Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

1,1'-SULFONYLBIS[2,4,6-TRIFLUOROBENZENE
CAS:236739-06-3
KIN03444577
1,1'-SULFONYLBIS[2,4,6-TRINITRO-BENZENE]
CAS:10580-80-0
Formula: C12H4N6O14S
KIN02008420
1,1'-SULFONYLBIS[2,4-DICHLOROBENZENE
CAS:6647-76-3
Formula: C6H4BrN3O2S
KIN01167930
1,1'-SULFONYLBIS[2,4-DIMETHOXY-BENZENE
CAS:50625-46-2
KIN02295401
1,1'-SULFONYLBIS[2,5-DICHLOROBENZENE
CAS:69925-17-3
Formula: C12H6Cl4O2S
KIN02573917
1,1'-SULFONYLBIS[2,5-DIFLUOROBENZENE
CAS:120022-64-2
KIN03161954
1,1'-SULFONYLBIS[2,5-DIMETHOXY-BENZENE
CAS:19116-52-0
Formula: C16H18O6S
KIN02078180
1,1'-SULFONYLBIS[2,6-DIMETHOXY-BENZENE
CAS:101432-34-2
KIN03039401
1,1'-SULFONYLBIS[2,6-DIMETHYLBENZENE
CAS:115231-24-8
KIN03136085
1,1'-SULFONYLBIS[2-(1-METHYLETHENYL)-BENZENE
CAS:80663-02-1
Formula: C18H18O2S
KIN02645538
1,1'-SULFONYLBIS[2-(TERT-BUTYL)-BENZENE
CAS:1190974-81-2
Formula: C20H26O2S
KIN05331768
1,1'-SULFONYLBIS[2-ALLYLBENZENE
CAS:160912-72-1
KIN03327477
1,1'-SULFONYLBIS[2-CHLORO-4-ISOTHIOCYANATO-BENZENE
CAS:40939-72-8
Formula: C14H6Cl2N2O2S3
KIN02267080
1,1'-SULFONYLBIS[2-CHLORO-4-METHYLBENZENE
CAS:38980-54-0
KIN02251889
1,1'-SULFONYLBIS[2-CHLORO-4-NITRO-BENZENE
CAS:35880-72-9
Formula: C12H6Cl2N2O6S
KIN02227057
1,1'-SULFONYLBIS[2-FLUORO-3-NITRO-BENZENE
CAS:312-05-0
Formula: C10H14FO3P
KIN01009866
1,1'-SULFONYLBIS[2-FLUOROBENZENE
CAS:141223-28-1
KIN03258908
1,1'-SULFONYLBIS[2-ISOTHIOCYANATO-BENZENE
CAS:40939-91-1
Formula: C14H8N2O2S3
KIN02267089
1,1'-SULFONYLBIS[2-METHOXY-5-METHYLBENZENE
CAS:66294-57-3
Formula: C16H18O4S
KIN02539998
1,1'-SULFONYLBIS[2-METHOXY-BENZENE
CAS:107775-84-8
KIN03084921
1,1'-SULFONYLBIS[2-METHYL-5-NITRO-BENZENE
CAS:189896-67-1
KIN03390136
1,1'-SULFONYLBIS[2-NITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:567-35-1
Formula: C5H9NO3
KIN01020131
1,1'-SULFONYLBIS[2-NITRO-BENZENE
CAS:14665-52-2
Formula: C12H8N2O6S
KIN02034379
1,1'-SULFONYLBIS[3,4-DICHLOROBENZENE
CAS:22588-79-0
Formula: C12H6Cl4O2S
KIN02112022
1,1'-SULFONYLBIS[3,4-DIFLUOROBENZENE
CAS:1189354-58-2
Formula: C12H6F4O2S
KIN05328923
1,1'-SULFONYLBIS[3,4-DIMETHOXY-BENZENE
CAS:50625-47-3
KIN02295402
1,1'-SULFONYLBIS[3,4-DIMETHYLBENZENE
CAS:28361-43-5
Formula: C16H18O2S
KIN02165529
Di-3,4-Dimethylphenyl sulfone
1,1'-SULFONYLBIS[3,5-DICHLORO-4-METHOXY-BENZENE
CAS:122438-79-3
KIN03174765
1,1'-SULFONYLBIS[3,5-DICHLOROBENZENE
CAS:75277-36-0
Formula: C12H6Cl4O2S
KIN02611541
1,1'-SULFONYLBIS[3,5-DIMETHYL-4-METHOXY-BENZENE
CAS:123443-94-7
KIN03179690
1,1'-SULFONYLBIS[3,5-DIMETHYLBENZENE
CAS:240405-82-7
KIN03445725
1,1'-SULFONYLBIS[3,5-DINITRO-BENZENE
CAS:17017-56-0
KIN02057282
1,1'-SULFONYLBIS[3-(ETHYLTHIO)-BENZENE
CAS:312742-23-7
KIN03486852
1,1'-SULFONYLBIS[3-(METHYLSULFONYL)-BENZENE
CAS:300406-78-4
KIN03475867
1,1'-SULFONYLBIS[3-(METHYLTHIO)-BENZENE
CAS:300406-11-5
KIN03475863
1,1'-SULFONYLBIS[3-BROMO-4-FLUOROBENZENE
CAS:79881-12-2
Formula: C12H6Br2F2O2S
KIN02640425
1,1'-SULFONYLBIS[3-CHLORO-4-FLUOROBENZENE
CAS:158753-84-5
KIN03321410
1,1'-SULFONYLBIS[3-CHLORO-4-METHOXY-BENZENE
CAS:66294-54-0
Formula: C14H12Cl2O4S
KIN02539995
1,1'-SULFONYLBIS[3-CHLORO-4-NITRO-BENZENE
CAS:63063-23-0
Formula: C12H6Cl2N2O6S
KIN02485682
1,1'-SULFONYLBIS[3-ETHOXY-BENZENE
CAS:1035812-59-9
Formula: C16H18O4S
KIN05069620
1,1'-SULFONYLBIS[3-ETHYLBENZENE
CAS:1035815-78-1
Formula: C16H18O2S
KIN05069649
1,1'-SULFONYLBIS[3-ETHYNYL-4-ISOCYANATO-BENZENE
CAS:75611-05-1
Formula: C18H8N2O4S
KIN02613819
1,1'-SULFONYLBIS[3-FLUORO-4-METHOXY-BENZENE
CAS:55347-01-8
KIN02365004
1,1'-SULFONYLBIS[3-ISOCYANATO-BENZENE
CAS:47119-84-6
Formula: C14H8N2O4S
KIN02286938
1,1'-SULFONYLBIS[3-ISOTHIOCYANATO-BENZENE
CAS:40939-76-2
Formula: C14H8N2O2S3
KIN02267082
1,1'-SULFONYLBIS[3-METHYLBENZENE
CAS:5097-15-4
Formula: C12H8Cl2O2S
KIN01120628
1,1'-SULFONYLBIS[3-METHYLBUT-2-ENE]
CAS:52936-39-7
Formula: C10H18O2S
KIN02327861
1,1'-SULFONYLBIS[3-NITRO-4-(4-NITROPHENOXY) -BENZENE
CAS:3950-59-2
Formula: C14H16N2O4S
KIN01098440
1,1'-SULFONYLBIS[3-NITRO-4-PHENOXY-BENZENE
CAS:3704-40-3
Formula: C15H11NS
KIN01094351
1,1'-SULFONYLBIS[4-(1,2-PROPADIEN-1-YLOXY) -BENZENE
CAS:127265-87-6
KIN03008531
1,1'-SULFONYLBIS[4-(1-METHYLETHOXY) -BENZENE
CAS:116763-20-3
Formula: C18H22O4S
KIN03145801
1,1'-SULFONYLBIS[4-(1-METHYLETHYL)-BENZENE
CAS:57913-35-6
Formula: C18H22O2S
KIN02407517
1,1'-SULFONYLBIS[4-(1-PROPEN-1-YLOXY) -BENZENE
CAS:149829-45-8
KIN03294113
1,1'-SULFONYLBIS[4-(2,2,2-TRIFLUORO-ETHOXY) -BENZENE
CAS:87014-32-2
Formula: C16H12F6O4S
KIN02683848
1,1'-SULFONYLBIS[4-(2,3-DIBROMOPROPOXY) -BENZENE
CAS:99890-14-9
Formula: C18H18Br4O4S
KIN02823376
1,1'-SULFONYLBIS[4-(2-CYCLOHEXEN-1-YLOXY) -BENZENE
CAS:325475-16-9
KIN03025451
1,1'-SULFONYLBIS[4-(2-METHYLPHENOXY) -BENZENE
CAS:53895-55-9
Formula: C26H22O4S
KIN02341960
1,1'-SULFONYLBIS[4-(3-ETHYNYLPHENOXY) -BENZENE
CAS:63770-82-1
Formula: C28H18O4S
KIN02498629
1,1'-SULFONYLBIS[4-(3-METHYLBUTOXY) -BENZENE
CAS:97042-13-2
Formula: C22H30O4S
KIN02804229
1,1'-SULFONYLBIS[4-(4-ETHYNYLPHENOXY) -BENZENE
CAS:88272-95-1
Formula: C28H18O4S
KIN02695712
1,1'-SULFONYLBIS[4-(4-METHYLPHENOXY) -3-NITRO-BENZENE
CAS:3795-88-8
KIN01096089
1,1'-SULFONYLBIS[4-(4-METHYLPHENOXY) -BENZENE
CAS:33127-68-3
KIN02202799
1,1'-SULFONYLBIS[4-(ALLYLOXY) -BENZENE
CAS:41481-63-4
Formula: C18H18O4S
KIN02271493
MFCD00506306
1,1'-SULFONYLBIS[4-(BENZYLOXY) -BENZENE
CAS:71338-01-7
Formula: C26H22O4S
KIN02583684
1,1'-SULFONYLBIS[4-(CHLOROMETHYL)-BENZENE
CAS:55154-19-3
Formula: C14H12Cl2O2S
KIN02361703
1,1'-SULFONYLBIS[4-(DIPHENOXYMETHOXY) -BENZENE
CAS:64523-82-6
Formula: C38H30O8S
KIN02511205
1,1'-SULFONYLBIS[4-(HEPTYLOXY) -BENZENE
CAS:97042-15-4
Formula: C26H38O4S
KIN02804231
1,1'-SULFONYLBIS[4-(HEXYLOXY) -BENZENE
CAS:97042-14-3
Formula: C24H34O4S
KIN02804230
1,1'-SULFONYLBIS[4-(IODO-METHYL)-BENZENE
CAS:93522-36-2
Formula: C14H12I2O2S
KIN02770218
1,1'-SULFONYLBIS[4-(PENTYLOXY) -BENZENE
CAS:95210-60-9
Formula: C22H30O4S
KIN02789335
1,1'-SULFONYLBIS[4-(PHENYLTHIO)-BENZENE
CAS:93103-32-3
Formula: C24H18O2S3
KIN02765221
1,1'-SULFONYLBIS[4-(PROPARGYLOXY) -BENZENE
CAS:73303-45-4
Formula: C18H14O4S
KIN02597449
1,1'-SULFONYLBIS[4-[(1-METHYLETHENYLOXY) ]BENZENE
CAS:110984-91-3
KIN03104800
1,1'-SULFONYLBIS[4-[(4-NITROPHENYL)THIO]BENZENE
CAS:89847-03-0
Formula: C24H16N2O6S3
KIN02718006
1,1'-SULFONYLBIS[4-[[4-(PHENYLTHIO)PHENYL]THIO]BENZENE
CAS:93972-95-3
Formula: C36H26O2S5
KIN02776080
1,1'-SULFONYLBIS[4-[3-(PHENYLETHYNYL)PHENOXY]BENZENE
CAS:96250-69-0
Formula: C40H26O4S
KIN02799268
1,1'-SULFONYLBIS[4-BROMO-3-CHLOROBENZENE
CAS:158753-83-4
KIN03321409
1,1'-SULFONYLBIS[4-BROMOMETHYLBENZENE
CAS:4542-77-2
Formula: C12H10Br2
KIN01110156
1,1'-SULFONYLBIS[4-BUTOXY-BENZENE
CAS:95210-59-6
Formula: C20H26O4S
KIN02789334
1,1'-SULFONYLBIS[4-CHLORO-1H-PYRAZOLE
CAS:147441-32-5
KIN03286129
1,1'-SULFONYLBIS[4-CHLORO-2-METHYLBENZENE
CAS:132653-96-4
KIN03219867
1,1'-SULFONYLBIS[4-CHLORO-2-NITRO-BENZENE
CAS:144505-71-5
Formula: C12H6Cl2N2O6S
KIN03276013
1,1'-SULFONYLBIS[4-CHLORO-3,5-DIMETHYLBENZENE
CAS:149444-34-8
KIN03292469
1,1'-SULFONYLBIS[4-CHLORO-3-(METHYLTHIO)-BENZENE
CAS:413605-17-1
Formula: C14H12Cl2O2S3
KIN03571338
1,1'-SULFONYLBIS[4-CHLORO-3-METHYLBENZENE
CAS:39022-42-9
Formula: C14H12Cl2O2S
KIN02252129
1,1'-SULFONYLBIS[4-CHLOROBENZENE
CAS:85228-26-8
KIN02672816
1,1'-SULFONYLBIS[4-ETHENYLBENZENE
CAS:71195-75-0
Formula: C16H14O2S
KIN02582697
1,1'-SULFONYLBIS[4-ETHOXY-BENZENE
CAS:66294-58-4
Formula: C16H18O4S
KIN02539999
1,1'-SULFONYLBIS[4-ETHYLBENZENE
CAS:66294-51-7
Formula: C16H18O2S
KIN02539994
1,1'-SULFONYLBIS[4-ETHYNYLBENZENE
CAS:27594-30-5
KIN02158757
1,1'-SULFONYLBIS[4-FLUORO-2-NITRO-BENZENE
CAS:72242-30-9
Formula: C12H6F2N2O6S
KIN02590055
1,1'-SULFONYLBIS[4-IODO-BENZENE
CAS:40915-22-8
Formula: C12H8I2O2S
KIN02266864
1,1'-SULFONYLBIS[4-ISOCYANATO-BENZENE
CAS:13753-52-1
Formula: C14H8N2O4S
KIN02024026
1,1'-SULFONYLBIS[4-ISOTHIOCYANATO-2-METHOXY-BENZENE
CAS:40939-74-0
Formula: C16H12N2O4S3
KIN02267081
1,1'-SULFONYLBIS[4-METHOXY-3-METHYLBENZENE
CAS:66294-56-2
Formula: C16H18O4S
KIN02539997
1,1'-SULFONYLBIS[4-METHOXY-BENZENE
CAS:3112-82-1
Formula: C15H16O2S
KIN01082565
1,1'-SULFONYLBIS[4-METHYL-3-NITRO-BENZENE
CAS:1235-97-8
Formula: C21H32O2
KIN01044389
1,1'-SULFONYLBIS[4-NITRO-1H-PYRAZOLE
CAS:147441-31-4
KIN03286128
1,1'-SULFONYLBIS[4-NITRO-2-(TRIFLUOROMETHYL)-BENZENE
CAS:360-80-5
Formula: C8H10N2O2S
KIN01011958
1,1'-SULFONYLBIS[4-PHENOXY-BENZENE
CAS:1623-92-3
Formula: C12H9ClO3S
KIN01051829
1,1'-SULFONYLBIS[4-PROPOXY-BENZENE
CAS:97042-12-1
Formula: C18H22O4S
KIN02804228
1,1'-SULFONYLBIS[5-CHLORO-2-METHOXY-BENZENE
CAS:66294-55-1
Formula: C14H12Cl2O4S
KIN02539996
1,1'-SULFONYLBIS[DIMETHYLBENZENE
CAS:27043-27-2
Formula: C16H20O2S
KIN02153421
Di Tetramethyldiphenyl sulfone; Dimethylphenyl sul
1,1'-SULFONYLBIS[FLUOROBENZENE
CAS:95243-95-1
Formula: C12H8F2O2S
KIN02789641
1,1'-SULFONYLBIS[NITRO-BENZENE
CAS:58704-57-7
Formula: C12H8N2O6S
KIN02419750
1,1'-SULFONYLDIPROPAN-2-OL
CAS:6633-90-5
Formula: C8H14O2S2
KIN01167194
1,1'-TELLURINYLBIS[2,4,6-TRIMETHYLBENZENE
CAS:92720-45-1
Formula: C18H22OTe
KIN02760576
1,1'-TELLURINYLBIS[3-METHOXY-BENZENE
CAS:92720-44-0
Formula: C14H14O3Te
KIN02760575
1,1'-TELLURINYLBIS[4-BROMOBENZENE
CAS:77443-99-3
Formula: C12H8Br2OTe
KIN02625658
1,1'-TELLURINYLBIS[4-CHLOROBENZENE
CAS:77443-97-1
Formula: C12H8Cl2OTe
KIN02625657
1,1'-TELLURINYLBIS[4-ETHOXY-BENZENE
CAS:96025-35-3
Formula: C16H18O3Te
KIN02797323
1,1'-TELLUROBIS-HEXADECANE
CAS:71766-42-2
Formula: C32H66Te
KIN02586750
1,1'-TELLUROBIS[2,4,6-TRIMETHYLBENZENE
CAS:70165-32-1
Formula: C18H22Te
KIN02575649
1,1'-TELLUROBIS[2,4-DIMETHYLBENZENE
CAS:97848-36-7
Formula: C16H18Te
KIN02808176
1,1'-TELLUROBIS[2-METHYLBENZENE]
CAS:6243-34-1
KIN01153318
1,1'-TELLUROBIS[3,3-DIMETHYLBUTANE
CAS:88691-72-9
Formula: C12H26Te
KIN02701393
1,1'-TELLUROBIS[3-BROMOBENZENE
CAS:63212-73-7
Formula: C12H8Br2Te
KIN02488535
1,1'-TELLUROBIS[3-CHLOROBENZENE
CAS:63212-72-6
Formula: C12H8Cl2Te
KIN02488534
1,1'-TELLUROBIS[3-METHOXY-BENZENE
CAS:92720-49-5
Formula: C14H14O2Te
KIN02760580
1,1'-TELLUROBIS[3-METHYLBENZENE
CAS:6422-06-6
Formula: C17H18N2O4
KIN01161963
1,1'-TELLUROBIS[4-FLUOROBENZENE
CAS:63212-71-5
Formula: C12H8F2Te
KIN02488533
1,1'-TELLUROBIS[4-METHOXY-BENZENE
CAS:4456-56-8
Formula: C9H9FO3
KIN01108427
1,1'-TELLUROBIS[4-METHYLBENZENE]
CAS:834-16-2
Formula: C13H22O2
KIN01031331
1,1'-TELLUROBIS[4-NITRO-BENZENE
CAS:63212-74-8
Formula: C12H8N2O4Te
KIN02488536
1,1'-TELLURONYLBIS[4-METHOXY-BENZENE
CAS:82342-66-3
Formula: C14H14O4Te
KIN02654974
1,1'-TEREPHTHALOYLBIS[4-METHYL-PIPERAZINE
CAS:104560-24-9
Formula: C18H26N4O2
KIN03062142
1,1'-TEREPHTHALOYLBIS[4-METHYL-PIPERAZINE 2HCL
CAS:94997-85-0
Formula: C18H26N4O2.2ClH
KIN02787148
1,1'-TETRADECAMETHYLENEDIPYRIDINIUM DIPERCHLORATE
CAS:15001-42-0
Formula: C24H38Cl2N2O8
KIN02037493
1,1'-TETRADECYLIDENEBISCYCLOHEXANE
CAS:55334-08-2
Formula: C18H20N2O2
KIN02364816
1,1'-TETRAMETHYLENEBIS(4-FORMYLPYRIDINIUM DIBROMIDE, DIOXIME
CAS:2438-49-5
Formula: C15H17N3O
KIN01069543
1,1'-TETRAMETHYLENEBIS[3-(P-2(1H)-1H-IMIDAZOLIN-2-YLPHENYL)UREA 2HCL
CAS:5737-47-3
Formula: C29H41ClN8O2
KIN01140442
1,1'-TETRAMETHYLENEBIS[3-[M-(4-METHYL-2(1H)-1H-IMIDAZOLIN-2-YL)PHENYL]UREA 2HCL
CAS:5726-79-4
Formula: C30H42N8O2.2ClH
KIN01140128
1,1'-TETRAMETHYLENEBIS[3-METHYL-3-NITROSO-UREA
CAS:92381-38-9
Formula: C8H16N6O4
KIN02756042
1,1'-TETRAMETHYLENEBIS[3-METHYL-UREA
CAS:20633-51-6
Formula: C8H18N4O2
KIN02092621
1,1'-TETRAMETHYLENEBIS[4-NITROPYRAZOLE
CAS:99185-95-2
Formula: C10H12N6O4
KIN02818773
1,1'-TETRAMETHYLENEBIS[TETRAHYDRO-THIOPHENIUM DIMETHANESULFONATE
CAS:6336-42-1
Formula: C12H10ClN5
KIN01159283
1,1'-TETRAMETHYLENEBISGUANIDINE
CAS:544-10-5
Formula: C6H13Cl
KIN01019181
1,1'-TETRASELENOBIS-PIPERIDINE
CAS:66168-04-5
Formula: C10H20N2Se4
KIN02538086
1,1'-TETRATHIOBIS-3-UNDECANONE
CAS:34852-29-4
KIN02217522
1,1'-TETRATHIOBIS-METHANETHIOAMIDE
