ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

1,1'-OXYBIS(PROPAN-2-ONE )
CAS:76089-31-1
Formula: C6H10O3
KIN02616858
1,1'-OXYBIS(TRIDECANE)
CAS:65193-89-7
Formula: C26H54O
KIN02522766
1,1'-OXYBIS-1,2-BENZIODO-XOL-3(1H)-ONE
CAS:1829-25-0
Formula: C8H7IO3
KIN01056804
1,1'-OXYBIS-2,5-PYRROLIDINEDIONE
CAS:181829-46-9
KIN03371643
1,1'-OXYBIS-2-NONENE
CAS:68555-30-6
Formula: C18H34O
KIN02564221
1,1'-OXYBIS-2-PROPANOL ESTER WITH BORIC ACID (H3BO3)
CAS:68070-93-9
Formula: C6H14O3
KIN02560501
1,1'-OXYBIS-2-PROPYN-1-OL
CAS:64205-67-0
Formula: C6H6O3
KIN02506063
1,1'-OXYBIS-BENZENE BROMO-DERIVS
CAS:90193-67-2
KIN02723788
1,1'-OXYBIS-BENZENE DIISODODECYL DERIV
CAS:68039-00-9
Formula: C36H58O
KIN02560212
1,1'-OXYBIS-BENZENE MONO- AND DIDECYL DERIVS
CAS:93062-99-8
KIN02764653
1,1'-OXYBIS-BENZENE SEC-DODECYL DERIVS
CAS:149119-18-6
KIN03291476
1,1'-OXYBIS-BENZENE SEC-HEXYL DERIVS.,SULFONATED
CAS:147732-59-0
KIN03287174
1,1'-OXYBIS-BENZENE TETRAPROPYLENE DERIVS
CAS:119345-02-7
KIN03158635
1,1'-OXYBIS-CYCLOBUTANE
CAS:74976-39-9
KIN02609652
1,1'-OXYBIS-CYCLOPENTANE
CAS:10137-73-2
Formula: C10H18O
KIN02002249
1,1'-OXYBIS-DIAZENE
CAS:14809-32-6
Formula: H2N4O
KIN02035940
1,1'-OXYBIS-PHOSPHOLANE 1,1'-DIOXIDE
CAS:46237-45-0
Formula: C8H16O3P2
KIN02285310
1,1'-OXYBIS-PYRIDINIUM
CAS:93743-74-9
KIN02773039
1,1'-OXYBIS[(1,1,3,3-TETRAMETHYLBUTYL)-BENZENE
CAS:61702-88-3
Formula: C28H44O
KIN02460235
1,1'-OXYBIS[(1,1-DIMETHYLBUTYL)-BENZENE]
CAS:55190-99-3
KIN02362175
1,1'-OXYBIS[(2,2,4-TRIMETHYLPENTYL)-BENZENE
CAS:68683-45-4
Formula: C28H44O
KIN02565034
1,1'-OXYBIS[(PHENOXY-PHENOXY)-BENZENE
CAS:56378-65-5
KIN02381832
1,1'-OXYBIS[1,1,2,2,3,3,4,4,4-NONAFLUORO-BUTANE]
CAS:308-71-4
Formula: C8H2F12O4
KIN01009804
1,1'-OXYBIS[1,1,2,2,3,3,4,4,5,5,6,6,6-TRIDECAFLUORO-HEXANE
CAS:424-36-2
Formula: C7H5F9O2
KIN01014144
1,1'-OXYBIS[1,1,2,2-TETRAFLUORO-2-IODO-ETHANE
CAS:681-35-6
KIN01025381
1,1'-OXYBIS[1,1,4,4,4-PENTAFLUORO-BUTANE
CAS:55757-42-1
Formula: C8H8F10O
KIN02371658
1,1'-OXYBIS[1,1-DIFLUORO-2-IODO-ETHANE
CAS:51100-31-3
Formula: C4H4F4I2O
KIN02301728
1,1'-OXYBIS[1,2,2,2-TETRAFLUORO-ETHANE
CAS:67429-44-1
Formula: C4H2F8O
KIN02553319
1,1'-OXYBIS[1,2-DIBROMO-ETHANE
CAS:6304-38-7
Formula: C8H14Br4O
KIN01156762
1,1'-OXYBIS[1,2-DICHLORO-ETHANE]
CAS:7166-45-2
KIN01180432
1,1'-OXYBIS[1,2-DIHYDRO-[5,6]FULLERENE-C60-IH RADICAL ION(II)
CAS:1021494-52-9
KIN05055313
1,1'-OXYBIS[1,2-DIMETHYL-SILACYCLOPENTANE
CAS:91512-89-9
Formula: C12H26OSi2
KIN02744828
1,1'-OXYBIS[1,3-DIMETHYL-SILACYCLOBUTANE
CAS:62288-17-9
Formula: C10H22OSi2
KIN02471601
1,1'-OXYBIS[1-(2-FLUORO-2,2-DINITROETHOXY)ETHANE
CAS:88934-25-2
Formula: C8H12F2N4O11
KIN02704555
1,1'-OXYBIS[1-CHLORO-2-METHYLPROPANE]
CAS:760-93-0
Formula: C8H10O3
KIN01028431
1,1'-OXYBIS[1-IODO-ETHANE
CAS:79074-16-1
Formula: C4H8I2O
KIN02635463
1,1'-OXYBIS[1-METHYL-PIPERIDINIUM DIMETHANESULFONATE
CAS:63262-10-2
Formula: C12H26N2O.2CH3O3S
KIN02489439
1,1'-OXYBIS[1-METHYLCYCLOBUTANE
CAS:86301-90-8
KIN02679601
1,1'-OXYBIS[1-PHENYL-SILACYCLOBUTANE
CAS:93241-93-1
Formula: C18H22OSi2
KIN02766903
1,1'-OXYBIS[2,2,2-TRIBROMO-1-FLUORO-ETHANE
CAS:67429-46-3
Formula: C4H2Br6F2O
KIN02553321
1,1'-OXYBIS[2,2,2-TRICHLORO-1-FLUORO-ETHANE
CAS:67429-45-2
Formula: C4H2Cl6F2O
KIN02553320
1,1'-OXYBIS[2,2,2-TRIFLUORO-ETHANOL]
CAS:675-09-2
Formula: C7H8O2
KIN01025212
1,1'-OXYBIS[2,2,3,4,4-PENTAMETHYLPHOSPHETANE 1,1'-DIOXIDE
CAS:51471-01-3
Formula: C16H32O3P2
KIN02306956
1,1'-OXYBIS[2,2-DIBROMO-3,3-DIMETHYLCYCLOPROPANE
CAS:61838-61-7
Formula: C10H14Br4O
KIN02462958
1,1'-OXYBIS[2,2-DICHLORO-1-FLUORO-ETHANE
CAS:67429-47-4
Formula: C4H4Cl4F2O
KIN02553322
1,1'-OXYBIS[2,3,4,5-TETRAMETHYLBENZENE
CAS:62787-19-3
Formula: C20H26O
KIN02480405
1,1'-OXYBIS[2,3,4,6-TETRACHLOROBENZENE
CAS:117948-62-6
Formula: C12H2Cl8O
KIN03151726
1,1'-OXYBIS[2,3,5,6-TETRACHLORO-4-METHYLBENZENE
CAS:62584-50-3
Formula: C14H6Cl8O
KIN02476645
1,1'-OXYBIS[2,3-BIS(DIMETHYLAMINO)CYCLOPROPENYLIUM
CAS:86611-83-8
KIN02681451
1,1'-OXYBIS[2,3-DIBROMOPROPANE
CAS:59261-06-2
Formula: C6H10Br4O
KIN02428831
1,1'-OXYBIS[2,3-DIMETHYLBENZENE
CAS:31313-29-8
Formula: C16H18O
KIN02188483
1,1'-OXYBIS[2,4,4,4-TETRACHLORO-BUTANE
CAS:61856-25-5
Formula: C8H10Cl8O
KIN02463205
1,1'-OXYBIS[2,4,6-TRIMETHYLBENZENE
CAS:64826-30-8
Formula: C18H22O
KIN02516384
1,1'-OXYBIS[2,4-DIMETHYLBENZENE
CAS:42878-71-7
Formula: C16H18O
KIN02281177
1,1'-OXYBIS[2,4-DINITRO-BENZENE
CAS:2217-59-6
Formula: C9H20O4S2
KIN01065110
1,1'-OXYBIS[2,5-DIHYDRO-1H-PHOSPHOLE 1,1'-DIOXIDE
CAS:105553-78-4
Formula: C8H12O3P2
KIN03017669
1,1'-OXYBIS[2,5-DIMETHYLBENZENE
CAS:62787-14-8
Formula: C16H18O
KIN02480400
1,1'-OXYBIS[2,6-DICHLOROBENZENE
CAS:91371-42-5
Formula: C12H6Cl4O
KIN02742624
1,1'-OXYBIS[2-(2-BROMOETHOXY)ETHANE
CAS:31255-26-2
Formula: C8H16Br2O3
KIN02188090
1,1'-OXYBIS[2-(2-CHLORO-ETHOXY)-PROPANE
CAS:88986-52-1
Formula: C10H20Cl2O3
KIN02705348
1,1'-OXYBIS[2-(2-CHLORO-ETHOXY)ETHANE
CAS:50906-80-4
KIN02299262
1,1'-OXYBIS[2-(2-CHLORO-ETHYL)-BENZENE
CAS:1020966-94-2
Formula: C16H16Cl2O
KIN05051177
1,1'-OXYBIS[2-(2-IODO-ETHOXY)ETHANE
CAS:36839-56-2
Formula: C8H16I2O3
KIN02234657
1,1'-OXYBIS[2-(2-METHOXY-PHENOXY)-BENZENE
CAS:63910-22-5
Formula: C26H22O5
KIN02501150
1,1'-OXYBIS[2-(4-BROMOPHENYL)-DIAZENE
CAS:90251-47-1
Formula: C12H8Br2N4O
KIN02724598
1,1'-OXYBIS[2-(4-METHOXY-PHENYL)-DIAZENE
CAS:90238-05-4
Formula: C14H14N4O3
KIN02724499
1,1'-OXYBIS[2-(4-METHYLPHENYL)-DIAZENE
CAS:90238-04-3
Formula: C14H14N4O
KIN02724498
1,1'-OXYBIS[2-(4-NITROPHENYL)-DIAZENE
CAS:90238-03-2
Formula: C12H8N6O5
KIN02724497
1,1'-OXYBIS[2-(METHYLSULFONYL)ETHANE
CAS:16523-03-8
Formula: C6H14O5S2
KIN02052191
1,1'-OXYBIS[2-(METHYLTHIO)ETHANE
CAS:60899-64-1
Formula: C6H14OS2
KIN02448709
1,1'-OXYBIS[2-(TRIMETHYLSILYL)-BENZENE
CAS:1082076-85-4
KIN05118405
1,1'-OXYBIS[2-[2-(2-METHOXY-PHENOXY)PHENOXY]BENZENE
CAS:63910-23-6
Formula: C38H30O7
KIN02501151
1,1'-OXYBIS[2-[4-(PHENYLAMINO)PHENOXY]-ETHANOL
CAS:62895-96-9
Formula: C28H28N2O5
KIN02482336
1,1'-OXYBIS[2-AZIDO-ETHANE
CAS:24345-74-2
Formula: C4H8N6O
KIN02129546
MFCD11655885
1,1'-OXYBIS[2-BROMO-1,1-DIFLUORO-ETHANE
CAS:51100-30-2
Formula: C4H4Br2F4O
KIN02301727
1,1'-OXYBIS[2-BROMOMETHYL-4-FLUOROBENZENE
CAS:1062600-39-8
KIN05108275
1,1'-OXYBIS[2-BROMOMETHYLBENZENE]
CAS:10038-41-2
Formula: C14H12Br2O
KIN02001163
1,1'-OXYBIS[2-BROMOPROPANE
CAS:89026-52-8
Formula: C6H12Br2O
KIN02705928
1,1'-OXYBIS[2-CHLOROBENZENE]
CAS:7024-99-9
Formula: C12H8Cl2O
KIN01176637
1,1'-OXYBIS[2-ETHOXY-ETHANE
CAS:112-37-8
Formula: C11H22O2
KIN01004454
1,1'-OXYBIS[2-ETHYNYLBENZENE
CAS:189620-06-2
Formula: C16H10O
KIN03389349
1,1'-OXYBIS[2-FLUORO-2,2-DINITRO-ETHANE
CAS:30290-64-3
Formula: C4H4F2N4O9
KIN02180870
1,1'-OXYBIS[2-FLUORO-ETHANE
CAS:373-22-8
KIN01012529
1,1'-OXYBIS[2-FLUOROBENZENE
CAS:1138557-63-7
KIN05188465
1,1'-OXYBIS[2-IODO-3,5-DIMETHOXY-4-METHYLBENZENE
CAS:95731-66-1
Formula: C18H20I2O5
KIN02794588
1,1'-OXYBIS[2-ISOTHIOCYANATO-BENZENE
CAS:15398-76-2
Formula: C14H8N2OS2
KIN02041125
1,1'-OXYBIS[2-METHOXY-ETHANE]
CAS:142939-39-7
KIN03267411
1,1'-OXYBIS[2-METHOXY-PROPANE
CAS:63019-84-1
Formula: C8H18O3
KIN02484913
1,1'-OXYBIS[2-NITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:346-42-9
Formula: C13H9FN2O3S
KIN01011227
1,1'-OXYBIS[2-NITRO-BENZENE
CAS:2217-76-7
Formula: C12H10O2S2
KIN01065113
1,1'-OXYBIS[3,3-DIMETHYLBUTANE]
CAS:94113-51-6
Formula: C12H26O
KIN02777998
1,1'-OXYBIS[3,4,5-TRIMETHYLBENZENE
CAS:18102-48-2
Formula: C18H22O
KIN02068762
1,1'-OXYBIS[3,4-DIETHYNYLBENZENE
CAS:446828-94-0
Formula: C20H10O
KIN03588709
1,1'-OXYBIS[3,4-DIMETHYLBENZENE
CAS:7717-74-0
Formula: C15H10O7
KIN01193973
1,1'-OXYBIS[3,5-DICHLOROBENZENE
CAS:85918-34-9
Formula: C12H6Cl4O
KIN02677387
1,1'-OXYBIS[3,5-DIMETHOXY-4-METHYLBENZENE
CAS:85949-95-7
Formula: C18H22O5
KIN02677553
1,1'-OXYBIS[3,5-DIMETHYLBENZENE
CAS:137591-57-2
Formula: C16H18O
KIN03242280
1,1'-OXYBIS[3,7,11-TRIMETHYL-2,6,10-DODECATRIENE
CAS:63438-51-7
Formula: C30H50O
KIN02492664
1,1'-OXYBIS[3,7-DIMETHYL-2,6-OCTADIENE
CAS:63438-49-3
Formula: C20H34O
KIN02492663
1,1'-OXYBIS[3-(3-PHENOXY-PHENOXY)-BENZENE
CAS:3705-69-9
Formula: C8H17N3O6
KIN01094370
1,1'-OXYBIS[3-(DICHLOROMETHYL)-BENZENE
CAS:76324-33-9
Formula: C14H10Cl4O
KIN02618498
1,1'-OXYBIS[3-(TERT-BUTYL)-BENZENE
CAS:118464-75-8
KIN03154327
1,1'-OXYBIS[3-AMINO-2-PROPANOL
CAS:31457-40-6
KIN02189559
1,1'-OXYBIS[3-BROMO-2,2-BIS(CHLOROMETHYL)-PROPANE
CAS:67294-35-3
Formula: C10H16Br2Cl4O
KIN02551285
1,1'-OXYBIS[3-BROMOPROPANE
CAS:58929-72-9
Formula: C6H12Br2O
KIN02423464
1,1'-OXYBIS[3-CHLORO-2,2-BIS(CHLOROMETHYL)-PROPANE
CAS:57690-45-6
Formula: C10H16Cl6O
KIN02403698
1,1'-OXYBIS[3-CHLORO-4-NITRO-BENZENE
CAS:63063-20-7
Formula: C12H6Cl2N2O5
KIN02485679
1,1'-OXYBIS[3-ETHYNYL-4-ISOCYANATO-BENZENE
CAS:73629-29-5
KIN02599570
1,1'-OXYBIS[3-ISOCYANATO-BENZENE
CAS:71865-93-5
Formula: C14H8N2O3
KIN02587475
1,1'-OXYBIS[3-METHOXY-BENZENE
CAS:82994-21-6
Formula: C14H14O3
KIN02658735
1,1'-OXYBIS[3-METHOXY-PROPANE
CAS:66226-74-2
Formula: C8H18O3
KIN02538970
1,1'-OXYBIS[3-METHYLBENZENE
CAS:19814-71-2
Formula: C14H14O
KIN02084957
di-m-tolyl ether
1,1'-OXYBIS[3-NITRO-5BENZOTRIFLUORIDE]
CAS:133532-73-7
Formula: [C14H6F6N2O5
KIN03224055
1,1'-OXYBIS[3-NITRO-BENZENE
CAS:38490-83-4
Formula: C12H8N2O5
KIN02248440
1,1'-OXYBIS[4-(1-METHYLETHYL)-BENZENE
CAS:23713-94-2
Formula: C18H22O
KIN02122837
1,1'-OXYBIS[4-(3-BROMOPROPOXY)-BENZENE]
CAS:6334-21-0
Formula: C12H16O4
KIN01159148
1,1'-OXYBIS[4-(3-METHYLPHENOXY)-BENZENE
CAS:62471-03-8
Formula: C26H22O3
KIN02474651
1,1'-OXYBIS[4-(4-ETHYNYLPHENOXY)-BENZENE
CAS:75991-28-5
KIN02616229
1,1'-OXYBIS[4-(4-METHOXY-PHENOXY)-BENZENE]
CAS:5024-91-9
Formula: C11H21N
KIN01119240
1,1'-OXYBIS[4-(DIAZOPHENYLMETHYL)-BENZENE
CAS:24377-73-9
Formula: C26H18N4O
KIN02129856
1,1'-OXYBIS[4-(DIMETHYLSILYL)-BENZENE
CAS:13315-17-8
Formula: C16H22OSi2
KIN02017870
Bis((p-dimethylsilyl)phenyl) ether
MFCD00054791
1,1'-OXYBIS[4-(ETHYLTHIO)-BENZENE
CAS:413605-16-0
Formula: C16H18OS2
KIN03571337
1,1'-OXYBIS[4-(METHYLTHIO)-BENZENE
CAS:35370-99-1
Formula: C14H14OS2
KIN02222505
1,1'-OXYBIS[4-(TERT-BUTYL)-BENZENE
CAS:24085-65-2
Formula: C20H26O
KIN02126733
1,1'-OXYBIS[4-[(2-CHLORO-ETHYL)SULFONYL]BENZENE
CAS:189358-82-5
Formula: C16H16Cl2O5S2
KIN03388845
1,1'-OXYBIS[4-[(4-NITROPHENYL)ETHYNYL]BENZENE
CAS:416878-68-7
Formula: C28H16N2O5
KIN03572819
1,1'-OXYBIS[4-[(4-NITROPHENYL)THIO]BENZENE
CAS:96847-79-9
Formula: C24H16N2O5S2
KIN02803252
1,1'-OXYBIS[4-[(4-PHENOXY-PHENYL)SULFONYL]BENZENE
CAS:52858-15-8
Formula: C36H26O7S2
KIN02326902
1,1'-OXYBIS[4-[(TRIFLUOROMETHYL)SULFONYL]BENZENE
CAS:63509-37-5
Formula: C14H8F6O5S2
KIN02494237
1,1'-OXYBIS[4-BENZYLBENZENE]
CAS:1990-07-4
Formula: C10H19NO5.1/2Ca
KIN01060352
1,1'-OXYBIS[4-BUTOXY-BUTANE]
CAS:4161-47-1
KIN01102149
1,1'-OXYBIS[4-CHLORO-3-NITRO-BENZENE
CAS:63107-19-7
Formula: C12H6Cl2N2O5
KIN02486523
1,1'-OXYBIS[4-ETHENYLBENZENE]
CAS:7659-55-4
KIN01192915
1,1'-OXYBIS[4-ETHYNYLBENZENE
CAS:21368-80-9
Formula: C16H10O
KIN02100186
1,1'-OXYBIS[4-ETHYNYLBENZENE TRIMER
