ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

(S)-2-AMINO-3-(FUNAN-2-YL)-PROPANOIC ACID
CAS:121786-31-0
Formula: C7H9NO3
KIN03171564
(S)-2-AMINO-3-(FURAN-3-YL)-PROPANOIC ACID
CAS:129030-32-6
Formula: C7H9NO3
KIN03204058
(S)-2-AMINO-3-(HYDROXY(NITROSO)AMINO)-PROPANOIC ACID
CAS:19149-54-3
Formula: C3H7N3O4
KIN02078445
Alanopine
(S)-2-AMINO-3-(HYDROXY-PHENOXY-PHOSPHORYLOXY)-2-METHYLPROPANOIC ACID
CAS:272783-96-7
KIN03464493
(S)-2-AMINO-3-(M-TOLYL)-PROPANOL
CAS:68208-22-0
Formula: C10H15NO
KIN02561472
MFCD03412786
(S)-2-AMINO-3-(METHOXYCARBONYLAMINO)-PROPANOIC ACID
CAS:149944-98-9
Formula: [C5H10N2O4
KIN03294472
(S)-2-AMINO-3-(METHYLAMINO)-PROPANOIC ACID
CAS:15920-93-1
Formula: C4H10N2O2
KIN02045590
3-(N-Methylamino)-L-alanine
MFCD08063270
(S)-2-AMINO-3-(METHYLCARBAMOYLOXY)-PROPANOIC ACID
CAS:98069-86-4
Formula: C5H10N2O4
KIN02810434
Serine methylcarbamate
(S)-2-AMINO-3-(METHYLTHIO)-1-PROPANOL
CAS:88165-68-8
Formula: C4H11NOS
KIN02694105
(S)-2-AMINO-3-(NAPHTHALEN-1-YL)-PROPANOIC ACID
CAS:58111-94-7
Formula: C21H23N5O6
KIN02410672
alpha-(Naphthalen-1-yl)-L-alanine
MFCD00065617
(S)-2-AMINO-3-(NAPHTHALEN-2-YL)-PROPAN-1-OL
CAS:153223-09-7
KIN03304459
(S)-2-AMINO-3-(P-TOLYL)-PROPANOIC ACID
CAS:1991-88-4
Formula: C10H13NO2S
KIN01060391
(S)-2-AMINO-3-(P-TOLYL)-PROPANOL
CAS:68208-23-1
Formula: C10H15NO
KIN02561473
DL-3-p-tolyl-alaninol
MFCD03412788
(S)-2-AMINO-3-(PHENYLAMINO)-PROPANOIC ACID
CAS:145545-23-9
Formula: C9H12N2O2
KIN03279955
(S)-2-AMINO-3-(PHOSPHONOOXY)-PROPANOIC ACID
CAS:407-43-2
Formula: C5H8F3NO2
KIN01013928
(S)-2-AMINO-3-(PROPAN-2-YLTHIO)-PROPANOIC ACID
CAS:1084690-55-0
KIN05124863
(S)-2-AMINO-3-(PROPYLTHIO)-PROPANOL
CAS:65309-76-4
Formula: C6H15NOS
KIN02524650
(S)-2-AMINO-3-(PYRIMIDIN-5-YL)-PROPANOIC ACID
CAS:309296-08-0
Formula: C7H9N3O2
KIN03484468
(S)-2-AMINO-3-(SULFOOXY)-PROPANOIC ACID
CAS:626-70-0
Formula: C7H12O4
KIN01023370
(S)-2-AMINO-3-(SULFOOXY)-PROPANOIC ACID MONOPOTASSIUM SALT
CAS:17436-02-1
Formula: C3H5K2NO6S
KIN02062064
L-Serine O-sulfate potassium salt
(S)-2-AMINO-3-(THIOPHEN-2-YL)-PROPANOIC ACID
CAS:139-87-7
Formula: C6H15NO2
KIN01006118
(S)-2-AMINO-3-(THIOPHEN-3-YL)-PROPANOIC ACID
CAS:3685-52-7
Formula: C7H9NO3
KIN01093948
(S)-2-AMINO-3-(TRITYLTHIO)-PROPANAMIDE
CAS:166737-85-5
Formula: C22H22N2OS?HCl
KIN03339197
(S)-2-AMINO-3-(TRITYLTHIO)-PROPANOIC ACID
CAS:25840-82-8
Formula: C22H21NO2S
KIN02143368
D-Trityl-L-cysteine
MFCD00236948
(S)-2-AMINO-3-[(BENZYL)THIO]PROPANAMIDE
CAS:120936-86-9
KIN03167075
(S)-2-AMINO-3-[[(4-METHOXY-PHENYL)METHYL]THIO]PROPANAMIDE
CAS:58290-37-2
KIN02413344
(S)-2-AMINO-3-[5'-((S)-2-AMINO-2-CARBOXY-PROPYL)-6,2'-DIHYDROXY-BIPHENYL-3-YL]-2-METHYLPROPANOIC ACID
CAS:142056-97-1
KIN03263380
(S)-2-AMINO-3-{3-[2-(DIMETHYLAMINO)ETHYL]INDOL-5-YL}PROPAN-1-OL
CAS:139264-69-0
Formula: C15H23N3O
KIN03251575
(S)-2-AMINO-3-AZIDOPROPANOIC ACID
CAS:105661-40-3
Formula: [C3H6N4O2
KIN03070070
(S)-2-AMINO-3-BENZENEPROPANOIC ACID
CAS:63-92-3
Formula: C18H23Cl2NO
KIN01000770
(S)-2-AMINO-3-BENZENEPROPANOIC ACID BENZYL ESTER HCL
CAS:2462-33-1
KIN01070030
(S)-2-AMINO-3-BENZO[D][1,3]DIOXOL-5-YL-2-METHYLPROPANOIC ACID
CAS:42334-89-4
KIN02277661
(S)-2-AMINO-3-BUTYNOIC ACID
CAS:73537-09-4
Formula: C4H5NO2
KIN02598934
L-2-Amino-3-butynoic acid
(S)-2-AMINO-3-CHLOROPROPANOIC ACID HCL
CAS:51887-88-8
Formula: C3H6ClNO2.HCl
KIN02313081
3-Chloro-D-alanine HCl
MFCD00070398
(S)-2-AMINO-3-CYANO-2-METHYLPROPANOIC ACID
CAS:64298-92-6
Formula: C5H8N2O2
KIN02507683
3-Cyano-2-methyl-alanine
(S)-2-AMINO-3-CYANOPROPANOIC ACID
CAS:6232-20-8
Formula: C4H6N2O2
KIN01152996
(S)-2-AMINO-3-CYCLOHEXYL-1-PROPANOL
CAS:131288-67-0
Formula: C9H19NO
KIN03213687
(S)-2-AMINO-3-CYCLOHEXYLPROPANAMIDE HCL
CAS:145232-34-4
Formula: C9H18N2O
KIN03278939
(S)-2-AMINO-3-CYCLOHEXYLPROPANOIC ACID
CAS:27527-05-5
Formula: C9H17NO2
KIN02158170
L-Cyclohexyl-alanine
MFCD00153484
(S)-2-AMINO-3-CYCLOHEXYLPROPANOIC ACID HCL
CAS:25528-71-6
Formula: C9H18ClNO2
KIN02140640
beta-Cyclohexyl-L-alanine HCl
(S)-2-AMINO-3-CYCLOHEXYLPROPANOIC ACID HYDRATE
CAS:307310-72-1
Formula: C9H19NO3
KIN03483208
(S)-2-AMINO-3-DITHIOPROPANOIC ACID
CAS:5652-36-8
Formula: C20H21NO2
KIN01137904
(S)-2-AMINO-3-ETHOXY-PROPANOIC ACID HCL
CAS:4775-86-4
Formula: C5H10N2O2
KIN01114463
(S)-2-AMINO-3-ETHYL-3-PENTANOL
CAS:65226-39-3
Formula: C7H17NO
KIN02523286
(S)-2-AMINO-3-ETHYLPENTANOIC ACID
CAS:14328-49-5
Formula: C7H15NO2
KIN02030719
3-Ethyl-L-norvaline
MFCD07369329
(S)-2-AMINO-3-FLUORO-3-BUTENOIC ACID
CAS:111687-18-4
Formula: C4H6FNO2
KIN03109350
(S)-2-AMINO-3-FLUOROPROPANOIC-2-D ACID; 3-FLUORO-D-(2-2H)-ALANINE; 3-FLUORO-D-(2-2H)-ALANINE
CAS:35523-45-6
Formula: C3H8FNO2
KIN02223908
3-Fluoro-D-(2-2H)-alanine; Fludalanine
(S)-2-AMINO-3-HYDROXY-2-(4-HYDROXY-BENZYL)-PROPANOIC ACID
CAS:134309-86-7
Formula: C10H13NO4
KIN03227663
(S)-2-AMINO-3-HYDROXY-2-METHYL-3-(4-NITROPHENYL)-PROPANOIC ACID
CAS:415899-43-3
KIN03572106
(S)-2-AMINO-3-HYDROXY-N-(4-NITROPHENYL)-PROPANAMIDE
CAS:95364-30-0
Formula: C9H11N3O4
KIN02790816
(S)-2-AMINO-3-HYDROXY-N-(NAPHTHALEN-2-YL)-PROPANAMIDE
CAS:888-78-8
Formula: C14H14N2O
KIN01033034
(S)-2-AMINO-3-HYDROXY-N-METHYLPROPANAMIDE
CAS:131173-29-0
KIN03213194
(S)-2-AMINO-3-HYDROXY-N-METHYLPROPANAMIDE HCL
CAS:90762-13-3
KIN02732839
(S)-2-AMINO-3-HYDROXY-N-PENTYLPROPANAMIDE OXALATE
CAS:153758-31-7
Formula: C10H20N2O6
KIN03306297
(S)-2-AMINO-3-HYDROXY-PROPANAMIDE
CAS:6791-53-3
KIN01170386
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID
CAS:56-47-3
Formula: C23H32O4
KIN01000398
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID BENZYL ESTER PHENYLSULFONATE
CAS:3695-73-6
Formula: C5H10N2O3
KIN01094160
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID DIPHENYLMETHYL ESTER
CAS:5033-09-0
Formula: C22H21NO2
KIN01119410
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID HYDRAZIDE
CAS:6367-08-4
Formula: C16H22N2O5
KIN01160420
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID PHENYLMETHYL ESTER, TOSYLATE (SALT)
CAS:1738-82-5
Formula: C18H22N2O6S
KIN01054666
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID SULFATE
CAS:3233-46-3
Formula: C2H4O6S
KIN01084966
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID TOSYLATE
CAS:5042-78-4
KIN01119592
(S)-2-AMINO-3-HYDROXY-PROPANOIC ACID TRIMETHYLSILYL ESTER
CAS:5269-64-7
KIN01124223
(S)-2-AMINO-3-HYDROXYAMINO-PROPANOIC ACID
CAS:5854-98-8
Formula: C53H100N16O13
KIN01143542
(S)-2-AMINO-3-MERCAPTO-2,3-DIMETHYLBUTANOIC ACID
CAS:92462-81-2
Formula: C6H13NO2S
KIN02757030
3-Mercapto-3-methyl-L-isovaline
(S)-2-AMINO-3-MERCAPTO-2-METHYLPROPANOIC ACID
CAS:151062-55-4
Formula: C4H9NO2S.HCl
KIN03298043
(S)-2-AMINO-3-MERCAPTO-N-NAPHTHALEN-2-YLPROPANAMIDE
CAS:74875-68-6
Formula: C13H14N2OS
KIN02608991
(S)-2-AMINO-3-MERCAPTO-PROPANOIC ACID
CAS:921-02-8
KIN01033607
(S)-2-AMINO-3-MERCAPTO-PROPANOIC ACID HCL HYDRATE
CAS:7048-05-7
Formula: C20H19NO5
KIN01177208
(S)-2-AMINO-3-MERCAPTOPROPANOIC ACID HCL
CAS:70361-61-4
Formula: C4H10ClNO2S
KIN02577033
D-Cysteine methyl ester HCl
MFCD00672724
(S)-2-AMINO-3-METHOXY-PROPANOIC ACID
CAS:4219-99-2
Formula: C27H47NO8
KIN01103258
(S)-2-AMINO-3-METHOXY-PROPANOIC ACID HCL
CAS:336100-47-1
Formula: C4H10ClNO3
KIN03509245
(S)-2-AMINO-3-METHYL-1,1-DIPHENYLBUTANOL HCL
CAS:130432-39-2
Formula: C17H22ClNO
KIN03209901
(S)-2-AMINO-3-METHYL-1-(THIAZOL-2-YL)-1-BUTANONE
CAS:120629-87-0
KIN03165489
(S)-2-AMINO-3-METHYL-1-THIONITROSO-BUTAN-1-ONE
CAS:111013-83-3
Formula: [C5H10N2OS]
KIN03105012
(S)-2-AMINO-3-METHYL-3-BUTENOIC ACID
CAS:61376-23-6
Formula: C5H9NO2
KIN02455208
(S)-2-AMINO-3-METHYL-N-(2-METHYLPROPYL)BUTYRAMIDE
CAS:131915-18-9
Formula: C9H20N2O
KIN03216264
(S)-2-AMINO-3-METHYL-N-(2-NITROPHENYL)BUTYRAMIDE
CAS:51163-92-9
Formula: C11H15N3O3
KIN02302607
(S)-2-AMINO-3-METHYL-N-(2-PHENYLETHYL)BUTYRAMIDE
CAS:55721-76-1
Formula: C13H20N2O
KIN02371011
(S)-2-AMINO-3-METHYL-N-(NAPHTHALEN-2-YL)BUTYRAMIDE
CAS:729-25-9
Formula: C14H16N2O2
KIN01027650
(S)-2-AMINO-3-METHYL-N-1,3,4-THIADIAZOL-2-YLBUTYRAMIDE
CAS:90581-81-0
Formula: C7H12N4OS
KIN02730279
(S)-2-AMINO-3-METHYLBUTAN-1-OL
CAS:147702-15-6
Formula: [C5H13NO
KIN03287056
(S)-2-AMINO-3-METHYLBUTANE-1-THIOL HCL
CAS:118079-24-6
KIN03152472
(S)-2-AMINO-3-METHYLBUTANOIC ACID COMPOUND WITH FORMALDEHYDE
CAS:5026-74-4
Formula: C15H19NO4
KIN01119273
(S)-2-AMINO-3-METHYLBUTANOIC ACID COMPOUND WITH NAPHTHALEN-1(4H)-ONE
CAS:135529-33-8
Formula: [C15H19NO3
KIN03233257
(S)-2-AMINO-3-METHYLBUTANOIC ACID METHYL ESTER; (S)-2-AMINO-3-METHYLBUTANOIC ACID METHYL ESTER
CAS:90989-06-3
Formula: C6H13NO2
KIN02736901
L-Valine methyl ester; L-Valine methyl ester; L-Va
(S)-2-AMINO-3-METHYLBUTANOIC ACID METHYL ESTER; L-VALINE, METHYL ESTER, TOSYLATE
CAS:67436-21-9
Formula: C7H8O3S.C6H13NO2
KIN02553442
L-Valine methyl ester
(S)-2-AMINO-3-METHYLBUTANOL
CAS:2026-56-4
Formula: C3H2O2.Rb
KIN01061145
(S)-2-AMINO-3-METHYLBUTYRAMIDE
CAS:20108-78-5
Formula: C5H12N2O
KIN02088252
Valinamide
MFCD09941740
(S)-2-AMINO-3-METHYLBUTYRAMIDE HCL
CAS:3014-82-2
Formula: C5H12N2OS.ClH
KIN01080919
(S)-2-AMINO-3-OXO-3-BENZENEPROPANOIC ACID
CAS:56884-61-8
Formula: C9H9NO3
KIN02390183
beta-Oxo-phenyl-alanine
(S)-2-AMINO-3-OXO-BUTANOIC ACID
CAS:65116-81-6
Formula: C4H7NO3
KIN02521340
(S)-2-AMINO-3-PHENOXY-PROPANOIC ACID
CAS:316833-42-8
KIN03491134
(S)-2-AMINO-3-PHENYL-1-(PYRROLIDIN-1-YL)-PROPAN-1-ONE
CAS:56414-89-2
Formula: C13H18N2O
KIN02382390
MFCD00672358
(S)-2-AMINO-3-PHENYL-1-(PYRROLIDINE-1-YL)-PROPAN-1-ONE 2,2,2-TRIFLUORO-ACETATE
CAS:144646-34-4
Formula: C15H19F3N2O3
KIN03276602
(S)-2-AMINO-3-PHENYL-1-PIPERIDIN-1-YLPROPAN-1-ONE
CAS:102292-89-7
Formula: C14H20N2O
KIN03046129
(S)-2-AMINO-3-PHENYL-1-PROPANOL
CAS:3183-08-2
Formula: C6H12N2O4S
KIN01084024
(S)-2-AMINO-3-PHENYL-1-THIONITROSOPROPAN-1-ONE
CAS:73176-38-2
Formula: C9H10N2OS
KIN02596448
L-phenyl-alaninethioamide
(S)-2-AMINO-3-PHENYLBUTANOIC ACID
CAS:2643-81-4
KIN01073579
(S)-2-AMINO-3-PHENYLPROPAN-1-YLSULFONIC ACID HCL
CAS:187089-21-0
Formula: C9H13NO3S.ClH
KIN03382631
(S)-2-AMINO-3-PHENYLPROPANAMIDE
CAS:5241-59-8
Formula: C9H12N2O
KIN01123538
(S)-2-AMINO-3-PHENYLPROPANAMIDE HCL
CAS:65864-22-4
Formula: C9H12N2O
KIN02533589
L-phenyl-alaninamide HCl
MFCD00039083
(S)-2-AMINO-3-PHENYLPROPANENITRILE
CAS:73148-70-6
Formula: C9H10N2
KIN02596248
(S)-2-AMINO-3-PHENYLPROPANESULFONIC ACID
CAS:126301-32-4
Formula: C9H13NO3S
KIN03192390
(S)-2-AMINO-3-PHOSPHONOPROPANOIC ACID
CAS:128241-72-5
Formula: C3H8NO5P
KIN03200862
(S)-2-AMINO-3-SULFOPROPANOIC ACID
CAS:35554-98-4
Formula: C3H7NO5S
KIN02224215
D-Cysteic acid
(S)-2-AMINO-3-TERT-BUTOXY-N-PYRIDIN-2-YLPROPANAMIDE
CAS:166814-95-5
KIN03680424
(S)-2-AMINO-3-TERT-BUTOXY-PROPANOIC ACID
CAS:18822-58-7
Formula: C7H15NO3
KIN02075505
O-tert-Butyl-L-serine
MFCD00066088
(S)-2-AMINO-3-TRICYCLO[3.3.1.13,7]DECAN-2-METHYL-ACETIC ACID
CAS:118076-00-9
KIN03152449
(S)-2-AMINO-3-UREIDOPROPANOIC ACID
CAS:585-24-0
Formula: C7H14O3
KIN01020844
(S)-2-AMINO-4,4-BIS[(4-SULFOPHENYL)AZO]BUTANOIC ACID
CAS:92695-06-2
Formula: C16H17N5O8S2
KIN02760335
(S)-2-AMINO-4,4-DICHLORO-BUTANOIC ACID
CAS:10139-00-1
Formula: C4H7Cl2NO2
KIN02000005
Armentomycin
(S)-2-AMINO-4,4-DICYANO-BUTANOIC ACID
CAS:126433-38-3
Formula: [C6H7N3O2
KIN03193056
(S)-2-AMINO-4,4-DIFLUORO-BUTANOIC ACID
CAS:121960-22-3
Formula: C4H7F2NO2
KIN03172536
(S)-2-AMINO-4,4-DIFLUOROPENTANOIC ACID
CAS:148043-97-4
Formula: [C5H9F2NO2
KIN03288184
(S)-2-AMINO-4,4-DIMETHYL-HEXANOIC ACID
CAS:308807-04-7
Formula: [C8H17NO2
KIN03484190
(S)-2-AMINO-4,4-DIMETHYLPENTANOIC ACID
CAS:60122-72-7
Formula: C7H15NO2
KIN02441797
DL-alpha-Neopentyl-glycine; 4-Methyl-DL-leucine
(S)-2-AMINO-4-(((2S,3S,4R,5R)-5-(6-AMINO-9H-PURIN-9-YL)-3,4-DIHYDROXYTETRAHYDROFURAN-2-YL)METHYLTHIO)BUTANOIC ACID
CAS:980-09-6
Formula: C22H15NO3
KIN01035892
(S)-2-AMINO-4-(((2S,4R,5R)-5-(6-AMINO-9H-PURIN-9-YL)-4-HYDROXYTETRAHYDROFURAN-2-YL)METHYLTHIO)BUTANOIC ACID
CAS:55197-15-4
Formula: C14H20N6O4S
KIN02362262
S-3'-Deoxyadenosylhomocysteine
(S)-2-AMINO-4-((4-IODO-BENZYLOXY))-4-OXO-BUTANOIC ACID
CAS:3940-69-0
KIN01098300
(S)-2-AMINO-4-((CYCLOPENTYLMETHYL)THIO)BUTANOIC ACID
CAS:37094-73-8
KIN02236997
S-(Cyclopentylmethyl)-L-homocysteine
(S)-2-AMINO-4-((R)-2-AMINO-2-CARBOXYETHYLTHIO)BUTANOIC ACID
CAS:6899-10-1
Formula: C19H42N