CAS:13092-99-4
Formula: C2H4N2S6
KIN02014634
1,1'-TETRATHIOBIS[1-PIPERIDIN-1-YL-METHANETHIONE
CAS:120-55-8
Formula: C18H22O7
KIN01004963
1,1'-TETRATHIOBIS[1-PIPERIDIN-1-YLMETHANETHIONE
CAS:232278-71-6
Formula: C12H20N2S6
KIN03443336
1,1'-TETRATHIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:98020-35-0
KIN02809794
1,1'-TETRATHIOBIS[2,2,6,6-TETRAMETHYL-PIPERIDIN-4-ONE
CAS:72896-39-0
KIN02594558
1,1'-TETRATHIOBIS[3-PROPOXY-PROPAN-2-OL
CAS:143415-79-6
Formula: C12H26O4S4
KIN03270110
1,1'-TETRATHIOBIS[N,N-DIBUTYL-METHANETHIOAMIDE
CAS:93918-43-5
Formula: C18H36N2S6
KIN02775315
1,1'-TETRATHIOBIS[N,N-DICYCLOHEXYLMETHANETHIOAMIDE
CAS:5439-80-5
Formula: C16H10ClNO2
KIN01131243
1,1'-TETRATHIOBIS[N,N-DIMETHYL-2-PROPANAMINE
CAS:197721-94-1
Formula: C10H24N2S4
KIN03403010
1,1'-TETRATHIOBIS[N-METHYL-N-PHENYL-METHANETHIOAMIDE
CAS:103597-02-0
Formula: C16H16N2S6
KIN03669439
1,1'-THIANTHRENEDIYLBIS-ETHANONE
CAS:63415-73-6
Formula: C16H12O2S2
KIN02492281
1,1'-THIOBIS(2-(ETHYLSULFINYL)ETHANE
CAS:74857-98-0
KIN02608887
1,1'-THIOBIS(3,4-DICHLOROBENZENE
CAS:76745-12-5
Formula: C12H6Cl4S
KIN02621256
1,1'-THIOBIS(PROPAN-2-OL)
CAS:6704-17-2
KIN01168895
1,1'-THIOBIS-1H-IMIDAZOLE
CAS:16192-35-1
Formula: C6H6N4S
KIN02048729
1,1'-THIOBIS-2,5-PYRROLIDINEDIONE
CAS:65952-76-3
Formula: C8H8N2O4S
KIN02534863
1,1'-THIOBIS-2-PROPANONE
CAS:63578-76-7
Formula: C6H10O2S
KIN02495361
1,1'-THIOBIS-BUT-2-ENE
CAS:5622-74-2
KIN01137148
1,1'-THIOBIS-CYCLOPROPANOL
CAS:56460-03-8
Formula: C6H10O2S
KIN02383211
1,1'-THIOBIS-ETHYNE
CAS:51678-67-2
Formula: C4H2S
KIN02310058
1,1'-THIOBIS-NAPHTHALENE
CAS:607-54-5
Formula: C17H14N2
KIN01022026
1,1'-THIOBIS-PIPERIDINE
CAS:25116-80-7
Formula: C10H20N2S
KIN02136545
1,1'-THIOBIS[1,2,2-TRICHLORO-ETHENE
CAS:23248-52-4
Formula: C4Cl6S
KIN02118271
1,1'-THIOBIS[1-BROMO-ETHANE
CAS:61961-79-3
Formula: C4H8Br2S
KIN02465227
1,1'-THIOBIS[1-CHLORO-ETHENE
CAS:79552-39-9
Formula: C4H4Cl2S
KIN02638389
1,1'-THIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:18271-97-1
Formula: C4H4Cl6O2S
KIN02070478
1,1'-THIOBIS[2,2-BIS(ETHYLTHIO)ETHENE
CAS:89880-17-1
Formula: C12H22S5
KIN02718647
1,1'-THIOBIS[2,2-DIETHOXY-ETHANE
CAS:45204-84-0
Formula: C12H26O4S
KIN02284044
1,1'-THIOBIS[2,3,4,5,6-PENTABROMOBENZENE
CAS:60416-30-0
Formula: C12Br10S
KIN02444218
1,1'-THIOBIS[2,3,5,6-TETRAFLUORO-4-METHOXY-BENZENE
CAS:61907-45-7
Formula: C14H6F8O2S
KIN02464412
1,1'-THIOBIS[2,4,4,4-TETRACHLORO-BUTANE
CAS:62251-21-2
Formula: C8H10Cl8S
KIN02470955
1,1'-THIOBIS[2,4,5-TRIMETHYLBENZENE
CAS:61841-56-3
Formula: C18H22S
KIN02463016
1,1'-THIOBIS[2,4,6-TRIMETHYLBENZENE
CAS:5324-72-1
Formula: C5H9N3O6
KIN01125801
1,1'-THIOBIS[2,4-DIETHYLBENZENE
CAS:84666-68-2
Formula: C20H26S
KIN02669132
1,1'-THIOBIS[2,4-DIMETHYLBENZENE
CAS:20058-03-1
Formula: C16H18S
KIN02087800
1,1'-THIOBIS[2,4-DINITRO-BENZENE
CAS:2253-69-2
Formula: C14H20O
KIN01065851
1,1'-THIOBIS[2,5-DIMETHYLBENZENE
CAS:35019-02-4
Formula: C16H18S
KIN02219013
1,1'-THIOBIS[2,6-DIMETHYLBENZENE
CAS:52805-90-0
KIN02326016
1,1'-THIOBIS[2,6-DINITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:59983-53-8
Formula: C14H4F6N4O8S
KIN02440428
1,1'-THIOBIS[2-(1-METHYLETHYL)-BENZENE
CAS:474318-29-1
Formula: C18H22S
KIN03601082
1,1'-THIOBIS[2-(2-CHLORO-ETHOXY) ETHANE
CAS:52559-89-4
Formula: C8H16Cl2O2S
KIN02322737
1,1'-THIOBIS[2-(4-NITROPHENYL)-DIAZENE
CAS:67842-68-6
Formula: C12H8N6O4S
KIN02558639
1,1'-THIOBIS[2-(ETHYLTHIO)ETHANE
CAS:6052-47-7
KIN01148467
1,1'-THIOBIS[2-(METHYLTHIO)ETHANE]
CAS:37460-04-1
Formula: C6H14S3
KIN02239511
1,1'-THIOBIS[2-[(2-BROMOETHYL)THIO]-ETHANE
CAS:89595-63-1
Formula: C8H16Br2S3
KIN02714079
1,1'-THIOBIS[2-[(2-CHLORO-ETHYL)THIO]-ETHANE
CAS:51472-73-2
Formula: C8H16Cl2S3
KIN02306984
1,1'-THIOBIS[2-BROMOBENZENE
CAS:21848-84-0
Formula: C12H8Br2S
KIN02104701
1,1'-THIOBIS[2-CHLORO-2-METHYLPROPANE
CAS:52444-00-5
Formula: C8H16Cl2S
KIN02321231
1,1'-THIOBIS[2-CHLORO-4-NITRO-BENZENE
CAS:65369-91-7
Formula: C12H6Cl2N2O4S
KIN02525657
1,1'-THIOBIS[2-FLUOROBENZENE
CAS:279217-70-8
Formula: C12H8F2S
KIN03466203
1,1'-THIOBIS[2-ISOCYANATO-BENZENE
CAS:1081842-29-6
Formula: C14H8N2O2S
KIN05118058
1,1'-THIOBIS[2-ISOCYANATO-ETHANE
CAS:25574-83-8
KIN02141114
1,1'-THIOBIS[2-METHOXY-4-METHYLBENZENE
CAS:1129264-45-4
Formula: C16H18O2S
KIN05182138
1,1'-THIOBIS[2-METHOXY-BENZENE
CAS:126770-56-7
Formula: C14H14O2S
KIN03194537
1,1'-THIOBIS[2-METHOXY-ETHANE
CAS:22428-72-4
Formula: C6H14O2S
KIN02110576
1,1'-THIOBIS[2-METHYL-2-PENTENE
CAS:90850-90-1
Formula: C12H22S
KIN02734473
1,1'-THIOBIS[2-METHYL-4-PENTEN-2-OL
CAS:97325-35-4
Formula: C12H22O2S
KIN02805536
1,1'-THIOBIS[2-METHYLBENZENE
CAS:4537-09-1
Formula: C11H16O2
KIN01110053
1,1'-THIOBIS[2-METHYLBUTANE
CAS:96034-00-3
Formula: C10H22S
KIN02797396
1,1'-THIOBIS[2-NITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:365-60-6
Formula: C13H9F3N2O2
KIN01012155
1,1'-THIOBIS[2-NITRO-BENZENE
CAS:22100-66-9
Formula: C12H8N2O4S
KIN02107245
1,1'-THIOBIS[2-NITRO-ETHANE
CAS:64820-00-4
Formula: C4H8N2O4S
KIN02516221
1,1'-THIOBIS[2-PHENYL-DIAZENE
CAS:22755-07-3
Formula: C12H10N4S
KIN02113445
1,1'-THIOBIS[2-PYRIDIN-3-YL-PIPERIDINE
CAS:63095-02-3
Formula: C20H26N4S
KIN02486271
1,1'-THIOBIS[3,3-DIMETHYLBUTAN-2-ONE
CAS:52196-65-3
Formula: C12H22O2S
KIN02317724
1,1'-THIOBIS[3,4-DIMETHOXY-BENZENE
CAS:70339-52-5
Formula: C16H18O4S
KIN02576830
1,1'-THIOBIS[3,4-DIMETHYLBENZENE
CAS:61841-55-2
Formula: C16H18S
KIN02463015
1,1'-THIOBIS[3,5-DICHLOROBENZENE
CAS:20805-43-0
KIN02094093
1,1'-THIOBIS[3,5-DIMETHYLBENZENE
CAS:148278-62-0
KIN03288920
1,1'-THIOBIS[3-(METHYLTHIO)-BENZENE
CAS:135489-58-6
KIN03233113
1,1'-THIOBIS[3-(PHENYLAMINO)-2-PROPANOL
CAS:38557-23-2
Formula: C18H24N2O2S
KIN02248810
1,1'-THIOBIS[3-(PHENYLTHIO)-BENZENE]
CAS:2392-86-1
Formula: C12H8Br2S
KIN01068489
1,1'-THIOBIS[3-(TERT-BUTYL)-2-METHOXY-5-METHYLBENZENE
CAS:54519-53-8
Formula: C24H34O2S
KIN02351218
1,1'-THIOBIS[3-[(4-ETHOXY-PHENYL) AMINO]-2-PROPANOL
CAS:55011-59-1
KIN02359210
1,1'-THIOBIS[3-[(4-METHOXY-PHENYL) AMINO]-2-PROPANOL
CAS:55011-58-0
Formula: C20H28N2O4S
KIN02359209
1,1'-THIOBIS[3-BROMOBENZENE]
CAS:2392-87-2
Formula: C29H21NO4
KIN01068490
1,1'-THIOBIS[3-CHLORO-4-METHYLBENZENE
CAS:61309-30-6
Formula: C14H12Cl2S
KIN02454084
1,1'-THIOBIS[3-CHLORO-4-NITRO-BENZENE
CAS:63063-21-8
Formula: C12H6Cl2N2O4S
KIN02485680
1,1'-THIOBIS[3-CHLORO-BUT-2-ENE
CAS:55882-20-7
Formula: C8H12Cl2S
KIN02373839
1,1'-THIOBIS[3-CHLOROPROPANE
CAS:55882-21-8
Formula: C6H12Cl2S
KIN02373840
1,1'-THIOBIS[3-ETHENYL-4-METHOXY-BENZENE
CAS:94229-06-8
Formula: C18H18O2S
KIN02779385
1,1'-THIOBIS[3-ETHENYL-5-METHYLBENZENE
CAS:1004519-22-5
Formula: C18H18S
KIN05009584
1,1'-THIOBIS[3-ETHENYLBENZENE
CAS:94240-41-2
Formula: C16H14S
KIN02779608
1,1'-THIOBIS[3-ETHYLBENZENE
CAS:84666-67-1
Formula: C16H18S
KIN02669131
1,1'-THIOBIS[3-FLUOROBENZENE
CAS:21099-60-5
KIN02097342
1,1'-THIOBIS[3-ISOCYANATO-BENZENE
CAS:71865-95-7
Formula: C14H8N2O2S
KIN02587476
1,1'-THIOBIS[3-ISOCYANATO-PROPANE
CAS:19350-78-8
KIN02080493
1,1'-THIOBIS[3-METHOXY-BENZENE
CAS:134953-13-2
KIN03230636
1,1'-THIOBIS[3-METHYL-4-NITRO-BENZENE
CAS:401636-45-1
Formula: C14H12N2O4S
KIN03562652
1,1'-THIOBIS[3-METHYLBENZENE
CAS:3111-78-2
KIN01082545
1,1'-THIOBIS[3-NITRO-BENZENE
CAS:37755-03-6
KIN02242293
1,1'-THIOBIS[3-PHENOXY-BENZENE]
CAS:7372-94-3
Formula: C24H18OS2
KIN01185347
1,1'-THIOBIS[3-PYRIDIN-2-YL-PIPERIDINE
CAS:63095-04-5
Formula: C20H26N4S
KIN02486273
1,1'-THIOBIS[3-PYRIDIN-2-YL-PIPERIDINE PICRATE
CAS:63095-05-6
Formula: C20H26N4S.C6H3N3O7
KIN02486274
1,1'-THIOBIS[4,5-DIFLUORO-2-NITRO-BENZENE
CAS:322-68-9
Formula: C12H9FN2O2
KIN01010316
1,1'-THIOBIS[4-(1,2-PROPADIENYLOXY) -BENZENE
CAS:127265-86-5
KIN03196637
1,1'-THIOBIS[4-(1-METHYLETHENYL)-BENZENE
CAS:60503-50-6
Formula: C18H18S
KIN02444978
1,1'-THIOBIS[4-(2,3-DIBROMOPROPOXY) -BENZENE
CAS:99890-15-0
Formula: C18H18Br4O2S
KIN02823377
1,1'-THIOBIS[4-(3-ETHYNYLPHENOXY) -BENZENE
CAS:82200-45-1
Formula: C28H18O2S
KIN02654101
1,1'-THIOBIS[4-(ALLYLOXY) -BENZENE
CAS:99873-56-0
Formula: C18H18O2S
KIN02823324
1,1'-THIOBIS[4-(CHLOROMETHYL)-BENZENE
CAS:1216-03-1
Formula: C14H10O2S
KIN01043866
1,1'-THIOBIS[4-(METHOXYMETHYL) -BENZENE
CAS:32449-05-1
KIN02197167
1,1'-THIOBIS[4-(METHYLTHIO)-BENZENE
CAS:125877-23-8
Formula: C14H14S3
KIN03190587
1,1'-THIOBIS[4-(PHENYLTHIO)-BENZENE
CAS:3379-98-4
KIN01088024
1,1'-THIOBIS[4-(PROPARGYLOXY) -BENZENE
CAS:119869-98-6
KIN03161037
1,1'-THIOBIS[4-(TERT-BUTYL)-BENZENE
CAS:52908-55-1
Formula: C20H26S
KIN02327531
1,1'-THIOBIS[4-(TRIFLUOROMETHYL)-BENZENE
CAS:90141-51-8
Formula: C14H8F6S
KIN02723003
1,1'-THIOBIS[4-[(2-CHLORO-ETHYL)SULFONYL]BENZENE
CAS:189358-84-7
Formula: C16H16Cl2O4S3
KIN03388846
1,1'-THIOBIS[4-[(2-CHLORO-ETHYL)THIO]BENZENE
CAS:152419-82-4
Formula: C14H12Cl2S3
KIN03302034
1,1'-THIOBIS[4-AZIDO-BENZENE]
CAS:6427-98-1
KIN01162126
1,1'-THIOBIS[4-BROMOMETHYLBENZENE
CAS:90549-27-2
Formula: C14H12Br2S
KIN02729771
1,1'-THIOBIS[4-BUTYLBENZENE
CAS:205241-16-3
KIN03414672
1,1'-THIOBIS[4-CHLORO-2-NITRO-BENZENE
CAS:36441-61-9
Formula: C12H6Cl2N2O4S
KIN02231891
1,1'-THIOBIS[4-CHLORO-3-NITRO-BENZENE
CAS:63063-17-2
Formula: C12H6Cl2N2O4S
KIN02485676
1,1'-THIOBIS[4-ETHENYL-2,5-DIMETHYLBENZENE
CAS:1004519-21-4
Formula: C20H22S
KIN05009583
1,1'-THIOBIS[4-ETHENYL-2-METHYLBENZENE
CAS:1004519-20-3
Formula: C18H18S
KIN05009582
1,1'-THIOBIS[4-ETHENYLBENZENE
CAS:93013-00-4
Formula: C16H14S
KIN02764250
1,1'-THIOBIS[4-ETHOXY-BENZENE
CAS:20057-98-1
KIN02087798
1,1'-THIOBIS[4-ETHYLBENZENE
CAS:132260-92-5
Formula: C16H18S
KIN03217904
1,1'-THIOBIS[4-ETHYNYL-2,3,5,6-TETRAFLUOROBENZENE
CAS:127052-12-4
Formula: C16H2F8S
KIN03195717
1,1'-THIOBIS[4-ETHYNYLBENZENE
CAS:27594-21-4
KIN02158756
1,1'-THIOBIS[4-ETHYNYLBENZENE TRIMER
CAS:35617-38-0
KIN02224766
1,1'-THIOBIS[4-FLUOROBENZENE
CAS:404-39-7
KIN01013776
1,1'-THIOBIS[4-ISOCYANATO-BENZENE
CAS:14353-02-7
Formula: C14H8N2O2S
KIN02031008
1,1'-THIOBIS[4-METHYL-PIPERAZINE
CAS:36938-53-1
KIN02235528
1,1'-THIOBIS[5,5,5-TRICHLOROPENTANE
CAS:14146-66-8
Formula: C10H16Cl6S
KIN02028697
1,1'-THIOBIS[5-CHLORO-2,4-DIMETHOXY-BENZENE
CAS:78046-26-1
Formula: C16H16Cl2O4S
KIN02628953
1,1'-THIOBIS[5-CHLORO-2-METHOXY-BENZENE
CAS:75024-24-7
Formula: C14H12Cl2O2S
KIN02609937
1,1'-THIOBIS[5-CHLORO-2-METHYLBENZENE
CAS:1071713-20-6
Formula: C14H12Cl2S
KIN05113501
1,1'-THIOBIS[METHOXY-BENZENE
CAS:67784-44-5
Formula: C14H14O2S
KIN02557927
1,1'-THIOBIS[METHYLBENZENE
CAS:26898-12-4
Formula: C14H14S
KIN02152174
1,1'-THIOBIS[N,N-DIMETHYLMETHANAMINE]
CAS:5695-41-0
Formula: C20H21ClN2O
KIN01139283
1,1'-THIOBISBENZENE TETRACHLORO-DERIV
CAS:55741-09-8
Formula: C12H6Cl4S
KIN02371378
1,1'-THIOCARBONYL-DI-PYRIDIN-2(1H)-ONE
CAS:102368-13-8
Formula: [C11H8N2O2S
KIN03046652
1,1'-THIODINAPHTHALEN-2-OL
CAS:17096-15-0
Formula: C20H14O2S
KIN02058151
MFCD00046469
1,1'-TRANS-1,3-CYCLOBUTANEDIYLBIS-BENZENE
CAS:25558-23-0
Formula: C16H16
KIN02140911
1,1'-TRANS-ETHEN-1,2-DIYL-DICYCLOPROPANE
CAS:10359-44-1
Formula: C8H12
KIN02005446
1,1'-TRICYCLO[8.2.2.24,7]HEXADECA-4,6,10,12,13,15-HEXAENE-5,11-DIYLBIS[1,1-DIPHENYL-PHOSPHINE
CAS:192463-40-4
Formula: C40H34P2
KIN03394145
1,1'-TRIMETHYLENEBIS[4-NITROPYRAZOLE
CAS:99179-33-6
Formula: C9H10N6O4
KIN02818611
1,1'-TRIMETHYLENEDI-CYCLOPENTANOL
CAS:100545-02-6
Formula: C13H24O2
KIN03032741
1,1'-TRISELENOBIS[N,N-DIBUTYL-METHANESELENOAMIDE
CAS:99077-77-7
Formula: C18H36N2Se5
KIN02818035
1,1'-TRISELENOBIS[N,N-DIETHYL-METHANESELENOAMIDE]
CAS:60003-30-7
Formula: C10H20N2Se5
KIN02440690
1,1'-TRITHIO-COBALTOCENIUM
CAS:71750-90-8
KIN02586629
1,1'-TRITHIO-COBALTOCENIUM HEXAFLUOROPHOSPHATE(I)
CAS:71750-91-9
KIN02586630
1,1'-TRITHIO-FERROCENE
CAS:32677-78-4
Formula: C10H8FeS3
KIN02199105
1,1'-TRITHIO-OSMOCENE
CAS:138599-22-1
Formula: C10H8OsS3
KIN03247751
1,1'-TRITHIO-RUTHENOCENE
CAS:91607-76-0
KIN02746347
1,1'-TRITHIOBIS-2-BUTANOL
CAS:101387-85-3
Formula: C8H18O2S3