CAS:35617-37-9
KIN02224765
1,1'-OXYBIS[4-FLUORO-2-METHYLBENZENE
CAS:1062600-19-4
Formula: C14H12F2O
KIN05108272
1,1'-OXYBIS[4-IODO-BUTANE
CAS:88420-48-8
Formula: C8H16I2O
KIN02697939
1,1'-OXYBIS[4-ISOCYANATO-3-METHYLBENZENE
CAS:179264-65-4
Formula: C16H12N2O3
KIN03366860
1,1'-OXYBIS[4-ISOCYANATO-BENZENE
CAS:4128-74-9
Formula: C15H8N2O3
KIN01101569
1,1'-OXYBIS[4-ISOCYANOBENZENE
CAS:3117-98-4
KIN01082661
1,1'-OXYBIS[4-ISOTHIOCYANATO-BENZENE
CAS:10396-05-1
Formula: C14H8N2OS2
KIN02005859
MFCD01310824
1,1'-OXYBIS[4-METHOXY-2,3-DIMETHYLBENZENE
CAS:433334-79-3
Formula: C18H22O3
KIN03579176
1,1'-OXYBIS[4-METHOXY-BENZENE]
CAS:1655-80-7
Formula: C6H14Br2Sn
KIN01052608
1,1'-OXYBIS[4-METHYLBENZENE]
CAS:1579-47-1
Formula: C13H10O2
KIN01050692
1,1'-OXYBIS[4-METHYLPENTANE
CAS:64192-92-3
Formula: C12H26O
KIN02505851
1,1'-OXYBIS[4-METHYLPYRIDINIUM
CAS:93743-76-1
KIN02773040
1,1'-OXYBIS[4-NITRO-2-BENZOTRIFLUORIDE]
CAS:344-48-9
Formula: C14H10F6N2O
KIN01011148
1,1'-OXYBIS[6-[(2-METHYL-1-PROPENYLOXY)]-HEXANE
CAS:90819-54-8
Formula: C20H38O3
KIN02733901
1,1'-OXYBIS[ALKANOL(C=2-6)] ETHER
CAS:190280-58-1
KIN03390863
1,1'-OXYBIS[CHLORO-ETHENE
CAS:95268-52-3
Formula: C4H4Cl2O
KIN02789905
1,1'-OXYBIS[ETHYLBENZENE
CAS:68900-67-4
Formula: C16H20O
KIN02566386
1,1'-OXYBIS[HEXAHYDRO-1-METHYL-STANNIN
CAS:67373-78-8
Formula: C12H26OSn2
KIN02552481
1,1'-OXYBIS[METHYLBENZENE CHLORO-DERIVS
CAS:90193-69-4
KIN02723789
1,1'-OXYBIS[METHYLBENZENE SULFONATED,AMMONIUM SALT
CAS:75314-26-0
KIN02611776
1,1'-OXYBIS[N,N,N-TRIMETHYL-2-PROPANAMINIUM DIIODIDE
CAS:64049-59-8
Formula: C12H30N2O.2I
KIN02503700
1,1'-OXYBIS[N-METHYL-N-NITRO-METHANAMINE
CAS:96302-52-2
Formula: C4H10N4O5
KIN02799639
1,1'-OXYBIS[TRIBROMOBENZENE
CAS:31153-30-7
Formula: C12H4Br6O
KIN02187388
1,1'-OXYBIS[TRINITRO-BUTANE
CAS:62084-80-4
Formula: C8H12N6O13
KIN02467425
1,1'-OXYBISBENZENE-TETRAPROPYLENE DERIVATIVES, SULFONATED
CAS:119345-03-8
KIN03158636
1,1'-OXYBISGLYCEROL
CAS:94158-53-9
Formula: C6H14O7
KIN02778667
1,1'-OXYBISPENTADECANE
CAS:51148-16-4
Formula: C30H62O
KIN02302470
1,1'-OXYBISPENTAN-2-OL
CAS:85866-06-4
Formula: C10H22O3
KIN02677052
1,1'-OXYDI(HEXAN-2-OL)
CAS:85866-08-6
Formula: C12H26O3
KIN02677054
1,1'-OXYDI-2-PROPANOL
CAS:110-99-6
Formula: C4H6O5
KIN01004319
1,1'-OXYDIBUTAN-2-OL
CAS:74262-24-1
Formula: C8H18O3
KIN02604471
1,1'-OXYDIMETHYLENE)BIS(4-FORMYL-2-PICOLINIUM CHLORIDE) DIOXIME
CAS:4006-38-6
Formula: C8H19P
KIN01099361
1,1'-OXYDIMETHYLENEBIS(4-ETHYLBENZENE)
CAS:55044-97-8
KIN02359816
1,1'-OXYDIOCTAN-2-OL
CAS:21875-81-0
Formula: C16H34O3
KIN02104990
1,1'-P-PHENYLENEBIS(3-(2-CHLORO-ETHYL)-3-NITROSO-UREA
CAS:13907-59-0
Formula: C12H14Cl2N6O4
KIN02025739
1,1'-P-PHENYLENEBIS[1-HYDROXYETHYLIUM
CAS:17104-51-7
KIN02058268
1,1'-P-PHENYLENEBIS[2,4-DIMETHYLPYRROLE
CAS:94067-12-6
Formula: C18H20N2
KIN02777223
1,1'-P-PHENYLENEBIS[3-(3,5-DI-2(1H)-1H-IMIDAZOLIN-2-YLPHENYL)UREA
CAS:5262-16-8
Formula: C26H30N8O2.2ClH
KIN01123975
1,1'-P-PHENYLENEBIS[3-[M-(N,N'-DIMETHYLAMIDINO)PHENYL]UREA 2HCL
CAS:5971-34-6
Formula: C33H30N8O3
KIN01146387
1,1'-P-PHENYLENEBIS[3-METHYL-UREA
CAS:94628-91-8
Formula: C10H14N4O2
KIN02783544
1,1'-P-PHENYLENEDI-UREA
CAS:1205-91-0
Formula: C10H10O4
KIN01043444
1,1'-PENTA-1,3-DIYNE-1,5-DIYLDIBENZENE
CAS:6089-03-8
Formula: C16H13NO5
KIN01149477
1,1'-PENTAMETHYLENEBIS(3-METHYL-3-NITROSO-UREA)
CAS:93507-75-6
Formula: C9H18N6O4
KIN02770033
1,1'-PENTAMETHYLENEBIS[1-BUTYL-PIPERIDINIUM DIBROMIDE
CAS:15921-74-1
Formula: C23H48Br2N2
KIN02045595
1,1'-PENTAMETHYLENEBIS[1-METHYLPYRROLIDINIUM DIPICRATE
CAS:17767-28-1
KIN02065377
Picric acid ion(I), 1,1'-pentamethylenebis[1-m
1,1'-PENTAMETHYLENEBIS[1-METHYLPYRROLIDINIUM] 4,4'-DIAMINO-2,2'-STILBENEDISULFONATE
CAS:120548-64-3
KIN03164968
1,1'-PENTAMETHYLENEBIS[4-NITROPYRAZOLE
CAS:91969-20-9
Formula: C11H14N6O4
KIN02751147
1,1'-PEROXYBIS(1-HYDROPEROXY-CYCLOHEXANE)
CAS:2699-13-0
Formula: C7H12O
KIN01074531
1,1'-PEROXYBIS(4-TERT-BUTYL-(HYDROPEROXY)CYCLOHEXANE)
CAS:1065628-56-9
Formula: C20H38O6
KIN05109603
1,1'-PEROXYDICYCLOHEXANOL
CAS:78-19-3
Formula: C11H16O4
KIN01001412
1,1'-PEROXYDICYCLOPENTANAMINE
CAS:117751-37-8
Formula: C10H20N2O2
KIN03150524
1,1'-PHENYLENEBIS-METHYL
CAS:31176-31-5
Formula: C8H8
KIN02187548
1,1'-PHOSPHINIDENEBIS-AZIRIDINE
CAS:25547-14-2
Formula: C4H9N2P
KIN02140800
1,1'-PHOSPHINIDENEBIS-SILANAMINE
CAS:14505-55-6
Formula: H9N2PSi2
KIN02032719
1,1'-PHOSPHINYLIDENEBIS-AZIRIDINE
CAS:4463-16-5
Formula: C11H14O5
KIN01108560
1,1'-PHOSPHINYLIDENEBIS[2-METHYL-AZIRIDINE
CAS:50333-22-7
KIN02291776
Bis-1-(2-methylaziridinyl)phenyl phosphine oxide;
1,1'-PHOSPHINYLIDENEBIS[3-METHYL-1H-PYRAZOLE
CAS:121881-42-3
KIN03172129
1,1'-PIPERAZIN-1,4-DIYLBIS(2-CHLOROPROPAN-1-ONE)
CAS:6328-57-0
KIN01158714
1,1'-PIPERAZIN-1,4-DIYLBIS(4-CHLORO-BUTAN-1-ONE)
CAS:6639-68-5
Formula: C19H16BrN
KIN01167620
1,1'-PIPERAZIN-1,4-DIYLBIS[3-(DIBUTYLAMINO)-PROPAN-2-OL]
CAS:6972-92-5
Formula: C10H9Cl2NO3S
KIN01175500
1,1'-PROPAN-2-YLIDENEBIS(4-ALLYLOXYDIBROMOBENZENE)
CAS:37769-31-6
Formula: C21H22Br4O2
KIN02242495
1,1'-PROPAN-2-YLIDENEBIS(OXY)BIS[2-ETHYLHEXANE]
CAS:85409-37-6
Formula: C19H40O2
KIN02674184
1,1'-PROPAN-2-YLIDENEZIRCONOCENE DICHLORIDE
CAS:138533-79-6
Formula: C13H14Cl2Zr10
KIN03247298
1,1'-PROPYLENEBIS(3-(2-CHLORO-ETHYL)-3-NITROSO-UREA
CAS:60784-42-1
Formula: C9H16Cl2N6O4
KIN02447797
1,1'-PROPYLIDENEBIS-PIPERIDINE
CAS:72206-76-9
KIN02589780
1,1'-PROPYLIDENEBIS[DIBROMO[DIBROMOPROPOXY]BENZENE
CAS:78414-11-6
Formula: C21H20Br8O2
KIN02631400
1,1'-PROPYLIDENEBISCYCLOHEXANE
CAS:54934-91-7
Formula: C15H28
KIN02357863
1,1'-PROPYLIDENEDI-PYRAZOLE
CAS:28791-91-5
KIN02168840
1,1'-PYRENE-1,6-DIYLBIS(2-BROMOETHANONE)
CAS:86471-05-8
Formula: C20H12Br2O2
KIN02680575
1,1'-PYRENE-1,6-DIYLDIETHANONE
CAS:86471-04-7
Formula: C20H14O2
KIN02680574
1,1'-SELANEDIYL-DI-[2]NAPHTHOL
CAS:100424-35-9
Formula: C20H14O2Se
KIN03031705
1,1'-SELENINYLBIS[4-(OCTYLOXY)-BENZENE
CAS:63924-32-3
Formula: C28H42O3Se
KIN02501493
1,1'-SELENINYLBIS[4-METHOXY-BENZENE
CAS:25862-14-0
Formula: C14H14O3Se
KIN02143598
MFCD00059043
1,1'-SELENOBIS-2-PROPANOL DIACETATE
CAS:35220-06-5
KIN02220975
1,1'-SELENOBIS-BENZENE
CAS:1132-40-7
Formula: C9H10N2O2
KIN01040902
1,1'-SELENOBIS-CYCLOPENTANE
CAS:136397-83-6
Formula: C10H18Se
KIN03236684
1,1'-SELENOBIS-DECANE
CAS:52056-05-0
Formula: C20H42Se
KIN02315446
1,1'-SELENOBIS-DODECANE
CAS:5819-04-5
Formula: C4H8Cl3P
KIN01142572
1,1'-SELENOBIS-ETHANE
CAS:627-54-3
Formula: C4H10Te
KIN01023439
1,1'-SELENOBIS-HEPTANE
CAS:52056-02-7
Formula: C14H30Se
KIN02315444
1,1'-SELENOBIS-PROPANE
CAS:7361-89-9
Formula: C6H14Se2
KIN01185167
1,1'-SELENOBIS[1,1,2,2,2-PENTAFLUORO-ETHANE]
CAS:6123-63-3
Formula: C12H12N2O
KIN01150311
1,1'-SELENOBIS[2,3,4,5,6-PENTAFLUOROBENZENE
CAS:973-21-7
Formula: C14H18N2O7
KIN01035804
1,1'-SELENOBIS[2,3-DI-MORPHOLIN-4-YLCYCLOPROPENYLIUM
CAS:114591-97-8
Formula: C22H32N4O4Se
KIN03669440
1,1'-SELENOBIS[2,3-DI-PIPERIDIN-1-YLCYCLOPROPENYLIUM
CAS:99968-51-1
KIN02823812
1,1'-SELENOBIS[2-(ETHYLTHIO)ETHANE
CAS:90053-43-3
Formula: C8H18S2Se
KIN02721622
1,1'-SELENOBIS[3-METHYL-1,2-BUTADIENE
CAS:67560-52-5
Formula: C10H14Se
KIN02555115
1,1'-SELENOBIS[4-BROMOBENZENE
CAS:33834-56-9
Formula: C12H8Br2Se
KIN02209117
1,1'-SELENOBIS[4-METHYLBENZENE
CAS:22077-55-0
Formula: C14H14Se
KIN02107018
1,1'-SELENOBIS[4-NITRO-BENZENE
CAS:56309-76-3
KIN02380702
1,1'-SELENONYLBIS-BENZENE
CAS:10504-99-1
Formula: C12H10O2Se
KIN02007258
1,1'-SILACYCLOBUT-1-YLIDENEBIS-1H-IMIDAZOLE
CAS:133144-52-2
KIN03222308
1,1'-SILYLENEBIS-1,2-DICARBADODECABORANE(12)
CAS:12547-84-1
KIN02012568
1,1'-SILYLENEBIS-HYDRAZINE
CAS:27798-00-1
Formula: H8N4Si
KIN02160401
1,1'-SILYLENEBIS-METHANAMINE
CAS:4382-10-9
Formula: C17H16N2O5
KIN01106477
1,1'-SILYLENEBIS[4-(TERT-BUTYL)-BENZENE
CAS:207925-47-1
KIN03418142
1,1'-SPIRO[2-CYCLOPROPENE-1,9'(9H)-FLUORENE]-2,3-DIYLBIS-ETHANONE
CAS:54415-09-7
Formula: C19H14O2
KIN02349694
1,1'-SPIRO[9H-FLUORENE-9,9'-[9H]XANTHENE]-2',7'-DIYLBIS-ETHANONE
CAS:152480-78-9
KIN03302219
1,1'-SPIRO[ANTHRACENE-9(10H),9'-[9H]FLUORENE]-2,7-DIYLBIS-1H-PYRROL-2,5-DIONE
CAS:152480-81-4
KIN03302222
1,1'-SPIROBI[1H-1L4-1,2-BENZISOSELENAZOLE]
CAS:1000017-65-1
Formula: C14H10N2Se
KIN05000050
1,1'-SPIROBI[1H-1L4-1,2-BENZISOSELENAZOLE]-3,3'(2H,2'H)-DIONE
CAS:1000141-70-7
Formula: C14H10N2O2Se
KIN05000244
1,1'-SPIROBI[1H-INDENE]
CAS:165-88-8
Formula: C18H12O3
KIN01006845
1,1'-SPIROBI[1H-INDENE], 2,2',3,3'-TETRAHYDRO-5,5',6,6'-TETRAPROPOXY-,
CAS:115310-65-1
Formula: C29H40O4
KIN03136432
1,1'-SPIROBI[1H-PYRROLIZINE]
CAS:31340-90-6
KIN02188687
1,1'-SPIROBIINDAN
CAS:7197-67-3
KIN01181055
1,1'-SULFINOTHIOYLBIS-BENZENE
CAS:52427-23-3
KIN02321048
1,1'-SULFINYLBIS(AZIRIDINE)
CAS:1192-78-5
Formula: C6H10O2
KIN01042700
1,1'-SULFINYLBIS-1-PROPYNE
CAS:68634-33-3
Formula: C6H6OS
KIN02564740
1,1'-SULFINYLBIS-1H-IMIDAZOLE
CAS:3005-60-5
Formula: C14H19NO3
KIN01080721
1,1'-SULFINYLBIS-1H-PYRAZOLE
CAS:50476-18-1
KIN02293427
1,1'-SULFINYLBIS-2,5-PYRROLIDINEDIONE
CAS:93634-52-7
Formula: C8H8N2O5S
KIN02771678
1,1'-SULFINYLBIS-CYCLOPENTANE
CAS:34757-43-2
KIN02216714
1,1'-SULFINYLBIS-HEPTANE
CAS:25355-20-8
Formula: C14H30OS
KIN02138797
MFCD00039513
1,1'-SULFINYLBIS-PENTANE
CAS:1986-91-0
Formula: C14H23O4P
KIN01060295
1,1'-SULFINYLBIS-TETRADECANE
CAS:62444-29-5
Formula: C28H58OS
KIN02474200
1,1'-SULFINYLBIS[2,2-BIS(ETHYLTHIO)ETHENE
CAS:83483-49-2
Formula: C12H22OS5
KIN02661368
1,1'-SULFINYLBIS[2,3,4,5,6-PENTAMETHYLBENZENE
CAS:132260-88-9
KIN03217900
1,1'-SULFINYLBIS[2,3-DIMETHYLBENZENE
CAS:131602-38-5
KIN03214869
1,1'-SULFINYLBIS[2,4,6-TRIFLUOROBENZENE
CAS:132260-87-8
KIN03217899
1,1'-SULFINYLBIS[2,4,6-TRIMETHYLBENZENE
CAS:3972-24-5
KIN01098789
1,1'-SULFINYLBIS[2,4-DIETHYLBENZENE
CAS:132260-86-7
KIN03217898
1,1'-SULFINYLBIS[2,4-DINITRO-BENZENE
CAS:52427-27-7
Formula: C12H6N4O9S
KIN02321049
1,1'-SULFINYLBIS[2,5-DIMETHOXY-BENZENE
CAS:447439-98-7
Formula: C16H18O5S
KIN03589158
1,1'-SULFINYLBIS[2,6-DIMETHOXY-BENZENE
CAS:146333-77-9
KIN03282126
1,1'-SULFINYLBIS[2,6-DIMETHYLBENZENE
CAS:342595-40-8
KIN03516243
1,1'-SULFINYLBIS[2-(1-METHYLETHENYL)-BENZENE
CAS:63744-04-7
Formula: C18H18OS
KIN02498138
1,1'-SULFINYLBIS[2-CHLORO-4-METHYLBENZENE
CAS:46876-72-6
KIN02286502
1,1'-SULFINYLBIS[2-CHLOROBENZENE
CAS:5097-09-6
KIN01120625
1,1'-SULFINYLBIS[2-ETHYL-5-METHYL-1H-IMIDAZOLE
CAS:90743-07-0
Formula: C12H18N4OS
KIN02732587
1,1'-SULFINYLBIS[2-METHYL-1H-IMIDAZOLE
CAS:90743-05-8
Formula: C8H10N4OS
KIN02732585
1,1'-SULFINYLBIS[2-METHYL-AZIRIDINE
CAS:1623-84-3
Formula: C4H8N2S2
KIN01051824
1,1'-SULFINYLBIS[2-METHYLBENZENE
CAS:5097-06-3
Formula: C14H14OS
KIN01120623
1,1'-SULFINYLBIS[2-NITRO-BENZENE
CAS:30388-70-6
Formula: C12H12N2O5S
KIN02181858
1,1'-SULFINYLBIS[2-PYRIDIN-3-YL-PIPERIDINE
CAS:63095-01-2
Formula: C20H26N4OS
KIN02486270
1,1'-SULFINYLBIS[3,4-DIMETHOXY-BENZENE
CAS:447439-97-6
Formula: C16H18O5S
KIN03589157
1,1'-SULFINYLBIS[3,4-DIMETHYLBENZENE
CAS:29146-86-9
KIN02171843
1,1'-SULFINYLBIS[3-(TRIFLUOROMETHYL)-BENZENE
CAS:132260-81-2
Formula: C14H8F6OS
KIN03217894