KIN01172230
(S)-2-AMINO-4-((S)-2-AMINO-2-CARBOXYETHYLTHIO)BUTANOIC ACID
CAS:2867-20-1
Formula: C6H12N2O3
KIN01077662
(S)-2-AMINO-4-((S)-BUTYLSULFONIMIDOYL)BUTANOIC ACID
CAS:83730-53-4
Formula: C8H18N2O3S
KIN02662992
Buthionine sulfoximine
MFCD00067000
(S)-2-AMINO-4-((TRIFLUOROMETHYL)THIO)BUTANOIC ACID
CAS:764-53-4
KIN01028575
(S)-2-AMINO-4-(1H-INDOL-3-YL)BUTANOIC ACID
CAS:6245-93-8
Formula: C9H7NO3
KIN01153394
(S)-2-AMINO-4-(2-((2-AMINO-6-OXO-1H-PURIN-9(6H)-YL)METHOXY)ETHOXY)-4-OXO-BUTANOIC ACID
CAS:355117-36-1
Formula: C12H16N6O6
KIN03532233
(S)-2-AMINO-4-(2-AMINOPHENYL)-4-OXO-BUTANOIC ACID
CAS:119817-54-8
Formula: C10H12N2O3
KIN03160752
(S)-2-AMINO-4-(3-NITROPHENYL)-4-OXO-BUTANOIC ACID
CAS:153212-71-6
Formula: C10H10N2O5
KIN03304435
(S)-2-AMINO-4-(4-AMINO-8-(5-AMINO-3,4-DIHYDROXY-1,2,3,4,5-OXATETRAZOLIDIN-2-YL)-4,8-DIHYDRO-1H-PENTAZOLO[1,2-A]HEXAZIN-1-YLTHIO)BUTANOIC ACID
CAS:53199-57-8
Formula: C4H14N16O5S
KIN02331634
S-(3-Deazaadenosyl)homocysteine
(S)-2-AMINO-4-(4-CHLOROPHENOXY)-1-BUTANOL
CAS:147959-27-1
Formula: C10H14ClNO2
KIN03287842
(S)-2-AMINO-4-(AMINOOXY)BUTANOIC ACID
CAS:496-98-0
Formula: C6H12N2O4S
KIN01017038
(S)-2-AMINO-4-(BENZENESULFONYL)BUTANOIC ACID
CAS:113806-54-5
Formula: C10H13NO4S
KIN03126148
(S)-2-AMINO-4-(BENZO[D]THIAZOL-2-YLTHIO)BUTANOIC ACID
CAS:102818-95-1
Formula: C11H12N2O2S2
KIN03050118
(S)-2-AMINO-4-(BENZYLOXY)-4-OXO-BUTANOIC ACID
CAS:2177-65-3
KIN01064250
(S)-2-AMINO-4-(CARBOXYMETHYLTHIO)BUTANOIC ACID
CAS:7374-06-3
Formula: C8H8N2O4
KIN01185364
(S)-2-AMINO-4-(DIETHOXY-PHOSPHINYL)BUTANOIC ACID
CAS:141894-89-5
Formula: C8H18NO5P
KIN03262528
(S)-2-AMINO-4-(ETHYLAMINO)-4-THIOXO-BUTANOIC ACID
CAS:4909-77-7
Formula: C17H18O2
KIN01117042
(S)-2-AMINO-4-(ETHYLHYDROXY-PHOSPHINYL)BUTANOIC ACID
CAS:96137-66-5
Formula: C6H14NO4P
KIN02798214
(S)-2-AMINO-4-(ETHYLSULFINYL)BUTANOIC ACID
CAS:63640-45-9
Formula: C6H13NO3S
KIN02496425
(S)-2-AMINO-4-(ETHYLSULFONYL)BUTANOIC ACID
CAS:63596-32-7
Formula: C6H13NO4S
KIN02495682
(S)-2-AMINO-4-(ETHYLTHIO)BUTANOIC ACID
CAS:13073-35-3
Formula: C6H13NO2S
KIN02014358
S-Ethyl-L-homocysteine; L-Ethionine
MFCD00002626
(S)-2-AMINO-4-(FLUOROMETHYLTHIO)BUTANOIC ACID
CAS:199526-45-9
Formula: [C5H10FNO2S
KIN03406035
(S)-2-AMINO-4-(GUANIDINOOXY)BUTANOIC ACID
CAS:543-39-5
Formula: C10H18O
KIN01019157
(S)-2-AMINO-4-(GUANIDINOOXY)BUTANOIC ACID SULFATE
CAS:2219-34-3
KIN01065150
(S)-2-AMINO-4-(GUANIDINOOXY)BUTANOIC ACID SULFATE HYDRATE
CAS:206996-57-8
Formula: [C5H16N4O8S
KIN03416856
(S)-2-AMINO-4-(GUANIDINOTHIO)BUTANOIC ACID
CAS:25456-99-9
Formula: C5H12N4O2S
KIN02139986
S-[(Aminoiminomethyl)amino]-L-homocysteine
(S)-2-AMINO-4-(HYDROXY-PHENYLPHOSPHINYL)BUTANOIC ACID
CAS:96137-67-6
Formula: C10H14NO4P
KIN02798215
(S)-2-AMINO-4-(METHYLAMINO)-4-OXO-BUTANOIC ACID
CAS:7175-35-1
KIN01180619
(S)-2-AMINO-4-(METHYLSELANYL)BUTANOIC ACID
CAS:1464-43-3
Formula: C6H12N2O4Se2
KIN01047675
(S)-2-AMINO-4-(METHYLSULFINYL)BUTYRAMIDE
CAS:7536-81-4
KIN01190871
(S)-2-AMINO-4-(METHYLTHIO)-N-(4-NITROPHENYL)BUTYRAMIDE
CAS:6042-08-6
Formula: C27H38N8O6S
KIN01148109
(S)-2-AMINO-4-(METHYLTHIO)-N-(NAPHTHALEN-2-YL)BUTYRAMIDE
CAS:7424-35-3
Formula: C10H14N2O2
KIN01186633
(S)-2-AMINO-4-(METHYLTHIO)BUTANOIC ACID
CAS:63-69-4
Formula: C7H7N3O5
KIN01000762
(S)-2-AMINO-4-(N-CBZ-AMINO)BUTANOIC ACID
CAS:2130-79-2
KIN01063251
(S)-2-AMINO-4-(NITROSO-THIO)BUTANOIC ACID
CAS:139427-42-2
Formula: C4H8N2O3S
KIN03252743
(S)-2-AMINO-4-(PROPYLTHIO)BUTANOIC ACID
CAS:13073-19-3
Formula: C7H15NO2S
KIN02014351
(S)-2-AMINO-4-(S-METHYLSULFONIMIDOYL)BUTANOIC ACID
CAS:15985-39-4
Formula: C5H12N2O3S2
KIN02046368
MFCD00002621
(S)-2-AMINO-4-(SULFOTHIO)BUTANOIC ACID
CAS:28715-19-7
Formula: C4H9NO5S2
KIN02168242
(S)-2-AMINO-4-(THIOCARBOXY)BUTANOIC ACID
CAS:141817-15-4
Formula: [C5H9NO3S
KIN03262190
(S)-2-AMINO-4-(TRIFLUOROMETHYLTHIO)BUTANOIC ACID
CAS:4220-06-8
Formula: C15H21NO3
KIN01103261
(S)-2-AMINO-4-[(2-CARBOXYETHYL)-HYDROXY-PHOSPHINOYL]-2-METHYLBUTANOIC ACID
CAS:445471-93-2
KIN03588082
(S)-2-AMINO-4-[(2-FLUOROBENZYL)THIO]-1-BUTANOL
CAS:147324-71-8
KIN03285590
(S)-2-AMINO-4-[(4-CHLOROPHENYL)THIO]-1-BUTANOL
CAS:147959-26-0
Formula: C10H14ClNOS
KIN03287841
(S)-2-AMINO-4-[(4-NITROPHENYL)AMINO]BUTANOIC ACID
CAS:117799-44-7
KIN03018851
(S)-2-AMINO-4-[(BENZYL)THIO]-1-BUTANOL
CAS:147325-19-7
KIN03285595
(S)-2-AMINO-4-[(BENZYL)THIO]-BUTYRAMIDE
CAS:6687-53-2
Formula: C15H15ClN5.Cl
KIN01168618
(S)-2-AMINO-4-[(R)-2-[5-((S)-2-AMINO-2-CARBOXY-PROPYL)-2,3-DIHYDROXY-PHENYLTHIO]-1-(CARBOXYMETHYLCARBAMOYL)ETHYLCARBAMOYL]
CAS:156707-56-1
KIN03316187
(S)-2-AMINO-4-[[(2-CHLOROPHENYL)METHYL]THIO]-1-BUTANOL
CAS:147325-20-0
KIN03647522
(S)-2-AMINO-4-{2-[2-((R)-4-AMINO-4-CARBOXY-BUTANOYLAMINO)ETHYLDITHIO]-ETHYLCARBAMOYL}-BUTANOIC ACID
CAS:17669-10-2
KIN02064338
(S)-2-AMINO-4-BROMO-4-PENTENOIC ACID
CAS:151144-96-6
Formula: C5H8BrNO2
KIN03298389
(S)-2-AMINO-4-BROMO-BUTANOIC ACID
CAS:92136-58-8
Formula: C4H8BrNO2
KIN02753324
MFCD03426104
(S)-2-AMINO-4-BROMO-BUTANOIC ACID HCL
CAS:1187453-22-0
KIN05323134
(S)-2-AMINO-4-CARBOXY-BUTYRATE
CAS:239135-34-3
Formula: [C5H8NO4-
KIN03445432
(S)-2-AMINO-4-CYANOBUTANOIC ACID
CAS:6232-26-4
Formula: C13H10ClNO2.na
KIN01152999
(S)-2-AMINO-4-ETHOXY-BUTANOIC ACID
CAS:17804-70-5
Formula: C6H13NO3
KIN02065805
o-Ethyl-homoserine
(S)-2-AMINO-4-HEPTEN-6-YNOIC ACID
CAS:98531-40-9
Formula: C7H9NO2
KIN02814609
(S)-2-AMINO-4-HEXYNOIC ACID PHENYLMETHYL ESTER
CAS:98254-07-0
Formula: C13H15NO2
KIN02812198
(S)-2-AMINO-4-HYDROXY-2-METHYLBUTANOIC ACID
CAS:5493-45-8
Formula: C14H20O6
KIN01134123
(S)-2-AMINO-4-HYDROXY-BUTANOIC ACID
CAS:459-86-9
Formula: C5H12N8
KIN01015298
(S)-2-AMINO-4-HYDROXY-BUTANOIC ACID HCL
CAS:123053-31-6
Formula: [C4H9NO3
KIN03177919
(S)-2-AMINO-4-HYDROXY-BUTANOIC ACID SODIUM SALT
CAS:387356-10-7
KIN03554012
(S)-2-AMINO-4-HYDROXY-BUTANOIC ACID TOSYLATE
CAS:23809-71-4
KIN02123730
L-Homoserine tosylate
(S)-2-AMINO-4-IODO-BUTANOIC ACID
CAS:92136-59-9
Formula: C4H8INO2
KIN02753325
(S)-2-AMINO-4-MERCAPTOBUTANOIC ACID
CAS:454-29-5
Formula: C4H9NO2S
KIN01015038
(S)-2-AMINO-4-MERCAPTOBUTANOIC ACID COMPOUND WITH NITRO-US ACID
CAS:187878-81-5
Formula: C4H10N2O4S
KIN03384016
(S)-2-AMINO-4-METHOXY-4-OXO-BUTANOIC ACID
CAS:7481-57-4
KIN01188944
(S)-2-AMINO-4-METHOXY-BUTANOIC ACID
CAS:3311-11-3
KIN01086550
(S)-2-AMINO-4-METHYL-1,1-DIPHENYLPENTAN-1-OL
CAS:78603-97-1
Formula: C18H23NO
KIN02632591
(S)-2-AMINO-4-METHYL-1-((R)-2-METHYLOXIRAN-2-YL)-PENTAN-1-ONE FORMATE
CAS:1140908-93-5
KIN05189371
CFLZ-171 formate
(S)-2-AMINO-4-METHYL-1-((R)-2-METHYLOXIRAN-2-YL)PENTAN-1-ONE
CAS:247068-84-4
Formula: C9H17NO2
KIN03002894
(S)-2-AMINO-4-METHYL-1-((R)-2-METHYLOXIRAN-2-YL)PENTAN-1-ONE 2,2,2-TRIFLUORO-ACETATE
CAS:247068-85-5
Formula: C11H18F3NO4
KIN03002895
(S)-2-AMINO-4-METHYL-1-((R)-2-METHYLOXIRAN-2-YL)PENTAN-1-ONE FORMATE
CAS:1140908-93-5
KIN05189372
CFLZ-171 formate
(S)-2-AMINO-4-METHYL-1-THIONITROSO-PENTAN-1-ONE HCL
CAS:114747-12-5
Formula: [C6H13ClN2OS]
KIN03133082
(S)-2-AMINO-4-METHYL-2-(TRIFLUOROMETHYL)PENTANOIC ACID
CAS:129865-66-3
Formula: C7H12F3NO2
KIN03647521
(S)-2-AMINO-4-METHYL-4-PENTEN-1-OL
CAS:157756-15-5
Formula: C6H13NO
KIN03318863
(S)-2-AMINO-4-METHYL-N-(3-NITROPHENYL)PENTANAMIDE
CAS:63277-11-2
Formula: C12H17N3O3
KIN02489711
(S)-2-AMINO-4-METHYL-N-(4-NITROPHENYL)PENTANAMIDE
CAS:4179-13-9
KIN01102498
(S)-2-AMINO-4-METHYL-N-(4-NITROPHENYL)PENTANAMIDE MONOACETATE
CAS:58279-58-6
KIN02413172
(S)-2-AMINO-4-METHYL-N-(4-NITROPHENYL)PENTANAMIDE SULFATE
CAS:58279-57-5
KIN02413171
(S)-2-AMINO-4-METHYL-N-(BENZYL)PENTANAMIDE
CAS:80152-39-2
Formula: C13H20N2O
KIN02642168
(S)-2-AMINO-4-METHYL-N-(NAPHTHALEN-2-YL)PENTANAMIDE
CAS:732-90-1
KIN01027773
(S)-2-AMINO-4-METHYL-N-(NAPHTHALEN-2-YL)PENTANAMIDE HCL
CAS:893-39-0
Formula: C12H7Cl4N3
KIN01033155
(S)-2-AMINO-4-METHYL-N-[2-(PYRIDIN-2-YLAMINO)ETHYL]-PENTANAMIDE
CAS:114622-97-8
Formula: C13H22N4O
KIN03132146
(S)-2-AMINO-4-METHYL-N-1,2,3-THIADIAZOL-5-YLPENTANAMIDE
CAS:140186-80-7
Formula: C8H14N4OS
KIN03636233
(S)-2-AMINO-4-METHYL-N-PHENYLPENTANAMIDE
CAS:6713-88-8
KIN01169112
(S)-2-AMINO-4-METHYL-N-PHENYLPENTANETHIOAMIDE
CAS:110345-04-5
Formula: C12H18N2S
KIN03100908
(S)-2-AMINO-4-METHYLPENTAN-1-OL
CAS:7533-52-0
Formula: C37H30P2
KIN01190806
(S)-2-AMINO-4-METHYLPENTAN-1-OL HCL
CAS:17016-87-4
Formula: C6H15NO.HCl
KIN02057275
L-(-)-Leucinol HCl
MFCD00237133
(S)-2-AMINO-4-METHYLPENTAN-1-OLATE
CAS:1302-42-7
Formula: AlNaO2
KIN01045041
(S)-2-AMINO-4-METHYLPENTANAMIDE
CAS:687-57-0
KIN01025565
(S)-2-AMINO-4-METHYLPENTANAMIDE MONOACETATE
CAS:13022-39-4
KIN02013648
(S)-2-AMINO-4-METHYLPENTANAMIDE MONOHBR
CAS:108039-98-1
KIN03086455
(S)-2-AMINO-4-METHYLPENTANEHYDRAZIDE
CAS:6278-98-4
Formula: C8H10N4O2S
KIN01155004
(S)-2-AMINO-4-METHYLPENTANEHYDRAZIDE 2HCL
CAS:83918-58-5
Formula: C6H15N3O.2ClH
KIN02664234
L-Leucinohydrazide 2HCl
(S)-2-AMINO-4-METHYLPENTANETHIOIC ACID S-(BENZYL) ESTER
CAS:108490-54-6
Formula: C13H19NOS
KIN03089436
(S)-2-AMINO-4-METHYLPENTANOIC ACID
CAS:61-94-9
Formula: C8H13NO2.ClH
KIN01000697
(S)-2-AMINO-4-METHYLPENTANOIC ACID COMPOUND WITH 2-AMINO-PROPANOIC ACID
CAS:1638-61-5
Formula: C12H13ClO3
KIN01052208
(S)-2-AMINO-4-METHYLPENTANOIC ACID HCL
CAS:760-86-1
Formula: C6H11ClO2
KIN01028428
(S)-2-AMINO-4-METHYLPENTANOIC ACID METHYL ESTER
CAS:2667-02-9
Formula: C36H38N4O5
KIN01074005
(S)-2-AMINO-4-METHYLTHIO-BUTANOIC ACID TERT-BUTYL ESTER
CAS:4976-76-5
Formula: C10H21N3O3S
KIN01118338
(S)-2-AMINO-4-OXO-4-(TRITYLAMINO)BUTANOIC ACID
CAS:132388-57-9
Formula: C23H22N2O3
KIN03218604
(S)-2-AMINO-4-OXO-4-PHENYLBUTANOIC ACID HCL
CAS:6310-43-6
Formula: C10H10N2O5
KIN01157249
(S)-2-AMINO-4-OXO-HEXANEDIOIC ACID
CAS:157290-12-5
Formula: C6H9NO5
KIN03317720
(S)-2-AMINO-4-OXOPENTANOIC ACID
CAS:4439-84-3
Formula: C5H9NO4
KIN01108014
(S)-2-AMINO-4-PENTENOIC ACID ETHYL ESTER
CAS:89105-35-1
Formula: C7H13NO2
KIN02707089
(S)-2-AMINO-4-PENTENOIC ACID ETHYL ESTER HCL
CAS:117770-60-2
Formula: C7H13NO2.ClH
KIN03150678
(S)-2-AMINO-4-PENTENOIC ACID HCL
CAS:195316-72-4
Formula: C5H10ClNO2
KIN03400013
(S)-2-AMINO-4-PENTYNOIC ACID TERT-BUTYL ESTER
CAS:71460-04-3
Formula: C9H15NO2
KIN02584439
(S)-2-AMINO-4-PHENYL-3-BUTENOIC ACID
CAS:27038-07-9
Formula: C10H11NO2
KIN02153357
(S)-2-AMINO-4-PROPOXY-BUTANOIC ACID
CAS:18312-28-2
Formula: C7H15NO3
KIN02070830
o-Propyl-L-homoserine
(S)-2-AMINO-4-TERT-BUTOXY-4-OXO-BUTANOIC ACID
CAS:3057-78-1
KIN01081678
(S)-2-AMINO-4-YLSULFOBUTANOIC ACID
CAS:1001-14-5
KIN01036376
(S)-2-AMINO-5-(((R)-1-((CARBOXYMETHYL)AMINO)-3-((DIMETHYLARSINO)THIO)-1-OXO-PROPAN-2-YL)AMINO)-5-OXOPENTANOIC ACID
CAS:69819-86-9
Formula: C12H22AsN3O6S
KIN02573174
Darinaparsin
MFCD17215931
(S)-2-AMINO-5-(((R)-1-((CARBOXYMETHYL)AMINO)-3-MERCAPTO-1-OXO-PROPAN-2-YL)AMINO)-5-OXOPENTANOIC ACID
CAS:70-19-9
Formula: C11H13NO3
KIN01000987
(S)-2-AMINO-5-(((R)-1-CARBOXY-2-MERCAPTOETHYL)AMINO)-5-OXOPENTANOIC ACID
CAS:686-60-2
Formula: C5H13As
KIN01025537
(S)-2-AMINO-5-(((S)-1-CARBOXY-2-(4-HYDROXY-PHENYL)ETHYL)AMINO)-5-OXOPENTANOIC ACID
CAS:7432-24-8
Formula: C14H18N2O5
KIN01186789
(S)-2-AMINO-5-(((S)-1-CARBOXY-3-METHYLBUTYL)AMINO)-5-OXOPENTANOIC ACID
CAS:2566-44-1
Formula: C5H10O
KIN01072100
(S)-2-AMINO-5-(((S)-1-CARBOXYETHYL)(PHENYL)AMINO)-5-OXOPENTANOIC ACID
CAS:7432-25-9
Formula: C17H16N2O
KIN01186790
(S)-2-AMINO-5-((2-CHLOROBENZYLOXY)CARBONYLAMINO)PENTANOIC ACID
CAS:118553-99-4
Formula: C13H17N2O4Cl
KIN03154819
(S)-2-AMINO-5-((4-NITROPHENYL)AMINO)-5-OXOPENTANOIC ACID
CAS:7300-80-3
Formula: C31H64O10
KIN01183877
(S)-2-AMINO-5-((CARBOXYMETHYL)AMINO)-5-OXOPENTANOIC ACID
CAS:1948-31-8
Formula: C6H12N2O3
KIN01059490
(S)-2-AMINO-5-((R)-1-CARBOXY-2-(METHYLSELANYL)ETHYLAMINO)-5-OXOPENTANOIC ACID
CAS:26046-89-9
Formula: C9H16N2O5Se
KIN02145022
L-gamma-Glutamyl-3-(methylseleno)-L-alanine
(S)-2-AMINO-5-((R)-2-AMINO-3-((2-((BIS(BIS(2-CHLORO-ETHYL)AMINO)PHOSPHORYLOXY))ETHYL)SULFONYL)-N-((R)-CARBOXY(PHENYL)METHYL)-PROPANAMIDO)-5-OXO-PENTANOIC ACID HCL
CAS:439943-59-6
Formula: C26H41Cl5N5O10PS
KIN03003396
(S)-2-AMINO-5-((R)-3-(((R)-2-((S)-4-AMINO-4-CARBOXY-BUTANAMIDO)-3-((CARBOXYMETHYL)(S)AMINO)-3-OXO-PROPYL)DITHIO)-1-(CARBOXYMETHYLAMINO)-1-OXO-PROPAN-2-YLAMINO)-5-OXOPENTANOIC ACID
CAS:3773-10-2
Formula: C34H34N2O8S2
KIN01095673