KIN03038975
1,1'-TRITHIOBIS-2-PROPANOL
CAS:100449-98-7
Formula: C6H14O2S3
KIN03031880
1,1'-TRITHIOBIS-2-PROPANONE
CAS:80389-33-9
Formula: C6H10O2S3
KIN02643767
1,1'-TRITHIOBIS-3-PENTANONE
CAS:156301-58-5
Formula: C10H18O2S3
KIN03315106
1,1'-TRITHIOBIS-3-UNDECANONE
CAS:34852-28-3
KIN02217521
1,1'-TRITHIOBIS-METHANIMIDAMIDE
CAS:74173-42-5
Formula: C2H6N4S3
KIN02603801
1,1'-TRITHIOBIS-METHANIMIDAMIDE 2HBR
CAS:1036714-42-7
Formula: C2H8Br2N4S3
KIN05072722
1,1'-TRITHIOBIS-METHANIMIDAMIDE DIPERCHLORATE
CAS:74173-43-6
Formula: C2H8Cl2N4O8S3
KIN02603802
1,1'-TRITHIOBIS-NAPHTHALEN-2-OL
CAS:80389-34-0
KIN02643768
1,1'-TRITHIOBIS[1,1-DICHLORO-3,3-DIMETHYLBUTAN-2-ONE
CAS:74128-89-5
KIN02603526
1,1'-TRITHIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:98020-34-9
KIN02809793
1,1'-TRITHIOBIS[2,2,6,6-TETRAMETHYL-PIPERIDIN-4-ONE
CAS:14045-12-6
KIN02027534
1,1'-TRITHIOBIS[3-(ALLYLOXY) -2-PROPANOL
CAS:339186-87-7
Formula: C12H22O4S3
KIN03512360
1,1'-TRITHIOBIS[3-PHENOXY-2-PROPANOL
CAS:110144-53-1
Formula: C18H22O4S3
KIN03099550
1,1'-TRITHIOBIS[N,N-DIBUTYL-METHANETHIOAMIDE
CAS:93918-42-4
Formula: C18H36N2O2S3
KIN02775314
1,1'-TRITHIOBIS[N-BROMO-FORMIMIDOYL BROMIDE
CAS:90462-82-1
KIN02728254
1,1'-TRITHIOBIS[N-ETHYL-N-PHENYL-METHANETHIOAMIDE
CAS:1129288-90-9
Formula: C18H20N2S5
KIN05182234
1,1'-UNDECYLIDENEBIS(DECAHYDRONAPHTHALENE)
CAS:55373-96-1
Formula: C31H56
KIN02365341
1,1'-VINYLENEBIS(3,3-DIMETHYL-UREA)
CAS:73840-17-2
Formula: C8H16N4O2
KIN02601300
1,1'-VINYLIDENEBISCYCLOPROPANE
CAS:822-94-6
KIN01030671
1,1'-YLCARBONYLBIS-1H-BENZO[D]IMIDAZOLE
CAS:14667-54-0
Formula: C15H10N4O
KIN02034399
1,1'-YLCARBONYLBIS-AZIRIDINE
CAS:1192-76-3
Formula: C4H8N2OS
KIN01042699
1,1'-YLSULFONYLBIS[2-METHOXY-ETHANE]
CAS:7209-47-4
KIN01181275
1,1'-YLSULFONYLBIS[2-METHYL-AZIRIDINE
CAS:1623-88-7
Formula: C6H5ClO2
KIN01051827
1,1'-YLSULFONYLBIS[4-(TERT-BUTYL)-BENZENE]
CAS:5453-71-4
Formula: C15H14O4S
KIN01132289
1,1'-YLSULFONYLBIS[4-CHLORO-3,5-DINITRO-BENZENE]
CAS:6462-05-1
KIN01162825
1,1':1',1 -TERCYCLOBUTANE
CAS:224824-01-5
Formula: C12H20
KIN03439752
1,1':2',1 -TERCYCLOHEXANE
CAS:2456-45-3
Formula: C23H24O
KIN01069931
1,1':2',1 -TERNAPHTHALENE
CAS:141356-07-2
Formula: C30H20
KIN03259772
1,1':2',1 -TERPHENYL
CAS:84-16-2
Formula: C18H22O2
KIN01001897
1,1':2',1 -TERPHENYL, 2,3,4,5-TETRACHLORO-,
CAS:106105-06-0
Formula: C18H10Cl4
KIN03073924
1,1':2',1 -TERPHENYL, 3',4',5',6'-TETRAPHENYL-4-(PHENYLETHYNYL)-,
CAS:284494-77-5
Formula: C50H34
KIN03467971
1,1':2',1 -TERPHENYL, 3-CHLORO-4-FLUORO-4 -(METHYLSULFONYL)-,
CAS:175883-06-4
Formula: C19H14ClFO2S
KIN03359872
1,1':2',1 -TERPHENYL, 4,4 -DIMETHOXY-,
CAS:160538-35-2
Formula: C20H18O2
KIN03326365
1,1':2',1 -TERPHENYL, 4,4',5'-TRIFLUORO-4 -(METHYLSULFONYL)-,
CAS:175883-15-5
Formula: C19H13F3O2S
KIN03359873
1,1':2',1 -TERPHENYL, 4-BROMO-3',4',5'-TRIPHENYL-,
CAS:330649-92-8
Formula: C36H25Br
KIN03502084
1,1':2',1 -TERPHENYL, 4-BROMO-4'-(4-BROMOPHENYL)-4 -METHOXY-3'-PHENYL-,
CAS:137839-66-8
Formula: C31H22Br2O
KIN03243625
1,1':2',1 -TERPHENYL, 4-NITRO-4'-(4-NITROPHENYL)-3',5',6'-TRIPHENYL-,
CAS:121264-22-0
Formula: C42H28N2O4
KIN03168820
1,1':2',1 :2 ,1 '-QUATERPHENYL
CAS:641-98-5
Formula: C14H6F6N2O4
KIN01024116
1,1':2',1 :2 ,1 ':2 ',1 :2 ,1 '-SEXIPHENYL
CAS:4740-57-2
Formula: C17H16OS2
KIN01113688
1,1':2',1 :3 ,1 '-QUATERPHENYL
CAS:1165-58-8
Formula: C24H18
KIN01042068
1,1':2',1 :3 ,1 ':2 ',1 -QUINQUEBENZENE
CAS:5660-38-8
Formula: C30H22
KIN01138152
1,1':2',1 :3 ,1 ':4 ',1 -QUINQUEPHENYL
CAS:5660-41-3
Formula: C15H13NO4
KIN01138153
1,1':2,2'-BIS(TRITHIO)-FERROCENE
CAS:147281-47-8
Formula: C10H6FeS6
KIN03285413
1,1':3',1 -TERCYCLOHEXANE
CAS:1706-52-1
Formula: C9H9ClO3S
KIN01053831
1,1':3',1 -TERPHENYL
CAS:92-07-9
Formula: C17H13N
KIN01002574
1,1':3',1 -TERPHENYL, 2'-BROMO-4,4 -BISBROMOMETHYL-,
CAS:154488-09-2
Formula: C20H15Br3
KIN03308991
1,1':3',1 -TERPHENYL, 2'-IODO-2,2 ,4,4 ,5',6,6 -HEPTAMETHYL-,
CAS:192071-13-9
Formula: C25H27I
KIN03393453
1,1':3',1 -TERPHENYL, 2'-IODO-2,2 ,4,4 ,6,6 -HEXAKIS(1-METHYLETHYL)-,
CAS:174272-36-7
Formula: C36H49I
KIN03355380
1,1':3',1 -TERPHENYL, 2'-IODO-2,2 -BIS(1-METHYLETHYL)-,
CAS:198023-04-0
Formula: C24H25I
KIN03403772
1,1':3',1 -TERPHENYL, 2'-IODO-4,4 -DIMETHOXY-,
CAS:328249-41-8
Formula: C20H17IO2
KIN03498531
1,1':3',1 -TERPHENYL, 2,2 ,4,4 ,6,6 -HEXAMETHYL-,
CAS:103068-13-9
Formula: C24H26
KIN03051696
1,1':3',1 -TERPHENYL, 2,2 ,6,6 -TETRAKISBROMOMETHYL-,
CAS:116129-61-4
Formula: C22H18Br4
KIN03141143
1,1':3',1 -TERPHENYL, 3,3 ,4,4 -TETRAMETHYL-,
CAS:115424-59-4
Formula: C22H22
KIN03137169
1,1':3',1 -TERPHENYL, 3,3 -BISBROMOMETHYL-5'-[3-BROMOMETHYLPHENYL]-,
CAS:109978-08-7
Formula: C27H21Br3
KIN03098532
1,1':3',1 -TERPHENYL, 4,4 -BIS(PHENYLETHYNYL)-5'-[4-(PHENYLETHYNYL)PHENYL]-,
CAS:164025-88-1
Formula: C48H30
KIN03334909
1,1':3',1 -TERPHENYL, 4,4 -DIMETHYL-2'-NITRO-5'-PHENYL-,
CAS:102949-26-8
Formula: C26H21NO2
KIN03050939
1,1':3',1 -TERPHENYL, 4,4 -DIPHENOXY-,
CAS:162607-95-6
Formula: C30H22O2
KIN03331885
1,1':3',1 -TERPHENYL, 4-PHENOXY-,
CAS:101798-19-0
Formula: C24H18O
KIN03041852
1,1':3',1 -TERPHENYL, 5'-BROMO-2,2 ,4,4 ,6,6 -HEXAKIS(1-METHYLETHYL)-,
CAS:443295-47-4
Formula: C36H49Br
KIN03585107
1,1':3',1 -TERPHENYL, 5'-BROMO-2,2 ,6,6 -TETRAMETHYL-,
CAS:135989-99-0
Formula: C22H21Br
KIN03235135
1,1':3',1 -TERPHENYL, 5'-BROMOMETHYL-,
CAS:100094-00-6
Formula: C19H15Br
KIN03028452
1,1':3',1 -TERPHENYL,2,2',2 ,4,4',4 ,6,6',6 -NONANITRO-5'-(2,4,6-TRINITROPHENYL)-,
CAS:125010-19-7
Formula: C24H6N12O24
KIN03186681
1,1':3',1 :4 ,1 '-QUATERPHENYL
CAS:1166-23-0
KIN01042083
1,1':4',1 -TERPHENYL, 2',3 -DIFLUORO-4-OCTYL-4 -(OCTYLOXY) -,
CAS:129271-66-5
Formula: C34H44F2O
KIN03205161
1,1':4',1 -TERPHENYL, 2',3',5',6'-TETRAMETHYL-,
CAS:145588-14-3
Formula: C22H22
KIN03280066
1,1':4',1 -TERPHENYL, 2',3'-DIFLUORO-4,4 -DIPENTYL-,
CAS:121218-76-6
Formula: C28H32F2
KIN03168523
1,1':4',1 -TERPHENYL, 2',3'-DIFLUORO-4-HEPTYL-4 -PENTYL-,
CAS:121235-87-8
Formula: C30H36F2
KIN03168633
1,1':4',1 -TERPHENYL, 2',3'-DIFLUORO-4-PENTYL-4 -PROPYL-,
CAS:121218-79-9
Formula: C26H28F2
KIN03168524
1,1':4',1 -TERPHENYL, 2',5'-BIS(HEXYLOXY) -,
CAS:241802-54-0
Formula: C30H38O2
KIN03446075
1,1':4',1 -TERPHENYL, 2',5'-BISBROMOMETHYL-,
CAS:135078-57-8
Formula: C20H16Br2
KIN03231321
1,1':4',1 -TERPHENYL, 2',5'-DIHEXYL-,
CAS:178426-66-9
Formula: C30H38
KIN03364792
1,1':4',1 -TERPHENYL, 2'-FLUORO-4 -(METHYLTHIO)-4-PROPYL-,
CAS:159896-18-1
Formula: C22H21FS
KIN03324650
1,1':4',1 -TERPHENYL, 2'-METHYL-4,4 -BIS(DECYCLOXY) -,
CAS:162047-76-9
Formula: C39H56O2
KIN03330546
1,1':4',1 -TERPHENYL, 2,2 ,5,5 -TETRAMETHOXY-4,4 -DIMETHYL-,
CAS:382595-15-5
Formula: C24H26O4
KIN03550740
1,1':4',1 -TERPHENYL, 2,3-DIFLUORO-4,4 -DIPROPYL-,
CAS:121218-89-1
Formula: C24H24F2
KIN03168526
1,1':4',1 -TERPHENYL, 3,3 ,5,5 -TETRAKIS(TERT-BUTYL)-,
CAS:104700-13-2
Formula: C34H46
KIN03063219
1,1':4',1 -TERPHENYL, 3,5-DIFLUORO-4 -PENTYL-,
CAS:137528-86-0
Formula: C23H22F2
KIN03242012
1,1':4',1 -TERPHENYL, 3-(1-METHYLETHYL)-,
CAS:128007-63-6
Formula: C21H20
KIN03199954
1,1':4',1 -TERPHENYL, 4,4 -BIS(2,2-DIPHENYLETHENYL)-,
CAS:213527-39-0
Formula: C46H34
KIN03425145
1,1':4',1 -TERPHENYL, 4,4 -BIS[(4-CHLOROPHENYL)SULFONYL]-,
CAS:125430-15-1
Formula: C30H20Cl2O4S2
KIN03188623
1,1':4',1 -TERPHENYL, 4-(METHYLTHIO)-,
CAS:103561-47-3
Formula: C19H16S
KIN03054597
1,1':4',1 -TERPHENYL, 4-BUTYL-4 -ETHYL-2',3'-DIFLUORO-,
CAS:486406-09-1
Formula: C24H24F2
KIN03610629
1,1':4',1 -TERPHENYL, 4-ETHOXY-2,3-DIFLUORO-4 -PENTYL-,
CAS:121218-93-7
Formula: C25H26F2O
KIN03168528
1,1':4',1 -TERPHENYL, 4-PENTYL-4 -(TRANS-4-PROPYLCYCLOHEXYL) -,
CAS:394738-45-5
Formula: C32H40
KIN03558800
1,1':4',1 -TERPHENYL,2,3,5,6-TETRACHLORO-,
CAS:61576-99-6
Formula: C18H10Cl4
KIN02458255
1,1':4',1 -TERPHENYL,4,4 -BIS(1,1-DIMETHYLPROPYL)-,;
CAS:121838-04-8
Formula: C28H34
KIN03646879
1,1':4',1 :2 ,1 ':2 ',1 :4 ,1 '-SEXIPHENYL
CAS:5080-62-6
KIN01120353
1,1':4',1 :4 ,1 '-QUATERPHENYL
CAS:135-71-7
Formula: C26H16N2Na2O4
KIN01005912
1,1':4',1 :4 ,1 '-QUATERPHENYL-4,4 '-DIAMINE
CAS:78486-88-1
KIN02631827
1,1':4',1 :4 ,1 ':4 ',1 -QUINQUEPHENYL
CAS:3073-26-5
Formula: C11H14N4O6
KIN01081908
1,1':4',1 :4 ,1 ':4 ',1 :4 ,1 '-SEXIPHENYL
CAS:4499-84-7
Formula: C20H20
KIN01109396
1,1':4',1 :4 ,1 ':4 ',1 :4 ,1 '-SEXIPHENYL, 2',3 -DIMETHYL-,
CAS:120956-76-5
Formula: C38H30
KIN03167164
1,1':4',1 :4 ,1 ':4 ',1 :4 ,1 ':4 ',1 -SEPTIPHENYL, 2 ',5 '-DIDECYL-,
CAS:165330-09-6
Formula: C62H70
KIN03337104
1,1':4',1'-TERPHENYL-4,4'-DIOL
CAS:4084-48-4
Formula: C6H6ClN
KIN01100712
1,1':9,9'-DIEPOXY[BI[5,6]FULLERENE-C60-IH]
CAS:208348-40-7
Formula: C120O2
KIN03418717
1,1(4H)-NAPHTHALENEDICARBOXYLIC ACID 1,1-DIMETHYL ESTER
CAS:126857-46-3
KIN03635571
1,1(OR 1,3)-DIMETHYL-PERIMIDINIUM IODIDE
CAS:27228-38-2
Formula: C12H10N2.CH3I
KIN02155312
1,1(OR 1,4)-DIMETHYL-4(OR 1)-[2-(P-PHENOXY(PHENYLAMINO))ETHYL]PIPERAZINIUM IODIDE
CAS:14277-58-8
KIN02030173
1,1,1 ,1 -TETRAETHYL-5',14',20',29',32',33',36',37'-OCTAMETHOXY-DISPIRO[PIPERIDIN-4,2'-[7,12,22,27]TETRAOXAPENTACYCLO[26.2.2.23,6.213,16.218,21]OCTATRIACONTA[3,5,13,15,18,20,28,30,31,33,35,37]DODECAENE-17',4 -PIPERIDINIUM] DICHLORIDE ROTAXANE COMPD. WITH 4,4'-[3-(4-ETH
CAS:212246-46-3
Formula: C58H84N2O12.C23H20N2O.4Cl
KIN03423706
1,1,1 ,1 -TETRAETHYL-5',14',20',29',32',33',36',37'-OCTAMETHOXY-DISPIRO[PIPERIDIN-4,2'-[7,12,22,27]TETRAOXAPENTACYCLO[26.2.2.23,6.213,16.218,21]OCTATRIACONTA[3,5,13,15,18,20,28,30,31,33,35,37]DODECAENE-17',4 -PIPERIDINIUM] DICHLORIDE ROTAXANE COMPD. WITH 4,4'-[3-[4-[(4
CAS:212246-54-3
Formula: C58H84N2O12.C31H24N2O.4Cl
KIN03423712
1,1,1 -, TRIFLUORO-2'-, METHYL-3'-, NITRO -, 2'-, PROPANOL
CAS:428-71-7
Formula: C3F7N
KIN01014244
1,1,1 -[[(2R)-3-(HEXADECYCLOXY)-2-(5-HEXEN-1-YLOXY)-PROPOXY]METHYLIDYNE]TRIS-BENZENE
CAS:431063-04-6
Formula: C44H64O3
KIN03577975
1,1,1'-(5-METHYLHEXAN-1,3,5-TRIYL) TRIBENZENE
CAS:7399-66-8
Formula: C8H14N3O2+
KIN01185896
1,1,1'-[2-(BENZENESULFONYL)ETHENE-1,1,2-TRIYL]TRIBENZENE
CAS:41946-66-1
Formula: C26H20O2S
KIN02274649
1,1,1'-METHANEDIYLYLIDENETRICYCLOPROPANE
CAS:37559-52-7
Formula: C10H14
KIN02240498
1,1,1'-METHANETRIYLTRIS(3,4-DIMETHOXY-BENZENE)
CAS:5450-53-3
Formula: C32H48O2
KIN01132050
1,1,1'-PHOSPHORYLTRIS[2-(2-METHYLPROPYL)AZIRIDINE]
CAS:5774-45-8
Formula: C24H24N3OP
KIN01141379
1,1,1'-PROP-1-EN-1,3,3-TRIYLTRIBENZENE
CAS:6281-48-7
Formula: C15H25NO2
KIN01155192
1,1,1'-TRIMETHYL-3-BROMO-2,3'-2'-3'-TRIINDOLYL
CAS:109005-14-3
Formula: C27H22BrN3
KIN03092669
1,1,1'-TRIS(HYDROXYMETHYL) ETHANE, TRIFORMATE
CAS:120570-78-7
Formula: C8H12O6
KIN03165109
1,1,1,1'-(5-BENZYLIDENECYCLOPENTA-1,3-DIENE-1,2,3,4-TETRAYL)-TETRABENZENE
CAS:6937-60-6
Formula: C11H16ClNO2
KIN01173096
1,1,1,1'-[(3,4-DICHLORO-CYCLOBUTANE-1,2-DIYLIDENE)DIMETHANEDIYLYLIDENE]TETRABENZENE
CAS:4283-98-1
Formula: C50H42P2.2Br
KIN01104456
1,1,1,1'-ETHANE-1,1,2,2-TETRAYL-TETRAKIS(4-NITRO-BENZENE)
CAS:7111-63-9
Formula: C13H8Cl2O2
KIN01178830
1,1,1,1'-ETHENE-1,1,2,2-TETRAYL-TETRAKIS(4-FLUOROBENZENE)
CAS:435-96-1
KIN01014467
1,1,1,1'-TETRAMETHYL-2,2'-PROPANEDIYL-BIS-PIPERIDINIUM, DIIODIDE
CAS:34947-70-1
Formula: C17H36IN2+
KIN02218410
1,1,1,1,2,2,3,3,4,4,5,5-DODECAFLUOROTHIEPANE
CAS:24345-53-7
Formula: C6H4F12S
KIN02129541
1,1,1,1,2,2-HEXAFLUOROTHIETANE
CAS:24345-51-5
Formula: C3H4F6S
KIN02129540
1,1,1,1-(1,4-BUTANEDIYLIDENE)-TETRAKIS-BENZENE
CAS:1483-67-6
Formula: C7H10O2
KIN01048169
1,1,1,1-(1-PROPYN-1-YL-3-YLIDYNE)-TETRAKIS-BENZENE
CAS:20143-13-9
Formula: C27H20
KIN02088525
1,1,1,1-TETRACHLORO-N,N-DIETHYL-PHOSPHORANAMINE
CAS:64265-89-0
Formula: C4H10Cl4NP
KIN02507019
1,1,1,1-TETRAFLUORO-N,N-DIMETHYL-PHOSPHORANAMINE
CAS:2354-04-3
Formula: C3Cl4F4
KIN01067583
1,1,1,1-TETRAHYDRO-1,1-DIIMINO-THIOPHENE
CAS:260969-93-5
KIN03458595
1,1,1,1-TETRAMETHYLAZOXY-ETHANE
CAS:2406-29-3
Formula: C10H16O2
KIN01068822
1,1,1,10,10,10-HEXAFLUORO-5,6-DIPHENYL-2,8-DECADIYNE-4,7-DIONE
