H7NO2S
KIN02520597
1-(4-Hydroxythieno[2,3-b]pyridin-5-yl)ethanone
1-(4-IMIDAZO[1,2-A]PYRIDIN-2-YLPHENYL)ETHANONE
CAS:55843-92-0
Formula: C15H12N2O
KIN02373256
1-(4-IMIDAZO[1,2-A]PYRIDIN-3-YLPHENYL)ETHANONE
CAS:59182-04-6
KIN02427596
1-(4-IMINO-1(4H)-QUINAZOLINYL)-2-PROPANONE HBR
CAS:60007-40-1
Formula: C11H11N3O.BrH
KIN02440716
1-(4-IMINO-2,5-CYCLOHEXADIEN-1-YLIDENE)METHANEDIAMINE
CAS:398141-20-3
Formula: C7H9N3
KIN03658328
1-(4-IMINO-2,5-CYCLOHEXADIEN-1-YLIDENE)PIPERIDINIUM DIPERCHLOROATE
CAS:115050-04-9
Formula: [C11H15Cl2N2O8-
KIN03134982
1-(4-INDANYLOXY)-3-MORPHOLIN-4-YL-2-PROPANOL
CAS:67465-90-1
Formula: C16H23NO3
KIN02553864
1-(4-INDANYLOXY)-3-PIPERIDIN-1-YL-2-PROPANOL
CAS:67465-91-2
Formula: C17H25NO2
KIN02553865
1-(4-INDOL-1-YLBUTYL)-INDOLE
CAS:94545-16-1
Formula: C20H20N2
KIN02782942
1-(4-IODO-1,3-BUTADIYNYL)-2-METHYLCYCLOHEXENE
CAS:67562-15-6
Formula: C11H11I
KIN02555123
1-(4-iodo-1,3-butadiynyl)-2-methyl-cyclohexene
1-(4-IODO-1,3-BUTADIYNYL)CYCLOHEXENE
CAS:67562-14-5
Formula: C10H9I
KIN02555122
1-(4-iodo-1,3-butadiynyl)cyclohexene
1-(4-IODO-1,5-DIMETHYL-1H-PYRAZOL-3-YL)ETHANONE
CAS:103589-73-7
KIN03054825
1-(4-IODO-1-OXO-BUTYL)PIPERIDINE
CAS:64793-93-7
Formula: C9H16INO
KIN02515779
1-(4-iodo-1-oxo-butyl)piperidine
1-(4-IODO-1H-PYRAZOL-1-YL)ETHANONE
CAS:98027-52-2
Formula: C5H5IN2O
KIN02809920
MFCD09744025
1-(4-IODO-1H-PYRROL-2-YL)ETHANONE
CAS:51333-65-4
Formula: C6H6INO
KIN02305062
1-(4-IODO-2,5-DIMETHOXY-PHENYL)-2-PROPANONE
CAS:90064-49-6
Formula: C11H13IO3
KIN02721835
1-(4-iodo-2,5-dimethoxyphenyl)-2-propanone
1-(4-IODO-2,5-DIMETHOXY-PHENYL)ETHANONE
CAS:103204-10-0
KIN03052334
1-(4-IODO-2,6-DIMETHOXY-PHENYL)ETHANONE
CAS:483989-05-5
Formula: C10H11IO3
KIN03609813
1-(4-IODO-2,6-DIMETHYLPHENYL)-3,3-DIMETHYLBUTAN-2-ONE
CAS:294662-83-2
KIN03658327
1-(4-IODO-2,6-DIMETHYLPHENYL)ETHANONE
CAS:118738-91-3
KIN03155711
1-(4-IODO-2-METHOXY-PHENYL)ETHANONE
CAS:90347-64-1
Formula: C9H9IO2
KIN02726439
1-(4-iodo-2-methoxyphenyl)ethanone; 4'-iodo-2&
1-(4-IODO-2-METHYLPHENYL)-1H-PYRROL-2,5-DIONE
CAS:324580-21-4
Formula: C11H8INO2
KIN03494739
1-(4-IODO-2-METHYLPHENYL)-1H-TETRAZOLE
CAS:370082-21-6
Formula: C8H7IN4
KIN03541989
1-(4-IODO-2-METHYLPHENYL)-2-METHYL-5-PHENYL-1H-PYRROLE
CAS:357989-02-7
Formula: C18H16IN
KIN03535020
1-(4-IODO-2-METHYLPHENYL)-3-(1-METHYL-1H-PYRROL-2-YL)-2,5-PYRROLIDINEDIONE
CAS:402486-84-4
Formula: C16H15IN2O2
KIN03563294
1-(4-IODO-2-METHYLPHENYL)-3-(PHENYLAMINO)-2,5-PYRROLIDINEDIONE
CAS:476409-81-1
Formula: C17H15IN2O2
KIN03603304
1-(4-IODO-2-METHYLPHENYL)-3-[[4-MORPHOLIN-4-YLPHENYL]AMINO]-2,5-PYRROLIDINEDIONE
CAS:474006-28-5
Formula: C21H22IN3O3
KIN03600835
1-(4-IODO-2-METHYLPHENYL)-3-PIPERIDIN-1-YL-2,5-PYRROLIDINEDIONE
CAS:324580-20-3
Formula: C16H19IN2O2
KIN03494738
1-(4-IODO-2-METHYLPHENYL)ETHANONE
CAS:52164-27-9
Formula: C9H9IO
KIN02317169
1-(4-IODO-2-METHYLPHENYL)ETHANONE OXIME
CAS:99979-74-5
Formula: C9H10INO
KIN02824028
1-(4-IODO-2-METHYLPHENYL)SULFONYL-3,5-DIMETHYLPYRAZOLE
CAS:5611-14-3
Formula: C17H22N2O4
KIN01136837
1-(4-IODO-2-NITROPHENYL)-1H-1,2,3-TRIAZOLE
CAS:89898-68-0
Formula: C8H5IN4O2
KIN02719039
1-(4-IODO-2-NITROPHENYL)ETHANONE
CAS:89976-23-8
Formula: C8H6INO3
KIN02720135
Acetophenone, 4'-iodo-2'-nitro-; 4'-io
1-(4-IODO-2-NITROPHENYL)ETHANONE OXIME
CAS:10577-17-0
KIN02008366
1-(4-IODO-2-NITROSOPHENYL)-1-PROPANONE
CAS:57807-30-4
Formula: C9H8INO2
KIN02405708
1-(4-IODO-2-PROPOXY-PHENYL)ETHANONE
CAS:135901-84-7
Formula: C11H13IO2
KIN03234817
1-(4-IODO-2-PROPYLPHENYL)ETHANONE
CAS:100127-53-5
KIN03028823
1-(4-IODO-3,5-DIMETHYLPHENYL)-3,3-DIMETHYLBUTAN-2-ONE
CAS:294662-86-5
KIN03658326
1-(4-IODO-3-METHYLPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE
CAS:423750-08-7
Formula: C14H14INO
KIN03575114
1-(4-IODO-3-METHYLPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:333394-47-1
Formula: C20H18IN5O4
KIN03506725
1-(4-IODO-3-METHYLPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE OXIME
CAS:347379-27-5
Formula: C14H15IN2O
KIN03524274
1-(4-IODO-3-METHYLPHENYL)-2-METHYL-5-PHENYL-1H-PYRROLE
CAS:357988-76-2
Formula: C18H16IN
KIN03535010
1-(4-IODO-3-METHYLPHENYL)ETHANONE
CAS:52107-80-9
KIN02316313
1-(4-IODO-3-NITROPHENYL)ETHANONE
CAS:89976-24-9
Formula: C8H6INO3
KIN02720136
1-(4-iodo-3-nitrophenyl)ethanone; 1-(4-iodo-3-nitr
1-(4-IODO-ALPHA-2,6-DIMETHYLPHENOXY)-2-PROPANAMINE
CAS:1115028-52-8
Formula: C11H16INO
KIN05175734
1-(4-IODO-ALPHA-2,6-DIMETHYLPHENOXY)-2-PROPANONE
CAS:1115285-47-6
Formula: C11H13IO2
KIN05175887
1-(4-IODO-ALPHA-3-NITROPHENYL)-1-PROPANONE
CAS:1132754-30-3
Formula: C9H8INO3
KIN05183804
1-(4-IODO-ALPHA-BENZOYL)PIPERIDIN-4-ONE
CAS:1040072-40-9
Formula: C12H12INO2
KIN05085132
1-(4-IODO-ALPHA-BENZOYL)PIPERIDIN-4-ONE 4-OXIME
CAS:1039889-34-3
Formula: C12H13IN2O2
KIN05081529
1-(4-IODO-ALPHA-PHENOXY)-3-(METHYLAMINO)-2-PROPANOL
CAS:1094293-51-2
Formula: C10H14INO2
KIN05138224
1-(4-IODO-ALPHA-PHENYL)-1H-PYRAZOL-4-CARBONITRILE
CAS:1000705-73-6
Formula: C10H6IN3
KIN05004644
1-(4-IODO-ALPHA-PHENYL)-1H-PYRAZOL-4-METHANOL
CAS:1000705-72-5
Formula: C10H9IN2O
KIN05004643
1-(4-IODO-ALPHA-PHENYL)-2-(1H-PYRAZOL-1-YL)ETHANONE
CAS:1157935-23-3
Formula: C11H9IN2O
KIN05251147
1-(4-IODO-ALPHA-PHENYL)-2-(METHYLPROPYLAMINO)ETHANONE
CAS:1157957-48-6
Formula: C12H16INO
KIN05251325
1-(4-IODO-ALPHA-PHENYL)-2-(PYRROLIDIN-1-YL)ETHANONE
CAS:1152852-31-7
Formula: C12H14INO
KIN05202010
1-(4-IODO-ALPHA-PHENYL)-2-PYRROLIDINIMINE
CAS:1040039-64-2
Formula: C10H11IN2
KIN05084478
1-(4-IODO-ALPHA-PHENYL)-3-METHYL-1H-PYRROL-2,5-DIONE
CAS:1097827-96-7
Formula: C11H8INO2
KIN05161760
1-(4-IODO-ALPHA-PHENYL)-3-PYRROLIDINAMINE
CAS:1179311-10-4
Formula: C10H13IN2
KIN05284420
1-(4-IODO-ALPHA-PHENYL)-3-PYRROLIDINEMETHANAMINE
CAS:1039879-47-4
Formula: C11H15IN2
KIN05081287
1-(4-IODO-ALPHA-PHENYL)-4-PIPERIDINAMINE
CAS:1183895-91-1
Formula: C11H15IN2
KIN05309018
1-(4-IODO-ALPHA-PHENYL)-N-METHYL-3-PYRROLIDINAMINE
CAS:1179653-73-6
Formula: C11H15IN2
KIN05286117
1-(4-IODO-ALPHA-PHENYL)-N-METHYL-4-PIPERIDINAMINE
CAS:1183308-35-1
Formula: C12H17IN2
KIN05302756
1-(4-IODO-ALPHA-PHENYL)-PYRROLIDIN-3-ONE
CAS:1096324-82-1
Formula: C10H10INO
KIN05154289
1-(4-IODO-ALPHA-PHENYL)PIPERIDIN-4-ONE
CAS:1039873-09-0
Formula: C11H12INO
KIN05081116
1-(4-IODO-ALPHA-PYRIDIN-2-YL)CYCLOPROPANAMINE
CAS:1159737-46-8
Formula: C8H9IN2
KIN05255556
1-(4-IODO-ALPHA-PYRIDIN-2-YL)PIPERIDIN-4-ONE
CAS:1057282-69-5
Formula: C10H11IN2O
KIN05104126
1-(4-IODO-BENZOYL)-1H-INDOL-3-CARBOXYLIC ACID METHYL ESTER
CAS:425619-65-4
Formula: C17H12INO3
KIN03576019
1-(4-IODO-BENZOYL)-2-PIPERIDINEACETIC ACID
CAS:1183921-24-5
Formula: C14H16INO3
KIN05309292
1-(4-IODO-BENZOYL)-2-PIPERIDINEACETIC ACID METHYL ESTER
CAS:1179266-18-2
Formula: C15H18INO3
KIN05283943
1-(4-IODO-BENZOYL)-3-PIPERIDINECARBOXYLIC ACID
CAS:1053982-15-2
KIN05101628
1-(4-IODO-BENZOYL)-3-PIPERIDINECARBOXYLIC ACID ETHYL ESTER
CAS:1156117-30-4
Formula: C15H18INO3
KIN05229701
1-(4-IODO-BENZOYL)-4-PHENYL-4-PIPERIDINECARBOXYLIC ACID
CAS:1054038-47-9
KIN05101663
1-(4-IODO-BENZOYL)-4-PIPERIDINECARBOXYLIC ACID
CAS:1054137-97-1
KIN05101710
1-(4-IODO-BENZOYL)-4-PIPERIDINECARBOXYLIC ACID ETHYL ESTER
CAS:425628-29-1
Formula: C15H18INO3
KIN03576076
1-(4-IODO-BENZOYL)-L-PROLINE METHYL ESTER
CAS:1189238-65-0
Formula: C13H14INO3
KIN05328707
1-(4-IODO-BENZOYL)-N-METHYLCYCLOBUTANE-CARBOTHIOAMIDE
CAS:181238-63-1
Formula: C13H14INOS
KIN03370663
1-(4-IODO-BENZOYL)PIPERIDIN-4-CARBOXAMIDE
CAS:425614-78-4
Formula: C13H15IN2O2
KIN03575982
1-(4-IODO-BUTOXY)OCTADECANE
CAS:105050-84-8
Formula: C22H45IO
KIN03065753
1-(4-IODO-BUTYL)-1H-INDOL-3-CARBALDEHYDE
CAS:156237-64-8
KIN03314882
1-(4-IODO-BUTYL)-1H-INDOLE
CAS:156237-68-2
KIN03314883
1-(4-IODO-BUTYL)-2,3,4,5-TETRAMETHOXY-6-METHYLBENZENE
CAS:80810-27-1
Formula: C15H23IO4
KIN02646230
1-(4-IODO-BUTYL)-2,5-PYRROLIDINEDIONE
CAS:177274-00-9
KIN03362118
1-(4-IODO-BUTYL)-4-(BENZYLOXY)-BENZENE
CAS:366016-80-0
KIN03540441
1-(4-IODO-BUTYL)-4-METHYLBENZENE
CAS:339570-60-4
Formula: C11H15I
KIN03513519
1-(4-IODO-BUTYL)-4-NITRO-BENZENE
CAS:99067-72-8
Formula: C10H12INO2
KIN02817764
1-(4-iodo-butyl)-4-nitro-benzene
1-(4-IODO-BUTYL)CYCLOPENTANE-CARBOXYLIC ACID METHYL ESTER
CAS:103724-57-8
Formula: C11H19IO2
KIN03055679
1-(4-IODO-PHENOXY)-2,3-DIMETHYLBENZENE
CAS:167990-12-7
Formula: C14H13IO
KIN03341821
1-(4-IODO-PHENOXY)-2,4-DINITRO-BENZENE
CAS:2363-34-0
KIN01067796
1-(4-IODO-PHENOXY)-2-BUTANOL
CAS:1183135-74-1
Formula: C10H13IO2
KIN05300860
1-(4-IODO-PHENOXY)-2-METHYL-2-PROPANOL
CAS:1179505-63-5
Formula: C10H13IO2
KIN05285088
1-(4-IODO-PHENOXY)-2-METHYLBENZENE
CAS:1017793-87-1
Formula: C13H11IO
KIN05035331
1-(4-IODO-PHENOXY)-2-PROPANOL
CAS:29639-84-7
KIN02175537
1-(4-IODO-PHENOXY)-2-PROPANONE
CAS:459819-68-2
Formula: C9H9IO2
KIN03595083
1-(4-IODO-PHENOXY)-3,5-DIMETHYLBENZENE
CAS:167987-59-9
Formula: C14H13IO
KIN03341807
1-(4-IODO-PHENOXY)-3,5-DINITRO-BENZENE
CAS:168839-38-1
Formula: C12H7IN2O5
KIN03343497
1-(4-IODO-PHENOXY)-3-(2-PROPYLBENZO[D]IMIDAZOL-1-YL)-PROPAN-2-OL
CAS:5924-35-6
KIN01145170
1-(4-IODO-PHENOXY)-3-(PROPYLAMINO)-2-PROPANOL
CAS:1094722-25-4
Formula: C12H18INO2
KIN05144585
1-(4-IODO-PHENOXY)-3-ISOQUINOLINECARBOXYLIC ACID
CAS:1097164-74-3
KIN05160116
1-(4-IODO-PHENOXY)-3-METHOXY-BENZENE
CAS:167987-57-7
Formula: C13H11IO2
KIN03341805
1-(4-IODO-PHENOXY)-3-METHYLBENZENE
CAS:131895-11-9
KIN03216208
1-(4-IODO-PHENOXY)-3-NITRO-5-PHENOXY-BENZENE
CAS:168839-57-4
Formula: C18H12INO4
KIN03343500
1-(4-IODO-PHENYL)-1,1-DI-ALLYL-SILANOL
CAS:1056691-17-8
Formula: C12H15IOSi
KIN05102971
1-(4-IODO-PHENYL)-1,2-PROPANEDIONE 1-OXIME
CAS:1087712-26-2
Formula: C9H8INO2
KIN05126690
1-(4-IODO-PHENYL)-1,3,5-TRIAZIN-2,4,6(1H,3H,5H)-TRIONE
CAS:327622-22-0
KIN03647008
1-(4-IODO-PHENYL)-1,3-BUTANEDIONE
CAS:54454-25-0
KIN02350299