(S)-2-AMINO-5-((R)-3-(((R)-3-((S)-4-AMINO-4-CARBOXY-N-(CARBOXYMETHYL)BUTANAMIDO)-2-((S)-4-AMINO-4-CARBOXY-BUTANAMIDO)-3-OXO-PROPYL)DITHIO)-1-(CARBOXYMETHYLAMINO)-1-OXO-PROPAN-2-YLAMINO)-5-OXOPENTANOIC ACID
CAS:105644-04-0
Formula: [C25H39N7O15S2
KIN03069933
(S)-2-AMINO-5-((S)-((2S,3R)-2-AMINO-3-HYDROXY-BUTANAMIDO)(CARBOXY)METHYLTHIO)-5-OXOPENTANOIC ACID
CAS:136567-42-5
Formula: [C11H19N3O7S]
KIN03237515
(S)-2-AMINO-5-([1,3]DIOXOLAN-2-YL)PENTANOIC ACID
CAS:215054-80-1
Formula: C8H15NO4
KIN03427430
(S)-2-AMINO-5-(2-CHLORO-ACETAMIDO)PENTANOIC ACID
CAS:20584-81-0
Formula: C7H13ClN2O3
KIN02092181
N-delta-Chloro-acetyl-L-ornithine
(S)-2-AMINO-5-(2-IODO-ACETAMIDO)PENTANOIC ACID
CAS:35748-65-3
Formula: C7H13IN2O3
KIN02226019
N5-(2-Iodo-acetyl)-L-ornithine
MFCD00278817
(S)-2-AMINO-5-(3,5-DIMETHYLPHENYLAMINO)-2-METHYLPENTANOIC ACID
CAS:59597-63-6
KIN02433911
(S)-2-AMINO-5-(3-NITRO-GUANIDINO)PENTANOIC ACID
CAS:2149-71-5
Formula: C10H12N4O4
KIN01063646
(S)-2-AMINO-5-(3-PROPYLGUANIDINO)PENTANOIC ACID
CAS:137361-05-8
Formula: C18H40N8O4
KIN03241133
(S)-2-AMINO-5-(3-TOSYLGUANIDINO)PENTANOIC ACID
CAS:4353-36-0
Formula: C4H8O3
KIN01105701
(S)-2-AMINO-5-(4-AMINOBUTYLAMINO)-5-OXOPENTANOIC ACID
CAS:58316-51-1
Formula: C9H19N3O3
KIN02413668
(S)-2-AMINO-5-(AMINO(METHYLTHIO)METHYLENEAMINO)PENTANOIC ACID 2HCL
CAS:209589-59-3
Formula: [C7H17Cl2N3O2S
KIN03419993
(S)-2-AMINO-5-(AMINO(METHYLTHIO)METHYLENEAMINO)PENTANOIC ACID COMPOUND WITH ACETIC ACID
CAS:174063-92-4
Formula: [C9H19N3O4S
KIN03354880
(S)-2-AMINO-5-(BENZYLOXY)-5-OXOPENTANOIC ACID
CAS:1676-74-0
Formula: C12H10N2O3
KIN01053087
(S)-2-AMINO-5-(DIETHYLAMINO)PENTAN-1-OL
CAS:77529-85-2
Formula: C9H22N2O
KIN02626222
(S)-2-AMINO-5-(ETHYLAMINO)-5-OXOPENTANOIC ACID
CAS:3081-62-7
Formula: C6H12N2O3
KIN01082077
(S)-2-AMINO-5-(METHYLAMINOOXY)PENTANOIC ACID
CAS:183994-92-5
Formula: [C6H14N2O3
KIN03375964
(S)-2-AMINO-5-(N-CBZ-AMINO)PENTANOIC ACID
CAS:3304-54-9
KIN01086404
(S)-2-AMINO-5-(TERT-BUTOXY)-5-OXO-PENTANOIC ACID
CAS:2419-59-2
Formula: C6H15N.HCl
KIN01069077
(S)-2-AMINO-5-[(AMINOCARBONYL)AMINO]-N-(4-METHYL-2-OXO-2H-1-BENZOPYRAN-7-YL)-PENTANAMIDE HBR
CAS:123314-39-6
Formula: C16H20N4O4.HBr
KIN03179007
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-(2-METHYLPHENYL)PENTANAMIDE HCL
CAS:126707-75-3
Formula: C13H21N5O.ClH
KIN03194207
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-(4-METHOXY-PHENYL)PENTANAMIDE HCL
CAS:126707-74-2
Formula: C13H21N5O2.ClH
KIN03194206
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-(4-METHYL-2-OXO-2H-1-BENZOPYRAN-7-YL)-PENTANAMIDE 2HCL
CAS:113712-08-6
Formula: C16H21N5O3.2ClH
KIN03125445
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-(4-NITROPHENYL)PENTANAMIDE DIHF
CAS:140845-10-9
Formula: C12H18N6O3.2FH
KIN03257391
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-(4-NITROPHENYL)PENTANAMIDE HBR
CAS:113277-28-4
Formula: C12H18N6O3.xBrH
KIN03121631
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-[2-(1-METHYLETHYL)PHENYL]-PENTANAMIDE HCL
CAS:126707-76-4
Formula: C15H25N5O.ClH
KIN03194208
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-[2-(BENZYL)PHENYL]-PENTANAMIDE HCL
CAS:126707-77-5
Formula: C19H25N5O.ClH
KIN03194209
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-[4-MORPHOLIN-4-YLPHENYL]-PENTANAMIDE 2HCL
CAS:111544-38-8
Formula: C16H26N6O2.2ClH
KIN03108531
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-N-PHENYLPENTANAMIDE HCL
CAS:126707-73-1
Formula: C12H19N5O.ClH
KIN03194205
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]-PENTANAMIDE
CAS:104639-61-4
KIN03680423
(S)-2-AMINO-5-[(AMINOIMINOMETHYL)AMINO]PENTANOIC ACID
CAS:74-83-9
Formula: CH3Br
KIN01001128
(S)-2-AMINO-5-[[IMINO[[(4-METHYLPHENYL)SULFONYL]AMINO]METHYL]AMINO]-PENTANAMIDE
CAS:2407-82-1
Formula: C17H24N2
KIN01068846
(S)-2-AMINO-5-AZIDOPENTANOIC ACID
CAS:156463-09-1
Formula: [C5H10N4O2
KIN03315535
(S)-2-AMINO-5-BORONOPENTANOIC ACID
CAS:212839-30-0
Formula: [C5H12BNO4
KIN03424431
(S)-2-AMINO-5-CHLORO-ALPHA-PHENYLBENZENEMETHANOL
CAS:127854-40-4
Formula: C13H12ClNO
KIN03199210
(S)-2-AMINO-5-ETHOXY-5-OXOPENTANOIC ACID
CAS:1119-34-2
Formula: C6H14N4O2.ClH
KIN01040087
(S)-2-AMINO-5-GUANIDINO-2-METHYLPENTANOIC ACID
CAS:59574-26-4
Formula: C7H16N4O2
KIN02433521
2-Methyl-L-arginine
(S)-2-AMINO-5-GUANIDINO-N-((S)-1-OXO-3-PHENYL-1-(PHENYLAMINO)PROPAN-2-YL)PENTANAMIDE
CAS:148504-96-5
Formula: C21H28N6O2
KIN03289537
(S)-2-AMINO-5-GUANIDINO-N-(NAPHTHALEN-2-YL)PENTANAMIDE
CAS:7182-77-6
Formula: C6H10O7.Na
KIN01180794
(S)-2-AMINO-5-GUANIDINO-N-(NAPHTHALEN-2-YL)PENTANAMIDE HCL
CAS:18905-73-2
Formula: C16H22ClN5O
KIN02076133
L-Arginine-beta-naphthylamide HCl
MFCD00051283
(S)-2-AMINO-5-GUANIDINOPENTANAMIDE
CAS:16709-23-2
Formula: C6H15N5O
KIN02054108
Argininamide
(S)-2-AMINO-5-GUANIDINOPENTANOIC ACID BUTYRATE; L-ARGININE, BUTYRATE (3:4); L-ARGININE, BUTYRATE (3:4)
CAS:80407-72-3
Formula: C6H14N4O2.4/3C4H8O2
KIN02643880
Arginine butyrate; HQK-1004; Butanoic acid compd.
(S)-2-AMINO-5-GUANIDINOPENTANOIC ACID COMPOUND WITH 2-ACETOXY-BENZOIC ACID
CAS:37466-21-0
Formula: C15H22N4O6
KIN02239566
L-Arginine acetylsalicylate
(S)-2-AMINO-5-HEXENOIC ACID PHENYLMETHYL ESTERTOSYLATE
CAS:142055-64-9
Formula: C13H17NO2.C7H8O3S
KIN03647520
(S)-2-AMINO-5-METHOXY-5-OXOPENTANOIC ACID
CAS:1499-56-5
Formula: C6H11NO3
KIN01048599
(S)-2-AMINO-5-METHOXY-5-OXOPENTANOIC ACID HCL
CAS:3077-57-4
Formula: C12H21N2O5PS
KIN01081994
(S)-2-AMINO-5-METHYL-1-HEXANOL
CAS:76693-81-7
Formula: C7H17NO
KIN02620964
(S)-2-AMINO-5-METHYL-4-HEXEN-1-OL
CAS:93842-22-9
Formula: C7H15NO
KIN02774368
(S)-2-AMINO-5-METHYL-HEXANOIC ACID
CAS:31872-98-7
Formula: C7H15NO2
KIN02192708
5-methyl-L-norleucine
MFCD03788077
(S)-2-AMINO-5-OXO-1-PYRROLIDINEACETIC ACID
CAS:151062-33-8
Formula: [C6H10N2O3
KIN03298040
(S)-2-AMINO-5-OXO-5-((2R,3S,4R,5R)-3,4,5,6-TETRAHYDROXY-1-OXOHEXAN-2-YLOXY)PENTANOIC ACID
CAS:113114-16-2
Formula: [C11H19NO9
KIN03120379
(S)-2-AMINO-5-OXO-5-(TRITYLAMINO)PENTANOIC ACID
CAS:102747-84-2
Formula: C24H24N2O3
KIN03049737
(S)-2-AMINO-5-OXOPENTANOIC ACID
CAS:2886-92-2
KIN01078066
(S)-2-AMINO-5-PHENYLPENT-4-ENOIC ACID
CAS:267650-37-3
Formula: C11H13NO2
KIN03462864
(S)-2-AMINO-5-PHOSPHONOPENTANOIC ACID
CAS:79055-67-7
Formula: C5H12NO5P
KIN02635350
L-AP5; L-(+)-2-Amino-5-phosphonovaleric acid
MFCD00078840
(S)-2-AMINO-5-THIOUREIDOPENTANOIC ACID
CAS:156719-37-8
Formula: C6H13N3O2S
KIN03316214
(S)-2-AMINO-5-THIOUREIDOPENTANOIC ACID 2HCL
CAS:212051-53-1
Formula: [C6H15Cl2N3O2S
KIN03423450
(S)-2-AMINO-5-UREIDOPENTANOIC ACID
CAS:372-77-0
Formula: C6H8F2O4
KIN01012507
(S)-2-AMINO-6,6-DIMETHYL-HEPTANOIC ACID
CAS:142927-21-7
Formula: C9H19NO2
KIN03267341
(S)-2-AMINO-6-((((4-NITRO-BENZYLOXY))-YLCARBONYL)AMINO)-HEXANOIC ACID
CAS:3557-92-4
Formula: C23H20N2O
KIN01091485
(S)-2-AMINO-6-((2,4-DINITROPHENYL)AMINO)-HEXANOIC ACID
CAS:1094-77-5
Formula: C20H18NO.Br
KIN01039507
(S)-2-AMINO-6-((2-(FURAN-2-YL)-2-OXOETHYL)AMINO)-HEXANOIC ACID 2HCL
CAS:19746-33-9
Formula: C12H20Cl2N2O4
KIN02084099
Furosine 2HCl; N6-(2-Furoylmethyl)-L-lysine 2HCl
MFCD00273691
(S)-2-AMINO-6-((E)-4-AMINO-1-((2R,3R,4S,5R)-3,4-DIHYDROXY-5-(HYDROXYMETHYL)-TETRAHYDROFURAN-2-YL)-PYRIMIDIN-2(1H)-YLIDENEAMINO)-HEXANOIC ACID
CAS:144796-96-3
Formula: C15H25N5O6
KIN03277285
(S)-2-AMINO-6-((N-CBZ-AMINO))-1-HEXANOL
CAS:101250-90-2
Formula: C14H22N2O3
KIN03037936
(S)-2-AMINO-6-(2,2,2-TRIFLUORO-ACETAMIDO)-HEXANOIC ACID
CAS:10009-20-8
Formula: C8H13F3N2O3
KIN02000612
N6-Trifluoro-acetyl-L-lysine
MFCD00037223
(S)-2-AMINO-6-(2,2-DICHLORO-ACETAMIDO)-HEXANOIC ACID
CAS:92145-83-0
Formula: C8H14Cl2N2O3
KIN02753437
N6-(Dichloro-acetyl)-L-lysine
(S)-2-AMINO-6-(2-HYDROXY-PROPANOYL)-7,8-DIHYDROPTERIDIN-4(1H)-ONE
CAS:17094-01-8
Formula: C9H11N5O3
KIN02058127
Sepiapterin; Sepiapterine
MFCD00210214
(S)-2-AMINO-6-(3-(2-HYDROXYETHYL)UREIDO)-HEXANOIC ACID
CAS:78407-17-7
Formula: C9H19N3O4
KIN02631370
N6-[[(2-Hydroxyethyl)amino]carbonyl]-L-lysine
(S)-2-AMINO-6-(4-METHYLBENZENESULFONYLAMINO)-HEXANOIC ACID
CAS:2130-77-0
Formula: C12H16N2O4
KIN01063250
(S)-2-AMINO-6-(5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANAMIDO)-HEXANOIC ACID
CAS:576-22-7
Formula: C8H9Br
KIN01020470
(S)-2-AMINO-6-(5-(DIMETHYLAMINO)-NAPHTHALEN-1-YLSULFONYLAMINO)-HEXANOIC ACID
CAS:1102-18-7
Formula: C16H17Cl2N5O3
KIN01039609
(S)-2-AMINO-6-(METHYLAMINO)-HEXANOIC ACID
CAS:1188-08-5
Formula: C10H18O4
KIN01042503
(S)-2-AMINO-6-(METHYLAMINO)-HEXANOIC ACID HCL
CAS:7622-30-2
KIN01192333
(S)-2-AMINO-6-(METHYLTHIO)-HEXANOIC ACID
CAS:34022-36-1
Formula: C7H15NO2S
KIN02210651
(S)-2-AMINO-6-(N-BOC-AMINO)-HEXANOIC ACID
CAS:2418-96-4
KIN01069068
(S)-2-AMINO-6-(N-BOC-AMINO)-HEXANOIC ACID METHYL ESTER HCL
CAS:2389-49-3
Formula: C20H30N2O6
KIN01068424
(S)-2-AMINO-6-(N-CBZ-AMINO)-4-HEXYNOIC ACID
CAS:90102-84-4
Formula: C14H16N2O4
KIN02722351
(S)-2-AMINO-6-(N-CBZ-AMINO)-6-OXOHEXANOIC ACID
CAS:83793-27-5
Formula: C14H18N2O5
KIN02663404
(S)-2-AMINO-6-(N-CBZ-AMINO)-HEXANAMIDE HCL
CAS:58117-53-6
Formula: C14H22ClN3O3
KIN02410744
Nepsilon-Z-L-lysineamide HCl
MFCD00035520
(S)-2-AMINO-6-(N-CBZ-AMINO)-HEXANOIC ACID
CAS:1155-65-3
Formula: C18H34N2.2ClH
KIN01041836
(S)-2-AMINO-6-(N-CBZ-AMINO)-HEXANOIC ACID ETHYL ESTER
CAS:59515-43-4
KIN02432682
(S)-2-AMINO-6-(N-HYDROXYACETAMIDO)-HEXANOIC ACID
CAS:88492-29-9
Formula: C8H16N2O4
KIN02698989
N6-Acetyl-N6-hydroxy-L-lysine
(S)-2-AMINO-6-(PHOSPHONOAMINO)-HEXANOIC ACID
CAS:14721-74-5
Formula: C6H15N2O5P
KIN02035044
N6-Phosphono-L-lysine
(S)-2-AMINO-6-(PROPAN-2-YLAMINO)-HEXANOIC ACID
CAS:5977-10-6
Formula: C16H22O3
KIN01146514
(S)-2-AMINO-6-(TRIMETHYLAMMONIO)-HEXANOATE
CAS:23284-33-5
Formula: C9H20N2O2
KIN02118638
MFCD00077169
(S)-2-AMINO-6-BENZAMIDOHEXANOIC ACID
CAS:1219-47-2
Formula: C15H20N2O.ClH
KIN01043998
(S)-2-AMINO-6-BORONOHEXANOIC ACID HCL
CAS:194656-75-2
Formula: [C6H15BClNO4
KIN03398613
(S)-2-AMINO-6-DECANAMIDOHEXANOIC ACID
CAS:59766-99-3
Formula: C16H32N2O3
KIN02436890
N6-(1-oxodecyl)-L-lysine
(S)-2-AMINO-6-DIAZO-5-OXOHEXANOIC ACID
CAS:157-06-2
Formula: C6H14N4O2
KIN01006770
(S)-2-AMINO-6-DODECANAMIDOHEXANOIC ACID
CAS:52315-75-0
Formula: C18H36N2O3
KIN02319316
N-alpha-Lauroyl-L-lysine
(S)-2-AMINO-6-FORMAMIDOHEXANOIC ACID
CAS:1190-49-4
Formula: C7H15N3O3
KIN01042591
(S)-2-AMINO-6-GUANIDINOHEXANOIC ACID
CAS:156-87-6
Formula: C3H9NO
KIN01006768
(S)-2-AMINO-6-GUANIDINOHEXANOIC ACID HCL
CAS:1483-07-4
Formula: C4H9N3O3
KIN01048132
(S)-2-AMINO-6-HEPTENOIC ACID
CAS:166734-64-1
Formula: C7H13NO2
KIN03339186
(S)-2-AMINO-6-HYDROXYHEXANOIC ACID
CAS:6033-34-7
Formula: C24H31N5O3S
KIN01147881
(S)-2-AMINO-6-HYDROXYHEXANOIC ACID METHYL ESTER
CAS:167090-40-6
KIN03339927
(S)-2-AMINO-6-METHYL-6,7-DIHYDROPTERIDIN-4(1H)-ONE
CAS:88848-83-3
Formula: C7H9N5O
KIN02703493
(S)-2-AMINO-6-OCTANAMIDOHEXANOIC ACID
CAS:23735-96-8
Formula: C14H28N2O3
KIN02123019
N6-(1-oxooctyl)-L-lysine
(S)-2-AMINO-6-OLEAMIDOHEXANOIC ACID
CAS:23499-75-4
Formula: C24H46N2O3
KIN02120576
N6-[(9Z)-1-Oxo-9-octadecen-1-yl]-L-lysine; N6-Oleo
(S)-2-AMINO-6-OXOHEXANOIC ACID
CAS:1962-94-3
Formula: C19H30O2
KIN01059805
(S)-2-AMINO-6-PALMITAMIDOHEXANOIC ACID
CAS:59012-43-0
Formula: C22H44N2O3
KIN02424809
N6-(1-oxohexadecyl)-L-lysine
(S)-2-AMINO-6-STEARAMIDOHEXANOIC ACID
CAS:52616-32-7
Formula: C24H48N2O3
KIN02323390
N6-(1-oxooctadecyl)-L-lysine
(S)-2-AMINO-6-TETRADECANAMIDOHEXANOIC ACID
CAS:62471-07-2
Formula: C20H40N2O3
KIN02474652
N6-(1-oxo-tetradecyl)-L-lysine
(S)-2-AMINO-6-UREIDOHEXANOIC ACID
CAS:121080-96-4
Formula: C7H15N3O3
KIN03167906
(S)-2-AMINO-7-(2,4-DIHYDROXY-BUTYL)-4,7-DIHYDRO-4-OXO-1H-PYRROLO[2,3-D]PYRIMIDIN-5-CARBONITRILE
CAS:127945-78-2
Formula: [C11H13N5O3
KIN03199720
(S)-2-AMINO-7-(2,4-DIHYDROXY-BUTYL)-4,7-DIHYDRO-4-OXO-1H-PYRROLO[2,3-D]PYRIMIDIN-5-CARBOXAMIDE
CAS:127945-74-8
Formula: [C11H15N5O4
KIN03199716
(S)-2-AMINO-7-(2,4-DIHYDROXY-BUTYL)-4,7-DIHYDRO-6-(METHYLTHIO)-4-OXO-1H-PYRROLO[2,3-D]PYRIMIDIN-5-CARBONITRILE
CAS:127945-70-4
Formula: [C12H15N5O3S
KIN03199712
(S)-2-AMINO-7-(2,4-DIHYDROXY-BUTYL)-4,7-DIHYDRO-6-(METHYLTHIO)-4-OXO-1H-PYRROLO[2,3-D]PYRIMIDIN-5-CARBOXAMIDE
CAS:127945-66-8
Formula: [C12H17N5O4S
KIN03199708
(S)-2-AMINO-7-PHOSPHONO-HEPTANOIC ACID
CAS:81338-24-1
Formula: C7H16NO5P
KIN02649304
MFCD00083245
(S)-2-AMINO-7-SULFO-HEPTANOIC ACID
CAS:86088-27-9
