ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

5-METHYL-2-THIOPHENECARBOXYLIC ACID ETHYL ESTER 1,1-DIOXIDE
CAS:158875-35-5
KIN03321736
5-METHYL-2-THIOPHENECARBOXYLIC ACID METHYL ESTER
CAS:19432-69-0
Formula: C7H8O2S
KIN02081320
MFCD06203669
5-METHYL-2-THIOPHENECARBOXYLIC ACID PROPARGYL ESTER
CAS:116041-68-0
KIN03674742
5-METHYL-2-THIOPHENECARBOXYLIC ACID PROPYLESTER
CAS:1071631-88-3
Formula: C9H12O2S
KIN05113161
5-METHYL-2-THIOPHENECARBOXYLIC ACID SODIUM SALT
CAS:112158-43-7
Formula: C6H6O2S.Na
KIN03113080
5-METHYL-2-THIOPHENECARBOXYLIC ACID TETRAHYDRO-2-OXO-FURAN-3-YL ESTER
CAS:452288-56-1
Formula: C10H10O4S
KIN03592482
5-METHYL-2-THIOPHENEETHANAMINE
CAS:30433-92-2
Formula: C7H11NS
KIN02182252
MFCD08059759
5-METHYL-2-THIOPHENEETHANOL
CAS:19498-70-5
KIN02081827
5-METHYL-2-THIOPHENEHEXANOIC ACID
CAS:1153514-86-3
Formula: C11H16O2S
KIN05211141
5-METHYL-2-THIOPHENEMETHANAMINE
CAS:104163-34-0
Formula: [C6H9NS
KIN03059184
5-METHYL-2-THIOPHENEMETHANAMINE HCL
CAS:171661-55-5
Formula: [C6H10ClNS
KIN03349474
5-METHYL-2-THIOPHENEMETHANETHIOL
CAS:136358-89-9
KIN03236471
5-METHYL-2-THIOPHENEMETHANOL
CAS:63826-59-5
Formula: C6H8OS
KIN02499532
5-METHYL-2-THIOPHENEMETHANOL 2-ACETATE
CAS:72306-62-8
Formula: C8H10O2S
KIN02590459
5-METHYL-2-THIOPHENEMETHANOL METHYLCARBAMATE
CAS:52316-41-3
KIN02319323
5-METHYL-2-THIOPHENEPENTANAMIDE
CAS:100131-93-9
KIN03028923
5-METHYL-2-THIOPHENEPENTANOIC ACID
CAS:13030-67-6
KIN02013732
5-METHYL-2-THIOPHENEPENTANOYL CHLORIDE
CAS:103323-76-8
KIN03053165
5-METHYL-2-THIOPHENEPROPANAMINE
CAS:1000530-84-6
Formula: C8H13NS
KIN05002274
5-METHYL-2-THIOPHENEPROPANOIC ACID
CAS:14779-24-9
Formula: C8H10O2S
KIN02035654
5-METHYL-2-THIOPHENEPROPANOIC ACID ETHYL ESTER
CAS:77626-62-1
Formula: C10H14O2S
KIN02626656
5-METHYL-2-THIOPHENEPROPANOIC ACID METHYL ESTER
CAS:14779-30-7
KIN02035657
5-METHYL-2-THIOPHENEPROPANOL
CAS:77626-58-5
Formula: C8H12OS
KIN02626652
5-METHYL-2-THIOPHENEPROPANOL 2-ACETATE
CAS:111511-07-0
KIN03108339
5-METHYL-2-THIOPHENESULFONAMIDE
CAS:53595-69-0
Formula: C5H7NO2S2
KIN02337561
5-Methylthiophene-2-sulfonamide
MFCD08444612
5-METHYL-2-THIOPHENESULFONIC ACID
CAS:73348-45-5
Formula: C5H6O3S2
KIN02597732
5-METHYL-2-THIOPHENESULFONIC ACID HYDRAZIDE
CAS:78380-35-5
Formula: C5H8N2O2S2
KIN02631174
5-METHYL-2-THIOPHENESULFONIC ACID SODIUM SALT
CAS:63988-95-4
Formula: C5H6O3S2.Na
KIN02502506
5-METHYL-2-THIOPHENESULFONYL AZIDE
CAS:1030824-61-3
Formula: C5H5N3O2S2
KIN05065861
5-METHYL-2-THIOPHENESULFONYL CHLORIDE
CAS:55854-45-0
Formula: C5H5ClO2S2
KIN02373441
5-Methylthiophene-2-sulfonyl chloride
MFCD05864499
5-METHYL-2-THIOPHENETHIOL
CAS:3970-29-4
KIN01098739
5-METHYL-2-THIOXO-1,3,4-THIADIAZOL-3(2H)-CARBALDEHYDE
CAS:100747-87-3
Formula: C4H4N2OS2
KIN03034421
5-METHYL-2-THIOXO-1H-IMIDAZOLIDINE-4-ONE -PYRROLIDINE-2-CARBOXYLATE
CAS:1968-37-2
Formula: C7H11N3O2S
KIN01059891
5-METHYL-2-THIOXO-1H-IMIDAZOLIDINE-4-ONE 2-AMINO-5-GUANIDINOPENTANOATE HCL
CAS:3120-04-5
Formula: C11H9NO2
KIN01082703
5-METHYL-2-THIOXO-2H-IMIDAZOL-4-CARBOXAMIDE
CAS:129015-07-2
Formula: C5H5N3OS
KIN03204003
5-METHYL-2-THIOXO-4(1H)-IMIDAZOLIDINONE
CAS:33368-94-4
Formula: C4H6N2OS
KIN02205052
5-METHYL-2-THIOXO-4-OXAZOLIDINONE
CAS:98019-64-8
Formula: C4H5NO2S
KIN02809777
5-METHYL-2-THIOXO-TETRAHYDROPYRIMIDIN-4-ONE
CAS:4338-94-7
Formula: C17H20N2S
KIN01105444
5-METHYL-2-TRICHLOROMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:3584-64-3
KIN01092006
5-METHYL-2-TRIDECYLBENZENESULFONIC ACID
CAS:88109-76-6
Formula: C20H34O3S
KIN02693397
5-METHYL-2-UNDECENE
CAS:56851-34-4
Formula: C12H24
KIN02389623
5-METHYL-2-UNDECYL-[1,3]DIOXOLANE-4-CARBOXYLIC ACID SODIUM SALT
CAS:141071-37-6
Formula: C16H30O4.Na
KIN03258190
5-METHYL-2-UNDECYL-1H-IMIDAZOL-4-CARBODITHIOIC ACID
CAS:84255-19-6
Formula: C16H28N2S2
KIN02666214
5-METHYL-2-UNDECYL-2-OXAZOLINE
CAS:7504-78-1
Formula: C16H10Cl2O4S
KIN01189846
5-METHYL-2-VINYL-4-HEXEN-1-OL ALLOPHANATE
CAS:110359-02-9
Formula: C11H18N2O3
KIN03101047
5-METHYL-2-VINYLPYRIDINE
CAS:107411-10-9
Formula: C8H9N
KIN03082558
5-METHYL-2H-[1,2,4]-TRIAZOLO[4,3-A]PYRIDIN-3-THIONE
CAS:4926-23-2
Formula: C7H7N3S
KIN01117362
5-METHYL-2H-1,2,4-OXADIAZOLO[2,3-A]PYRIDIN-2-THIONE
CAS:65478-60-6
Formula: C7H6N2OS
KIN02527455
5-METHYL-2H-1,2,4-OXADIAZOLO[2,3-C]QUINAZOLIN-2-ONE
CAS:61844-46-0
Formula: C10H7N3O2
KIN02463052
5-METHYL-2H-1,2,6-THIADIAZINE 1,1-DIOXIDE
CAS:79991-29-0
Formula: C4H6N2O2S
KIN02641109
5-METHYL-2H-1,3,4-OXADIAZIN-2,6(3H)-DIONE
CAS:58792-17-9
Formula: C4H4N2O3
KIN02421224
5-METHYL-2H-1,3-OXAZIN-2,6(3H)-DIONE
CAS:51255-10-8
Formula: C5H5NO3
KIN02303918
5-METHYL-2H-1,3-THIAZIN-2,4(3H)-DIONE
CAS:10048-54-1
Formula: C5H5NO2S
KIN02001287
5-METHYL-2H-1,4-THIAZIN-3(4H)-ONE
CAS:22390-69-8
Formula: C5H7NOS
KIN02110204
5-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:31366-49-1
Formula: C9H9NO2
KIN02188872
5-METHYL-2H-BENZO[B][1,4]OXAZINE-2,3(4H)-DIONE
CAS:72985-52-5
Formula: C9H7NO3
KIN02595089
5-METHYL-2H-BENZO[B]OXET-2-ONE
CAS:41743-74-2
Formula: C8H6O2
KIN02273225
5-METHYL-2H-BENZO[D][1,3]DIOXOLE
CAS:7146-00-1
Formula: C11H15NO
KIN01179631
5-METHYL-2H-BENZO[D]IMIDAZOL-2-ONE
CAS:29844-42-6
Formula: C8H6N2O
KIN02177089
5-METHYL-2H-BENZOTRIAZOL-2-METHANOL
CAS:1065651-59-3
Formula: C8H9N3O
KIN05109617
5-METHYL-2H-CHROMEN-2-ONE
CAS:42286-84-0
Formula: C10H8O2
KIN02277324
5-METHYL-2H-FURO[3,2-G]CHROMEN-7(3H)-ONE
CAS:24416-64-6
Formula: C12H10O3
KIN02130291
5-METHYL-2H-INDOL-2-ONE
CAS:1174006-92-8
Formula: C9H7NO
KIN05265311
5-METHYL-2H-PYRAN-2,4(3H)-DIONE
CAS:98198-34-6
Formula: C6H6O3
KIN02811765
5-METHYL-2H-PYRAN-2,6(3H)-DIONE
CAS:56298-63-6
Formula: C6H6O3
KIN02380476
5-METHYL-2H-PYRAZOLO[3,4-B]PYRIDINE
CAS:1160246-04-7
Formula: C7H7N3;C7H7N3
KIN05257365
5-METHYL-2H-PYRAZOLO[3,4-B]PYRIDINE-2-PROPANENITRILE
CAS:1160246-33-2
Formula: C10H10N4
KIN05257373
5-METHYL-2H-PYRROL-3-OL
CAS:68332-46-7
Formula: C5H7NO
KIN02562545
5-METHYL-2H-TETRAZOL-2-METHANOL
CAS:86979-32-0
Formula: C3H6N4O
KIN02683632
5-METHYL-2H-TETRAZOLE
CAS:94079-30-8
Formula: C2H4N4
KIN02777398
5-METHYL-2H-TETRAZOLE 1-OXIDE
CAS:121316-32-3
KIN03169067
5-METHYL-2H-TETRAZOLE AMMONIATE (1:2)
CAS:157280-44-9
KIN03317670
5-METHYL-2H-TETRAZOLE BARIUM SALT (2:1)
CAS:153401-64-0
KIN03304995
5-METHYL-2H-TETRAZOLE CALCIUM SALT (2:1)
CAS:153401-63-9
KIN03304994
5-METHYL-2H-TETRAZOLE CESIUM SALT (1:1)
CAS:1084890-05-0
KIN05124904
5-METHYL-2H-TETRAZOLE COMPD. WITH CYCLOHEXANAMINE
CAS:157280-98-3
KIN03021846
5-METHYL-2H-TETRAZOLE COMPD. WITH N,N-DIETHYLETHANAMINE
CAS:157281-09-9
KIN03629948
5-METHYL-2H-TETRAZOLE COPPER(II) SALT (2:1)
CAS:143936-33-8
KIN03273070
5-METHYL-2H-TETRAZOLE DIMER
CAS:1104989-28-7
KIN05170271
5-METHYL-2H-TETRAZOLE ION(I)
CAS:67648-55-9
KIN02556284
5-METHYL-2H-TETRAZOLE RUBIDIUM SALT (1:1)
CAS:1084890-04-9
KIN05124903
5-METHYL-2H-TETRAZOLE SODIUM SALT
CAS:40370-03-4
KIN02262321
5-Methyl-1H-tetrazole sodium salt; 5-Methyl-tetraz
5-METHYL-3'-C-(TRIFLUOROMETHYL)-URIDINE
CAS:162894-35-1
KIN03332508
5-METHYL-3'-C-METHYL-2'-O-METHYL-URIDINE
CAS:159312-41-1
KIN03322958
5-METHYL-3'-NITRO-BIPHENYL-2-OL
CAS:132555-27-2
KIN03219362
5-METHYL-3'-O-PROPYL-URIDINE
CAS:182495-85-8
KIN03372919
5-METHYL-3'-URIDYLIC ACID
CAS:3352-23-6
Formula: C20H25N10O11P
KIN01087418
5-METHYL-3(2H)-BENZOFURANONE OXIME
CAS:109926-32-1
Formula: C9H9NO2
KIN03098248
5-METHYL-3(2H)-FURANONE
CAS:3511-33-9
Formula: C7H8O3
KIN01090566
5-METHYL-3(2H)-FURANTHIONE
CAS:65936-85-8
Formula: C5H6OS
KIN02534631
5-METHYL-3(2H)-ISOQUINOLINONE
CAS:51463-07-1
Formula: C10H9NO
KIN02306840
5-METHYL-3(2H)-ISOTHIAZOLONE
CAS:2825-30-1
KIN01076836
5-METHYL-3(2H)-ISOTHIAZOLONE 1,1-DIOXIDE
CAS:31028-44-1
KIN02186568
5-METHYL-3(2H)-ISOTHIAZOLONE 1-OXIDE
CAS:31028-30-5
KIN02186564
5-METHYL-3(2H)-ISOXAZOLETHIONE
CAS:69528-40-1
Formula: C4H5NOS
KIN02570988
5-METHYL-3(2H)-ISOXAZOLONE
CAS:128907-24-4
KIN03203504
5-METHYL-3(2H)-ISOXAZOLONE CALCIUM SALT DIHYDRATE
CAS:194143-81-2
Formula: C4H5NO2.1/2Ca.H2O
KIN03023421
5-METHYL-3(2H)-PYRIDAZINONE
CAS:54709-94-3
Formula: C5H6N2O
KIN02354133
5-Methyl-pyridazin-3-ol; 5-Methylpyridazin-3-ol
MFCD09743644
5-METHYL-3(2H)-THIOPHENONE
CAS:121781-88-2
KIN03171543
5-METHYL-3(2H)-THIOPHENONE 1,1-DIOXIDE
CAS:101455-55-4
KIN03039520
5-METHYL-3,3'-BI-1,2,4-OXADIAZOLE
CAS:162969-66-6
KIN03332630
5-METHYL-3,3'-BIPYRIDINE
CAS:78210-82-9
Formula: C11H10N2
KIN02629973
5-METHYL-3,3-BIS(TRIFLUOROMETHYL)-3H-2,1-BENZOXATHIOLE