1-(4-IODO-PHENYL)-1,3-PROPANEDIOL
CAS:62914-12-9
Formula: C9H11IO2
KIN02482705
1-(4-iodo-phenyl)-1,3-propanediol
1-(4-IODO-PHENYL)-1,3-PROPANEDIOL 3-ACETATE
CAS:62872-51-9
Formula: C11H13IO3
KIN02481933
1-(4-iodo-phenyl)-1,3-propanediol 3-acetate
1-(4-IODO-PHENYL)-1-BUTANONE
CAS:160565-77-5
Formula: C10H11IO
KIN03326465
1-(4-IODO-PHENYL)-1-HEXANONE
CAS:160565-78-6
Formula: C12H15IO
KIN03326466
1-(4-IODO-PHENYL)-1-OCTANONE
CAS:111829-16-4
Formula: C14H19IO
KIN03110322
1-(4-IODO-PHENYL)-1-PENTANONE
CAS:226712-31-8
Formula: C11H13IO
KIN03440570
1-(4-IODO-PHENYL)-1-PROPANONE
CAS:31970-26-0
Formula: C9H9IO
KIN02193462
MFCD09813773
1-(4-IODO-PHENYL)-1H-[1,2,4]-TRIAZOL-3,5-DIAMINE
CAS:92475-01-9
Formula: C8H8IN5
KIN02757173
1-(4-IODO-PHENYL)-1H-[1,2,4]-TRIAZOLE
CAS:173190-50-6
Formula: C8H6IN3
KIN03352996
1-(4-IODO-PHENYL)-1H-1,2,3-TRIAZOL-5-CARBOXYLIC ACID
CAS:20177-60-0
Formula: C9H6IN3O2
KIN02088839
1-(4-IODO-PHENYL)-1H-1,2,3-TRIAZOLE
CAS:1101173-99-2
Formula: C8H6IN3
KIN05167431
1-(4-IODO-PHENYL)-1H-BENZO[D]IMIDAZOL-2-YLAMINE
CAS:158722-28-2
Formula: C13H10IN3
KIN03321275
1-(4-IODO-PHENYL)-1H-BENZO[D]IMIDAZOL-5-YLAMINE
CAS:7104-68-9
KIN01178699
1-(4-IODO-PHENYL)-1H-BENZOTRIAZOLE
CAS:212780-91-1
KIN03424392
1-(4-IODO-PHENYL)-1H-IMIDAZOLE
CAS:132464-89-2
KIN03219007
1-(4-IODO-PHENYL)-1H-PYRAZOL-3-CARBOXYLIC ACID
CAS:19532-42-4
KIN02082082
1-(4-IODO-PHENYL)-1H-PYRAZOL-4-OL
CAS:77458-32-3
Formula: C9H7IN2O
KIN02625748
1-(4-IODO-PHENYL)-1H-PYRAZOLE
CAS:368869-86-7
Formula: [C9H7IN2
KIN03541491
1-(4-IODO-PHENYL)-1H-PYRROL-2,5-DIONE
CAS:65833-01-4
Formula: C10H6INO2
KIN02533076
1-(4-iodo-phenyl)-1H-pyrrol-2,5-dione; N-(4-iodo-p
MFCD00022575
1-(4-IODO-PHENYL)-1H-PYRROL-2-CARBALDEHYDE
CAS:261178-18-1
Formula: C11H8INO
KIN03458684
1-(4-IODO-PHENYL)-1H-PYRROL-2-CARBALDEHYDE OXIME
CAS:428841-65-0
Formula: C11H9IN2O
KIN03577203
1-(4-IODO-PHENYL)-1H-PYRROL-2-PROPANOL
CAS:1000517-54-3
Formula: C13H14INO
KIN05001635
1-(4-IODO-PHENYL)-1H-PYRROLE
CAS:92636-36-7
Formula: C10H8IN
KIN02759523
N-(4-iodo-phenyl)-1H-pyrrole; 1-(4-iodo-phenyl)-1H
MFCD00052399
1-(4-IODO-PHENYL)-1H-TETRAZOL-5-ACETALDEHYDE 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:125037-92-5
Formula: C15H11IN8O4
KIN03186817
1-(4-IODO-PHENYL)-1H-TETRAZOL-5-ACETALDEHYDE 2-(4-NITROPHENYL)HYDRAZONE
CAS:125057-34-3
Formula: C15H12IN7O2
KIN03186931
1-(4-IODO-PHENYL)-1H-TETRAZOLE
CAS:249291-82-5
Formula: C7H5IN4
KIN03450101
1-(4-IODO-PHENYL)-2,2-DIMETHYL-1-PROPANONE
CAS:496945-90-5
Formula: C11H13IO
KIN03615430
1-(4-IODO-PHENYL)-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:90800-18-3
Formula: C10H7IN2O3
KIN02733570
Barbituric acid , 1-(p-iodo-phenyl)-; 1-(4-iodo-ph
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE
CAS:241488-81-3
Formula: C13H12INO
KIN03446034
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(1,6-DIHYDRO-4-METHYL-6-OXO-PYRIMIDIN-2-YL)HYDRAZONE
CAS:385788-38-5
Formula: C18H18IN5O
KIN03553415
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(1-PHTHALAZINYL)HYDRAZONE
CAS:453532-88-2
Formula: C21H18IN5
KIN03592923
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(1H-BENZO[D]IMIDAZOL-2-YL)HYDRAZONE
CAS:454240-49-4
Formula: C20H18IN5
KIN03593272
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(2,3,4,5-TETRAHYDRO-3,5-DIOXO-1,2,4-TRIAZIN-6-YL)HYDRAZONE
CAS:303126-86-5
Formula: C16H15IN6O2
KIN03479541
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(2,4,6-TRICHLOROPHENYL)HYDRAZONE
CAS:389596-22-9
Formula: C19H15Cl3IN3
KIN03555474
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(2,4-DINITROPHENYL)HYDRAZONE
CAS:387386-94-9
Formula: C19H16IN5O4
KIN03554183
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(2-NITROPHENYL)HYDRAZONE
CAS:389872-64-4
Formula: C19H17IN4O2
KIN03555789
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(3,4-DICHLOROPHENYL)HYDRAZONE
CAS:380335-23-9
Formula: C19H16Cl2IN3
KIN03548442
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(3-CHLORO-4-METHYLPHENYL)HYDRAZONE
CAS:391636-74-1
Formula: C20H19ClIN3
KIN03556641
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(3-METHYL-2(3H)-BENZO[D]THIAZOLYLIDENE)HYDRAZONE
CAS:399012-23-8
Formula: C21H19IN4S
KIN03560551
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(3-NITROPHENYL)HYDRAZONE
CAS:399002-35-8
Formula: C19H17IN4O2
KIN03560520
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(4,6-DIMETHYLPYRIMIDIN-2-YL)HYDRAZONE
CAS:385787-29-1
Formula: C19H20IN5
KIN03553410
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(5,6,7,8-TETRAHYDRO-2-METHYL[1]BENZOTHIENO[2,3-D]PYRIMIDIN-4-YL)HYDRAZONE
CAS:326876-10-2
Formula: C24H24IN5S
KIN03496800
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(6-CHLOROPYRIDAZIN-3-YL)HYDRAZONE
CAS:452294-58-5
Formula: C17H15ClIN5
KIN03592503
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(7-CHLORO-QUINOLIN-4-YL)HYDRAZONE
CAS:391617-63-3
Formula: C22H18ClIN4
KIN03556604
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(BENZO[D]THIAZOL-2-YL)HYDRAZONE
CAS:327082-98-4
Formula: C20H17IN4S
KIN03497367
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-(DIPHENYLMETHYLENE)HYDRAZONE
CAS:380207-80-7
Formula: C26H22IN3
KIN03548252
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[2,6-DINITRO-4-(TRIFLUOROMETHYL)PHENYL]HYDRAZONE
CAS:384840-62-4
Formula: C20H15F3IN5O4
KIN03552801
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL]HYDRAZONE
CAS:385772-22-5
Formula: C20H16ClF3IN3
KIN03553323
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[2-NITRO-4-(PYRROLIDINE-1-YLSULFONYL)PHENYL]HYDRAZONE
CAS:385445-55-6
Formula: C23H24IN5O4S
KIN03553305
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[2-NITRO-4-(TRIFLUOROMETHYL)PHENYL]HYDRAZONE
CAS:473429-31-1
Formula: C20H16F3IN4O2
KIN03600019
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[3-CHLORO-5-(TRIFLUOROMETHYL)-PYRIDIN-2-YL]HYDRAZONE
CAS:402918-18-7
Formula: C19H15ClF3IN4
KIN03563978
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[4-(MORPHOLIN-4-YLSULFONYL)-2-NITROPHENYL]HYDRAZONE
CAS:390415-39-1
Formula: C23H24IN5O5S
KIN03555961
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-[5-(TRIFLUOROMETHYL)-PYRIDIN-2-YL]HYDRAZONE
CAS:327103-11-7
Formula: C19H16F3IN4
KIN03497483
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-FORMYLHYDRAZONE
CAS:454234-03-8
Formula: C14H14IN3O
KIN03593263
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE 2-PHENYLHYDRAZONE
CAS:387386-28-9
Formula: C19H18IN3
KIN03554182
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE OXIME
CAS:348576-86-3
Formula: C13H13IN2O
KIN03524843
1-(4-IODO-PHENYL)-2,5-DIMETHYL-1H-PYRROLE
CAS:288608-09-3
Formula: C12H12IN
KIN03470333
1-(4-IODO-PHENYL)-2,5-PYRROLIDINEDIONE
CAS:94590-85-9
Formula: C10H8INO2
KIN02783199
1-(4-IODO-PHENYL)-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:130523-92-1
KIN03679960
1-(4-IODO-PHENYL)-2,6-DIMETHYL-4(1H)-PYRIDINONE
CAS:325742-92-5
Formula: C13H12INO
KIN03495425
1-(4-IODO-PHENYL)-2,6-PIPERIDINEDIONE
CAS:200706-81-6
Formula: C11H10INO2
KIN03407935
1-(4-IODO-PHENYL)-2-(1,3,4-THIADIAZOL-2-YLTHIO)ETHANONE
CAS:1099238-61-5
KIN05163959
1-(4-IODO-PHENYL)-2-(1-METHYL-3,4-DIHYDRO-2H-QUINOLIN-1-IUM-1-YL)ETHANONE
CAS:6267-58-9
Formula: C18H24ClN
KIN01154059
1-(4-IODO-PHENYL)-2-(1-METHYLETHOXY)ETHANONE
CAS:1158038-04-0
Formula: C11H13IO2
KIN05252042
1-(4-IODO-PHENYL)-2-(1-OXO-PROPOXY)ETHANONE
CAS:92287-21-3
Formula: C11H11IO3
KIN02755066
1-(4-IODO-PHENYL)-2-(2,2,2-TRIFLUORO-ETHOXY)ETHANONE
CAS:1157998-89-4
Formula: C10H8F3IO2
KIN05251737
1-(4-IODO-PHENYL)-2-(2,3,5-TRIMETHYLPHENOXY)ETHANONE
CAS:1156293-59-2
Formula: C17H17IO2
KIN05232484
1-(4-IODO-PHENYL)-2-(2,3,6-TRIMETHYLPHENOXY)ETHANONE
CAS:1157149-09-1
Formula: C17H17IO2
KIN05243975
1-(4-IODO-PHENYL)-2-(2-METHOXY-4-METHYLPHENOXY)ETHANONE
CAS:1152608-36-0
Formula: C16H15IO3
KIN05200399
1-(4-IODO-PHENYL)-2-(2-METHOXY-PHENOXY)ETHANONE
CAS:1152628-80-2
Formula: C15H13IO3
KIN05200647
1-(4-IODO-PHENYL)-2-(2-METHOXYETHOXY)ETHANONE
CAS:1157990-56-1
Formula: C11H13IO3
KIN05251639
1-(4-IODO-PHENYL)-2-(2-METHYL-1H-IMIDAZOL-1-YL)ETHANONE
CAS:1157984-85-4
Formula: C12H11IN2O
KIN05251578
1-(4-IODO-PHENYL)-2-(2-METHYL-3-NITROPHENOXY)ETHANONE
CAS:1179662-46-4
Formula: C15H12INO4
KIN05286208
1-(4-IODO-PHENYL)-2-(2-METHYL-5-NITROPHENOXY)ETHANONE
CAS:1178323-18-6
Formula: C15H12INO4
KIN05275581
1-(4-IODO-PHENYL)-2-(2-METHYL-PIPERIDIN-1-YL)ETHANONE
CAS:1152621-02-7
Formula: C14H18INO
KIN05200534
1-(4-IODO-PHENYL)-2-(2-METHYLMORPHOLIN-4-YL)ETHANONE
CAS:1157737-08-0
Formula: C13H16INO2
KIN05249766
1-(4-IODO-PHENYL)-2-(2-METHYLPHENOXY)ETHANONE
CAS:1152613-48-3
Formula: C15H13IO2
KIN05200448
1-(4-IODO-PHENYL)-2-(2-METHYLPROPOXY)ETHANONE
CAS:1158042-20-6
Formula: C12H15IO2
KIN05252098
1-(4-IODO-PHENYL)-2-(2-METHYLPYRROLIDIN-1-YL)ETHANONE
CAS:1183963-70-3
Formula: C13H16INO
KIN05309764
1-(4-IODO-PHENYL)-2-(2-NITROPHENOXY)ETHANONE
CAS:1099223-89-8
KIN05163950
1-(4-IODO-PHENYL)-2-(2-PHENOXYETHOXY)ETHANONE
CAS:1157999-04-6
Formula: C16H15IO3
KIN05251738
1-(4-IODO-PHENYL)-2-(2-PHENYLETHOXY)ETHANONE
CAS:1157218-30-8
Formula: C16H15IO2
KIN05244617
1-(4-IODO-PHENYL)-2-(2-PROPOXY-PHENOXY)ETHANONE
CAS:1156293-97-8
Formula: C17H17IO3
KIN05232494
1-(4-IODO-PHENYL)-2-(3-METHOXY-PHENOXY)ETHANONE
CAS:1152848-65-1
Formula: C15H13IO3
KIN05201944
1-(4-IODO-PHENYL)-2-(3-METHOXY-PHENYL)ETHANONE
CAS:1097147-43-7
Formula: C14H9F3O2
KIN05159885
1-(4-IODO-PHENYL)-2-(3-METHOXY-PROPOXY)ETHANONE
CAS:1183070-60-1
Formula: C12H15IO3
KIN05300133
1-(4-IODO-PHENYL)-2-(3-METHYL-2(3H)-BENZO[D]THIAZOLYLIDENE)ETHANONE
CAS:301356-67-2
Formula: C16H12INOS
KIN03477432
1-(4-IODO-PHENYL)-2-(3-METHYL-2-NITROPHENOXY)ETHANONE
CAS:1179148-93-6
Formula: C15H12INO4
KIN05282708
1-(4-IODO-PHENYL)-2-(3-METHYL-4-NITROPHENOXY)ETHANONE