CAS:149978-94-9
KIN03294678
1,1,1,10,10,10-HEXAFLUORO-DECANE
CAS:1826-81-9
KIN01056758
1,1,1,10,10,10-HEXAPHENYL-3,8-DITHIOXO-2,9-DITHIA-4,7-DIAZA-1,10-DISTANNADECANE
CAS:2591-44-8
Formula: C22H22Sn
KIN01072590
1,1,1,10-TETRACHLORO-DECANE
CAS:10311-15-6
KIN02004721
1,1,1,11,11,11-HEXAMETHYL-3,3,5,5,7,7,9,9-OCTAKIS[(TRIMETHYLSILYLOXY) ]-HEXASILOXANE
CAS:52809-00-4
Formula: C30H90O13Si14
KIN02326084
1,1,1,11-TETRACHLORO-UNDECANE
CAS:3922-40-5
Formula: C12H8N2O2
KIN01098041
1,1,1,12-TETRACHLORO-DODECANE
CAS:10311-16-7
KIN02004722
1,1,1,13-TETRACHLORO-TRIDECANE
CAS:3922-34-7
KIN01098040
1,1,1,2,2,12-HEXACHLORO-DODECANE
CAS:100525-30-2
KIN03032549
1,1,1,2,2,2-HEXABUTYL-DISTANNANE
CAS:813-27-4
KIN01030286
1,1,1,2,2,2-HEXACYCLOHEXYLDIPLUMBANE
CAS:6713-83-3
Formula: C6H18Pb2
KIN01169110
1,1,1,2,2,2-HEXAETHOXYDISILANE
CAS:5851-14-9
Formula: C6H11O2PS2
KIN01143423
1,1,1,2,2,2-HEXAETHOXYETHANE
CAS:65789-73-3
Formula: C14H30O6
KIN02532478
1,1,1,2,2,2-HEXAETHYLDIGERMANE
CAS:993-63-5
Formula: C12H30Sn2
KIN01036099
1,1,1,2,2,2-HEXAETHYLDIPLUMBANE
CAS:2388-01-4
Formula: C4H8N2O
KIN01068383
1,1,1,2,2,2-HEXAETHYLDISILANE
CAS:1633-14-3
Formula: C6H2Br2O2
KIN01052079
1,1,1,2,2,2-HEXAETHYLDISTANNANE
CAS:993-66-8
Formula: C10H24O3Si
KIN01036100
1,1,1,2,2,2-HEXAFLUORO-ETHANE
CAS:76-17-5
Formula: C3Cl3F5
KIN01001246
1,1,1,2,2,2-HEXAKIS(METHYLTHIO)ETHANE
CAS:26477-87-2
Formula: C8H18S6
KIN02148570
1,1,1,2,2,2-HEXAMETHOXYDISILANE
CAS:5851-08-1
Formula: C12H30O6Si2
KIN01143422
1,1,1,2,2,2-HEXAMETHYL-DIPLUMBANE
CAS:6713-87-7
KIN01169111
1,1,1,2,2,2-HEXAMETHYL-DISELENINE
CAS:1017791-72-8
KIN05035288
1,1,1,2,2,2-HEXAMETHYL-DISTANNANE
CAS:661-71-2
Formula: C4H4ClF3
KIN01024829
1,1,1,2,2,2-HEXAMETHYLDIGERMANE
CAS:993-53-3
Formula: C8H14O
KIN01036095
1,1,1,2,2,2-HEXAMETHYLDISILANE
CAS:1450-16-4
Formula: C16H22Si2
KIN01047303
1,1,1,2,2,2-HEXAMETHYLHYDRAZINIUM
CAS:1069135-46-1
KIN05110594
1,1,1,2,2,2-HEXANITRO-ETHANE
CAS:918-42-3
Formula: C4H9NO3
KIN01033533
1,1,1,2,2,2-HEXAPENTYL-DISTANNANE
CAS:21227-23-6
KIN02098600
Hexapentyl-distannane; Hexaamylditin; 1,1,1,2,2,2-
1,1,1,2,2,2-HEXAPHENYL-DISTANNANE
CAS:1064-16-0
Formula: C29H44O9
KIN01038308
1,1,1,2,2,2-HEXAPHENYLDIGERMANE
CAS:2816-43-5
Formula: C18H16Ge
KIN01076704
1,1,1,2,2,2-HEXAPHENYLDISILANE
CAS:1450-29-9
Formula: C8H18Si2
KIN01047308
1,1,1,2,2,2-HEXAPROPYL-DISTANNANE
CAS:6028-87-1
KIN01147767
1,1,1,2,2,3,3,3-OCTAETHYL-TRIGERMANE
CAS:13937-05-8
Formula: C16H40Ge3
KIN02026201
1,1,1,2,2,3,3,3-OCTAFLUORO-TRISILANE
CAS:14521-14-3
Formula: F8Si3
KIN02032834
1,1,1,2,2,3,3,3-OCTAMETHYLTRIGERMANE
CAS:1066-64-4
Formula: C13H36Si4
KIN01038363
1,1,1,2,2,3,3,4,4,4-DECADEUTERIOBUTANE
CAS:7582-08-3
KIN01191618
1,1,1,2,2,3,3,4,4,4-DECAMETHYL-TETRAGERMANE
CAS:14938-41-1
Formula: C10H30Ge4
KIN02036897
1,1,1,2,2,3,3,4,4,5,5,6,6,6-TETRADECACHLORO-HEXANE
CAS:83682-34-2
Formula: C6Cl14
KIN02662626
1,1,1,2,2,3,3,4,4,5,5,6,6,6-TETRADECAMETHYL-HEXASILANE
CAS:812-54-4
Formula: C12H36Cl2Si6
KIN01030273
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-OCTADECAMETHYL-OCTASILANE
CAS:3704-83-4
Formula: C18H13NO2
KIN01094356
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-DOCOSAMETHYL-DECASILANE
CAS:4774-85-0
Formula: C26H78Si12
KIN01114449
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-TETRACOSAFLUORO-UNDECANE
CAS:307-50-6
Formula: C11F23I
KIN01009769
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-HEXACOSAMETHYL-DODECASILANE
CAS:4775-07-9
Formula: C9H11N7S
KIN01114450
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-DOTETRACONTAFLUORO-EICOSANE
CAS:37589-57-4
Formula: C20F42
KIN02240831
Perfluoroeicosane
MFCD00000438
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22,23,23,24,24-NONATETRACONTAFLUORO-24-IODO-TETRACOSANE
CAS:39823-55-7
Formula: C24F49I
KIN02257744
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22-PENTA-TETRACONTAFLUORO-22-IODO-DOCOSANE
CAS:29809-36-7
Formula: C22F45I
KIN02176816
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20-HEN-TETRACONTAFLUORO-20-IODO-ICOSANE
CAS:29809-34-5
Formula: C20F41I
KIN02176814
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20-HEN-TETRACONTAFLUORO-22-IODO-DOCOSANE
CAS:263756-45-2
Formula: C22H4F41I
KIN03461033
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18-HEPTATRIACONTAFLUORO-18-IODO-OCTADECANE
CAS:29809-35-6
Formula: C18F37I
KIN02176815
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-TRITRIACONTAFLUORO-16-IODO-HEXADECANE
CAS:355-51-1
Formula: C16H6F21NO2S
KIN01011708
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-NONACOSAFLUORO-14-IODO-TETRADECANE
CAS:307-65-3
KIN01009776
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-HEPTACOSAFLUORO-15-IODO-PENTADECANE
CAS:146983-96-2
Formula: C15H4F27I
KIN03284331
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-TRICOSAFLUORO-11-IODO-UNDECANE
CAS:307-51-7
Formula: C10F22O2S
KIN01009770
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-TRICOSAFLUORO-13-IODO-TRIDECANE
CAS:57216-88-3
Formula: C13H4F23I
KIN02395823
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-NONADECAFLUORO-9-IODO-NONANE
CAS:559-05-7
Formula: C14H6F17NO2S
KIN01019821
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-10-(ALLYLTHIO)-DECANE
CAS:239463-91-3
Formula: [C13H9F17S
KIN03445501
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-9-OCTADECENE
CAS:113999-61-4
Formula: [C18H19F17
KIN03127698
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-DOCOSANE
CAS:133310-72-2
Formula: C22H29F17
KIN03222978
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-EICOSANE
CAS:106873-67-0
Formula: [C20H25F17
KIN03079233
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-HEXADECANE
CAS:6145-09-1
Formula: C23H16O4
KIN01150973
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-OCTADECANE;
CAS:138472-76-1
Formula: [C18H21F17
KIN03246959
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-TETRACOSANE
CAS:117146-18-6
Formula: C24H33F17
KIN03147636
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUOROOCTANE
CAS:3459-80-1
Formula: C11H16O
KIN01089660
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-HEXADECAFLUORO-OCTANE
CAS:2070-83-9
KIN01062111
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-11-IODO-UNDECANE
CAS:1748-99-8
Formula: C19H17NO
KIN01054928
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-15-IODO-PENTADECANE
CAS:2377-79-9
Formula: C8BrF16I
KIN01068117
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-7-ISOCYANATO-HEPTANE
CAS:335-93-3
Formula: C8HF15O2
KIN01010852
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-9-IODO-NONANE
CAS:2043-53-0
Formula: C10H4F17I
KIN01061540
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-9-IODO-PENTADECANE
CAS:918-36-5
Formula: C13H14F6O4
KIN01033531
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-TRIACONTAFLUORO-7-(TRIFLUOROMETHYL)PENTADECAN-7-OL
CAS:161144-54-3
Formula: C16HF33O
KIN03328102
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8-PENTADECAFLUORO-10-IODO-DECANE
CAS:49676-71-3
Formula: C10H6F15I
KIN02289687
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8-PENTADECAFLUORO-8-IODO-OCTANE
CAS:53826-16-7
Formula: C8H2F15I
KIN02341040
1,1,1,2,2,3,3,4,4,5,5,6,6,8-TETRADECAFLUOROOCTANE
CAS:361532-17-4
Formula: C8H4F14
KIN03537449
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-6-(1,2,2-TRIFLUORO-ETHENOXY) -HEXANE
CAS:103489-99-2
Formula: C8F16O
KIN03054196
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-6-IODO-HEXANE
CAS:355-46-4
Formula: C6HF13O3S
KIN01011704
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-(2-METHYLPENTAN-2-YLOXY) OCTANE
CAS:210896-25-6
Formula: [C14H17F13O
KIN03422088
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-HEXADECENE
CAS:120464-27-9
Formula: C16H19F13
KIN03164535
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-IODO-HEPTANE
CAS:212563-43-4
Formula: C7H2F13I
KIN03424079
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-TETRADECENE
CAS:120464-26-8
Formula: C14H15F13
KIN03164534
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-(PENTYLOXY) OCTANE
CAS:1193009-93-6
Formula: C13H15F13O;CF3(CF2)5CH2CH2OCH2CH2CH2CH2CH3;CF3(CF2)5CH2CH2OCH2CH2CH2CH2CH3;C13H15F13O
KIN05334631
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-(PROPOXY) OCTANE
CAS:1193010-01-3
Formula: C11H11F13O
KIN05334634
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODO-DODECANE
CAS:120695-82-1
Formula: C12H12F13I
KIN03165852
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODO-OCTANE
CAS:2043-61-0
Formula: C7H12O
KIN01061544
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-PROP-2-ENOXYOCTANE
CAS:103628-86-0
Formula: C11H9F13O
KIN03055112
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-HEXADECANE
CAS:147492-59-9
Formula: C16H21F13
KIN03286270
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-HEXANE
CAS:355-38-4
Formula: C6F12O
KIN01011699
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-OCTADECANE
CAS:90499-30-2
Formula: C18H25F13
KIN02728938
MFCD04038340
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-TETRADECANE
CAS:133331-77-8
Formula: C14H17F13
KIN03223037
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORODECANE
CAS:154478-86-1
Formula: C10H9F13
KIN03308958
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORODOCOSANE
CAS:133310-71-1
Formula: C22H33F13
KIN03222977
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUOROOCTADEC-7-ENE
CAS:131851-05-3
Formula: C18H23F13
KIN03216004
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUOROPENTADECANE
CAS:113659-13-5
Formula: C15H19F13
KIN03124921
1,1,1,2,2,3,3,4,4,5,5,6,7,7-TETRADECAFLUORO-7-METHOXYHEPTANE
CAS:355-73-7
Formula: C6H8F8N2
KIN01011715
1,1,1,2,2,3,3,4,4,5,5,6,7,7-TETRADECAFLUORO-8-PROP-2-ENOXYOCTANE
CAS:192998-90-6
Formula: C11H8F14O
KIN03395411
1,1,1,2,2,3,3,4,4,5,5,6-DODECAFLUORONONANE
CAS:126038-58-2
Formula: C9H8F12
KIN03191163
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-5-IODO-PENTANE
CAS:638-88-0
KIN01024009
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-7-IODO-HEPTANE
CAS:1682-32-2
Formula: C5H2F8O
KIN01053257
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-HEXANE
CAS:154275-17-9
Formula: C6H3F11
KIN03308155
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORONONADECANE
CAS:112344-48-6
Formula: C19H29F11
KIN03114651
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUOROPENTANE
CAS:139063-93-7
Formula: C5HF11
KIN03250462
1,1,1,2,2,3,3,4,4,5,6,6,6-TRIDECAFLUORO-5-(TRIFLUOROMETHYL)-HEXANE
CAS:36610-38-5
Formula: C7F16
KIN02232775
1,1,1,2,2,3,3,4,4,5,6,6,6-TRIDECAFLUORO-HEXANE
CAS:1998-58-9
Formula: C6HF4IO
KIN01060527
1,1,1,2,2,3,3,4,4,5,6,7,7,7-TETRADECAFLUORO-HEPTANE
CAS:142347-10-2
Formula: C7H2F14
KIN03264718
1,1,1,2,2,3,3,4,4,5-DECAFLUORO-HEXANE
CAS:155072-58-5
Formula: C6H4F10
KIN03311011
1,1,1,2,2,3,3,4,4,5-DECAFLUORONONANE
CAS:126038-57-1
Formula: C9H10F10
KIN03191162
1,1,1,2,2,3,3,4,4,6,6,8,8-TRIDECAFLUORO-8-IODO-OCTANE
CAS:99325-17-4
Formula: C8H4F13I
KIN02819555
1,1,1,2,2,3,3,4,4,6,6-UNDECAFLUORO-8-IODO-OCTANE
CAS:53626-95-2
Formula: C8H6F11I
KIN02338041
1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-OCTADECAFLUORODECANE
CAS:142083-52-1
Formula: C10H4F18
KIN03263567
1,1,1,2,2,3,3,4,4-NONACHLORO-BUTANE
CAS:21483-62-5
Formula: C4HCl9
KIN02101244
1,1,1,2,2,3,3,4,4-NONACHLORO-TETRASILANE
CAS:56240-72-3
Formula: Cl9HSi4
KIN02379586
1,1,1,2,2,3,3,4,4-NONACHLOROUNDECANE
CAS:219697-11-7
Formula: C11H15Cl9
KIN03431991
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-(TRIFLUOROMETHOXY) BUTANE
CAS:559-31-9
KIN01019825
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-IODO-BUTANE
CAS:423-40-5
Formula: C3F8O2S
KIN01014117
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-METHOXY-BUTANE
CAS:163702-07-6
Formula: C5H3F9O
KIN03334297