1,1'-SULFINYLBIS[3-CHLOROBENZENE
CAS:5097-12-1
Formula: C14H14O2S
KIN01120626
1,1'-SULFINYLBIS[3-FLUORO-4-METHOXY-BENZENE
CAS:5400-68-0
Formula: C4H5NO3
KIN01128761
1,1'-SULFINYLBIS[3-METHYLBENZENE
CAS:5097-08-5
KIN01120624
1,1'-SULFINYLBIS[3-PYRIDIN-2-YL-PIPERIDINE
CAS:63095-03-4
Formula: C20H26N4OS
KIN02486272
1,1'-SULFINYLBIS[3-TERT-BUTOXY-BENZENE
CAS:186889-62-3
KIN03382441
1,1'-SULFINYLBIS[4-(1-METHYLETHOXY)-BENZENE
CAS:1159592-34-3
Formula: C18H22O3S
KIN05255268
1,1'-SULFINYLBIS[4-(1-METHYLETHYL)-BENZENE
CAS:118021-43-5
KIN03152225
1,1'-SULFINYLBIS[4-(TERT-BUTYL)-BENZENE
CAS:91815-55-3
Formula: C20H26OS
KIN02749081
1,1'-SULFINYLBIS[4-(TRIFLUOROMETHYL)-BENZENE
CAS:143028-36-8
Formula: C14H8F6OS
KIN03267855
1,1'-SULFINYLBIS[4-BUTOXY-BENZENE
CAS:91815-60-0
Formula: C20H26O3S
KIN02749085
1,1'-SULFINYLBIS[4-CHLORO-2,5-DIMETHYLBENZENE
CAS:47056-03-1
KIN02286837
1,1'-SULFINYLBIS[4-CHLORO-2-METHYLBENZENE
CAS:132653-95-3
KIN03219866
1,1'-SULFINYLBIS[4-CHLORO-3-METHYLBENZENE
CAS:132260-84-5
KIN03217897
1,1'-SULFINYLBIS[4-ETHOXY-BENZENE
CAS:1194718-22-3
Formula: C16H18O3S
KIN05335773
1,1'-SULFINYLBIS[4-ETHYLBENZENE
CAS:132260-80-1
KIN03217893
1,1'-SULFINYLBIS[4-FLUORO-2-METHYLBENZENE
CAS:132260-82-3
KIN03217895
1,1'-SULFINYLBIS[4-FLUORO-2-NITRO-BENZENE
CAS:72242-29-6
Formula: C12H6F2N2O5S
KIN02590054
1,1'-SULFINYLBIS[4-FLUORO-3-METHYLBENZENE
CAS:132260-83-4
KIN03217896
1,1'-SULFINYLBIS[4-ISOTHIOCYANATO-BENZENE
CAS:15398-70-6
KIN02041122
1,1'-SULFINYLBIS[4-METHOXY-2,6-DIMETHYLBENZENE
CAS:24586-86-5
KIN02131854
1,1'-SULFINYLBIS[4-METHYL-1H-IMIDAZOLE
CAS:90743-06-9
Formula: C8H10N4OS
KIN02732586
1,1'-SULFINYLBIS[4-METHYL-PIPERAZINE
CAS:82942-83-4
KIN02658429
1,1'-SULFINYLBIS[4-PHENOXY-BENZENE
CAS:91815-51-9
Formula: C24H18O3S
KIN02749077
1,1'-SULFINYLBIS[4-TERT-BUTOXY-BENZENE
CAS:170632-59-4
KIN03346991
1,1'-SULFINYLBIS[5-CHLORO-2-METHOXY-BENZENE
CAS:106472-56-4
KIN03076581
1,1'-SULFONODIIMIDOYLBIS-BENZENE
CAS:50347-72-3
Formula: C12H12N2S
KIN02291977
1,1'-SULFONODIIMIDOYLBIS-BUTANE
CAS:97990-59-5
Formula: C8H20N2S
KIN02809474
1,1'-SULFONYLBIS(2-METHYL-1H-IMIDAZOLE)
CAS:489471-87-6
Formula: C8H10N4O2S
KIN03612407
1,1'-SULFONYLBIS-1-PROPENE
CAS:38405-93-5
Formula: C6H10O2S
KIN02247778
1,1'-SULFONYLBIS-1H-IMIDAZOLE
CAS:7189-72-2
Formula: C14H11N3O2
KIN01180888
1,1'-SULFONYLBIS-CYCLOBUTANE
CAS:133763-22-1
Formula: C8H14O2S
KIN03225283
1,1'-SULFONYLBIS-CYCLOBUTANE-CARBONITRILE
CAS:221044-80-0
Formula: C10H12N2O2S
KIN03435692
1,1'-SULFONYLBIS-CYCLOPENTANE
CAS:34008-65-6
KIN02210532
Dicyclopentyl sulfone; 1,1'-Sulfonylbis-cyclop
1,1'-SULFONYLBIS-CYCLOPROPANE
CAS:57899-47-5
Formula: C6H10O2S
KIN02407170
1,1'-SULFONYLBIS[1,1,2,2,2-PENTAFLUORO-ETHANE]
CAS:14930-22-4
Formula: C4F10O2S
KIN02036826
1,1'-SULFONYLBIS[1-BROMO-ETHENE
CAS:17101-75-6
Formula: C4H4Br2O2S
KIN02058233
1,1'-SULFONYLBIS[2,2-BIS(METHYLTHIO)ETHENE
CAS:89880-21-7
Formula: C8H14O2S5
KIN02718651
1,1'-SULFONYLBIS[2,3,4,5,6-PENTAFLUOROBENZENE
CAS:18707-14-7
Formula: C12F10O2S
KIN02074433
1,1'-SULFONYLBIS[2,3,5,6-TETRAFLUORO-4-METHOXY-BENZENE
CAS:18707-16-9
KIN02074434
1,1'-SULFONYLBIS[2,3,5,6-TETRAFLUORO-4-NITRO-BENZENE
CAS:61907-49-1
Formula: C12F8N2O6S
KIN02464414
1,1'-SULFONYLBIS[2,3-DIMETHOXY-BENZENE
CAS:189316-03-8
KIN03388541
1,1'-SULFONYLBIS[2,3-DIMETHYL-4-CHLOROBENZENE
CAS:146251-13-0
KIN03281890
1,1'-SULFONYLBIS[2,3-DIMETHYLBENZENE
CAS:49853-93-2
KIN02290957
1,1'-SULFONYLBIS[2,4,5-TRIMETHYLBENZENE
CAS:23101-77-1
Formula: C18H22O2S
KIN02116791
1,1'-SULFONYLBIS[2,4,6-TRIFLUOROBENZENE
CAS:236739-06-3
KIN03444577
1,1'-SULFONYLBIS[2,4,6-TRINITRO-BENZENE]
CAS:10580-80-0
Formula: C12H4N6O14S
KIN02008420
1,1'-SULFONYLBIS[2,4-DICHLOROBENZENE
CAS:6647-76-3
Formula: C6H4BrN3O2S
KIN01167930
1,1'-SULFONYLBIS[2,4-DIMETHOXY-BENZENE
CAS:50625-46-2
KIN02295401
1,1'-SULFONYLBIS[2,5-DICHLOROBENZENE
CAS:69925-17-3
Formula: C12H6Cl4O2S
KIN02573917
1,1'-SULFONYLBIS[2,5-DIFLUOROBENZENE
CAS:120022-64-2
KIN03161954
1,1'-SULFONYLBIS[2,5-DIMETHOXY-BENZENE
CAS:19116-52-0
Formula: C16H18O6S
KIN02078180
1,1'-SULFONYLBIS[2,6-DIMETHOXY-BENZENE
CAS:101432-34-2
KIN03039401
1,1'-SULFONYLBIS[2,6-DIMETHYLBENZENE
CAS:115231-24-8
KIN03136085
1,1'-SULFONYLBIS[2-(1-METHYLETHENYL)-BENZENE
CAS:80663-02-1
Formula: C18H18O2S
KIN02645538
1,1'-SULFONYLBIS[2-(TERT-BUTYL)-BENZENE
CAS:1190974-81-2
Formula: C20H26O2S
KIN05331768
1,1'-SULFONYLBIS[2-ALLYLBENZENE
CAS:160912-72-1
KIN03327477
1,1'-SULFONYLBIS[2-CHLORO-4-ISOTHIOCYANATO-BENZENE
CAS:40939-72-8
Formula: C14H6Cl2N2O2S3
KIN02267080
1,1'-SULFONYLBIS[2-CHLORO-4-METHYLBENZENE
CAS:38980-54-0
KIN02251889
1,1'-SULFONYLBIS[2-CHLORO-4-NITRO-BENZENE
CAS:35880-72-9
Formula: C12H6Cl2N2O6S
KIN02227057
1,1'-SULFONYLBIS[2-FLUORO-3-NITRO-BENZENE
CAS:312-05-0
Formula: C10H14FO3P
KIN01009866
1,1'-SULFONYLBIS[2-FLUOROBENZENE
CAS:141223-28-1
KIN03258908
1,1'-SULFONYLBIS[2-ISOTHIOCYANATO-BENZENE
CAS:40939-91-1
Formula: C14H8N2O2S3
KIN02267089
1,1'-SULFONYLBIS[2-METHOXY-5-METHYLBENZENE
CAS:66294-57-3
Formula: C16H18O4S
KIN02539998
1,1'-SULFONYLBIS[2-METHOXY-BENZENE
CAS:107775-84-8
KIN03084921
1,1'-SULFONYLBIS[2-METHYL-5-NITRO-BENZENE
CAS:189896-67-1
KIN03390136
1,1'-SULFONYLBIS[2-NITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:567-35-1
Formula: C5H9NO3
KIN01020131
1,1'-SULFONYLBIS[2-NITRO-BENZENE
CAS:14665-52-2
Formula: C12H8N2O6S
KIN02034379
1,1'-SULFONYLBIS[3,4-DICHLOROBENZENE
CAS:22588-79-0
Formula: C12H6Cl4O2S
KIN02112022
1,1'-SULFONYLBIS[3,4-DIFLUOROBENZENE
CAS:1189354-58-2
Formula: C12H6F4O2S
KIN05328923
1,1'-SULFONYLBIS[3,4-DIMETHOXY-BENZENE
CAS:50625-47-3
KIN02295402
1,1'-SULFONYLBIS[3,4-DIMETHYLBENZENE
CAS:28361-43-5
Formula: C16H18O2S
KIN02165529
Di-3,4-Dimethylphenyl sulfone
1,1'-SULFONYLBIS[3,5-DICHLORO-4-METHOXY-BENZENE
CAS:122438-79-3
KIN03174765
1,1'-SULFONYLBIS[3,5-DICHLOROBENZENE
CAS:75277-36-0
Formula: C12H6Cl4O2S
KIN02611541
1,1'-SULFONYLBIS[3,5-DIMETHYL-4-METHOXY-BENZENE
CAS:123443-94-7
KIN03179690
1,1'-SULFONYLBIS[3,5-DIMETHYLBENZENE
CAS:240405-82-7
KIN03445725
1,1'-SULFONYLBIS[3,5-DINITRO-BENZENE
CAS:17017-56-0
KIN02057282
1,1'-SULFONYLBIS[3-(ETHYLTHIO)-BENZENE
CAS:312742-23-7
KIN03486852
1,1'-SULFONYLBIS[3-(METHYLSULFONYL)-BENZENE
CAS:300406-78-4
KIN03475867
1,1'-SULFONYLBIS[3-(METHYLTHIO)-BENZENE
CAS:300406-11-5
KIN03475863
1,1'-SULFONYLBIS[3-BROMO-4-FLUOROBENZENE
CAS:79881-12-2
Formula: C12H6Br2F2O2S
KIN02640425
1,1'-SULFONYLBIS[3-CHLORO-4-FLUOROBENZENE
CAS:158753-84-5
KIN03321410
1,1'-SULFONYLBIS[3-CHLORO-4-METHOXY-BENZENE
CAS:66294-54-0
Formula: C14H12Cl2O4S
KIN02539995
1,1'-SULFONYLBIS[3-CHLORO-4-NITRO-BENZENE
CAS:63063-23-0
Formula: C12H6Cl2N2O6S
KIN02485682
1,1'-SULFONYLBIS[3-ETHOXY-BENZENE
CAS:1035812-59-9
Formula: C16H18O4S
KIN05069620
1,1'-SULFONYLBIS[3-ETHYLBENZENE
CAS:1035815-78-1
Formula: C16H18O2S
KIN05069649
1,1'-SULFONYLBIS[3-ETHYNYL-4-ISOCYANATO-BENZENE
CAS:75611-05-1
Formula: C18H8N2O4S
KIN02613819
1,1'-SULFONYLBIS[3-FLUORO-4-METHOXY-BENZENE
CAS:55347-01-8
KIN02365004
1,1'-SULFONYLBIS[3-ISOCYANATO-BENZENE
CAS:47119-84-6
Formula: C14H8N2O4S
KIN02286938
1,1'-SULFONYLBIS[3-ISOTHIOCYANATO-BENZENE
CAS:40939-76-2
Formula: C14H8N2O2S3
KIN02267082
1,1'-SULFONYLBIS[3-METHYLBENZENE
CAS:5097-15-4
Formula: C12H8Cl2O2S
KIN01120628
1,1'-SULFONYLBIS[3-METHYLBUT-2-ENE]
CAS:52936-39-7
Formula: C10H18O2S
KIN02327861
1,1'-SULFONYLBIS[3-NITRO-4-(4-NITROPHENOXY)-BENZENE
CAS:3950-59-2
Formula: C14H16N2O4S
KIN01098440
1,1'-SULFONYLBIS[3-NITRO-4-PHENOXY-BENZENE
CAS:3704-40-3
Formula: C15H11NS
KIN01094351
1,1'-SULFONYLBIS[4-(1,2-PROPADIEN-1-YLOXY)-BENZENE
CAS:127265-87-6
KIN03008531
1,1'-SULFONYLBIS[4-(1-METHYLETHOXY)-BENZENE
CAS:116763-20-3
Formula: C18H22O4S
KIN03145801
1,1'-SULFONYLBIS[4-(1-METHYLETHYL)-BENZENE
CAS:57913-35-6
Formula: C18H22O2S
KIN02407517
1,1'-SULFONYLBIS[4-(1-PROPEN-1-YLOXY)-BENZENE
CAS:149829-45-8
KIN03294113
1,1'-SULFONYLBIS[4-(2,2,2-TRIFLUORO-ETHOXY)-BENZENE
CAS:87014-32-2
Formula: C16H12F6O4S
KIN02683848
1,1'-SULFONYLBIS[4-(2,3-DIBROMOPROPOXY)-BENZENE
CAS:99890-14-9
Formula: C18H18Br4O4S
KIN02823376
1,1'-SULFONYLBIS[4-(2-CYCLOHEXEN-1-YLOXY)-BENZENE
CAS:325475-16-9
KIN03025451
1,1'-SULFONYLBIS[4-(2-METHYLPHENOXY)-BENZENE
CAS:53895-55-9
Formula: C26H22O4S
KIN02341960
1,1'-SULFONYLBIS[4-(3-ETHYNYLPHENOXY)-BENZENE
CAS:63770-82-1
Formula: C28H18O4S
KIN02498629
1,1'-SULFONYLBIS[4-(3-METHYLBUTOXY)-BENZENE
CAS:97042-13-2
Formula: C22H30O4S
KIN02804229
1,1'-SULFONYLBIS[4-(4-ETHYNYLPHENOXY)-BENZENE
CAS:88272-95-1
Formula: C28H18O4S
KIN02695712
1,1'-SULFONYLBIS[4-(4-METHYLPHENOXY)-3-NITRO-BENZENE
CAS:3795-88-8
KIN01096089
1,1'-SULFONYLBIS[4-(4-METHYLPHENOXY)-BENZENE
CAS:33127-68-3
KIN02202799
1,1'-SULFONYLBIS[4-(ALLYLOXY)-BENZENE
CAS:41481-63-4
Formula: C18H18O4S
KIN02271493
MFCD00506306
1,1'-SULFONYLBIS[4-(BENZYLOXY)-BENZENE
CAS:71338-01-7
Formula: C26H22O4S
KIN02583684
1,1'-SULFONYLBIS[4-(CHLOROMETHYL)-BENZENE
CAS:55154-19-3
Formula: C14H12Cl2O2S
KIN02361703
1,1'-SULFONYLBIS[4-(DIPHENOXYMETHOXY)-BENZENE
CAS:64523-82-6
Formula: C38H30O8S
KIN02511205
1,1'-SULFONYLBIS[4-(HEPTYLOXY)-BENZENE
CAS:97042-15-4
Formula: C26H38O4S
KIN02804231
1,1'-SULFONYLBIS[4-(HEXYLOXY)-BENZENE
CAS:97042-14-3
Formula: C24H34O4S
KIN02804230
1,1'-SULFONYLBIS[4-(IODO-METHYL)-BENZENE
CAS:93522-36-2
Formula: C14H12I2O2S
KIN02770218
1,1'-SULFONYLBIS[4-(PENTYLOXY)-BENZENE
CAS:95210-60-9
Formula: C22H30O4S
KIN02789335
1,1'-SULFONYLBIS[4-(PHENYLTHIO)-BENZENE
CAS:93103-32-3
Formula: C24H18O2S3
KIN02765221
1,1'-SULFONYLBIS[4-(PROPARGYLOXY)-BENZENE
CAS:73303-45-4
Formula: C18H14O4S
KIN02597449
1,1'-SULFONYLBIS[4-[(1-METHYLETHENYLOXY)]BENZENE
CAS:110984-91-3
KIN03104800
1,1'-SULFONYLBIS[4-[(4-NITROPHENYL)THIO]BENZENE
CAS:89847-03-0
Formula: C24H16N2O6S3
KIN02718006
1,1'-SULFONYLBIS[4-[[4-(PHENYLTHIO)PHENYL]THIO]BENZENE
CAS:93972-95-3
Formula: C36H26O2S5
KIN02776080
1,1'-SULFONYLBIS[4-[3-(PHENYLETHYNYL)PHENOXY]BENZENE
CAS:96250-69-0
Formula: C40H26O4S
KIN02799268
1,1'-SULFONYLBIS[4-BROMO-3-CHLOROBENZENE
CAS:158753-83-4
KIN03321409
1,1'-SULFONYLBIS[4-BROMOMETHYLBENZENE
CAS:4542-77-2
Formula: C12H10Br2
KIN01110156
1,1'-SULFONYLBIS[4-BUTOXY-BENZENE
CAS:95210-59-6
Formula: C20H26O4S
KIN02789334
1,1'-SULFONYLBIS[4-CHLORO-1H-PYRAZOLE
CAS:147441-32-5
KIN03286129
1,1'-SULFONYLBIS[4-CHLORO-2-METHYLBENZENE
CAS:132653-96-4
KIN03219867
1,1'-SULFONYLBIS[4-CHLORO-2-NITRO-BENZENE
CAS:144505-71-5
Formula: C12H6Cl2N2O6S
KIN03276013
1,1'-SULFONYLBIS[4-CHLORO-3,5-DIMETHYLBENZENE
CAS:149444-34-8
KIN03292469
1,1'-SULFONYLBIS[4-CHLORO-3-(METHYLTHIO)-BENZENE
CAS:413605-17-1
Formula: C14H12Cl2O2S3
KIN03571338
1,1'-SULFONYLBIS[4-CHLORO-3-METHYLBENZENE
CAS:39022-42-9
Formula: C14H12Cl2O2S
KIN02252129
1,1'-SULFONYLBIS[4-CHLOROBENZENE
CAS:85228-26-8
KIN02672816
1,1'-SULFONYLBIS[4-ETHENYLBENZENE
CAS:71195-75-0
Formula: C16H14O2S
KIN02582697
1,1'-SULFONYLBIS[4-ETHOXY-BENZENE
CAS:66294-58-4
Formula: C16H18O4S
KIN02539999
1,1'-SULFONYLBIS[4-ETHYLBENZENE
CAS:66294-51-7
Formula: C16H18O2S
KIN02539994
1,1'-SULFONYLBIS[4-ETHYNYLBENZENE
CAS:27594-30-5
KIN02158757