CAS:1178479-71-4
Formula: C15H12INO4
KIN05277328
1-(4-IODO-PHENYL)-2-(3-METHYL-PIPERIDIN-1-YL)ETHANONE
CAS:1152854-61-9
Formula: C14H18INO
KIN05202052
1-(4-IODO-PHENYL)-2-(3-METHYLBUTOXY)ETHANONE
CAS:1158039-54-3
Formula: C13H17IO2
KIN05252071
1-(4-IODO-PHENYL)-2-(3-METHYLMORPHOLIN-4-YL)ETHANONE
CAS:1157844-51-3
Formula: C13H16INO2
KIN05250649
1-(4-IODO-PHENYL)-2-(3-METHYLPHENOXY)ETHANONE
CAS:1152628-73-3
Formula: C15H13IO2
KIN05200645
1-(4-IODO-PHENYL)-2-(3-NITROPHENOXY)ETHANONE
CAS:1099223-91-2
KIN05163951
1-(4-IODO-PHENYL)-2-(4,5,6,7-TETRAHYDRO-2-IMINO-3(2H)-BENZO[D]THIAZOLYL)ETHANONE HBR
CAS:470687-71-9
Formula: C15H15IN2OS.BrH
KIN03599194
1-(4-IODO-PHENYL)-2-(4-METHOXY-PHENOXY)ETHANONE
CAS:1152849-02-9
Formula: C15H13IO3
KIN05201954
1-(4-IODO-PHENYL)-2-(4-METHOXY-PHENYL)ETHANONE
CAS:1096920-35-2
KIN05157820
1-(4-IODO-PHENYL)-2-(4-METHOXY-PIPERIDINE-1-YL)ETHANONE
CAS:1158014-19-7
Formula: C14H18INO2
KIN05251888
1-(4-IODO-PHENYL)-2-(4-METHYL-1H-PYRAZOL-1-YL)ETHANONE
CAS:1183539-04-9
Formula: C12H11IN2O
KIN05305220
1-(4-IODO-PHENYL)-2-(4-METHYL-PIPERAZIN-1-YL)ETHANONE
CAS:1152850-61-7
Formula: C13H17IN2O
KIN05201980
1-(4-IODO-PHENYL)-2-(4-METHYL-PIPERIDIN-1-YL)ETHANONE
CAS:1152960-81-0
Formula: C14H18INO
KIN05203192
1-(4-IODO-PHENYL)-2-(4-METHYL-THIAZOL-3-IUM-3-YL)ETHANONE, BROMIDE
CAS:7248-92-2
Formula: C13H11INO.Br
KIN01182722
1-(4-IODO-PHENYL)-2-(4-METHYLPHENOXY)ETHANONE
CAS:1152848-85-5
Formula: C15H13IO2
KIN05201950
1-(4-IODO-PHENYL)-2-(4-METHYLPHENYL)-DIAZENE
CAS:120567-90-0
KIN03165047
1-(4-IODO-PHENYL)-2-(4-NITROPHENOXY)ETHANONE
CAS:1099223-85-4
KIN05163949
1-(4-IODO-PHENYL)-2-(4-NITROPHENYL)DIAZENE
CAS:29808-88-6
Formula: C12H8IN3O2
KIN02176804
1-(4-IODO-PHENYL)-2-(4-PROPOXY-PHENOXY)ETHANONE
CAS:1152628-02-8
Formula: C17H17IO3
KIN05200626
1-(4-IODO-PHENYL)-2-(4-PROPYLPIPERAZINE-1-YL)ETHANONE
CAS:1152873-46-5
Formula: C15H21IN2O
KIN05202362
1-(4-IODO-PHENYL)-2-(4-QUINAZOLINYLAMINO)ETHANONE HBR
CAS:95862-57-0
Formula: C16H12IN3O.BrH
KIN02795856
1-(4-IODO-PHENYL)-2-(4-QUINAZOLINYLTHIO)ETHANONE
CAS:1178625-06-3
Formula: C16H11IN2OS
KIN05278033
1-(4-IODO-PHENYL)-2-(5-METHYL-2-NITROPHENOXY)ETHANONE
CAS:1099335-88-2
KIN05164030
1-(4-IODO-PHENYL)-2-(7-METHYL-[1,3]DIOXOLO[4,5-F]BENZO[D]THIAZOL-6(7H)-YLIDENE)ETHANONE
CAS:345616-66-2
Formula: C17H12INO3S
KIN03521786
1-(4-IODO-PHENYL)-2-(BENZYLTHIO)ETHANONE
CAS:1157363-23-9
Formula: C15H13IOS
KIN05245813
1-(4-IODO-PHENYL)-2-(METHYLPENTYLAMINO)ETHANONE
CAS:1157840-98-6
Formula: C14H20INO
KIN05250627
1-(4-IODO-PHENYL)-2-(METHYLTHIO)ETHANONE
CAS:1179822-13-9
Formula: C9H9IOS
KIN05287716
1-(4-IODO-PHENYL)-2-(NAPHTHALEN-1-YLOXY)ETHANONE
CAS:1152628-91-5
Formula: C18H13IO2
KIN05200648
1-(4-IODO-PHENYL)-2-(NAPHTHALEN-2-YLOXY)ETHANONE
CAS:1152608-22-4
Formula: C18H13IO2
KIN05200395
1-(4-IODO-PHENYL)-2-(NAPHTHALEN-2-YLTHIO)ETHANONE
CAS:1152848-46-8
Formula: C18H13IOS
KIN05201938
1-(4-IODO-PHENYL)-2-(OCTYLOXY)ETHANONE
CAS:1157249-66-5
Formula: C16H23IO2;C16H23IO2
KIN05244909
1-(4-IODO-PHENYL)-2-(PENTYLOXY)ETHANONE
CAS:1157250-81-1
Formula: C13H17IO2
KIN05244925
1-(4-IODO-PHENYL)-2-(PIPERIDIN-1-YL)ETHANONE
CAS:1152947-81-3
Formula: C13H16INO
KIN05203048
1-(4-IODO-PHENYL)-2-(PROPYLTHIO)ETHANONE
CAS:1157363-24-0
Formula: C11H13IOS
KIN05245814
1-(4-IODO-PHENYL)-2-(PYRIDIN-2-YL)ETHANONE
CAS:1039889-42-3
Formula: C13H10INO
KIN05081532
1-(4-IODO-PHENYL)-2-(PYRIDINE-2-YLTHIO)ETHANONE
CAS:1153116-34-7
Formula: C13H10INOS
KIN05205498
1-(4-IODO-PHENYL)-2-(PYRIMIDINE-2-YLTHIO)ETHANONE
CAS:1152612-83-3
Formula: C12H9IN2OS
KIN05200437
1-(4-IODO-PHENYL)-2-(QUINOLIN-2-YL)ETHANONE
CAS:1038735-36-2
KIN05077874
1-(4-IODO-PHENYL)-2-(QUINOLIN-8-YLOXY)ETHANONE
CAS:1152613-18-7
Formula: C17H12INO2
KIN05200444
1-(4-IODO-PHENYL)-2-(THIOPHEN-2-YL)ETHANONE
CAS:1184353-63-6
Formula: C12H9IOS
KIN05313229
1-(4-IODO-PHENYL)-2-(THIOPHEN-2-YLTHIO)ETHANONE
CAS:1157149-74-0
Formula: C12H9IOS2
KIN05243986
1-(4-IODO-PHENYL)-2-(THIOPHEN-3-YL)ETHANONE
CAS:1183230-65-0
Formula: C12H9IOS
KIN05301924
1-(4-IODO-PHENYL)-2-[(1-METHYL-1H-IMIDAZOL-2-YL)THIO]-ETHANONE
CAS:312927-89-2
Formula: C12H11IN2OS
KIN03487082
1-(4-IODO-PHENYL)-2-[(1-METHYL-HEPTYLOXY)]-ETHANONE
CAS:1157134-67-2
Formula: C16H23IO2
KIN05243743
1-(4-IODO-PHENYL)-2-[(1-METHYLETHYL)THIO]-ETHANONE
CAS:1182904-44-4
Formula: C11H13IOS
KIN05298284
1-(4-IODO-PHENYL)-2-[(1-METHYLPROPYL)THIO]-ETHANONE
CAS:1152848-56-0
Formula: C12H15IOS
KIN05201942
1-(4-IODO-PHENYL)-2-[(2-METHOXYETHYL)THIO]-ETHANONE
CAS:1157150-12-3
Formula: C11H13IO2S
KIN05243990
1-(4-IODO-PHENYL)-2-[(2-METHYL-CYCLOHEXYLOXY)]-ETHANONE
CAS:1157991-98-4
Formula: C15H19IO2
KIN05251659
1-(4-IODO-PHENYL)-2-[(2-METHYLPROPYL)THIO]-ETHANONE
CAS:1152848-78-6
Formula: C12H15IOS
KIN05201948
1-(4-IODO-PHENYL)-2-[(2-NITROPHENYL)THIO]-ETHANONE
CAS:1157303-49-5
Formula: C14H10INO3S
KIN05245286
1-(4-IODO-PHENYL)-2-[(2-NITROPYRIDINE-3-YLOXY)]-ETHANONE
CAS:1099238-13-7
KIN05163957
1-(4-IODO-PHENYL)-2-[(3-METHOXY-PHENYL)THIO]-ETHANONE
CAS:1156766-49-2
Formula: C15H13IO2S
KIN05238196
1-(4-IODO-PHENYL)-2-[(3-METHYL-CYCLOHEXYLOXY)]-ETHANONE
CAS:1157247-94-3
Formula: C15H19IO2
KIN05244877
1-(4-IODO-PHENYL)-2-[(4-METHOXY-PHENYL)THIO]-ETHANONE
CAS:1152609-35-2
Formula: C15H13IO2S
KIN05200412
1-(4-IODO-PHENYL)-2-[(4-METHYL-CYCLOHEXYLOXY)]-ETHANONE
CAS:1158037-02-5
Formula: C15H19IO2
KIN05252028
1-(4-IODO-PHENYL)-2-[(4-METHYL-THIAZOL-2-YL)THIO]-ETHANONE
CAS:1152888-39-5
Formula: C12H10INOS2
KIN05202586
1-(4-IODO-PHENYL)-2-[(4-METHYLPENTYLOXY)]-ETHANONE
CAS:1157190-51-6
Formula: C14H19IO2
KIN05244387
1-(4-IODO-PHENYL)-2-[(4-METHYLPHENYL)THIO]-ETHANONE
CAS:1153116-02-9
Formula: C15H13IOS
KIN05205497
1-(4-IODO-PHENYL)-2-[(4-NITROPHENYL)THIO]-ETHANONE
CAS:1157309-05-1
Formula: C14H10INO3S
KIN05245333
1-(4-IODO-PHENYL)-2-[[4-PROPAN-2-YLPHENYL]THIO]-ETHANONE
CAS:1154573-50-8
Formula: C17H17IOS
KIN05218164
1-(4-IODO-PHENYL)-2-[2-(1-METHYLETHOXY)ETHOXY]-ETHANONE
CAS:1157132-03-0
Formula: C13H17IO3
KIN05243728
1-(4-IODO-PHENYL)-2-[2-(1-METHYLPROPYL)-PHENOXY]-ETHANONE
CAS:1152608-32-6
Formula: C18H19IO2
KIN05200397
1-(4-IODO-PHENYL)-2-[2-(TRIFLUOROMETHYL)-PHENOXY]-ETHANONE
CAS:1152641-07-0
Formula: C15H10F3IO2
KIN05200762
1-(4-IODO-PHENYL)-2-[2-PROPAN-2-YLPHENOXY]-ETHANONE
CAS:1152849-13-2
Formula: C17H17IO2
KIN05201958
1-(4-IODO-PHENYL)-2-[3-(METHYLSULFONYL)-PHENOXY]-ETHANONE
CAS:1156122-75-6
Formula: C15H13IO4S
KIN05229790
1-(4-IODO-PHENYL)-2-[3-METHYL-4-PROPAN-2-YLPHENOXY]-ETHANONE
CAS:1152628-35-7
Formula: C18H19IO2
KIN05200636
1-(4-IODO-PHENYL)-2-[3-PROPAN-2-YLPHENOXY]-ETHANONE
CAS:1152628-29-9
Formula: C17H17IO2
KIN05200634
1-(4-IODO-PHENYL)-2-[4-(2-METHOXYETHYL)-PHENOXY]-ETHANONE
CAS:1152888-35-1
Formula: C17H17IO3
KIN05202585
1-(4-IODO-PHENYL)-2-[4-(METHYLSULFONYL)-PHENOXY]-ETHANONE
CAS:1152955-66-2
Formula: C15H13IO4S
KIN05203130
1-(4-IODO-PHENYL)-2-[4-[(BENZYL)IMINO]-1(4H)-PYRIDINYL]-ETHANONE HBR
CAS:444987-51-3
Formula: C20H17IN2O.BrH
KIN03587193
1-(4-IODO-PHENYL)-2-[4-PROPAN-2-YLPHENOXY]-ETHANONE
CAS:1152612-67-3
Formula: C17H17IO2
KIN05200435
1-(4-IODO-PHENYL)-2-[4-PROPAN-2-YLPIPERAZINE-1-YL]-ETHANONE
CAS:1157829-66-7
Formula: C15H21IN2O
KIN05250521
1-(4-IODO-PHENYL)-2-[5-METHYL-2-PROPAN-2-YLPHENOXY]-ETHANONE
CAS:1152612-75-3
Formula: C18H19IO2
KIN05200436
1-(4-IODO-PHENYL)-2-[METHYL-(BENZYL)AMINO]-ETHANONE HCL
CAS:5402-84-6
Formula: C16H20ClNO
KIN01128875
1-(4-IODO-PHENYL)-2-AZETIDINONE
CAS:7661-29-2
Formula: C10H11NO2
KIN01192948
1-(4-IODO-PHENYL)-2-METHOXY-ETHANONE
CAS:1054480-39-5
Formula: C9H9IO2
KIN05101821
1-(4-IODO-PHENYL)-2-METHYL-1-BUTANONE
CAS:1094374-75-0
Formula: C11H13IO
KIN05139906
1-(4-IODO-PHENYL)-2-METHYL-1-PENTANONE
CAS:1094313-02-6
Formula: C12H15IO
KIN05138622
1-(4-IODO-PHENYL)-2-METHYL-1-PROPANONE
CAS:99059-63-9
Formula: C10H11IO
KIN02817600
Propiophenone, 4'-iodo-2-methyl-; 1-(4-iodo-ph
1-(4-IODO-PHENYL)-2-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:122957-30-6
KIN03177523
1-(4-IODO-PHENYL)-2-METHYL-1H-IMIDAZO[4,5-C]PYRIDINE
CAS:167694-22-6
KIN03669603
1-(4-IODO-PHENYL)-2-METHYL-1H-IMIDAZOLE
CAS:179420-75-8
Formula: C10H9IN2
KIN03367106
1-(4-IODO-PHENYL)-2-METHYL-1H-PYRROLE
CAS:179421-11-5
KIN03367115
1-(4-IODO-PHENYL)-2-METHYL-2-PROPEN-1-ONE
CAS:84598-15-2
Formula: C10H9IO
KIN02668628
1-(4-iodo-phenyl)-2-methyl-2-propen-1-one
1-(4-IODO-PHENYL)-2-METHYL-5-PHENYL-1H-PYRROLE
CAS:26165-83-3
KIN02145982
1-(4-IODO-PHENYL)-2-MORPHOLIN-4-YLETHANONE
CAS:1152855-98-5
Formula: C12H14INO2
KIN05202070
1-(4-IODO-PHENYL)-2-OXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:1037156-40-3
Formula: C11H10INO3
KIN05073661
1-(4-IODO-PHENYL)-2-PHENOXY-ETHANONE
CAS:1152613-54-1
Formula: C14H11IO2
KIN05200449
1-(4-IODO-PHENYL)-2-PHENYL-1-BUTANONE
CAS:219901-56-1
Formula: C16H15IO
KIN03432507
1-(4-IODO-PHENYL)-2-PHENYL-AZIRIDINE
CAS:64222-61-3
Formula: C14H12IN
KIN02506338
1-(4-iodo-phenyl)-2-phenyl-aziridine
1-(4-IODO-PHENYL)-2-PHENYL-DIAZENE 1-OXIDE
CAS:85572-14-1
Formula: C12H9IN2O
KIN02675153
1-(4-IODO-PHENYL)-2-PHENYL-DIAZENE 2-OXIDE
CAS:81710-98-7
Formula: C12H9IN2O
KIN02651265
1-(4-IODO-PHENYL)-2-PHENYLHYDRAZINE
CAS:137720-86-6
KIN03243023
1-(4-IODO-PHENYL)-2-PIPERIDIN-1-YLETHANOL HCL
CAS:6267-54-5
Formula: C17H12ClINO.Br
KIN01154055
1-(4-IODO-PHENYL)-2-PROPANONE
CAS:21906-36-5
Formula: C9H9IO
KIN02105377
MFCD03410480
1-(4-IODO-PHENYL)-2-PROPEN-1-ONE
CAS:83482-36-4
Formula: C9H7IO
KIN02661355
1-(4-iodo-phenyl)-2-propen-1-one
1-(4-IODO-PHENYL)-2-PROPOXY-ETHANONE
CAS:1157249-01-8
Formula: C11H13IO2
KIN05244892
1-(4-IODO-PHENYL)-2-PROPYN-1-ONE
CAS:54012-25-8
KIN02343790
1-(4-IODO-PHENYL)-3,3-DIMETHYL-1-BUTANONE
CAS:1094416-81-5
Formula: C12H15IO
KIN05140685
1-(4-IODO-PHENYL)-3,3-DIMETHYL-1-TRIAZENE
CAS:23456-93-1