CAS:57565-50-1
Formula: C10H6F6OS
KIN02401684
5-METHYL-3,3-BIS(TRIFLUOROMETHYL)-3H-2,1-BENZOXATHIOLE 1-OXIDE
CAS:57565-55-6
Formula: C10H6F6O2S
KIN02401686
5-METHYL-3,3-DIPHENYL-2(3H)-BENZOFURANONE
CAS:55190-58-4
KIN02362172
5-METHYL-3,3-DIPHENYL-4-HEXEN-2-ONE
CAS:51507-33-6
Formula: C19H20O
KIN02307557
5-METHYL-3,3A,4,5,6,7-HEXAHYDRO-2H-INDOLE
CAS:176097-75-9
Formula: C9H15N
KIN03360210
5-METHYL-3,4'-BIPYRIDINE
CAS:362478-91-9
Formula: C11H10N2
KIN03537695
5-METHYL-3,4,5-TRIPHENYL-5H-FURAN-2-ONE
CAS:29021-87-2
Formula: C23H18O2
KIN02170741
5-METHYL-3,4,6-TRIPHENYL-2-(2-PHENYLETHENYL)-3H-AZEPINE
CAS:33070-67-6
Formula: C33H27N
KIN02202253
5-METHYL-3,4-DIHYDRO-2H-PYRROLE
CAS:872-33-3
KIN01032279
5-METHYL-3,4-DIHYDRONAPHTHALEN-2(1H)-ONE
CAS:4242-17-5
Formula: C13H16O2
KIN01103700
5-METHYL-3,4-DIHYDROPYRAZOL-2-CARBOXAMIDE
CAS:17014-30-1
Formula: C5H9N3O
KIN02057240
5-METHYL-3,4-DINITRO-1H-PYRAZOL-1-ACETAMIDE
CAS:1006548-21-5
Formula: C6H7N5O5
KIN05013022
5-METHYL-3,4-DINITRO-1H-PYRAZOL-1-ACETIC ACID
CAS:299405-25-7
KIN03475066
5-METHYL-3,4-DINITRO-1H-PYRAZOL-1-BUTANENITRILE
CAS:1006536-84-0
Formula: C8H9N5O4
KIN05012985
5-METHYL-3,4-DINITRO-1H-PYRAZOL-1-PROPANENITRILE
CAS:1006535-00-7
Formula: C7H7N5O4
KIN05012977
5-METHYL-3,4-DINITRO-N-PROPYL-1H-PYRAZOL-1-ACETAMIDE
CAS:381204-39-3
KIN03663643
5-METHYL-3,4-DIPHENYL-1H-PYRROL-2-CARBALDEHYDE
CAS:14533-79-0
KIN02032965
5-METHYL-3,4-DIPHENYL-2(5H)-FURANONE
CAS:52313-14-1
Formula: C17H14O2
KIN02319273
5-METHYL-3,4-DIPHENYL-2(5H)-THIOPHENONE
CAS:127582-38-1
KIN03197931
5-METHYL-3,4-DIPHENYL-2-CYCLOPENTEN-1-ONE
CAS:95124-85-9
Formula: C18H16O
KIN02788657
5-METHYL-3,4-DIPHENYL-2-THIOPHENECARBALDEHYDE
CAS:226918-22-5
KIN03440704
5-METHYL-3,4-DIPHENYL-4,5-DIHYDRO-ISOXAZOL-5-OL
CAS:181696-73-1
Formula: C16H15NO2
KIN03371379
5-METHYL-3,4-DIPHENYL-4-HEXEN-2-ONE
CAS:71597-62-1
Formula: C19H20O
KIN02585437
5-METHYL-3,4-DIPHENYL-ISOXAZOLE
CAS:37928-17-9
Formula: C16H13NO
KIN02243918
5-METHYL-3,4-DIPROPYL-PHTHALONITRILE
CAS:125774-02-9
KIN03190116
5-METHYL-3,4-HEPTADIEN-1-OL 1-( TOSYLATE)
CAS:308144-04-9
KIN03483931
5-METHYL-3,4-HEXADIEN-1-OL
CAS:54795-27-6
Formula: C7H12O
KIN02355487
5-METHYL-3,4-HEXADIEN-1-OL 1-( TOSYLATE)
CAS:144348-02-7
Formula: C14H18O3S
KIN03275220
5-METHYL-3,4-HEXADIEN-1-YLAMINE
CAS:144347-94-4
Formula: C7H13N
KIN03275219
5-METHYL-3,4-HEXADIEN-2-OL
CAS:2425-51-6
Formula: C18H36O3S.Na
KIN01069224
5-METHYL-3,4-HEXADIEN-2-OL ACETATE
CAS:89228-84-2
Formula: C9H16O3
KIN02708936
5-METHYL-3,4-HEXADIEN-2-ONE
CAS:50598-53-3
Formula: C7H10O
KIN02294951
5-METHYL-3,4-ISOXAZOLEDIAMINE
CAS:216321-12-9
Formula: C4H7N3O
KIN03429005
5-METHYL-3,4-ISOXAZOLEDICARBOXAMIDE
CAS:400077-37-4
Formula: C6H7N3O3
KIN03560976
5-METHYL-3,4-ISOXAZOLEDICARBOXYLIC ACID
CAS:198135-45-4
Formula: C6H5NO5
KIN03403943
5-METHYL-3,4-ISOXAZOLEDICARBOXYLIC ACID 3,4-DIHYDRAZIDE
CAS:17334-64-4
Formula: C6H9N5O3
KIN02060964
5-METHYL-3,4-ISOXAZOLEDICARBOXYLIC ACID 3-ETHYL 4-METHYL ESTER
CAS:198135-28-3
Formula: C9H11NO5
KIN03403942
5-METHYL-3,4-ISOXAZOLEDICARBOXYLIC ACID 3-ETHYL ESTER
CAS:474678-51-8
Formula: C8H9NO5
KIN03601589
5-METHYL-3,4-ISOXAZOLEDICARBOXYLIC ACID 3-METHYL ESTER
CAS:1003584-56-2
Formula: C7H7NO5
KIN05008422
5-METHYL-3,4-OCTADIENE-1,8-DIOL
CAS:85217-14-7
Formula: C9H16O2
KIN02672743
5-METHYL-3,4-PYRIDINEDIAMINE
CAS:13958-86-6
Formula: C6H9N3
KIN02026448
5-METHYL-3,4-PYRIDINEDICARBOXYLIC ACID
CAS:90345-13-4
Formula: C8H7NO4
KIN02726367
5-Methyl-3,4-pyridinedicarboxylic acid
5-METHYL-3,5-DIHYDRO-1H-[1,2,4]TRIAZINO[3,4-C][1,4]BENZOXAZIN-2-ONE
CAS:139605-55-3
Formula: C11H11N3O2
KIN03253717
5-METHYL-3,5-DIHYDRO-1H-[1,2,4]TRIAZINO[3,4-C]BENZO[B][1,4]THIAZIN-2-ONE
CAS:139605-59-7
Formula: C11H11N3OS
KIN03253721
5-METHYL-3,5-DIPHENYL-4H-1,2-OXAZOL-4-OL
CAS:7463-19-6
Formula: C15H33O4P
KIN01187556
5-METHYL-3,5-DIPHENYL-5H-2-BENZAZEPINE
CAS:95206-95-4
Formula: C23H19N
KIN02789266
5-METHYL-3,5-HEPTADIEN-1-OL ACETATE
CAS:65395-93-9
Formula: C10H16O2
KIN02526014
5-METHYL-3,5-HEXADIEN-2-ONE
CAS:49859-69-0
Formula: C7H10O
KIN02290982
5-METHYL-3,6,8-TRIOXA-BICYCLO[3.2.1]OCTANE
CAS:30120-60-6
Formula: C6H10O3
KIN02179414
5-METHYL-3,6-BIS(2-METHYLPROPYL)-2(1H)-PYRAZINONE
CAS:170028-21-4
KIN03022431
5-METHYL-3,6-BIS(BENZYL)-2(1H)-PYRAZINONE
CAS:155650-95-6
KIN03312958
5-METHYL-3,6-DIOXO-1,4-CYCLOHEXADIEN-1-CARBALDEHYDE
CAS:395643-31-9
Formula: [C8H6O3
KIN03559055
5-METHYL-3,6-DIOXO-2-PIPERAZINEACETAMIDE
CAS:397847-83-5
Formula: [C7H11N3O3
KIN03560080
5-METHYL-3,6-DIPHENYL-2(1H)-PYRAZINONE
CAS:108977-86-2
KIN03092515
5-METHYL-3,6-DIPHENYL-2-PYRAZINEMETHANOL
CAS:75456-79-0
Formula: C18H16N2O
KIN02612786
5-METHYL-3,6-DIPHENYL-2H-1,3-OXAZIN-2,4(3H)-DIONE
CAS:93598-73-3
Formula: C17H13NO3
KIN02771190
5-METHYL-3,7-BISPROPAN-2-YL-4H-1,2-DIAZEPINE
CAS:88829-71-4
Formula: C12H20N2
KIN02703226
5-METHYL-3,7-DIOXA-4,6-DISILANONANE
CAS:28848-11-5
Formula: C6H18O2Si2
KIN02169287
5-METHYL-3,7-DIOXO-HEPTANOIC ACID METHYL ESTER
CAS:137910-87-3
Formula: C9H14O4
KIN03243971
5-METHYL-3,7-DIPHENYL-1H-PYRROLO[3,4-D]PYRIMIDIN-2,4(3H,6H)-DIONE
CAS:57436-21-2
Formula: C19H15N3O2
KIN02399624
5-METHYL-3,7-DIPHENYLPYRAZOLO[1,5-A]PYRIMIDIN-2(1H)-ONE
CAS:140706-32-7
KIN03257245
5-METHYL-3,7-DIPHENYLPYRIDO[2,3-D]PYRIMIDIN-2,4(1H,3H)-DIONE
CAS:1913-70-8
KIN01058732
5-METHYL-3,8-DINITRO-6-PHENYLPHENANTHRIDINIUM BROMIDE
CAS:66180-22-1
Formula: C20H14BrN3O4
KIN02538243
5-METHYL-3,8-DIOXO-2,4,7,9-TETRAAZADECANEDIAMIDE
CAS:124522-02-7
KIN03184544
5-METHYL-3-((2-(MORPHOLIN-4-YL)ETHYL)THIO)-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:3993-29-1
KIN01099156
5-METHYL-3-((MORPHOLIN-4-YL)METHYL)-5-STYRYL-HYDANTOIN
CAS:19967-89-6
Formula: C17H21N3O3
KIN02086668
5-METHYL-3-(-PYRROLIDINE-1-YL)-1,2-BENZENEDICARBOXYLIC ACID 1,2-DIMETHYL ESTER
CAS:7395-80-4
Formula: C18H19N.ClH
KIN01185760
5-METHYL-3-(1,2,2-TRIMETHYLCYCLOPENTYL)-BENZENE-1,2-DIOL
CAS:175355-97-2
Formula: C15H22O2
KIN03358778
5-METHYL-3-(1,2,3,6-TETRAHYDROPYRIDIN-4-YL)-1H-INDOLE
CAS:460354-14-7
Formula: C14H16N2
KIN03595633
5-METHYL-3-(1-METHYL-1,2,5,6-TETRAHYDROPYRIDIN-3-YL)-1H-INDOLE
CAS:173927-69-0
KIN03354544
5-METHYL-3-(1-METHYL-3,6-DIHYDRO-2H-PYRIDIN-4-YL)-1H-INDOLE
CAS:116480-59-2
Formula: C15H18N2
KIN03143939
5-METHYL-3-(1-METHYL-4-NITRO-1H-IMIDAZOL-5-YL)-1,2,4-OXADIAZOLE
CAS:32000-15-0
Formula: C7H7N5O3
KIN02193666
5-METHYL-3-(1-METHYL-4-NITRO-1H-PYRAZOL-5-YL)-1,2,4-OXADIAZOLE
CAS:36123-03-2
KIN02229133
5-METHYL-3-(1-METHYL-5-NITRO-1H-IMIDAZOL-2-YL)-1,2,4-OXADIAZOLE
CAS:37579-16-1
Formula: C7H7N5O3
KIN02240716
5-METHYL-3-(1-METHYLBUTYL)-1H-PYRROL-2-CARBOXAMIDE
CAS:1079360-99-8
Formula: C11H18N2O
KIN05116570
5-METHYL-3-(1-METHYLBUTYL)-N-(2,4,5-TRIMETHYLPHENYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:197799-78-3
Formula: C19H26N6
KIN03403239
5-METHYL-3-(1-METHYLBUTYL)-N-(2,4,6-TRIMETHYLPHENYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:197799-72-7
Formula: C19H26N6
KIN03403236
5-METHYL-3-(1-METHYLETHENYL)-1,2,4-OXADIAZOLE
CAS:89691-78-1
Formula: C6H8N2O
KIN02715564
5-METHYL-3-(1-METHYLETHENYL)-1H-PYRAZOLE
CAS:92304-56-8
Formula: C7H10N2
KIN02755364
5-METHYL-3-(1-METHYLETHENYL)-2-HEXANONE
CAS:79895-67-3
Formula: C10H18O
KIN02640567
5-METHYL-3-(1-METHYLETHENYL)ISOXAZOLE
CAS:38198-77-5
Formula: C7H9NO
KIN02246021
5-METHYL-3-(1-METHYLETHOXY)-1,4-DIPHENYL-1H-PYRAZOLE
CAS:1155802-61-1
Formula: C19H20N2O
KIN05227280
5-METHYL-3-(1-METHYLETHOXY)-1-(BENZYL)-1H-PYRAZOLE
CAS:1147771-31-0
Formula: C14H18N2O
KIN05195939
5-METHYL-3-(1-METHYLETHOXY)-1-PHENYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:113525-22-7
KIN03123848
5-METHYL-3-(1-METHYLETHOXY)-1-PHENYL-1H-PYRAZOLE
CAS:1147770-44-2
Formula: C13H16N2O
KIN05195931
5-METHYL-3-(1-METHYLETHOXY)-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:113525-16-9
KIN03123847
5-METHYL-3-(1-METHYLETHOXY)-2-THIOPHENECARBOXYLIC ACID
CAS:113589-52-9
KIN03641130
5-METHYL-3-(1-METHYLETHYL)-1,2,4-OXADIAZOLE
CAS:1071618-01-3
Formula: C6H10N2O
KIN05113092
5-METHYL-3-(1-METHYLETHYL)-1-(4-NITROPHENYL)-1H-PYRAZOLE
CAS:343867-58-3
KIN03618587
5-METHYL-3-(1-METHYLETHYL)-1-(BENZYL)-1H-PYRAZOLE
CAS:220716-11-0
KIN03024214
5-METHYL-3-(1-METHYLETHYL)-1-PHENYL-1H-PYRAZOLE
CAS:58442-48-1
KIN02415617
5-METHYL-3-(1-METHYLETHYL)-1H-PYRAZOL-1-CARBOXAMIDE
CAS:254734-51-5
Formula: [C8H13N3O
KIN03454185
5-METHYL-3-(1-METHYLETHYL)-1H-PYRAZOLE
CAS:91724-94-6
Formula: C7H12N2
KIN02747970