Formula: C7H15NO5S
KIN02678267
(S)-2-AMINO-9-CHLORO-8-OXO-NONANOIC ACID
CAS:104848-83-1
Formula: C9H16ClNO3
KIN03064412
(S)-2-AMINO-9BETA-D-RIBOFURANOSYL-9H-PURIN-6-SULFINAMIDE
CAS:123002-47-1
KIN03625028
(S)-2-AMINO-ALPHA-(2-METHYLPROPYL)-4-THIAZOLEMETHANAMINE
CAS:115894-55-8
KIN03625027
(S)-2-AMINO-BUT-3-EN-1-OL HCL
CAS:219803-57-3
Formula: C4H10ClNO
KIN03432310
(S)-2-AMINO-BUT-3-EN-1-OL, BENZOATE SALT
CAS:261360-75-2
Formula: C11H15NO3
KIN03458764
(S)-2-AMINO-BUTANOIC ACID
CAS:1492-26-8
Formula: C11H21NO4
KIN01048414
(S)-2-AMINO-BUTANOIC ACID 2-METHOXYETHYL ESTER
CAS:97884-66-7
Formula: C7H15NO3
KIN02808480
(S)-2-AMINO-BUTANOIC ACID BARIUM SALT (2:1)
CAS:89709-28-4
Formula: C4H9NO2.1/2Ba
KIN02715843
(S)-2-AMINO-BUTANOIC ACID CALCIUM SALT (2:1)
CAS:93060-11-8
Formula: C4H9NO2.1/2Ca
KIN02764638
(S)-2-AMINO-BUTANOIC ACID HCL
CAS:5959-32-0
Formula: C4H10N2O
KIN01146055
(S)-2-AMINO-BUTANOIC ACID HEXYL ESTER
CAS:63907-65-3
Formula: C10H21NO2
KIN02501106
(S)-2-AMINO-DECANOIC ACID PHENYLMETHYL ESTER
CAS:89371-57-3
Formula: C17H27NO2
KIN02710877
(S)-2-AMINO-HEPT-3-ONE HCL
CAS:156990-36-2
Formula: C7H16ClNO
KIN03316930
(S)-2-AMINO-HEPTANEDIOIC ACID BIS(TERT-BUTYL) ESTER
CAS:87174-87-6
Formula: C15H29NO4
KIN02684909
(S)-2-AMINO-HEXADECANOIC ACID
CAS:98393-17-0
Formula: C16H33NO2
KIN02813417
(S)-2-AMINO-HEXANAMIDE
CAS:7324-11-0
Formula: C4H10N2O
KIN01184304
(S)-2-AMINO-HEXANAMIDE HCL
CAS:94787-97-0
Formula: C6H14N2O?HCl
KIN02785137
L-2-Aminohexanamide HCl
MFCD00035526
(S)-2-AMINO-HEXANEDIOIC ACID
CAS:1118-91-8
Formula: C10H18O2
KIN01040066
(S)-2-AMINO-HEXANEDIOIC ACID 1-(DIPHENYLMETHYL) ESTER
CAS:71264-13-6
Formula: C19H20NO4
KIN02583117
(S)-2-AMINO-HEXANEDIOIC ACID 6-METHYL ESTER
CAS:147780-40-3
KIN03287332
(S)-2-AMINO-HEXANEDIOIC ACID 6-METHYL ESTER HCL
CAS:147780-39-0
Formula: C7H13NO4.HCl
KIN03287331
(S)-2-AMINO-HEXANEDIOIC ACID BISPROPAN-2-YL ESTER
CAS:87227-02-9
Formula: C12H23NO4
KIN02685221
(S)-2-AMINO-HEXANEDIOIC ACID HCL
CAS:62787-49-9
Formula: C6H11NO4.ClH
KIN02480420
(S)-2-AMINO-HEXANEDIOIC ACID MONOSODIUM SALT
CAS:13429-95-3
Formula: C6H11NO4.Na
KIN02019429
(S)-2-AMINO-HEXANEDIOIC ACID TOSYLATE
CAS:71264-12-5
Formula: C7H8O3S.C6H11NO4
KIN02583116
(S)-2-AMINO-N,3-DIHYDROXY-PROPANAMIDE
CAS:31697-35-5
Formula: C3H8N2O3
KIN02191380
Serine hydroxamate
(S)-2-AMINO-N,3-DIPHENYLPROPANAMIDE
CAS:15423-54-8
Formula: C15H16N2O
KIN02041340
Phenyl-alanine anilide
(S)-2-AMINO-N,4-DIMETHYLPENTANAMIDE
CAS:64569-68-2
Formula: C7H16N2O
KIN02511847
(S)-2-AMINO-N,N'-BIS[2-(3,4-DIHYDROXY-PHENYL)ETHYL]-PENTANEDIAMIDE
CAS:142546-45-0
Formula: C21H27N3O6
KIN03265543
(S)-2-AMINO-N,N,N',N'-TETRAMETHYLBUTANEDIAMIDE
CAS:115797-95-0
Formula: C8H17N3O2
KIN03139132
(S)-2-AMINO-N,N-DIETHYL-4-METHYLPENTANAMIDE
CAS:63618-45-1
Formula: C10H22N2O
KIN02496055
(S)-2-AMINO-N,N-DIETHYLPROPANAMIDE
CAS:56414-86-9
Formula: C7H16N2O
KIN02382387
(S)-2-AMINO-N,N-DIMETHYL-3-PHENYLPROPANAMIDE
CAS:29618-17-5
Formula: C11H16N2O
KIN02175369
(S)-2-AMINO-N,N-DIMETHYLPROPANAMIDE MONOACETATE
CAS:93667-69-7
KIN02772088
(S)-2-AMINO-N-((R)-1-METHYL-2-OXO-5-PHENYL-2,3-DIHYDRO-1H-BENZO[E][1,4]DIAZEPIN-3-YL)-3-PHENYLPROPANAMIDE
CAS:103343-64-2
Formula: C25H24N4O2
KIN03053251
(S)-2-AMINO-N-((S)-1-(((2S,3S,4R,5R)-5-(6-(DIMETHYLAMINO)-9H-PURIN-9-YL)-4-HYDROXY-2-(HYDROXYMETHYL)-TETRAHYDROFURAN-3-YL)AMINO)-3-(4-METHOXY-PHENYL)-1-OXO-PROPAN-2-YL)-4-(METHYLTHIO)BUTYRAMIDE
CAS:6042-25-7
Formula: C32H37N3O4
KIN01148110
(S)-2-AMINO-N-((S)-1-AMINO-1-OXO-3-PHENYLPROPAN-2-YL)-3-PHENYLPROPANAMIDE
CAS:15893-46-6
Formula: C18H21N3O2
KIN02045251
L-Phenyl-alanyl-L-phenyl-alaninamide
(S)-2-AMINO-N-((S)-3,3-DIMETHYL-1-(METHYLAMINO)-1-OXO-BUTAN-2-YL)-4-METHYLPENTANAMIDE
CAS:178933-95-4
Formula: [C13H27N3O2
KIN03365778
(S)-2-AMINO-N-((S)-3-METHYL-2-OXO-2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPIN-1-YL)-PROPANAMIDE
CAS:253136-72-0
Formula: C14H19N3O2
KIN03453168
(S)-2-AMINO-N-(1H-TETRAZOL-5-YLMETHYL)-PROPANAMIDE
CAS:66211-96-9
Formula: C5H10N6O
KIN02538737
(S)-2-AMINO-N-(2,4,6-TRIMETHYLPHENYL)-PROPANAMIDE
CAS:113889-99-9
Formula: C12H18N2O
KIN03660792
(S)-2-AMINO-N-(2,4-DICHLOROPHENYL)-PROPANAMIDE
CAS:58112-19-9
Formula: C9H10Cl2N2O
KIN02410675
(S)-2-AMINO-N-(2,4-DIMETHYLPHENYL)-PROPANAMIDE
CAS:113800-28-5
Formula: C11H16N2O
KIN03007282
(S)-2-AMINO-N-(2-(((S)-1-(((S)-1-AMINO-1-OXO-3-PHENYLPROPAN-2-YL)AMINO)-1-OXO-3-PHENYLPROPAN-2-YL)AMINO)-2-OXOETHYL)-5-GUANIDINOPENTANAMIDE
CAS:34367-74-3
Formula: C26H36N8O4
KIN02213500
L-Arginylglycyl-L-phenyl-alanyl-L-phenyl-alaninami
(S)-2-AMINO-N-(2-AMINO-2-OXOETHYL)-3-(4-OXO-4H-IMIDAZOL-5-YL)-N-PROPYLPROPANAMIDE
CAS:27058-74-8
Formula: C11H17N5O3
KIN02153583
5-Oxo-L-propyl-L-histidyl-glycinamide
(S)-2-AMINO-N-(2-HYDROXYETHYL)-3-(4-METHOXY-PHENYL)-PROPANAMIDE
CAS:133859-34-4
KIN03225686
(S)-2-AMINO-N-(2-HYDROXYETHYL)-PROPANAMIDE
CAS:61275-23-8
Formula: C5H12N2O2
KIN02453598
(S)-2-AMINO-N-(2-MERCAPTOETHYL)-3-METHYL-BUTYRAMIDE MONOHBR
CAS:120626-97-3
Formula: C7H16N2OS.BrH
KIN03165469
(S)-2-AMINO-N-(2-MERCAPTOETHYL)-4-METHYL-PENTANAMIDE MONOHBR
CAS:120626-96-2
Formula: C8H18N2OS.BrH
KIN03165468
(S)-2-AMINO-N-(2-METHYLPHENYL)-PROPANAMIDE
CAS:113890-00-9
Formula: C10H14N2O
KIN03126843
(S)-2-AMINO-N-(3,3-DIPHENYLPROPYL)-4-METHYLPENTANAMIDE
CAS:67314-54-9
Formula: C21H28N2O
KIN02551625
(S)-2-AMINO-N-(4-AMINOBUTYL)-N-((2,5-DIOXO-PYRROLIDINE-1-YL)(IMINO)METHYL)-4-METHYLPENTANAMIDE
CAS:126673-18-5
Formula: [C15H27N5O3
KIN03194064
(S)-2-AMINO-N-(4-AMINOPHENYL)-4-METHYLPENTANAMIDE
CAS:96989-27-4
Formula: C12H19N3O
KIN02803865
(S)-2-AMINO-N-(4-HYDROXY-PHENYL)-4-METHYLPENTANAMIDE
CAS:65540-64-9
Formula: C12H18N2O2
KIN02528528
(S)-2-AMINO-N-(4-METHOXY-NAPHTHALEN-2-YL)-3-METHYLBUTYRAMIDE
CAS:142451-04-5
Formula: C16H20N2O2
KIN03265142
(S)-2-AMINO-N-(4-METHOXY-NAPHTHALEN-2-YL)-3-METHYLBUTYRAMIDE HCL
CAS:201982-92-5
Formula: C16H21ClN2O2
KIN03409824
(S)-2-AMINO-N-(4-METHOXY-NAPHTHALEN-2-YL)-PROPANAMIDE HCL
CAS:3438-15-1
Formula: C8H9ClO
KIN01089203
(S)-2-AMINO-N-(4-METHOXY-PHENYL)-4-METHYLPENTANAMIDE
CAS:65540-65-0
Formula: C13H20N2O2
KIN02528529
(S)-2-AMINO-N-(4-METHOXY-PHENYL)-PROPANAMIDE
CAS:65734-58-9
Formula: C10H14N2O2
KIN02531495
(S)-2-AMINO-N-(4-METHOXYNAPHTHALEN-2-YL)-4-METHYLPENTANAMIDE HCL
CAS:4467-70-3
KIN01108675
(S)-2-AMINO-N-(4-METHOXYNAPHTHALEN-2-YL)-PROPANAMIDE
CAS:4467-68-9
Formula: C17H22N2O2.ClH
KIN01108674
(S)-2-AMINO-N-(4-NITROPHENYL)-3-PHENYLPROPANAMIDE
CAS:2361-10-6
Formula: C30H48O3
KIN01067725
(S)-2-AMINO-N-(4-NITROPHENYL)-PROPANAMIDE MONOHBR
CAS:117507-15-0
Formula: C9H11N3O3.BrH
KIN03660791
(S)-2-AMINO-N-(5-BROMOPYRIDIN-2-YL)-3-METHYLBUTYRAMIDE
CAS:85472-08-8
Formula: C10H14BrN3O
KIN02674540
(S)-2-AMINO-N-(6-METHYLBENZO[D]THIAZOL-2-YL)-PROPANAMIDE
CAS:126310-16-5
Formula: C11H13N3OS
KIN03625026
(S)-2-AMINO-N-(BENZYLOXY)-PROPANAMIDE
CAS:64532-68-9
Formula: C10H14N2O2
KIN02511351
(S)-2-AMINO-N-(NAPHTHALEN-2-YL)-5-UREIDOPENTANAMIDE HBR
CAS:201988-71-8
Formula: C16H20N4O2.HBr
KIN03409858
(S)-2-AMINO-N-(NAPHTHALEN-2-YL)-PROPANAMIDE
CAS:720-92-3
Formula: C10H9F3O3
KIN01027327
(S)-2-AMINO-N-(NAPHTHALEN-2-YL)-PROPANAMIDE HBR
CAS:3513-69-7
Formula: C21H32O2
KIN01090629
(S)-2-AMINO-N-[2,6-BIS(1-METHYLETHYL)PHENYL]PROPANAMIDE
CAS:135628-13-6
KIN03636232
(S)-2-AMINO-N-[2-(2,5-DIMETHOXY-PHENYL)-2-HYDROXYETHYL]ACETAMIDE
CAS:133267-39-7
Formula: [C12H18N2O4]
KIN03222765
(S)-2-AMINO-N-[2-(3,4-DIHYDROXY-PHENYL)ETHYL]-3-HYDROXY-PROPANAMIDE
CAS:54653-58-6
KIN02353344
L-Seryldopamide
(S)-2-AMINO-N-[2-(3,4-DIHYDROXY-PHENYL)ETHYL]-3-METHYLBUTYRAMIDE
CAS:54653-61-1
KIN02353345
L-Valyldopamide
(S)-2-AMINO-N-[2-(3,4-DIHYDROXY-PHENYL)ETHYL]-4-METHYLPENTANAMIDE
CAS:54653-57-5
KIN02353343
L-Leucyldopamide
(S)-2-AMINO-N-[2-(3,4-DIHYDROXY-PHENYL)ETHYL]PROPANAMIDE
CAS:54601-15-9
Formula: C11H16N2O3
KIN02352556
L-Alanyldopamide; N-L-Alanyldopamine
(S)-2-AMINO-N-[2-(4-METHOXY-PHENYL)ETHYL]PROPANAMIDE
CAS:55677-66-2
Formula: C12H18N2O2
KIN02370092
(S)-2-AMINO-N-[2-OXO-4-(TRIFLUOROMETHYL)-2H-BENZOPYRANE-7-YL]PROPANAMIDE
CAS:126910-31-4
Formula: C13H11F3N2O3
KIN03195125
(S)-2-AMINO-N-[4-(AMINOSULFONYL)PHENYL]PROPANAMIDE
CAS:133639-68-6
KIN03009100
(S)-2-AMINO-N-[4-(TERT-BUTYL)PHENYL]PROPANAMIDE
CAS:160981-45-3
KIN03327658
(S)-2-AMINO-N-2-DIBENZOTHIENYL-3-METHYLBUTYRAMIDE
CAS:93619-11-5
Formula: C17H18N2OS
KIN02771386
Dibenzo[b]thiophene, butyramide deriv
(S)-2-AMINO-N-BENZO[D]THIAZOL-2-YLPROPANAMIDE
CAS:78221-03-1
Formula: C10H11N3OS
KIN02630062
(S)-2-AMINO-N-BENZYL-3-(1H-INDOL-3-YL)-N-METHYLPROPANAMIDE
CAS:169673-44-3
KIN03345206
(S)-2-AMINO-N-CYCLOBUTYL-3,3-DIMETHYLBUTYRAMIDE
CAS:178419-26-6
Formula: C10H20N2O
KIN03364763
(S)-2-AMINO-N-CYCLOBUTYL-N-METHYL-3-PHENYLPROPANAMIDE
CAS:1044040-85-8
Formula: C14H20N2O
KIN05093152
(S)-2-AMINO-N-DODECYL-3-METHYLBUTYRAMIDE
CAS:60654-00-4
Formula: C17H36N2O
KIN02446506
(S)-2-AMINO-N-DODECYL-4-(METHYLTHIO)BUTYRAMIDE
CAS:60654-03-7
Formula: C17H36N2OS
KIN02446508
(S)-2-AMINO-N-DODECYLPROPANAMIDE
CAS:110139-25-8
Formula: C15H32N2O
KIN03099511
(S)-2-AMINO-N-ETHYLPROPANAMIDE
CAS:71773-95-0
Formula: C5H12N2O
KIN02586781
(S)-2-AMINO-N-HEXADECYL-3-(SULFOOXY)-PROPANAMIDE MONOSODIUM SALT
CAS:185520-32-5
Formula: C19H40N2O5S.Na
KIN03379915
(S)-2-AMINO-N-HYDROXY-3-(1H-INDOL-3-YL)-PROPANAMIDE
CAS:69780-12-7
Formula: C11H13N3O2
KIN02572817
Tryptophanhydroxamic acid
(S)-2-AMINO-N-HYDROXY-4-(METHYLSELENO)BUTYRAMIDE
CAS:62950-35-0
Formula: C5H12N2O2Se
KIN02483419
(S)-2-AMINO-N-HYDROXY-N,4-DIMETHYLPENTANAMIDE
CAS:110374-71-5
Formula: C7H16N2O2
KIN03101123
(S)-2-AMINO-N-METHYL-2-PHENYL-ACETAMIDE HCL
CAS:367260-42-2
Formula: C9H13ClN2O
KIN03540780
(S)-2-AMINO-N-METHYL-3-(BENZYLOXY)-PROPANAMIDE
CAS:90013-44-8
Formula: C11H16N2O2
KIN02721117
(S)-2-AMINO-N-METHYL-3-PHENYLPROPANAMIDE
CAS:35373-92-3
Formula: C10H14N2O
KIN02222540
L-Phenyl-alanine N-methylamide
(S)-2-AMINO-N-METHYLPROPANAMIDE
CAS:33194-35-3
Formula: C4H10N2O
KIN02203380
(S)-2-AMINO-N-METHYLPROPANAMIDE MONOACETATE
CAS:111742-12-2
Formula: C4H10N2O.C2H4O2
KIN03109788
(S)-2-AMINO-N-NAPHTHALEN-2-YLPROPANAMIDE HCL
CAS:1211-57-0
Formula: C12H14O4
KIN01043695
(S)-2-AMINO-N-PHENYLBUTYRAMIDE
CAS:90891-74-0
Formula: C10H14N2O
KIN02735231
(S)-2-AMINO-N-PHENYLPROPANAMIDE HCL
CAS:108321-83-1
Formula: C9H12N2O.HCl
KIN03088417
(S)-2-AMINO-N-PHENYLPROPANOHYDRAZIDE
CAS:52386-52-4
Formula: C9H13N3O
KIN02320437
MFCD00190981
(S)-2-AMINO-N-PROPYLPROPANAMIDE
CAS:62072-60-0
Formula: C6H14N2O
KIN02467259
(S)-2-AMINO-N-QUINOLIN-2-YLPROPANAMIDE
CAS:148837-93-8
Formula: C12H13N3O
KIN03290528
(S)-2-AMINO-N-QUINOLIN-6-YLPROPANAMIDE
CAS:127581-89-9
Formula: C12H13N3O
KIN03197929
(S)-2-AMINO-N-TERT-BUTYL-3-METHYLBUTYRAMIDE
CAS:72669-49-9
Formula: C9H20N2O
KIN02593005
L-Valine tert-butylamide
(S)-2-AMINO-N1-(4-NITROPHENYL)PENTANEDIAMIDE
CAS:134580-25-9
KIN03228850
(S)-2-AMINO-N1-(NAPHTHALEN-2-YL)SUCCINAMIDE
CAS:3313-45-9
Formula: C19H18N2O.BrH
KIN01086601
(S)-2-AMINO-OCTANEDIOIC ACID 8-METHYL ESTER
CAS:166976-50-7
Formula: C9H17NO4
KIN03339707
(S)-2-AMINO-OCTANEDIOIC ACID DIMETHYL ESTER
CAS:87206-10-8
Formula: C10H19NO4
KIN02685080
(S)-2-AMINO-OCTANOIC ACID HCL
CAS:110508-14-0
KIN03102031
(S)-2-AMINO-PENT-4-ENOIC ACID
CAS:16338-48-0
Formula: C5H9NO2
KIN02050351
L-2-Amino-4-pentenoic acid; N-BOC-L-Allyl-glycine
MFCD00002627
(S)-2-AMINO-PENTAN-1-OL
CAS:22724-81-8
Formula: C5H13NO
KIN02113142
L-Norvalinol
MFCD02683229
(S)-2-AMINO-PENTANEDIAMIDE
CAS:2013-22-1
Formula: C14H8HgO4.2H
KIN01060878
(S)-2-AMINO-PROPAN-1-OL
CAS:2749-19-1
KIN01075422
(S)-2-AMINO-PROPANAL
CAS:4744-20-1
Formula: C12H29N3O2
KIN01113788
(S)-2-AMINO-PROPANENITRILE
CAS:95596-57-9
Formula: C3H6N2
KIN02793079
(S)-2-AMINO-PROPANOIC ACID
CAS:312623-85-1
Formula: [C3H7NO2
KIN03486555
(S)-2-AMINO-PROPANOIC ACID HCL
CAS:6003-11-8
Formula: C15H10O4
KIN01147125
(S)-2-AMINO-PROPANOIC ACID TERT-BUTYL ESTER HCL
CAS:10589-97-6
Formula: C7H15NO2.ClH
KIN02008514
L-Alanine, tert-butyl ester HCl
(S)-2-AMINO-PROPANOIC ANHYDRIDE
CAS:220190-44-3
Formula: C6H12N2O3
KIN03433283
(S)-2-AMINO-PROPYLSULFONIC ACID
CAS:126301-30-2
Formula: C3H9NO3S
KIN03192388
(S)-2-AMINO-TETRACOSANOIC ACID METHYL ESTER
CAS:111730-86-0
Formula: C25H51NO2
KIN03109707
(S)-2-AMINOBUTANEDIOIC ACID
CAS:56-85-9
Formula: C5H10N2O3