Formula: C8H10IN3
KIN02120126
1-(4-IODO-PHENYL)-3,3-DIMETHYL-2-AZETIDINONE
CAS:339100-84-4
Formula: C11H12INO
KIN03512105
1-(4-IODO-PHENYL)-3,3-DIPROPYL-1-TRIAZENE
CAS:1173821-45-8
Formula: C12H18IN3
KIN05265086
1-(4-IODO-PHENYL)-3,4-DIMETHYL-1H-PYRROL-2,5-DIONE
CAS:89068-57-5
Formula: C12H10INO2
KIN02706632
1-(4-iodo-phenyl)-3,4-dimethyl-1H-pyrrol-2,5-dione
1-(4-IODO-PHENYL)-3,4-DIMETHYLPYRANO[2,3-C]PYRAZOL-6(1H)-ONE
CAS:329714-18-3
Formula: C14H11IN2O2
KIN03500606
1-(4-IODO-PHENYL)-3,5,5-TRIMETHYL-1-HEXANONE
CAS:1094313-05-9
Formula: C15H21IO
KIN05138623
1-(4-IODO-PHENYL)-3,5-DIMETHYL-1H-PYRAZOL-4-ETHANOL
CAS:1000705-79-2
Formula: C13H15IN2O
KIN05004646
1-(4-IODO-PHENYL)-3,5-DIMETHYL-1H-PYRAZOLE
CAS:179421-17-1
Formula: C11H11IN2
KIN03367118
1-(4-IODO-PHENYL)-3,5-DIMETHYL-4-(3-NITROPHENYL)-1H-PYRAZOLE
CAS:354577-03-0
Formula: C17H14IN3O2
KIN03531777
1-(4-IODO-PHENYL)-3,5-DIMETHYL-4-NITROSO-1H-PYRAZOLE
CAS:1071549-72-8
Formula: C11H10IN3O
KIN05112791
1-(4-IODO-PHENYL)-3,5-DINITRO-4(1H)-PYRIDINONE
CAS:74197-57-2
Formula: C11H6IN3O5
KIN02604009
1-(4-iodo-phenyl)-3,5-dinitro-4(1H)-pyridinone
1-(4-IODO-PHENYL)-3,5-DIPHENYL-2-PENTENE-1,5-DIONE
CAS:91232-62-1
Formula: C23H17IO2
KIN02740627
1-(4-iodo-phenyl)-3,5-diphenyl-2-pentene-1,5-dione
1-(4-IODO-PHENYL)-3,5-PYRAZOLIDINEDIONE
CAS:331464-78-9
Formula: C9H7IN2O2
KIN03503514
1-(4-IODO-PHENYL)-3-(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)-2-PROPEN-1-ONE
CAS:494791-29-6
Formula: C15H15IN2O
KIN03613821
1-(4-IODO-PHENYL)-3-(1-ADAMANTYL)GUANIDINE
CAS:133985-85-0
Formula: [C17H22IN3
KIN03226211
1-(4-IODO-PHENYL)-3-(1-METHYL-1H-PYRROL-2-YL)-2,5-PYRROLIDINEDIONE
CAS:402514-84-5
Formula: C15H13IN2O2
KIN03563367
1-(4-IODO-PHENYL)-3-(1-PHENYLETHYL)-2,5-PYRROLIDINEDIONE
CAS:312718-70-0
Formula: C18H16INO2
KIN03486800
1-(4-IODO-PHENYL)-3-(1H-[1,2,4]-TRIAZOL-5-YLTHIO)-2,5-PYRROLIDINEDIONE
CAS:372505-21-0
Formula: C12H9IN4O2S
KIN03543976
1-(4-IODO-PHENYL)-3-(1H-PYRROL-2-YL)-2-PROPEN-1-ONE
CAS:328035-02-5
Formula: C13H10INO
KIN03498082
1-(4-IODO-PHENYL)-3-(2,3,4-TRIMETHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:499182-95-5
Formula: C18H17IO4
KIN03617247
1-(4-IODO-PHENYL)-3-(2,4,5-TRIMETHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:499182-93-3
Formula: C18H17IO4
KIN03617245
1-(4-IODO-PHENYL)-3-(2-METHYL-4-NITROPHENYL)-1-TRIAZENE
CAS:300403-82-1
Formula: C13H11IN4O2
KIN03635698
1-(4-IODO-PHENYL)-3-(3,4,5-TRIMETHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:499182-94-4
Formula: C18H17IO4
KIN03617246
1-(4-IODO-PHENYL)-3-(3-METHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:499182-91-1
Formula: C16H13IO2
KIN03617244
1-(4-IODO-PHENYL)-3-(3-NITROPHENYL)-1-TRIAZENE
CAS:412959-03-6
Formula: C12H9IN4O2
KIN03571137
1-(4-IODO-PHENYL)-3-(3-NITROPHENYL)-2-PROPEN-1-ONE
CAS:331249-30-0
Formula: C15H10INO3
KIN03503116
1-(4-IODO-PHENYL)-3-(4-METHOXY-2-NITROPHENYL)-1-TRIAZENE
CAS:412960-21-5
Formula: C13H11IN4O3
KIN03571148
1-(4-IODO-PHENYL)-3-(4-METHOXY-3-NITROPHENYL)-2-PROPEN-1-ONE
CAS:312286-22-9
Formula: C16H12INO4
KIN03485880
1-(4-IODO-PHENYL)-3-(4-METHOXY-PHENYL)-1-PROPANONE
CAS:1097147-41-5
Formula: C17H17FO2
KIN05159881
1-(4-IODO-PHENYL)-3-(4-METHOXY-PHENYL)UREA
CAS:5214-50-6
KIN01122992
1-(4-IODO-PHENYL)-3-(4-METHYL-PIPERAZIN-1-YL)-2,5-PYRROLIDINEDIONE
CAS:331966-67-7
Formula: C15H18IN3O2
KIN03504533
1-(4-IODO-PHENYL)-3-(4-METHYL-PIPERIDIN-1-YL)-2,5-PYRROLIDINEDIONE
CAS:312281-52-0
Formula: C16H19IN2O2
KIN03485863
1-(4-IODO-PHENYL)-3-(4-METHYLPHENYL)-1-TRIAZENE
CAS:64190-75-6
Formula: C13H12IN3
KIN02505821
1-(4-iodo-phenyl)-3-(4-methylphenyl)-1-triazene
1-(4-IODO-PHENYL)-3-(4-NITROPHENYL)-2-PROPEN-1-ONE
CAS:148703-66-6
Formula: C15H10INO3
KIN03290170
1-(4-IODO-PHENYL)-3-(4-PHENYL-PIPERAZIN-1-YL)-2,5-PYRROLIDINEDIONE
CAS:331966-62-2
Formula: C20H20IN3O2
KIN03504528
1-(4-IODO-PHENYL)-3-(4-THIOMORPHOLINYL)-2,5-PYRROLIDINEDIONE
CAS:314038-49-8
Formula: C14H15IN2O2S
KIN03489144
1-(4-IODO-PHENYL)-3-(BENZYL)-2,5-PYRROLIDINEDIONE
CAS:340818-62-4
Formula: C17H14INO2
KIN03514621
1-(4-IODO-PHENYL)-3-(METHYLAMINO)-1-PROPANONE
CAS:133640-05-8
KIN03224683
1-(4-IODO-PHENYL)-3-(TETRAHYDROFURAN-2-YL)-2,5-PYRROLIDINEDIONE
CAS:337496-74-9
Formula: C14H14INO3
KIN03509892
1-(4-IODO-PHENYL)-3-(THIOPHEN-2-YL)-2-PROPEN-1-ONE
CAS:133838-45-6
KIN03009121
1-(4-IODO-PHENYL)-3-(THIOPHEN-2-YL)-2-PROPYN-1-ONE
CAS:1097966-35-2
Formula: C13H7IOS
KIN05161952
1-(4-IODO-PHENYL)-3-[(1-METHYLETHYL)AMINO]-1-PROPANONE
CAS:133640-07-0
KIN03647007
1-(4-IODO-PHENYL)-3-[(1-METHYLETHYL)THIO]-2,5-PYRROLIDINEDIONE
CAS:406176-90-7
Formula: C13H14INO2S
KIN03566942
1-(4-IODO-PHENYL)-3-[(2-METHOXY-PHENYL)METHYL]-2,5-PYRROLIDINEDIONE
CAS:312718-55-1
Formula: C18H16INO3
KIN03486798
1-(4-IODO-PHENYL)-3-[(2-PHENYLETHYL)AMINO]-2,5-PYRROLIDINEDIONE
CAS:472981-03-6
Formula: C18H17IN2O2
KIN03599751
1-(4-IODO-PHENYL)-3-[(4-METHOXY-PHENYL)AMINO]-2,5-PYRROLIDINEDIONE
CAS:345951-15-7
Formula: C17H15IN2O3
KIN03522128
1-(4-IODO-PHENYL)-3-[(4-METHOXY-PHENYL)METHYL]-2,5-PYRROLIDINEDIONE
CAS:340826-70-2
Formula: C18H16INO3
KIN03514652
1-(4-IODO-PHENYL)-3-[(4-METHYLPHENYL)METHYL]-2,5-PYRROLIDINEDIONE
CAS:332063-30-6
Formula: C18H16INO2
KIN03505222
1-(4-IODO-PHENYL)-3-[(4-METHYLPHENYL)THIO]-2,5-PYRROLIDINEDIONE
CAS:306732-15-0
Formula: C17H14INO2S
KIN03482412
1-(4-IODO-PHENYL)-3-[(4-METHYLPYRIMIDIN-2-YL)THIO]-2-PROPEN-1-ONE
CAS:277325-94-7
Formula: C14H11IN2OS
KIN03465811
1-(4-IODO-PHENYL)-3-[(5-METHYL-1,3,4-THIADIAZOL-2-YL)THIO]-2,5-PYRROLIDINEDIONE
CAS:374096-06-7
Formula: C13H10IN3O2S2
KIN03544503
1-(4-IODO-PHENYL)-3-[(BENZYL)AMINO]-2,5-PYRROLIDINEDIONE
CAS:1009417-93-9
KIN05016556
1-(4-IODO-PHENYL)-3-[(PYRIDIN-4-YLMETHYL)AMINO]-2,5-PYRROLIDINEDIONE
CAS:473268-45-0
Formula: C16H14IN3O2
KIN03599905
1-(4-IODO-PHENYL)-3-[[(4-METHOXY-PHENYL)METHYL]AMINO]-2,5-PYRROLIDINEDIONE
CAS:472980-25-9
Formula: C18H17IN2O3
KIN03599746
1-(4-IODO-PHENYL)-3-[[2-(2-METHYL-1H-INDOL-3-YL)-ACETYL]AMINO]THIOUREA
CAS:54648-95-2
Formula: C18H17IN4OS
KIN02353303
1-(4-IODO-PHENYL)-3-[[2-(4-METHOXY-PHENYL)ETHYL]AMINO]-2,5-PYRROLIDINEDIONE
CAS:471914-90-6
Formula: C19H19IN2O3
KIN03599618
1-(4-IODO-PHENYL)-3-[4-(2-METHOXY-PHENYL)PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:331966-65-5
Formula: C21H22IN3O3
KIN03504531
1-(4-IODO-PHENYL)-3-[4-(3-PHENYL-ALLYL)PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:331966-63-3
Formula: C23H24IN3O2
KIN03504529
1-(4-IODO-PHENYL)-3-[4-(BENZYL)PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:311800-75-6
Formula: C21H22IN3O2
KIN03485711
1-(4-IODO-PHENYL)-3-[4-(PYRIMIDIN-2-YL)PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:352219-18-2
Formula: C18H18IN5O2
KIN03529602
1-(4-IODO-PHENYL)-3-[4-[3-(TRIFLUOROMETHYL)PHENYL]PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:331966-60-0
Formula: C21H19F3IN3O2
KIN03504526
1-(4-IODO-PHENYL)-3-[4-METHOXY-3-[(2,4,6-TRICHLOROPHENOXY)METHYL]PHENYL]-2-PROPEN-1-ONE
CAS:499183-42-5
Formula: C23H16Cl3IO3
KIN03617255
1-(4-IODO-PHENYL)-3-[4-PYRIDIN-2-YL-PIPERAZIN-1-YL]-2,5-PYRROLIDINEDIONE
CAS:331966-61-1
Formula: C19H19IN4O2
KIN03504527
1-(4-IODO-PHENYL)-3-[METHYL(BENZYL)AMINO]-2,5-PYRROLIDINEDIONE
CAS:339989-50-3
Formula: C18H17IN2O2
KIN03513621
1-(4-IODO-PHENYL)-3-METHYL-1-BUTANONE
CAS:1094416-88-2
Formula: C11H13IO
KIN05140692
1-(4-IODO-PHENYL)-3-METHYL-1H-PYRAZOL-5-OL
CAS:482279-18-5
Formula: C10H9IN2O
KIN03608957
1-(4-IODO-PHENYL)-3-METHYL-2-PHENYL-1-PENTANONE
CAS:1097147-42-6
Formula: C14H9BrF2O2
KIN05159883
1-(4-IODO-PHENYL)-3-METHYL-4-[(4-METHYLPHENYL)METHYL]-2,5-PYRROLIDINEDIONE
CAS:331988-48-8
Formula: C19H18INO2
KIN03504662
1-(4-IODO-PHENYL)-3-METHYL-ISOQUINOLINE
CAS:215922-56-8
KIN03428558
1-(4-IODO-PHENYL)-3-MORPHOLIN-4-YL-2,5-PYRROLIDINEDIONE
CAS:306732-13-8
Formula: C14H15IN2O3
KIN03482411
1-(4-IODO-PHENYL)-3-PHENYL-1-PROPANONE
CAS:1094374-71-6
Formula: C15H13IO
KIN05139902
1-(4-IODO-PHENYL)-3-PHENYL-2-PROPEN-1-ONE
CAS:7466-61-7
KIN01187835
1-(4-IODO-PHENYL)-3-PIPERIDIN-1-YL-2,5-PYRROLIDINEDIONE
CAS:306732-12-7
Formula: C15H17IN2O2
KIN03482410
1-(4-IODO-PHENYL)-4(1H)-PYRIDINONE
CAS:197770-43-7
KIN03403044
1-(4-IODO-PHENYL)-4-(1-METHYLCYCLOPROPYL)-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:130523-84-1
Formula: C15H17IO3
KIN03210264
1-(4-IODO-PHENYL)-4-(1-METHYLETHYLIDENE)-3,5-PYRAZOLIDINEDIONE
CAS:331667-52-8
Formula: C12H11IN2O2
KIN03503762
1-(4-IODO-PHENYL)-4-(1-METHYLPROPYL)-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:130523-75-0
Formula: C15H19IO3
KIN03210256
1-(4-IODO-PHENYL)-4-(1-METHYLPROPYLIDENE)-3,5-PYRAZOLIDINEDIONE
CAS:331667-44-8
Formula: C13H13IN2O2
KIN03503755
1-(4-IODO-PHENYL)-4-(2-METHYLPROPYL)PIPERAZINE
CAS:1014987-50-8
Formula: C14H21IN2
KIN05020425
1-(4-IODO-PHENYL)-4-(3-PHENYL-ALLYLIDENE)-3,5-PYRAZOLIDINEDIONE
CAS:331667-48-2
Formula: C18H13IN2O2
KIN03503759
1-(4-IODO-PHENYL)-4-(METHOXYMETHYL)-1H-PYRAZOLE
CAS:1000705-74-7
Formula: C11H11IN2O
KIN05004645
1-(4-IODO-PHENYL)-4-(METHYLAMINO)-1-BUTANONE
CAS:133640-09-2
KIN03224685
1-(4-IODO-PHENYL)-4-(PHENYLMETHYLENE)-3,5-PYRAZOLIDINEDIONE
CAS:331667-53-9
Formula: C16H11IN2O2
KIN03503763
1-(4-IODO-PHENYL)-4-(THIOPHEN-2-YLMETHYLENE)-3,5-PYRAZOLIDINEDIONE
CAS:337504-47-9
Formula: C14H9IN2O2S
KIN03509928
1-(4-IODO-PHENYL)-4-(TRIMETHYLSILYL)-1H-1,2,3-TRIAZOLE
CAS:1101173-98-1
Formula: C11H14IN3Si
KIN05167430
1-(4-IODO-PHENYL)-4-[(2-PROPOXY-PHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:331667-01-7
Formula: C19H17IN2O3
KIN03503727
1-(4-IODO-PHENYL)-4-[(3-IODO-PHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:331667-40-4
Formula: C16H10I2N2O2
KIN03503752
1-(4-IODO-PHENYL)-4-[(3-METHOXY-PHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:423745-69-1
Formula: C17H13IN2O3
KIN03575096