1,1'-SULFONYLBIS[4-FLUORO-2-NITRO-BENZENE
CAS:72242-30-9
Formula: C12H6F2N2O6S
KIN02590055
1,1'-SULFONYLBIS[4-IODO-BENZENE
CAS:40915-22-8
Formula: C12H8I2O2S
KIN02266864
1,1'-SULFONYLBIS[4-ISOCYANATO-BENZENE
CAS:13753-52-1
Formula: C14H8N2O4S
KIN02024026
1,1'-SULFONYLBIS[4-ISOTHIOCYANATO-2-METHOXY-BENZENE
CAS:40939-74-0
Formula: C16H12N2O4S3
KIN02267081
1,1'-SULFONYLBIS[4-METHOXY-3-METHYLBENZENE
CAS:66294-56-2
Formula: C16H18O4S
KIN02539997
1,1'-SULFONYLBIS[4-METHOXY-BENZENE
CAS:3112-82-1
Formula: C15H16O2S
KIN01082565
1,1'-SULFONYLBIS[4-METHYL-3-NITRO-BENZENE
CAS:1235-97-8
Formula: C21H32O2
KIN01044389
1,1'-SULFONYLBIS[4-NITRO-1H-PYRAZOLE
CAS:147441-31-4
KIN03286128
1,1'-SULFONYLBIS[4-NITRO-2-(TRIFLUOROMETHYL)-BENZENE
CAS:360-80-5
Formula: C8H10N2O2S
KIN01011958
1,1'-SULFONYLBIS[4-PHENOXY-BENZENE
CAS:1623-92-3
Formula: C12H9ClO3S
KIN01051829
1,1'-SULFONYLBIS[4-PROPOXY-BENZENE
CAS:97042-12-1
Formula: C18H22O4S
KIN02804228
1,1'-SULFONYLBIS[5-CHLORO-2-METHOXY-BENZENE
CAS:66294-55-1
Formula: C14H12Cl2O4S
KIN02539996
1,1'-SULFONYLBIS[DIMETHYLBENZENE
CAS:27043-27-2
Formula: C16H20O2S
KIN02153421
Di Tetramethyldiphenyl sulfone; Dimethylphenyl sul
1,1'-SULFONYLBIS[FLUOROBENZENE
CAS:95243-95-1
Formula: C12H8F2O2S
KIN02789641
1,1'-SULFONYLBIS[NITRO-BENZENE
CAS:58704-57-7
Formula: C12H8N2O6S
KIN02419750
1,1'-SULFONYLDIPROPAN-2-OL
CAS:6633-90-5
Formula: C8H14O2S2
KIN01167194
1,1'-TELLURINYLBIS[2,4,6-TRIMETHYLBENZENE
CAS:92720-45-1
Formula: C18H22OTe
KIN02760576
1,1'-TELLURINYLBIS[3-METHOXY-BENZENE
CAS:92720-44-0
Formula: C14H14O3Te
KIN02760575
1,1'-TELLURINYLBIS[4-BROMOBENZENE
CAS:77443-99-3
Formula: C12H8Br2OTe
KIN02625658
1,1'-TELLURINYLBIS[4-CHLOROBENZENE
CAS:77443-97-1
Formula: C12H8Cl2OTe
KIN02625657
1,1'-TELLURINYLBIS[4-ETHOXY-BENZENE
CAS:96025-35-3
Formula: C16H18O3Te
KIN02797323
1,1'-TELLUROBIS-HEXADECANE
CAS:71766-42-2
Formula: C32H66Te
KIN02586750
1,1'-TELLUROBIS[2,4,6-TRIMETHYLBENZENE
CAS:70165-32-1
Formula: C18H22Te
KIN02575649
1,1'-TELLUROBIS[2,4-DIMETHYLBENZENE
CAS:97848-36-7
Formula: C16H18Te
KIN02808176
1,1'-TELLUROBIS[2-METHYLBENZENE]
CAS:6243-34-1
KIN01153318
1,1'-TELLUROBIS[3,3-DIMETHYLBUTANE
CAS:88691-72-9
Formula: C12H26Te
KIN02701393
1,1'-TELLUROBIS[3-BROMOBENZENE
CAS:63212-73-7
Formula: C12H8Br2Te
KIN02488535
1,1'-TELLUROBIS[3-CHLOROBENZENE
CAS:63212-72-6
Formula: C12H8Cl2Te
KIN02488534
1,1'-TELLUROBIS[3-METHOXY-BENZENE
CAS:92720-49-5
Formula: C14H14O2Te
KIN02760580
1,1'-TELLUROBIS[3-METHYLBENZENE
CAS:6422-06-6
Formula: C17H18N2O4
KIN01161963
1,1'-TELLUROBIS[4-FLUOROBENZENE
CAS:63212-71-5
Formula: C12H8F2Te
KIN02488533
1,1'-TELLUROBIS[4-METHOXY-BENZENE
CAS:4456-56-8
Formula: C9H9FO3
KIN01108427
1,1'-TELLUROBIS[4-METHYLBENZENE]
CAS:834-16-2
Formula: C13H22O2
KIN01031331
1,1'-TELLUROBIS[4-NITRO-BENZENE
CAS:63212-74-8
Formula: C12H8N2O4Te
KIN02488536
1,1'-TELLURONYLBIS[4-METHOXY-BENZENE
CAS:82342-66-3
Formula: C14H14O4Te
KIN02654974
1,1'-TEREPHTHALOYLBIS[4-METHYL-PIPERAZINE
CAS:104560-24-9
Formula: C18H26N4O2
KIN03062142
1,1'-TEREPHTHALOYLBIS[4-METHYL-PIPERAZINE 2HCL
CAS:94997-85-0
Formula: C18H26N4O2.2ClH
KIN02787148
1,1'-TETRADECAMETHYLENEDIPYRIDINIUM DIPERCHLORATE
CAS:15001-42-0
Formula: C24H38Cl2N2O8
KIN02037493
1,1'-TETRADECYLIDENEBISCYCLOHEXANE
CAS:55334-08-2
Formula: C18H20N2O2
KIN02364816
1,1'-TETRAMETHYLENEBIS(4-FORMYLPYRIDINIUM DIBROMIDE, DIOXIME
CAS:2438-49-5
Formula: C15H17N3O
KIN01069543
1,1'-TETRAMETHYLENEBIS[3-(P-2(1H)-1H-IMIDAZOLIN-2-YLPHENYL)UREA 2HCL
CAS:5737-47-3
Formula: C29H41ClN8O2
KIN01140442
1,1'-TETRAMETHYLENEBIS[3-[M-(4-METHYL-2(1H)-1H-IMIDAZOLIN-2-YL)PHENYL]UREA 2HCL
CAS:5726-79-4
Formula: C30H42N8O2.2ClH
KIN01140128
1,1'-TETRAMETHYLENEBIS[3-METHYL-3-NITROSO-UREA
CAS:92381-38-9
Formula: C8H16N6O4
KIN02756042
1,1'-TETRAMETHYLENEBIS[3-METHYL-UREA
CAS:20633-51-6
Formula: C8H18N4O2
KIN02092621
1,1'-TETRAMETHYLENEBIS[4-NITROPYRAZOLE
CAS:99185-95-2
Formula: C10H12N6O4
KIN02818773
1,1'-TETRAMETHYLENEBIS[TETRAHYDRO-THIOPHENIUM DIMETHANESULFONATE
CAS:6336-42-1
Formula: C12H10ClN5
KIN01159283
1,1'-TETRAMETHYLENEBISGUANIDINE
CAS:544-10-5
Formula: C6H13Cl
KIN01019181
1,1'-TETRASELENOBIS-PIPERIDINE
CAS:66168-04-5
Formula: C10H20N2Se4
KIN02538086
1,1'-TETRATHIOBIS-3-UNDECANONE
CAS:34852-29-4
KIN02217522
1,1'-TETRATHIOBIS-METHANETHIOAMIDE
CAS:13092-99-4
Formula: C2H4N2S6
KIN02014634
1,1'-TETRATHIOBIS[1-PIPERIDIN-1-YL-METHANETHIONE
CAS:120-55-8
Formula: C18H22O7
KIN01004963
1,1'-TETRATHIOBIS[1-PIPERIDIN-1-YLMETHANETHIONE
CAS:232278-71-6
Formula: C12H20N2S6
KIN03443336
1,1'-TETRATHIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:98020-35-0
KIN02809794
1,1'-TETRATHIOBIS[2,2,6,6-TETRAMETHYL-PIPERIDIN-4-ONE
CAS:72896-39-0
KIN02594558
1,1'-TETRATHIOBIS[3-PROPOXY-PROPAN-2-OL
CAS:143415-79-6
Formula: C12H26O4S4
KIN03270110
1,1'-TETRATHIOBIS[N,N-DIBUTYL-METHANETHIOAMIDE
CAS:93918-43-5
Formula: C18H36N2S6
KIN02775315
1,1'-TETRATHIOBIS[N,N-DICYCLOHEXYLMETHANETHIOAMIDE
CAS:5439-80-5
Formula: C16H10ClNO2
KIN01131243
1,1'-TETRATHIOBIS[N,N-DIMETHYL-2-PROPANAMINE
CAS:197721-94-1
Formula: C10H24N2S4
KIN03403010
1,1'-TETRATHIOBIS[N-METHYL-N-PHENYL-METHANETHIOAMIDE
CAS:103597-02-0
Formula: C16H16N2S6
KIN03669439
1,1'-THIANTHRENEDIYLBIS-ETHANONE
CAS:63415-73-6
Formula: C16H12O2S2
KIN02492281
1,1'-THIOBIS(2-(ETHYLSULFINYL)ETHANE
CAS:74857-98-0
KIN02608887
1,1'-THIOBIS(3,4-DICHLOROBENZENE
CAS:76745-12-5
Formula: C12H6Cl4S
KIN02621256
1,1'-THIOBIS(PROPAN-2-OL)
CAS:6704-17-2
KIN01168895
1,1'-THIOBIS-1H-IMIDAZOLE
CAS:16192-35-1
Formula: C6H6N4S
KIN02048729
1,1'-THIOBIS-2,5-PYRROLIDINEDIONE
CAS:65952-76-3
Formula: C8H8N2O4S
KIN02534863
1,1'-THIOBIS-2-PROPANONE
CAS:63578-76-7
Formula: C6H10O2S
KIN02495361
1,1'-THIOBIS-BUT-2-ENE
CAS:5622-74-2
KIN01137148
1,1'-THIOBIS-CYCLOPROPANOL
CAS:56460-03-8
Formula: C6H10O2S
KIN02383211
1,1'-THIOBIS-ETHYNE
CAS:51678-67-2
Formula: C4H2S
KIN02310058
1,1'-THIOBIS-NAPHTHALENE
CAS:607-54-5
Formula: C17H14N2
KIN01022026
1,1'-THIOBIS-PIPERIDINE
CAS:25116-80-7
Formula: C10H20N2S
KIN02136545
1,1'-THIOBIS[1,2,2-TRICHLORO-ETHENE
CAS:23248-52-4
Formula: C4Cl6S
KIN02118271
1,1'-THIOBIS[1-BROMO-ETHANE
CAS:61961-79-3
Formula: C4H8Br2S
KIN02465227
1,1'-THIOBIS[1-CHLORO-ETHENE
CAS:79552-39-9
Formula: C4H4Cl2S
KIN02638389
1,1'-THIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:18271-97-1
Formula: C4H4Cl6O2S
KIN02070478
1,1'-THIOBIS[2,2-BIS(ETHYLTHIO)ETHENE
CAS:89880-17-1
Formula: C12H22S5
KIN02718647
1,1'-THIOBIS[2,2-DIETHOXY-ETHANE
CAS:45204-84-0
Formula: C12H26O4S
KIN02284044
1,1'-THIOBIS[2,3,4,5,6-PENTABROMOBENZENE
CAS:60416-30-0
Formula: C12Br10S
KIN02444218
1,1'-THIOBIS[2,3,5,6-TETRAFLUORO-4-METHOXY-BENZENE
CAS:61907-45-7
Formula: C14H6F8O2S
KIN02464412
1,1'-THIOBIS[2,4,4,4-TETRACHLORO-BUTANE
CAS:62251-21-2
Formula: C8H10Cl8S
KIN02470955
1,1'-THIOBIS[2,4,5-TRIMETHYLBENZENE
CAS:61841-56-3
Formula: C18H22S
KIN02463016
1,1'-THIOBIS[2,4,6-TRIMETHYLBENZENE
CAS:5324-72-1
Formula: C5H9N3O6
KIN01125801
1,1'-THIOBIS[2,4-DIETHYLBENZENE
CAS:84666-68-2
Formula: C20H26S
KIN02669132
1,1'-THIOBIS[2,4-DIMETHYLBENZENE
CAS:20058-03-1
Formula: C16H18S
KIN02087800
1,1'-THIOBIS[2,4-DINITRO-BENZENE
CAS:2253-69-2
Formula: C14H20O
KIN01065851
1,1'-THIOBIS[2,5-DIMETHYLBENZENE
CAS:35019-02-4
Formula: C16H18S
KIN02219013
1,1'-THIOBIS[2,6-DIMETHYLBENZENE
CAS:52805-90-0
KIN02326016
1,1'-THIOBIS[2,6-DINITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:59983-53-8
Formula: C14H4F6N4O8S
KIN02440428
1,1'-THIOBIS[2-(1-METHYLETHYL)-BENZENE
CAS:474318-29-1
Formula: C18H22S
KIN03601082
1,1'-THIOBIS[2-(2-CHLORO-ETHOXY)ETHANE
CAS:52559-89-4
Formula: C8H16Cl2O2S
KIN02322737
1,1'-THIOBIS[2-(4-NITROPHENYL)-DIAZENE
CAS:67842-68-6
Formula: C12H8N6O4S
KIN02558639
1,1'-THIOBIS[2-(ETHYLTHIO)ETHANE
CAS:6052-47-7
KIN01148467
1,1'-THIOBIS[2-(METHYLTHIO)ETHANE]
CAS:37460-04-1
Formula: C6H14S3
KIN02239511
1,1'-THIOBIS[2-[(2-BROMOETHYL)THIO]-ETHANE
CAS:89595-63-1
Formula: C8H16Br2S3
KIN02714079
1,1'-THIOBIS[2-[(2-CHLORO-ETHYL)THIO]-ETHANE
CAS:51472-73-2
Formula: C8H16Cl2S3
KIN02306984
1,1'-THIOBIS[2-BROMOBENZENE
CAS:21848-84-0
Formula: C12H8Br2S
KIN02104701
1,1'-THIOBIS[2-CHLORO-2-METHYLPROPANE
CAS:52444-00-5
Formula: C8H16Cl2S
KIN02321231
1,1'-THIOBIS[2-CHLORO-4-NITRO-BENZENE
CAS:65369-91-7
Formula: C12H6Cl2N2O4S
KIN02525657
1,1'-THIOBIS[2-FLUOROBENZENE
CAS:279217-70-8
Formula: C12H8F2S
KIN03466203
1,1'-THIOBIS[2-ISOCYANATO-BENZENE
CAS:1081842-29-6
Formula: C14H8N2O2S
KIN05118058
1,1'-THIOBIS[2-ISOCYANATO-ETHANE
CAS:25574-83-8
KIN02141114
1,1'-THIOBIS[2-METHOXY-4-METHYLBENZENE
CAS:1129264-45-4
Formula: C16H18O2S
KIN05182138
1,1'-THIOBIS[2-METHOXY-BENZENE
CAS:126770-56-7
Formula: C14H14O2S
KIN03194537
1,1'-THIOBIS[2-METHOXY-ETHANE
CAS:22428-72-4
Formula: C6H14O2S
KIN02110576
1,1'-THIOBIS[2-METHYL-2-PENTENE
CAS:90850-90-1
Formula: C12H22S
KIN02734473
1,1'-THIOBIS[2-METHYL-4-PENTEN-2-OL
CAS:97325-35-4
Formula: C12H22O2S
KIN02805536
1,1'-THIOBIS[2-METHYLBENZENE
CAS:4537-09-1
Formula: C11H16O2
KIN01110053
1,1'-THIOBIS[2-METHYLBUTANE
CAS:96034-00-3
Formula: C10H22S
KIN02797396
1,1'-THIOBIS[2-NITRO-4-(TRIFLUOROMETHYL)-BENZENE
CAS:365-60-6
Formula: C13H9F3N2O2
KIN01012155
1,1'-THIOBIS[2-NITRO-BENZENE
CAS:22100-66-9
Formula: C12H8N2O4S
KIN02107245
1,1'-THIOBIS[2-NITRO-ETHANE
CAS:64820-00-4
Formula: C4H8N2O4S
KIN02516221
1,1'-THIOBIS[2-PHENYL-DIAZENE
CAS:22755-07-3
Formula: C12H10N4S
KIN02113445
1,1'-THIOBIS[2-PYRIDIN-3-YL-PIPERIDINE
CAS:63095-02-3
Formula: C20H26N4S
KIN02486271
1,1'-THIOBIS[3,3-DIMETHYLBUTAN-2-ONE
CAS:52196-65-3
Formula: C12H22O2S
KIN02317724
1,1'-THIOBIS[3,4-DIMETHOXY-BENZENE
CAS:70339-52-5
Formula: C16H18O4S
KIN02576830
1,1'-THIOBIS[3,4-DIMETHYLBENZENE
CAS:61841-55-2
Formula: C16H18S
KIN02463015
1,1'-THIOBIS[3,5-DICHLOROBENZENE
CAS:20805-43-0
KIN02094093
1,1'-THIOBIS[3,5-DIMETHYLBENZENE
CAS:148278-62-0
KIN03288920
1,1'-THIOBIS[3-(METHYLTHIO)-BENZENE
CAS:135489-58-6
KIN03233113
1,1'-THIOBIS[3-(PHENYLAMINO)-2-PROPANOL
CAS:38557-23-2
Formula: C18H24N2O2S
KIN02248810
1,1'-THIOBIS[3-(PHENYLTHIO)-BENZENE]
CAS:2392-86-1
Formula: C12H8Br2S
KIN01068489
1,1'-THIOBIS[3-(TERT-BUTYL)-2-METHOXY-5-METHYLBENZENE
CAS:54519-53-8
Formula: C24H34O2S
KIN02351218
1,1'-THIOBIS[3-[(4-ETHOXY-PHENYL)AMINO]-2-PROPANOL
CAS:55011-59-1
KIN02359210
1,1'-THIOBIS[3-[(4-METHOXY-PHENYL)AMINO]-2-PROPANOL
CAS:55011-58-0
Formula: C20H28N2O4S
KIN02359209
1,1'-THIOBIS[3-BROMOBENZENE]
CAS:2392-87-2
Formula: C29H21NO4
KIN01068490
1,1'-THIOBIS[3-CHLORO-4-METHYLBENZENE
CAS:61309-30-6
Formula: C14H12Cl2S
KIN02454084
1,1'-THIOBIS[3-CHLORO-4-NITRO-BENZENE
CAS:63063-21-8
Formula: C12H6Cl2N2O4S
KIN02485680
1,1'-THIOBIS[3-CHLORO-BUT-2-ENE
CAS:55882-20-7
Formula: C8H12Cl2S
KIN02373839
1,1'-THIOBIS[3-CHLOROPROPANE
CAS:55882-21-8
Formula: C6H12Cl2S
KIN02373840
1,1'-THIOBIS[3-ETHENYL-4-METHOXY-BENZENE
CAS:94229-06-8
Formula: C18H18O2S
KIN02779385
1,1'-THIOBIS[3-ETHENYL-5-METHYLBENZENE
CAS:1004519-22-5
Formula: C18H18S
KIN05009584
1,1'-THIOBIS[3-ETHENYLBENZENE
CAS:94240-41-2
Formula: C16H14S
KIN02779608
1,1'-THIOBIS[3-ETHYLBENZENE
CAS:84666-67-1