KIN01000417
(S)-2-AMINOBUTYRAMIDE HCL
CAS:141978-61-2
Formula: [C4H11ClN2O
KIN03262949
(S)-2-AMINODODECANOIC ACID
CAS:169106-34-7
Formula: C12H25NO2
KIN03343954
(S)-2-AMINOETHYL 2,6-DIAMINOHEXANOATE 3HCL
CAS:70198-23-1
Formula: C8H22Cl3N3O2
KIN02575880
(S)-2-AMINOHEXADECANOIC ACID
CAS:116783-26-7
Formula: C16H33NO2
KIN03145883
(S)-2-AMINOHEXANOIC ACID
CAS:327-58-2
KIN01010486
(S)-2-AMINOHEXANOIC ACID ETHYL ESTER
CAS:6141-44-2
KIN01150871
(S)-2-AMINOMETHYL-3-(3-HYDROXY-PHENYL)-PROPANOIC ACID
CAS:1190597-10-4
KIN05331224
(S)-2-AMINOOCTANE
CAS:34566-04-6
Formula: C8H19N
KIN02214876
MFCD01091021
(S)-2-AMINOOCTANEDIOIC ACID
CAS:4255-07-6
Formula: C2H4O6Zn
KIN01103928
(S)-2-AMINOPENTANEDIOIC ACID 4-(4-((2-AMINO-4-OXO-3,4-DIHYDROPTERIDINE-6-YL)METHYLAMINO)-BENZAMIDO)-4-CARBOXY-BUTYRATE SALT
CAS:6807-83-6
Formula: C22H22O10
KIN01170642
(S)-2-AMINOPENTANEDIOIC ACID 4-(4-((2-AMINO-5-METHYL-4-OXO-3,4,5,6,7,8-HEXAHYDROPTERIDIN-6-YL)METHYLAMINO)-BENZAMIDO)-4-CARBOXY-BUTYRATE SALT
CAS:50998-20-4
Formula: C35H51N10O18-
KIN02300192
(S)-2-AMINOPENTANOIC ACID
CAS:498-19-1
Formula: C4H9NO3
KIN01017099
(S)-2-AMINOSUCCINAMIDE HCL
CAS:57471-69-9
Formula: C4H10ClN3O2
KIN02400262
L-Asparaginamide HCl
(S)-2-AMINOSUCCINIC ACID
CAS:32505-46-7
Formula: C4H7NO4
KIN02197650
L-Aspartic acid
(S)-2-AMINOSUCCINIC ACID DIMETHYL ESTER
CAS:24425-79-4
KIN02130385
L-Aspartic acid dimethyl ester
(S)-2-AZABICYCLO[2.2.2]OCTAN-3-CARBOXAMIDE
CAS:115238-33-0
Formula: [C8H14N2O
KIN03136121
(S)-2-AZASPIRO[4.5]DEC-1-EN-3-CARBOXYLIC ACID
CAS:88708-87-6
Formula: C10H15NO2
KIN02701625
(S)-2-AZASPIRO[4.5]DECAN-3-CARBOXYLIC ACID
CAS:88708-85-4
Formula: C10H17NO2
KIN02701623
(S)-2-AZASPIRO[5.5]UNDECAN-7-ONE
CAS:81149-25-9
Formula: C10H17NO
KIN02648240
(S)-2-AZIDO-3-(BENZYLOXY)-PROPANOIC ACID
CAS:114519-05-0
Formula: C10H11N3O3
KIN03131426
(S)-2-AZIDO-3-(HEXADECYCLOXY)-PROPANOL
CAS:92445-90-4
Formula: C19H39N3O2
KIN02756800
(S)-2-AZIDO-4,4-DIFLUOROPENTANOIC ACID
CAS:148043-93-0
Formula: C5H7F2N3O2
KIN03288183
(S)-2-AZIDO-PENTANEDIOIC ACID 5-(TERT-BUTYL) ESTER
CAS:114519-06-1
Formula: C9H15N3O4
KIN03131427
(S)-2-AZIDO-PROPANOIC ACID ETHYL ESTER
CAS:79410-47-2
Formula: C5H9N3O2
KIN02637432
(S)-2-AZIRIDINECARBOXAMIDE
CAS:67413-30-3
Formula: C3H6N2O
KIN02553197
(S)-2-AZIRIDINECARBOXYLIC ACID MONOLITHIUM SALT
CAS:67413-27-8
Formula: C3H4LiNO2
KIN02553196
MFCD00077654
(S)-2-AZIRIDINECARBOXYLIC ACID MONOSODIUM SALT
CAS:85012-56-2
Formula: C3H5NO2.Na
KIN02671314
(S)-2-BENZAMIDO-3-(1H-IMIDAZOL-4-YL)-PROPANOIC ACID
CAS:5355-03-3
Formula: C11H13ClN2O
KIN01127380
(S)-2-BENZAMIDO-3-(4-HYDROXY-PHENYL)-PROPANOIC ACID
CAS:2566-26-9
Formula: C6H5N2O8P
KIN01072091
(S)-2-BENZAMIDO-3-BENZENEPROPANOIC ACID
CAS:2566-23-6
Formula: C16H15NO4
KIN01072090
(S)-2-BENZAMIDO-3-HYDROXY-2-METHYLPROPANOIC ACID
CAS:7508-83-0
Formula: C17H17NO4
KIN01190169
(S)-2-BENZAMIDO-3-METHYLBUTANOIC ACID
CAS:5699-82-1
Formula: C12H10Cl6N2P2
KIN01139414
(S)-2-BENZAMIDO-4-(METHYLTHIO)BUTANOIC ACID
CAS:10290-61-6
Formula: C12H15NO3S
KIN02004465
N-benzoyl-L-methionine
(S)-2-BENZAMIDO-4-METHOXY-4-OXO-BUTANOIC ACID
CAS:39741-26-9
Formula: C12H13NO5
KIN02257102
N-Benzooyl-L-aspartic acid beta-methyl ester
(S)-2-BENZAMIDO-4-METHYLPENTANOIC ACID
CAS:1466-87-1
Formula: C9H9NO3
KIN01047727
(S)-2-BENZAMIDO-5-GUANIDINOPENTANOIC ACID
CAS:154-93-8
Formula: C5H9Cl2N3O2
KIN01006708
(S)-2-BENZAMIDO-N1-(4-NITROPHENYL)SUCCINAMIDE
CAS:201733-11-1
Formula: C17H16N4O5
KIN03409455
(S)-2-BENZAMIDOPENTANEDIOIC ACID
CAS:6094-40-2
Formula: C4H10N2.xClH
KIN01149615
(S)-2-BENZAMIDOPENTANOIC ACID
CAS:121470-62-0
Formula: C12H15NO3
KIN03169857
(S)-2-BENZAMIDOPROPANOIC ACID
CAS:2198-65-4
KIN01064584
(S)-2-BENZAMIDOPROPANOIC ACID METHYL ESTER
CAS:7244-70-4
Formula: C9H10N2O4
KIN01182611
(S)-2-BENZAMIDOSUCCINIC ACID
CAS:4631-21-4
Formula: C7H13NO7
KIN01111670
(S)-2-BENZENESULFONYL-2-BENZENEPROPANOIC ACIDAMIDE
CAS:14182-52-6
Formula: C15H15NO3S
KIN02029162
(S)-2-BENZHYDRYL-1-BENZYLPYRROLIDINE
CAS:118971-05-4
Formula: C24H25N
KIN03156894
(S)-2-BENZOYL-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID
CAS:115732-15-5
Formula: C17H15NO3
KIN03138777
(S)-2-BENZOYLAMINO-4-GUANIDINO-BUTANOIC ACID
CAS:100255-54-7
Formula: C12H16N4O3
KIN03030079
(S)-2-BENZOYLOXY-1-DIMETHOXY-PHOSPHORYLPROPANE
CAS:1104662-26-1
Formula: C12H17O5P
KIN05169632
(S)-2-BENZOYLOXY-PROPIONSAEUREETHYL ESTER
CAS:1211-58-1
Formula: C14H22BrN.BrH
KIN01043696
(S)-2-BENZOYLPYRROLIDINE-1-CARBOXYLIC ACID ETHYL ESTER
CAS:106202-17-9
Formula: C14H17NO3
KIN03074805
(S)-2-BENZYL-1-((3AS,8AR)-2,2-DIMETHYL-8,8A-DIHYDRO-3AH-INDENO[1,2-D]OXAZOL-3-YL)PENT-4-EN-1-ONE
CAS:165883-48-7
KIN03337990
(S)-2-BENZYL-1-METHYL-PIPERAZINE
CAS:290832-49-4
Formula: C12H18N2
KIN03471437
(S)-2-BENZYL-1-TOSYLAZIRIDINE
CAS:62596-64-9
Formula: C16H17NO2S
KIN02476988
MFCD00799479
(S)-2-BENZYL-2-FLUORO-1-METHYLENE-INDAN
CAS:1040749-21-0
Formula: C17H15F
KIN05086655
(S)-2-BENZYL-2-HYDROXY-BUTANEDIOIC ACID
CAS:51692-93-4
KIN02310245
(S)-2-BENZYL-3-(N-BOC-AMINO)-PROPANOIC ACID
CAS:189619-55-4
Formula: C15H21NO4
KIN03389344
(S)-2-BENZYL-4-TERT-BUTOXY-4-OXO-BUTANOIC ACID
CAS:337518-87-3
Formula: C15H20O4
KIN03509979
(S)-2-BENZYL-AZIRIDINE
CAS:73058-30-7
Formula: C9H11N
KIN02595676
MFCD06796591
(S)-2-BENZYL-HEXANOIC ACID
CAS:225917-33-9
Formula: [C13H18O2
KIN03440165
(S)-2-BENZYL-N-((1S,2R)-2-HYDROXY-2,3-DIHYDRO-1H-INDEN-1-YL)-3-((S)-OXIRAN-2-YL)-PROPANAMIDE
CAS:198973-01-2
KIN03405183
(S)-2-BENZYL-PIPERAZINE
CAS:208655-19-0
Formula: C11H16N2
KIN03419060
(S)-2-BENZYL-SUCCINIC ACID
CAS:3972-40-5
Formula: C4H5ClO4
KIN01098791
(S)-2-BENZYLAMINO-3-HYDROXY-PROPANOIC ACID
CAS:17136-45-7
Formula: C10H13NO3
KIN02058621
N-Benzyl-L-serine
MFCD00020417
(S)-2-BENZYLOXYMETHYL-3-METHYLBUTAN-1-OL
CAS:365541-75-9
Formula: [C13H20O2
KIN03540124
(S)-2-BENZYLPENT-4-ENOIC ACID
CAS:93780-03-1
Formula: C12H14O2
KIN02773583
(S)-2-BOC-1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-CARBOXYLIC ACID
CAS:151004-94-3
Formula: C15H19NO4
KIN03297897
(S)-2-BOC-2-PYRROLIDINEBUTANOIC ACID METHYL ESTER
CAS:172039-38-2
Formula: C14H25NO4
KIN03022528
(S)-2-BOC-4-METHOXY-4-OXO-BUTANOIC ACID;
CAS:198646-59-2
Formula: C10H16O6
KIN03404693
(S)-2-BOC-4-OXOOCTAHYDRO-2H-PYRIDO[1,2-A]PYRAZINE
CAS:248914-26-3
Formula: C13H22N2O3
KIN03450000
(S)-2-BROMO-1-(1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-YL)ETHANONE
CAS:35940-86-4
Formula: C14H11BrO2
KIN02227497
(S)-2-BROMO-1-(3-BROMO-4-METHOXY-PHENYL)DECAN-1-ONE
CAS:306972-97-4
Formula: C17H24Br2O2
KIN03482974
(S)-2-BROMO-1-(TETRAHYDRO-5,5-DIMETHYL-FURAN-2-YL)ETHANONE
CAS:141072-75-5
Formula: [C8H13BrO2]
KIN03258211
(S)-2-BROMO-1-(TETRAHYDROFURAN-2-YL)ETHANONE
CAS:141194-61-8
Formula: [C6H9BrO2
KIN03258764
(S)-2-BROMO-1-[4-(2-METHYLBUTOXY)PHENYL]-ETHANONE
CAS:128958-59-8
Formula: C13H17BrO2
KIN03019806
(S)-2-BROMO-1-[4-[(4-METHYLHEXYLOXY)]PHENYL]-ETHANONE
CAS:128958-61-2
Formula: C15H21BrO2
KIN03658828
(S)-2-BROMO-1-[4-[(6-METHYL-OCTYLOXY)]PHENYL]-ETHANONE
CAS:128958-58-7
Formula: C17H25BrO2
KIN03647519
(S)-2-BROMO-1-PHENYL-1-PROPANONE
CAS:100679-76-3
Formula: C9H9BrO
KIN03033860
(S)-2-BROMO-3,3-DIMETHYLBUTANOIC ACID
CAS:32653-37-5
Formula: C5H9BrO2
KIN02198904
MFCD00211267
(S)-2-BROMO-3,4-DIHYDRO-7-HYDROXY-4,4-DIMETHYL-1(2H)-NAPHTHALENONE
CAS:24338-65-6
Formula: C12H13BrO2
KIN02129448
(S)-2-BROMO-3-(1-HYDROXYETHYL)-N-METHOXY-N-METHYLBENZAMIDE
CAS:149832-53-1
Formula: C11H14BrNO3
KIN03294124
(S)-2-BROMO-3-(BENZYLOXY)-PROPANOIC ACID METHYL ESTER
CAS:97486-35-6
Formula: C11H13BrO3
KIN02806294
(S)-2-BROMO-3-METHYLBUTANOIC ACID
CAS:26782-75-2
Formula: C5H9BrO2
KIN02151168
MFCD00210114
(S)-2-BROMO-3-METHYLBUTANOIC ACID METHYL ESTER
CAS:69367-52-8
Formula: C6H11BrO2
KIN02569799
(S)-2-BROMO-5-(1-METHYLBUTOXY)-PYRIMIDINE
CAS:178417-82-8
Formula: C9H13BrN2O
KIN03364756
(S)-2-BROMO-ALPHA-BUTYLBENZENEMETHANOL ACETATE
CAS:182742-54-7
Formula: C13H17BrO2
KIN03373246
(S)-2-BROMO-ALPHA-ETHYLBENZENEMETHANOL
CAS:170379-92-7
Formula: C9H11BrO
KIN03346455
(S)-2-BROMO-ALPHA-PHENYLBENZENEMETHANOL
CAS:182265-16-3
KIN03372530
(S)-2-BROMO-BUTANE
CAS:5787-33-7
Formula: C4H9Br
KIN01141711
(S)-2-BROMO-BUTANE-1,4-DIOL
CAS:105601-94-3
Formula: C4H9BrO2
KIN03069511
(S)-2-BROMO-ISOVALERYL-UREA
CAS:27109-48-4
Formula: C6H11BrN2O2
KIN02154136
(S)-2-BROMO-N-(4-FLUOROPHENYL)-PROPANAMIDE
CAS:40781-42-8
KIN02265753
(S)-2-BROMO-N-(4-METHOXY-PHENYL)-PROPANAMIDE
CAS:40781-41-7
Formula: C10H12BrNO2
KIN02265752
(S)-2-BROMO-N-(5,6,7,9-TETRAHYDRO-1,2,3,10-TETRAMETHOXY-9-OXOBENZO[A]HEPTALEN-7-YL)-ACETAMIDE
CAS:26195-69-7
Formula: C22H24BrNO6
KIN02146293
(S)-2-BROMO-N-[(4-ETHYL-3,4,12,14-TETRAHYDRO-4-HYDROXY-11-METHYL-3,14-DIOXO-1H-PYRANO[3',4':6,7]INDOLIZINO[1,2-B]QUINOLIN-9-YL)METHYL]-ACETAMIDE
CAS:131206-46-7
Formula: C24H22BrN3O5
KIN03213393
(S)-2-BROMO-N-[(4-ETHYL-3,4,12,14-TETRAHYDRO-4-HYDROXY-3,14-DIOXO-1H-PYRANO[3',4':6,7]INDOLIZINO[1,2-B]QUINOLIN-9-YL)METHYL]-ACETAMIDE
CAS:131206-45-6
Formula: C23H20BrN3O5
KIN03213392
(S)-2-BROMOHEXANOIC ACID METHYL ESTER
CAS:114438-64-1
Formula: C7H13BrO2
KIN03130811
(S)-2-BROMOMETHYL-1-METHYLPYRROLIDINE
CAS:60365-88-0
Formula: C6H12BrN
KIN02443876
(S)-2-BROMOMETHYL-1-METHYLPYRROLIDINE HBR
CAS:54352-52-2
Formula: C6H12BrN.BrH
KIN02348636
(S)-2-BROMOMETHYL-1-TRITYLAZIRIDINE
CAS:1008129-10-9
Formula: C22H20BrN
KIN05015430
(S)-2-BROMOMETHYL-2-HYDROXY-8-(4-CHLOROPHENOXY)-OCTANOIC ACID
CAS:467235-27-4
Formula: C15H20BrClO4
KIN03598137
(S)-2-BROMOMETHYL-2-METHYLOXIRANE
CAS:185330-65-8
KIN03379216
(S)-2-BROMOMETHYL-5-ETHOXY-3,4-DIHYDRO-2H-PYRROLE
CAS:180347-71-1
Formula: C7H12BrNO
KIN03369178
(S)-2-BROMOMETHYL-TETRAHYDROFURAN
CAS:57203-03-9
Formula: C5H9BrO
KIN02395627
(S)-2-BROMOOCTANE
CAS:1191-25-9
Formula: C6H12O3
KIN01042626
(S)-2-BROMOPENTANEDIOIC ACID
CAS:51528-22-4
Formula: C5H7BrO4
KIN02307873
(S)-2-BROMOPENTANOIC ACID
CAS:32835-74-8
Formula: C5H9BrO2
KIN02200334
MFCD00210116
(S)-2-BROMOPROPANOIC ACID BUTYL ESTER
CAS:114489-97-3
Formula: C7H13BrO2
KIN03131222
(S)-2-BROMOPROPANOYL CHLORIDE
CAS:22592-73-0
Formula: C3H4BrClO
KIN02112060
(S)-2-BROMOSUCCINIC ACID
CAS:20859-23-8
Formula: C4H5BrO4
KIN02094609
MFCD00153931
(S)-2-BUTANETHIOL
CAS:20407-74-3
Formula: C4H10S
KIN02090847
(S)-2-BUTANOL
CAS:4222-00-8
Formula: C17H14O5
KIN01103294
(S)-2-BUTANOL ALUMINUM SALT
CAS:90278-55-0
Formula: C12H30AlO3
KIN02725150
(S)-2-BUTOXY PROPANOIC ACID
CAS:104631-62-1
Formula: C7H14O3
KIN03062663
(S)-2-BUTOXY-PROPANOIC ACID 4-[2-[4-(OCTYLOXY)PHENYL]PYRIMIDIN-5-YL]PHENYL ESTER
CAS:139905-89-8
Formula: C31H40N2O4
KIN03254816
(S)-2-BUTYL-1-[[4-[[2-(3-CARBOXY-2-METHYL-1H-PYRROL-1-YL)-1-OXO-3-PHENYLPROPYL]AMINO]PHENYL]METHYL]-4-CHLORO-1H-IMIDAZOL-5-ACETIC ACID
CAS:142219-27-0
Formula: C31H33ClN4O5
KIN03264076
(S)-2-BUTYL-4-CHLORO-1-[[4-[[2-[3-(ETHOXYCARBONYL)-2-METHYL-1H-PYRROL-1-YL]-1-OXO-3-PHENYLPROPYL]AMINO]PHENYL]METHYL]-1H-IMIDAZOL-5-ACETIC ACID
CAS:142245-31-6
Formula: C33H37ClN4O5
KIN03264219
(S)-2-BUTYL-4-CHLORO-1-[[4-[[2-[3-(ETHOXYCARBONYL)-2-METHYL-1H-PYRROL-1-YL]-1-OXO-3-PHENYLPROPYL]AMINO]PHENYL]METHYL]-1H-IMIDAZOL-5-ACETIC ACID METHYL ESTER
CAS:142219-18-9
Formula: C34H39ClN4O5
KIN03264075
(S)-2-BUTYL-OXIRANE
CAS:130404-08-9
Formula: C6H12O
KIN03209735
(S)-2-BUTYRAMIDO-4-(METHYLTHIO)BUTANOIC ACID
CAS:54746-52-0
Formula: C9H17NO3S
KIN02354699
N-(1-Oxo-butyl)-L-methionine
(S)-2-BUTYRAMIDO-4-METHYLPENTANOIC ACID
CAS:195060-95-8
Formula: [C10H19NO3
KIN03399558
(S)-2-BUTYRAMIDOSUCCINIC ACID
CAS:1116-10-5
Formula: C10H17NO5
KIN01039934
(S)-2-CARBOXY-1,1-DIMETHYLPYRROLIDINIUM OXALATE
CAS:6198-73-8
Formula: C7H12O5
KIN01152222
(S)-2-CARBOXY-1,1-DIMETHYLPYRROLIDINIUM SALT WITH PICRATE
CAS:6160-27-6
Formula: C8H20N6O8S
KIN01151379
(S)-2-CARBOXY-1,1-DIMETHYLPYRROLIDINIUM SALT WITH PICRATE (1:1)
CAS:37308-53-5
Formula: C7H14NO2.C6H2N3O7
KIN02238533
Stachydrine picrate; 2,4,6-trinitrophenol ion(I) (
(S)-2-CARBOXY-1-PYRROLIDINEACETIC ACID
CAS:33012-76-9
Formula: C7H11NO4
KIN02201703
(S)-2-CARBOXY-5-OXO-1-PYRROLIDINEPROPANOIC ACID
CAS:110523-47-2
Formula: C8H11NO5
KIN03682133
(S)-2-CARBOXY-ALPHA-METHYL-1-AZIRIDINEACETIC ACID
CAS:223522-29-0
Formula: C6H9NO4
KIN03438181
(S)-2-CARBOXY-BETA-OXO-1-PYRROLIDINEPROPANOIC ACID
CAS:65134-70-5
Formula: C8H11NO5