1-(4-IODO-PHENYL)-4-[(3-METHYLPHENYL)AMINO]-1,3-DIAZASPIRO[4.5]DEC-3-EN-2-THIONE
CAS:311327-18-1
Formula: C21H22IN3S
KIN03485412
1-(4-IODO-PHENYL)-4-[(4-METHOXY-3-NITROPHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:345323-26-4
Formula: C17H12IN3O5
KIN03521600
1-(4-IODO-PHENYL)-4-[(4-METHOXY-PHENYL)AMINO]-1,3-DIAZASPIRO[4.5]DEC-3-EN-2-THIONE
CAS:352223-74-6
Formula: C21H22IN3OS
KIN03529616
1-(4-IODO-PHENYL)-4-[(4-METHOXY-PHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:331667-55-1
Formula: C17H13IN2O3
KIN03503765
1-(4-IODO-PHENYL)-4-[(4-METHYLPHENYL)METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:353249-08-8
Formula: C17H13IN2O2
KIN03530648
1-(4-IODO-PHENYL)-4-[[2-(BENZYLOXY)PHENYL]METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:352651-41-3
Formula: C23H17IN2O3
KIN03530413
1-(4-IODO-PHENYL)-4-[[3-METHOXY-4-(1-OXO-PROPOXY)PHENYL]METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:328562-12-5
Formula: C20H17IN2O5
KIN03499015
1-(4-IODO-PHENYL)-4-[[3-METHOXY-4-(PROPARGYLOXY)PHENYL]METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:445411-54-1
Formula: C20H15IN2O4
KIN03587852
1-(4-IODO-PHENYL)-4-[[4-MORPHOLIN-4-YLPHENYL]METHYLENE]-3,5-PYRAZOLIDINEDIONE
CAS:331667-42-6
Formula: C20H18IN3O3
KIN03503753
1-(4-IODO-PHENYL)-4-[3-(3-NITROPHENYL)-ALLYLIDENE]-3,5-PYRAZOLIDINEDIONE
CAS:331667-30-2
Formula: C18H12IN3O4
KIN03503743
1-(4-IODO-PHENYL)-4-METHYL-1-PENTANONE
CAS:1094247-51-4
Formula: C12H15IO
KIN05137326
1-(4-IODO-PHENYL)-4-METHYL-2,6-PIPERIDINEDIONE
CAS:135475-37-5
Formula: C12H12INO2
KIN03233047
1-(4-IODO-PHENYL)-4-METHYL-PIPERAZINE
CAS:1125409-95-1
Formula: C11H15IN2
KIN05178962
1-(4-IODO-PHENYL)-4-PHENYL-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:130523-78-3
Formula: C17H15IO3
KIN03210259
1-(4-IODO-PHENYL)-4-PROPAN-2-YL-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:130523-77-2
Formula: C14H17IO3
KIN03210258
1-(4-IODO-PHENYL)-4-PROPYL-2,6,7-TRIOXA-BICYCLO[2.2.2]OCTANE
CAS:118529-02-5
Formula: C14H17IO3
KIN03154706
1-(4-IODO-PHENYL)-5,5-BIS[2-PYRIDIN-4-YLETHYL]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:346449-79-4
Formula: C24H21IN4O3
KIN03522906
1-(4-IODO-PHENYL)-5-(1H-PYRROL-2-YLMETHYLENE)-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:346450-17-7
Formula: C15H10IN3O3
KIN03522908
1-(4-IODO-PHENYL)-5-(3-METHYL-1H-PYRAZOL-4-YL)-1H-TETRAZOLE
CAS:139094-17-0
Formula: C11H9IN6
KIN03250609
1-(4-IODO-PHENYL)-5-(3-PHENYL-1H-PYRAZOL-4-YL)-1H-TETRAZOLE
CAS:139094-25-0
Formula: C16H11IN6
KIN03250610
1-(4-IODO-PHENYL)-5-(4-NITROPHENYL)-1H-TETRAZOLE
CAS:361153-22-2
Formula: C13H8IN5O2
KIN03536631
1-(4-IODO-PHENYL)-5-(4-NITROPHENYL)SPIRO[3A,6A-DIHYDRO-1H-FURO[3,4-C]PYRROL-3,2'-INDENE]-1,3,4,6-TETRONE
CAS:4525-22-8
KIN01109820
1-(4-IODO-PHENYL)-5-(5-METHYL-1-PHENYL-1H-PYRAZOL-4-YL)-1H-TETRAZOLE
CAS:139094-31-8
Formula: C17H13IN6
KIN03250611
1-(4-IODO-PHENYL)-5-[(1-METHYL-1H-INDOL-3-YL)METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:373613-59-3
Formula: C20H14IN3O3
KIN03544304
1-(4-IODO-PHENYL)-5-[(1-PHENYL-1H-PYRAZOL-4-YL)METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:429639-01-0
Formula: C20H13IN4O3
KIN03577381
1-(4-IODO-PHENYL)-5-[(2-PHENYLPYRIMIDIN-5-YL)METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:429648-52-2
Formula: C21H13IN4O3
KIN03577421
1-(4-IODO-PHENYL)-5-[(MORPHOLIN-4-YLAMINO)METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:380554-76-7
Formula: C15H15IN4O4
KIN03549099
1-(4-IODO-PHENYL)-5-[(PIPERIDIN-1-YLAMINO)METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:381712-38-5
Formula: C16H17IN4O3
KIN03550517
1-(4-IODO-PHENYL)-5-[[[1-(BENZYL)PIPERIDIN-4-YL]AMINO]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:381207-63-2
Formula: C23H23IN4O3
KIN03550130
1-(4-IODO-PHENYL)-5-[[[2-MORPHOLIN-4-YLETHYL]AMINO]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:381705-08-4
Formula: C17H19IN4O4
KIN03550483
1-(4-IODO-PHENYL)-5-[[[2-PIPERAZIN-1-YLETHYL]AMINO]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:381717-81-3
Formula: C17H20IN5O3
KIN03550550
1-(4-IODO-PHENYL)-5-[[[2-PIPERIDIN-1-YLETHYL]AMINO]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:378778-77-9
Formula: C18H21IN4O3
KIN03547398
1-(4-IODO-PHENYL)-5-[[[2-PYRIDIN-3-YL-PIPERIDIN-1-YL]AMINO]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:374764-90-6
Formula: C21H20IN5O3
KIN03545152
1-(4-IODO-PHENYL)-5-[[1-(BENZYL)-1H-INDOL-3-YL]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:372500-21-5
Formula: C26H18IN3O3
KIN03543963
1-(4-IODO-PHENYL)-5-[[2-(METHYLTHIO)-PYRIMIDIN-5-YL]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:429656-09-7
Formula: C16H11IN4O3S
KIN03577468
1-(4-IODO-PHENYL)-5-[[4-METHOXY-3-[(PYRIDIN-2-YLTHIO)METHYL]PHENYL]METHYLENE]-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE
CAS:374769-52-5
Formula: C24H18IN3O4S
KIN03545163
1-(4-IODO-PHENYL)-5-METHOXY-1-PENTANONE
CAS:168317-98-4
KIN03342740
1-(4-IODO-PHENYL)-5-METHOXY-2-METHYL-1H-INDOL-3-CARBOXYLIC ACID
CAS:325739-91-1
Formula: C17H14INO3
KIN03495408
1-(4-IODO-PHENYL)-5-METHOXY-2-METHYL-1H-INDOL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:325739-88-6
Formula: C19H18INO3
KIN03495407
1-(4-IODO-PHENYL)-5-METHYL-1H-BENZO[D]IMIDAZOL-2-AMINE
CAS:1156929-35-9
Formula: C14H12IN3
KIN05240460
1-(4-IODO-PHENYL)-5-METHYL-1H-PYRAZOL-4-CARBOXYLIC ACID
CAS:288252-16-4
Formula: C11H9IN2O2
KIN03469900
1-(4-IODO-PHENYL)-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:491874-23-8
Formula: C11H10INO3
KIN03613065
1-(4-IODO-PHENYL)-5-PHENYL-1H-1,2,3-TRIAZOLE
CAS:110684-43-0
KIN03103133
1-(4-IODO-PHENYL)-5-THIOXO-PYRROLIDINE-2-ONE
CAS:4166-09-0
Formula: C10H9NOS
KIN01102247
1-(4-IODO-PHENYL)-6-NITRO-1H-INDAZOL-3-CARBONITRILE
CAS:143335-18-6
KIN03269618
1-(4-IODO-PHENYL)-6-NITRO-INDAZOL-3-CARBOXYLIC ACID
CAS:143335-21-1
Formula: C14H8IN3O4
KIN03269621
1-(4-IODO-PHENYL)-N,N-DIMETHYL-CYCLOPROPANEMETHANAMINE
CAS:1184950-14-8
Formula: C12H16IN
KIN05318211
1-(4-IODO-PHENYL)-N-(BENZYL)CYCLOPENTANE-CARBOXAMIDE
CAS:332040-05-8
Formula: C19H20INO
KIN03504834
1-(4-IODO-PHENYL)-N-PROPYL-3-PYRROLIDINAMINE
CAS:1179235-85-8
Formula: C13H19IN2
KIN05283638
1-(4-IODO-PHENYL)-N-PROPYL-4-PIPERIDINAMINE
CAS:1182933-61-4
Formula: C14H21IN2
KIN05298622
1-(4-IODO-PHENYL)-NAPHTHALENE
CAS:1001337-35-4
Formula: C16H11I
KIN05005750
1-(4-IODO-PHENYL)-PROPAN-2-YLAMINE
CAS:82444-07-3
Formula: C9H12IN
KIN02655595
MFCD00040801
1-(4-IODO-PHENYL)-PYRROLIDINE
CAS:87350-76-3
Formula: C10H12IN
KIN02685986
1-(4-iodo-phenyl)-pyrrolidine; 1-(4-iodo-phenyl)-p
1-(4-IODO-PHENYL)-PYRROLIDINE-2-ONE
CAS:7661-37-2
Formula: C12H13N
KIN01192954
1-(4-IODO-PHENYL)-TRICYCLO[3.3.1.13,7]DECANE
CAS:98611-00-8
Formula: C16H19I
KIN02815402
1-(4-IODO-PHENYL)BUTANE
CAS:20651-57-6
KIN02092782
1-(4-IODO-PHENYL)CYCLOPENTANE-CARBONITRILE
CAS:324532-35-6
Formula: C12H12IN
KIN03494602
1-(4-IODO-PHENYL)CYCLOPENTANE-CARBOXYLIC ACID
CAS:135569-28-7
Formula: C12H13IO2
KIN03233401
1-(4-IODO-PHENYL)CYCLOPROPAN-CARBONITRILE
CAS:124276-79-5
Formula: C10H8IN
KIN03183301
1-(4-IODO-PHENYL)CYCLOPROPAN-CARBOXYLIC ACID
CAS:124276-89-7
Formula: C10H9IO2
KIN03183306
1-(4-IODO-PHENYL)ETHANOL
CAS:68120-56-9
Formula: C8H9IO
KIN02560858
MFCD00046636
1-(4-IODO-PHENYL)ETHANONE
CAS:13329-40-3
Formula: C8H7IO
KIN02018024
MFCD00045320
1-(4-IODO-PHENYL)ETHANONE 2-(2,6-DIPHENYLPYRIMIDIN-4-YL)HYDRAZONE
CAS:478911-10-3
Formula: C24H19IN4
KIN03607327
1-(4-IODO-PHENYL)ETHANONE 2-(2-METHYL-6-PHENYLPYRIMIDIN-4-YL)HYDRAZONE
CAS:293323-28-1
Formula: C19H17IN4
KIN03472538
1-(4-IODO-PHENYL)ETHANONE 2-(3-CHLOROPYRAZIN-2-YL)HYDRAZONE
CAS:330994-10-0
Formula: C12H10ClIN4
KIN03502992
1-(4-IODO-PHENYL)ETHANONE 2-(4,6-DIPHENYLPYRIMIDIN-2-YL)-2-METHYLHYDRAZONE
CAS:330993-31-2
Formula: C25H21IN4
KIN03502990
1-(4-IODO-PHENYL)ETHANONE 2-(4-METHYL-6-PHENYLPYRIMIDIN-2-YL)HYDRAZONE
CAS:330981-05-0
Formula: C19H17IN4
KIN03502907
1-(4-IODO-PHENYL)ETHANONE 2-(5,6-DIPHENYL-1,2,4-TRIAZIN-3-YL)HYDRAZONE
CAS:416883-86-8
Formula: C23H18IN5
KIN03572859
1-(4-IODO-PHENYL)ETHANONE 2-(5-BROMOPYRIMIDIN-2-YL)HYDRAZONE
CAS:293323-32-7
Formula: C12H10BrIN4
KIN03472539
1-(4-IODO-PHENYL)ETHANONE 2-(6-CHLORO-2-METHYLPYRIMIDIN-4-YL)HYDRAZONE
CAS:330992-29-5
Formula: C13H12ClIN4
KIN03502986
1-(4-IODO-PHENYL)ETHANONE 2-(6-CHLORO-2-PHENYLPYRIMIDIN-4-YL)HYDRAZONE
CAS:481641-94-5
Formula: C18H14ClIN4
KIN03608795
1-(4-IODO-PHENYL)ETHANONE 2-(6-METHOXY-PYRIMIDIN-4-YL)HYDRAZONE
CAS:415698-85-0
Formula: C13H13IN4O
KIN03571879
1-(4-IODO-PHENYL)ETHANONE 2-(6-METHYL-2-PHENYLPYRIMIDIN-4-YL)HYDRAZONE
CAS:299967-68-3
Formula: C19H17IN4
KIN03475610
1-(4-IODO-PHENYL)ETHANONE 2-[2-(3,5-DIBROMO-2-HYDROXY-PHENYL)-6-METHYLPYRIMIDIN-4-YL]HYDRAZONE
CAS:330993-75-4
Formula: C19H15Br2IN4O
KIN03502991
1-(4-IODO-PHENYL)ETHANONE 2-[2-(4-BROMOPHENYL)-6-METHYLPYRIMIDIN-4-YL]HYDRAZONE
CAS:481703-47-3
Formula: C19H16BrIN4
KIN03608923
1-(4-IODO-PHENYL)ETHANONE 2-[2-(4-BROMOPHENYL)-6-PHENYLPYRIMIDIN-4-YL]HYDRAZONE
CAS:301327-80-0
Formula: C24H18BrIN4
KIN03477332
1-(4-IODO-PHENYL)ETHANONE 2-[2-(4-METHOXY-PHENYL)-4-QUINAZOLINYL]HYDRAZONE
CAS:378775-25-8
Formula: C23H19IN4O
KIN03547374
1-(4-IODO-PHENYL)ETHANONE 2-[2-(4-METHYLPHENYL)-4-QUINAZOLINYL]HYDRAZONE
CAS:416879-78-2
Formula: C23H19IN4
KIN03572827
1-(4-IODO-PHENYL)ETHANONE 2-[4-(4-FLUOROPHENYL)-6-PHENYLPYRIMIDIN-2-YL]HYDRAZONE
CAS:355826-05-0
Formula: C24H18FIN4
KIN03532852
1-(4-IODO-PHENYL)ETHANONE 2-[5-(4-NITROPHENYL)-PYRIMIDIN-2-YL]HYDRAZONE
CAS:415699-89-7
Formula: C18H14IN5O2
KIN03571883
1-(4-IODO-PHENYL)ETHANONE 2-[6-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)-2-METHYLPYRIMIDIN-4-YL]HYDRAZONE
CAS:293323-36-1
Formula: C18H19IN6
KIN03472540
1-(4-IODO-PHENYL)ETHANONE 2-[6-METHYL-2-[(BENZYL)AMINO]PYRIMIDIN-4-YL]HYDRAZONE