Formula: C16H18S
KIN02669131
1,1'-THIOBIS[3-FLUOROBENZENE
CAS:21099-60-5
KIN02097342
1,1'-THIOBIS[3-ISOCYANATO-BENZENE
CAS:71865-95-7
Formula: C14H8N2O2S
KIN02587476
1,1'-THIOBIS[3-ISOCYANATO-PROPANE
CAS:19350-78-8
KIN02080493
1,1'-THIOBIS[3-METHOXY-BENZENE
CAS:134953-13-2
KIN03230636
1,1'-THIOBIS[3-METHYL-4-NITRO-BENZENE
CAS:401636-45-1
Formula: C14H12N2O4S
KIN03562652
1,1'-THIOBIS[3-METHYLBENZENE
CAS:3111-78-2
KIN01082545
1,1'-THIOBIS[3-NITRO-BENZENE
CAS:37755-03-6
KIN02242293
1,1'-THIOBIS[3-PHENOXY-BENZENE]
CAS:7372-94-3
Formula: C24H18OS2
KIN01185347
1,1'-THIOBIS[3-PYRIDIN-2-YL-PIPERIDINE
CAS:63095-04-5
Formula: C20H26N4S
KIN02486273
1,1'-THIOBIS[3-PYRIDIN-2-YL-PIPERIDINE PICRATE
CAS:63095-05-6
Formula: C20H26N4S.C6H3N3O7
KIN02486274
1,1'-THIOBIS[4,5-DIFLUORO-2-NITRO-BENZENE
CAS:322-68-9
Formula: C12H9FN2O2
KIN01010316
1,1'-THIOBIS[4-(1,2-PROPADIENYLOXY)-BENZENE
CAS:127265-86-5
KIN03196637
1,1'-THIOBIS[4-(1-METHYLETHENYL)-BENZENE
CAS:60503-50-6
Formula: C18H18S
KIN02444978
1,1'-THIOBIS[4-(2,3-DIBROMOPROPOXY)-BENZENE
CAS:99890-15-0
Formula: C18H18Br4O2S
KIN02823377
1,1'-THIOBIS[4-(3-ETHYNYLPHENOXY)-BENZENE
CAS:82200-45-1
Formula: C28H18O2S
KIN02654101
1,1'-THIOBIS[4-(ALLYLOXY)-BENZENE
CAS:99873-56-0
Formula: C18H18O2S
KIN02823324
1,1'-THIOBIS[4-(CHLOROMETHYL)-BENZENE
CAS:1216-03-1
Formula: C14H10O2S
KIN01043866
1,1'-THIOBIS[4-(METHOXYMETHYL)-BENZENE
CAS:32449-05-1
KIN02197167
1,1'-THIOBIS[4-(METHYLTHIO)-BENZENE
CAS:125877-23-8
Formula: C14H14S3
KIN03190587
1,1'-THIOBIS[4-(PHENYLTHIO)-BENZENE
CAS:3379-98-4
KIN01088024
1,1'-THIOBIS[4-(PROPARGYLOXY)-BENZENE
CAS:119869-98-6
KIN03161037
1,1'-THIOBIS[4-(TERT-BUTYL)-BENZENE
CAS:52908-55-1
Formula: C20H26S
KIN02327531
1,1'-THIOBIS[4-(TRIFLUOROMETHYL)-BENZENE
CAS:90141-51-8
Formula: C14H8F6S
KIN02723003
1,1'-THIOBIS[4-[(2-CHLORO-ETHYL)SULFONYL]BENZENE
CAS:189358-84-7
Formula: C16H16Cl2O4S3
KIN03388846
1,1'-THIOBIS[4-[(2-CHLORO-ETHYL)THIO]BENZENE
CAS:152419-82-4
Formula: C14H12Cl2S3
KIN03302034
1,1'-THIOBIS[4-AZIDO-BENZENE]
CAS:6427-98-1
KIN01162126
1,1'-THIOBIS[4-BROMOMETHYLBENZENE
CAS:90549-27-2
Formula: C14H12Br2S
KIN02729771
1,1'-THIOBIS[4-BUTYLBENZENE
CAS:205241-16-3
KIN03414672
1,1'-THIOBIS[4-CHLORO-2-NITRO-BENZENE
CAS:36441-61-9
Formula: C12H6Cl2N2O4S
KIN02231891
1,1'-THIOBIS[4-CHLORO-3-NITRO-BENZENE
CAS:63063-17-2
Formula: C12H6Cl2N2O4S
KIN02485676
1,1'-THIOBIS[4-ETHENYL-2,5-DIMETHYLBENZENE
CAS:1004519-21-4
Formula: C20H22S
KIN05009583
1,1'-THIOBIS[4-ETHENYL-2-METHYLBENZENE
CAS:1004519-20-3
Formula: C18H18S
KIN05009582
1,1'-THIOBIS[4-ETHENYLBENZENE
CAS:93013-00-4
Formula: C16H14S
KIN02764250
1,1'-THIOBIS[4-ETHOXY-BENZENE
CAS:20057-98-1
KIN02087798
1,1'-THIOBIS[4-ETHYLBENZENE
CAS:132260-92-5
Formula: C16H18S
KIN03217904
1,1'-THIOBIS[4-ETHYNYL-2,3,5,6-TETRAFLUOROBENZENE
CAS:127052-12-4
Formula: C16H2F8S
KIN03195717
1,1'-THIOBIS[4-ETHYNYLBENZENE
CAS:27594-21-4
KIN02158756
1,1'-THIOBIS[4-ETHYNYLBENZENE TRIMER
CAS:35617-38-0
KIN02224766
1,1'-THIOBIS[4-FLUOROBENZENE
CAS:404-39-7
KIN01013776
1,1'-THIOBIS[4-ISOCYANATO-BENZENE
CAS:14353-02-7
Formula: C14H8N2O2S
KIN02031008
1,1'-THIOBIS[4-METHYL-PIPERAZINE
CAS:36938-53-1
KIN02235528
1,1'-THIOBIS[5,5,5-TRICHLOROPENTANE
CAS:14146-66-8
Formula: C10H16Cl6S
KIN02028697
1,1'-THIOBIS[5-CHLORO-2,4-DIMETHOXY-BENZENE
CAS:78046-26-1
Formula: C16H16Cl2O4S
KIN02628953
1,1'-THIOBIS[5-CHLORO-2-METHOXY-BENZENE
CAS:75024-24-7
Formula: C14H12Cl2O2S
KIN02609937
1,1'-THIOBIS[5-CHLORO-2-METHYLBENZENE
CAS:1071713-20-6
Formula: C14H12Cl2S
KIN05113501
1,1'-THIOBIS[METHOXY-BENZENE
CAS:67784-44-5
Formula: C14H14O2S
KIN02557927
1,1'-THIOBIS[METHYLBENZENE
CAS:26898-12-4
Formula: C14H14S
KIN02152174
1,1'-THIOBIS[N,N-DIMETHYLMETHANAMINE]
CAS:5695-41-0
Formula: C20H21ClN2O
KIN01139283
1,1'-THIOBISBENZENE TETRACHLORO-DERIV
CAS:55741-09-8
Formula: C12H6Cl4S
KIN02371378
1,1'-THIOCARBONYL-DI-PYRIDIN-2(1H)-ONE
CAS:102368-13-8
Formula: [C11H8N2O2S
KIN03046652
1,1'-THIODINAPHTHALEN-2-OL
CAS:17096-15-0
Formula: C20H14O2S
KIN02058151
MFCD00046469
1,1'-TRANS-1,3-CYCLOBUTANEDIYLBIS-BENZENE
CAS:25558-23-0
Formula: C16H16
KIN02140911
1,1'-TRANS-ETHEN-1,2-DIYL-DICYCLOPROPANE
CAS:10359-44-1
Formula: C8H12
KIN02005446
1,1'-TRICYCLO[8.2.2.24,7]HEXADECA-4,6,10,12,13,15-HEXAENE-5,11-DIYLBIS[1,1-DIPHENYL-PHOSPHINE
CAS:192463-40-4
Formula: C40H34P2
KIN03394145
1,1'-TRIMETHYLENEBIS[4-NITROPYRAZOLE
CAS:99179-33-6
Formula: C9H10N6O4
KIN02818611
1,1'-TRIMETHYLENEDI-CYCLOPENTANOL
CAS:100545-02-6
Formula: C13H24O2
KIN03032741
1,1'-TRISELENOBIS[N,N-DIBUTYL-METHANESELENOAMIDE
CAS:99077-77-7
Formula: C18H36N2Se5
KIN02818035
1,1'-TRISELENOBIS[N,N-DIETHYL-METHANESELENOAMIDE]
CAS:60003-30-7
Formula: C10H20N2Se5
KIN02440690
1,1'-TRITHIO-COBALTOCENIUM
CAS:71750-90-8
KIN02586629
1,1'-TRITHIO-COBALTOCENIUM HEXAFLUOROPHOSPHATE(I)
CAS:71750-91-9
KIN02586630
1,1'-TRITHIO-FERROCENE
CAS:32677-78-4
Formula: C10H8FeS3
KIN02199105
1,1'-TRITHIO-OSMOCENE
CAS:138599-22-1
Formula: C10H8OsS3
KIN03247751
1,1'-TRITHIO-RUTHENOCENE
CAS:91607-76-0
KIN02746347
1,1'-TRITHIOBIS-2-BUTANOL
CAS:101387-85-3
Formula: C8H18O2S3
KIN03038975
1,1'-TRITHIOBIS-2-PROPANOL
CAS:100449-98-7
Formula: C6H14O2S3
KIN03031880
1,1'-TRITHIOBIS-2-PROPANONE
CAS:80389-33-9
Formula: C6H10O2S3
KIN02643767
1,1'-TRITHIOBIS-3-PENTANONE
CAS:156301-58-5
Formula: C10H18O2S3
KIN03315106
1,1'-TRITHIOBIS-3-UNDECANONE
CAS:34852-28-3
KIN02217521
1,1'-TRITHIOBIS-METHANIMIDAMIDE
CAS:74173-42-5
Formula: C2H6N4S3
KIN02603801
1,1'-TRITHIOBIS-METHANIMIDAMIDE 2HBR
CAS:1036714-42-7
Formula: C2H8Br2N4S3
KIN05072722
1,1'-TRITHIOBIS-METHANIMIDAMIDE DIPERCHLORATE
CAS:74173-43-6
Formula: C2H8Cl2N4O8S3
KIN02603802
1,1'-TRITHIOBIS-NAPHTHALEN-2-OL
CAS:80389-34-0
KIN02643768
1,1'-TRITHIOBIS[1,1-DICHLORO-3,3-DIMETHYLBUTAN-2-ONE
CAS:74128-89-5
KIN02603526
1,1'-TRITHIOBIS[2,2,2-TRICHLORO-ETHANOL
CAS:98020-34-9
KIN02809793
1,1'-TRITHIOBIS[2,2,6,6-TETRAMETHYL-PIPERIDIN-4-ONE
CAS:14045-12-6
KIN02027534
1,1'-TRITHIOBIS[3-(ALLYLOXY)-2-PROPANOL
CAS:339186-87-7
Formula: C12H22O4S3
KIN03512360
1,1'-TRITHIOBIS[3-PHENOXY-2-PROPANOL
CAS:110144-53-1
Formula: C18H22O4S3
KIN03099550
1,1'-TRITHIOBIS[N,N-DIBUTYL-METHANETHIOAMIDE
CAS:93918-42-4
Formula: C18H36N2O2S3
KIN02775314
1,1'-TRITHIOBIS[N-BROMO-FORMIMIDOYL BROMIDE
CAS:90462-82-1
KIN02728254
1,1'-TRITHIOBIS[N-ETHYL-N-PHENYL-METHANETHIOAMIDE
CAS:1129288-90-9
Formula: C18H20N2S5
KIN05182234
1,1'-UNDECYLIDENEBIS(DECAHYDRONAPHTHALENE)
CAS:55373-96-1
Formula: C31H56
KIN02365341
1,1'-VINYLENEBIS(3,3-DIMETHYL-UREA)
CAS:73840-17-2
Formula: C8H16N4O2
KIN02601300
1,1'-VINYLIDENEBISCYCLOPROPANE
CAS:822-94-6
KIN01030671
1,1'-YLCARBONYLBIS-1H-BENZO[D]IMIDAZOLE
CAS:14667-54-0
Formula: C15H10N4O
KIN02034399
1,1'-YLCARBONYLBIS-AZIRIDINE
CAS:1192-76-3
Formula: C4H8N2OS
KIN01042699
1,1'-YLSULFONYLBIS[2-METHOXY-ETHANE]
CAS:7209-47-4
KIN01181275
1,1'-YLSULFONYLBIS[2-METHYL-AZIRIDINE
CAS:1623-88-7
Formula: C6H5ClO2
KIN01051827
1,1'-YLSULFONYLBIS[4-(TERT-BUTYL)-BENZENE]
CAS:5453-71-4
Formula: C15H14O4S
KIN01132289
1,1'-YLSULFONYLBIS[4-CHLORO-3,5-DINITRO-BENZENE]
CAS:6462-05-1
KIN01162825
1,1':1',1''-TERCYCLOBUTANE
CAS:224824-01-5
Formula: C12H20
KIN03439752
1,1':2',1''-TERCYCLOHEXANE
CAS:2456-45-3
Formula: C23H24O
KIN01069931
1,1':2',1''-TERNAPHTHALENE
CAS:141356-07-2
Formula: C30H20
KIN03259772
1,1':2',1''-TERPHENYL
CAS:84-16-2
Formula: C18H22O2
KIN01001897
1,1':2',1''-TERPHENYL, 2,3,4,5-TETRACHLORO-,
CAS:106105-06-0
Formula: C18H10Cl4
KIN03073924
1,1':2',1''-TERPHENYL, 3',4',5',6'-TETRAPHENYL-4-(PHENYLETHYNYL)-,
CAS:284494-77-5
Formula: C50H34
KIN03467971
1,1':2',1''-TERPHENYL, 3-CHLORO-4-FLUORO-4''-(METHYLSULFONYL)-,
CAS:175883-06-4
Formula: C19H14ClFO2S
KIN03359872
1,1':2',1''-TERPHENYL, 4,4''-DIMETHOXY-,
CAS:160538-35-2
Formula: C20H18O2
KIN03326365
1,1':2',1''-TERPHENYL, 4,4',5'-TRIFLUORO-4''-(METHYLSULFONYL)-,
CAS:175883-15-5
Formula: C19H13F3O2S
KIN03359873
1,1':2',1''-TERPHENYL, 4-BROMO-3',4',5'-TRIPHENYL-,
CAS:330649-92-8
Formula: C36H25Br
KIN03502084
1,1':2',1''-TERPHENYL, 4-BROMO-4'-(4-BROMOPHENYL)-4''-METHOXY-3'-PHENYL-,
CAS:137839-66-8
Formula: C31H22Br2O
KIN03243625
1,1':2',1''-TERPHENYL, 4-NITRO-4'-(4-NITROPHENYL)-3',5',6'-TRIPHENYL-,
CAS:121264-22-0
Formula: C42H28N2O4
KIN03168820
1,1':2',1'':2'',1'''-QUATERPHENYL
CAS:641-98-5
Formula: C14H6F6N2O4
KIN01024116
1,1':2',1'':2'',1''':2''',1'''':2'''',1'''''-SEXIPHENYL
CAS:4740-57-2
Formula: C17H16OS2
KIN01113688
1,1':2',1'':3'',1'''-QUATERPHENYL
CAS:1165-58-8
Formula: C24H18
KIN01042068
1,1':2',1'':3'',1''':2''',1''''-QUINQUEBENZENE
CAS:5660-38-8
Formula: C30H22
KIN01138152
1,1':2',1'':3'',1''':4''',1''''-QUINQUEPHENYL
CAS:5660-41-3
Formula: C15H13NO4
KIN01138153
1,1':2,2'-BIS(TRITHIO)-FERROCENE
CAS:147281-47-8
Formula: C10H6FeS6
KIN03285413
1,1':3',1''-TERCYCLOHEXANE
CAS:1706-52-1
Formula: C9H9ClO3S
KIN01053831
1,1':3',1''-TERPHENYL
CAS:92-07-9
Formula: C17H13N
KIN01002574
1,1':3',1''-TERPHENYL, 2'-BROMO-4,4''-BISBROMOMETHYL-,
CAS:154488-09-2
Formula: C20H15Br3
KIN03308991
1,1':3',1''-TERPHENYL, 2'-IODO-2,2'',4,4'',5',6,6''-HEPTAMETHYL-,
CAS:192071-13-9
Formula: C25H27I
KIN03393453
1,1':3',1''-TERPHENYL, 2'-IODO-2,2'',4,4'',6,6''-HEXAKIS(1-METHYLETHYL)-,
CAS:174272-36-7
Formula: C36H49I
KIN03355380
1,1':3',1''-TERPHENYL, 2'-IODO-2,2''-BIS(1-METHYLETHYL)-,
CAS:198023-04-0
Formula: C24H25I
KIN03403772
1,1':3',1''-TERPHENYL, 2'-IODO-4,4''-DIMETHOXY-,
CAS:328249-41-8
Formula: C20H17IO2
KIN03498531
1,1':3',1''-TERPHENYL, 2,2'',4,4'',6,6''-HEXAMETHYL-,
CAS:103068-13-9
Formula: C24H26
KIN03051696
1,1':3',1''-TERPHENYL, 2,2'',6,6''-TETRAKISBROMOMETHYL-,
CAS:116129-61-4
Formula: C22H18Br4
KIN03141143
1,1':3',1''-TERPHENYL, 3,3'',4,4''-TETRAMETHYL-,
CAS:115424-59-4
Formula: C22H22
KIN03137169
1,1':3',1''-TERPHENYL, 3,3''-BISBROMOMETHYL-5'-[3-BROMOMETHYLPHENYL]-,
CAS:109978-08-7
Formula: C27H21Br3
KIN03098532
1,1':3',1''-TERPHENYL, 4,4''-BIS(PHENYLETHYNYL)-5'-[4-(PHENYLETHYNYL)PHENYL]-,
CAS:164025-88-1
Formula: C48H30
KIN03334909
1,1':3',1''-TERPHENYL, 4,4''-DIMETHYL-2'-NITRO-5'-PHENYL-,
CAS:102949-26-8
Formula: C26H21NO2
KIN03050939
1,1':3',1''-TERPHENYL, 4,4''-DIPHENOXY-,
CAS:162607-95-6
Formula: C30H22O2
KIN03331885
1,1':3',1''-TERPHENYL, 4-PHENOXY-,
CAS:101798-19-0
Formula: C24H18O
KIN03041852
1,1':3',1''-TERPHENYL, 5'-BROMO-2,2'',4,4'',6,6''-HEXAKIS(1-METHYLETHYL)-,
CAS:443295-47-4
Formula: C36H49Br
KIN03585107
1,1':3',1''-TERPHENYL, 5'-BROMO-2,2'',6,6''-TETRAMETHYL-,
CAS:135989-99-0
Formula: C22H21Br
KIN03235135
1,1':3',1''-TERPHENYL, 5'-BROMOMETHYL-,
CAS:100094-00-6
Formula: C19H15Br
KIN03028452
1,1':3',1''-TERPHENYL,2,2',2'',4,4',4'',6,6',6''-NONANITRO-5'-(2,4,6-TRINITROPHENYL)-,
CAS:125010-19-7
Formula: C24H6N12O24
KIN03186681
1,1':3',1'':4'',1'''-QUATERPHENYL
CAS:1166-23-0
KIN01042083
1,1':4',1''-TERPHENYL, 2',3''-DIFLUORO-4-OCTYL-4''-(OCTYLOXY)-,
CAS:129271-66-5
Formula: C34H44F2O
KIN03205161
1,1':4',1''-TERPHENYL, 2',3',5',6'-TETRAMETHYL-,
CAS:145588-14-3
Formula: C22H22
KIN03280066
1,1':4',1''-TERPHENYL, 2',3'-DIFLUORO-4,4''-DIPENTYL-,