KIN02521847
(S)-2-CARBOXY-PYRROLIDIN-1-YLOXY
CAS:52918-91-9
Formula: C5H8NO3
KIN02327684
(S)-2-CARBOXYMETHYLPYRROLIDINE-1-CARBOXYLIC ACID
CAS:193693-60-6
Formula: C21H21NO4
KIN03396996
(S)-2-CBZ-1-PYRROLIDINEACETIC ACID METHYL ESTER
CAS:87297-08-3
Formula: C15H19NO4
KIN02685722
(S)-2-CBZ-1-PYRROLIDINEPROPANOIC ACID ETHYL ESTER
CAS:87297-24-3
Formula: C17H23NO4
KIN02685727
(S)-2-CHLORO-1-(2,4,6-CYCLOHEPTATRIEN-1-YL)-1-PROPANONE
CAS:128913-26-8
Formula: [C10H11ClO
KIN03203517
(S)-2-CHLORO-1-(4'-ISOBUTYLPHENYL)-PROPAN-1-ONE
CAS:105538-90-7
Formula: C13H17ClO
KIN03069002
(S)-2-CHLORO-1-(4-HEXYLPHENYL)ETHANOL
CAS:1175765-09-9
Formula: C14H21ClO
KIN05267429
(S)-2-CHLORO-1-(5'-CHLORO-6'-METHOXY-2'-NAPHTHYL)-PROPAN-1-ONE
CAS:102770-50-3
Formula: C14H12Cl2O2
KIN03049799
(S)-2-CHLORO-1-(PYRROLIDIN-2-YL)ETHANONE
CAS:38491-75-7
Formula: C6H10ClNO
KIN02248449
(S)-2-CHLORO-1-(PYRROLIDIN-2-YL)ETHANONE HCL
CAS:63762-11-8
KIN02498430
(S)-2-CHLORO-1-[3-(BENZYL)PHENYL]-1-PROPANONE
CAS:154320-58-8
Formula: C16H15ClO
KIN03308292
(S)-2-CHLORO-1-[4-(3-METHYLPENTYL)PHENYL]-ETHANONE
CAS:149222-31-1
Formula: C14H19ClO
KIN03010148
(S)-2-CHLORO-1-[4-(5-METHYL-HEPTYL)PHENYL]-ETHANONE
CAS:149222-32-2
Formula: C16H23ClO
KIN03680422
(S)-2-CHLORO-1-PROPANOL TOSYLATE
CAS:173219-17-5
KIN03353087
(S)-2-CHLORO-3,3-DIMETHYLBUTANOIC ACID
CAS:32659-48-6
Formula: C6H11ClO2
KIN02198950
(S)-2-CHLORO-3-(1-METHYLPROPYL)-PYRAZINE
CAS:143839-72-9
KIN03272622
(S)-2-CHLORO-3-(1-METHYLPROPYL)-PYRIDINE
CAS:128776-23-8
Formula: C9H12ClN
KIN03203034
(S)-2-CHLORO-3-(BENZYLOXY)-1-PROPANOL
CAS:137709-61-6
KIN03242970
(S)-2-CHLORO-3-(OXIRANYLMETHOXY)-PYRIDINE
CAS:152984-03-7
Formula: C8H8ClNO2
KIN03303746
(S)-2-CHLORO-3-METHYL-1-BUTANOL TOSYLATE
CAS:149703-74-2
KIN03293499
(S)-2-CHLORO-3-METHYLBUTAN-1-OL
CAS:82378-45-8
Formula: C5H11ClO
KIN02655173
(S)-2-CHLORO-3-METHYLBUTANOIC ACID
CAS:26782-74-1
Formula: C5H9ClO2
KIN02151167
MFCD00067109
(S)-2-CHLORO-3-METHYLBUTANOIC ACID 4-(CHLOROCARBONYL)PHENYL ESTER
CAS:106793-63-9
Formula: C12H12Cl2O3
KIN03078588
(S)-2-CHLORO-3-METHYLBUTANOIC ACID 4-FORMYLPHENYL ESTER
CAS:166317-77-7
KIN03636231
(S)-2-CHLORO-3-METHYLBUTANOIC ACID 4-HYDROXY-PHENYL ESTER
CAS:112450-44-9
Formula: C11H13ClO3
KIN03115489
(S)-2-CHLORO-4-(BENZYLOXY)-1-BUTANOL
CAS:132980-11-1
KIN03221500
(S)-2-CHLORO-4-(METHYLTHIO)-3-[(5-OXO-PYRROLIDINE-2-YL)METHOXY]BENZOIC ACID
CAS:349480-06-4
Formula: C13H14ClNO4S
KIN03526487
(S)-2-CHLORO-4-(METHYLTHIO)-3-[(5-OXO-PYRROLIDINE-2-YL)METHOXY]BENZOIC ACID ETHYL ESTER
CAS:349480-05-3
Formula: C15H18ClNO4S
KIN03526486
(S)-2-CHLORO-4-HYDROXY-BENZOIC ACID 2-METHYLBUTYL ESTER
CAS:106315-79-1
Formula: C12H15ClO3
KIN03636230
(S)-2-CHLORO-4-METHYLPENTAN-1-OL
CAS:110299-12-2
KIN03100591
(S)-2-CHLORO-4-METHYLPENTAN-1-OL TOSYLATE
CAS:149703-73-1
KIN03293498
(S)-2-CHLORO-4-METHYLPENTANOIC ACID
CAS:28659-81-6
Formula: C6H11ClO2
KIN02167773
MFCD00044943
(S)-2-CHLORO-4-NITRO-BENZOIC ACID 2-METHYLBUTYL ESTER
CAS:116311-51-4
Formula: C12H14ClNO4
KIN03658827
(S)-2-CHLORO-5-(1-METHYLPROPYL)-PYRIDINE
CAS:97182-29-1
Formula: C9H12ClN
KIN02804825
(S)-2-CHLORO-5-(2-METHYLBUTOXY)-PYRAZINE
CAS:117555-34-7
KIN03149490
(S)-2-CHLORO-5-[(1-METHYL-2-AZETIDINYL)METHOXY]PYRAZINE
CAS:161416-55-3
KIN03636229
(S)-2-CHLORO-5-[4-(2-METHYLBUTOXY)PHENYL]-PYRIMIDINE
CAS:117814-24-1
Formula: C15H17ClN2O
KIN03670145
(S)-2-CHLORO-5-[4-(2-METHYLBUTOXY)PHENYL]PYRAZINE
CAS:146602-40-6
KIN03021121
(S)-2-CHLORO-ALPHA-(FORMYLAMINO)PHENYL-ACETIC ACID
CAS:86169-25-7
Formula: C9H8ClNO3
KIN02678787
(S)-2-CHLORO-ALPHA-[[(1-METHYLETHYL)AMINO]METHYL]BENZENEMETHANOL HCL
CAS:33404-81-8
Formula: C11H16ClNO.ClH
KIN02205359
D-Chloroprenaline HCl; D-Chlorprenaline HCl
(S)-2-CHLORO-ALPHA-[[(TERT-BUTYL)AMINO]METHYL]BENZENEMETHANOL
CAS:329183-10-0
Formula: C12H18ClNO
KIN03499870
(S)-2-CHLORO-ALPHA-ETHYLBENZENEMETHANOL
CAS:158635-38-2
Formula: C9H11ClO
KIN03321029
(S)-2-CHLORO-ALPHA-ETHYNYL-ALPHA-PHENYLBENZENEMETHANOL
CAS:86436-16-0
Formula: C15H11ClO
KIN02680387
(S)-2-CHLORO-ALPHA-HYDROXY-BENZENEACETAMIDE
CAS:144664-09-5
Formula: C8H8ClNO2
KIN03276751
(S)-2-CHLORO-ALPHA-METHYLBENZENEETHANAMINE
CAS:13235-81-9
KIN02016805
(S)-2-CHLORO-ALPHA-PHENYLBENZENEMETHANOL
CAS:16071-25-3
KIN02047367
(S)-2-CHLORO-BUTANE
CAS:22156-91-8
KIN02107887
(S)-2-CHLORO-BUTANOIC ACID
CAS:32653-32-0
Formula: C4H7ClO2
KIN02198901
MFCD00067099
(S)-2-CHLORO-BUTANOYL CHLORIDE
CAS:125638-87-1
Formula: C4H6Cl2O
KIN03189499
(S)-2-CHLORO-CYCLOHEXANONE
CAS:64363-89-9
Formula: C6H9ClO
KIN02508785
(S)-2-CHLORO-ETHYL 2-AMINO-PROPANOATE
CAS:116339-89-0
Formula: C5H10ClNO2
KIN03142653
(S)-2-CHLORO-HEXANOIC ACID
CAS:32653-33-1
Formula: C6H11ClO2
KIN02198902
(S)-2-CHLORO-N-(1-PHENYLETHYL)-N-ALLYL-ACETAMIDE
CAS:162103-30-2
KIN03330710
(S)-2-CHLORO-N-(2-CHLOROPHENYL)-PROPANAMIDE
CAS:40781-57-5
Formula: C9H9Cl2NO
KIN02265758
(S)-2-CHLORO-N-(2-HYDROXY-PROPAN-2-YL)-ACETAMIDE
CAS:94193-79-0
Formula: C5H10ClNO2
KIN02778949
(S)-2-CHLORO-N-(3-CHLOROPHENYL)-PROPANAMIDE
CAS:40781-51-9
Formula: C9H9Cl2NO
KIN02265756
(S)-2-CHLORO-N-(3-METHOXY-PHENYL)-PROPANAMIDE
CAS:40781-50-8
Formula: C10H12ClNO2
KIN02265755
(S)-2-CHLORO-N-(3-NITROPHENYL)-PROPANAMIDE
CAS:40781-53-1
Formula: C9H9ClN2O3
KIN02265757
MFCD03147405
(S)-2-CHLORO-N-(4-CHLOROPHENYL)-PROPANAMIDE
CAS:40781-33-7
Formula: C9H9Cl2NO
KIN02265748
(S)-2-CHLORO-N-(4-FLUOROPHENYL)-PROPANAMIDE
CAS:40781-32-6
KIN02265747
(S)-2-CHLORO-N-(CYANOMETHYL)-N-(1-PHENYLETHYL)-ACETAMIDE
CAS:35341-84-5
KIN02222175
(S)-2-CHLORO-N-(TERT-BUTYL)-PROPANAMIDE
CAS:94668-47-0
Formula: C7H14ClNO
KIN02783959
(S)-2-CHLORO-N-(TETRAHYDRO-2,5-DIOXO-FURAN-3-YL)-ACETAMIDE
CAS:41567-23-1
Formula: C6H6ClNO4
KIN02272030
(S)-2-CHLORO-N-[5,6,7,9-TETRAHYDRO-1,2,3-TRIMETHOXY-10-(METHYLTHIO)-9-OXOBENZO[A]HEPTALEN-7-YL]ACETAMIDE
CAS:38479-08-2
Formula: C22H24ClNO5S
KIN02248351
(S)-2-CHLORO-N-CYCLOHEXYLPROPANAMIDE
CAS:94347-46-3
Formula: C9H16ClNO
KIN02780891
(S)-2-CHLORO-NONANE-2-D
CAS:168215-52-9
KIN03342517
(S)-2-CHLORO-OCTANE
CAS:16844-08-9
Formula: C8H17Cl
KIN02055534
(S)-2-CHLORO-SUCCINIC ACID
CAS:4198-47-4
Formula: C6H13O9P.Ba
KIN01102810
(S)-2-CHLOROPENTANEDIOIC ACID
CAS:4189-10-0
Formula: C8H13Cl3O2
KIN01102662
(S)-2-CHLOROPENTANOIC ACID
CAS:32644-12-5
Formula: C5H9ClO2
KIN02198842
MFCD00044960
(S)-2-CHLOROPROPANOIC ACID 2-FORMYLHYDRAZIDE
CAS:134985-18-5
KIN03230809
(S)-2-CHLOROPROPANOIC ACID METHYL ESTER
CAS:73246-45-4
Formula: C4H7ClO2
KIN02596998
MFCD00062941
(S)-2-CHLOROPROPANOIC ACID PHENYLMETHYL ESTER
CAS:153052-86-9
Formula: C10H11ClO2
KIN03303978
(S)-2-CHLOROPROPANOIC ACID TERT-BUTYL ESTER
CAS:101617-24-7
Formula: C7H13ClO2
KIN03040679
(S)-2-CHLOROPROPANOYL CHLORIDE
CAS:70110-24-6
KIN02575239
MFCD20621226
(S)-2-CHLOROSULFONYLMETHYLPYRROLIDINE-1-CARBOXYLIC ACID BENZYL ESTER
CAS:212204-36-9
Formula: C13H16ClNO4S
KIN03423685
(S)-2-CINNAMAMIDO-3-BENZENEPROPANOIC ACID HYDRATE
CAS:73680-56-5
Formula: C18H19NO4
KIN02599936
L-N-Cinnamoyl-3-phenyl-alanine hydrate
(S)-2-CYANO-2-ETHYL-4-PENTENOIC ACID
CAS:82484-81-9
Formula: C8H11NO2
KIN02655817
(S)-2-CYANO-2-ETHYL-4-PENTENOYL CHLORIDE
CAS:82484-82-0
Formula: C8H10ClNO
KIN02655818
(S)-2-CYANO-2-ETHYLPENTANOIC ACID
CAS:56344-82-2
Formula: C8H13NO2
KIN02381241
(S)-2-CYANO-3-METHYLBUTANOIC ACID METHYL ESTER
CAS:92265-42-4
Formula: C7H11NO2
KIN02754911
(S)-2-CYANO-3-METHYLBUTANOIC ACID TERT-BUTYL ESTER
CAS:92265-43-5
Formula: C10H17NO2
KIN02754912
(S)-2-CYANO-N-(4-ETHOXY-PHENYL)-2-(1-METHYLETHYL)PENTANAMIDE
CAS:115176-10-8
Formula: C17H24N2O2
KIN03135794
(S)-2-CYCLOHEPTEN-1-OL
CAS:84580-11-0
Formula: C7H12O
KIN02668508
(S)-2-CYCLOHEXEN-1-YLBENZENE
CAS:61604-88-4
Formula: C12H14
KIN02458677
(S)-2-CYCLOHEXEN-1-YLCARBAMIC ACID TERT-BUTYL ESTER
CAS:153833-68-2
Formula: [C11H19NO2
KIN03306599
(S)-2-CYCLOHEXYL-2-HYDROXYACETIC ACID
CAS:61475-31-8
Formula: C8H14O3
KIN02456670
MFCD00057821
(S)-2-CYCLOHEXYL-3,3,3-TRIFLUOROPROPAN-1-OL
CAS:1180131-05-8
Formula: C9H15F3O
KIN05289380
(S)-2-CYCLOHEXYL-AZIRIDINE
CAS:125043-47-2
Formula: C8H15N
KIN03186848
(S)-2-CYCLOHEXYL-OXIRANEMETHANOL
CAS:74963-03-4
Formula: C9H16O2
KIN02609552
(S)-2-CYCLOHEXYLPROPANOIC ACID
CAS:3527-95-5
Formula: C15H46O7Si7
KIN01090896
(S)-2-CYCLOOCTEN-1-YL-MALONIC ACID DIMETHYL ESTER
CAS:160427-93-0
KIN03022020
(S)-2-CYCLOOCTEN-1-YLAMINE
CAS:135268-94-9
Formula: [C8H15N]
KIN03232039
(S)-2-CYCLOPENTEN-1-OL
CAS:6426-39-7
Formula: C6H12O.1/4ti
KIN01162078
(S)-2-CYCLOPENTEN-1-YLCARBAMIC ACID TERT-BUTYL ESTER
CAS:171034-35-8
Formula: [C10H17NO2
KIN03348267
(S)-2-CYCLOPENTENE-1-ACETIC ACID
CAS:67886-21-9
Formula: C7H10O2
KIN02559089
(S)-2-CYCLOPENTENE-1-CARBONYL CHLORIDE
CAS:91927-20-7
Formula: C6H7ClO
KIN02750649
(S)-2-CYCLOPENTENE-1-ETHANOL
CAS:62358-05-8
Formula: C7H12O
KIN02472635
(S)-2-CYCLOPENTENE-1-ETHANOL TOSYLATE
CAS:67968-56-3
Formula: C14H18O3S
KIN02559689
(S)-2-CYCLOPENTENE-1-METHANOL TOSYLATE
CAS:67886-27-5
Formula: C13H16O3S
KIN02559090
(S)-2-CYCLOPENTENE-1-PROPANENITRILE
CAS:75206-96-1
Formula: C8H11N
KIN02611078
(S)-2-CYCLOPENTYL-2-(N-FMOC-AMINO)-ACETIC ACID
CAS:220497-61-0
Formula: C22H23NO4
KIN03434299
(S)-2-CYCLOPENTYLPYRROLIDINE
CAS:132959-38-7
Formula: C9H17N
KIN03221427
(S)-2-DECEN-5-OLIDE
CAS:61248-45-1
Formula: C10H16O2
KIN02453208
MFCD01862989
(S)-2-DECYLTHIIRANE
CAS:308103-61-9
Formula: C12H24S
KIN03483871
(S)-2-DIBENZYLAMINO-PROPANOIC ACID BENZYL ESTER
CAS:111060-49-2
Formula: C24H25NO2
KIN03105410
(S)-2-DODECANAMIDO-3-BENZENEPROPANOIC ACID
CAS:14379-64-7
Formula: C21H33NO3
KIN02031359
(S)-2-DODECANAMIDO-3-METHYLBUTANOIC ACID
CAS:14379-28-3
Formula: C17H33NO3
KIN02031351
N-dodecanoyl-Valine
MFCD00416663
(S)-2-DODECANAMIDO-5-GUANIDINOPENTANOIC ACID
CAS:42492-22-8
Formula: C18H36N4O3
KIN02278903
N2-(1-Oxododecyl)-L-arginine
(S)-2-DODECANAMIDOPROPANOIC ACID
CAS:52558-74-4
Formula: CH3(CH2)10CONHCH(CH3)COOH
KIN02322695
N-lauroyl-l-alanine
MFCD00216726
(S)-2-DODECANAMIDOSUCCINIC ACID
CAS:1116-14-9
Formula: C18H33NO5
KIN01039938
(S)-2-ETHENYL-1-(TRICHLORO-ACETYL)-PYRROLIDINE
CAS:141521-12-2
Formula: C8H10Cl3NO
KIN03260649
(S)-2-ETHENYL-1-[(METHYLTHIO)-ACETYL]PYRROLIDINE
CAS:112826-00-3
Formula: C9H15NOS
KIN03118516
(S)-2-ETHENYL-2,3-DIHYDRO-5-METHYLBENZOFURAN
CAS:95485-37-3
Formula: C11H12O
KIN02791968
(S)-2-ETHENYL-2,3-DIHYDRO-BENZOFURAN
CAS:69119-19-3
Formula: C10H10O
KIN02568062
(S)-2-ETHENYL-2-HYDROXY-CYCLOHEXANONE
CAS:96304-00-6
Formula: C8H12O2
KIN02799678
(S)-2-ETHENYL-9-(2-METHYLBUTYL)-9H-CARBAZOLE
CAS:60206-34-0
Formula: C19H21N
KIN02442538
(S)-2-ETHENYL-TETRAHYDRO-2H-PYRAN
CAS:89254-39-7
Formula: C7H12O
KIN02709342
(S)-2-ETHENYLPYRROLIDINE-1-CARBOXYLIC ACID PHENYLMETHYL ESTER
CAS:141521-11-1
Formula: C14H17NO2
KIN03260648
(S)-2-ETHOXY-1-PROPANOL TOSYLATE
CAS:122671-56-1
KIN03176123
(S)-2-ETHOXY-2H-PYRAN-6-METHANOL ACETATE
CAS:73189-00-1
Formula: C10H14O4
KIN02596535
(S)-2-ETHOXY-3-(1-METHYLPYRROLIDIN-2-YL)-PYRIDINE
CAS:50550-15-7
Formula: C12H18N2O
KIN02294327
(S)-2-ETHOXY-3-(4-HYDROXY-PHENYL)-PROPANOIC ACID
CAS:325793-65-5
Formula: C11H14O4
KIN03495646
(S)-2-ETHOXY-3-(4-HYDROXY-PHENYL)-PROPANOIC ACID ETHYL ESTER
CAS:222555-06-8
Formula: [C13H18O4
KIN03437265
(S)-2-ETHOXY-3-(4-METHOXY-PHENYL)-PROPANOIC ACID
CAS:343880-41-1
Formula: C12H16O4
KIN03518677
(S)-2-ETHOXY-4,5-DIHYDRO-4-(1-METHYLETHYL)-OXAZOLE
CAS:102922-29-2
Formula: C8H15NO2
KIN03050820
(S)-2-ETHOXY-4,5-DIHYDRO-4-BENZYL-OXAZOLE
CAS:119109-56-7
Formula: [C12H15NO2
KIN03157547
(S)-2-ETHOXY-4,5-DIHYDRO-4-OXAZOLEACETIC ACID ETHYL ESTER
CAS:119109-68-1
Formula: [C9H15NO4
KIN03157550
(S)-2-ETHOXY-4,5-DIHYDRO-4-OXAZOLEETHANOL
CAS:119109-69-2
Formula: C7H13NO3
KIN03157551
(S)-2-ETHOXY-4,5-DIHYDRO-4-OXAZOLEPROPANOIC ACID METHYL ESTER
CAS:119109-66-9
Formula: [C9H15NO4
KIN03157549
(S)-2-ETHOXY-4-(1-METHYLETHYL)-5(4H)-OXAZOLONE
CAS:91613-92-2
Formula: C8H13NO3
KIN02746413
(S)-2-ETHOXY-4-(2-((3-METHYL-1-(2-PIPERIDIN-1-YLPHENYL)BUTYL)AMINO)-2-OXOETHYL)-BENZOIC ACID
CAS:135062-02-1
Formula: C27H36N2O4
KIN03001619
(S)-2-ETHOXY-4-(PHENYLMETHYL)-5(4H)-OXAZOLONE
CAS:117155-97-2
Formula: C12H13NO3
KIN03147663
(S)-2-ETHOXY-4-[2-[[3-METHYL-1-[2-PIPERIDIN-1-YLPHENYL]BUTYL]AMINO]-2-OXOETHYL]BENZOIC ACID PHENYLMETHYL ESTER
CAS:147770-09-0
KIN03287291