5-METHYL-3-(1-METHYLETHYL)-1H-PYRROL-2-CARBALDEHYDE
CAS:324570-74-3
Formula: C9H13NO
KIN03494691
5-METHYL-3-(1-METHYLETHYL)-1H-PYRROL-2-CARBONITRILE
CAS:131475-09-7
KIN03674741
5-METHYL-3-(1-METHYLETHYL)-1H-PYRROL-2-CARBOXAMIDE
CAS:131475-10-0
Formula: [C9H14N2O
KIN03214393
5-METHYL-3-(1-METHYLETHYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19347-82-1
Formula: C7H12N2O2
KIN02080444
5-METHYL-3-(1-METHYLETHYL)-2-(2-METHYL-ALLYL)PHENOL
CAS:137443-34-6
KIN03674740
5-METHYL-3-(1-METHYLETHYL)-2-CYCLOPENTEN-1-ONE
CAS:17299-51-3
KIN02060524
5-METHYL-3-(1-METHYLETHYL)-4-NITRO-1H-PYRAZOL-1-METHANOL
CAS:51355-81-8
KIN02305397
5-METHYL-3-(1-METHYLETHYL)-6-(BENZYL)-2(1H)-PYRAZINONE
CAS:170028-25-8
KIN03641129
5-METHYL-3-(1-METHYLETHYL)-PYRAZIN-2-YLAMINE
CAS:91678-84-1
Formula: C8H13N3
KIN02747443
5-METHYL-3-(1-METHYLETHYL)-QUINOXALIN-2(1H)-ALPHA-ONE
CAS:1090593-18-2
Formula: C12H14N2O
KIN05131170
5-METHYL-3-(1-METHYLETHYL)ISOXAZOLE
CAS:34548-30-6
Formula: C7H11NO
KIN02214728
5-METHYL-3-(1-METHYLETHYLIDENE)-2(3H)-THIOPHENONE
CAS:92187-82-1
Formula: C8H10OS
KIN02753929
5-METHYL-3-(1-METHYLHEXYL)-2-PHENYL-1H-PYRROLE
CAS:1190750-36-7
Formula: C18H25N
KIN05331368
5-METHYL-3-(1-METHYLPROPYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19347-83-2
Formula: C8H14N2O2
KIN02080445
5-METHYL-3-(1-METHYLPROPYL)-6-(BENZYL)-2(1H)-PYRAZINONE
CAS:170028-26-9
KIN03629945
5-METHYL-3-(1-METHYLPYRROLIDIN-2-YL)-1H-INDOLE
CAS:19137-69-0
Formula: C14H18N2
KIN02078325
5-METHYL-3-(1-PENTYN-1-YL)-PYRIDIN-2-AMINE
CAS:1006880-61-0
Formula: C11H14N2
KIN05013442
5-METHYL-3-(1-PHENYLETHYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:18647-76-2
Formula: C12H14N2O2
KIN02073862
5-METHYL-3-(1-PHENYLETHYL)-2,4-OXAZOLIDINEDIONE
CAS:100192-62-9
KIN03029542
5-METHYL-3-(1-PHENYLETHYL)-2-THIOXO-4-THIAZOLIDINONE
CAS:23538-09-2
Formula: C12H13NOS2
KIN02121009
5-METHYL-3-(1-PROPENYL)-BENZO[D]ISOTHIAZOLE
CAS:78073-32-2
Formula: C11H11NS
KIN02629163
5-METHYL-3-(1-PROPYLBUTYL)-N-(2,4,6-TRIMETHYLPHENYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:197798-79-1
Formula: C21H30N6
KIN03403200
5-METHYL-3-(1-PROPYLBUTYL)-N-(2,4,6-TRIMETHYLPYRIDIN-3-YL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:197798-92-8
Formula: C20H29N7
KIN03403211
5-METHYL-3-(1-PROPYN-1-YL)-1H-PYRAZOLE
CAS:1178568-23-4
Formula: C7H8N2
KIN05277762
5-METHYL-3-(1-PROPYN-1-YL)-2H-PYRROLE
CAS:408314-06-7
Formula: C8H9N
KIN03568112
5-METHYL-3-(1H-PYRAZOL-1-YLMETHYL)-ISOXAZOLE
CAS:172475-36-4
Formula: C8H9N3O
KIN03351015
5-METHYL-3-(1H-PYRROL-1-YL)-ISOXAZOLE
CAS:358332-83-9
Formula: C8H8N2O
KIN03535108
5-METHYL-3-(2,2,2-TRIPHENYLETHYL)ISOXAZOLE PICRATE
CAS:63673-65-4
Formula: C24H21NO.C6H3N3O7
KIN02496979
5-METHYL-3-(2,3,4-TRIMETHOXY-PHENYL)-1,2,4-OXADIAZOLE
CAS:1125424-17-0
Formula: C12H14N2O4
KIN05179136
5-METHYL-3-(2,4,4-TRIMETHYLPENTAN-2-YL)-BENZENE-1,2-DIOL
CAS:2213-69-6
KIN01064987
5-METHYL-3-(2,4,6-TRIMETHOXY-PHENYL)-1,2,4-OXADIAZOLE
CAS:51983-78-9
KIN02314309
5-METHYL-3-(2,4,6-TRIMETHYLPHENOXY)-1,2,4-OXADIAZOLE
CAS:131945-54-5
Formula: C12H14N2O2
KIN03626387
5-METHYL-3-(2,4,6-TRIMETHYLPHENYL)-1,2,4-OXADIAZOLE
CAS:55151-94-5
Formula: C12H14N2O
KIN02361628
5-METHYL-3-(2,4,6-TRIMETHYLPHENYL)-4-ISOXAZOLEMETHANOL
CAS:288404-35-3
Formula: C14H17NO2
KIN03470229
5-METHYL-3-(2-METHYL-4-THIAZOLYL)-ISOXAZOLE
CAS:108129-28-8
Formula: C8H8N2OS
KIN03087033
5-METHYL-3-(2-METHYLOXIRANYL)-2-HEXANONE
CAS:71515-72-5
Formula: C10H18O2
KIN02584873
5-METHYL-3-(2-METHYLPHENOXY)-ISOXAZOLE
CAS:72309-19-4
Formula: C11H11NO2
KIN02590494
5-METHYL-3-(2-METHYLPHENYL)-1,2,4-OXADIAZOLE
CAS:87944-74-9
Formula: C10H10N2O
KIN02690963
5-METHYL-3-(2-METHYLPHENYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:51027-24-8
Formula: C11H12N2O2
KIN02300578
5-METHYL-3-(2-METHYLPHENYL)-2,4-THIAZOLIDINEDIONE
CAS:88103-70-2
Formula: C11H11NO2S
KIN02693272
5-METHYL-3-(2-METHYLPHENYL)-2-PHENYL-4-THIAZOLIDINONE
CAS:63445-16-9
Formula: C17H17NOS
KIN02492780
5-METHYL-3-(2-METHYLPHENYL)-2-THIOXO-4(1H)-IMIDAZOLIDINONE
CAS:51027-26-0
Formula: C11H12N2OS
KIN02300580
5-METHYL-3-(2-METHYLPHENYL)-2-THIOXO-4-THIAZOLIDINONE
CAS:88371-71-5
Formula: C11H11NOS2
KIN02697257
5-METHYL-3-(2-METHYLPHENYL)-3-PYRROLIDINOL
CAS:1003562-08-0
Formula: C12H17NO
KIN05008370
5-METHYL-3-(2-METHYLPHENYL)-BENZO[D]ISOXAZOL-6-AMINE
CAS:1093097-95-0
Formula: C15H14N2O
KIN05135108
5-METHYL-3-(2-METHYLPHENYL)-PYRIDAZINE
CAS:106982-34-7
KIN03080233
5-METHYL-3-(2-METHYLPROPOXY)-2-CYCLOHEXEN-1-ONE
CAS:61692-48-6
Formula: C11H18O2
KIN02459973
5-METHYL-3-(2-METHYLPROPYL)-1,2,4-OXADIAZOLE
CAS:70541-08-1
Formula: C7H12N2O
KIN02578128
5-METHYL-3-(2-METHYLPROPYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19360-43-1
Formula: C8H14N2O2
KIN02080621
5-METHYL-3-(2-METHYLPROPYL)-2-CYCLOPENTEN-1-ONE
CAS:69770-89-4
Formula: C10H16O
KIN02572739
5-METHYL-3-(2-METHYLPROPYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1082329-68-7
Formula: C9H13NO3
KIN05119302
5-METHYL-3-(2-METHYLPROPYL)-6-(BENZYL)-2(1H)-PYRAZINONE
CAS:170028-17-8
KIN03629944
5-METHYL-3-(2-METHYLPROPYL)HEX-1-EN-3-OL
CAS:21378-11-0
Formula: C11H22O
KIN02100248
5-METHYL-3-(2-NITRO-THIAZOL-5-YL)-1,2,4-OXADIAZOLE
CAS:51640-48-3
KIN02309568
5-METHYL-3-(2-NITROPHENYL)-1,2,4-OXADIAZOLE
CAS:336608-12-9
KIN03509482
5-METHYL-3-(2-NITROPHENYL)-1-PHENYL-1H-PYRAZOLE
CAS:1194798-69-0
Formula: C16H13N3O2
KIN05336037
5-METHYL-3-(2-NITROPHENYL)-1H-PYRROL-2-CARBOXYLIC ACID
CAS:18488-63-6
KIN02072447
5-METHYL-3-(2-NITROPHENYL)-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:10349-91-4
KIN02005310
5-METHYL-3-(2-NITROPHENYL)ISOXAZOL-4-CARBOXYLIC ACID
CAS:91135-89-6
Formula: C11H8N2O5
KIN02739256
5-METHYL-3-(2-OXIRANYLMETHYL)-1,2,4-OXADIAZOLE
CAS:88338-85-6
Formula: C6H8N2O2
KIN02696645
5-METHYL-3-(2-OXO-PROPOXY)-2-THIOPHENECARBONITRILE
CAS:87753-31-9
Formula: C9H9NO2S
KIN02689382
5-METHYL-3-(2-OXO-PROPYL)-3H-[1,3,4]-OXADIAZOL-2-ONE
CAS:136738-11-9
Formula: C6H8N2O3
KIN03238282
5-METHYL-3-(2-PHENYL-THIAZOL-4-YL)-2(5H)-FURANONE
CAS:425381-66-4
KIN03026791
5-METHYL-3-(2-PHENYLDIAZENYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:56777-64-1
Formula: C10H10N4O2
KIN02388620
5-METHYL-3-(2-PHENYLETHENYL)-1,2,4-OXADIAZOLE
CAS:58599-02-3
KIN02418347
5-METHYL-3-(2-PHENYLETHENYL)-BENZO[D]ISOXAZOLE
CAS:76288-26-1
Formula: C16H13NO
KIN02618261
5-METHYL-3-(2-PHENYLETHYL)-1H-PYRROL-2-CARBONITRILE
CAS:131475-12-2
KIN03674739
5-METHYL-3-(2-PHENYLETHYL)-2-THIOXO-4-THIAZOLIDINONE
CAS:23522-18-1
Formula: C12H13NOS2
KIN02120839
5-METHYL-3-(2-PHENYLETHYL)-4-HEXENE-2,3-DIOL
CAS:91826-77-6
Formula: C15H22O2
KIN02749246
5-METHYL-3-(2-PHENYLETHYL)-ISOXAZOLE
CAS:63205-27-6
Formula: C12H13NO
KIN02488418
5-METHYL-3-(2-PHENYLETHYNYL)-1,2,4-OXADIAZOLE
CAS:13482-84-3
KIN02020293
5-METHYL-3-(2-PHENYLETHYNYL)-2-PYRIDINAMINE
CAS:288254-70-6
Formula: C14H12N2
KIN03469914
5-METHYL-3-(2-PHENYLHYDRAZINYL)-2-CYCLOHEXEN-1-ONE
CAS:39554-99-9
KIN02255743
MFCD00129652
5-METHYL-3-(2-PIPERIDIN-1-YLETHYL)ISOXAZOLE HCL
CAS:946-98-5
KIN01034964
5-METHYL-3-(2-PROPEN-1-YLOXY)-1,2-BENZENEDIOL
CAS:152898-19-6
Formula: C10H12O3
KIN03303529
5-METHYL-3-(2-PROPEN-1-YLSULFINYL)-ISOXAZOLE
CAS:69528-37-6
Formula: C7H9NO2S
KIN02570987
5-METHYL-3-(2-PROPEN-1-YLTHIO)-ISOXAZOLE
CAS:66196-71-2
Formula: C7H9NOS
KIN02538543
5-METHYL-3-(2-PROPYLPHENOXY)-PYRIDAZINE
CAS:38732-04-6
KIN02249999
5-METHYL-3-(2-PROPYN-1-YLOXY)-ISOXAZOLE
CAS:70325-77-8
Formula: C7H7NO2
KIN02576739
5-METHYL-3-(2-PYRAZINYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1083369-26-9
Formula: C9H7N3O3
KIN05124609
5-METHYL-3-(2-PYRIMIDINYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1083246-22-3
Formula: C9H7N3O3
KIN05124226
5-METHYL-3-(2-PYRROLIDINYL)-ISOXAZOLE
CAS:1000932-34-2
Formula: C8H12N2O
KIN05005041
5-methyl-3-pyrrolidin-2-ylisoxazole
5-METHYL-3-(2H-TETRAZOL-5-YL)-2-PYRIDINAMINE
CAS:120504-28-1
Formula: C7H8N6
KIN03164707
5-METHYL-3-(3,4,5'-TRIMETHOXY-BENZYLIDENE)CYCLOPENTANE-1,2,4-TRIONE
CAS:34947-63-2
Formula: C16H16O6
KIN02218409
5-METHYL-3-(3-METHYLBUTYL)-2(5H)-FURANONE
CAS:41589-64-4
KIN02272169
5-METHYL-3-(3-METHYLBUTYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19347-85-4
Formula: C9H16N2O2
KIN02080447
3-Isopentyl-5-methyl-hydantoin
5-METHYL-3-(3-METHYLPHENOXY)-ISOXAZOLE
CAS:72309-20-7
Formula: C11H11NO2
KIN02590495
5-METHYL-3-(3-METHYLPHENYL)-1,2,4-OXADIAZOLE
CAS:87944-75-0
Formula: C10H10N2O
KIN02690964