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-METHOXY-BUTANE, 2-((DIFLUOROMETHOXY) METHYL)-1,1,1,2,3,3,3-HEPTAFLUOROPROPANE
CAS:219484-64-7
Formula: C10H6F18O2
KIN03431457
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-PROPOXY-BUTANE
CAS:72372-80-6
Formula: C7H7F9O
KIN02590967
1,1,1,2,2,3,3,4,4-NONAFLUORO-5-DECANOL
CAS:95452-56-5
Formula: C10H13F9O
KIN02791565
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(METHANE-SULFINYL)-HEXANE
CAS:357604-65-0
Formula: [C7H7F9OS
KIN03534577
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(PENTYLOXY) -HEXANE
CAS:1193009-96-9
Formula: C11H15F9O
KIN05334632
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(PROPOXY) -HEXANE
CAS:1193009-98-1
Formula: C9H11F9O
KIN05334633
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-DECANE
CAS:40735-32-8
Formula: C10H12F9I
KIN02265296
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-DODECANE
CAS:109603-73-8
Formula: C12H16F9I
KIN03096348
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-HEPTANE
CAS:89889-25-8
Formula: C7H6F9I
KIN02718772
1,1,1,2,2,3,3,4,4-NONAFLUORO-7,7-DIISOCYANATOHEPTANE
CAS:306976-22-7
Formula: C9H5F9N2O2
KIN03482980
1,1,1,2,2,3,3,4,4-NONAFLUORO-BUTANE
CAS:375-18-8
Formula: C4F7IO
KIN01012622
1,1,1,2,2,3,3,4,4-NONAFLUOROPENTANE
CAS:141993-31-9
Formula: C5H3F9
KIN03263046
1,1,1,2,2,3,3,4,4-NONAMETHYL-TETRASILANE
CAS:56240-58-5
Formula: C9H28Si4
KIN02379580
1,1,1,2,2,3,3,4,5,5,5-UNDECAFLUORO-4-(TRIFLUOROMETHYL)PENTANE
CAS:355-08-8
Formula: [C5H3F7
KIN01011680
1,1,1,2,2,3,3,4,5,5,6,6,6-TRIDECAFLUORO-4-(TRIFLUOROMETHYL)-HEXANE
CAS:558-82-7
KIN01019815
1,1,1,2,2,3,3,4,5,5,6,6,6-TRIDECAFLUORO-HEXANE
CAS:1998-78-3
Formula: C5H11F2NO2S
KIN01060537
1,1,1,2,2,3,3,4,5,5-DECAFLUOROPENTANE
CAS:150999-42-1
Formula: C5H2F10
KIN03297884
1,1,1,2,2,3,3,4,5,6,6,7,7,8,8,8-HEXADECAFLUORO-4-OCTENE
CAS:35844-81-6
Formula: C8F16
KIN02226766
1,1,1,2,2,3,3,4- OCTAFLUOROPENTANE
CAS:72923-37-6
Formula: C5H4F8
KIN02594724
1,1,1,2,2,3,3,4-OCTAFLUORO-BUTANE
CAS:662-42-0
Formula: C3ClF7S
KIN01024851
1,1,1,2,2,3,3,4-OCTAFLUORO-HEXANE
CAS:154275-19-1
Formula: C6H6F8
KIN03308156
1,1,1,2,2,3,3,4-OCTAFLUOROOCTANE
CAS:126038-55-9
Formula: C8H10F8
KIN03191161
1,1,1,2,2,3,3,5,5,5-DECAFLUORO-4-METHYL-4-(TRIFLUOROMETHYL)PENTANE
CAS:100645-99-6
Formula: C7H3F13
KIN03033667
1,1,1,2,2,3,3,5,5,6,6,7,7,7-TETRADECAFLUORO-HEPT-4-ONE
CAS:378-94-9
Formula: C4F9NO
KIN01012780
1,1,1,2,2,3,3,6,6,7,7,8,8,8-TETRADECAFLUORO-4-OCTENE
CAS:3910-88-1
Formula: C18H30O2
KIN01097825
1,1,1,2,2,3,3-HEPTABROMO-TRISILANE
CAS:192331-09-2
Formula: Br7HSi3
KIN03393882
1,1,1,2,2,3,3-HEPTACHLORO-3-FLUOROPROPANE
CAS:422-79-7
Formula: C3Br2ClF5
KIN01014101
1,1,1,2,2,3,3-HEPTACHLORO-BUTANE
CAS:83682-70-6
Formula: C4H3Cl7
KIN02662654
1,1,1,2,2,3,3-HEPTACHLORO-TRISILANE
CAS:56240-63-2
Formula: Cl7HSi3
KIN02379583
1,1,1,2,2,3,3-HEPTACHLORODECANE
CAS:32534-78-4
Formula: C10H15Cl7
KIN02197875
Heptachloro-decane
1,1,1,2,2,3,3-HEPTACHLOROPROPANE
CAS:594-90-1
Formula: C3Cl8
KIN01021380
1,1,1,2,2,3,3-HEPTADEUTERIO-HEXANE
CAS:32740-31-1
Formula: C6H7D7
KIN02199521
1,1,1,2,2,3,3-HEPTAFLUORO-3-(1,2,2,2-TETRAFLUORO-ETHOXY) -PROPANE
CAS:3330-16-3
Formula: C11HF23O3
KIN01086901
1,1,1,2,2,3,3-HEPTAFLUORO-3-(2,2,3,3-TETRAFLUOROPROPOXY) -PROPANE
CAS:176310-29-5
Formula: C6H3F11O
KIN03360559
1,1,1,2,2,3,3-HEPTAFLUORO-3-(FLUOROMETHOXY) -PROPANE
CAS:184899-81-8
Formula: C4H2F8O
KIN03377830
1,1,1,2,2,3,3-HEPTAFLUORO-3-(TRIFLUOROMETHOXY) -PROPANE
CAS:59426-77-6
Formula: C4F10O
KIN02431422
1,1,1,2,2,3,3-HEPTAFLUORO-3-{[1,1,1,2,3,3-HEXAFLUORO-3-(1,2,2,2-TETRAFLUORO-ETHOXY) -PROPAN-2-YL]OXY}PROPANE
CAS:34252-81-8
Formula: C8HF17O2
KIN02212501
1,1,1,2,2,3,3-HEPTAFLUORO-3-IODO-PROPANE
CAS:754-36-9
KIN01028226
1,1,1,2,2,3,3-HEPTAFLUORO-3-ISOCYANATO-PROPANE
CAS:424-64-6
Formula: C7H5F7O2
KIN01014151
1,1,1,2,2,3,3-HEPTAFLUORO-3-METHOXY-PROPANE
CAS:375-04-2
Formula: C8H11F7N2O2
KIN01012614
1,1,1,2,2,3,3-HEPTAFLUORO-4,4-BIS(TRIFLUOROMETHYL)-HEXANE
CAS:100646-00-2
Formula: C8H5F13
KIN03033668
1,1,1,2,2,3,3-HEPTAFLUORO-4-CHLORO-BUTANE
CAS:374-98-1
Formula: C4H2F7I
KIN01012608
1,1,1,2,2,3,3-HEPTAFLUORO-4-IODO-BUTANE
CAS:374-99-2
Formula: C4H4F7N
KIN01012609
1,1,1,2,2,3,3-HEPTAFLUORO-4-ISOCYANATOBUTANE
CAS:377-07-1
Formula: C4H5F3N2O3
KIN01012712
1,1,1,2,2,3,3-HEPTAFLUORO-4-METHOXY-BUTANE
CAS:377-00-4
Formula: C5H2F7NO
KIN01012711
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-(4E)-4-UNDECENE
CAS:109574-86-9
Formula: C11H14F7I
KIN03096209
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-HEXANE
CAS:261503-73-5
Formula: C6H6F7I
KIN03458853
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-NONANE
CAS:755-50-0
Formula: C6F14N2
KIN01028255
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-4-(NITRO-METHYL)PENTANE
CAS:355-93-1
Formula: C9H8F8O2
KIN01011727
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-HEPT-4-OL
CAS:355-91-9
Formula: C6H5F7N2O4
KIN01011726
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-PENTANE
CAS:356-06-9
Formula: C6H5F7O2
KIN01011735
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITROHEPTANE
CAS:356-69-4
Formula: C5H3F7O3
KIN01011768
1,1,1,2,2,3,3-HEPTAFLUORO-8-METHYLNONANE-4,6-DIONE
CAS:6304-29-6
Formula: C10H13NO
KIN01156755
1,1,1,2,2,3,3-HEPTAFLUORO-BUTANE
CAS:662-01-1
Formula: C3Cl2F6
KIN01024839
1,1,1,2,2,3,3-HEPTAFLUORO-HEPT-4-OL
CAS:425-22-9
Formula: C7H7F7O
KIN01014161
1,1,1,2,2,3,3-HEPTAFLUORO-HEPT-4-ONE
CAS:425-24-1
KIN01014162
1,1,1,2,2,3,3-HEPTAFLUORO-HEPTA-4,6-DIENE
CAS:261503-72-4
KIN03458852
1,1,1,2,2,3,3-HEPTAFLUORO-HEPTANE
CAS:152076-35-2
Formula: C7H9F7
KIN03301121
1,1,1,2,2,3,3-HEPTAFLUOROPENTANE
CAS:754-73-4
Formula: C4HF8I
KIN01028237
1,1,1,2,2,3,3-HEPTAFLUOROPROPANE
CAS:2252-87-1
Formula: C3H2Cl2F2
KIN01065828
1,1,1,2,2,3,3-HEPTAMETHYL-3-(NAPHTHALEN-1-YL)-TRISILANE
CAS:38446-42-3
Formula: C17H28Si3
KIN02248065
1,1,1,2,2,3,3-HEPTAMETHYL-3-PHENYL-TRISILANE
CAS:780-59-6
Formula: C11H14N2O3
KIN01029519
1,1,1,2,2,3,3-HEPTAMETHYL-TRISILANE
CAS:812-30-6
Formula: C3Cl3F5
KIN01030266
1,1,1,2,2,3,4,4,4-NONAFLUORO-3-(TRIFLUOROMETHYL)BUTANE
CAS:595-00-6
KIN01021382
1,1,1,2,2,3,4,4,4-NONAFLUORO-BUTANE
CAS:680-19-3
Formula: C3F9N
KIN01025360
1,1,1,2,2,3,4,4,5,5,5-UNDECAFLUORO-3-(TRIFLUOROMETHYL)PENTANE
CAS:865-76-9
Formula: C10H30Si4
KIN01032050
1,1,1,2,2,3,4,4,5,5,5-UNDECAFLUOROPENTANE
CAS:95576-22-0
Formula: C5HF11
KIN02792885
1,1,1,2,2,3,4,4-OCTAFLUORO-BUTANE
CAS:119450-58-7
Formula: C4H2F8
KIN03159109
1,1,1,2,2,3,4,5,5,5-DECAFLUORO-3-[1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL]-4-(TRIFLUOROMETHYL)PENTANE
CAS:50285-18-2
Formula: C9F20
KIN02291354
1,1,1,2,2,3,4,5,5,6,6,6-DODECAFLUORO-3,4-BIS(TRIFLUOROMETHYL)-HEXANE
CAS:1735-50-8
KIN01054539
1,1,1,2,2,3,4,5,5,6,6,7,7,7-TETRADECAFLUORO-3-HEPTENE
CAS:71039-88-8
Formula: C7F14
KIN02581445
1,1,1,2,2,3,4,5,5,6,6,7,7,8,8,8-HEXADECAFLUORO-3-OCTENE
CAS:35844-82-7
Formula: C8F16
KIN02226767
1,1,1,2,2,3,4,5,6,7,7,8,8,8-TETRADECAFLUOROOCTA-3,5-DIENE
CAS:105311-63-5
Formula: C8F14
KIN03067367
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-(2,2,3,3-TETRAFLUOROPROPOXY) -4-(TRIFLUOROMETHYL)PENTANE
CAS:106054-52-8
Formula: C9H4F16O
KIN03073414
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-IODO-PENTANE
CAS:755-48-6
Formula: C9H12F7I
KIN01028254
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-ISOPROPOXY-4-(TRIFLUOROMETHYL)PENTANE
CAS:106054-38-0
Formula: C9H8F12O
KIN03073408
1,1,1,2,2,3- HEXAFLUORO-BUTANE
CAS:74469-62-8
Formula: C4H4F6
KIN02606096
1,1,1,2,2,3-HEXACHLORO-3,3-DIFLUOROPROPANE
CAS:661-97-2
Formula: C3Cl2F6
KIN01024836
1,1,1,2,2,3-HEXACHLORO-3-FLUOROPROPANE
CAS:422-30-0
Formula: C3HCl5F2
KIN01014074
1,1,1,2,2,3-HEXACHLORO-HEXANE
CAS:26264-54-0
Formula: C6H8Cl6
KIN02146875
1,1,1,2,2,3-HEXACHLORODECANE
CAS:175801-38-4
Formula: C10H16Cl6
KIN03359721
1,1,1,2,2,3-HEXAFLUORO-3-(TRIFLUOROMETHYL)-5-IODO-HEXANE
CAS:239464-00-7
Formula: C7H6F9I
KIN03445510
1,1,1,2,2,3-HEXAFLUORO-3-(TRIFLUOROMETHYL)-5-IODO-NONANE
CAS:239464-01-8
Formula: C10H12F9I
KIN03445511
1,1,1,2,2,3-HEXAFLUORODECAN-4-ONE
CAS:113487-29-9
Formula: C10H14F6O
KIN03123416
1,1,1,2,2,3-HEXAFLUOROPROPANE
CAS:677-57-6
KIN01025286
1,1,1,2,2,4,4,4-OCTAFLUORO-3,3-BIS(TRIFLUOROMETHYL)BUTANE
CAS:112156-74-8
Formula: C6F14
KIN03113048
1,1,1,2,2,4,4,4-OCTAFLUORO-3-(TRIFLUOROMETHYL)BUTANE
CAS:71127-00-9
Formula: C5HF11
KIN02582130
1,1,1,2,2,4,4,4-OCTAFLUORO-3-METHYLBUTANE
CAS:154381-64-3
Formula: C5H4F8
KIN03308564
1,1,1,2,2,4,4,4-OCTAFLUORO-BUTANE
CAS:2924-30-3
Formula: C6H2Br2FNO3
KIN01078980
1,1,1,2,2,4,4,5,5,5-DECACHLOROPENTANE
CAS:54976-89-5
Formula: C5H2Cl10
KIN02358619
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-(PENTAFLUORO-ETHYL)PENTAN-3-OL
CAS:6189-02-2
Formula: C3HClF4O2
KIN01152000
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-HYDROXY-3-PHENYLPENTANE
CAS:2823-52-1
Formula: C11H13FN2O6
KIN01076795
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-METHYL-3-(TRIFLUOROMETHYL)PENTANE
CAS:116089-50-0
Formula: C7H3F13
KIN03140922
1,1,1,2,2,4,4,5,5,7,7,8,8,10,10,10-HEXADECACHLORODECANE
CAS:190003-05-5
Formula: C10H6Cl16
KIN03390287
1,1,1,2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13-NONADECAFLUORO-3,6,9,12-TETRAOXATETRADECAN-14-OL
CAS:14548-76-6
Formula: C10H3F19O5
KIN02033153
1,1,1,2,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,17,18,18,18-TETRACOSAFLUORO-5,8,11,14-TETRAKIS(TRIFLUOROMETHYL)-3,6,9,12,15-PENTAOXAOCTADECANE
CAS:31054-85-0
Formula: C17F36O5
KIN02186767
1,1,1,2,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,20,21,21,21-HEPTACOSAFLUORO-5,8,11,14,17-PENTAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18-HEXAOXAHENEICOSANE
CAS:59884-34-3
Formula: C20F42O6
KIN02438855
1,1,1,2,2,4,4-HEPTAFLUORO-4-IODO-BUTANE
CAS:1810-13-5
Formula: C4H5F4N.ClH
KIN01056352
1,1,1,2,2,4,4-HEPTAFLUORO-BUTANE
CAS:161791-36-2
Formula: C4H3F7
KIN03329842
1,1,1,2,2,4,5,5,5-NONAFLUORO-4-(TRIFLUOROMETHYL)PENTAN-3-ONE
CAS:756-21-8
KIN01028270
1,1,1,2,2,4,5,5-OCTAFLUOROPENTAN-3-ONE
CAS:370862-44-5
Formula: C5H2F8O
KIN03542376
1,1,1,2,2,4-HEXAFLUORO-BUTANE
CAS:161791-33-9
Formula: [C4H4F6
KIN03329841
1,1,1,2,2,5,5,5-OCTAFLUORO-3-PENTANONE
CAS:61637-92-1
Formula: C5H2F8O
KIN02459130
1,1,1,2,2,5,5,5-OCTAFLUORO-4-(TRIFLUOROMETHYL)PENTANE
CAS:90278-01-6
Formula: C6H3F11
KIN02725137
1,1,1,2,2,5,5,6,6,6-DECAFLUORO-HEXANE
CAS:95576-25-3
Formula: C6H4F10
KIN02792887
1,1,1,2,2,5,5,6,6,9,9,10,10,10-TETRADECAFLUORODEC-3-ENE
CAS:35208-08-3
Formula: C10H6F14
KIN02220860
1,1,1,2,2,5,6,6,9,9,10,10,10-TRIDECAFLUORODEC-4-ENE
CAS:40723-77-1
Formula: C10H7F13
KIN02265206
1,1,1,2,2,5-HEXAFLUOROPENTAN-3-ONE
CAS:370862-40-1
Formula: C5H4F6O
KIN03542375
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-4-HEPTYN-3-ONE
CAS:96102-07-7
Formula: C7F10O
KIN02797834
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-5-HYDROXY-5-METHYL-HEPT-3-ONE
CAS:6742-94-5
KIN01169617
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-HEPTANE
CAS:95576-26-4
Formula: C7H6F10
KIN02792888
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-HEPTANE-3,5-DIONE
CAS:38007-33-9
Formula: C7H2F10O2
KIN02244496
4H,4H-Decafluoro-heptan-3,5-dione
MFCD06246840
1,1,1,2,2-PENTABROMO-3,3,3-TRIFLUOROTRISILANE
CAS:108737-35-5
Formula: Br5F3Si3
KIN03090911
1,1,1,2,2-PENTABROMOETHANE
CAS:75-96-7
Formula: CBr3CO2H
KIN01001226
1,1,1,2,2-PENTABUTYLDISTANNANE
CAS:139582-88-0
Formula: C20H46Sn2
KIN03253586
1,1,1,2,2-PENTACHLORO-2-(1,1,2,2,2-PENTACHLORO-ETHOXY) ETHANE
CAS:597-39-7
KIN01021489
1,1,1,2,2-PENTACHLORO-2-FLUORO-DISILANE
CAS:18356-60-0
Formula: Cl5FSi2
KIN02071223
1,1,1,2,2-PENTACHLORO-2-FLUORO-ETHANE
CAS:354-58-5
Formula: C2Cl3F3
KIN01011653
1,1,1,2,2-PENTACHLORO-3,3,3-TRIFLUOROPROPANE
CAS:1652-93-3
Formula: C13H21N3O
KIN01052534
1,1,1,2,2-PENTACHLORO-3,3,4,4,5,5,5-HEPTAFLUOROPENTANE
CAS:116046-22-1
Formula: C5Cl5F7
KIN03140578