(S)-2-ETHOXY-4-[2-[[3-METHYL-1-[2-PIPERIDIN-1-YLPHENYL]BUTYL]AMINO]-2-OXOETHYL]BENZOIC ACID TERT-BUTYL ESTER
CAS:147770-10-3
KIN03287292
(S)-2-ETHOXY-4-METHYL-4,5-DIHYDRO-1H-IMIDAZOLE
CAS:122833-56-1
Formula: C6H12N2O
KIN03176880
(S)-2-ETHOXY-4-PENTYN-1-OL TOSYLATE
CAS:178751-72-9
KIN03365346
(S)-2-ETHOXY-5-(1-METHYLPYRROLIDIN-2-YL)-PYRIDINE
CAS:50550-13-5
Formula: C12H18N2O
KIN02294326
(S)-2-ETHOXY-N-(2-HYDROXY-(R)-1-PHENYLETHYL)-3-[4-(2-{4-METHANESULFONYLOXY-PHENYL}-ETHOXY)PHENYL]PROPANOICAMIDE
CAS:251565-89-6
Formula: C28H33NO7S
KIN03451597
(S)-2-ETHOXY-PROPAN-1,2-DIOL
CAS:91191-95-6
Formula: C5H12O3
KIN02740115
MFCD07367838
(S)-2-ETHOXY-PROPANOIC ACID 4-HYDROXY-PHENYL ESTER
CAS:110961-32-5
KIN03007045
(S)-2-ETHOXYCARBONYLAMINO-2-METHYL-3-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:111063-61-7
Formula: C15H21NO4
KIN03105449
(S)-2-ETHOXYETHYL 2-AMINO-PROPANOATE
CAS:98092-29-6
Formula: C7H15NO3
KIN02810693
L-Alanine 2-ethoxyethyl ester
(S)-2-ETHYL-1,3-PROPANEDIOL MONOACETATE
CAS:161449-30-5
Formula: C7H14O3
KIN03328924
(S)-2-ETHYL-1-(1-OXO-PROPYL)PIPERIDINE
CAS:89578-42-7
Formula: C10H19NO
KIN02713846
(S)-2-ETHYL-1-(2-METHYL-1-OXO-PROPYL)PIPERIDINE
CAS:89578-43-8
Formula: C11H21NO
KIN02713847
(S)-2-ETHYL-1-HEXANOL
CAS:128821-84-1
Formula: C8H18O
KIN03203201
(S)-2-ETHYL-2',6-DIMETHOXY-BIPHENYL
CAS:169057-77-6
KIN03343921
(S)-2-ETHYL-2,3-HEXADIENOIC ACID
CAS:57470-32-3
Formula: C8H12O2
KIN02400210
(S)-2-ETHYL-2,3-PENTADIENOIC ACID
CAS:57470-30-1
Formula: C7H10O2
KIN02400209
(S)-2-ETHYL-2-(N-ETHYLPALMITAMIDO)SUCCINIC ACID
CAS:3397-16-8
Formula: C23H43NO5
KIN01088383
(S)-2-ETHYL-2-AZETIDINECARBOXYLIC ACID
CAS:123053-14-5
Formula: C6H11NO2
KIN03177913
(S)-2-ETHYL-2-HYDROXY-CYCLOHEXANONE
CAS:96304-03-9
Formula: C8H14O2
KIN02799681
(S)-2-ETHYL-2-HYDROXY-PENTANAL
CAS:89556-35-4
Formula: C7H14O2
KIN02713527
(S)-2-ETHYL-2-HYDROXY-PENTANOIC ACID
CAS:89556-41-2
Formula: C7H14O3
KIN02713533
(S)-2-ETHYL-2-HYDROXY-PENTANOIC ACID METHYL ESTER
CAS:89556-39-8
Formula: C8H16O3
KIN02713531
(S)-2-ETHYL-2-METHYLBUTANEDIOIC ACID DIMETHYL ESTER
CAS:4727-86-0
KIN01113432
(S)-2-ETHYL-3-(1-METHYL-2-PYRROLIDINYL)-PYRIDINE
CAS:101926-73-2
Formula: C12H18N2
KIN03672102
(S)-2-ETHYL-3-METHYL-1-BUTANOL
CAS:56116-35-9
Formula: C7H16O
KIN02377624
(S)-2-ETHYL-3-METHYL-3-BUTEN-1-OL
CAS:294176-65-1
Formula: C7H14O
KIN03472783
(S)-2-ETHYL-4,5-DIHYDRO-4-PROPAN-2-YL-OXAZOLE
CAS:88362-45-2
Formula: C8H15NO
KIN02697105
(S)-2-ETHYL-4-(1H-INDOL-3-YLMETHYL)-5(4H)-OXAZOLONE
CAS:21281-85-6
Formula: C14H14N2O2
KIN02099301
(S)-2-ETHYL-4-PHENYL-2,3-BUTADIENOIC ACID
CAS:52340-23-5
Formula: C12H12O2
KIN02319857
(S)-2-ETHYL-5-FLUORO-ALPHA-METHYL-1H-INDOL-1-ETHANAMINE
CAS:169675-40-5
KIN03636228
(S)-2-ETHYL-6-METHYL-HEPTYLAMINE
CAS:33204-58-9
Formula: C10H23N
KIN02203431
(S)-2-ETHYL-HEXANAL
CAS:58712-09-7
Formula: C8H16O
KIN02419890
(S)-2-ETHYL-HEXANOIC ACID PYRROLIDIN-2-YLMETHYL ESTER
CAS:112997-08-7
KIN03658826
(S)-2-ETHYL-OXIRANE
CAS:30608-62-9
Formula: C4H8O
KIN02183477
MFCD02683445
(S)-2-ETHYL-PIPERAZINE
CAS:207284-20-6
Formula: C6H14N2
KIN03417130
(S)-2-ETHYL-PIPERAZINE 2HCL
CAS:128427-05-4
Formula: C6H14N2.2ClH
KIN03201668
(S)-2-ETHYL-PIPERIDINE
CAS:34272-40-7
Formula: C7H15N
KIN02212702
MFCD11046063
(S)-2-ETHYL-TETRAHYDRO-2H-PYRAN
CAS:87561-47-5
Formula: C7H14O
KIN02687640
(S)-2-ETHYL-TETRAHYDRO-4H-PYRAN-4-ONE
CAS:82110-23-4
Formula: C7H12O2
KIN02653482
(S)-2-ETHYLMORPHOLINE
CAS:74572-14-8
Formula: C6H13NO
KIN02606809
(S)-2-ETHYLPENTANAL
CAS:66875-72-7
Formula: C7H14O
KIN02546432
(S)-2-ETHYLPENTANEDIOIC ACID DIMETHYL ESTER
CAS:143008-53-1
Formula: C9H16O4
KIN03267795
(S)-2-ETHYNYL-1-(1-OXO-PROPYL)-PYRROLIDINE
CAS:182754-33-2
Formula: [C9H13NO]
KIN03373276
(S)-2-ETHYNYL-3',4'-DIMETHOXY-N-[1-METHYL-4-PYRIDIN-3-YLBUTYL]-BIPHENYL-4-CARBOXAMIDE
CAS:179007-91-1
Formula: C27H28N2O3
KIN03366183
(S)-2-ETHYNYL-5-OXO-1-PYRROLIDINEACETIC ACID ETHYL ESTER
CAS:159972-29-9
Formula: C10H13NO3
KIN03625025
(S)-2-ETHYNYLPYRROLIDINE OXALATE
CAS:128959-92-2
Formula: C8H11NO4
KIN03203763
(S)-2-FLUORO-1,2,2-TRIPHENYLETHANAMINE
CAS:75198-01-5
Formula: C20H18FN
KIN02611029
(S)-2-FLUORO-1-HEPTANOL
CAS:110500-31-7
Formula: C7H15FO
KIN03101959
(S)-2-FLUORO-1-HEPTANOL TOSYLATE
CAS:131614-07-8
KIN03214947
(S)-2-FLUORO-1-OCTANOL TOSYLATE
CAS:119259-50-6
Formula: C15H23FO3S
KIN03158253
(S)-2-FLUORO-2-(HYDROXYMETHYL)CYCLOHEXANONE
CAS:144462-31-7
Formula: [C7H11FO2
KIN03275786
(S)-2-FLUORO-2-METHYL-3-(BENZYLOXY)-PROPANAL
CAS:117581-75-6
KIN03149657
(S)-2-FLUORO-2-METHYL-HEPTANOIC ACID
CAS:137505-56-7
Formula: C8H15FO2
KIN03241828
(S)-2-FLUORO-3-(HEXADECYCLOXY)-PROPANOL
CAS:92445-92-6
Formula: C19H39FO2
KIN02756801
(S)-2-FLUORO-3-METHYLBUTANOIC ACID
CAS:75244-23-4
Formula: C5H9FO2
KIN02611317
(S)-2-FLUORO-4-[[4-(OCTYLOXY)PHENYL]METHOXY]BENZOIC ACID 2-METHYLBUTYL ESTER
CAS:114045-67-9
Formula: C27H37FO4
KIN03127994
(S)-2-FLUORO-4-IODO-1-(2-METHYLBUTOXY)-BENZENE
CAS:134322-25-1
KIN03227749
(S)-2-FLUORO-4-IODO-BENZOIC ACID 2-METHYLBUTYL ESTER
CAS:145631-21-6
KIN03670144
(S)-2-FLUORO-4-METHYLPENTANOIC ACID
CAS:126957-44-6
Formula: C6H11FO2
KIN03195350
(S)-2-FLUORO-ALPHA-HYDROXY-PHENYL-ACETIC ACID
CAS:175134-34-6
Formula: C8H7FO3
KIN03357459
(S)-2-FLUORO-ALPHA-METHYLBENZENEACETALDEHYDE
CAS:215055-09-7
Formula: [C9H9FO
KIN03427431
(S)-2-FLUORO-ALPHA-METHYLBENZENEETHANOL
CAS:256526-08-6
Formula: [C9H11FO
KIN03455755
(S)-2-FLUORO-BUTANOIC ACID
CAS:95977-22-3
Formula: C4H7FO2
KIN02796886
(S)-2-FLUORO-N-(1-PHENYLETHYL)-ACRYLAMIDE
CAS:139680-31-2
Formula: C11H12FNO
KIN03254120
(S)-2-FLUORO-N-(2-HYDROXY-1-METHYLETHYL)-BENZAMIDE
CAS:179116-89-3
Formula: C10H12FNO2
KIN03011803
(S)-2-FLUORO-N-(5,6,7,9-TETRAHYDRO-1,2,3,10-TETRAMETHOXY-9-OXOBENZO[A]HEPTALEN-7-YL)-ACETAMIDE
CAS:26195-68-6
Formula: C22H24FNO6
KIN02146292
(S)-2-FLUORO-N-[1-(HYDROXYMETHYL)-2,2-DIMETHYLPROPYL]BENZAMIDE
CAS:179116-92-8
Formula: C13H18FNO2
KIN03366583
(S)-2-FLUORO-OCTANE
CAS:56772-74-8
Formula: C8H17F
KIN02388516
(S)-2-FLUOROOCTAN-1-OL
CAS:110500-32-8
Formula: C8H17FO
KIN03101960
(S)-2-FLUOROPROPANOIC ACID
CAS:57965-29-4
Formula: C3H5FO2
KIN02408210
(S)-2-FORMAMIDO-3-(1H-INDOL-3-YL)-PROPANOIC ACID HCL
CAS:38023-86-8
Formula: C12H13ClN2O3
KIN02244592
(S)-2-FORMAMIDO-3-(4-HYDROXY-3-NITROPHENYL)-PROPANOIC ACID
CAS:143730-45-4
Formula: C10H10N2O6
KIN03272001
(S)-2-FORMAMIDO-3-(4-METHOXY-3-NITROPHENYL)-PROPANOIC ACID
CAS:110359-78-9
KIN03101049
(S)-2-FORMAMIDO-3-METHYLBUTANOIC ACID
CAS:4289-98-9
Formula: C6H11NO3S
KIN01104554
(S)-2-FORMAMIDO-4-(METHYLTHIO)-N-(4-NITROPHENYL)BUTYRAMIDE
CAS:102185-40-0
Formula: [C12H15N3O4S
KIN03045106
(S)-2-FORMAMIDO-4-(METHYLTHIO)BUTANOIC ACID
CAS:4289-99-0
Formula: C6H11NO3
KIN01104555
(S)-2-FORMAMIDO-4-METHYLPENTANOIC ACID
CAS:6113-62-8
Formula: C12H8BClO2
KIN01150069
(S)-2-FORMAMIDOPENTANEDIOIC ACID
CAS:1681-98-7
Formula: C10H9N3O
KIN01053246
(S)-2-FORMAMIDOPROPANOIC ACID
CAS:10512-86-4
Formula: C4H7NO3
KIN02007355
N-Formyl-l-alanine
MFCD00037357
(S)-2-FORMIMIDAMIDOPENTANEDIOIC ACID HEMIBARIUM SALT OCTAHYDRATE
CAS:816-91-1
Formula: C8H12N2O6S2
KIN01030431
(S)-2-FORMIMIDAMIDOPROPANOIC ACID
CAS:182623-70-7
Formula: [C4H8N2O2
KIN03373092
(S)-2-FORMIMIDAMIDOSUCCINIC ACID
CAS:2374-46-1
KIN01068064
(S)-2-FORMYLPYRROLIDINE-1-CARBOXYLIC ACID ALLYL ESTER
CAS:126407-70-3
Formula: C9H13NO3
KIN03192950
(S)-2-FORMYLPYRROLIDINE-1-CARBOXYLIC ACID ETHYL ESTER
CAS:103979-69-7
Formula: C8H13NO3
KIN03057703
(S)-2-FURANCARBOXYLIC ACID 2-(1-PHENYLETHYL)HYDRAZIDE
CAS:152922-44-6
KIN03658825
(S)-2-FURANCARBOXYLIC ACID 2-ISOCYANATO-1-METHYL-2-OXOETHYL ESTER
CAS:50911-34-7
Formula: C9H7NO5
KIN02299361
(S)-2-GUANIDINOPENTANEDIOIC ACID
CAS:73477-53-9
Formula: C6H11N3O4
KIN02598608
MFCD00270869
(S)-2-HEPTANOL TOSYLATE
CAS:110482-76-3
KIN03101869
(S)-2-HEPTYL-3,4-DIHYDRO-1-(BENZYL)-2H-PYRROLIUM
CAS:95513-30-7
Formula: C18H28N
KIN02792228
(S)-2-HEXANAMIDO-3-METHYLBUTANOIC ACID
CAS:133849-26-0
Formula: [C11H21NO3]
KIN03225646
(S)-2-HEXANAMIDO-4-METHYLPENTANOIC ACID
CAS:133906-92-0
Formula: [C12H23NO3]
KIN03225902
(S)-2-HEXYL-2,3-DIHYDRO-6-HYDROXY-3-METHYL-1H-ISOINDOL-1-ONE
CAS:113801-08-4
Formula: C15H21NO2
KIN03126117
(S)-2-HEXYLTHIIRANE
CAS:244221-84-9
Formula: C8H16S
KIN03447302
(S)-2-HEXYLTHIOLANE
CAS:1073253-91-4
Formula: C10H20S
KIN05115056
(S)-2-HYDRAZINYL-2-OXO-N-(1-PHENYLETHYL)-ACETAMIDE
CAS:6152-31-4
KIN01151177
(S)-2-HYDRAZINYL-3-METHYLBUTANOIC ACID
CAS:60208-57-3
Formula: C5H12N2O2
KIN02442573
(S)-2-HYDRAZINYL-4-METHYLPENTANOIC ACID
CAS:112674-68-7
Formula: C6H14N2O2
KIN03117299
(S)-2-HYDRAZINYL-5-METHOXY-PENTANOIC ACID
CAS:179746-89-5
Formula: [C6H14N2O3
KIN03367704
(S)-2-HYDRAZINYLPROPANOIC ACID ETHYL ESTER
CAS:54631-40-2
Formula: C5H12N2O2
KIN02353053
(S)-2-HYDROXY-1,2,2-TRIPHENYLETHYL ACETATE
CAS:95061-51-1
Formula: C22H20O3
KIN02787626
MFCD00066241
(S)-2-HYDROXY-1,2-BIS(3-METHOXY-PHENYL)ETHANONE
CAS:1081978-76-8
Formula: C16H16O4
KIN05118132
(S)-2-HYDROXY-1,2-BIS(4-METHYLPHENYL)ETHANONE
CAS:138429-18-2
Formula: C16H16O2
KIN03246759
(S)-2-HYDROXY-1,2-DIPHENYLETHANONE OXIME
CAS:57794-28-2
Formula: C14H13NO2
KIN02405484
(S)--2-Hydroxy-1,2-diphenylethanone oxime
(S)-2-HYDROXY-1,3-DIPHENYL-3-BUTEN-1-ONE
CAS:63257-45-4
Formula: C16H14O2
KIN02489326
(S)-2-HYDROXY-1-(4-METHYLPHENYL)-2-PHENYLETHANONE
CAS:66768-23-8
Formula: C15H14O2
KIN02545471
(S)-2-HYDROXY-1-(6-METHOXY-NAPHTHALEN-2-YL)-1-PROPANONE
CAS:111197-81-0
Formula: C14H14O3
KIN03106276
(S)-2-HYDROXY-1-[4-(2-PROPENYLOXY)PHENYL]-1-PROPANONE
CAS:137758-58-8
Formula: C12H14O3
KIN03658824
(S)-2-HYDROXY-1-METHYL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE
CAS:152251-15-5
Formula: C10H13NO
KIN03647518
(S)-2-HYDROXY-1-PHENYL-1-OCTANONE
CAS:143191-73-5
Formula: C14H20O2
KIN03268714
(S)-2-HYDROXY-2'-METHOXY-1,1'-BI-NAPHTHOL
CAS:35193-69-2
Formula: C21H16O2
KIN02220663
(S)--2-Hydroxy-2'-methoxy-1,1'-bi-naphthol
(S)-2-HYDROXY-2,3-DIMETHYLBUTANOIC ACID
CAS:78640-99-0
Formula: C6H12O3
KIN02632810
(S)-2-HYDROXY-2,4-DIMETHYLPENTANENITRILE
CAS:174849-23-1
Formula: C7H13NO
KIN03357034
(S)-2-HYDROXY-2-((R)-3-HYDROXY-5-OXO-4-(PALMITOYLOXY)-2,5-DIHYDRO-FURAN-2-YL)ETHYL PALMITATE
CAS:4218-86-4
KIN01103235
(S)-2-HYDROXY-2-(4-METHOXY-3-((TRIPROPAN-2-YLSILYLOXY))PHENYL)ETHYL TOSYLATE
CAS:179260-99-2
Formula: C25H38O6SSi
KIN03366844
(S)-2-HYDROXY-2-(HYDROXYMETHYL)-HEXADECANOIC ACID METHYL ESTER
CAS:189576-77-0
Formula: C18H36O4
KIN03389314
(S)-2-HYDROXY-2-(NAPHTHALEN-2-YL)-ACETIC ACID
CAS:144371-23-3
Formula: C12H10O3
KIN03275326
(S)-2-HYDROXY-2-BENZENEPROPANOIC ACID
CAS:13113-71-8
Formula: C9H10O3
KIN02014896
(+)-Atrolactic acid
MFCD00067700
(S)-2-HYDROXY-2-CYCLOHEXYL-ACETONITRILE
CAS:107485-34-7
Formula: C8H13NO
KIN03083002
(S)-2-HYDROXY-2-METHYL-3-BENZENEPROPANOIC ACID
CAS:16433-77-1
KIN02051312
(S)-2-HYDROXY-2-METHYL-4-HEXENOIC ACID
CAS:132314-84-2
Formula: C7H12O3
KIN03218204
(S)-2-HYDROXY-2-METHYL-4-OXO-PENTANOIC ACID METHYL ESTER
CAS:194153-92-9
Formula: C7H12O4
KIN03397851
(S)-2-HYDROXY-2-METHYL-4-PENTENOIC ACID
CAS:62696-40-6
Formula: C6H10O3
KIN02478849
(S)-2-HYDROXY-2-METHYL-SUCCINIC ACID
CAS:6236-10-8
Formula: C5H8O5
KIN01153081
(S)-2-HYDROXY-2-METHYLBUTANOIC ACID
CAS:37505-07-0
Formula: C5H10O3
KIN02239951
MFCD05663610
(S)-2-HYDROXY-2-METHYLBUTENOIC ACID
CAS:292177-91-4
Formula: C5H8O3
KIN03472029
(S)-2-HYDROXY-2-METHYLCYCLOHEXANONE
CAS:96304-02-8
Formula: C7H12O2
KIN02799680
(S)-2-HYDROXY-2-METHYLHEXANAL
CAS:121222-01-3
Formula: C7H14O2
KIN03168590
(S)-2-HYDROXY-2-PHENYLBUTANEDIOIC ACID
CAS:63137-53-1
Formula: C10H10O5
KIN02487112
(S)-2-HYDROXY-2-PHENYLETHYL ACETATE
CAS:103574-67-0
Formula: C10H12O3
KIN03054684
(S)-2-HYDROXY-2-PROPAN-2-YL-SUCCINIC ACID
CAS:49601-06-1
Formula: C7H12O5
KIN02288979
(S)--2-Hydroxy-2-isopropyl-succinic acid
(S)-2-HYDROXY-2-TRIFLUOROMETHYLPROPANOIC ACID
CAS:24435-45-8
Formula: C4H5F3O3
KIN02130467
MFCD07375449
(S)-2-HYDROXY-2-UREIDOACETIC ACID
CAS:7424-09-1
KIN01186630
(S)-2-HYDROXY-3,3-DIMETHYLBUTANAL
CAS:370066-57-2
Formula: C6H12O2
KIN03541931
(S)-2-HYDROXY-3,3-DIMETHYLBUTANOIC ACID
CAS:21641-92-9
Formula: C6H12O3
KIN02102802
MFCD00192212
(S)-2-HYDROXY-3-(1-PHENYLPROPYL)-BENZALDEHYDE
CAS:132932-88-8
KIN03221324
(S)-2-HYDROXY-3-(4-METHOXY-PHENYL)-PROPANOIC ACID ETHYL ESTER
CAS:38618-53-0