CAS:381709-22-4
Formula: C20H20IN5
KIN03550498
1-(4-IODO-PHENYL)ETHANONE 2-[6-METHYL-2-MORPHOLIN-4-YLPYRIMIDIN-4-YL]HYDRAZONE
CAS:380593-09-9
Formula: C17H20IN5O
KIN03549309
1-(4-IODO-PHENYL)ETHANONE 2-[6-MORPHOLIN-4-YLPYRIMIDIN-4-YL]HYDRAZONE
CAS:301327-07-1
Formula: C16H18IN5O
KIN03477331
1-(4-IODO-PHENYL)ETHANONE 2-METHYL-2-(3-NITROPYRIDIN-2-YL)HYDRAZONE
CAS:384826-01-1
Formula: C14H13IN4O2
KIN03552759
1-(4-IODO-PHENYL)ETHANONE HYDRAZONE
CAS:98491-25-9
Formula: C8H9IN2
KIN02814348
1-(4-IODO-PHENYL)ETHANONE OXIME
CAS:27760-43-6
KIN02160094
1-(4-IODO-PHENYL)METHANEDIOL 1,1-DIACETATE
CAS:133746-50-6
KIN03225198
1-(4-IODO-PHENYL)PIPERAZINE
CAS:96530-59-5
Formula: C10H13IN2
KIN02801414
MFCD03444411
1-(4-IODO-PHENYL)PIPERIDIN-2-ONE
CAS:385425-15-0
Formula: C11H12INO
KIN03553261
1-(4-IODO-PHENYL)PIPERIDINE
CAS:55376-34-6
Formula: C11H14IN
KIN02365369
1-(4-IODO-SYLPHENOXY)-2,4-DINITRO-BENZENE
CAS:64297-77-4
Formula: C12H7IN2O6
KIN02507645
1-(4-iodo-sylphenoxy)-2,4-dinitro-benzene
1-(4-IODO-SYLPHENYL)ETHANONE
CAS:64297-70-7
Formula: C8H7IO2
KIN02507638
1-(4-iodo-sylphenyl)ethanone
1-(4-IODOPHENYL)-2-(2,2,3,3-TETRAFLUOROPROPOXY)-ETHANONE
CAS:1157250-76-4
Formula: C11H9F4IO2
KIN05244923
1-(4-IODOPHENYL)-2-(2-METHYLPHENYL)-ETHANONE
CAS:1094374-73-8
Formula: C15H13IO
KIN05139904
1-(4-IODOPHENYL)-2-(2-NITROPHENYL)-ETHANONE
CAS:1184398-24-0
Formula: C14H10INO3
KIN05313674
1-(4-IODOPHENYL)-2-(4-METHYLPHENYL)-ETHANONE
CAS:1094313-00-4
Formula: C15H13IO
KIN05138621
1-(4-IODOPHENYL)-2-(4-NITROPHENYL)-ETHANONE
CAS:1179801-98-9
Formula: C14H10INO3
KIN05287680
1-(4-IODOPHENYL)-2-METHYL-2-PHENYL-1-PROPANONE
CAS:1094416-83-7
Formula: C16H15IO
KIN05140687
1-(4-IODYLPHENYL)-2-PHENYL-DIAZENE
CAS:64297-71-8
Formula: C12H9IN2O2
KIN02507639
(4-Iodylphenyl)phenyl-diazene
1-(4-ISOBUTOXY-3-METHOXY-PHENYL)ETHANAMINE HCL
CAS:1171067-18-7
Formula: C13H21NO2.ClH;C13H21NO2.ClH
KIN05261919
1-(4-ISOBUTOXY-BENZOYL)-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:303729-54-6
KIN03480016
1-(4-ISOBUTOXY-PHENYL)-3-(4-PYRIDIN-2-YLPHENYL)THIOUREA
CAS:92-98-8
Formula: C13H23N2.Cl
KIN01002662
1-(4-ISOBUTYLPHENYL)-2-(PHENYLSELANYL)-PROPAN-1-OL
CAS:116333-31-4
Formula: C19H24OSe
KIN03142609
1-(4-ISOCYANATO-2,6-DIMETHYLPHENYL)-1-PROPANONE
CAS:95638-48-5
Formula: C12H13NO2
KIN02793599
1-(4-ISOCYANATO-2-METHYLPHENYL)-2-(3-METHYLPHENYL)-DIAZENE
CAS:15324-94-4
Formula: C15H13N3O
KIN02040547
1-(4-ISOCYANATO-PIPERIDIN-1-YL)ETHANONE
CAS:1044273-49-5
Formula: C8H12N2O2
KIN05093834
1-(4-ISOCYANATOBENZOYL)-2,5-PYRROLIDINEDIONE
CAS:167951-39-5
Formula: C12H8N2O4
KIN03341708
1-(4-ISOCYANATOPHENOXY)-2-NITRO-BENZENE
CAS:91804-89-6
Formula: C13H8N2O4
KIN02748917
1-(4-ISOCYANATOPHENOXY)-3-(TRIFLUOROMETHYL)-BENZENE
CAS:87217-81-0
Formula: C14H8F3NO2
KIN02685151
1-(4-ISOCYANATOPHENOXY)-3-METHOXY-BENZENE
CAS:80250-98-2
Formula: C14H11NO3
KIN02642879
1-(4-ISOCYANATOPHENOXY)-4-(TRIFLUOROMETHYL)-BENZENE
CAS:94656-62-9
Formula: C14H8F3NO2
KIN02783845
1-(4-ISOCYANATOPHENOXY)-NAPHTHALENE
CAS:76590-32-4
Formula: C17H11NO2
KIN02620341
1-(4-ISOCYANATOPHENYL)-1-BUTANONE
CAS:54528-27-7
Formula: C11H11NO2
KIN02351390
1-(4-ISOCYANATOPHENYL)-1-PROPANONE
CAS:54528-26-6
Formula: C10H9NO2
KIN02351389
1-(4-ISOCYANATOPHENYL)-1H-[1,2,4]-TRIAZOLE
CAS:27318-13-4
Formula: C9H6N4O
KIN02156184
1-(4-ISOCYANATOPHENYL)-1H-1,2,3-TRIAZOLE
CAS:27199-77-5
Formula: C9H6N4O
KIN02155060
1-(4-ISOCYANATOPHENYL)-1H-PYRROL-2,5-DIONE
CAS:123457-83-0
Formula: C11H6N2O3
KIN03179754
1-(4-ISOCYANATOPHENYL)-2-(4-NITROPHENYL)-DIAZENE
CAS:157190-96-0
Formula: C13H8N4O3
KIN03317446
1-(4-ISOCYANATOPHENYL)-2-PHENYL-DIAZENE
CAS:1942-68-3
KIN01059383
1-(4-ISOCYANATOPHENYL)-3,4-DIMETHYL-1H-PYRROL-2,5-DIONE
CAS:183149-88-4
Formula: C13H10N2O3
KIN03635697
1-(4-ISOCYANATOPHENYL)-3-METHYL-1H-PYRROL-2,5-DIONE
CAS:1161915-68-9
Formula: C12H8N2O3
KIN05258902
1-(4-ISOCYANATOPHENYL)-4-PHENYL-PIPERAZINE
CAS:1027594-32-6
Formula: C17H17N3O
KIN05062932
1-(4-ISOCYANATOPHENYL)-4-PYRIDIN-3-YL-PIPERAZINE
CAS:1027594-43-9
Formula: C16H16N4O
KIN05062933
1-(4-ISOCYANATOPHENYL)-N,N-DIMETHYL-4-PIPERIDINAMINE
CAS:1027071-94-8
Formula: C14H19N3O
KIN05061903
1-(4-ISOCYANATOPHENYL)ETHANONE
CAS:49647-20-3
Formula: C9H7NO2
KIN02289419
MFCD00013879
1-(4-ISOCYANATOPHENYL)ETHANONE 1-(O-METHYLOXIME)
CAS:69922-24-3
Formula: C10H10N2O2
KIN02573894
1-(4-ISOCYANATOPHENYL)PIPERIDIN-2-ONE
CAS:461435-27-8
Formula: C12H12N2O2
KIN03596250
1-(4-ISOCYANO-3-METHYLPHENYL)-2-(2-METHYLPHENYL)-DIAZENE
CAS:3097-82-3
Formula: C16H12N2O2
KIN01082341
1-(4-ISOCYANOBUTYL)-4-(2-METHOXY-PHENYL)PIPERAZINE
CAS:491611-29-1
Formula: C16H23N3O
KIN03612757
1-(4-ISOCYANOPHENYL)-2-PHENYL-DIAZENE
CAS:22287-69-0
Formula: C13H9N3
KIN02109275
1-(4-ISOCYANOPHENYL)ETHANONE
CAS:125192-28-1
Formula: C9H7NO
KIN03187547
1-(4-ISOPROPYL-1H-PYRROL-2-YL)ETHANONE
CAS:7136-73-4
KIN01179290
1-(4-ISOSELENOCYANATOPHENYL)ETHANONE
CAS:39195-15-8
Formula: C9H7NOSe
KIN02253660
1-(4-ISOTHIAZOLYL)ETHANONE
CAS:88511-36-8
Formula: C5H5NOS
KIN02699174
1-(4-Isothiazolyl)ethanone; Ketone, 4-isothiazolyl
1-(4-ISOTHIOCYANATO-2-BUTYN-1-YL)-4-METHYL-PIPERAZINE
CAS:59961-49-8
KIN02440141
1-(4-ISOTHIOCYANATO-2-BUTYN-1-YL)PIPERIDINE
CAS:59961-47-6
KIN02440139
1-(4-ISOTHIOCYANATO-2-NITROPHENYL)-1H-IMIDAZOLE
CAS:130482-32-5
Formula: C10H6N4O2S
KIN03210087
1-(4-ISOTHIOCYANATO-3-METHYLPHENYL)-2-(2-METHYLPHENYL)-DIAZENE
CAS:7612-98-8
Formula: C15H14N4S
KIN01192205
1-(4-ISOTHIOCYANATOBENZOYL)-PYRROLIDIN-2-ONE
CAS:57466-36-1
Formula: C12H10N2O2S
KIN02400138
1-(4-ISOTHIOCYANATOPHENOXY)-2-NITRO-BENZENE
CAS:19881-21-1
Formula: C13H8N2O3S
KIN02085823
1-(4-ISOTHIOCYANATOPHENYL)-1-BUTANONE
CAS:62237-19-8
Formula: C11H11NOS
KIN02470623
1-(4-ISOTHIOCYANATOPHENYL)-1-PENTANONE
CAS:81172-21-6
Formula: C12H13NOS
KIN02648346
1-(4-ISOTHIOCYANATOPHENYL)-1-PROPANONE
CAS:81172-32-9
Formula: C10H9NOS
KIN02648349
1-(4-ISOTHIOCYANATOPHENYL)-1H-[1,2,4]-TRIAZOLE
CAS:1092833-10-7
Formula: C9H6N4S
KIN05134809
1-(4-ISOTHIOCYANATOPHENYL)-1H-IMIDAZOLE
CAS:223785-60-2
Formula: C10H7N3S
KIN03438963
1-(4-ISOTHIOCYANATOPHENYL)-1H-PYRAZOLE
CAS:352018-96-3
Formula: C10H7N3S
KIN03529472
1-(4-ISOTHIOCYANATOPHENYL)-1H-PYRROL-2,5-DIONE
CAS:60283-89-8
Formula: C11H6N2O2S
KIN02443192
1-(4-ISOTHIOCYANATOPHENYL)-1H-PYRROLE
CAS:1192762-24-5
Formula: C11H8N2S
KIN05334265
1-(4-ISOTHIOCYANATOPHENYL)-2-(3-METHYLPHENYL)-DIAZENE
CAS:49540-68-3
Formula: C14H11N3S
KIN02288501
1-(4-ISOTHIOCYANATOPHENYL)-2-(4-NITROPHENYL)-DIAZENE
CAS:24722-66-5
Formula: C13H8N4O2S
KIN02133246
1-(4-ISOTHIOCYANATOPHENYL)-2-PHENYL-DIAZENE
CAS:7612-97-7
Formula: C15H13N3S
KIN01192204
1-(4-ISOTHIOCYANATOPHENYL)-3-(4-METHOXY-PHENYL)-2-PROPEN-1-ONE
CAS:25870-85-3
Formula: C17H13NO2S
KIN02143647
1-(4-ISOTHIOCYANATOPHENYL)-3-(4-METHYLPHENYL)-2-PROPEN-1-ONE
CAS:25870-86-4
Formula: C17H13NOS
KIN02143648
1-(4-ISOTHIOCYANATOPHENYL)-3-METHYL-3-BUTEN-2-ONE
CAS:1025900-77-9
Formula: C12H11NOS
KIN05059472
1-(4-ISOTHIOCYANATOPHENYL)-3-PHENYL-2-PROPEN-1-ONE
CAS:25870-87-5
Formula: C16H11NOS
KIN02143649
1-(4-ISOTHIOCYANATOPHENYL)-3-PROPOXY-1H-[1,2,4]-TRIAZOLE
CAS:158895-53-5
Formula: C12H12N4OS
KIN03321795
1-(4-ISOTHIOCYANATOPHENYL)-4-(1-METHYLETHYL)PIPERAZINE
CAS:443914-87-2
Formula: C14H19N3S
KIN03585895
1-(4-ISOTHIOCYANATOPHENYL)-4-(1-METHYLPROPYL)PIPERAZINE
CAS:443914-90-7
Formula: C15H21N3S
KIN03585898
1-(4-ISOTHIOCYANATOPHENYL)-4-(2-METHOXYETHYL)PIPERAZINE
CAS:443914-89-4
Formula: C14H19N3OS
KIN03585897
1-(4-ISOTHIOCYANATOPHENYL)-4-(2-METHYLPROPYL)PIPERAZINE
CAS:443914-92-9
Formula: C15H21N3S
KIN03585900
1-(4-ISOTHIOCYANATOPHENYL)-4-METHYL-PIPERAZINE
CAS:23861-85-0
Formula: C12H15N3S
KIN02124253
1-(4-ISOTHIOCYANATOPHENYL)-4-PROPYL-BICYCLO[2.2.2]OCTANE
CAS:121219-39-4
Formula: C18H23NS
KIN03168549
1-(4-ISOTHIOCYANATOPHENYL)-4-PYRIDIN-2-YL-PIPERAZINE
CAS:223786-48-9
Formula: C16H16N4S
KIN03439012
1-(4-ISOTHIOCYANATOPHENYL)-4-PYRIDIN-4-YL-PIPERAZINE
CAS:223786-21-8
Formula: C16H16N4S
KIN03439007
1-(4-ISOTHIOCYANATOPHENYL)-PYRROLIDINE
CAS:51317-64-7
Formula: C11H12N2S
KIN02304826
1-(4-ISOTHIOCYANATOPHENYL)-TRICYCLO[3.3.1.13,7]DECANE
CAS:75342-44-8
Formula: C17H19NS
KIN02611992
1-(4-ISOTHIOCYANATOPHENYL)ETHANONE
CAS:2131-59-1
Formula: C7H4BrNS
KIN01063273
1-(4-ISOTHIOCYANATOPHENYL)PIPERIDIN-4-CARBOXAMIDE
CAS:223786-52-5
Formula: C13H15N3OS
KIN03439015
1-(4-ISOTHIOCYANATOPHENYL)PIPERIDINE
CAS:51317-65-8
Formula: C12H14N2S
KIN02304827
1-(4-ISOXAZOLYL)-ETHANONE
CAS:83259-37-4
Formula: C5H5NO2
KIN02660194
1-(4-ISOXAZOLYLMETHYL)-PIPERAZINE
CAS:1178757-01-1
Formula: C8H13N3O
KIN05279469
1-(4-MERCAPTO-1-OXO-BUTYL)-L-PROLINE
CAS:64805-69-2
Formula: C9H15NO3S
KIN02515981
1-(4-Mercapto-1-oxo-butyl)-L-proline
1-(4-MERCAPTO-2-METHOXY-PHENYL)ETHANONE
CAS:93276-64-3
Formula: C9H10O2S
KIN02767534
1-(4-MERCAPTO-2-METHYLPHENYL)ETHANONE
CAS:90535-89-0
Formula: C9H10OS
KIN02729512
1-(4-MERCAPTO-2-PROPOXY-PHENYL)ETHANONE
CAS:135901-75-6
Formula: C11H14O2S
KIN03234811
1-(4-MERCAPTO-3,5-DIMETHOXY-PHENYL)ETHANONE
CAS:1024226-41-2
Formula: C10H12O3S
KIN05058170
1-(4-MERCAPTO-3-METHOXY-PHENYL)-1-PROPANONE
CAS:1024226-45-6
Formula: C10H12O2S
KIN05058173
1-(4-MERCAPTO-3-METHOXY-PHENYL)ETHANONE
CAS:69114-75-6
Formula: C9H10O2S
KIN02568050
1-(4-Mercapto-3-methoxyphenyl)ethanone; 2-Methoxy-
1-(4-MERCAPTO-3-METHYLPHENYL)ETHANONE
CAS:17067-24-2
Formula: C9H10OS
KIN02057768
1-(4-MERCAPTOPHENYL)-1-PROPANONE
CAS:174827-10-2
Formula: C9H10OS
KIN03356972
1-(4-MERCAPTOPHENYL)-2-METHYL-1-PROPANONE
CAS:91358-97-3
Formula: C10H12OS
KIN02742430
1-(4-MERCAPTOPHENYL)ETHANONE
CAS:3814-24-2
KIN01096404
1-(4-MERCAPTOPHENYL)ETHANONE SODIUM SALT
CAS:51679-05-1
Formula: C8H8OS.Na
KIN02310069
1-(4-METHANESULFONYLAMINOPHENOXY)-2-[N-METHYL-N-(4-AMINOPHENETHYL)AMINO]-ETHANE
CAS:115256-12-7