1,1,1,2,2-PENTACHLORO-3-FLUOROPROPANE
CAS:134190-48-0
Formula: [C3H2Cl5F
KIN03227131
1,1,1,2,2-PENTACHLORO-DISILANE
CAS:31411-98-0
Formula: Cl5HSi2
KIN02189261
1,1,1,2,2-PENTACHLORO-ETHANE
CAS:76-02-8
Formula: C2Cl4O
KIN01001232
1,1,1,2,2-PENTACHLORODODECANE
CAS:214327-67-0
Formula: C12H21Cl5
KIN03426246
1,1,1,2,2-PENTACHLOROPROPANE
CAS:64240-29-5
Formula: C3H3Cl5
KIN02506607
1,1,1,2,2-PENTADEUTERIO-2-ETHYLTHIO-ETHANE
CAS:61260-04-6
Formula: C4H10S
KIN02453369
1,1,1,2,2-PENTADEUTERIO-2-IODO-ETHANE
CAS:6485-61-6
KIN01163363
1,1,1,2,2-PENTAETHYL-DIGERMANE
CAS:993-86-2
Formula: C6H12Cl3O4P
KIN01036107
1,1,1,2,2-PENTAFLUORO-2-(PERFLUORO-ETHOXY) ETHANE
CAS:358-23-6
Formula: C2F6O5S2
KIN01011826
1,1,1,2,2-PENTAFLUORO-2-IODO-ETHANE
CAS:354-65-4
Formula: C2F4I2
KIN01011656
1,1,1,2,2-PENTAFLUORO-2-NITRO-SOETHANE
CAS:354-73-4
Formula: C2Cl2F4S
KIN01011661
1,1,1,2,2-PENTAFLUORO-3,3-DIMETHYLBUTANE
CAS:67498-75-3
Formula: C6H9F5
KIN02554278
1,1,1,2,2-PENTAFLUORO-3,5-HEPTANEDIONE
CAS:2357-39-3
Formula: C7H8F3NO2
KIN01067645
1,1,1,2,2-PENTAFLUORO-3,5-OCTANEDIONE
CAS:2355-93-3
Formula: C8H11F3
KIN01067616
1,1,1,2,2-PENTAFLUORO-3-(1,2,2-TRIFLUORO-ETHENOXY) -PROPANE
CAS:1682-37-7
Formula: C7H5BF4N2O2+
KIN01053258
1,1,1,2,2-PENTAFLUORO-3-(FLUOROMETHOXY) -PROPANE
CAS:1515-14-6
Formula: C4H4F6O
KIN01049022
1,1,1,2,2-PENTAFLUORO-3-DECYN-5-OL
CAS:95540-92-4
Formula: C10H13F5O
KIN02792579
1,1,1,2,2-PENTAFLUORO-3-HEXENE
CAS:94099-51-1
Formula: C6H7F5
KIN02777726
1,1,1,2,2-PENTAFLUORO-3-IODO-PROPANE
CAS:354-71-2
Formula: C2Cl2F3NO
KIN01011659
1,1,1,2,2-PENTAFLUORO-3-METHYLBUTAN-3-OL
CAS:374-47-0
Formula: C4H3Cl3F4
KIN01012588
1,1,1,2,2-PENTAFLUORO-3-METHYLPENTAN-3-OL
CAS:2368-92-5
Formula: C6H10F2O2
KIN01067935
1,1,1,2,2-PENTAFLUORO-3-UNDECYN-5-OL
CAS:95540-93-5
Formula: C11H15F5O
KIN02792580
1,1,1,2,2-PENTAFLUORO-4,4-DIMETHYLPENTAN-3-OL
CAS:378-89-2
Formula: C7H2F14O
KIN01012778
1,1,1,2,2-PENTAFLUORO-4-METHYLPENTAN-3-OL
CAS:357-28-8
Formula: C6H7F5O
KIN01011789
1,1,1,2,2-PENTAFLUORO-4-METHYLPENTAN-3-ONE
CAS:357-31-3
Formula: C3H2F6O3S
KIN01011790
1,1,1,2,2-PENTAFLUORO-5-HYDROXY-3-HEXANONE
CAS:91485-47-1
Formula: C6H7F5O2
KIN02744418
1,1,1,2,2-PENTAFLUORO-5-HYDROXY-4-DECANONE
CAS:95541-10-9
Formula: C10H15F5O2
KIN02792585
1,1,1,2,2-PENTAFLUORO-6-METHYL-3,5-HEPTANEDIONE
CAS:2355-63-7
Formula: C17H17Cl2FN2
KIN01067613
1,1,1,2,2-PENTAFLUORO-7-PHENYL-HEPT-3-ONE
CAS:1071000-98-0
Formula: C13H13F5O
KIN05111375
Fkgk 11
1,1,1,2,2-PENTAFLUORO-BUTANE
CAS:141529-32-0
Formula: C4H5F5
KIN03260703
1,1,1,2,2-PENTAFLUORO-DISILANE
CAS:24628-33-9
Formula: F5HSi2
KIN02132339
1,1,1,2,2-PENTAFLUORO-ETHANE
CAS:354-34-7
Formula: C2F4O
KIN01011636
1,1,1,2,2-PENTAFLUORO-ETHANE MIXT. WITH DIFLUOROMETHANE
CAS:133023-17-3
Formula: C2 HF5 .CH2 F2
KIN03635566
1,1,1,2,2-PENTAFLUORO-HEPT-3-ONE
CAS:426-75-5
Formula: C26H18F6Si
KIN01014199
1,1,1,2,2-PENTAFLUORO-HEXAN-3-OL
CAS:357-46-0
Formula: C6H7F5O
KIN01011794
1,1,1,2,2-PENTAFLUORO-HEXAN-3-ONE
CAS:357-47-1
Formula: C5H3F5O2
KIN01011795
1,1,1,2,2-PENTAFLUORO-HEXANE
CAS:94099-50-0
Formula: C6H9F5
KIN02777725
1,1,1,2,2-PENTAFLUOROOCTAN-3-ONE
CAS:108214-46-6
Formula: C8H11F5O
KIN03087629
1,1,1,2,2-PENTAFLUOROPENTAN-3-OL
CAS:378-72-3
Formula: C5H5F5O
KIN01012770
1,1,1,2,2-PENTAFLUOROPENTAN-3-ONE
CAS:378-75-6
Formula: C4H3F5O2
KIN01012771
1,1,1,2,2-PENTAFLUOROPROPANE
CAS:1814-89-7
Formula: C3H3F5O
KIN01056458
1,1,1,2,2-PENTAMETHYL-2-(2,3,4,5,6-PENTAFLUOROPHENYL)-DISILANE
CAS:33558-55-3
Formula: C11H15F5Si2
KIN02206775
1,1,1,2,2-PENTAMETHYL-2-(THIOPHEN-2-YL)-DISILANE
CAS:147463-22-7
KIN03286212
1,1,1,2,2-PENTAMETHYL-2-[(TRIMETHYLPHOSPHORANYLIDENE)METHYL]-DISILANE
CAS:29947-67-9
Formula: C9H25PSi2
KIN02177933
1,1,1,2,2-PENTAMETHYL-2-BENZYL-DISILANE
CAS:3098-83-7
Formula: C11H19ClSi2
KIN01082358
1,1,1,2,2-PENTAMETHYL-2-PHENYL-DIGERMANE
CAS:32284-96-1
Formula: C11H20Ge2
KIN02195662
1,1,1,2,2-PENTAMETHYL-2-PHENYL-DISILANE
CAS:1130-18-3
Formula: C10H15NO2
KIN01040776
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM
CAS:84996-13-4
KIN02671208
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM 1,1,1- TRIFLATE
CAS:452069-41-9
Formula: C5H15N2.CF3O3S
KIN03592343
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM AZIDE
CAS:339530-82-4
KIN03513271
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM BROMIDE
CAS:117122-66-4
KIN03147522
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM CHLORIDE
CAS:117122-65-3
KIN03147521
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM HEXACHLOROANTIMONATE(I)
CAS:117122-64-2
KIN03624348
1,1,1,2,2-PENTAMETHYLHYDRAZINIUM IODIDE
CAS:68387-97-3
KIN02562910
1,1,1,2,2-PENTANITRO-PROPANE
CAS:62626-83-9
Formula: C3H3N5O10
KIN02477622
1,1,1,2,3,3,3-HEPTACHLORO-TRISILANE
CAS:62218-01-3
Formula: Cl7HSi3
KIN02470219
1,1,1,2,3,3,3-HEPTACHLOROPROPANE
CAS:3849-34-1
Formula: C8H18O2
KIN01096901
1,1,1,2,3,3,3-HEPTAFLUORO-2-(1,1,2,2-TETRAFLUORO-2-IODO-ETHOXY) -PROPANE
CAS:16005-38-2
Formula: C5F11IO
KIN02046574
1,1,1,2,3,3,3-HEPTAFLUORO-2-(1,1,2,2-TETRAFLUORO-ETHOXY) -PROPANE
CAS:23228-89-9
Formula: C5HF11O
KIN02118075
1,1,1,2,3,3,3-HEPTAFLUORO-2-(1,2,2,2-TETRAFLUORO-1-IODO-ETHOXY) -PROPANE
CAS:127629-28-1
Formula: C5F11IO
KIN03198116
1,1,1,2,3,3,3-HEPTAFLUORO-2-(FLUOROMETHYL)-PROPANE
CAS:65781-19-3
Formula: C4H2F8
KIN02532323
1,1,1,2,3,3,3-HEPTAFLUORO-2-(TRIFLUOROMETHOXY) -PROPANE
CAS:60901-74-8
Formula: C4F10O
KIN02448745
1,1,1,2,3,3,3-HEPTAFLUORO-2-(TRIFLUOROMETHYL)-PROPANE
CAS:354-93-8
Formula: C4F9NO
KIN01011674
1,1,1,2,3,3,3-HEPTAFLUORO-2-(TRIFLUOROMETHYLSULFONYL)-PROPANE
CAS:207129-45-1
Formula: C4F10O2S
KIN03416970
1,1,1,2,3,3,3-HEPTAFLUORO-2-[(TRIFLUORO-VINYLOXY) ]PROPANE
CAS:10372-98-2
Formula: C5F10O
KIN02005608
1,1,1,2,3,3,3-HEPTAFLUORO-2-IODO-PROPANE
CAS:677-70-3
Formula: C3H2Cl4F2O2
KIN01025292
1,1,1,2,3,3,3-HEPTAFLUORO-2-METHYLPROPANE
CAS:65781-18-2
Formula: C4H3F7
KIN02532322
1,1,1,2,3,3,3-HEPTAFLUORO-2-NITRO-PROPANE
CAS:2730-58-7
Formula: C3F5O2.H4N
KIN01075064
1,1,1,2,3,3,3-HEPTAFLUORO-2-NITRO-SOPROPANE
CAS:423-01-8
Formula: C3F9OP
KIN01014108
1,1,1,2,3,3,3-HEPTAFLUORO-2-PROPANESULFONIC ACID
CAS:51604-59-2
Formula: C3HF7O3S
KIN02309133
1,1,1,2,3,3,3-HEPTAFLUORO-2-PROPANOLPOTASSIUM SALT
CAS:7459-63-4
Formula: C9H7N3O2
KIN01187296
1,1,1,2,3,3,3-HEPTAFLUOROPROPANE
CAS:431-90-3
Formula: C3HF6I
KIN01014361
1,1,1,2,3,3,3-HEPTAMETHYL-2-(TRIMETHYLSILYL)TRISILANE
CAS:2003-87-4
Formula: C12H22O5Si2
KIN01060665
1,1,1,2,3,3,3-HEPTAMETHYL-2-PHENYL-TRIGERMANE
CAS:56986-59-5
Formula: C13H26Ge3
KIN02392158
1,1,1,2,3,3,3-HEPTAMETHYL-2-PHENYL-TRISILANE
CAS:780-57-4
KIN01029518
1,1,1,2,3,3,3-HEPTAMETHYL-TRISILANE
CAS:815-28-1
Formula: C4F11N
KIN01030370
1,1,1,2,3,3,3-HEPTAPHENYL-TRIGERMANE
CAS:91123-24-9
Formula: C42H36Ge3
KIN02739017
1,1,1,2,3,3,3-HEPTAPHENYL-TRISILANE
CAS:101213-71-2
Formula: C42H36Si3
KIN03037707
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-OCTACOSAFLUORO-14-IODO-2-(TRIFLUOROMETHYL)-TETRADECANE
CAS:3248-78-0
KIN01085293
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-TETRACOSAFLUORO-12-IODO-2-(TRIFLUOROMETHYL)-DODECANE
CAS:3248-63-3
Formula: C15F31I
KIN01085292
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-ICOSAFLUORO-10-IODO-2-(TRIFLUOROMETHYL)-DECANE
CAS:678-04-6
KIN01025305
1,1,1,2,3,3,4,4,5,5,6,6-DODECAFLUORO-6-IODO-2-(TRIFLUOROMETHYL)-HEXANE
CAS:3486-30-4
Formula: C37H35N2NaO6S2
KIN01090204
1,1,1,2,3,3,4,4-OCTACHLORO-BUTANE
CAS:32694-76-1
Formula: C4H2Cl8
KIN02199202
1,1,1,2,3,3,4,4-OCTAFLUORO-4-IODO-2-(TRIFLUOROMETHYL)BUTANE
CAS:1514-96-1
Formula: C5H2ClF3N2
KIN01049019
1,1,1,2,3,3,4,5,5,5-DECAFLUOROPENTAN-2-YLBENZENE
CAS:89185-51-3
Formula: C11H6F10
KIN02708197
1,1,1,2,3,3,4-HEPTAFLUORO-BUTANE
CAS:53005-35-9
Formula: C4H3F7
KIN02328881
1,1,1,2,3,3,7,7,8,9,9,9-DODECAFLUORO-4-METHYLNONANE
CAS:57915-73-8
Formula: C10H10F12
KIN02407552
1,1,1,2,3,3-HEXACHLORO-2,3-DIFLUOROPROPANE
CAS:1645-75-6
Formula: C3HF6N
KIN01052414
1,1,1,2,3,3-HEXACHLORO-3-FLUOROPROPANE
CAS:431-84-5
KIN01014356
1,1,1,2,3,3-HEXACHLOROPROPANE
CAS:5406-72-4
Formula: C12H15BrO3
KIN01128988
1,1,1,2,3,3-HEXADEUTERIO-3-PHENYLPROPAN-2-YLAMINE
CAS:73758-26-6
Formula: C9H7D6N
KIN02600494
1,1,1,2,3,3-HEXAFLUORO-2-(FLUOROMETHYL)-PROPANE
CAS:65781-22-8
Formula: C4H3F7
KIN02532326
1,1,1,2,3,3-HEXAFLUORO-2-METHYLPROPANE
CAS:65781-20-6
Formula: C4H4F6
KIN02532324
1,1,1,2,3,3-HEXAFLUORO-3-(3,4,4,4-TETRAFLUORO-3-(TRIFLUOROMETHYL)BUTOXY)-PROPAN-2-SULFONYL FLUORIDE
CAS:130518-86-4
Formula: C8H4F14O3S
KIN03210236
1,1,1,2,3,3-HEXAFLUORO-3-(FLUOROMETHOXY) -PROPANE
CAS:60598-14-3
Formula: C4H3F7O
KIN02445953
1,1,1,2,3,3-HEXAFLUORO-3-(TRIFLUOROMETHOXY) -PROPANE
CAS:428454-68-6
Formula: C4HF9O
KIN03576875
1,1,1,2,3,3-HEXAFLUORO-3-[2-(1,1,2,3,3,3-HEXAFLUOROPROPOXY) ETHOXY]PROPANE
CAS:479075-22-4
Formula: C8H6F12O2
KIN03607610
1,1,1,2,3,3-HEXAFLUORO-3-METHOXY-PROPANE
CAS:382-40-1
Formula: C6H5Br2F3O3
KIN01012891
1,1,1,2,3,3-HEXAFLUORO-3-PROP-2-ENOXY-2-(TRIFLUOROMETHOXY) -PROPANE
CAS:141652-05-3
Formula: C7H5F9O2
KIN03261350
1,1,1,2,3,3-HEXAFLUORO-4,4-DIMETHYLPENTANE
CAS:53005-29-1
Formula: C7H10F6
KIN02328878
1,1,1,2,3,3-HEXAFLUORO-4-(1,1,2,2-TETRAFLUORO-ETHOXY) PENTANE
CAS:24556-39-6
Formula: C7H6F10O
KIN02131571
1,1,1,2,3,3-HEXAFLUORO-4-(TRIFLUOROMETHOXY) BUTANE
CAS:69948-43-2
Formula: C5H3F9O
KIN02574068
1,1,1,2,3,3-HEXAFLUORO-4-METHOXY-BUTANE
CAS:58705-93-4
Formula: C5H6F6O
KIN02419763
1,1,1,2,3,3-HEXAFLUORO-4-METHYL-HEXANE
CAS:57915-72-7
Formula: C7H10F6
KIN02407551
1,1,1,2,3,3-HEXAFLUORO-4-METHYLPENTANE
CAS:53072-71-2
Formula: C6H8F6
KIN02329882
1,1,1,2,3,3-HEXAFLUORO-4-PROPOXY-HEXANE
CAS:94412-77-8
Formula: C9H14F6O
KIN02781669
1,1,1,2,3,3-HEXAFLUORO-HEPTANE
CAS:57915-71-6
Formula: C7H10F6
KIN02407550
1,1,1,2,3,3-HEXAFLUOROPENTANE
CAS:57915-69-2
Formula: C5H6F6
KIN02407548
1,1,1,2,3,3-HEXAFLUOROPROPAN-2-YL HYPOFLUORITE
CAS:152239-88-8
Formula: C3HF7O
KIN03301483
1,1,1,2,3,3-HEXAFLUOROPROPANE
CAS:431-65-2
Formula: C3F5I
KIN01014348
1,1,1,2,3,3-HEXAMETHYL-TRISILANE
CAS:99811-09-3
Formula: C6H20Si3
KIN02822548
1,1,1,2,3,4,4,4-OCTACHLORO-BUT-2-ENE
CAS:3050-69-9
Formula: C8H14O2
KIN01081552
1,1,1,2,3,4,4,4-OCTACHLORO-BUTANE
CAS:18791-19-0
Formula: C4H2Cl8
KIN02075175
1,1,1,2,3,4,4,4-OCTAFLUORO-2,3-BIS(HEPTAFLUOROPROPOXY) BUTANE
CAS:2501-02-2
Formula: C14H10N2O4
KIN01070798
1,1,1,2,3,4,4,4-OCTAFLUORO-2,3-BIS(TRIFLUOROMETHYL)BUTANE
CAS:354-97-2
Formula: C8F18
KIN01011676
1,1,1,2,3,4,4,4-OCTAFLUORO-BUTANE
CAS:75995-72-1
Formula: C4H2F8
KIN02616242
MFCD03092909
1,1,1,2,3,4,4,4-OCTAMETHYL-2,3-DIPHENYL-TETRASILANE
CAS:40907-20-8
Formula: C20H34Si4
KIN02266761
1,1,1,2,3,4,4,5,5,5-DECAFLUORO-2-PENTENE
CAS:72804-49-0
Formula: C5F10
KIN02594002
MFCD01320761
1,1,1,2,3,4,4,5,5,6,6-UNDECAFLUORO-2-HEXENE
CAS:65578-34-9
Formula: C6HF11
KIN02529086
1,1,1,2,3,4,4-HEPTAFLUORO-4-(1,2,2-TRIFLUORO-ETHENOXY) BUT-2-ENE
CAS:136132-94-0
Formula: C6F10O
KIN03235681
1,1,1,2,3,4,5,5,6,6,6-UNDECAFLUORO-4-(TRIFLUOROMETHYL)HEX-2-ENE
CAS:403855-46-9
Formula: C7F14
KIN03564827
1,1,1,2,3,4,5,6,6,6-DECACHLORO-2,4-HEXADIENE
CAS:64739-22-6
Formula: C6Cl10
KIN02514779
1,1,1,2,3,4-HEXAFLUORO-BUTANE
CAS:119450-67-8
Formula: C4H4F6
KIN03159112
1,1,1,2,3,5,5,5-OCTAFLUORO-2,3,4,4-TETRAKIS(TRIFLUOROMETHYL)PENTANE
CAS:122432-75-1
Formula: C9F20
KIN03174731
1,1,1,2,3,5,5,6,6,7,7,7-DODECAFLUORO-2,4-BIS(TRIFLUOROMETHYL)-3-HEPTENE
CAS:30320-29-7
Formula: C9F18
KIN02181106
1,1,1,2,3-PENTACHLORO-1,1-DIHYDRO-1H-PHOSPHINDOLE
CAS:66441-89-2
Formula: C8H4Cl5P
KIN02542082
1,1,1,2,3-PENTACHLORO-2-FLUOROPROPANE
CAS:421-99-8
Formula: C3H2Cl3F3
KIN01014060
1,1,1,2,3-PENTACHLORO-2-METHYLPROPANE
CAS:4749-34-2
KIN01113935
1,1,1,2,3-PENTACHLORO-BUTANE
CAS:91025-74-0
Formula: C4H5Cl5
KIN02737466
1,1,1,2,3-PENTACHLOROPROPANE
CAS:21700-31-2
Formula: C3H3Cl5
KIN02103371
MFCD01024425
1,1,1,2,3-PENTAFLUORO-2,5-HEXADIENE
CAS:1730-23-0
Formula: C5H5ClF2