5-METHYL-3-(3-METHYLPHENYL)-2(3H)-OXAZOLONE
CAS:107377-50-4
Formula: C11H11NO2
KIN03082318
5-METHYL-3-(3-METHYLPHENYL)-2,4-THIAZOLIDINEDIONE
CAS:88103-71-3
Formula: C11H11NO2S
KIN02693273
5-METHYL-3-(3-METHYLPHENYL)-2-PHENYL-4-THIAZOLIDINONE
CAS:63481-16-3
Formula: C17H17NOS
KIN02493676
5-METHYL-3-(3-METHYLPHENYL)-2-THIOXO-4-THIAZOLIDINONE
CAS:20174-62-3
Formula: C11H11NOS2
KIN02088813
5-METHYL-3-(3-METHYLPHENYL)-4-ISOXAZOLEMETHANOL
CAS:1159602-00-2
Formula: C12H13NO2
KIN05255287
5-METHYL-3-(3-METHYLPHENYL)-PYRIDAZINE
CAS:106982-31-4
KIN03080231
5-METHYL-3-(3-METHYLPHENYL)-PYRIDAZINE 1-OXIDE
CAS:106982-37-0
KIN03080234
5-METHYL-3-(3-NITRO-1H-PYRAZOL-4-YL)-1,2,4-OXADIAZOLE
CAS:1006498-91-4
Formula: C6H5N5O3
KIN05012877
5-METHYL-3-(3-NITROPHENYL)-1,2,4-OXADIAZOLE
CAS:25283-98-1
Formula: C9H7N3O3
KIN02138006
MFCD00740195
5-METHYL-3-(3-NITROPHENYL)-4-ISOTHIAZOLECARBONITRILE
CAS:19762-97-1
KIN02084282
5-METHYL-3-(3-NITROPHENYL)-4-ISOTHIAZOLECARBONYL CHLORIDE
CAS:16188-06-0
KIN02048668
5-METHYL-3-(3-NITROPHENYL)-4-ISOTHIAZOLECARBOXYLIC ACID
CAS:16188-05-9
KIN02048667
5-METHYL-3-(3-NITROPHENYL)ISOXAZOL-4-CARBOXYLIC ACID
CAS:38694-05-2
Formula: C11H8N2O5
KIN02249775
5-METHYL-3-(3-NITROPHENYL)ISOXAZOLE
CAS:58332-81-3
Formula: C10H8N2O3
KIN02413930
5-METHYL-3-(3-OXO-1-PROPENYL)-URIDINE
CAS:90029-87-1
Formula: C13H16N2O7
KIN02721268
5-METHYL-3-(3-PHENYL-2-OXIRANYL)-ISOXAZOLE
CAS:113100-13-3
Formula: C12H11NO2
KIN03120226
5-METHYL-3-(3-PROPOXY-PHENYL)-1,2,4-OXADIAZOLE
CAS:1170247-14-9
Formula: C12H14N2O2
KIN05261106
5-METHYL-3-(3-PYRIDAZINYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1083424-19-4
Formula: C9H7N3O3
KIN05124752
5-METHYL-3-(3-PYRIDINYL)-2,4-OXAZOLIDINEDIONE
CAS:99459-31-1
Formula: C9H8N2O3
KIN02820477
5-METHYL-3-(3-PYRIDINYL)-4-ISOXAZOLECARBOXALDEHYDE
CAS:1083224-01-4
Formula: C10H8N2O2
KIN05124141
5-METHYL-3-(3-THIENYL)-ISOXAZOLE
CAS:147137-35-7
Formula: C8H7NOS
KIN03284958
5-METHYL-3-(4-(BENZYLOXY)PHENYL)-PYRROLIDIN-3-OL HCL
CAS:67489-36-5
Formula: C18H22ClNO2
KIN02554163
5-METHYL-3-(4-METHYL-3-NITROPHENYL)-1,2,4-OXADIAZOLE
CAS:460722-59-2
Formula: C10H9N3O3
KIN03663646
5-METHYL-3-(4-METHYL-PIPERAZIN-1-YL)-5H-PYRIDAZINO[3,4-B][1,4]BENZOXAZINE
CAS:24886-52-0
Formula: C16H19N5O
KIN02134715
Azaxazin; Pipofezine
5-METHYL-3-(4-METHYL-PIPERAZIN-1-YL)-PYRIDAZINO[3,4-B][1,4]BENZOXAZINE HCL
CAS:24853-80-3
KIN02134488
Pipofezine HCl
5-METHYL-3-(4-METHYLCYCLOHEXYL)-N-(2,4,6-TRIMETHYLPHENYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:197801-45-9
Formula: C21H28N6
KIN03403346
5-METHYL-3-(4-METHYLPENTYL)-2(5H)-FURANONE
CAS:41589-65-5
KIN02272170
5-METHYL-3-(4-METHYLPHENOXY)-ISOXAZOLE
CAS:72309-16-1
Formula: C11H11NO2
KIN02590491
5-METHYL-3-(4-METHYLPHENYL)-1,2,4-OXADIAZOLE
CAS:81386-30-3
Formula: C10H10N2O
KIN02649526
MFCD00085801
5-METHYL-3-(4-METHYLPHENYL)-1H-INDAZOLE
CAS:65452-74-6
Formula: C15H14N2
KIN02527043
5-METHYL-3-(4-METHYLPHENYL)-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:138043-81-9
KIN03244616
5-METHYL-3-(4-METHYLPHENYL)-1H-PYRROL-2-CARBOXAMIDE
CAS:131475-17-7
KIN03674738
5-METHYL-3-(4-METHYLPHENYL)-2(3H)-OXAZOLONE
CAS:107377-46-8
Formula: C11H11NO2
KIN03082314
5-METHYL-3-(4-METHYLPHENYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:91350-78-6
Formula: C11H12N2O2
KIN02742336
5-METHYL-3-(4-METHYLPHENYL)-2-PHENYL-4-THIAZOLIDINONE
CAS:63445-32-9
Formula: C17H17NOS
KIN02492783
5-METHYL-3-(4-METHYLPHENYL)-2-THIOIDENE-THIAZOLIDIN-4-ONE
CAS:2045-00-3
Formula: C6H8AsNO3
KIN01061574
5-METHYL-3-(4-METHYLPHENYL)-4-ISOXAZOLEMETHANAMINE
CAS:1177481-78-5
Formula: C12H14N2O
KIN05271778
5-METHYL-3-(4-METHYLPHENYL)-4-ISOXAZOLEMETHANOL
CAS:1018297-60-3
Formula: C12H13NO2
KIN05036625
5-METHYL-3-(4-METHYLPHENYL)-ALPHA-OXO-4-ISOXAZOLEACETIC ACID
CAS:35166-28-0
KIN02220389
5-METHYL-3-(4-METHYLPHENYL)-BENZO[D]ISOXAZOLE
CAS:69617-55-6
Formula: C15H13NO
KIN02571597
5-METHYL-3-(4-METHYLPHENYL)-ISOXAZOLE
CAS:156777-04-7
Formula: C11H11NO
KIN03316392
5-METHYL-3-(4-METHYLPHENYL)-PYRIDAZINE
CAS:37385-35-6
KIN02238859
5-METHYL-3-(4-NITROPHENYL)-1,2,4-OXADIAZOLE
CAS:25283-96-9
Formula: C9H7N3O3
KIN02138005
5-METHYL-3-(4-NITROPHENYL)-1-(BENZYL)-1H-PYRAZOLE
CAS:338467-58-6
KIN03025695
5-METHYL-3-(4-NITROPHENYL)-1-PHENYL-1H-PYRAZOL-4-OL
CAS:139285-29-3
KIN03674737
5-METHYL-3-(4-NITROPHENYL)-1-PHENYL-1H-PYRAZOLE
CAS:20147-65-3
KIN02088580
5-METHYL-3-(4-NITROPHENYL)-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:10272-74-9
KIN02004166
5-METHYL-3-(4-NITROPHENYL)-3H-1,3,4-OXADIAZOL-2-ONE
CAS:27182-39-4
Formula: C9H7N3O4
KIN02154940
5-METHYL-3-(4-NITROPHENYL)-ALPHA-OXO-4-ISOXAZOLEACETALDEHYDE 4-OXIME
CAS:13788-16-4
KIN02024430
5-METHYL-3-(4-NITROPHENYL)-PYRIDAZINE
CAS:100677-83-6
KIN03033837
5-METHYL-3-(4-NITROPHENYL)ISOXAZOL-4-CARBOXYLIC ACID
CAS:7123-65-1
KIN01179059
5-METHYL-3-(4-NITROPHENYL)ISOXAZOLE
CAS:30213-79-7
Formula: C10H8N2O3
KIN02180256
5-METHYL-3-(4-PENTEN-1-YL)-ISOXAZOLE
CAS:130628-67-0
Formula: C9H13NO
KIN03210865
5-METHYL-3-(4-PENTENYL)-2(5H)-FURANONE
CAS:138042-38-3
KIN03244599
5-METHYL-3-(4-PHENOXY-PHENYL)ISOXAZOL-4-CARBOXYLIC ACID
CAS:1159981-28-8
Formula: C17H13NO4
KIN05256961
5-METHYL-3-(4-PROPOXY-PHENYL)-1,2,4-OXADIAZOLE
CAS:145259-30-9
KIN03279018
5-METHYL-3-(4-PROPOXY-PHENYL)-1H-PYRAZOLE
CAS:1091594-75-0
Formula: C13H16N2O
KIN05131954
5-METHYL-3-(4-PYRIDAZINYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1083369-24-7
Formula: C9H7N3O3
KIN05124607
5-METHYL-3-(4-PYRIDINYLTHIO)-2H-1,4-THIAZIN-2-ONE
CAS:121345-06-0
Formula: C10H8N2OS2
KIN03660147
5-METHYL-3-(4-PYRIMIDINYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1083424-22-9
Formula: C9H7N3O3
KIN05124755
5-METHYL-3-(5-METHYL-1H-PYRAZOL-3-YL)ISOXAZOLE
CAS:35592-90-6
Formula: C8H9N3O
KIN02224529
5-METHYL-3-(5-METHYL-4-NITROSO-1H-PYRAZOL-3-YL)ISOXAZOLE
CAS:327155-18-0
Formula: C8H8N4O2
KIN03618586
5-METHYL-3-(5-METHYL-FURAN-2-YL)-4-PHENYL-ISOXAZOLE
CAS:1171190-69-4
Formula: C15H13NO2
KIN05262101
5-METHYL-3-(5-NITRO-FURAN-2-YL)-[1,2,4]-TRIAZOLO[4,3-A]PYRIMIDIN-7-YLAMINE
CAS:33575-14-3
Formula: C10H8N6O3
KIN02206909
5-METHYL-3-(5-NITRO-FURAN-2-YL)-1,2,4-OXADIAZOLE
CAS:63-62-7
Formula: C24H34N2O4
KIN01000757
5-METHYL-3-(5-NITRO-FURAN-2-YL)-1H-PYRAZOLE
CAS:16239-90-0
Formula: C8H7N3O3
KIN02049404
5-METHYL-3-(5-NITRO-FURAN-2-YL)-4-ISOXAZOLECARBOXAMIDE
CAS:21787-26-8
Formula: C9H7N3O5
KIN02104225
5-METHYL-3-(5-NITRO-FURAN-2-YL)-S-TRIAZOLO[4,3-A]PYRIMIDINE
CAS:33616-93-2
Formula: C10H7N5O3
KIN02207307
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 1-METHYL-PIPERIDIN-4-YL ESTER
CAS:21787-36-0
Formula: C15H17N3O6
KIN02104229
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 2-(DIETHYLAMINO)-PROPAN-2-YL ESTER
CAS:21709-30-8
Formula: C17H23N3O8
KIN02103440
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 2-(DIETHYLAMINO)ETHYL ESTER
CAS:21709-28-4
Formula: C15H19N3O6
KIN02103438
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 2-(DIMETHYLAMINO)-2-METHYLPROPYL ESTER
CAS:21709-31-9
Formula: C15H19N3O6
KIN02103441
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 2-(DIMETHYLAMINO)-PROPAN-2-YL ESTER
CAS:21709-29-5
Formula: C15H19N3O8
KIN02103439
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID 3-(DIMETHYLAMINO)-PROPYL ESTER
CAS:21709-27-3
Formula: C14H17N3O6
KIN02103437
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID BUTYL ESTER
CAS:22996-59-4
Formula: C13H14N2O6
KIN02115752
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:17960-18-8
Formula: C11H10N2O6
KIN02067383
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:17960-17-7
Formula: C10H8N2O6
KIN02067382
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID PROPYL ESTER
CAS:22996-58-3
Formula: C12H12N2O6
KIN02115751
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOL-4-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:22996-62-9
Formula: C13H14N2O6
KIN02115753
5-METHYL-3-(5-NITRO-FURAN-2-YL)ISOXAZOLE
CAS:7194-20-9
Formula: C9H8N2O4
KIN01180998
5-METHYL-3-(5-NITRO-THIAZOL-2-YL)ISOXAZOLE
CAS:58644-28-3
Formula: C7H5N3O3S
KIN02418840
5-METHYL-3-(ALLYL)-2-OXAZOLIDINONE
CAS:55956-20-2
Formula: C7H11NO2
KIN02374985
5-METHYL-3-(ALLYLTHIO)-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:3993-32-6
Formula: C11H12O3
KIN01099159
5-METHYL-3-(BENZENESULFONYL)-2-HYDROXY-PHENOL
CAS:53760-95-5
Formula: C13H12O4S
KIN02340177
5-METHYL-3-(BENZENESULFONYL)-2-PYRAZINECARBONITRILE
CAS:128142-25-6
KIN03674736