Formula: C18H25N3O3S
KIN03136189
1-(4-METHANESULFONYLAMINOPHENOXY)-2-[N-METHYL-N-(4-NITROPHENETHYL)AMINO]-ETHANE
CAS:115256-44-5
Formula: C18H23N3O5S
KIN03136191
1-(4-METHOXY(PHENYLAMINO))-3-PHENOXY-PROPAN-2-OL
CAS:101287-58-5
Formula: C16H19NO3
KIN03038347
1-(4-METHOXY(PHENYLAMINO))-PROPAN-2-ONE HCL
CAS:104401-78-7
Formula: C10H13NO2.ClH
KIN03060935
1-(4-METHOXY)PHENYL-2-AZIRIDINEETHANOL
CAS:272448-30-3
Formula: C11H15NO2
KIN03464423
1-(4-METHOXY-(PHENYLAMINO))-3-PROP-2-YNYLOXY-PROPAN-2-OL
CAS:23452-76-8
Formula: C13H17NO3
KIN02120085
1-(4-METHOXY-1,2,5-OXADIAZOL-3-YL)-4-METHYL-PIPERAZINE
CAS:356774-41-9
Formula: C8H14N4O2
KIN03533663
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)-2-METHYL-PIPERIDINE
CAS:1170801-75-8
Formula: C9H15N3OS
KIN05261634
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)-4-METHYL-PIPERAZINE
CAS:1171741-67-5
Formula: C8H14N4OS
KIN05262633
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)-4-METHYL-PIPERIDINE
CAS:1171344-22-1
Formula: C9H15N3OS
KIN05262207
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)-4-PHENYL-PIPERAZINE
CAS:1170433-56-3
Formula: C13H16N4OS
KIN05261247
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)PIPERAZINE
CAS:291748-14-6
KIN03471680
1-(4-METHOXY-1,2,5-THIADIAZOL-3-YL)PIPERIDINE
CAS:1170086-42-6
Formula: C8H13N3OS
KIN05260950
1-(4-METHOXY-1,4-CYCLOHEXADIEN-1-YL)-2,5-DIMETHYL-1H-PYRROLE
CAS:23041-63-6
KIN02116150
1-(4-METHOXY-1,4-CYCLOHEXADIEN-1-YL)CYCLOHEXANOL
CAS:66336-43-4
Formula: C13H20O2
KIN02540610
1-(4-METHOXY-1,4-DIOXO-BUTYL)-L-PROLYL-N-(4-NITROPHENYL)-L-VALINAMIDE
CAS:106436-07-1
Formula: C21H28N4O7
KIN03076408
1-(4-METHOXY-1,4-METHANONAPHTHALEN-1(4H)-YL)ETHANONE
CAS:91948-55-9
Formula: C14H14O2
KIN02750843
1-(4-Methoxy-1,4-methanonaphthalen-1(4H)-yl)ethano
1-(4-METHOXY-1-CYCLOHEXEN-1-YL)-PYRROLIDINE
CAS:52290-93-4
Formula: C11H19NO
KIN02319013
1-(4-METHOXY-1-DIBENZO[B]FURANYL)ETHANONE
CAS:5919-15-3
Formula: C5H4N2O
KIN01145050
1-(4-METHOXY-1-METHYL-1H-INDOL-2-YL)-1-PROPANONE
CAS:111258-31-2
KIN03106772
1-(4-METHOXY-1-METHYL-1H-PYRROL-3-YL)METHANEDIOL
CAS:1135277-43-8
Formula: C7H11NO3
KIN05186119
1-(4-METHOXY-1-OXIDO-2-PYRIDINYL)-CYCLOHEXANOL
CAS:1092694-59-1
Formula: C12H17NO3
KIN05134637
1-(4-METHOXY-1-OXIDO-PYRIDIN-2-YL)-1H-BENZOTRIAZOLE
CAS:380449-28-5
Formula: C12H10N4O2
KIN03679959
1-(4-METHOXY-1-OXO-BUTYL)-PYRROLIDIN-2-ONE
CAS:66283-27-0
Formula: C9H15NO3
KIN02539816
1-(4-METHOXY-1H-INDOL-2-YL)CYCLOPENTANOL
CAS:374071-97-3
KIN03544426
1-(4-METHOXY-1H-INDOL-2-YL)ETHANONE
CAS:370556-72-2
Formula: C11H11NO2
KIN03542122
1-(4-METHOXY-1H-INDOL-3-YL)-2-PROPANONE
CAS:113997-54-9
KIN03127670
1-(4-METHOXY-1H-INDOL-3-YL)ETHANONE
CAS:73260-12-5
Formula: C11H11NO2
KIN02597144
1-(4-METHOXY-1H-INDOL-7-YL)ETHANONE
CAS:81224-38-6
Formula: C11H11NO2
KIN02648568
1-(4-Methoxy-1H-indol-7-yl)ethanone
1-(4-METHOXY-1H-PYRAZOL-1-YL)ETHANONE
CAS:16407-14-0
Formula: C6H8N2O2
KIN02051071
1-(4-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE-3-YL)ETHANONE
CAS:1011711-59-3
KIN05018419
3-Acetyl-4-methoxy-7-aza-1H-indole
1-(4-METHOXY-2,2,6,6-TETRAMETHYL-3-CYCLOHEXEN-1-YL)ETHANONE
CAS:16556-48-2
Formula: C13H22O2
KIN02052552
1-(4-METHOXY-2,3,5,6-TETRAMETHYLPHENYL)ETHANONE
CAS:34671-78-8
Formula: C13H18O2
KIN02215965
1-(4-METHOXY-2,3,5-TRIMETHYLPHENYL)-1-PROPANONE
CAS:107076-00-6
Formula: C13H18O2
KIN03682089
1-(4-METHOXY-2,3,6-TRIMETHYLPHENYL)-1-PROPANONE
CAS:107076-01-7
Formula: C13H18O2
KIN03682088
1-(4-METHOXY-2,3,6-TRIMETHYLPHENYL)-2-PROPEN-1-ONE
CAS:113450-86-5
Formula: C13H16O2
KIN03649420
1-(4-METHOXY-2,3,6-TRIMETHYLPHENYL)-3-METHYL-1,4-PENTADIEN-3-OL
CAS:54757-48-1
Formula: C16H22O2
KIN02354872
MFCD09033282
1-(4-METHOXY-2,3,6-TRIMETHYLPHENYL)-3-METHYL-1-PENTEN-4-YN-3-OL
CAS:54756-70-6
Formula: C16H20O2
KIN02354849
MFCD09033281
1-(4-METHOXY-2,3,6-TRIMETHYLPHENYL)BUT-2-EN-1-ONE
CAS:122567-30-0
Formula: C14H18O2
KIN03660736
1-(4-METHOXY-2,3-DIMETHYLPHENYL)-1-PROPANONE
CAS:90852-26-9
Formula: C12H16O2
KIN02734481
1-(4-METHOXY-2,3-DIMETHYLPHENYL)-2-PROPANONE
CAS:205826-82-0
Formula: C12H16O2
KIN03415518
1-(4-METHOXY-2,3-DIMETHYLPHENYL)-2-PROPANONE OXIME
CAS:319913-87-6
Formula: C12H17NO2
KIN03649419
1-(4-METHOXY-2,3-DIMETHYLPHENYL)ETHANONE
CAS:41068-27-3
Formula: C11H14O2
KIN02268385
1-(4-METHOXY-2,5-DIMETHYLPHENYL)-1-BUTANONE
CAS:107076-15-3
Formula: C13H18O2
KIN03080706
1-(4-METHOXY-2,5-DIMETHYLPHENYL)-1-PROPANONE
CAS:36871-56-4
Formula: C12H16O2
KIN02234924
1-(4-METHOXY-2,5-DIMETHYLPHENYL)-2-PROPANONE
CAS:205826-81-9
Formula: C12H16O2
KIN03415517
1-(4-METHOXY-2,5-DIMETHYLPHENYL)-2-PROPANONE OXIME
CAS:319913-88-7
Formula: C12H17NO2
KIN03649418
1-(4-METHOXY-2,5-DIMETHYLPHENYL)BUT-2-EN-1-ONE
CAS:107076-36-8
Formula: C13H16O2
KIN03006642
1-(4-METHOXY-2,5-DIMETHYLPHENYL)ETHANONE
CAS:104174-28-9
Formula: C11H14O2
KIN03059271
1-(4-METHOXY-2,6-DIMETHYLPHENYL)-1-PROPANONE
CAS:107075-90-1
Formula: C12H16O2
KIN03080690
1-(4-METHOXY-2,6-DIMETHYLPHENYL)-ETHANONE
CAS:60999-76-0
Formula: C11H14O2
KIN02449606
Acetophenone, 4'-methoxy-2',6'-dimethy
1-(4-METHOXY-2,6-DIMETHYLPHENYL)PIPERAZINE
CAS:1121610-11-4
Formula: C13H20N2O
KIN05177925
1-(4-METHOXY-2-(2-METHOXYVINYL)PHENYL)-NAPHTHALENE
CAS:199117-09-4
Formula: C20H18O2
KIN03405372
1-(4-METHOXY-2-(BENZYLOXY)PHENYL)-3-(6-(BENZYLOXY)-BENZO[D][1,3]DIOXOL-5-YL)-PROP-2-EN-1-ONE
CAS:52249-89-5
Formula: C31H26O6
KIN02318520
1-(4-METHOXY-2-AMINOPHENYL)-PYRENE
CAS:102420-68-8
Formula: C23H17NO
KIN03047042
1-(4-METHOXY-2-METHYL-1-AZULENYL)ETHANONE
CAS:128637-56-9
Formula: C14H14O2
KIN03202518
1-(4-METHOXY-2-METHYL-1H-INDOL-1-YL)ETHANONE
CAS:473883-13-5
Formula: C12H13NO2
KIN03600667
1-(4-METHOXY-2-METHYL-5-PHENYL-1H-PYRROL-3-YL)ETHANONE
CAS:91480-98-7
Formula: C14H15NO2
KIN02744316
1-(4-METHOXY-2-METHYL-NAPHTHALEN-1-YL)ETHANONE
CAS:885-19-8
Formula: C14H10O2
KIN01032918
1-(4-METHOXY-2-METHYL-QUINOLIN-3-YL)ETHANONE
CAS:479076-67-0
Formula: C13H13NO2
KIN03607613
1-(4-METHOXY-2-METHYLBENZO[D]THIAZOL-7-YL)ETHANONE
CAS:26749-57-5
Formula: C11H11NO2S
KIN02150901
1-(4-METHOXY-2-METHYLPHENOXY)-2-PROPANAMINE
CAS:93750-31-3
Formula: C11H17NO2
KIN02773162
1-(4-METHOXY-2-METHYLPHENYL)-1,2-ETHANEDIAMINE
CAS:1089346-97-3
Formula: C10H16N2O
KIN05128553
1-(4-METHOXY-2-METHYLPHENYL)-1,3-BUTANEDIONE
CAS:147808-44-4
KIN03287474
1-(4-METHOXY-2-METHYLPHENYL)-1-HYDRAZINECARBOXYLIC ACID 1-[2-(TRIMETHYLSILYL)ETHYL] ESTER
CAS:154876-30-9
Formula: C14H24N2O3Si
KIN03310211
1-(4-METHOXY-2-METHYLPHENYL)-1-PROPANONE
CAS:53773-76-5
Formula: C11H14O2
KIN02340346
1-(4-METHOXY-2-METHYLPHENYL)-1H-IMIDAZOLE
CAS:190198-13-1
Formula: C11H12N2O
KIN03390629
1-(4-METHOXY-2-METHYLPHENYL)-1H-PYRROL-2-CARBALDEHYDE
CAS:299165-21-2
KIN03658325
1-(4-METHOXY-2-METHYLPHENYL)-1H-PYRROLE
CAS:383137-82-4
Formula: [C12H13NO
KIN03551373
1-(4-METHOXY-2-METHYLPHENYL)-2,2-DIMETHYL-1-PROPANONE
CAS:2234-20-0
Formula: C10H12
KIN01065449
1-(4-METHOXY-2-METHYLPHENYL)-2-(2-METHYLPHENYL)-DIAZENE
CAS:29418-45-9
Formula: C15H16N2O
KIN02173846
1-(4-METHOXY-2-METHYLPHENYL)-2-(4-METHOXY-PHENYL)-DIAZENE
CAS:29418-53-9
Formula: C15H16N2O2
KIN02173854
1-(4-METHOXY-2-METHYLPHENYL)-2-(4-NITROPHENYL)-DIAZENE
CAS:29418-60-8
Formula: C14H13N3O3
KIN02173860
1-(4-METHOXY-2-METHYLPHENYL)-2-METHYL-1-PROPANONE
CAS:54696-07-0
KIN02353903
1-(4-METHOXY-2-METHYLPHENYL)-2-PHENYL-DIAZENE
CAS:29418-42-6
Formula: C14H14N2O
KIN02173843
1-(4-METHOXY-2-METHYLPHENYL)-2-PHENYLETHANONE
CAS:66248-82-6
Formula: C16H16O2
KIN02539303
1-(4-Methoxy-2-methylphenyl)-2-phenylethanone
1-(4-METHOXY-2-METHYLPHENYL)-2-PROPANONE
CAS:16882-24-9
Formula: C11H14O2
KIN02056015
1-(4-METHOXY-2-METHYLPHENYL)-3-PYRAZOLIDINONE
CAS:130286-38-3
Formula: C11H14N2O2
KIN03209251
1-(4-METHOXY-2-METHYLPHENYL)CYCLOHEXANOL
CAS:68623-31-4
Formula: C14H20O2
KIN02564704
1-(4-Methoxy-2-methylphenyl)cyclohexanol
1-(4-METHOXY-2-METHYLPHENYL)ETHANONE
CAS:24826-74-2
Formula: C10H12O2
KIN02134200
MFCD09753673
1-(4-METHOXY-2-METHYLPHENYL)ETHANONE OXIME
CAS:75112-71-9
Formula: C10H13NO2
KIN02610471
1-(4-METHOXY-2-METHYLPHENYL)PIPERAZINE
CAS:59803-92-8
Formula: C12H18N2O
KIN02437362
MFCD06656929
1-(4-METHOXY-2-NITROPHENYL)-1H-IMIDAZOLE
CAS:25372-06-9
Formula: C10H9N3O3
KIN02139013
1-(4-METHOXY-2-NITROPHENYL)-1H-PYRROL-2,5-DIONE
CAS:91135-91-0
Formula: C11H8N2O5
KIN02739258
MFCD00047120
1-(4-METHOXY-2-NITROPHENYL)-1H-PYRROLE
CAS:59194-25-1
Formula: C11H10N2O3
KIN02427801
1-(4-METHOXY-2-NITROPHENYL)-2,5-DIMETHYL-1H-PYRROL-3-CARBALDEHYDE
CAS:428503-14-4
Formula: C14H14N2O4
KIN03577058
1-(4-METHOXY-2-NITROPHENYL)-2,5-DIMETHYL-1H-PYRROLE
CAS:333750-04-2
KIN03679958
1-(4-METHOXY-2-NITROPHENYL)-2-PROPANONE
CAS:113352-66-2
Formula: C10H11NO4
KIN03122275
1-(4-METHOXY-2-NITROPHENYL)-PYRENE
CAS:102420-64-4
Formula: C23H15NO3
KIN03047040
1-(4-METHOXY-2-NITROPHENYL)-PYRROLIDINE
CAS:181995-78-8
KIN03371899
1-(4-METHOXY-2-NITROPHENYL)ETHANONE
CAS:67323-06-2
Formula: C9H9NO4
KIN02551738
Acetophenone, 4'-methoxy-2'-nitro-; 4'
1-(4-METHOXY-2-NITROPHENYL)ETHANONE OXIME
CAS:90558-03-5
Formula: C9H10N2O4
KIN02729935
1-(4-METHOXY-2-NITROPHENYL)PIPERAZINE
CAS:330633-73-3
Formula: C11H15N3O3
KIN03502004
1-(4-METHOXY-2-NITROPHENYL)PIPERAZINE HCL
CAS:299912-45-1
Formula: C11H15N3O3.ClH
KIN03475352
1-(4-METHOXY-2-NITROPHENYL)PIPERIDINE
CAS:32117-02-5
KIN02194506
1-(4-METHOXY-2-PENTYLPHENYL)ETHANONE
CAS:60441-56-7
Formula: C14H20O2
KIN02444429
1-(4-Methoxy-2-pentylphenyl)ethanone; 4'-Metho
1-(4-METHOXY-2-PENTYN-1-YL)CYCLOPENTANOL
CAS:220581-33-9
Formula: C11H18O2
KIN03434514
1-(4-METHOXY-2-PROPOXY-PHENYL)ETHANONE
CAS:135901-78-9
Formula: C12H16O3
KIN03234813
1-(4-METHOXY-2-PYRIDINYL)-2-PROPANONE
CAS:289469-47-2
Formula: C9H11NO2
KIN03470611
1-(4-METHOXY-2-PYRIDINYL)-CYCLOPROPANEMETHANAMINE
CAS:1060805-26-6