KIN01054403
1,1,1,2,3-PENTAFLUORO-2-CHLOROPROPANE
CAS:230956-35-1
Formula: C3H2ClF5
KIN03442828
1,1,1,2,3-PENTAFLUORO-3-METHOXY-PROPANE
CAS:58335-45-8
Formula: C4 H5 F5 O
KIN02413979
Hfe-365pcf
1,1,1,2,3-PENTAFLUORO-BUTANE
CAS:161791-22-6
Formula: C4H5F5
KIN03329839
1,1,1,2,3-PENTAFLUOROPROPANE
CAS:431-32-3
Formula: C3HF4N
KIN01014327
1,1,1,2,3-PENTAPHENYL-TRISILANE
CAS:192568-51-7
Formula: C30H28Si3
KIN03394283
1,1,1,2,4,4,4-HEPTAFLUORO-3-(TRIFLUOROMETHYL)BUT-2-ENE
CAS:41004-33-5
Formula: C5F10
KIN02267677
1,1,1,2,4,4,4-HEPTAFLUORO-BUTANE
CAS:86884-16-4
Formula: C4H3F7
KIN02683147
MFCD03094219
1,1,1,2,4,4,5,5,5-NONACHLORO-2-PENTENE
CAS:54976-91-9
Formula: C5HCl9
KIN02358620
1,1,1,2,4,4,5,5,5-NONAFLUORO-2-PENTENE
CAS:86154-61-2
Formula: C5HF9
KIN02678683
1,1,1,2,4,4,5,5,6,6,6-UNDECAFLUORO-2-(TRIFLUOROMETHYL)-3-HEXANONE
CAS:813-46-7
Formula: C4H3Cl5O2
KIN01030292
1,1,1,2,4,4,5,5,6,6,7,7,8,8,9,9-HEXADECAFLUORO-2-(TRIFLUOROMETHYL)-3-NONANONE
CAS:42287-80-9
Formula: C10HF19O
KIN02277334
1,1,1,2,4,4,5,5,6,6,7,7,9,10,10,10-HEXADECAFLUORO-2,9-BIS(TRIFLUOROMETHYL)-3,8-DECANEDIONE
CAS:57070-05-0
Formula: C12F22O2
KIN02393584
1,1,1,2,4,4,5,5,6,6,7,7-DODECAFLUORO-2-(TRIFLUOROMETHYL)-3-HEPTANONE
CAS:680-08-0
Formula: C10H12F6O5
KIN01025355
1,1,1,2,4,4,5,5-OCTAFLUORO-2,5-BIS(TRIFLUOROMETHOXY) -3-PENTANONE
CAS:54519-03-8
Formula: C7F14O3
KIN02351198
1,1,1,2,4,4,5,5-OCTAFLUORO-2-(HEPTAFLUOROPROPOXY) -3-PENTANONE
CAS:54519-04-9
Formula: C8HF15O2
KIN02351199
1,1,1,2,4,4,5,5-OCTAFLUORO-2-(TRIFLUOROMETHOXY) -3-PENTANONE
CAS:54519-01-6
Formula: C6HF11O2
KIN02351197
1,1,1,2,4,4,5,5-OCTAFLUORO-2-[1,1,2,2,3,3-HEXAFLUORO-3-(TRIFLUOROMETHOXY) PROPOXY]-5-(TRIFLUOROMETHOXY)-3-PENTANONE
CAS:59681-96-8
Formula: C10F20O4
KIN02435431
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,14,15,15,15-ICOSAFLUORO-5,8,11-TRIS(TRIFLUOROMETHYL)-3,6,9,12-TETRAOXAPENTADECANE
CAS:26738-51-2
Formula: C14HF29O4
KIN02150846
MFCD00054717
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,14-HEPTADECAFLUORO-2,5,8,11-TETRAKIS(TRIFLUOROMETHYL)-3,6,9,12-TETRAOXAPENTADECAN-15-OIC ACID POTASSIUM SALT
CAS:139326-66-2
KIN03251920
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,22,22,23,23,24,24,24-NONACOSAFLUORO-5,8,11,14,17,20-HEXAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18,21-HEPTAOXA-TETRACOSANE
CAS:59852-65-2
Formula: C23HF47O7
KIN02438191
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,22,22,23,25,25,26,26,27,27,27-DOTRIACONTAFLUORO-5,8,11,14,17,20,23-HEPTAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18,21,24-OCTAOXAHEPTACOSANE
CAS:27120-63-4
Formula: C26HF53O8
KIN02154260
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,22,22,23,25,25,26,28,28,29,29,30,30,30-PENTATRIACONTAFLUORO-5,8,11,14,17,20,23,26-OCTAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18,21,24,27-NONAOXATRIACONTANE
CAS:58979-41-2
Formula: C29HF59O9
KIN02424248
1,1,1,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,22,22,23,25,25,26,28,28,29,31,31,32,34,34,35,37,37,38,40,40,41,43,43,44,46,46,47,48,48,48-TRIPENTACONTAFLUORO-5,8,11,14,17,20,23,26,29,32,35,38,41,44-TETRADECAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18,21,24,27,30,33,36,39,42,45-PENTADECAOXAOCTATETRACONTANE
CAS:122998-72-5
Formula: C47HF95O15
KIN03177672
1,1,1,2,4,4-HEXAFLUORO-2-(TRIFLUOROMETHYL)BUTANE
CAS:1801-06-5
Formula: C5H4ClFN2O
KIN01056159
1,1,1,2,4,4-HEXAFLUORO-4-IODO-2-(TRIFLUOROMETHYL)BUTANE
CAS:756-88-7
Formula: C6F14Hg
KIN01028287
1,1,1,2,4,4-HEXAFLUORO-BUTANE
CAS:158421-88-6
Formula: C4H4F6
KIN03320384
1,1,1,2,4,5,5,5-OCTAFLUORO-2,4-BIS(TRIFLUOROMETHOXY) -3-PENTANONE
CAS:59681-95-7
Formula: C7F14O3
KIN02435430
1,1,1,2,4,5,5,5-OCTAFLUORO-2,4-BIS(TRIFLUOROMETHYL)-3-PENTANOL
CAS:918-51-4
Formula: C2H3BrN2O5
KIN01033537
1,1,1,2,4,5,5,5-OCTAFLUORO-2,4-BIS(TRIFLUOROMETHYL)-3-PENTANOL, COMPD. WITH TETRAHYDROFURAN
CAS:6884-94-2
KIN01172028
1,1,1,2,4,5,5,5-OCTAFLUORO-2,4-BIS(TRIFLUOROMETHYL)PENTAN-3-ONE
CAS:813-45-6
KIN01030291
1,1,1,2,4,5,5,5-OCTAFLUORO-3-[1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL]-4-(TRIFLUOROMETHYL)PENT-2-ENE
CAS:30320-27-5
Formula: C9F18
KIN02181104
1,1,1,2,5,5,5-HEPTAFLUORO-4-METHYL-2-PENTENE
CAS:90296-73-4
Formula: C6H5F7
KIN02725517
1,1,1,2,5,6,6,6-OCTAFLUORO-2,5-BIS(TRIFLUOROMETHYL)-HEXAN-3,4-DIONE
CAS:1870-20-8
Formula: C8H7FN2O3
KIN01057771
1,1,1,2,5,6,6,6-OCTAFLUORO-3,4-BISTRIFLUOROMETHYL-HEXA-2,4-DIENE
CAS:24692-18-0
Formula: C8F14
KIN02133024
1,1,1,2- TETRABROMOPROPANE
CAS:72108-72-6
Formula: C3H4Br4
KIN02589025
1,1,1,2-ETHANETETRACARBOXYLIC ACID 1-ETHYL ESTER
CAS:1082770-32-8
Formula: C8H10O8
KIN05122309
1,1,1,2-PROPANETETRACARBOXYLIC ACID
CAS:1089692-00-1
Formula: C7H8O8
KIN05129467
1,1,1,2-TETRABROMO-2,2-DIFLUORO-ETHANE
CAS:3470-71-1
KIN01089892
1,1,1,2-TETRABROMO-2-CHLORO-ETHANE
CAS:379226-03-6
Formula: C2HBr4Cl
KIN03547505
1,1,1,2-TETRABROMO-BUTANE
CAS:25497-47-6
Formula: C4H6Br4
KIN02140421
1,1,1,2-TETRABROMO-ETHANE
CAS:630-17-1
Formula: C5H11Br
KIN01023617
1,1,1,2-TETRACHLOR-2-(P-TOLYL)ETHAN
CAS:4714-30-1
Formula: C8H5Cl5
KIN01113201
1,1,1,2-TETRACHLORO-2,2-DIFLUORO-ETHANE
CAS:76-12-0
Formula: C2Cl4F2
KIN01001241
1,1,1,2-TETRACHLORO-2,2-DIMETHYL-DISILANE
CAS:26980-43-8
Formula: C2H6Cl4Si2
KIN02152887
1,1,1,2-TETRACHLORO-2,2-DIMETHYLDISILANE
CAS:71951-01-4
Formula: C2H6Cl4Si2
KIN02587972
1,1,1,2-TETRACHLORO-2,2-DIPHENYL-DISILANE
CAS:85465-19-6
Formula: C12H10Cl4Si2
KIN02674498
1,1,1,2-TETRACHLORO-2,3,3,3-TETRAFLUOROPROPANE
CAS:3175-79-9
Formula: C17H17NO2
KIN01083890
1,1,1,2-TETRACHLORO-2,3,3,4,4,4-HEXAFLUORO-BUTANE
CAS:28107-59-7
Formula: C4Cl4F6
KIN02163278
1,1,1,2-TETRACHLORO-2-(1,2,2,2-TETRACHLORO-ETHOXY) ETHANE
CAS:41284-12-2
Formula: C4H2Cl8O
KIN02269902
1,1,1,2-TETRACHLORO-2-(2,2,2-TRICHLORO-ETHOXY) ETHANE
CAS:36458-84-1
Formula: C4H3Cl7O
KIN02232046
1,1,1,2-TETRACHLORO-2-(2-FLUORO-ETHOXY) ETHANE
CAS:339-71-9
Formula: C4H5O3-
KIN01010973
1,1,1,2-TETRACHLORO-2-FLUORO-2-METHOXY-ETHANE
CAS:37021-34-4
Formula: C3H3Cl4FO
KIN02236289
MFCD07784228
1,1,1,2-TETRACHLORO-2-FLUORO-ETHANE
CAS:354-12-1
Formula: C2HCl3F2
KIN01011617
1,1,1,2-TETRACHLORO-2-FLUOROPROPANE
CAS:3175-26-6
Formula: C3H3Cl4F
KIN01083888
1,1,1,2-TETRACHLORO-2-METHOXY-ETHANE
CAS:18272-01-0
Formula: C3H4Cl4O
KIN02070479
1,1,1,2-TETRACHLORO-2-NITRO-ETHANE
CAS:54529-52-1
Formula: C2HCl4NO2
KIN02351418
1,1,1,2-TETRACHLORO-3-OCTYNE
CAS:91735-07-8
Formula: C8H10Cl4
KIN02748081
1,1,1,2-TETRACHLORO-4,4,4-TRIFLUORO-BUT-2-ENE
CAS:400-43-1
Formula: C4H3ClF6
KIN01013545
1,1,1,2-TETRACHLORO-BUTANE
CAS:29470-16-4
Formula: C4H6Cl4
KIN02174260
1,1,1,2-TETRACHLORO-ETHANE
CAS:630-22-8
Formula: C5H11NS
KIN01023621
1,1,1,2-TETRACHLORO-UNDECANE
CAS:63981-28-2
Formula: C11H20Cl4
KIN02502374
1,1,1,2-TETRACHLORODECANE
CAS:175801-36-2
Formula: C10H18Cl4
KIN03359719
1,1,1,2-TETRACHLOROPERFLUORO-N-OCTANE
CAS:135941-32-1
Formula: C8Cl4F14
KIN03234930
1,1,1,2-TETRACHLOROPROPANE
CAS:812-04-4
Formula: C2HCl2F3
KIN01030254
1,1,1,2-TETRAETHOXY-ETHANE
CAS:58995-67-8
Formula: C10H22O4
KIN02424467
1,1,1,2-TETRAFLUORO-2-(1,1,2,2-TETRAFLUORO-ETHOXY) ETHANE
CAS:51410-38-9
Formula: C4H2F8O
KIN02306036
1,1,1,2-TETRAFLUORO-2-(2,2,2-TRIFLUORO-ETHOXY) ETHANE
CAS:55605-86-2
Formula: C4H3F7O
KIN02369045
1,1,1,2-TETRAFLUORO-2-(FLUOROMETHOXY) ETHANE
CAS:56885-27-9
Formula: C3H3F5O
KIN02390191
1,1,1,2-TETRAFLUORO-2-(HEPTAFLUOROPROPOXY) -3-PENTANOL
CAS:67727-80-4
Formula: C8H7F11O2
KIN02557170
1,1,1,2-TETRAFLUORO-2-(HEPTAFLUOROPROPOXY) -3-PENTANONE
CAS:67727-78-0
Formula: C8H5F11O2
KIN02557169
1,1,1,2-TETRAFLUORO-2-(HEPTAFLUOROPROPOXY) -4-IODO-OCTANE
CAS:261760-05-8
Formula: C11H12F11IO
KIN03459160
1,1,1,2-TETRAFLUORO-2-(HEPTAFLUOROPROPOXY) OCT-3-ENE
CAS:261760-07-0
Formula: C11H11F11O
KIN03459162
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHOXY) BUTANE
CAS:200501-98-0
Formula: C5H5F7O
KIN03407687
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHOXY) ETHANE
CAS:2356-69-6
KIN01067627
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHOXY) OCT-3-ENE
CAS:261760-17-2
Formula: C9H11F7O
KIN03459170
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)-3-NONANOL
CAS:91299-14-8
Formula: C10H15F7O
KIN02741501
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)-3-PENTANONE
CAS:83848-30-0
Formula: C6H5F7O
KIN02663903
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)-6-IODO-HEXANE
CAS:99324-97-7
Formula: C7H8F7I
KIN02819553
MFCD06248783
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)BUTANE
CAS:151854-62-5
Formula: C5H5F7
KIN03300554
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)HEX-4-EN-3-ONE
CAS:184711-88-4
Formula: C7H5F7O
KIN03377317
1,1,1,2-TETRAFLUORO-2-(TRIFLUOROMETHYL)OCT-3-ENE
CAS:261760-26-3
Formula: C9H11F7
KIN03459178
1,1,1,2-TETRAFLUORO-2-HEPTAFLUOROPROPOXY-4-IODO-BUTANE
CAS:243128-38-3
Formula: C7H4F11IO
KIN03446417
1,1,1,2-TETRAFLUORO-2-IODO-ETHANE
CAS:3831-54-7
KIN01096638
1,1,1,2-TETRAFLUORO-2-NITRO-ETHANE
CAS:2967-15-9
Formula: C18H20F3NO.C4H4O4
KIN01079954
1,1,1,2-TETRAFLUORO-3,3,3-TRIMETHOXY-PROPANE
CAS:42415-18-9
Formula: C6H10F4O3
KIN02278199
1,1,1,2-TETRAFLUORO-BUT-2-ENE
CAS:74728-73-7
Formula: C4H4F4
KIN02607885
1,1,1,2-TETRAFLUORO-ETHANE
CAS:812-00-0
Formula: CH5O4P
KIN01030251
1,1,1,2-TETRAFLUORO-ETHANE, HBR
CAS:357409-09-7
Formula: C2H3BrF4
KIN03534380
1,1,1,2-TETRAFLUORO-ETHANEMIXT. WITH 1,1-DIFLUORO-ETHANE
CAS:284495-78-9
Formula: C2H4F2.C2H2F4
KIN03624347
1,1,1,2-TETRAFLUORONONAN-3-ONE
CAS:113487-28-8
Formula: C9H14F4O
KIN03123415
1,1,1,2-TETRAFLUOROPROPANE
CAS:421-49-8
Formula: C3H6F3N.ClH
KIN01014041
1,1,1,2-TETRAHYDRO-1-[(4-IODO-PHENYL)IMINO]-2-METHYL-1-MORPHOLIN-4-YL-3-PHENYLTHIENO[3,2-C][1,2]AZAPHOSPHORINE-6-CARBOXYLIC ACID METHYL ESTER
CAS:380419-76-1
Formula: C25H25IN3O3PS
KIN03548714
1,1,1,2-TETRAKIS(4-NITROPHENYL)ETHANE
CAS:7497-24-7
Formula: C14H11Cl2NO
KIN01189389
1,1,1,2-TETRAKIS-(4-METHOXY-PHENYL) ETHANE
CAS:116028-51-4
Formula: C30H30O4
KIN03140478
1,1,1,2-TETRAMETHYL-2,2-DIPHENYL-DISILANE
CAS:1450-18-6
Formula: C21H24Si2
KIN01047304
1,1,1,2-TETRAMETHYL-2,2-DIVINYLDISILANE
CAS:1450-31-3
Formula: C13H10S
KIN01047309
1,1,1,2-TETRAMETHYL-2-(4-METHYLPHENYL)-DISILANE
CAS:61211-86-7
Formula: C11H20Si2
KIN02452784
1,1,1,2-TETRAMETHYL-2-DIPHENYLPHOSPHINOYLHYDRAZINIUM, IODIDE
CAS:132509-05-8
Formula: C16H22IN2OP
KIN03219185
1,1,1,2-TETRAMETHYL-DISILANE
CAS:81633-92-3
Formula: C4H14Si2
KIN02650898
1,1,1,2-TETRAMETHYLHYDRAZINIUM IODIDE
CAS:3291-33-6
Formula: C14H16O2
KIN01086139
1,1,1,2-TETRAPHENYL-DIGERMANE
CAS:91123-25-0
Formula: C24H22Ge2
KIN02739018
1,1,1,24,24,24-HEXAPHENYL-2,5,8,11,14,17,20,23-OCTAAOXATETRACOSANE
CAS:144270-97-3
Formula: C52H58O8
KIN03274858
1,1,1,2TETRAFLUORO-2-FLUOROCARBONYLETHANSULFINYLFLUORIDE
CAS:27825-79-2
Formula: C3F6O2S
KIN02160673
1,1,1,3,3,3 O-HEPTADEUTERIO-PROPAN-2-OL
CAS:24567-48-4
Formula: C3HD7O
KIN02131682
1,1,1,3,3,3-HEXABROMOPROPAN-2-ONE
CAS:23162-64-3
Formula: C3Br6O
KIN02117376
MFCD11656171
1,1,1,3,3,3-HEXABUTYL-2,2-BIS(TRICHLOROSILYL)DISTANNASILANE
CAS:239478-71-8
Formula: C24H54Cl6Si3Sn2
KIN03445541
1,1,1,3,3,3-HEXACHLORO-2,2-BIS(TRICHLOROSILYL)-TRISILANE
CAS:50350-62-4
Formula: Cl12Si5
KIN02291994
1,1,1,3,3,3-HEXACHLORO-2,2-DIFLUOROPROPANE
CAS:3182-48-7
Formula: C20H24O4
KIN01083999
1,1,1,3,3,3-HEXACHLORO-2-(TRICHLOROSILYL)-TRISILANE
CAS:62257-60-7
Formula: Cl9HSi4
KIN02471089
1,1,1,3,3,3-HEXACHLORO-DISILOXANE
CAS:246228-72-8
Formula: [Cl6OSi2]
KIN03448467
1,1,1,3,3,3-HEXACHLORO-TRISILANE
CAS:62218-00-2
Formula: Cl6H2Si3
KIN02470218
1,1,1,3,3,3-HEXACHLOROPROPAN-2-ONE
CAS:116-17-6
Formula: C11H25O3P
KIN01004643
1,1,1,3,3,3-HEXACHLOROPROPANE
CAS:3607-93-0
KIN01092474
1,1,1,3,3,3-HEXACYCLOHEXYL-2,2-BIS(2-METHYLPROPYL)-TRISTANNANE
CAS:6055-39-6
Formula: C14H19ClN2O2
KIN01148583
1,1,1,3,3,3-HEXACYCLOHEXYLDISTANNOXANE
CAS:5837-39-8
KIN01143029
1,1,1,3,3,3-HEXADEUTERIO-2-(TRIDEUTERIOMETHYL)-PROPAN-2-OL