5-METHYL-3-(BENZYL)-1,2,4-OXADIAZOLE
CAS:55152-22-2
KIN02361641
5-METHYL-3-(BENZYL)-1BETA-D-RIBOFURANOSYLPYRIDO[2,3-D]PYRIMIDIN-2,4(1H,3H)-DIONE
CAS:137103-31-2
Formula: C20H21N3O6
KIN03240098
5-METHYL-3-(BENZYL)-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:24370-89-6
KIN02129786
5-METHYL-3-(BENZYL)-2(1H)-PYRAZINONE
CAS:155650-94-5
KIN03312957
5-METHYL-3-(BENZYL)-2(5H)-THIOPHENONE
CAS:34971-43-2
KIN02218646
5-METHYL-3-(BENZYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:2301-40-8
Formula: C10H10N2O2
KIN01066731
5-METHYL-3-(BENZYL)-2,4-THIAZOLIDINEDIONE
CAS:63205-37-8
Formula: C11H11NO2S
KIN02488420
5-METHYL-3-(BENZYL)-2-OXAZOLIDINONE
CAS:99855-06-8
Formula: C11H13NO2
KIN02823065
5-METHYL-3-(BENZYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:55898-89-0
Formula: C12H12N6
KIN02374043
5-METHYL-3-(BENZYL)-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDINE
CAS:51073-81-5
Formula: C12H11N5
KIN02301263
9-Benzyl-2-methyl-8-azapurine
5-METHYL-3-(BENZYL)-4-OXAZOLIDINONE
CAS:66223-63-0
Formula: C11H13NO2
KIN02538908
5-METHYL-3-(BENZYL)-4-THIAZOLIDINONE
CAS:67824-14-0
Formula: C11H13NOS
KIN02558429
5-METHYL-3-(BENZYL)-BENZO[D]ISOXAZOLE
CAS:53155-27-4
Formula: C15H13NO
KIN02331047
5-METHYL-3-(BENZYL)-PYRAZIN-2-YLAMINE
CAS:93034-70-9
Formula: C12H13N3
KIN02764441
5-METHYL-3-(BENZYL)-PYRAZIN-2-YLAMINE 1-OXIDE
CAS:151674-85-0
KIN03300106
5-METHYL-3-(BENZYLOXY)-1-(BENZYL)-1H-PYRAZOLE
CAS:79000-06-9
Formula: C18H18N2O
KIN02635026
5-METHYL-3-(BENZYLOXYMETHYL)-1H-PYRIMIDIN-2,4-DIONE
CAS:119451-90-0
Formula: C13H14N2O3
KIN03159123
5-METHYL-3-(ISOPROPOXY)-1,1-DIPHENYL-4-OXA-2-THIA-3-PHOSPHA-1-STIBAHEXANE 3-SULFIDE
CAS:126443-52-5
Formula: C18H24O2PS2Sb
KIN03193087
5-METHYL-3-(METHYLAMINO)-1-PHENYLPYRROLIDIN-2-ONE
CAS:91557-14-1
KIN02745556
5-METHYL-3-(METHYLAMINO)-2(1H)-PYRIDINONE
CAS:33252-52-7
Formula: C7H10N2O
KIN02203965
5-METHYL-3-(METHYLAMINO)-2-CYCLOHEXEN-1-ONE
CAS:63724-01-6
Formula: C8H13NO
KIN02497797
5-METHYL-3-(METHYLAMINO)-2-HEXANONE
CAS:90226-69-0
Formula: C8H17NO
KIN02724343
5-METHYL-3-(METHYLAMINO)-2-PYRAZINECARBONITRILE
CAS:63352-07-8
Formula: C7H8N4
KIN02491079
5-METHYL-3-(METHYLAMINO)-2-PYRAZINECARBOXAMIDE
CAS:32526-86-6
KIN02197800
5-METHYL-3-(METHYLAMINO)-2-PYRAZINECARBOXYLIC ACID 1-[[2-(1-METHYLETHYLIDENE)HYDRAZINYL]CARBONYL]HYDRAZIDE
CAS:32526-82-2
KIN02197796
5-METHYL-3-(METHYLAMINO)-2-PYRAZINECARBOXYLIC ACID 1-ACETYL-2-(1-METHYLETHYLIDENE)HYDRAZIDE
CAS:32526-88-8
KIN02197801
5-METHYL-3-(METHYLAMINO)-2-PYRAZINECARBOXYLIC ACID 2-ACETYLHYDRAZIDE
CAS:32526-89-9
KIN02197802
5-METHYL-3-(METHYLAMINO)-BETA-OXO-2-THIOPHENEPROPANAMIDE
CAS:116624-04-5
KIN03618585
5-METHYL-3-(METHYLAMINO)-HEXANOIC ACID
CAS:1025904-96-4
KIN05059479
5-METHYL-3-(METHYLSULFONYL)-2-PYRAZINECARBONITRILE
CAS:124629-48-7
KIN03008322
5-METHYL-3-(METHYLSULFONYL)-4-ISOTHIAZOLECARBONITRILE
CAS:82000-51-9
Formula: C6H6N2O2S2
KIN02652866
MFCD00138543
5-METHYL-3-(METHYLSULFONYL)-PYRANO[3,2-B]INDOL-4(5H)-ONE
CAS:1135280-52-2
Formula: C13H11NO4S
KIN05186132
5-METHYL-3-(METHYLTHIO)-1,2,4-THIADIAZOLE
CAS:89281-47-0
Formula: C4H6N2S2
KIN02709726
5-METHYL-3-(METHYLTHIO)-1,2,4-TRIAZINE
CAS:28735-24-2
Formula: C5H7N3S
KIN02168394
5-METHYL-3-(METHYLTHIO)-1-PHENYL-1H-PYRAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:31728-76-4
KIN02191660
5-METHYL-3-(METHYLTHIO)-1-PHENYL-1H-PYRAZOLE
CAS:18714-79-9
Formula: C11H12N2S
KIN02074563
5-METHYL-3-(METHYLTHIO)-1H-INDOLE
CAS:40015-14-3
Formula: C10H11NS
KIN02259310
5-METHYL-3-(METHYLTHIO)-1H-PYRAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:31728-72-0
Formula: C7H10N2O2S
KIN02191656
5-METHYL-3-(METHYLTHIO)-2-HYDROXY-PHENOL
CAS:289658-18-0
KIN03470853
5-METHYL-3-(METHYLTHIO)-2-PYRAZINECARBONITRILE
CAS:128142-13-2
KIN03200467
5-METHYL-3-(METHYLTHIO)-4-ISOTHIAZOLECARBONITRILE
CAS:82000-50-8
Formula: C6H6N2S2
KIN02652865
MFCD00138506
5-METHYL-3-(METHYLTHIO)-4-ISOTHIAZOLECARBOXYLIC ACID
CAS:338778-85-1
Formula: C6H7NO2S2
KIN03511284
5-METHYL-3-(METHYLTHIO)-4-NITROPYRIDAZINE
CAS:66031-24-1
Formula: C6H7N3O2S
KIN02535885
5-METHYL-3-(METHYLTHIO)-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:4091-90-1
KIN01100823
5-METHYL-3-(MORPHOLIN-4-YL)CYCLOHEX-2-EN-1-ON
CAS:326803-12-7
Formula: C11H17NO2
KIN03496638
5-METHYL-3-(NAPHTHALEN-1-YL)-1,2,4-OXADIAZOLE
CAS:103499-19-0
Formula: C13H10N2O
KIN03054242
5-METHYL-3-(NAPHTHALEN-1-YL)-2-OXAZOLIDINONE
CAS:99520-11-3
Formula: C14H13NO2
KIN02820906
5-METHYL-3-(NAPHTHALEN-1-YL)-2-THIOXO-4-THIAZOLIDINONE
CAS:23517-79-5
Formula: C14H11NOS2
KIN02120799
5-METHYL-3-(NAPHTHALEN-2-YL)-4-NITROSO-1H-PYRAZOLE
CAS:1119730-72-1
Formula: C14H11N3O
KIN05177340
5-METHYL-3-(PERFLUOROPENTYL)-1H-PYRAZOLE
CAS:82633-43-0
Formula: C9H5F11N2
KIN02656740
MFCD00156096
5-METHYL-3-(PHENOXYMETHYL)-1,2,4-OXADIAZOLE
CAS:156596-15-5
KIN03315889
5-METHYL-3-(PHENOXYMETHYL)-1H-PYRAZOLE
CAS:94934-45-9
Formula: C11H12N2O
KIN02786671
5-METHYL-3-(PHENYLAMINO)-1H-PYRAZOL-1-CARBOTHIOAMIDE
CAS:95643-12-2
Formula: C11H12N4S
KIN02793668
5-METHYL-3-(PHENYLAMINO)-1H-PYRAZOL-4-CARBOXYLIC ACID
CAS:4280-78-8
Formula: C10H11N3
KIN01104387
5-METHYL-3-(PHENYLAMINO)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:3016-43-1
Formula: C9H9N3O3
KIN01080949
5-METHYL-3-(PHENYLMETHOXY)-2-PYRIDINAMINE
CAS:110223-14-8
Formula: C13H14N2O
KIN03100096
5-METHYL-3-(PHENYLMETHOXY)-4-ISOXAZOLECARBOXALDEHYDE
CAS:172540-13-5
Formula: C12H11NO3
KIN03626386
5-METHYL-3-(PHENYLMETHOXY)-ISOXAZOLE
CAS:115886-00-5
Formula: C11H11NO2
KIN03139603
5-METHYL-3-(PHENYLMETHYL)-2(1H)-PYRIDINONE
CAS:434899-21-5
Formula: C13H13NO
KIN03579824
5-METHYL-3-(PHENYLMETHYL)-2-PYRIDINAMINE
CAS:98477-44-2
Formula: C13H14N2
KIN02814116
5-METHYL-3-(PHENYLMETHYL)-4-ISOXAZOLECARBOXYLIC ACID
CAS:1017165-31-9
Formula: C12H11NO3
KIN05030734
5-METHYL-3-(PHENYLMETHYLENE)-2(3H)-FURANONE
CAS:165263-76-3
Formula: C12H10O2
KIN03336913
5-METHYL-3-(PHENYLSULFINYL)-2-PYRAZINECARBONITRILE
CAS:128142-24-5
KIN03008617
5-METHYL-3-(PHENYLTHIO)-1H-INDOLE
CAS:92554-52-4
Formula: C15H13NS
KIN02758368
5-METHYL-3-(PHENYLTHIO)-2(5H)-FURANONE
CAS:54144-99-9
Formula: C11H10O2S
KIN02345749
5-METHYL-3-(PHENYLTHIO)-2-HYDROXY-PHENOL
CAS:71594-52-0
Formula: C13H12O2S
KIN02585417
5-METHYL-3-(PHENYLTHIO)-2-PYRAZINECARBONITRILE
CAS:128142-22-3
KIN03200470
5-METHYL-3-(PHENYLTHIO)-3,4-HEXADIEN-1-OL
CAS:92617-03-3
Formula: C13H16OS
KIN02759313
5-METHYL-3-(PHENYLTHIO)-BICYCLO[3.3.1]NON-2-EN-9-ONE
CAS:90857-61-7
Formula: C16H18OS
KIN02734587
5-METHYL-3-(PHENYLTHIO)-ISOXAZOLE
CAS:72309-45-6
Formula: C10H9NOS
KIN02590507
5-METHYL-3-(PIPERIDIN-1-YLMETHYL)ISOXAZOLE HCL
CAS:943-66-8
Formula: C10H10BrNO
KIN01034798
5-METHYL-3-(PIPERIDIN-2-YLMETHOXY)-BENZO[D]ISOXAZOLE
CAS:167851-70-9
Formula: C14H18N2O2
KIN03663645
5-METHYL-3-(PIPERIDIN-4-YL)-BENZO[D]ISOXAZOLE
CAS:1177480-09-9
Formula: C13H16N2O
KIN05271756
5-METHYL-3-(PROPAN-2-YLIDENE)-4-HEXEN-2-ONE
CAS:64149-32-2
Formula: C10H16O
KIN02505101
5-METHYL-3-(PROPARGYL)-2(3H)-FURANONE
CAS:106421-06-1
Formula: C8H8O2
KIN03076333
5-METHYL-3-(PROPARGYL)-2(5H)-FURANONE
CAS:106421-05-0
Formula: C8H8O2
KIN03076332
5-METHYL-3-(PROPARGYL)-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:98276-65-4
Formula: C7H8N2O2
KIN02812422
5-METHYL-3-(PROPARGYLAMINO)-2-CYCLOHEXEN-1-ONE
CAS:1023528-07-5
KIN05057461
5-METHYL-3-(PROPARGYLOXY)-BENZO[D]ISOXAZOLE
CAS:66571-03-7
Formula: C11H9NO2
KIN02543598
5-METHYL-3-(PROPYLSULFINYL)-ISOXAZOLE
CAS:69528-86-5
Formula: C7H11NO2S
KIN02571015
5-METHYL-3-(PROPYLTHIO)-ISOXAZOLE
CAS:69528-71-8
Formula: C7H11NOS
KIN02571002
5-METHYL-3-(PYRIDIN-2-YL)-2-THIOPHENAMINE
CAS:1184410-18-1
Formula: C10H10N2S
KIN05313810
5-METHYL-3-(PYRIDIN-2-YL)-4-ISOXAZOLEMETHANOL
CAS:1159251-90-7
Formula: C10H10N2O2
KIN05254765
5-METHYL-3-(PYRIDIN-3-YL)-4-ISOXAZOLEMETHANOL
CAS:1159600-98-2
Formula: C10H10N2O2
KIN05255286
5-METHYL-3-(PYRIDIN-4-YL)-4-ISOXAZOLEMETHANOL
CAS:1159251-58-7
Formula: C10H10N2O2
KIN05254763
5-METHYL-3-(PYRIMIDIN-4-YL)-4-ISOXAZOLEMETHANOL
CAS:1159252-22-8
Formula: C9H9N3O2
KIN05254769
5-METHYL-3-(PYRROLIDIN-1-YL)-1,2,4-OXADIAZOLE
CAS:163631-69-4
KIN03334157
5-METHYL-3-(THIAZOL-5-YL)-1,2,4-OXADIAZOLE
CAS:51640-49-4
KIN02309569
5-METHYL-3-(THIOPHEN-2-YL)-1,2,4-OXADIAZOLE
CAS:103499-20-3
KIN03054243
5-METHYL-3-(THIOPHEN-2-YL)-1H-PYRROL-2-CARBOXYLIC ACID
CAS:29903-96-6
KIN02177552
5-METHYL-3-(THIOPHEN-2-YL)-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:31894-56-1