Formula: C10H14N2O
KIN05106116
1-(4-METHOXY-2-PYRIDINYL)-PIPERAZINE
CAS:444666-41-5
Formula: C10H15N3O
KIN03586745
1-(4-METHOXY-2-PYRIMIDINYL)-ETHANONE
CAS:463337-53-3
Formula: C7H8N2O2
KIN03597324
1-(4-METHOXY-3,5-DI-ALLYLPHENYL)ETHANONE
CAS:142500-03-6
Formula: C15H18O2
KIN03265382
1-(4-METHOXY-3,5-DIMETHYLPHENYL)-1,2-ETHANEDIAMINE
CAS:1089348-39-9
Formula: C11H18N2O
KIN05128622
1-(4-METHOXY-3,5-DIMETHYLPHENYL)-1-BUTANONE
CAS:104024-15-9
Formula: C13H18O2
KIN03058125
1-(4-METHOXY-3,5-DIMETHYLPHENYL)-ETHANONE
CAS:60609-65-6
Formula: C11H14O2
KIN02446050
MFCD06201228
1-(4-METHOXY-3,5-DIMETHYLPHENYL)-ETHANONE OXIME
CAS:154782-57-7
Formula: C11H15NO2
KIN03309928
1-(4-METHOXY-3,5-DINITROPHENYL)-2,5-PYRROLIDINEDIONE
CAS:210489-77-3
KIN03669602
1-(4-METHOXY-3,5-DINITROPHENYL)ETHANONE
CAS:108302-72-3
Formula: C9H8N2O6
KIN03088249
1-(4-METHOXY-3,5-DIPHENYL-1H-PYRAZOL-1-YL)ETHANONE
CAS:71296-94-1
Formula: C18H16N2O2
KIN02583365
1-(4-METHOXY-3,5-DIPROPYLPHENYL)-1-PROPANONE
CAS:104008-51-7
Formula: C16H24O2
KIN03058027
1-(4-METHOXY-3-BUTEN-1-YN-1-YL)CYCLOPENTANOL
CAS:7179-19-3
KIN01180706
1-(4-METHOXY-3-CYCLOHEXEN-1-YL)ETHANONE
CAS:4893-16-7
Formula: C9H14O2
KIN01116747
1-(4-METHOXY-3-METHYL-2-NITRO-BENZOFURAN-7-YL)ETHANONE
CAS:53724-99-5
Formula: C12H11NO5
KIN02339670
1-(4-METHOXY-3-METHYLPHENYL)-1-PENTANONE
CAS:5394-92-3
Formula: C22H30NO.I
KIN01128462
1-(4-METHOXY-3-METHYLPHENYL)-1-PROPANONE
CAS:76805-57-7
Formula: C11H14O2
KIN02621572
1-(4-Methoxy-3-methylphenyl)-1-propanone; 4'-M
1-(4-METHOXY-3-METHYLPHENYL)-2,2-DIMETHYL-1-PROPANONE
CAS:181260-67-3
KIN03658324
1-(4-METHOXY-3-METHYLPHENYL)-2-(4-NITROPHENYL)ETHANONE
CAS:65118-19-6
Formula: C16H15NO4
KIN02521374
1-(4-METHOXY-3-METHYLPHENYL)-2-(PIPERAZIN-1-YL)ETHANONE
CAS:1082439-71-1
Formula: C14H20N2O2
KIN05120206
1-(4-METHOXY-3-METHYLPHENYL)-2-METHYL-1-PENTANONE
CAS:1096325-65-3
Formula: C14H20O2
KIN05154317
1-(4-METHOXY-3-METHYLPHENYL)-2-METHYL-1-PROPANONE
CAS:2954-68-9
Formula: C14H18O4
KIN01079712
1-(4-METHOXY-3-METHYLPHENYL)-2-PHENYL-DIAZENE
CAS:478176-71-5
Formula: C14H14N2O
KIN03606319
1-(4-METHOXY-3-METHYLPHENYL)-2-PHENYLETHANONE
CAS:1979-73-3
KIN01060129
1-(4-METHOXY-3-METHYLPHENYL)-2-PIPERAZINE-1-YL-1-PROPANONE
CAS:1181966-84-6
Formula: C15H22N2O2
KIN05295411
1-(4-METHOXY-3-METHYLPHENYL)-2-PROPANONE
CAS:16882-23-8
Formula: C11H14O2
KIN02056014
1-(4-METHOXY-3-METHYLPHENYL)-3-PHENYL-2-PROPEN-1-ONE
CAS:65081-26-7
Formula: C17H16O2
KIN02520699
1-(4-METHOXY-3-METHYLPHENYL)-3-PYRAZOLIDINONE
CAS:130286-42-9
Formula: C11H14N2O2
KIN03209253
1-(4-METHOXY-3-METHYLPHENYL)CYCLOHEXANOL
CAS:65010-48-2
Formula: C14H20O2
KIN02519613
1-(4-Methoxy-3-methylphenyl)cyclohexanol
1-(4-METHOXY-3-METHYLPHENYL)ETHANONE
CAS:10024-90-5
Formula: C10H12O2
KIN02000911
MFCD01673307
1-(4-METHOXY-3-METHYLPHENYL)ETHANONE OXIME
CAS:75112-72-0
Formula: C10H13NO2
KIN02610472
1-(4-METHOXY-3-METHYLPHENYL)PIPERAZINE
CAS:1121610-28-3
Formula: C12H18N2O
KIN05177935
1-(4-METHOXY-3-NITROPHENYL)-1-PROPANONE
CAS:103204-39-3
Formula: C10H11NO4
KIN03052352
1-(4-METHOXY-3-NITROPHENYL)-1H-PYRROL-2,5-DIONE
CAS:199583-64-7
Formula: [C11H8N2O5
KIN03406112
1-(4-METHOXY-3-NITROPHENYL)-2,5-PYRROLIDINEDIONE
CAS:91091-31-5
Formula: C11H10N2O5
KIN02738657
1-(4-METHOXY-3-NITROPHENYL)-2-(THIOPHEN-2-YL)ETHANONE
CAS:1178825-87-0
Formula: C13H11NO4S
KIN05280210
1-(4-METHOXY-3-NITROPHENYL)-2-(THIOPHEN-3-YL)ETHANONE
CAS:1178946-10-5
Formula: C13H11NO4S
KIN05281011
1-(4-METHOXY-3-NITROPHENYL)-2-PHENYL-DIAZENE 1-OXIDE
CAS:133498-22-3
Formula: C13H11N3O4
KIN03669601
1-(4-METHOXY-3-NITROPHENYL)-2-PHENYL-DIAZENE 2-OXIDE
CAS:133498-23-4
Formula: C13H11N3O4
KIN03669600
1-(4-METHOXY-3-NITROPHENYL)-2-PROPANONE
CAS:90617-47-3
Formula: C10H11NO4
KIN02730829
1-(4-Methoxy-3-nitrophenyl)-2-propanone
1-(4-METHOXY-3-NITROPHENYL)-4-(1-METHYLETHYL)PIPERAZINE
CAS:1116229-27-6
Formula: C14H21N3O3
KIN05176216
1-(4-METHOXY-3-NITROPHENYL)-4-METHYL-PIPERAZINE
CAS:1034617-86-1
Formula: C12H17N3O3
KIN05068803
1-(4-METHOXY-3-NITROPHENYL)-N1-METHYL-1,2-ETHANEDIAMINE
CAS:115898-10-7
Formula: C10H15N3O3
KIN03635696
1-(4-METHOXY-3-NITROPHENYL)ETHANONE HYDRAZONE
CAS:125672-10-8
KIN03189660
1-(4-METHOXY-3-NITROPHENYL)ETHANONE OXIME
CAS:149773-91-1
KIN03293912
1-(4-METHOXY-3-NITROPHENYL)ETHYLIUM
CAS:88510-81-0
Formula: C9H10NO3
KIN02699163
1-(4-Methoxy-3-nitrophenyl)ethylium
1-(4-METHOXY-3-PENTYLPHENYL)ETHANONE
CAS:92300-66-8
Formula: C14H20O2
KIN02755323
1-(4-Methoxy-3-pentylphenyl)ethanone; 4'-Metho
1-(4-METHOXY-3-PROPOXY-PHENYL)-1,2-ETHANEDIAMINE
CAS:1089348-67-3
Formula: C12H20N2O2
KIN05128635
1-(4-METHOXY-3-PROPOXY-PHENYL)ETHANONE
CAS:104226-65-5
Formula: C12H16O3
KIN03059798
1-(4-METHOXY-3-PROPYLPHENYL)-1,2-ETHANEDIAMINE
CAS:1089358-43-9
Formula: C12H20N2O
KIN05129017
1-(4-METHOXY-3-PROPYLPHENYL)ETHANONE
CAS:100256-35-7
Formula: C12H16O2
KIN03030092
1-(4-METHOXY-3-PYRIDINYL)-CYCLOPROPANAMINE
CAS:1060805-25-5
Formula: C9H12N2O
KIN05106115
1-(4-METHOXY-3-PYRIDINYL)-CYCLOPROPANEMETHANAMINE
CAS:1060805-28-8
Formula: C10H14N2O
KIN05106117
1-(4-METHOXY-3-PYRIDINYL)-ETHANONE
CAS:191725-82-3
Formula: C8H9NO2
KIN03392971
1-(4-METHOXY-4'-METHYL-BIPHENYL-2-YL)-PYRROLIDIN-2-ONE
CAS:1170731-28-8
Formula: C18H19NO2
KIN05261547
1-(4-METHOXY-4-METHYL-CYCLOHEXYL)-4-PIPERIDINAMINE
CAS:1067713-76-1
Formula: C13H26N2O
KIN05110144
1-(4-METHOXY-4-PHENYLBUTYL)-1H-IMIDAZOLE OXALATE
CAS:64765-22-6
Formula: C14H18N2O.xC2H2O4
KIN02515337
1-(4-METHOXY-5,5-DIMETHYL-2-PROPAN-2-YL-THIAZOLIDINE-3-YL)ETHANONE
CAS:113261-59-9
Formula: C11H21NO2S
KIN03121462
1-(4-METHOXY-5,6,7,8-TETRAHYDRONAPHTHALEN-1-YL)-2-PIPERIDIN-1-YLETHANOL HCL
CAS:5427-69-0
Formula: C18H29NO
KIN01130282
1-(4-METHOXY-5-METHYL-2-NITROSOPHENYL)-1-PROPANONE
CAS:81484-60-8
Formula: C11H13NO3
KIN02650103
1-(4-METHOXY-6-METHYL-[1,3,5]TRIAZIN-2-YL)-1-METHYL-UREA
CAS:220225-04-7
KIN03624458
1-(4-METHOXY-6-METHYL-2-PHENYLPYRIMIDIN-5-YL)ETHANONE
CAS:1089828-07-8
Formula: C14H14N2O2
KIN05129659
1-(4-METHOXY-6-METHYL-2-PYRIDINYL)-2-PROPANONE
CAS:289469-46-1
Formula: C10H13NO2
KIN03014158
1-(4-METHOXY-6-METHYLPYRIMIDIN-2-YL)-1-PROPANONE
CAS:64929-18-6
Formula: C9H12N2O2
KIN02518031
1-(4-METHOXY-6-METHYLPYRIMIDIN-2-YL)-3-METHYL-1H-PYRAZOL-5-OL
CAS:23898-82-0
Formula: C10H12N4O2
KIN02124598
1-(4-METHOXY-6-METHYLPYRIMIDIN-2-YL)-4-PIPERIDINAMINE
CAS:1158423-30-3
Formula: C11H18N4O
KIN05253524
1-(4-METHOXY-6-METHYLPYRIMIDIN-2-YL)ETHANONE
CAS:64571-49-9
Formula: C8H10N2O2
KIN02511921
1-(4-METHOXY-6-NAPHTHALEN-2-YLOXY-1H-1,3,5-TRIAZIN-2-YLIDENE)-NAPHTHALEN-2-ONE
CAS:143108-90-1
Formula: C24H17N3O3
KIN03268252
1-(4-METHOXY-7-METHYL-1H-INDOL-1-YL)ETHANONE
CAS:1082041-55-1
Formula: C12H13NO2
KIN05118267
1-(4-METHOXY-9H-PYRIDO[3,4-B]INDOL-1-YL)ETHANONE
CAS:65236-63-7
Formula: C14H12N2O2
KIN02523444
1-(4-METHOXY-BENZENESULFONYL)-3-PHENYL-UREA
CAS:51327-24-3
Formula: C14H14N2O4S
KIN02304982
1-(4-METHOXY-BENZENESULFONYL)-PYRROLIDINE
CAS:335215-12-8
KIN03508553
1-(4-METHOXY-BENZENESULFONYL)PIPERIDIN-3-CARBOXYLIC ACID
CAS:377770-58-6
Formula: C13H17NO5S
KIN03546884
1-(4-METHOXY-BENZO[D][1,3]DIOXOL-5-YL)-PROPAN-2-YLAMINE
CAS:23693-19-8
Formula: C11H15NO3
KIN02122665
2-Meo-3,4-mda
1-(4-METHOXY-BENZOFURAN-2-YL)ETHANONE
CAS:59445-59-9
Formula: C11H10O3
KIN02431680
1-(4-METHOXY-BENZOFURAN-5-YL)-3-PHENYL-1,3-PROPANEDIONE
CAS:484-38-8
Formula: C9H5NO4
KIN01016447
1-(4-METHOXY-BENZOFURAN-5-YL)ETHANONE
CAS:52055-86-4
Formula: C11H10O3
KIN02315440
1-(4-METHOXY-BENZOFURAN-7-YL)ETHANONE
CAS:63272-77-5
Formula: C11H10O3
KIN02489607
1-(4-Methoxy-benzofuran-7-yl)ethanone
1-(4-METHOXY-BENZOYL)-1-METHYLHYDRAZINE
CAS:14908-48-6
KIN02036652
1-(4-METHOXY-BENZOYL)-1H-BENZO[D]IMIDAZOL-2-ACETIC ACID
CAS:1018581-56-0
KIN05038293
1-(4-METHOXY-BENZOYL)-1H-IMIDAZOLE HCL
CAS:60536-04-1
Formula: C11H10N2O2.ClH
KIN02445275
1-(4-METHOXY-BENZOYL)-1H-INDOL-2,3-DIONE
CAS:97095-29-9
KIN02804431
1-(4-Methoxy-benzoyl)-1H-indol-2,3-dione
1-(4-METHOXY-BENZOYL)-1H-INDOL-3-CARBONITRILE
CAS:154477-40-4
KIN03308929
1-(4-METHOXY-BENZOYL)-1H-PYRROLE
CAS:70971-72-1
Formula: C12H11NO2
KIN02580962
1-(4-METHOXY-BENZOYL)-2(1H)-IMIDAZOLIDINONE
CAS:67357-58-8
Formula: C11H12N2O3
KIN02552182
1-(4-METHOXY-BENZOYL)-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:90330-17-9
Formula: C12H10N2O4
KIN02726181
1-(4-Methoxy-benzoyl)-2,4(1H,3H)-pyrimidinedione
1-(4-METHOXY-BENZOYL)-2,4-DIMETHYL THIOSEMICARBAZIDE
CAS:110623-58-0
Formula: C11H15N3O2S
KIN03102789
1-(4-METHOXY-BENZOYL)-2,5-PYRROLIDINEDIONE
CAS:6343-27-7
Formula: C11H9NO3
KIN01159835
1-(4-METHOXY-BENZOYL)-2-AZIRIDINECARBONITRILE
CAS:69826-54-6
Formula: C11H10N2O2
KIN02573206
1-(4-METHOXY-BENZOYL)-2-OXO-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:137427-81-7
Formula: C21H21NO5
KIN03241431
1-(4-METHOXY-BENZOYL)-2-PIPERIDINECARBALDEHYDE
CAS:479672-34-9
KIN03608229
1-(4-METHOXY-BENZOYL)-2-PIPERIDINECARBOXYLIC ACID
CAS:1103529-63-0
Formula: C14H17NO4
KIN05168795
1-(4-METHOXY-BENZOYL)-4,6-DIPHENYLPYRIDIN-2(1H)-ONE
CAS:76435-97-7
Formula: C25H19NO3
KIN02619251
1-(4-METHOXY-BENZOYL)-4-(PYRIDIN-4-YLCARBONYL)PIPERAZINE
CAS:336179-32-9
Formula: C18H19N3O3
KIN03624457
1-(4-METHOXY-BENZOYL)-4-METHYL THIOSEMICARBAZIDE
CAS:154106-04-4
Formula: C10H13N3O2S
KIN03307543
1-(4-METHOXY-BENZOYL)-5-(PENTYLOXY)-PYRROLIDINE-2-ONE
CAS:119984-19-9
KIN03161692
1-(4-METHOXY-BENZOYL)-5-OXO-L-PROLINE
CAS:105425-03-4
KIN03068188
1-(4-METHOXY-BENZOYL)-CARBAZOLE
CAS:114049-66-0
Formula: C20H15NO2
KIN03128051
1-(4-METHOXY-BENZOYL)-N-METHYLCYCLOBUTANE-CARBOTHIOAMIDE
CAS:150515-25-6
Formula: C14H17NO2S
KIN03296436
1-(4-METHOXY-BENZOYL)-NAPHTHALEN-2-CARBOXYLIC ACID
CAS:66239-97-2
Formula: C19H14O4
KIN02539200
1-(4-METHOXY-BENZOYL)-PYRROLIDIN-2-ONE
CAS:72432-10-1
Formula: C12H13NO3
KIN02591356
Aniracetam
MFCD00153767