CAS:121218-76-6
Formula: C28H32F2
KIN03168523
1,1':4',1''-TERPHENYL, 2',3'-DIFLUORO-4-HEPTYL-4''-PENTYL-,
CAS:121235-87-8
Formula: C30H36F2
KIN03168633
1,1':4',1''-TERPHENYL, 2',3'-DIFLUORO-4-PENTYL-4''-PROPYL-,
CAS:121218-79-9
Formula: C26H28F2
KIN03168524
1,1':4',1''-TERPHENYL, 2',5'-BIS(HEXYLOXY)-,
CAS:241802-54-0
Formula: C30H38O2
KIN03446075
1,1':4',1''-TERPHENYL, 2',5'-BISBROMOMETHYL-,
CAS:135078-57-8
Formula: C20H16Br2
KIN03231321
1,1':4',1''-TERPHENYL, 2',5'-DIHEXYL-,
CAS:178426-66-9
Formula: C30H38
KIN03364792
1,1':4',1''-TERPHENYL, 2'-FLUORO-4''-(METHYLTHIO)-4-PROPYL-,
CAS:159896-18-1
Formula: C22H21FS
KIN03324650
1,1':4',1''-TERPHENYL, 2'-METHYL-4,4''-BIS(DECYCLOXY)-,
CAS:162047-76-9
Formula: C39H56O2
KIN03330546
1,1':4',1''-TERPHENYL, 2,2'',5,5''-TETRAMETHOXY-4,4''-DIMETHYL-,
CAS:382595-15-5
Formula: C24H26O4
KIN03550740
1,1':4',1''-TERPHENYL, 2,3-DIFLUORO-4,4''-DIPROPYL-,
CAS:121218-89-1
Formula: C24H24F2
KIN03168526
1,1':4',1''-TERPHENYL, 3,3'',5,5''-TETRAKIS(TERT-BUTYL)-,
CAS:104700-13-2
Formula: C34H46
KIN03063219
1,1':4',1''-TERPHENYL, 3,5-DIFLUORO-4''-PENTYL-,
CAS:137528-86-0
Formula: C23H22F2
KIN03242012
1,1':4',1''-TERPHENYL, 3-(1-METHYLETHYL)-,
CAS:128007-63-6
Formula: C21H20
KIN03199954
1,1':4',1''-TERPHENYL, 4,4''-BIS(2,2-DIPHENYLETHENYL)-,
CAS:213527-39-0
Formula: C46H34
KIN03425145
1,1':4',1''-TERPHENYL, 4,4''-BIS[(4-CHLOROPHENYL)SULFONYL]-,
CAS:125430-15-1
Formula: C30H20Cl2O4S2
KIN03188623
1,1':4',1''-TERPHENYL, 4-(METHYLTHIO)-,
CAS:103561-47-3
Formula: C19H16S
KIN03054597
1,1':4',1''-TERPHENYL, 4-BUTYL-4''-ETHYL-2',3'-DIFLUORO-,
CAS:486406-09-1
Formula: C24H24F2
KIN03610629
1,1':4',1''-TERPHENYL, 4-ETHOXY-2,3-DIFLUORO-4''-PENTYL-,
CAS:121218-93-7
Formula: C25H26F2O
KIN03168528
1,1':4',1''-TERPHENYL, 4-PENTYL-4''-(TRANS-4-PROPYLCYCLOHEXYL)-,
CAS:394738-45-5
Formula: C32H40
KIN03558800
1,1':4',1''-TERPHENYL,2,3,5,6-TETRACHLORO-,
CAS:61576-99-6
Formula: C18H10Cl4
KIN02458255
1,1':4',1''-TERPHENYL,4,4''-BIS(1,1-DIMETHYLPROPYL)-,;
CAS:121838-04-8
Formula: C28H34
KIN03646879
1,1':4',1'':2'',1''':2''',1'''':4'''',1'''''-SEXIPHENYL
CAS:5080-62-6
KIN01120353
1,1':4',1'':4'',1'''-QUATERPHENYL
CAS:135-71-7
Formula: C26H16N2Na2O4
KIN01005912
1,1':4',1'':4'',1'''-QUATERPHENYL-4,4'''-DIAMINE
CAS:78486-88-1
KIN02631827
1,1':4',1'':4'',1''':4''',1''''-QUINQUEPHENYL
CAS:3073-26-5
Formula: C11H14N4O6
KIN01081908
1,1':4',1'':4'',1''':4''',1'''':4'''',1'''''-SEXIPHENYL
CAS:4499-84-7
Formula: C20H20
KIN01109396
1,1':4',1'':4'',1''':4''',1'''':4'''',1'''''-SEXIPHENYL, 2',3''''-DIMETHYL-,
CAS:120956-76-5
Formula: C38H30
KIN03167164
1,1':4',1'':4'',1''':4''',1'''':4'''',1''''':4''''',1''''''-SEPTIPHENYL, 2''',5'''-DIDECYL-,
CAS:165330-09-6
Formula: C62H70
KIN03337104
1,1':4',1'-TERPHENYL-4,4'-DIOL
CAS:4084-48-4
Formula: C6H6ClN
KIN01100712
1,1':9,9'-DIEPOXY[BI[5,6]FULLERENE-C60-IH]
CAS:208348-40-7
Formula: C120O2
KIN03418717
1,1(4H)-NAPHTHALENEDICARBOXYLIC ACID 1,1-DIMETHYL ESTER
CAS:126857-46-3
KIN03635571
1,1(OR 1,3)-DIMETHYL-PERIMIDINIUM IODIDE
CAS:27228-38-2
Formula: C12H10N2.CH3I
KIN02155312
1,1(OR 1,4)-DIMETHYL-4(OR 1)-[2-(P-PHENOXY(PHENYLAMINO))ETHYL]PIPERAZINIUM IODIDE
CAS:14277-58-8
KIN02030173
1,1,1 -, TRIFLUORO-2'-, METHYL-3'-, NITRO -, 2'-, PROPANOL
CAS:428-71-7
Formula: C3F7N
KIN01014244
1,1,1 -[[(2R)-3-(HEXADECYCLOXY)-2-(5-HEXEN-1-YLOXY)-PROPOXY]METHYLIDYNE]TRIS-BENZENE
CAS:431063-04-6
Formula: C44H64O3
KIN03577975
1,1,1'',1''-TETRAETHYL-5',14',20',29',32',33',36',37'-OCTAMETHOXY-DISPIRO[PIPERIDIN-4,2'-[7,12,22,27]TETRAOXAPENTACYCLO[26.2.2.23,6.213,16.218,21]OCTATRIACONTA[3,5,13,15,18,20,28,30,31,33,35,37]DODECAENE-17',4''-PIPERIDINIUM] DICHLORIDE ROTAXANE COMPD. WITH 4,4'-[3-(4-ETH
CAS:212246-46-3
Formula: C58H84N2O12.C23H20N2O.4Cl
KIN03423706
1,1,1'',1''-TETRAETHYL-5',14',20',29',32',33',36',37'-OCTAMETHOXY-DISPIRO[PIPERIDIN-4,2'-[7,12,22,27]TETRAOXAPENTACYCLO[26.2.2.23,6.213,16.218,21]OCTATRIACONTA[3,5,13,15,18,20,28,30,31,33,35,37]DODECAENE-17',4''-PIPERIDINIUM] DICHLORIDE ROTAXANE COMPD. WITH 4,4'-[3-[4-[(4
CAS:212246-54-3
Formula: C58H84N2O12.C31H24N2O.4Cl
KIN03423712
1,1,1'-(5-METHYLHEXAN-1,3,5-TRIYL)TRIBENZENE
CAS:7399-66-8
Formula: C8H14N3O2+
KIN01185896
1,1,1'-[2-(BENZENESULFONYL)ETHENE-1,1,2-TRIYL]TRIBENZENE
CAS:41946-66-1
Formula: C26H20O2S
KIN02274649
1,1,1'-METHANEDIYLYLIDENETRICYCLOPROPANE
CAS:37559-52-7
Formula: C10H14
KIN02240498
1,1,1'-METHANETRIYLTRIS(3,4-DIMETHOXY-BENZENE)
CAS:5450-53-3
Formula: C32H48O2
KIN01132050
1,1,1'-PHOSPHORYLTRIS[2-(2-METHYLPROPYL)AZIRIDINE]
CAS:5774-45-8
Formula: C24H24N3OP
KIN01141379
1,1,1'-PROP-1-EN-1,3,3-TRIYLTRIBENZENE
CAS:6281-48-7
Formula: C15H25NO2
KIN01155192
1,1,1'-TRIMETHYL-3-BROMO-2,3'-2'-3'-TRIINDOLYL
CAS:109005-14-3
Formula: C27H22BrN3
KIN03092669
1,1,1'-TRIS(HYDROXYMETHYL)ETHANE, TRIFORMATE
CAS:120570-78-7
Formula: C8H12O6
KIN03165109
1,1,1,1'-(5-BENZYLIDENECYCLOPENTA-1,3-DIENE-1,2,3,4-TETRAYL)-TETRABENZENE
CAS:6937-60-6
Formula: C11H16ClNO2
KIN01173096
1,1,1,1'-[(3,4-DICHLORO-CYCLOBUTANE-1,2-DIYLIDENE)DIMETHANEDIYLYLIDENE]TETRABENZENE
CAS:4283-98-1
Formula: C50H42P2.2Br
KIN01104456
1,1,1,1'-ETHANE-1,1,2,2-TETRAYL-TETRAKIS(4-NITRO-BENZENE)
CAS:7111-63-9
Formula: C13H8Cl2O2
KIN01178830
1,1,1,1'-ETHENE-1,1,2,2-TETRAYL-TETRAKIS(4-FLUOROBENZENE)
CAS:435-96-1
KIN01014467
1,1,1,1'-TETRAMETHYL-2,2'-PROPANEDIYL-BIS-PIPERIDINIUM, DIIODIDE
CAS:34947-70-1
Formula: C17H36IN2+
KIN02218410
1,1,1,1,2,2,3,3,4,4,5,5-DODECAFLUOROTHIEPANE
CAS:24345-53-7
Formula: C6H4F12S
KIN02129541
1,1,1,1,2,2-HEXAFLUOROTHIETANE
CAS:24345-51-5
Formula: C3H4F6S
KIN02129540
1,1,1,1-(1,4-BUTANEDIYLIDENE)-TETRAKIS-BENZENE
CAS:1483-67-6
Formula: C7H10O2
KIN01048169
1,1,1,1-(1-PROPYN-1-YL-3-YLIDYNE)-TETRAKIS-BENZENE
CAS:20143-13-9
Formula: C27H20
KIN02088525
1,1,1,1-TETRACHLORO-N,N-DIETHYL-PHOSPHORANAMINE
CAS:64265-89-0
Formula: C4H10Cl4NP
KIN02507019
1,1,1,1-TETRAFLUORO-N,N-DIMETHYL-PHOSPHORANAMINE
CAS:2354-04-3
Formula: C3Cl4F4
KIN01067583
1,1,1,1-TETRAHYDRO-1,1-DIIMINO-THIOPHENE
CAS:260969-93-5
KIN03458595
1,1,1,1-TETRAMETHYLAZOXY-ETHANE
CAS:2406-29-3
Formula: C10H16O2
KIN01068822
1,1,1,10,10,10-HEXAFLUORO-5,6-DIPHENYL-2,8-DECADIYNE-4,7-DIONE
CAS:149978-94-9
KIN03294678
1,1,1,10,10,10-HEXAFLUORO-DECANE
CAS:1826-81-9
KIN01056758
1,1,1,10,10,10-HEXAPHENYL-3,8-DITHIOXO-2,9-DITHIA-4,7-DIAZA-1,10-DISTANNADECANE
CAS:2591-44-8
Formula: C22H22Sn
KIN01072590
1,1,1,10-TETRACHLORO-DECANE
CAS:10311-15-6
KIN02004721
1,1,1,11,11,11-HEXAMETHYL-3,3,5,5,7,7,9,9-OCTAKIS[(TRIMETHYLSILYLOXY)]-HEXASILOXANE
CAS:52809-00-4
Formula: C30H90O13Si14
KIN02326084
1,1,1,11-TETRACHLORO-UNDECANE
CAS:3922-40-5
Formula: C12H8N2O2
KIN01098041
1,1,1,12-TETRACHLORO-DODECANE
CAS:10311-16-7
KIN02004722
1,1,1,13-TETRACHLORO-TRIDECANE
CAS:3922-34-7
KIN01098040
1,1,1,2,2,12-HEXACHLORO-DODECANE
CAS:100525-30-2
KIN03032549
1,1,1,2,2,2-HEXABUTYL-DISTANNANE
CAS:813-27-4
KIN01030286
1,1,1,2,2,2-HEXACYCLOHEXYLDIPLUMBANE
CAS:6713-83-3
Formula: C6H18Pb2
KIN01169110
1,1,1,2,2,2-HEXAETHOXYDISILANE
CAS:5851-14-9
Formula: C6H11O2PS2
KIN01143423
1,1,1,2,2,2-HEXAETHOXYETHANE
CAS:65789-73-3
Formula: C14H30O6
KIN02532478
1,1,1,2,2,2-HEXAETHYLDIGERMANE
CAS:993-63-5
Formula: C12H30Sn2
KIN01036099
1,1,1,2,2,2-HEXAETHYLDIPLUMBANE
CAS:2388-01-4
Formula: C4H8N2O
KIN01068383
1,1,1,2,2,2-HEXAETHYLDISILANE
CAS:1633-14-3
Formula: C6H2Br2O2
KIN01052079
1,1,1,2,2,2-HEXAETHYLDISTANNANE
CAS:993-66-8
Formula: C10H24O3Si
KIN01036100
1,1,1,2,2,2-HEXAFLUORO-ETHANE
CAS:76-17-5
Formula: C3Cl3F5
KIN01001246
1,1,1,2,2,2-HEXAKIS(METHYLTHIO)ETHANE
CAS:26477-87-2
Formula: C8H18S6
KIN02148570
1,1,1,2,2,2-HEXAMETHOXYDISILANE
CAS:5851-08-1
Formula: C12H30O6Si2
KIN01143422
1,1,1,2,2,2-HEXAMETHYL-DIPLUMBANE
CAS:6713-87-7
KIN01169111
1,1,1,2,2,2-HEXAMETHYL-DISELENINE
CAS:1017791-72-8
KIN05035288
1,1,1,2,2,2-HEXAMETHYL-DISTANNANE
CAS:661-71-2
Formula: C4H4ClF3
KIN01024829
1,1,1,2,2,2-HEXAMETHYLDIGERMANE
CAS:993-53-3
Formula: C8H14O
KIN01036095
1,1,1,2,2,2-HEXAMETHYLDISILANE
CAS:1450-16-4
Formula: C16H22Si2
KIN01047303
1,1,1,2,2,2-HEXAMETHYLHYDRAZINIUM
CAS:1069135-46-1
KIN05110594
1,1,1,2,2,2-HEXANITRO-ETHANE
CAS:918-42-3
Formula: C4H9NO3
KIN01033533
1,1,1,2,2,2-HEXAPENTYL-DISTANNANE
CAS:21227-23-6
KIN02098600
Hexapentyl-distannane; Hexaamylditin; 1,1,1,2,2,2-
1,1,1,2,2,2-HEXAPHENYL-DISTANNANE
CAS:1064-16-0
Formula: C29H44O9
KIN01038308
1,1,1,2,2,2-HEXAPHENYLDIGERMANE
CAS:2816-43-5
Formula: C18H16Ge
KIN01076704
1,1,1,2,2,2-HEXAPHENYLDISILANE
CAS:1450-29-9
Formula: C8H18Si2
KIN01047308
1,1,1,2,2,2-HEXAPROPYL-DISTANNANE
CAS:6028-87-1
KIN01147767
1,1,1,2,2,3,3,3-OCTAETHYL-TRIGERMANE
CAS:13937-05-8
Formula: C16H40Ge3
KIN02026201
1,1,1,2,2,3,3,3-OCTAFLUORO-TRISILANE
CAS:14521-14-3
Formula: F8Si3
KIN02032834
1,1,1,2,2,3,3,3-OCTAMETHYLTRIGERMANE
CAS:1066-64-4
Formula: C13H36Si4
KIN01038363
1,1,1,2,2,3,3,4,4,4-DECADEUTERIOBUTANE
CAS:7582-08-3
KIN01191618
1,1,1,2,2,3,3,4,4,4-DECAMETHYL-TETRAGERMANE
CAS:14938-41-1
Formula: C10H30Ge4
KIN02036897
1,1,1,2,2,3,3,4,4,5,5,6,6,6-TETRADECACHLORO-HEXANE
CAS:83682-34-2
Formula: C6Cl14
KIN02662626
1,1,1,2,2,3,3,4,4,5,5,6,6,6-TETRADECAMETHYL-HEXASILANE
CAS:812-54-4
Formula: C12H36Cl2Si6
KIN01030273
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-OCTADECAMETHYL-OCTASILANE
CAS:3704-83-4
Formula: C18H13NO2
KIN01094356
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-DOCOSAMETHYL-DECASILANE
CAS:4774-85-0
Formula: C26H78Si12
KIN01114449
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-TETRACOSAFLUORO-UNDECANE
CAS:307-50-6
Formula: C11F23I
KIN01009769
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-HEXACOSAMETHYL-DODECASILANE
CAS:4775-07-9
Formula: C9H11N7S
KIN01114450
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-DOTETRACONTAFLUORO-EICOSANE
CAS:37589-57-4
Formula: C20F42
KIN02240831
Perfluoroeicosane
MFCD00000438
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22,23,23,24,24-NONATETRACONTAFLUORO-24-IODO-TETRACOSANE
CAS:39823-55-7
Formula: C24F49I
KIN02257744
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22-PENTA-TETRACONTAFLUORO-22-IODO-DOCOSANE
CAS:29809-36-7
Formula: C22F45I
KIN02176816
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20-HEN-TETRACONTAFLUORO-20-IODO-ICOSANE
CAS:29809-34-5
Formula: C20F41I
KIN02176814
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20-HEN-TETRACONTAFLUORO-22-IODO-DOCOSANE
CAS:263756-45-2
Formula: C22H4F41I
KIN03461033
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18-HEPTATRIACONTAFLUORO-18-IODO-OCTADECANE
CAS:29809-35-6
Formula: C18F37I
KIN02176815
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-TRITRIACONTAFLUORO-16-IODO-HEXADECANE
CAS:355-51-1
Formula: C16H6F21NO2S
KIN01011708
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-NONACOSAFLUORO-14-IODO-TETRADECANE
CAS:307-65-3
KIN01009776
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-HEPTACOSAFLUORO-15-IODO-PENTADECANE
CAS:146983-96-2
Formula: C15H4F27I
KIN03284331
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-TRICOSAFLUORO-11-IODO-UNDECANE