KIN02192896
5-METHYL-3-(THIOPHEN-2-YL)-2(5H)-FURANONE
CAS:425381-56-2
KIN03575685
5-METHYL-3-(THIOPHEN-2-YL)-4-ISOXAZOLEMETHANAMINE
CAS:1177483-30-5
Formula: C9H10N2OS
KIN05271800
5-METHYL-3-(THIOPHEN-2-YL)-4-ISOXAZOLEMETHANOL
CAS:1017668-98-2
Formula: C9H9NO2S
KIN05034756
5-METHYL-3-(THIOPHEN-2-YL)-BENZO[D]ISOXAZOLE
CAS:97035-31-9
Formula: C12H9NOS
KIN02804157
5-METHYL-3-(THIOPHEN-2-YL)-BENZO[F][1,7]NAPHTHYRIDINE
CAS:63481-86-7
Formula: C17H12N2S
KIN02493704
5-METHYL-3-(THIOPHEN-3-YL)-2(5H)-FURANONE
CAS:425381-57-3
KIN03575686
5-METHYL-3-(THIOPHEN-3-YLMETHYL)-1,2,4-OXADIAZOLE
CAS:155601-62-0
KIN03021718
5-METHYL-3-(TRICHLOROMETHYL)-1,2,4-OXADIAZOLE
CAS:5229-00-5
Formula: C29H26N2OS
KIN01123309
5-METHYL-3-(TRICHLOROMETHYL)-1H-PYRAZOLE
CAS:60445-31-0
Formula: C5H5Cl3N2
KIN02444474
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETALDEHYDE
CAS:1007550-87-9
Formula: C7H7F3N2O
KIN05014520
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETAMIDE
CAS:351520-68-8
KIN03674735
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETIC ACID
CAS:345637-71-0
Formula: C7H7F3N2O2
KIN03521884
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:299405-24-6
Formula: [C9H11F3N2O2
KIN03475065
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETONITRILE
CAS:1001500-48-6
Formula: C7H6F3N3
KIN05005993
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-BUTANAMINE
CAS:325490-92-4
KIN03663644
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-BUTANOIC ACID
CAS:1006461-93-3
Formula: C9H11F3N2O2
KIN05012269
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ETHANOL
CAS:1006480-14-3
Formula: C7H9F3N2O
KIN05012572
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-PROPANOL
CAS:1006479-72-6
Formula: C8H11F3N2O
KIN05012561
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1182709-87-0
Formula: C6H5F3N2O
KIN05296757
5-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL 4-METHYL ESTER
CAS:34580-40-0
KIN02215042
5-METHYL-3-(TRIFLUOROMETHYL)-3H-PYRAZOLE
CAS:151226-17-4
KIN03298646
5-METHYL-3-(TRIFLUOROMETHYL)-4-ISOXAZOLAMINE
CAS:354795-56-5
Formula: C5H5F3N2O
KIN03531941
5-METHYL-3-(TRIFLUOROMETHYL)-4-ISOXAZOLEMETHANOL
CAS:447401-97-0
Formula: C6H6F3NO2
KIN03671429
5-METHYL-3-(TRIFLUOROMETHYL)-ISOXAZOLE
CAS:111079-03-9
Formula: C5H4F3NO
KIN03105531
5-METHYL-3-(TRIMETHOXYSILYLMETHYL)OXOLAN-2-ONE
CAS:150241-72-8
Formula: C9H18O5Si
KIN03295608
5-METHYL-3-(TRIMETHYLSILYL)-4-HEXENAL
CAS:89375-88-2
Formula: C10H20OSi
KIN02710965
5-METHYL-3-[(1-METHYLETHYL)SULFINYL]-ISOXAZOLE
CAS:69528-87-6
Formula: C7H11NO2S
KIN02571016
5-METHYL-3-[(1-METHYLETHYL)THIO]-ISOXAZOLE
CAS:69528-76-3
Formula: C7H11NOS
KIN02571007
5-METHYL-3-[(1E)-2-[4-(METHYLSULFINYL)PHENYL]-ETHENYL][1,2,4]-OXADIAZOLE
CAS:36166-22-0
KIN02229594
5-METHYL-3-[(1E)-2-PHENYLETHENYL][1,2,4]-OXADIAZOLE
CAS:129610-15-7
KIN03674734
5-METHYL-3-[(2-METHYLPHENOXY)METHYL][1,2,4]-OXADIAZOLE
CAS:156596-18-8
KIN03641128
5-METHYL-3-[(2-NITROPHENYL)METHYL][1,2,4]-OXADIAZOLE
CAS:154224-05-2
Formula: C10H9N3O3
KIN03663642
5-METHYL-3-[(3-METHYLPHENOXY)METHYL][1,2,4]-OXADIAZOLE
CAS:156596-20-2
KIN03641127
5-METHYL-3-[(3-PHENYL-2-PROPEN-1-YL)OXY]-ISOXAZOLE
CAS:155300-37-1
Formula: C13H13NO2
KIN03648859
5-METHYL-3-[(4-METHYLPHENOXY)METHYL][1,2,4]-OXADIAZOLE
CAS:156596-21-3
KIN03641126
5-METHYL-3-[(4-METHYLPHENYL)THIO]-ISOXAZOLE
CAS:72309-48-9
Formula: C11H11NOS
KIN02590510
5-METHYL-3-[(4-NITRO-1H-IMIDAZOL-1-YL)METHYL]-ISOXAZOLE
CAS:1016140-35-4
Formula: C8H8N4O3
KIN05021521
5-METHYL-3-[(4-NITROPHENYL)THIO]-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:4064-53-3
KIN01100316
5-METHYL-3-[(5-METHYL-1H-INDOL-3-YL)METHYL]INDOLE
CAS:159890-08-1
Formula: C19H18N2
KIN03324634
5-METHYL-3-[(5-NITRO-FURFURYLIDENE)AMINO]-2-OXAZOLIDINETHIONE
CAS:5407-82-9
Formula: C9H12N4O4
KIN01129022
5-METHYL-3-[(BENZYL)THIO]-2(5H)-FURANONE
CAS:87053-27-8
KIN02684129
5-METHYL-3-[(BENZYL)THIO]-2-PYRAZINECARBONITRILE
CAS:128142-16-5
KIN03200469
5-METHYL-3-[(BENZYL)THIO]-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:28899-09-4
Formula: C17H14N4S
KIN02169706
5-METHYL-3-[(METHYLTHIO)METHYL]-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:200278-94-0
Formula: C7H10N2O2S
KIN03407241
5-METHYL-3-[(METHYLTHIO)METHYL]PYRIDIN-2-AMINE
CAS:1101059-48-6
Formula: C8H12N2S
KIN05167146
5-METHYL-3-[(PHENYL-IMINO)METHYL]THIOPHEN-2-OL
CAS:91569-01-6
Formula: C12H11NOS
KIN02745833
5-METHYL-3-[(PHENYLAMINO)METHYLENE]-2(3H)-THIOPHENONE
CAS:30544-42-4
KIN02183103
5-METHYL-3-[(PHENYLMETHYL)THIO]-2-PYRIDINAMINE
CAS:110402-46-5
Formula: C13H14N2S
KIN03006990
5-METHYL-3-[(PHENYLMETHYL)THIO]-ISOXAZOLE
CAS:73112-01-3
Formula: C11H11NOS
KIN02596023
5-METHYL-3-[(PROPYLAMINO)METHYL]-9(10H)-ACRIDINONE
CAS:164256-70-6
Formula: C18H20N2O
KIN03011123
5-METHYL-3-[(TRIMETHYLSILYL)METHYL]-2-HEXANONE
CAS:67262-90-2
Formula: C11H24OSi
KIN02550737
5-METHYL-3-[(TRIMETHYLSILYL)METHYL]-ISOXAZOLE
CAS:75632-87-0
Formula: C8H15NOSi
KIN02613948
5-METHYL-3-[(TRIMETHYLSILYL)OXY]-ISOXAZOLE
CAS:155928-74-8
Formula: C7H13NO2Si
KIN03313834
5-METHYL-3-[[(1-METHYLETHYL)AMINO]CARBONYL]-4-ISOXAZOLECARBOXYLIC ACID
CAS:135399-59-6
Formula: C9H12N2O4
KIN03232677
5-METHYL-3-[[(4-METHYLPHENYL)SULFONYL]OXY]-2-HEXANONE
CAS:208453-94-5
KIN03652368
5-METHYL-3-[[(5-NITRO-FURAN-2-YL)METHYLENE]AMINO]-2-OXAZOLIDINONE
CAS:6281-32-9
Formula: C10H9NO
KIN01155183
5-METHYL-3-[[2-PIPERIDIN-1-YLETHYL]THIO]-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:36047-70-8
Formula: C17H21N5S
KIN02228482
5-METHYL-3-[[4-(METHYLSULFONYL)PHENOXY]METHYL]ISOXAZOLE
CAS:1197759-36-6
Formula: C12H13NO4S
KIN05341340
5-METHYL-3-[[4-[[[4-(TETRADECYCLOXY)PHENYL]ACETYL]AMINO]PHENYL]METHYL]THIAZOLIUM BROMIDE
CAS:138831-50-2
KIN03249018
5-METHYL-3-[1-(PHENYLAMINO)ETHYLIDENE]-2,4(3H,5H)-FURANDIONE
CAS:59884-22-9
Formula: C13H13NO3
KIN02438851
5-METHYL-3-[1-(PHENYLAMINO)ETHYLIDENE]-2,4-PYRROLIDINEDIONE
CAS:52372-20-0
KIN02320152
5-METHYL-3-[1-METHYL-5-(5-METHYL-1H-INDOL-3-YL)-PYRROL-2-YL]INDOLE
CAS:454180-94-0
Formula: C23H21N3
KIN03593160
5-METHYL-3-[2,8,10,13-TETRAHYDROXY-13-[TETRAHYDRO-5-(1-HYDROXYTRIDECYL)FURAN-2-YL]TRIDECYL]-2(5H)-FURANONE
CAS:167172-79-4
Formula: C35H64O8
KIN03340083
5-METHYL-3-[2,8,9,13-TETRAHYDROXY-13-[TETRAHYDRO-5-(1-HYDROXYTRIDECYL)FURAN-2-YL]TRIDECYL]-2(5H)-FURANONE
CAS:167172-78-3
Formula: C35H64O8
KIN03340082
5-METHYL-3-[2-(1H-PYRAZOL-1-YL)ETHYL]BENZO[D]ISOXAZOLE
CAS:444177-56-4
Formula: C13H13N3O
KIN03641125
5-METHYL-3-[2-(2-NITROPHENYL)HYDRAZINYL]INDOL-2-ONE
CAS:21303-42-4
Formula: C15H12N4O3
KIN02099443
5-METHYL-3-[2-(2-PROPEN-1-YL)PHENOXY]-ISOXAZOLE
CAS:72309-37-6
Formula: C13H13NO2
KIN02590503
5-METHYL-3-[2-(4-PHENYL-PIPERAZIN-1-YL)ETHYL][1,3]OXAZOLO[4,5-B]PYRIDIN-2-ONE
CAS:134337-07-8
Formula: C19H22N4O2
KIN03227826
5-METHYL-3-[2-(BENZYL)PHENYL]PYRAZOLE
CAS:1021429-86-6
Formula: C17H16N2
KIN05055174
5-METHYL-3-[2-(PIPERAZIN-1-YL)ETHYL]BENZO[D]ISOXAZOLE
CAS:1176710-15-8
Formula: C14H19N3O
KIN05270130
5-METHYL-3-[2-(PIPERIDIN-4-YL)ETHYL]BENZO[D]ISOXAZOLE
CAS:1028301-37-2
Formula: C15H20N2O
KIN05063711
5-METHYL-3-[2-(PYRROLIDIN-1-YL)ETHYL]ISOXAZOLE
CAS:830-09-1
Formula: C10H10O3
KIN01031117
5-METHYL-3-[2-(THIOPHEN-2-YL)ETHYL]-2-OXAZOLIDINONE
CAS:93448-11-4
Formula: C10H13NO2S
KIN02769423
5-METHYL-3-[2-MORPHOLIN-4-YLETHYL]BENZO[D]ISOXAZOLE
CAS:248912-00-7
Formula: C14H18N2O2
KIN03674733
5-METHYL-3-[2-PIPERIDIN-1-YLETHYL]BENZO[D]ISOXAZOLE
CAS:248912-01-8
Formula: C15H20N2O
KIN03674732
5-METHYL-3-[3-(1-METHYLETHOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:1170865-61-8
Formula: C12H14N2O2
KIN05261693
5-METHYL-3-[3-(1-PHENYLETHOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:1171539-63-1
Formula: C17H16N2O2
KIN05262424
5-METHYL-3-[3-(1H-PYRROL-1-YL)PHENYL][1,2,4]-OXADIAZOLE
CAS:261966-38-5
KIN03629943
5-METHYL-3-[3-(3-NITROPHENYL)-2-TRIAZEN-1-YL]ISOXAZOLE
CAS:3662-37-1
KIN01093453
5-METHYL-3-[3-(4-NITROPHENOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:259184-38-8
KIN03629942
5-METHYL-3-[3-(4-NITROPHENYL)-2-TRIAZEN-1-YL]ISOXAZOLE
CAS:3662-72-4
KIN01093454
5-METHYL-3-[3-(ALLYLOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:1048541-03-2
Formula: C12H12N2O2
KIN05096670
5-METHYL-3-[3-(BENZYLOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:1048541-10-1
Formula: C16H14N2O2
KIN05096671
5-METHYL-3-[3-(TRIFLUOROMETHYL)PHENYL]-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:29903-92-2