CAS:25725-11-5
Formula: C4HD9O
KIN02142292
1,1,1,3,3,3-HEXAETHYL-2,2-BISPROPAN-2-YL-TRISTANNANE
CAS:66362-98-9
Formula: C18H44Sn3
KIN02541005
1,1,1,3,3,3-HEXAETHYL-2,2-DIMETHYL-TRIGERMANE
CAS:14908-74-8
Formula: C14H36Ge3
KIN02036656
1,1,1,3,3,3-HEXAETHYL-2-HEXYL-2-METHYL-TRISILANE
CAS:95999-69-2
Formula: C19H46Si3
KIN02797098
1,1,1,3,3,3-HEXAETHYL-DIGERMASELENANE
CAS:6002-77-3
Formula: C20H25N3S?xC4H4O4
KIN01147122
1,1,1,3,3,3-HEXAETHYL-DIGERMOXANE
CAS:2538-76-3
Formula: C17H26N2
KIN01071550
1,1,1,3,3,3-HEXAETHYL-DISTANNOXANE
CAS:1112-64-7
Formula: C11H24GeO2
KIN01039778
1,1,1,3,3,3-HEXAETHYLTRIGERMANE
CAS:121777-27-3
Formula: C12H32Ge3
KIN03171520
1,1,1,3,3,3-HEXAFLUORO-2,2-BIS(TRIFLUOROMETHYL)-PROPANE
CAS:374-59-4
Formula: C9F18
KIN01012591
1,1,1,3,3,3-HEXAFLUORO-2,2-DIMETHOXY-PROPANE
CAS:754-56-3
Formula: C12H24O
KIN01028232
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIAMINE
CAS:1737-87-7
KIN01054637
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOL, COMPD. WITH BENZENEMETHANAMINE
CAS:1540-94-9
Formula: C6H13NO
KIN01049691
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOLCOMPD. WITH 1H-[1,2,4]-TRIAZOL-5-YLAMINE
CAS:327182-53-6
Formula: C5H6F6N4O2
KIN03497594
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOLCOMPD. WITH 2-METHYL-ANILINE
CAS:327176-15-8
Formula: C10H11F6NO2
KIN03497580
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOLCOMPD. WITH 4-CHLORO-2-NITRO-ANILINE
CAS:327176-29-4
Formula: C6H5ClN2O2.C3H2F6O2
KIN03497581
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOLCOMPD. WITH ALPHA-METHYLBENZENEMETHANAMINE
CAS:327176-09-0
Formula: C8H11N.C3H2F6O2
KIN03497579
1,1,1,3,3,3-HEXAFLUORO-2,2-PROPANEDIOLMONOACETATE
CAS:66363-05-1
Formula: C5H4F6O3
KIN02541010
1,1,1,3,3,3-HEXAFLUORO-2-(1,1,1,3,3,3-HEXAFLUORO-ISOPROPOXYMETHOXY) -PROPANE
CAS:194039-81-1
Formula: C7H4F12O2
KIN03397662
1,1,1,3,3,3-HEXAFLUORO-2-(1,1,2,3,3,3-HEXAFLUOROPROPOXY) -PROPANE
CAS:25352-92-5
Formula: C6H2F12O
KIN02138771
1,1,1,3,3,3-HEXAFLUORO-2-(2-((2-HYDROXY-1,2,2-TRIPHENYLETHYL) THIO)PHENYL)-PROPAN-2-OL
CAS:165066-89-7
Formula: C29H22F6O2S
KIN03336579
1,1,1,3,3,3-HEXAFLUORO-2-(3-NITROPHENYL)-PROPAN-2-OL
CAS:2402-67-7
Formula: C9H7F6NO
KIN01068721
1,1,1,3,3,3-HEXAFLUORO-2-(4-ETHYLPHENYL)-PROPAN-2-OL
CAS:786-03-8
Formula: C16H16O2
KIN01029730
1,1,1,3,3,3-HEXAFLUORO-2-(4-METHOXY-PHENYL) -PROPAN-2-YLIUM
CAS:150935-10-7
Formula: C10H7F6O+
KIN03297683
1,1,1,3,3,3-HEXAFLUORO-2-(DIFLUOROMETHOXY) -PROPANE
CAS:26103-08-2
Formula: C4H2F8O
KIN02145473
1,1,1,3,3,3-HEXAFLUORO-2-(FLUOROMETHOXY) -PROPANE
CAS:28523-86-6
Formula: C4H3F7O
KIN02166735
Sevoflurane; Fluoromethyl 1,1,1,3,3,3-hexafluorois
MFCD00153189
1,1,1,3,3,3-HEXAFLUORO-2-(FLUOROMETHOXYMETHOXY) -PROPANE
CAS:194039-91-3
Formula: C5H5F7O2
KIN03397663
1,1,1,3,3,3-HEXAFLUORO-2-(METHYL-PHOSPHINO)-2-PROPANOL
CAS:7238-89-3
Formula: C10H18Mo2S4
KIN01182351
1,1,1,3,3,3-HEXAFLUORO-2-(METHYLAMINOMETHYL)-PROPAN-2-OL
CAS:380609-21-2
Formula: C5H7F6NO
KIN03549370
1,1,1,3,3,3-HEXAFLUORO-2-(P-TOLYL)-PROPAN-2-OL
CAS:2010-62-0
Formula: C11H10F6O
KIN01060817
1,1,1,3,3,3-HEXAFLUORO-2-(PHENYLAMINO)-2-PROPANOL
CAS:3420-97-1
Formula: C8H9NO2
KIN01088891
1,1,1,3,3,3-HEXAFLUORO-2-(PHENYLTHIO)-2-PROPANOL
CAS:78550-31-9
Formula: C9H6F6OS
KIN02632231
1,1,1,3,3,3-HEXAFLUORO-2-(TRIFLUOROMETHYL)-2-PROPANOLSODIUM SALT
CAS:17526-77-1
Formula: C4HF9O.Na
KIN02062915
1,1,1,3,3,3-HEXAFLUORO-2-(TRIFLUOROMETHYL)-PROPAN-2-YLAMINE
CAS:2809-93-0
Formula: C10H15N
KIN01076569
1,1,1,3,3,3-HEXAFLUORO-2-(TRIFLUOROMETHYL)-PROPANE
CAS:382-26-3
Formula: C5H4F8O
KIN01012885
1,1,1,3,3,3-HEXAFLUORO-2-[(2,2,2-TRIFLUORO-ETHYL)SULFONYL]PROPANE
CAS:53105-45-6
Formula: C5H3F9O2S
KIN02330364
1,1,1,3,3,3-HEXAFLUORO-2-[(2-HYDROXYETHYL) AMINO]-2-PROPANOL
CAS:30184-89-5
Formula: C5H7F6NO2
KIN02179924
1,1,1,3,3,3-HEXAFLUORO-2-[(2-METHOXYETHYLAMINO) METHYL]PROPAN-2-OL
CAS:380609-16-5
Formula: C7H11F6NO2
KIN03549369
1,1,1,3,3,3-HEXAFLUORO-2-[[2-PIPERAZIN-1-YLETHYL]AMINO]-2-PROPANOL
CAS:26799-51-9
KIN02151258
1,1,1,3,3,3-HEXAFLUORO-2-[4-(METHYLAMINO)PHENYL]PROPAN-2-OL
CAS:1481-12-5
Formula: C13H10F2O
KIN01048076
1,1,1,3,3,3-HEXAFLUORO-2-FLUOROMETHYLPROPANE
CAS:2794-20-9
Formula: C4H5F3N2
KIN01076252
1,1,1,3,3,3-HEXAFLUORO-2-FLUOROSULFONYLOXY-2-(TRIFLUOROMETHYL)-PROPANE
CAS:106054-87-9
Formula: C4F10O3S
KIN03073416
1,1,1,3,3,3-HEXAFLUORO-2-IODO-PROPANE
CAS:4141-97-3
KIN01101804
1,1,1,3,3,3-HEXAFLUORO-2-ISOCYANATO-PROPANE
CAS:684-31-1
Formula: C3H6Cl3O4P
KIN01025478
1,1,1,3,3,3-HEXAFLUORO-2-METHOXY-PROPAN-2-OL
CAS:662-19-1
KIN01024845
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-PROPANAMINE HCL
CAS:164364-08-3
Formula: C4H6ClF6N
KIN03335531
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-PROPANOL ALUMINUM SALT
CAS:112357-31-0
Formula: C4H4F6O.1/3Al
KIN03114707
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-PROPANOL POTASSIUM SALT
CAS:662-16-8
Formula: C4H4F6O2
KIN01024844
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-PROPANOL SCANDIUM(III) SALT
CAS:140221-90-5
Formula: C4H4F6O.1/3Sc
KIN03255822
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-PROPANOLSODIUM SALT
CAS:59857-46-4
Formula: C4H4F6O.Na
KIN02438352
1,1,1,3,3,3-HEXAFLUORO-2-METHYL-2-TRIFLUOROMETHYLPROPANE
CAS:36553-69-2
Formula: C5H3F9
KIN02232465
1,1,1,3,3,3-HEXAFLUORO-2-METHYLISOPROPANOL
CAS:1515-16-8
Formula: C4H5ClF2O
KIN01049023
1,1,1,3,3,3-HEXAFLUORO-2-METHYLPROPANE
CAS:382-10-5
Formula: C4H2F6
KIN01012875
1,1,1,3,3,3-HEXAFLUORO-2-NITROSO-2-TRIFLUOROMETHYLPROPANE
CAS:354-96-1
Formula: C6F14
KIN01011675
1,1,1,3,3,3-HEXAFLUORO-2-PHENYLPROPAN-2-OL
CAS:718-66-1
Formula: C9H6F5NO
KIN01027236
1,1,1,3,3,3-HEXAFLUORO-2-PIPERAZIN-1-YLPROPAN-2-OL HYDRATE
CAS:30192-64-4
Formula: C7H12F6N2O2
KIN02180042
1,1,1,3,3,3-HEXAFLUORO-2-PIPERIDIN-1-YLPROPAN-2-OL HYDRATE
CAS:30192-67-7
Formula: C8H13F6NO2
KIN02180043
1,1,1,3,3,3-HEXAFLUORO-2-PROPANIMINELITHIUM SALT
CAS:31340-36-0
Formula: C3HF6N.Li
KIN02188684
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL
CAS:29463-77-2
Formula: C3H2F6O
KIN02174239
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL BISMUTH(III) SALT (3:1)
CAS:1036384-16-3
KIN05069968
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL CALCIUM SALT (2:1)
CAS:1084906-46-6
KIN05124925
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL COMPD. WITH ETHYL ETHER
CAS:6919-80-8
Formula: C9H3BF18O3
KIN01172617
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL COMPD. WITH TETRAHYDROFURAN
CAS:6843-83-0
KIN01171301
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL ION(I)
CAS:44870-01-1
KIN02283790
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL SODIUM SALT
CAS:6919-76-2
KIN01172616
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOL THALLIUM(I) SALT
CAS:1079891-64-7
KIN05116721
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLALUMINUM(III) SALT (3:1)
CAS:32103-95-0
KIN02194440
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLANTIMONY(V) SALT (5:1)
CAS:159538-19-9
Formula: C3H2F6O.1/5Sb
KIN03635565
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLBARIUM SALT (2:1)
CAS:134333-28-1
Formula: C3H2F6O.1/2Ba
KIN03009169
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH [1,3]DIOXOLANE
CAS:13004-04-1
KIN02013407
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH 1,1'-SULFINYLBIS[BENZENE]
CAS:58228-33-4
KIN02412395
Benzene, 1,1'-sulfinylbis-, compd. with 1,1,1,
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH 1-AZABICYCLO[2.2.2]OCTANE
CAS:36578-85-5
KIN02232605
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH 2-METHYL-2-PROPANOL
CAS:40389-29-5
KIN02262458
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH 2-PROPANOL
CAS:40389-28-4
KIN02262457
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH METHANOL
CAS:40389-26-2
KIN02262455
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH N,N-DIETHYLETHANAMINE
CAS:56285-72-4
Formula: C6H15N.C3H2F6O
KIN02380297
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH PYRIDINE
CAS:58228-38-9
Formula: C5H5N.C3H2F6O
KIN02412396
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH PYRIDINE (2:1)
CAS:58228-43-6
KIN02412398
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH PYRIDINE N1-OXIDE
CAS:58228-40-3
KIN02412397
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH PYRIDINE N1-OXIDE (2:1)
CAS:58228-44-7
KIN02412399
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOMPD. WITH SULFINYLBIS[METHANE]
CAS:22868-53-7
KIN02114413
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLCOPPER(I) SALT
CAS:136604-47-2
Formula: C3H2F6O.Cu
KIN03237704
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLERBIUM(III) SALT (3:1)
CAS:34505-03-8
KIN02214466
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLGERMANIUM(IV) SALT (4:1)
CAS:21348-28-7
KIN02100049
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLHAFNIUM(IV) SALT (4:1)
CAS:32103-98-3
KIN02194441
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLHEMISULFATE
CAS:92720-81-5
Formula: C6H2F12O4S
KIN02760590
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLHYDRATE
CAS:26035-26-7
KIN02144942
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLHYDROGEN CARBONATE
CAS:90160-98-8
Formula: C4H2F6O3
KIN02723302
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLLANTHANUM(III) SALT (3:1)
CAS:34505-01-6
KIN02214464
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLLEAD(II) SALT (2:1)
CAS:194875-47-3
Formula: C3H2F6O.1/2Pb
KIN03669463
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLLITHIUM SALT
CAS:29649-10-3
Formula: C3H2F6O.Li
KIN02175630
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLMAGNESIUM SALT (2:1)
CAS:100501-99-3
Formula: C3H2F6O.1/2Mg
KIN03658155
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLNEODYMIUM(III) SALT (3:1)
CAS:34505-02-7
KIN02214465
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLNIOBIUM(V) SALT (5:1)
CAS:21348-29-8
KIN02100050
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLPHOSPHATE (3:1)
CAS:66489-68-7
Formula: C9H3F18O4P
KIN02542631
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLPOTASSIUM SALT
CAS:85762-91-0
Formula: C3H2F6O.K
KIN02676531
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLSODIUM SALT
CAS:88917-14-0
KIN02704316
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLSULFITE (2:1)
CAS:53517-89-8
Formula: C6H2F12O3S
KIN02336425
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLTANTALUM(V) SALT (5:1)
CAS:21348-30-1
KIN02100051
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLTHALLIUM(I) SALT
CAS:27619-71-2
KIN02158957
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLTHULIUM(III) SALT (3:1)
CAS:178064-31-8
Formula: C3H2F6O.1/3Tm
KIN03624346
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLTIN(II) SALT (2:1)
CAS:184000-71-3
Formula: C3H2F6O.1/2Sn
KIN03679837
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLTITANIUM(IV) SALT (4:1)
CAS:21416-30-8
KIN02100650
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLYTTRIUM(III) SALT (3:1)
CAS:34520-24-6
KIN02214530
1,1,1,3,3,3-HEXAFLUORO-2-PROPANOLZIRCONIUM(IV) SALT (4:1)
CAS:21416-31-9
Formula: C3H2F6O.1/4Zr
KIN02100651
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE
CAS:17785-84-1
Formula: C3F6O
KIN02065521
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:346-55-4
Formula: C10H5ClF3N
KIN01011234
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE COMPD. WITH 4-CHLORO-6-METHYLPYRIMIDIN-2-YLAMINE
CAS:33661-68-6
Formula: C5H6ClN3.C3F6O
KIN02207737
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE COMPD. WITH FURFURYL ALC
CAS:3334-42-7
Formula: C11H13NO2
KIN01086963
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE HYDRATE (5:8)
CAS:109640-39-3
Formula: C3F6O.8/5D2O
KIN03096544
1,1,1,3,3,3-HEXAFLUORO-2-PROPANONE OXIME
CAS:1645-78-9
Formula: C3H2BrClF4
KIN01052416