CAS:307-51-7
Formula: C10F22O2S
KIN01009770
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-TRICOSAFLUORO-13-IODO-TRIDECANE
CAS:57216-88-3
Formula: C13H4F23I
KIN02395823
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-NONADECAFLUORO-9-IODO-NONANE
CAS:559-05-7
Formula: C14H6F17NO2S
KIN01019821
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-10-(ALLYLTHIO)-DECANE
CAS:239463-91-3
Formula: [C13H9F17S
KIN03445501
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-9-OCTADECENE
CAS:113999-61-4
Formula: [C18H19F17
KIN03127698
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-DOCOSANE
CAS:133310-72-2
Formula: C22H29F17
KIN03222978
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-EICOSANE
CAS:106873-67-0
Formula: [C20H25F17
KIN03079233
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-HEXADECANE
CAS:6145-09-1
Formula: C23H16O4
KIN01150973
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-OCTADECANE;
CAS:138472-76-1
Formula: [C18H21F17
KIN03246959
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUORO-TETRACOSANE
CAS:117146-18-6
Formula: C24H33F17
KIN03147636
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-HEPTADECAFLUOROOCTANE
CAS:3459-80-1
Formula: C11H16O
KIN01089660
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-HEXADECAFLUORO-OCTANE
CAS:2070-83-9
KIN01062111
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-11-IODO-UNDECANE
CAS:1748-99-8
Formula: C19H17NO
KIN01054928
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-15-IODO-PENTADECANE
CAS:2377-79-9
Formula: C8BrF16I
KIN01068117
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-7-ISOCYANATO-HEPTANE
CAS:335-93-3
Formula: C8HF15O2
KIN01010852
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-9-IODO-NONANE
CAS:2043-53-0
Formula: C10H4F17I
KIN01061540
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-PENTADECAFLUORO-9-IODO-PENTADECANE
CAS:918-36-5
Formula: C13H14F6O4
KIN01033531
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-TRIACONTAFLUORO-7-(TRIFLUOROMETHYL)PENTADECAN-7-OL
CAS:161144-54-3
Formula: C16HF33O
KIN03328102
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8-PENTADECAFLUORO-10-IODO-DECANE
CAS:49676-71-3
Formula: C10H6F15I
KIN02289687
1,1,1,2,2,3,3,4,4,5,5,6,6,8,8-PENTADECAFLUORO-8-IODO-OCTANE
CAS:53826-16-7
Formula: C8H2F15I
KIN02341040
1,1,1,2,2,3,3,4,4,5,5,6,6,8-TETRADECAFLUOROOCTANE
CAS:361532-17-4
Formula: C8H4F14
KIN03537449
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-6-(1,2,2-TRIFLUORO-ETHENOXY)-HEXANE
CAS:103489-99-2
Formula: C8F16O
KIN03054196
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-6-IODO-HEXANE
CAS:355-46-4
Formula: C6HF13O3S
KIN01011704
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-(2-METHYLPENTAN-2-YLOXY)OCTANE
CAS:210896-25-6
Formula: [C14H17F13O
KIN03422088
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-HEXADECENE
CAS:120464-27-9
Formula: C16H19F13
KIN03164535
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-IODO-HEPTANE
CAS:212563-43-4
Formula: C7H2F13I
KIN03424079
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-7-TETRADECENE
CAS:120464-26-8
Formula: C14H15F13
KIN03164534
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-(PENTYLOXY)OCTANE
CAS:1193009-93-6
Formula: C13H15F13O;CF3(CF2)5CH2CH2OCH2CH2CH2CH2CH3;CF3(CF2)5CH2CH2OCH2CH2CH2CH2CH3;C13H15F13O
KIN05334631
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-(PROPOXY)OCTANE
CAS:1193010-01-3
Formula: C11H11F13O
KIN05334634
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODO-DODECANE
CAS:120695-82-1
Formula: C12H12F13I
KIN03165852
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODO-OCTANE
CAS:2043-61-0
Formula: C7H12O
KIN01061544
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-PROP-2-ENOXYOCTANE
CAS:103628-86-0
Formula: C11H9F13O
KIN03055112
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-HEXADECANE
CAS:147492-59-9
Formula: C16H21F13
KIN03286270
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-HEXANE
CAS:355-38-4
Formula: C6F12O
KIN01011699
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-OCTADECANE
CAS:90499-30-2
Formula: C18H25F13
KIN02728938
MFCD04038340
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-TETRADECANE
CAS:133331-77-8
Formula: C14H17F13
KIN03223037
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORODECANE
CAS:154478-86-1
Formula: C10H9F13
KIN03308958
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORODOCOSANE
CAS:133310-71-1
Formula: C22H33F13
KIN03222977
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUOROOCTADEC-7-ENE
CAS:131851-05-3
Formula: C18H23F13
KIN03216004
1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUOROPENTADECANE
CAS:113659-13-5
Formula: C15H19F13
KIN03124921
1,1,1,2,2,3,3,4,4,5,5,6,7,7-TETRADECAFLUORO-7-METHOXYHEPTANE
CAS:355-73-7
Formula: C6H8F8N2
KIN01011715
1,1,1,2,2,3,3,4,4,5,5,6,7,7-TETRADECAFLUORO-8-PROP-2-ENOXYOCTANE
CAS:192998-90-6
Formula: C11H8F14O
KIN03395411
1,1,1,2,2,3,3,4,4,5,5,6-DODECAFLUORONONANE
CAS:126038-58-2
Formula: C9H8F12
KIN03191163
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-5-IODO-PENTANE
CAS:638-88-0
KIN01024009
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-7-IODO-HEPTANE
CAS:1682-32-2
Formula: C5H2F8O
KIN01053257
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORO-HEXANE
CAS:154275-17-9
Formula: C6H3F11
KIN03308155
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUORONONADECANE
CAS:112344-48-6
Formula: C19H29F11
KIN03114651
1,1,1,2,2,3,3,4,4,5,5-UNDECAFLUOROPENTANE
CAS:139063-93-7
Formula: C5HF11
KIN03250462
1,1,1,2,2,3,3,4,4,5,6,6,6-TRIDECAFLUORO-5-(TRIFLUOROMETHYL)-HEXANE
CAS:36610-38-5
Formula: C7F16
KIN02232775
1,1,1,2,2,3,3,4,4,5,6,6,6-TRIDECAFLUORO-HEXANE
CAS:1998-58-9
Formula: C6HF4IO
KIN01060527
1,1,1,2,2,3,3,4,4,5,6,7,7,7-TETRADECAFLUORO-HEPTANE
CAS:142347-10-2
Formula: C7H2F14
KIN03264718
1,1,1,2,2,3,3,4,4,5-DECAFLUORO-HEXANE
CAS:155072-58-5
Formula: C6H4F10
KIN03311011
1,1,1,2,2,3,3,4,4,5-DECAFLUORONONANE
CAS:126038-57-1
Formula: C9H10F10
KIN03191162
1,1,1,2,2,3,3,4,4,6,6,8,8-TRIDECAFLUORO-8-IODO-OCTANE
CAS:99325-17-4
Formula: C8H4F13I
KIN02819555
1,1,1,2,2,3,3,4,4,6,6-UNDECAFLUORO-8-IODO-OCTANE
CAS:53626-95-2
Formula: C8H6F11I
KIN02338041
1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-OCTADECAFLUORODECANE
CAS:142083-52-1
Formula: C10H4F18
KIN03263567
1,1,1,2,2,3,3,4,4-NONACHLORO-BUTANE
CAS:21483-62-5
Formula: C4HCl9
KIN02101244
1,1,1,2,2,3,3,4,4-NONACHLORO-TETRASILANE
CAS:56240-72-3
Formula: Cl9HSi4
KIN02379586
1,1,1,2,2,3,3,4,4-NONACHLOROUNDECANE
CAS:219697-11-7
Formula: C11H15Cl9
KIN03431991
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-(TRIFLUOROMETHOXY)BUTANE
CAS:559-31-9
KIN01019825
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-IODO-BUTANE
CAS:423-40-5
Formula: C3F8O2S
KIN01014117
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-METHOXY-BUTANE
CAS:163702-07-6
Formula: C5H3F9O
KIN03334297
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-METHOXY-BUTANE, 2-((DIFLUOROMETHOXY)METHYL)-1,1,1,2,3,3,3-HEPTAFLUOROPROPANE
CAS:219484-64-7
Formula: C10H6F18O2
KIN03431457
1,1,1,2,2,3,3,4,4-NONAFLUORO-4-PROPOXY-BUTANE
CAS:72372-80-6
Formula: C7H7F9O
KIN02590967
1,1,1,2,2,3,3,4,4-NONAFLUORO-5-DECANOL
CAS:95452-56-5
Formula: C10H13F9O
KIN02791565
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(METHANE-SULFINYL)-HEXANE
CAS:357604-65-0
Formula: [C7H7F9OS
KIN03534577
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(PENTYLOXY)-HEXANE
CAS:1193009-96-9
Formula: C11H15F9O
KIN05334632
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-(PROPOXY)-HEXANE
CAS:1193009-98-1
Formula: C9H11F9O
KIN05334633
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-DECANE
CAS:40735-32-8
Formula: C10H12F9I
KIN02265296
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-DODECANE
CAS:109603-73-8
Formula: C12H16F9I
KIN03096348
1,1,1,2,2,3,3,4,4-NONAFLUORO-6-IODO-HEPTANE
CAS:89889-25-8
Formula: C7H6F9I
KIN02718772
1,1,1,2,2,3,3,4,4-NONAFLUORO-7,7-DIISOCYANATOHEPTANE
CAS:306976-22-7
Formula: C9H5F9N2O2
KIN03482980
1,1,1,2,2,3,3,4,4-NONAFLUORO-BUTANE
CAS:375-18-8
Formula: C4F7IO
KIN01012622
1,1,1,2,2,3,3,4,4-NONAFLUOROPENTANE
CAS:141993-31-9
Formula: C5H3F9
KIN03263046
1,1,1,2,2,3,3,4,4-NONAMETHYL-TETRASILANE
CAS:56240-58-5
Formula: C9H28Si4
KIN02379580
1,1,1,2,2,3,3,4,5,5,5-UNDECAFLUORO-4-(TRIFLUOROMETHYL)PENTANE
CAS:355-08-8
Formula: [C5H3F7
KIN01011680
1,1,1,2,2,3,3,4,5,5,6,6,6-TRIDECAFLUORO-4-(TRIFLUOROMETHYL)-HEXANE
CAS:558-82-7
KIN01019815
1,1,1,2,2,3,3,4,5,5,6,6,6-TRIDECAFLUORO-HEXANE
CAS:1998-78-3
Formula: C5H11F2NO2S
KIN01060537
1,1,1,2,2,3,3,4,5,5-DECAFLUOROPENTANE
CAS:150999-42-1
Formula: C5H2F10
KIN03297884
1,1,1,2,2,3,3,4,5,6,6,7,7,8,8,8-HEXADECAFLUORO-4-OCTENE
CAS:35844-81-6
Formula: C8F16
KIN02226766
1,1,1,2,2,3,3,4- OCTAFLUOROPENTANE
CAS:72923-37-6
Formula: C5H4F8
KIN02594724
1,1,1,2,2,3,3,4-OCTAFLUORO-BUTANE
CAS:662-42-0
Formula: C3ClF7S
KIN01024851
1,1,1,2,2,3,3,4-OCTAFLUORO-HEXANE
CAS:154275-19-1
Formula: C6H6F8
KIN03308156
1,1,1,2,2,3,3,4-OCTAFLUOROOCTANE
CAS:126038-55-9
Formula: C8H10F8
KIN03191161
1,1,1,2,2,3,3,5,5,5-DECAFLUORO-4-METHYL-4-(TRIFLUOROMETHYL)PENTANE
CAS:100645-99-6
Formula: C7H3F13
KIN03033667
1,1,1,2,2,3,3,5,5,6,6,7,7,7-TETRADECAFLUORO-HEPT-4-ONE
CAS:378-94-9
Formula: C4F9NO
KIN01012780
1,1,1,2,2,3,3,6,6,7,7,8,8,8-TETRADECAFLUORO-4-OCTENE
CAS:3910-88-1
Formula: C18H30O2
KIN01097825
1,1,1,2,2,3,3-HEPTABROMO-TRISILANE
CAS:192331-09-2
Formula: Br7HSi3
KIN03393882
1,1,1,2,2,3,3-HEPTACHLORO-3-FLUOROPROPANE
CAS:422-79-7
Formula: C3Br2ClF5
KIN01014101
1,1,1,2,2,3,3-HEPTACHLORO-BUTANE
CAS:83682-70-6
Formula: C4H3Cl7
KIN02662654
1,1,1,2,2,3,3-HEPTACHLORO-TRISILANE
CAS:56240-63-2
Formula: Cl7HSi3
KIN02379583
1,1,1,2,2,3,3-HEPTACHLORODECANE
CAS:32534-78-4
Formula: C10H15Cl7
KIN02197875
Heptachloro-decane
1,1,1,2,2,3,3-HEPTACHLOROPROPANE
CAS:594-90-1
Formula: C3Cl8
KIN01021380
1,1,1,2,2,3,3-HEPTADEUTERIO-HEXANE
CAS:32740-31-1
Formula: C6H7D7
KIN02199521
1,1,1,2,2,3,3-HEPTAFLUORO-3-(1,2,2,2-TETRAFLUORO-ETHOXY)-PROPANE
CAS:3330-16-3
Formula: C11HF23O3
KIN01086901
1,1,1,2,2,3,3-HEPTAFLUORO-3-(2,2,3,3-TETRAFLUOROPROPOXY)-PROPANE
CAS:176310-29-5
Formula: C6H3F11O
KIN03360559
1,1,1,2,2,3,3-HEPTAFLUORO-3-(FLUOROMETHOXY)-PROPANE
CAS:184899-81-8
Formula: C4H2F8O
KIN03377830
1,1,1,2,2,3,3-HEPTAFLUORO-3-(TRIFLUOROMETHOXY)-PROPANE
CAS:59426-77-6
Formula: C4F10O
KIN02431422
1,1,1,2,2,3,3-HEPTAFLUORO-3-{[1,1,1,2,3,3-HEXAFLUORO-3-(1,2,2,2-TETRAFLUORO-ETHOXY)-PROPAN-2-YL]OXY}PROPANE
CAS:34252-81-8
Formula: C8HF17O2
KIN02212501
1,1,1,2,2,3,3-HEPTAFLUORO-3-IODO-PROPANE
CAS:754-36-9
KIN01028226
1,1,1,2,2,3,3-HEPTAFLUORO-3-ISOCYANATO-PROPANE
CAS:424-64-6
Formula: C7H5F7O2
KIN01014151
1,1,1,2,2,3,3-HEPTAFLUORO-3-METHOXY-PROPANE
CAS:375-04-2
Formula: C8H11F7N2O2
KIN01012614
1,1,1,2,2,3,3-HEPTAFLUORO-4,4-BIS(TRIFLUOROMETHYL)-HEXANE
CAS:100646-00-2
Formula: C8H5F13
KIN03033668
1,1,1,2,2,3,3-HEPTAFLUORO-4-CHLORO-BUTANE
CAS:374-98-1
Formula: C4H2F7I