KIN02177550
5-METHYL-3-[3-(TRIFLUOROMETHYL)PHENYL]PYRIDAZINE
CAS:68845-76-1
Formula: C12H9F3N2
KIN02566037
5-METHYL-3-[3-(TRIFLUOROMETHYL)PHENYL]THIAZOL-2-IMINE
CAS:137402-43-8
Formula: C11H9F3N2S
KIN03241338
5-METHYL-3-[3-[4-[2-(2,2,2-TRIFLUORO-ETHOXY)PHENYL]PIPERAZIN-1-YL]PROPYL]-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:232953-52-5
Formula: C20H25F3N4O3
KIN03443553
5-METHYL-3-[4-(1-METHYLETHYL)PHENOXY][1,2,4]-OXADIAZOLE
CAS:131945-52-3
KIN03629941
5-METHYL-3-[4-(1-METHYLETHYL)PHENYL]-2-OXAZOLIDINONE
CAS:121372-96-1
KIN03663641
5-METHYL-3-[4-(1-METHYLETHYL)PHENYL]PYRAZOLE
CAS:1035092-07-9
Formula: C13H16N2
KIN05069008
5-METHYL-3-[4-(3-PHENYLPROPOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:145259-31-0
KIN03618584
5-METHYL-3-[4-(4-METHYLPHENYL)-THIAZOL-2-YL]ISOXAZOLE
CAS:263897-39-8
KIN03652367
5-METHYL-3-[4-(ALLYLOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:1047323-47-6
Formula: C12H12N2O2
KIN05095919
5-METHYL-3-[4-(BENZYLOXY)PHENYL]-3-PYRROLIDINOL
CAS:95618-19-2
Formula: C18H21NO2
KIN02793432
5-METHYL-3-[4-(BENZYLOXY)PHENYL][1,2,4]-OXADIAZOLE
CAS:145259-32-1
KIN03009920
5-METHYL-3-[4-(METHYLSULFONYL)PHENYL]-2-OXAZOLIDINONE
CAS:121373-02-2
KIN03652366
5-METHYL-3-[4-(METHYLSULFONYL)PHENYL]PYRIDIN-2-YLAMINE
CAS:202409-77-6
KIN03641124
5-METHYL-3-[4-(METHYLTHIO)PHENYL]-2-PYRIDINAMINE
CAS:217090-18-1
Formula: C13H14N2S
KIN03671428
5-METHYL-3-[4-(TRIFLUOROMETHOXY)-PHENYL]-2(3H)-THIAZOLIMINE
CAS:1163277-23-3
Formula: C11H9F3N2OS
KIN05259360
5-METHYL-3-[4-(TRIFLUOROMETHYL)PHENYL]ISOXAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:159693-08-0
KIN03324032
5-METHYL-3-[4-[(2-METHYLHYDRAZINYL)METHYL]PHENYL][1,2,4]-OXADIAZOLE
CAS:1211-51-4
KIN01043694
5-METHYL-3-[8-(3'-OCTADECYL[2,2'-BIOXIRAN]-3-YL)OCTYL]-2(5H)-FURANONE
CAS:158204-48-9
Formula: C35H62O4
KIN03320003
5-METHYL-3-ALLYL-1H-INDOLE
CAS:72628-94-5
Formula: C12H13N
KIN02592684
5-METHYL-3-ALLYL-2(5H)-THIOPHENONE
CAS:34971-41-0
KIN02218645
5-METHYL-3-ALLYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:160448-60-2
Formula: C7H10N2O2
KIN03326015
5-METHYL-3-ALLYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:39588-98-2
Formula: C8H10N2O2
KIN02256045
5-METHYL-3-ALLYL-2-THIOPHENETHIOL
CAS:84021-65-8
Formula: C8H10S2
KIN02664858
5-METHYL-3-ALLYL-2-THIOXO-4(1H)-IMIDAZOLIDINONE
CAS:49630-32-2
Formula: C7H10N2OS
KIN02289292
5-METHYL-3-AMINO-ANILINE
CAS:108-72-5
Formula: C6H9N3
KIN01004107
5-METHYL-3-AMINO-ANILINE 2HCL
CAS:26346-38-3
Formula: C7H10N2.2ClH
KIN02147567
5-METHYL-3-BENZOFURANACETAMIDE
CAS:102196-60-1
Formula: C11H11NO2
KIN03045184
5-METHYL-3-BENZOFURANCARBALDEHYDE
CAS:143883-36-7
Formula: [C10H8O2
KIN03272841
5-METHYL-3-BENZOFURANCARBOXYLIC ACID
CAS:93670-26-9
Formula: C10H8O3
KIN02772172
5-METHYL-3-BENZOFURANCARBOXYLIC ACID METHYL ESTER
CAS:93670-27-0
Formula: C11H10O3
KIN02772173
5-METHYL-3-CYCLOHEXENE-1-CARBONITRILE
CAS:24054-29-3
Formula: C8H11N
KIN02126437
5-METHYL-3-ETHYLNONANE
CAS:62184-49-0
Formula: C12H26
KIN02469537
5-METHYL-3-FURANCARBALDEHYDE
CAS:87241-04-1
Formula: C6H6O2
KIN02685329
5-METHYL-3-FURANCARBOXYLIC ACID
CAS:21984-93-0
Formula: C6H6O3
KIN02106126
5-METHYL-3-FURANCARBOXYLIC ACID 2-CARBOXY-PHENYL ESTER
CAS:339289-09-7
KIN03641123
5-METHYL-3-FURANTHIOL
CAS:56078-97-8
Formula: C5H6OS
KIN02377126
5-METHYL-3-HEPTANAMINE
CAS:67953-05-3
Formula: C8H19N
KIN02559591
5-METHYL-3-HEPTANOL
CAS:18720-65-5
Formula: C8H18O
KIN02074636
MFCD00021920
5-METHYL-3-HEPTANONE
CAS:541-86-6
Formula: C5H8ClFO2
KIN01019094
5-METHYL-3-HEPTANONE PEROXIDE
CAS:90604-94-7
Formula: C16H34O4
KIN02730567
5-METHYL-3-HEPTEN-2-ONE
CAS:5090-17-5
Formula: C13H15BrN2OS
KIN01120491
5-METHYL-3-HEPTENE
CAS:13172-91-3
Formula: C8H16
KIN02015947
MFCD00049124
5-METHYL-3-HEXANOL
CAS:623-56-3
Formula: C7H14O
KIN01023132
5-METHYL-3-HEXANOL ACETATE
CAS:89389-86-6
Formula: C9H20O3
KIN02711138
5-METHYL-3-HEXANOL HYDROGEN PHOSPHORO-DITHIOATE
CAS:175888-46-7
Formula: C14H31O2PS2
KIN03359891
5-METHYL-3-HEXANONE OXIME
CAS:52435-36-6
Formula: C7H15NO
KIN02321144
5-METHYL-3-HEXANONE PHENYLHYDRAZONE
CAS:89188-92-1
Formula: C13H20N2
KIN02708282
5-METHYL-3-HEXANONE SEMICARBAZONE
CAS:1116-61-6
Formula: C9H21B
KIN01039962
5-METHYL-3-HEXEN-2-OL ACETATE
CAS:92775-98-9
Formula: C9H16O2
KIN02761363
5-METHYL-3-HEXEN-2-ONE
CAS:5166-56-3
Formula: C34H30O6
KIN01122026
5-METHYL-3-HEXENOIC ACID
CAS:62356-03-0
Formula: C7H12O2
KIN02472619
5-METHYL-3-HEXYN-1-OL
CAS:96308-72-4
Formula: C7H12O
KIN02799754
5-METHYL-3-HEXYN-2-ONE
CAS:51686-95-4
Formula: C7H10O
KIN02310160
5-METHYL-3-HEXYN-2-ONE (2,4-DINITROPHENYL)HYDRAZONE
CAS:64632-97-9
Formula: C13H14N4O4
KIN02512984
5-METHYL-3-HYDROXY-PHENOL 1,3-DIACETATE
CAS:20982-28-9
Formula: C11H12O4
KIN02096176
5-METHYL-3-HYDROXY-PHENOL 1-BENZENESULFONATE
CAS:176382-26-6
KIN03360663
5-METHYL-3-HYDROXY-PHENOL 1-METHANESULFONATE
CAS:59722-46-2
KIN02436157
5-METHYL-3-HYDROXY-PIPERIDINE
CAS:33469-64-6
Formula: C6H13NO
KIN02205954
5-METHYL-3-HYDROXY-PYRIDINE
CAS:42732-49-0
Formula: C6H7NO
KIN02279912
MFCD00661297
5-METHYL-3-HYDROXY-PYRIDINE 1-OXIDE
CAS:1194545-55-5
Formula: C6H7NO2
KIN05335556
5-METHYL-3-HYDROXY-PYRIDINE 3-( TOSYLATE)
CAS:458569-34-1
Formula: C13H13NO3S
KIN03594669
5-METHYL-3-HYDROXY-PYRIDINE 3-ACETATE
CAS:1071669-62-9
Formula: C8H9NO2
KIN05113306
5-METHYL-3-HYDROXYMETHYL-1H-INDOLE
CAS:215997-77-6
Formula: C10H11NO
KIN03428668
5-METHYL-3-INDOLIZINECARBOXYLIC ACID ETHYL ESTER
CAS:65894-08-8
Formula: C12H13NO2
KIN02534055
5-METHYL-3-ISOTHIAZOLAMINE
CAS:128146-85-0
KIN03200503
5-METHYL-3-ISOTHIAZOLECARBALDEHYDE
CAS:1083274-36-5
Formula: C5H5NOS
KIN05124308
5-METHYL-3-ISOTHIAZOLECARBONITRILE
CAS:65735-08-2
Formula: C5H4N2S
KIN02531527
5-METHYL-3-ISOTHIAZOLECARBOXYLIC ACID
CAS:110632-59-2
Formula: C5H5NO2S
KIN03102855
5-METHYL-3-ISOTHIAZOLOL 3-(N-METHYLCARBAMATE)
CAS:50786-78-2
KIN02297489
5-METHYL-3-ISOTHIAZOLOL 3-ACETATE
CAS:90724-58-6
Formula: C6H7NO2S
KIN02732322
5-METHYL-3-ISOXAZOLAMINE
CAS:1072-68-0
Formula: C5H8N2
KIN01038648
5-METHYL-3-ISOXAZOLAMINE HCL
CAS:60959-25-3
Formula: C4H6N2O.ClH
KIN02449228
5-METHYL-3-ISOXAZOLEACETAMIDE
CAS:1087755-31-4
Formula: C6H8N2O2
KIN05126868
5-METHYL-3-ISOXAZOLEACETIC ACID
CAS:57612-87-0
Formula: C6H7NO3
KIN02402313
(5-Methyl-isoxazol-3-yl)-acetic acid; 5-Methyl-3-i
5-METHYL-3-ISOXAZOLEACETIC ACID, ETHYL ESTER
CAS:60148-50-7
Formula: C8H11NO3
KIN02442057
5-METHYL-3-ISOXAZOLEACETONITRILE
CAS:35166-41-7
Formula: C6H6N2O
KIN02220398
5-METHYL-3-ISOXAZOLECARBONITRILE
CAS:57351-99-2
Formula: C5H4N2O
KIN02398293
5-Methyl-1,2-oxazole-3-carbonitrile
MFCD09064940
5-METHYL-3-ISOXAZOLECARBONYL AZIDE
CAS:61672-67-1
Formula: C5H4N4O2
KIN02459686
5-METHYL-3-ISOXAZOLECARBONYL CHLORIDE
CAS:39499-34-8
Formula: C5H4ClNO2
KIN02255306
5-Methylisoxazole-3-carbonyl chloride
MFCD00085127
5-METHYL-3-ISOXAZOLECARBONYL ISOCYANATE
CAS:37071-01-5
Formula: C6H4N2O3
KIN02236799
5-METHYL-3-ISOXAZOLECARBOTHIISOCYANATE
CAS:77358-49-7
Formula: C6H4N2O2S
KIN02625091
5-METHYL-3-ISOXAZOLECARBOTHIOAMIDE
CAS:77358-26-0
Formula: C5H6N2OS
KIN02625088
5-Methyl-isoxazol-3-carbothioamide
MFCD00173804
5-METHYL-3-ISOXAZOLECARBOTHIOIC ACID S-[3-(TRIFLUOROMETHYL)-PYRIDIN-2-YL] ESTER
CAS:263762-06-7
Formula: C11H7F3N2O2S
KIN03461058
5-METHYL-3-ISOXAZOLECARBOTHIOIC ACID S-[5-(TRIFLUOROMETHYL)-PYRIDIN-2-YL] ESTER
CAS:263707-26-2
Formula: C11H7F3N2O2S
KIN03460953
5-METHYL-3-ISOXAZOLECARBOXALDEHYDE
CAS:62254-74-4
Formula: C5H5NO2
KIN02471018
5-Methyl-isoxazol-3-carbaldehyde
MFCD06797459
5-METHYL-3-ISOXAZOLECARBOXALDEHYDE OXIME
CAS:89322-78-1
Formula: C5H6N2O2
KIN02710266
5-METHYL-3-ISOXAZOLECARBOXAMIDE
CAS:3445-53-2
Formula: C9H9ClO3S
KIN01089372
5-METHYL-3-ISOXAZOLECARBOXIMIDAMIDE
CAS:1172692-54-4
Formula: C5H7N3O
KIN05263975
5-METHYL-3-ISOXAZOLECARBOXYLIC ACID 2-BUTYLHYDRAZIDE
CAS:101670-69-3
Formula: C9H15N3O2
KIN03041007
5-METHYL-3-ISOXAZOLECARBOXYLIC ACID, BUTYL ESTER
CAS:85168-94-1
Formula: C9H13NO3
KIN02672447
5-METHYL-3-ISOXAZOLECARBOXYLIC ACID, HYDRAZIDE
CAS:62438-03-3
Formula: C5H7N3O2
KIN02474075
MFCD02091279
5-METHYL-3-ISOXAZOLEETHANAMINE
CAS:1018662-73-1
Formula: C6H10N2O
KIN05039792
5-METHYL-3-ISOXAZOLEMETHANAMINE
CAS:154016-48-5
Formula: C5H8N2O
KIN03307239
5-METHYL-3-ISOXAZOLEMETHANESULFONAMIDE
CAS:1042780-11-9
Formula: C5H8N2O3S
KIN05091394
5-METHYL-3-ISOXAZOLEMETHANESULFONIC ACID HYDRAZIDE
CAS:1042780-60-8
Formula: C5H9N3O3S
KIN05091405
5-METHYL-3-ISOXAZOLEMETHANESULFONYL CHLORIDE