Formula: C12H16O4
KIN02249301
MFCD06796130
(S)-2-HYDROXY-3-(BENZYLOXY)-PROPANAL
CAS:144491-19-0
Formula: C10H12O3
KIN03275957
(S)-2-HYDROXY-3-(NAPHTHALEN-1-YLOXY)-PROPANENITRILE
CAS:123356-16-1
Formula: C13H11NO2
KIN03179278
(S)-2-HYDROXY-3-(NAPHTHALEN-1-YLOXY)-PROPANOIC ACID
CAS:80789-59-9
Formula: C13H12O4
KIN02646153
(S)-2-HYDROXY-3-(PHOSPHONOOXY)-PROPANOIC ACID
CAS:73358-94-8
Formula: C3H7O7P
KIN02597795
(S)-2-HYDROXY-3-(TOSYLOXY)-PROPYL PROPANOATE
CAS:141656-36-2
Formula: C13H18O6S
KIN03261382
(S)-2-HYDROXY-3-(TRIBENZYLOXY)-PROPANOIC ACID METHYL ESTER
CAS:111247-96-2
Formula: C23H22O4
KIN03106660
(S)-2-HYDROXY-3-[[2,3,6-TRI-O-ACETYL-4-O-(2,3,4,6-TETRA-O-ACETYL-BETA-D-GALACTOPYRANOSYL)-BETA-D-GLUCOPYRANOSYL]OXY]PROPYL 4-O-BETA-D-GALACTOPYRANOSYL-ALPHA-D-GLUCOPYRANOSIDE
CAS:126873-17-4
Formula: C41H62O30
KIN03194967
(S)-2-HYDROXY-3-[1-(1H-IMIDAZOL-4-YL)ETHYL]-BENZAMIDE HCL
CAS:127170-77-8
Formula: C12H13N3O2.ClH
KIN03196220
(S)-2-HYDROXY-3-HEPTYNENITRILE
CAS:160754-12-1
KIN03327020
(S)-2-HYDROXY-3-MERCAPTO-PROPANAL
CAS:183623-71-4
Formula: C3H6O2S
KIN03375192
(S)-2-HYDROXY-3-MERCAPTO-PROPANOIC ACID METHYL ESTER
CAS:103004-09-7
Formula: C4H8O3S
KIN03051146
(S)-2-HYDROXY-3-METHYL-3-BUTENOIC ACID
CAS:140653-94-7
KIN03256971
(S)-2-HYDROXY-3-METHYLBUTANOIC ACID
CAS:17407-55-5
Formula: C5H10O3
KIN02061714
MFCD00066443
(S)-2-HYDROXY-3-METHYLBUTANOIC ACID 2-(TRIMETHYLSILYL)ETHYL ESTER
CAS:185448-87-7
Formula: C10H22O3Si
KIN03379693
(S)-2-HYDROXY-3-NITROPHENYL 2-BENZAMIDOPROPANOATE
CAS:59921-69-6
Formula: C16H14N2O6
KIN02439543
N-Benzoyl-3-nitro-L-tyrosine
(S)-2-HYDROXY-3-PHENOXY-PROPANOIC ACID
CAS:140460-45-3
Formula: C9H10O4
KIN03256581
(S)-2-HYDROXY-3-PHENYL-N-(1-PHENYLPROPYL)-1-NAPHTHAMIDE
CAS:174636-26-1
Formula: [C26H23NO2]
KIN03356337
(S)-2-HYDROXY-3-PHENYLPROPYL TOSYLATE
CAS:118629-70-2
Formula: C16H18O4S
KIN03155164
(S)-2-HYDROXY-4-(BENZYLOXY)BUTANAL
CAS:177428-61-4
KIN03362371
(S)-2-HYDROXY-4-(METHYLTHIO)BUTANOIC ACID
CAS:48042-96-2
Formula: C5H10O3S
KIN02288134
(S)-2-HYDROXY-4-(THIOPHEN-2-YL)-3-BUTENOIC ACID
CAS:139005-53-1
KIN03250091
(S)-2-HYDROXY-4-[(4-METHYLHEXYLOXY)]BENZALDEHYDE
CAS:112901-66-3
KIN03118961
(S)-2-HYDROXY-4-[(6-METHYL-OCTYLOXY)]BENZALDEHYDE
CAS:82427-45-0
Formula: C16H24O3
KIN02655512
(S)-2-HYDROXY-4-[2-[[3-METHYL-1-[2-PIPERIDIN-1-YLPHENYL]BUTYL]AMINO]-2-OXOETHYL]BENZOIC ACID ETHYL ESTER
CAS:147770-07-8
KIN03287289
(S)-2-HYDROXY-4-METHYL-3-PENTENOIC ACID
CAS:143164-74-3
Formula: C6H10O3
KIN03268588
(S)-2-HYDROXY-4-METHYL-4-PENTENOIC ACID METHYL ESTER
CAS:119072-57-0
Formula: C7H12O3
KIN03670143
(S)-2-HYDROXY-4-METHYLMORPHOLIN-3-ONE
CAS:174746-93-1
Formula: C5H9NO3
KIN03356757
(S)-2-HYDROXY-4-METHYLPENTAN-3-ONE
CAS:86838-21-3
Formula: C6H12O2
KIN02682834
(S)-2-HYDROXY-4-METHYLPENTANENITRILE
CAS:110905-96-9
Formula: C6H11NO
KIN03104310
(S)-2-HYDROXY-4-METHYLPENTANOIC ACID
CAS:13748-90-8
Formula: C6H12O3
KIN02023960
L-Leucic acid; L-alpha-Hydroxy-isocaproic acid
MFCD00064214
(S)-2-HYDROXY-4-METHYLPENTANOIC ACID ETHYL ESTER
CAS:60856-85-1
Formula: C8H16O3
KIN02448446
(S)-2-HYDROXY-4-OCTANONE
CAS:105735-18-0
Formula: C8H16O2
KIN03070602
(S)-2-HYDROXY-4-OXO-BUTANOIC ACID
CAS:62386-30-5
Formula: C4H6O4
KIN02473234
(S)-2-HYDROXY-4-PENTENOIC ACID
CAS:164453-92-3
KIN03335634
(S)-2-HYDROXY-4-PHENYL-3-BUTENENITRILE
CAS:132617-10-8
Formula: C10H9NO
KIN03219637
(S)-2-HYDROXY-4-PHENYL-3-BUTENOIC ACID
CAS:128573-55-7
Formula: C10H10O3
KIN03202263
(S)-2-HYDROXY-4-PHENYLBUTANOIC ACID
CAS:115016-95-0
Formula: [C10H12O3
KIN03134755
(S)-2-HYDROXY-5-[2-[[2-HYDROXY-3-[4-[1-METHYL-4-(TRIFLUOROMETHYL)-1H-IMIDAZOL-2-YL]PHENOXY]PROPYL]AMINO]-ETHOXY]-BENZAMIDE MONOMETHANESULFONATE (SALT)
CAS:105603-76-7
Formula: C23H25F3N4O5.CH4O3S
KIN03069569
(S)-2-HYDROXY-5-[2-[[2-HYDROXY-3-[4-[1-METHYL-4-(TRIFLUOROMETHYL)-1H-IMIDAZOL-2-YL]PHENOXY]PROPYL]AMINO]-ETHOXY]BENZAMIDE
CAS:105603-75-6
KIN03069568
(S)-2-HYDROXY-5-AMINOPENTANOIC ACID
CAS:16814-81-6
Formula: C5H11NO3
KIN02055221
(S)-2-HYDROXY-5-METHOXY-ALPHA,4-DIMETHYLBENZENEETHANOL
CAS:58262-10-5
KIN02412869
(S)-2-HYDROXY-6-[(TRIFLUORO-ACETYL)AMINO]HEXANOIC ACID
CAS:116287-37-7
Formula: C8H12F3NO4
KIN03142300
(S)-2-HYDROXY-6-METHYL-HEPTANOIC ACID ETHYL ESTER
CAS:93097-42-8
Formula: C10H20O3
KIN02765096
(S)-2-HYDROXY-8-NONEN-4-ONE
CAS:102273-62-1
Formula: C9H16O2
KIN03045965
(S)-2-HYDROXY-ALPHA-METHYLPHENYL-ACETIC ACID
CAS:153541-39-0
Formula: C9H10O3
KIN03305505
(S)-2-HYDROXY-BUTANAL
CAS:96243-33-3
Formula: C4H8O2
KIN02799209
(S)-2-HYDROXY-BUTANOIC ACID
CAS:3347-92-0
KIN01087315
(S)-2-HYDROXY-BUTYL BENZOATE
CAS:141339-63-1
Formula: C11H14O3
KIN03259688
(S)-2-HYDROXY-DECANOIC ACID
CAS:70267-29-7
Formula: C10H20O3
KIN02576362
(S)-2-HYDROXY-DECANOIC ACID METHYL ESTER
CAS:95055-97-3
Formula: C11H22O3
KIN02787526
(S)-2-HYDROXY-HEPTANOIC ACID
CAS:52437-21-5
Formula: C7H14O3
KIN02321180
(S)--2-Hydroxy-heptanoic acid
(S)-2-HYDROXY-HEPTANOIC ACID METHYL ESTER
CAS:97211-28-4
Formula: C8H16O3
KIN02805013
(S)-2-HYDROXY-HEXADECANEDIOIC ACID 1-METHYL ESTER
CAS:112848-59-6
Formula: C17H32O5
KIN03118610
(S)-2-HYDROXY-HEXADECANOIC ACID METHYL ESTER
CAS:78330-57-1
Formula: C17H34O3
KIN02630872
(S)-2-HYDROXY-HEXANOIC ACID METHYL ESTER
CAS:106225-85-8
Formula: C7H14O3
KIN03074946
(S)-2-HYDROXY-N,N,N',N'-TETRAMETHYLBUTANEDIAMIDE
CAS:63126-42-1
Formula: C8H16N2O3
KIN02486870
(S)-2-HYDROXY-N,N,N-TRIMETHYL-1-BUTANAMINIUM HYDROXIDE
CAS:93246-18-5
Formula: C7H18NO.HO
KIN02767066
(S)-2-HYDROXY-N-(PROP-2-YNYL)-PROPANAMIDE
CAS:134441-85-3
Formula: [C6H9NO2
KIN03228265
(S)-2-HYDROXY-N-PHENYLPROPANAMIDE COMPD. WITH (R)-ALPHA,4-DIMETHYLBENZENEMETHANAMINE
CAS:201002-90-6
Formula: C9H13N.C9H11NO2
KIN03408317
(S)-2-HYDROXY-N-PHENYLPROPANAMIDE COMPD. WITH (R)-ALPHA-METHYLBENZENEMETHANAMINE
CAS:201002-88-2
Formula: C9H11NO2.C8H11N
KIN03408315
(S)-2-HYDROXY-N-PHENYLPROPANAMIDE COMPD. WITH ALPHA,4-DIMETHYLBENZENEMETHANAMINE
CAS:201002-91-7
Formula: C9H13N.C9H11NO2
KIN03408318
(S)-2-HYDROXY-N-PHENYLPROPANAMIDE COMPD. WITH ALPHA-METHYLBENZENEMETHANAMINE
CAS:201002-89-3
Formula: C9H11NO2.C8H11N
KIN03408316
(S)-2-HYDROXY-N-PROPAN-2-YLPROPANAMIDE
CAS:133964-74-6
Formula: [C6H13NO2
KIN03226147
(S)-2-HYDROXY-N-PROPYLPROPANAMIDE
CAS:88392-20-5
Formula: C6H13NO2
KIN02697539
(S)-2-HYDROXY-OCTANOIC ACID
CAS:70267-27-5
Formula: C8H16O3
KIN02576361
(S)-2-HYDROXY-PENTANAL
CAS:143168-75-6
Formula: C5H10O2
KIN03268616
(S)-2-HYDROXY-PENTANEDIOIC ACID
CAS:13095-48-2
Formula: C5H8O5
KIN02014670
(2S)-2-Hydroxypentanedioic?acid; (2S)-2-Hydroxypen
(S)-2-HYDROXY-PENTANEDIOIC ACID 1-(TERT-BUTYL) 5-[(4-NITROPHENYL)METHYL] ESTER
CAS:55714-68-6
Formula: C16H21NO7
KIN02370859
(S)-2-HYDROXY-PENTANEDIOIC ACID DIHEPTYL ESTER
CAS:51191-88-9
Formula: C19H36O5
KIN02302915
(S)--2-Hydroxy-pentanedioic acid diheptyl ester; (
(S)-2-HYDROXY-PENTANEDIOIC ACID ION(II)
CAS:30868-17-8
Formula: C5H6O5
KIN02185548
L-2-Hydroxy-glutaric acid ion(II)
(S)-2-HYDROXY-PENTANENITRILE
CAS:107537-99-5
Formula: C5H9NO
KIN03083309
(S)-2-HYDROXY-PENTANOIC ACID
CAS:41014-93-1
Formula: C5H10O3
KIN02267752
MFCD00065002
(S)-2-HYDROXY-PENTANOIC ACID METHYL ESTER
CAS:95912-79-1
Formula: C6H12O3
KIN02796449
(S)-2-HYDROXY-PENTANOIC ACID TERT-BUTYL ESTER
CAS:88945-71-5
Formula: C9H18O3
KIN02704724
(S)-2-HYDROXY-PROPANAL
CAS:3913-65-3
KIN01097868
(S)-2-HYDROXY-PROPANAMIDE
CAS:89673-71-2
Formula: C3H7NO2
KIN02715297
(S)--(-)-Lactamide
MFCD00198010
(S)-2-HYDROXY-PROPANOIC ACID
CAS:79-34-5
Formula: C2H2Cl4
KIN01001517
(S)-2-HYDROXY-PROPANOIC ACID (TRIMETHYLSILYL)METHYL ESTER
CAS:103573-62-2
Formula: C7H16O3Si
KIN03054677
(S)-2-HYDROXY-PROPANOIC ACID 2-HYDROXYETHYL ESTER
CAS:138893-48-8
Formula: [C5H10O4
KIN03249461
(S)-2-HYDROXY-PROPANOIC ACID COMPD. WITH (R)-HEXAHYDRO-3,3,8A-TRIMETHYLPYRROLO[1,2-A]PYRIMIDIN-6(2H)-ONE
CAS:110610-80-5
Formula: C10H18N2O.C3H6O3
KIN03102708
(S)-2-HYDROXY-PROPANOIC ACID METHOXYMETHYL ESTER
CAS:99613-36-2
Formula: C5H10O4
KIN02821585
(S)-2-HYDROXY-PROPANOIC ACID MONOAMMONIUM SALT
CAS:137296-15-2
Formula: C3H6O3.H3N
KIN03240822
(S)-2-HYDROXY-PROPYL
CAS:137645-42-2
Formula: C3H7O
KIN03242615
(S)-2-HYDROXY-PROPYL METHANESULFONATE
CAS:262423-83-6
Formula: C4H10O4S
KIN03459947
(S)-2-HYDROXYHEPT-3-ONE
CAS:125850-28-4
Formula: C7H14O2
KIN03190502
(S)-2-HYDROXYHEPTANENITRILE
CAS:106863-48-3
Formula: C7H13NO
KIN03079126
(S)-2-HYDROXYHEXANEDIOIC ACID
CAS:18294-85-4
Formula: C6H10O5
KIN02070713
(S)-2-HYDROXYMETHYL-3-PHYENYL PROPANOIC ACID
CAS:147383-72-0
Formula: C10H12O3
KIN03285845
(S)-2-HYDROXYMETHYLCYCLOHEXANONE
CAS:220199-90-6
Formula: C7H12O2
KIN03433308
(S)-2-HYDROXYTETRACOSANOIC ACID
CAS:54563-87-0
Formula: C24H48O3
KIN02351972
(S)--2-Hydroxytetracosanoic acid
(S)-2-HYDROXYTETRACOSANOIC ACID METHYL ESTER
CAS:54563-86-9
Formula: C25H50O3
KIN02351971
(S)-2-HYDROXYTETRADECANOIC ACID
CAS:67253-09-2
Formula: C14H28O3
KIN02550603
(S)-2-IMINO-1-AZA-3-THIA-BICYCLO[3.3.0]OCTAN-HYDROBROMID
CAS:127075-44-9
Formula: C6H11BrN2S
KIN03195813
(S)-2-IODO-1-(2-IODO-ETHOXY)-1-METHOXYETHANE
CAS:136418-26-3
Formula: C5H10I2O2
KIN03236816
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID
CAS:144759-97-7
Formula: C9H9IO2
KIN03277145
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID ALLYL ESTER
CAS:144789-12-8
KIN03658823
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID BUTYL ESTER
CAS:144789-11-7
KIN03658822
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID ETHYL ESTER
CAS:144789-09-3
Formula: C11H13IO2
KIN03658821
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID METHYL ESTER
CAS:144789-08-2
Formula: C10H11IO2
KIN03647517
(S)-2-IODO-ALPHA-METHYLBENZENEACETIC ACID PROPYL ESTER
CAS:144789-10-6
KIN03647516
(S)-2-IODO-ALPHA-METHYLBENZENEMETHANOL ACETATE
CAS:182742-52-5
Formula: C10H11IO2
KIN03373244
(S)-2-IODO-OCTANE
CAS:1809-05-8
Formula: C5H11I
KIN01056335
(S)-2-ISOBUTYL-PIPERAZINE
CAS:106576-37-8
Formula: C8H18N2
KIN03077168
(S)-2-ISOCHROMAN-1-YLETHANOL
CAS:177742-20-0
Formula: C11H14O2
KIN03362999
(S)-2-ISOCYANATO-4-METHYLPENTANOIC ACID TRIMETHYLSILYL ESTER
CAS:34596-95-7
KIN02215247
(S)-2-ISOCYANATO-HEXANOIC ACID METHYL ESTER
CAS:96789-62-7
Formula: C8H13NO3
KIN02802944
(S)-2-ISOCYANO-3-METHYLBUTANOIC ACID 1-METHYLETHYL ESTER
CAS:112115-11-4
Formula: C9H15NO2
KIN03112769
(S)-2-ISOCYANO-4-METHYLPENTANOIC ACID TERT-BUTYL ESTER
CAS:61900-42-3
Formula: C11H19NO2
KIN02464253
(S)-2-ISOCYANO-BUTANE
CAS:53368-88-0
Formula: C5H9N
KIN02334048
(S)-2-ISOCYANO-N-(1-PHENYLETHYL)-ACETAMIDE
CAS:65484-42-6
Formula: C11H12N2O
KIN02527589
(S)-2-MERCAPTO-4-METHYLPENTANOIC ACID
CAS:66386-08-1
Formula: C6H12O2S
KIN02541347
(S)-2-MERCAPTO-PROPANOIC ACID
CAS:57965-30-7
Formula: C3H6O2S
KIN02408211
(S)--2-Mercapto-propanoic acid; (2S)-2-Sulfanylpro
MFCD01075044
(S)-2-MERCAPTO-PROPANOIC ACID METHYL ESTER
CAS:132958-63-5
Formula: C4H8O2S
KIN03221420
(S)-2-MERCAPTOBUTANOIC ACID
CAS:26473-48-3
Formula: C4H8O2S
KIN02148527
(S)--3-Bromo-butanoic acid; (S)--2-Mercaptobutanoi
MFCD09027320
(S)-2-MERCAPTOSUCCINIC ACID
CAS:74708-34-2
Formula: C4H6O4S
KIN02607804
(S)-2-METHANESULFONYLOXY-4-METHYLPENTANOIC ACID METHYL ESTER
CAS:146746-21-6
Formula: C8H16O5S
KIN03283471
(S)-2-METHOXY-1-PROPANOL TOSYLATE
CAS:114114-86-2
Formula: C11H16O4S
KIN03128614
(S)-2-METHOXY-2-PHENYL-ACETIC ACID-4-NITROPHENYL ESTER
CAS:31528-01-5
Formula: C15H13NO5
KIN02190078
(S)-2-METHOXY-3-(1-METHYLPROPYL)-PYRAZINE 4-OXIDE
CAS:124070-50-4
KIN03019365
(S)-2-METHOXY-3-(4-(3-(4-PHENOXY-PHENOXY)-PROPOXY)PHENYL)-PROPANOIC ACID
CAS:476436-68-7
Formula: C25H26O6
KIN03003486
(S)-2-METHOXY-3-(BENZYLOXY)-1-PROPANOL
CAS:70259-28-8
Formula: C11H16O3
KIN02576262
(S)-2-METHOXY-3-(OCTADECYCLOXY)-1-PROPANAMINE
CAS:89635-95-0
Formula: C22H47NO2
KIN02714655
(S)-2-METHOXY-3-(OCTADECYCLOXY)-PROPYL (1R,2R,3S,4R,6R)-2,3,4,6-TETRAHYDROXY-CYCLOHEXYL CARBONATE
CAS:290812-37-2
Formula: C29H56O9
KIN03471375
(S)-2-METHOXY-3-(OCTADECYCLOXY)-PROPYL 4-O-(2,3,4,6-TETRA-O-ACETYL-ALPHA-D-GLUCOPYRANOSYL)-BETA-D-GLUCOPYRANOSIDE TRIACETATE
CAS:110658-24-7
Formula: C48H80O20
KIN03102969
(S)-2-METHOXY-3-(TETRADECYCLOXY)-PROPANOL
CAS:82873-42-5
Formula: C18H38O3
KIN02658076
(S)-2-METHOXY-3-(TRIBENZYLOXY)-PROPANOIC ACID METHYL ESTER
CAS:111247-97-3
Formula: C24H24O4
KIN03106661