KIN01012608
1,1,1,2,2,3,3-HEPTAFLUORO-4-IODO-BUTANE
CAS:374-99-2
Formula: C4H4F7N
KIN01012609
1,1,1,2,2,3,3-HEPTAFLUORO-4-ISOCYANATOBUTANE
CAS:377-07-1
Formula: C4H5F3N2O3
KIN01012712
1,1,1,2,2,3,3-HEPTAFLUORO-4-METHOXY-BUTANE
CAS:377-00-4
Formula: C5H2F7NO
KIN01012711
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-(4E)-4-UNDECENE
CAS:109574-86-9
Formula: C11H14F7I
KIN03096209
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-HEXANE
CAS:261503-73-5
Formula: C6H6F7I
KIN03458853
1,1,1,2,2,3,3-HEPTAFLUORO-5-IODO-NONANE
CAS:755-50-0
Formula: C6F14N2
KIN01028255
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-4-(NITRO-METHYL)PENTANE
CAS:355-93-1
Formula: C9H8F8O2
KIN01011727
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-HEPT-4-OL
CAS:355-91-9
Formula: C6H5F7N2O4
KIN01011726
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITRO-PENTANE
CAS:356-06-9
Formula: C6H5F7O2
KIN01011735
1,1,1,2,2,3,3-HEPTAFLUORO-5-NITROHEPTANE
CAS:356-69-4
Formula: C5H3F7O3
KIN01011768
1,1,1,2,2,3,3-HEPTAFLUORO-8-METHYLNONANE-4,6-DIONE
CAS:6304-29-6
Formula: C10H13NO
KIN01156755
1,1,1,2,2,3,3-HEPTAFLUORO-BUTANE
CAS:662-01-1
Formula: C3Cl2F6
KIN01024839
1,1,1,2,2,3,3-HEPTAFLUORO-HEPT-4-OL
CAS:425-22-9
Formula: C7H7F7O
KIN01014161
1,1,1,2,2,3,3-HEPTAFLUORO-HEPT-4-ONE
CAS:425-24-1
KIN01014162
1,1,1,2,2,3,3-HEPTAFLUORO-HEPTA-4,6-DIENE
CAS:261503-72-4
KIN03458852
1,1,1,2,2,3,3-HEPTAFLUORO-HEPTANE
CAS:152076-35-2
Formula: C7H9F7
KIN03301121
1,1,1,2,2,3,3-HEPTAFLUOROPENTANE
CAS:754-73-4
Formula: C4HF8I
KIN01028237
1,1,1,2,2,3,3-HEPTAFLUOROPROPANE
CAS:2252-87-1
Formula: C3H2Cl2F2
KIN01065828
1,1,1,2,2,3,3-HEPTAMETHYL-3-(NAPHTHALEN-1-YL)-TRISILANE
CAS:38446-42-3
Formula: C17H28Si3
KIN02248065
1,1,1,2,2,3,3-HEPTAMETHYL-3-PHENYL-TRISILANE
CAS:780-59-6
Formula: C11H14N2O3
KIN01029519
1,1,1,2,2,3,3-HEPTAMETHYL-TRISILANE
CAS:812-30-6
Formula: C3Cl3F5
KIN01030266
1,1,1,2,2,3,4,4,4-NONAFLUORO-3-(TRIFLUOROMETHYL)BUTANE
CAS:595-00-6
KIN01021382
1,1,1,2,2,3,4,4,4-NONAFLUORO-BUTANE
CAS:680-19-3
Formula: C3F9N
KIN01025360
1,1,1,2,2,3,4,4,5,5,5-UNDECAFLUORO-3-(TRIFLUOROMETHYL)PENTANE
CAS:865-76-9
Formula: C10H30Si4
KIN01032050
1,1,1,2,2,3,4,4,5,5,5-UNDECAFLUOROPENTANE
CAS:95576-22-0
Formula: C5HF11
KIN02792885
1,1,1,2,2,3,4,4-OCTAFLUORO-BUTANE
CAS:119450-58-7
Formula: C4H2F8
KIN03159109
1,1,1,2,2,3,4,5,5,5-DECAFLUORO-3-[1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL]-4-(TRIFLUOROMETHYL)PENTANE
CAS:50285-18-2
Formula: C9F20
KIN02291354
1,1,1,2,2,3,4,5,5,6,6,6-DODECAFLUORO-3,4-BIS(TRIFLUOROMETHYL)-HEXANE
CAS:1735-50-8
KIN01054539
1,1,1,2,2,3,4,5,5,6,6,7,7,7-TETRADECAFLUORO-3-HEPTENE
CAS:71039-88-8
Formula: C7F14
KIN02581445
1,1,1,2,2,3,4,5,5,6,6,7,7,8,8,8-HEXADECAFLUORO-3-OCTENE
CAS:35844-82-7
Formula: C8F16
KIN02226767
1,1,1,2,2,3,4,5,6,7,7,8,8,8-TETRADECAFLUOROOCTA-3,5-DIENE
CAS:105311-63-5
Formula: C8F14
KIN03067367
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-(2,2,3,3-TETRAFLUOROPROPOXY)-4-(TRIFLUOROMETHYL)PENTANE
CAS:106054-52-8
Formula: C9H4F16O
KIN03073414
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-IODO-PENTANE
CAS:755-48-6
Formula: C9H12F7I
KIN01028254
1,1,1,2,2,3,5,5,5-NONAFLUORO-3-ISOPROPOXY-4-(TRIFLUOROMETHYL)PENTANE
CAS:106054-38-0
Formula: C9H8F12O
KIN03073408
1,1,1,2,2,3- HEXAFLUORO-BUTANE
CAS:74469-62-8
Formula: C4H4F6
KIN02606096
1,1,1,2,2,3-HEXACHLORO-3,3-DIFLUOROPROPANE
CAS:661-97-2
Formula: C3Cl2F6
KIN01024836
1,1,1,2,2,3-HEXACHLORO-3-FLUOROPROPANE
CAS:422-30-0
Formula: C3HCl5F2
KIN01014074
1,1,1,2,2,3-HEXACHLORO-HEXANE
CAS:26264-54-0
Formula: C6H8Cl6
KIN02146875
1,1,1,2,2,3-HEXACHLORODECANE
CAS:175801-38-4
Formula: C10H16Cl6
KIN03359721
1,1,1,2,2,3-HEXAFLUORO-3-(TRIFLUOROMETHYL)-5-IODO-HEXANE
CAS:239464-00-7
Formula: C7H6F9I
KIN03445510
1,1,1,2,2,3-HEXAFLUORO-3-(TRIFLUOROMETHYL)-5-IODO-NONANE
CAS:239464-01-8
Formula: C10H12F9I
KIN03445511
1,1,1,2,2,3-HEXAFLUORODECAN-4-ONE
CAS:113487-29-9
Formula: C10H14F6O
KIN03123416
1,1,1,2,2,3-HEXAFLUOROPROPANE
CAS:677-57-6
KIN01025286
1,1,1,2,2,4,4,4-OCTAFLUORO-3,3-BIS(TRIFLUOROMETHYL)BUTANE
CAS:112156-74-8
Formula: C6F14
KIN03113048
1,1,1,2,2,4,4,4-OCTAFLUORO-3-(TRIFLUOROMETHYL)BUTANE
CAS:71127-00-9
Formula: C5HF11
KIN02582130
1,1,1,2,2,4,4,4-OCTAFLUORO-3-METHYLBUTANE
CAS:154381-64-3
Formula: C5H4F8
KIN03308564
1,1,1,2,2,4,4,4-OCTAFLUORO-BUTANE
CAS:2924-30-3
Formula: C6H2Br2FNO3
KIN01078980
1,1,1,2,2,4,4,5,5,5-DECACHLOROPENTANE
CAS:54976-89-5
Formula: C5H2Cl10
KIN02358619
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-(PENTAFLUORO-ETHYL)PENTAN-3-OL
CAS:6189-02-2
Formula: C3HClF4O2
KIN01152000
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-HYDROXY-3-PHENYLPENTANE
CAS:2823-52-1
Formula: C11H13FN2O6
KIN01076795
1,1,1,2,2,4,4,5,5,5-DECAFLUORO-3-METHYL-3-(TRIFLUOROMETHYL)PENTANE
CAS:116089-50-0
Formula: C7H3F13
KIN03140922
1,1,1,2,2,4,4,5,5,7,7,8,8,10,10,10-HEXADECACHLORODECANE
CAS:190003-05-5
Formula: C10H6Cl16
KIN03390287
1,1,1,2,2,4,4,5,5,7,7,8,8,10,10,11,11,13,13-NONADECAFLUORO-3,6,9,12-TETRAOXATETRADECAN-14-OL
CAS:14548-76-6
Formula: C10H3F19O5
KIN02033153
1,1,1,2,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,17,18,18,18-TETRACOSAFLUORO-5,8,11,14-TETRAKIS(TRIFLUOROMETHYL)-3,6,9,12,15-PENTAOXAOCTADECANE
CAS:31054-85-0
Formula: C17F36O5
KIN02186767
1,1,1,2,2,4,4,5,7,7,8,10,10,11,13,13,14,16,16,17,19,19,20,20,21,21,21-HEPTACOSAFLUORO-5,8,11,14,17-PENTAKIS(TRIFLUOROMETHYL)-3,6,9,12,15,18-HEXAOXAHENEICOSANE
CAS:59884-34-3
Formula: C20F42O6
KIN02438855
1,1,1,2,2,4,4-HEPTAFLUORO-4-IODO-BUTANE
CAS:1810-13-5
Formula: C4H5F4N.ClH
KIN01056352
1,1,1,2,2,4,4-HEPTAFLUORO-BUTANE
CAS:161791-36-2
Formula: C4H3F7
KIN03329842
1,1,1,2,2,4,5,5,5-NONAFLUORO-4-(TRIFLUOROMETHYL)PENTAN-3-ONE
CAS:756-21-8
KIN01028270
1,1,1,2,2,4,5,5-OCTAFLUOROPENTAN-3-ONE
CAS:370862-44-5
Formula: C5H2F8O
KIN03542376
1,1,1,2,2,4-HEXAFLUORO-BUTANE
CAS:161791-33-9
Formula: [C4H4F6
KIN03329841
1,1,1,2,2,5,5,5-OCTAFLUORO-3-PENTANONE
CAS:61637-92-1
Formula: C5H2F8O
KIN02459130
1,1,1,2,2,5,5,5-OCTAFLUORO-4-(TRIFLUOROMETHYL)PENTANE
CAS:90278-01-6
Formula: C6H3F11
KIN02725137
1,1,1,2,2,5,5,6,6,6-DECAFLUORO-HEXANE
CAS:95576-25-3
Formula: C6H4F10
KIN02792887
1,1,1,2,2,5,5,6,6,9,9,10,10,10-TETRADECAFLUORODEC-3-ENE
CAS:35208-08-3
Formula: C10H6F14
KIN02220860
1,1,1,2,2,5,6,6,9,9,10,10,10-TRIDECAFLUORODEC-4-ENE
CAS:40723-77-1
Formula: C10H7F13
KIN02265206
1,1,1,2,2,5-HEXAFLUOROPENTAN-3-ONE
CAS:370862-40-1
Formula: C5H4F6O
KIN03542375
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-4-HEPTYN-3-ONE
CAS:96102-07-7
Formula: C7F10O
KIN02797834
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-5-HYDROXY-5-METHYL-HEPT-3-ONE
CAS:6742-94-5
KIN01169617
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-HEPTANE
CAS:95576-26-4
Formula: C7H6F10
KIN02792888
1,1,1,2,2,6,6,7,7,7-DECAFLUORO-HEPTANE-3,5-DIONE
CAS:38007-33-9
Formula: C7H2F10O2
KIN02244496
4H,4H-Decafluoro-heptan-3,5-dione
MFCD06246840
1,1,1,2,2-PENTABROMO-3,3,3-TRIFLUOROTRISILANE
CAS:108737-35-5
Formula: Br5F3Si3
KIN03090911
1,1,1,2,2-PENTABROMOETHANE
CAS:75-96-7
Formula: CBr3CO2H
KIN01001226
1,1,1,2,2-PENTABUTYLDISTANNANE
CAS:139582-88-0
Formula: C20H46Sn2
KIN03253586
1,1,1,2,2-PENTACHLORO-2-(1,1,2,2,2-PENTACHLORO-ETHOXY)ETHANE
CAS:597-39-7
KIN01021489
1,1,1,2,2-PENTACHLORO-2-FLUORO-DISILANE
CAS:18356-60-0
Formula: Cl5FSi2
KIN02071223
1,1,1,2,2-PENTACHLORO-2-FLUORO-ETHANE
CAS:354-58-5
Formula: C2Cl3F3
KIN01011653
1,1,1,2,2-PENTACHLORO-3,3,3-TRIFLUOROPROPANE
CAS:1652-93-3
Formula: C13H21N3O
KIN01052534
1,1,1,2,2-PENTACHLORO-3,3,4,4,5,5,5-HEPTAFLUOROPENTANE
CAS:116046-22-1
Formula: C5Cl5F7
KIN03140578
1,1,1,2,2-PENTACHLORO-3-FLUOROPROPANE
CAS:134190-48-0
Formula: [C3H2Cl5F
KIN03227131
1,1,1,2,2-PENTACHLORO-DISILANE
CAS:31411-98-0
Formula: Cl5HSi2
KIN02189261
1,1,1,2,2-PENTACHLORO-ETHANE
CAS:76-02-8
Formula: C2Cl4O
KIN01001232
1,1,1,2,2-PENTACHLORODODECANE
CAS:214327-67-0
Formula: C12H21Cl5
KIN03426246
1,1,1,2,2-PENTACHLOROPROPANE
CAS:64240-29-5
Formula: C3H3Cl5
KIN02506607
1,1,1,2,2-PENTADEUTERIO-2-ETHYLTHIO-ETHANE
CAS:61260-04-6
Formula: C4H10S
KIN02453369
1,1,1,2,2-PENTADEUTERIO-2-IODO-ETHANE
CAS:6485-61-6
KIN01163363
1,1,1,2,2-PENTAETHYL-DIGERMANE
CAS:993-86-2
Formula: C6H12Cl3O4P
KIN01036107
1,1,1,2,2-PENTAFLUORO-2-(PERFLUORO-ETHOXY)ETHANE
CAS:358-23-6
Formula: C2F6O5S2
KIN01011826
1,1,1,2,2-PENTAFLUORO-2-IODO-ETHANE
CAS:354-65-4
Formula: C2F4I2
KIN01011656
1,1,1,2,2-PENTAFLUORO-2-NITRO-SOETHANE
CAS:354-73-4
Formula: C2Cl2F4S
KIN01011661
1,1,1,2,2-PENTAFLUORO-3,3-DIMETHYLBUTANE
CAS:67498-75-3
Formula: C6H9F5
KIN02554278
1,1,1,2,2-PENTAFLUORO-3,5-HEPTANEDIONE
CAS:2357-39-3
Formula: C7H8F3NO2
KIN01067645
1,1,1,2,2-PENTAFLUORO-3,5-OCTANEDIONE
CAS:2355-93-3
Formula: C8H11F3
KIN01067616
1,1,1,2,2-PENTAFLUORO-3-(1,2,2-TRIFLUORO-ETHENOXY)-PROPANE
CAS:1682-37-7
Formula: C7H5BF4N2O2+
KIN01053258
1,1,1,2,2-PENTAFLUORO-3-(FLUOROMETHOXY)-PROPANE
CAS:1515-14-6
Formula: C4H4F6O
KIN01049022
1,1,1,2,2-PENTAFLUORO-3-DECYN-5-OL
CAS:95540-92-4
Formula: C10H13F5O
KIN02792579
1,1,1,2,2-PENTAFLUORO-3-HEXENE
CAS:94099-51-1
Formula: C6H7F5
KIN02777726
1,1,1,2,2-PENTAFLUORO-3-IODO-PROPANE
CAS:354-71-2
Formula: C2Cl2F3NO
KIN01011659
1,1,1,2,2-PENTAFLUORO-3-METHYLBUTAN-3-OL
CAS:374-47-0
Formula: C4H3Cl3F4
KIN01012588
1,1,1,2,2-PENTAFLUORO-3-METHYLPENTAN-3-OL
CAS:2368-92-5
Formula: C6H10F2O2
KIN01067935
1,1,1,2,2-PENTAFLUORO-3-UNDECYN-5-OL
CAS:95540-93-5
Formula: C11H15F5O
KIN02792580
1,1,1,2,2-PENTAFLUORO-4,4-DIMETHYLPENTAN-3-OL
CAS:378-89-2
Formula: C7H2F14O
KIN01012778
1,1,1,2,2-PENTAFLUORO-4-METHYLPENTAN-3-OL
CAS:357-28-8
Formula: C6H7F5O
KIN01011789
1,1,1,2,2-PENTAFLUORO-4-METHYLPENTAN-3-ONE
CAS:357-31-3
Formula: C3H2F6O3S
KIN01011790
1,1,1,2,2-PENTAFLUORO-5-HYDROXY-3-HEXANONE
CAS:91485-47-1
Formula: C6H7F5O2
KIN02744418
1,1,1,2,2-PENTAFLUORO-5-HYDROXY-4-DECANONE
CAS:95541-10-9
Formula: C10H15F5O2
KIN02792585
1,1,1,2,2-PENTAFLUORO-6-METHYL-3,5-HEPTANEDIONE
CAS:2355-63-7
Formula: C17H17Cl2FN2
KIN01067613
1,1,1,2,2-PENTAFLUORO-7-PHENYL-HEPT-3-ONE
CAS:1071000-98-0
Formula: C13H13F5O
KIN05111375
Fkgk 11
1,1,1,2,2-PENTAFLUORO-BUTANE
CAS:141529-32-0
Formula: C4H5F5
KIN03260703
1,1,1,2,2-PENTAFLUORO-DISILANE
CAS:24628-33-9
Formula: F5HSi2
KIN02132339
1,1,1,2,2-PENTAFLUORO-ETHANE
CAS:354-34-7
Formula: C2F4O
KIN01011636
1,1,1,2,2-PENTAFLUORO-ETHANE MIXT. WITH DIFLUOROMETHANE
CAS:133023-17-3
Formula: C2 HF5 .CH2 F2
KIN03635566
1,1,1,2,2-PENTAFLUORO-HEPT-3-ONE
CAS:426-75-5
Formula: C26H18F6Si
KIN01014199
1,1,1,2,2-PENTAFLUORO-HEXAN-3-OL
CAS:357-46-0
Formula: C6H7F5O
KIN01011794
1,1,1,2,2-PENTAFLUORO-HEXAN-3-ONE
CAS:357-47-1
Formula: C5H3F5O2
KIN01011795
1,1,1,2,2-PENTAFLUORO-HEXANE
CAS:94099-50-0
Formula: C6H9F5
KIN02777725
1,1,1,2,2-PENTAFLUOROOCTAN-3-ONE
CAS:108214-46-6
Formula: C8H11F5O
KIN03087629
1,1,1,2,2-PENTAFLUOROPENTAN-3-OL
CAS:378-72-3
Formula: C5H5F5O
KIN01012770
1,1,1,2,2-PENTAFLUOROPENTAN-3-ONE
CAS:378-75-6
Formula: C4H3F5O2
KIN01012771
1,1,1,2,2-PENTAFLUOROPROPANE
CAS:1814-89-7
Formula: C3H3F5O
KIN01056458