CAS:1000932-59-1
Formula: C5H6ClNO3S
KIN05005052
5-METHYL-3-ISOXAZOLEMETHANETHIOL
CAS:146796-46-5
Formula: C5H7NOS
KIN03283697
5-METHYL-3-ISOXAZOLEMETHANOL
CAS:35166-33-7
Formula: C5H7NO2
KIN02220394
(5-Methyl-1,2-oxazol-3-yl)methanol; 3-Hydroxymethy
MFCD00085129
5-METHYL-3-ISOXAZOLEPENTANOIC ACID
CAS:91945-52-7
Formula: C9H13NO3
KIN02750817
5-METHYL-3-ISOXAZOLEPENTANOL
CAS:91945-53-8
Formula: C9H15NO2
KIN02750818
5-METHYL-3-ISOXAZOLEPROPANAMINE
CAS:1000555-94-1
Formula: C7H12N2O
KIN05003427
5-METHYL-3-ISOXAZOLEPROPANOIC ACID
CAS:80073-32-1
Formula: C7H9NO3
KIN02641709
5-METHYL-3-ISOXAZOLEPROPANOIC ACID, METHYL ESTER
CAS:91945-49-2
Formula: C8H11NO3
KIN02750814
5-METHYL-3-ISOXAZOLEPROPANOL
CAS:91945-50-5
Formula: C7H11NO2
KIN02750815
5-METHYL-3-ISOXAZOLIDINONE
CAS:41833-03-8
KIN02273788
5-METHYL-3-ISOXAZOLOL 2-NITRO-BENZOATE (ESTER)
CAS:66300-78-5
Formula: C11H8N2O5
KIN02540131
5-METHYL-3-ISOXAZOLOL 3-( TOSYLATE)
CAS:76422-46-3
Formula: C11H11NO4S
KIN02619156
5-METHYL-3-ISOXAZOLOL 3-(HYDROGEN SULFATE)
CAS:118076-57-6
Formula: C4H5NO5S
KIN03152454
5-METHYL-3-ISOXAZOLOL 3-ACETATE
CAS:151293-47-9
Formula: C6H7NO3
KIN03298921
5-METHYL-3-ISOXAZOLOL 3-BENZOATE
CAS:24827-14-3
Formula: C11H9NO3
KIN02134203
5-METHYL-3-ISOXAZOLOL 3-METHANESULFONATE
CAS:129235-20-7
Formula: C5H7NO4S
KIN03205011
5-METHYL-3-ISOXAZOLOL 3-NITRO-BENZOATE (ESTER)
CAS:66300-79-6
Formula: C11H8N2O5
KIN02540132
5-METHYL-3-MERCAPTO[1,2,4]-TRIAZOLO[3,4-B]BENZO[D]THIAZOLE
CAS:147423-88-9
Formula: C9H7N3S2
KIN03286026
5-METHYL-3-METHYLENE-1-(METHYLTHIO)-HEXANE
CAS:67173-71-1
Formula: C9H18S
KIN02549431
5-METHYL-3-METHYLENE-2-HEXANONE
CAS:1187-89-9
Formula: C7H13NO
KIN01042494
5-METHYL-3-METHYLENE-4-OXO-1,5-CYCLOHEXADIEN-1-CARBALDEHYDE
CAS:153873-03-1
Formula: [C9H8O2
KIN03306753
5-METHYL-3-METHYLENE-5-HEXEN-2-OL
CAS:65669-04-7
Formula: C8H14O
KIN02530554
5-METHYL-3-METHYLENE-5-HEXEN-2-ONE
CAS:51756-18-4
Formula: C8H12O
KIN02311129
5-METHYL-3-METHYLENE-9-OXA-BICYCLO[3.3.1]NONANE
CAS:172946-29-1
Formula: C10H16O
KIN03352368
5-METHYL-3-METHYLENE-BICYCLO[3.2.1]OCTAN-6,8-DIONE
CAS:127255-00-9
Formula: C10H12O2
KIN03008526
5-METHYL-3-METHYLENE-DIHYDRO-FURAN-2-ONE
CAS:62322-49-0
Formula: C6H8O2
KIN02472068
alpha-Methylene-gamma-valerolactone
MFCD06797118
5-METHYL-3-METHYLENE-HEXANOIC ACID
CAS:90252-88-3
Formula: C8H14O2
KIN02724619
5-METHYL-3-METHYLENE-THIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:206554-06-5
Formula: C8H8N2OS
KIN03416387
5-METHYL-3-METHYLENEDIHYDRO-FURAN-2(3H)-ONE
CAS:62873-16-9
Formula: C6H8O2
KIN02481959
alpha-Methylene-gamma-valerolactone
MFCD06797118
5-METHYL-3-METHYLENEPYRROLIDINE-2-ONE
CAS:130868-98-3
Formula: C6H9NO
KIN03211849
5-METHYL-3-MORPHOLIN-4-YL-5H-1,2,4-TRIAZINO[5,6-B]INDOLE
CAS:3993-23-5
KIN01099153
5-METHYL-3-MORPHOLIN-4-YL-5H-PYRIDAZINO[3,4-B][1,4]BENZOXAZINE
CAS:35669-65-9
Formula: C15H16N4O2
KIN02225211
5-METHYL-3-N-PENTADECYLCATECHOL
CAS:16273-08-8
Formula: C22H38O2
KIN02049703
5-METHYL-3-NITRO-1-(2,2,2-TRIFLUORO-ETHYL)-1H-PYRAZOLE
CAS:1170885-02-5
Formula: C6H6F3N3O2
KIN05261715
5-METHYL-3-NITRO-1-(2,3,3-TRIFLUORO-ALLYL)-1H-PYRAZOLE
CAS:1006555-33-4
Formula: C7H6F3N3O2
KIN05013047
5-METHYL-3-NITRO-1-(3,3,3-TRIFLUOROPROPYL)-1H-PYRAZOLE
CAS:1006553-96-3
Formula: C7H8F3N3O2
KIN05013037
5-METHYL-3-NITRO-1-[(4-NITROPHENYL)METHYL]PYRAZOLE
CAS:1006500-04-4
Formula: C11H10N4O4
KIN05012884
5-METHYL-3-NITRO-1-PHENYL-1H-PYRAZOLE
CAS:38581-18-9
KIN02248989
5-METHYL-3-NITRO-1-PROPYL-1H-PYRAZOLE
CAS:1171712-33-6
Formula: C7H11N3O2
KIN05262604
5-METHYL-3-NITRO-1H-[1,2,4]-TRIAZOL-1-ACETAMIDE
CAS:151354-67-5
Formula: C5H7N5O3
KIN03299062
5-METHYL-3-NITRO-1H-[1,2,4]-TRIAZOL-1-ACETIC ACID
CAS:498572-52-4
Formula: C5H6N4O4
KIN03027513
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETALDEHYDE
CAS:1006457-88-0
Formula: C6H7N3O3
KIN05012195
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETAMIDE
CAS:384820-93-3
KIN03552734
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETIC ACID
CAS:344912-39-6
Formula: C6H7N3O4
KIN03521120
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:321165-21-3
KIN03492756
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETOHYDRAZIDE
CAS:1002034-01-6
Formula: C6H9N5O3
KIN05006627
5-METHYL-3-NITRO-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1006442-04-1
Formula: C6H6ClN3O3
KIN05011954
5-METHYL-3-NITRO-1H-PYRAZOL-1-BUTANENITRILE
CAS:1006555-38-9
Formula: C8H10N4O2
KIN05013048
5-METHYL-3-NITRO-1H-PYRAZOL-1-BUTANOYL CHLORIDE
CAS:1006459-08-0
Formula: C8H10ClN3O3
KIN05012236
5-METHYL-3-NITRO-1H-PYRAZOL-1-ETHANAMINE
CAS:1004192-84-0
Formula: C6H10N4O2
KIN05009173
5-METHYL-3-NITRO-1H-PYRAZOL-1-ETHANOL
CAS:1006950-51-1
Formula: C6H9N3O3
KIN05013501
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANAMIDE
CAS:1005640-88-9
Formula: C7H10N4O3
KIN05010886
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANAMINE
CAS:1006950-61-3
Formula: C7H12N4O2
KIN05013508
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANENITRILE
CAS:1006554-02-4
Formula: C7H8N4O2
KIN05013038
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANOIC ACID
CAS:1002032-61-2
Formula: C7H9N3O4
KIN05006614
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANOIC ACID HYDRAZIDE
CAS:1001755-69-6
Formula: C7H11N5O3
KIN05006262
5-METHYL-3-NITRO-1H-PYRAZOL-1-PROPANOL
CAS:1006440-62-5
Formula: C7H11N3O3
KIN05011922
5-METHYL-3-NITRO-1H-PYRAZOL-1-YLAMINE
CAS:151588-03-3
Formula: [C4H6N4O2
KIN03299823
5-METHYL-3-NITRO-1H-PYRAZOLE
CAS:1048925-02-5
Formula: C4H5N3O2
KIN05097022
5-METHYL-3-NITRO-1H-PYRAZOLO[3,4-C]PYRIDINE
CAS:76006-16-1
Formula: C7H6N4O2
KIN02616335
5-METHYL-3-NITRO-1H-PYRAZOLO[4,3-B]PYRIDINE
CAS:52090-80-9
Formula: C7H6N4O2
KIN02315971
5-METHYL-3-NITRO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190321-24-4
KIN05330732
3-Nitro-5-methyl-7-aza-1H-indole
5-METHYL-3-NITRO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190318-47-8
KIN05330506
5-Methyl-3-nitro-4-aza-1H-indole
5-METHYL-3-NITRO-2(1H)-PYRIDINETHIONE
CAS:25391-74-6
Formula: C6H6N2O2S
KIN02139289
5-METHYL-3-NITRO-2(1H)-PYRIDINONE
CAS:7464-15-5
Formula: C6H7N3O2
KIN01187631
5-METHYL-3-NITRO-2(3H)-ALPHA-PYRIDINIMINE
CAS:1099859-46-7
Formula: C6H7N3O2
KIN05166037
5-METHYL-3-NITRO-2,4-HEXANEDIOL
CAS:78651-63-5
Formula: C7H15NO4
KIN02632887
5-METHYL-3-NITRO-2-(2-NITROETHENYL)-1H-PYRROLE
CAS:1112182-16-7
Formula: C7H7N3O4
KIN05174963
5-METHYL-3-NITRO-2-(2-NITROETHENYL)THIOPHENE
CAS:1112179-38-0
Formula: C7H6N2O4S
KIN05174891
5-METHYL-3-NITRO-2-(2-PYRIDINYLTHIO)-PYRIDINE
CAS:353280-98-5
Formula: C11H9N3O2S
KIN03530839
5-METHYL-3-NITRO-2-(BENZENESULFONYL)-PYRIDINE
CAS:1087745-45-6
Formula: C12H10N2O4S
KIN05126816
5-METHYL-3-NITRO-2-(BENZYLOXY)PHENYL-ACETIC ACID
CAS:383135-87-3
Formula: C16H15NO5
KIN03551326
5-METHYL-3-NITRO-2-(PHENYLAMINO)-BENZOIC ACID
CAS:103942-83-2
KIN03057421
5-METHYL-3-NITRO-2-[(BENZYL)THIO]PYRIDINE
CAS:439147-66-7
Formula: C13H12N2O2S
KIN03582581
5-METHYL-3-NITRO-2-AMINO-ANILINE
CAS:53369-89-4
KIN02334070
5-METHYL-3-NITRO-2-FURANCARBALDEHYDE
CAS:213178-16-6
Formula: C6H5NO4
KIN03424709
5-METHYL-3-NITRO-2-HYDROXY-PHENOL
CAS:89791-96-8
Formula: C7H7NO4
KIN02717085
5-METHYL-3-NITRO-2-PHENYL-1H-PYRROLE
CAS:37964-20-8
KIN02244195
5-METHYL-3-NITRO-2-PYRIDINEACETONITRILE
CAS:123846-68-4
Formula: C8H7N3O2
KIN03181413
5-METHYL-3-NITRO-2-PYRIDINEBUTANENITRILE
CAS:85634-84-0
Formula: C10H11N3O2
KIN02675657
5-METHYL-3-NITRO-2-PYRIDINECARBALDEHYDE
CAS:52381-07-4
Formula: C7H6N2O3
KIN02320373
5-METHYL-3-NITRO-2-PYRIDINECARBALDEHYDE OXIME
CAS:52381-13-2
Formula: C7H7N3O3
KIN02320376
5-METHYL-3-NITRO-2-PYRIDINECARBONITRILE
CAS:1089330-68-6
Formula: C7H5N3O2
KIN05128354
5-METHYL-3-NITRO-2-PYRIDINECARBONYL CHLORIDE
CAS:59290-87-8
Formula: C7H5ClN2O3
KIN02429361
5-METHYL-3-NITRO-2-PYRIDINECARBOXAMIDE
CAS:63478-64-8
Formula: C7H7N3O3
KIN02493641
5-METHYL-3-NITRO-2-PYRIDINEPENTANENITRILE
CAS:85634-98-6
Formula: C11H13N3O2
KIN02675664
5-METHYL-3-NITRO-2-PYRIDINESULFENAMIDE
CAS:163137-48-2
Formula: C6H7N3O2S
KIN03333049
5-METHYL-3-NITRO-2-PYRIDINESULFONAMIDE
CAS:163137-49-3
Formula: C6H7N3O4S
KIN03333050
5-METHYL-3-NITRO-2-THIOPHENAMINE
CAS:1119454-99-7
Formula: C5H6N2O2S
KIN05177222
5-METHYL-3-NITRO-2-THIOPHENECARBONITRILE
CAS:1027512-56-6
Formula: C6H4N2O2S
KIN05062695
5-METHYL-3-NITRO-3-HEXEN-2-OL
CAS:78651-76-0
KIN02632888
5-METHYL-3-NITRO-4-(PHENYLTHIO)-QUINOLIN-2(1H)-ONE
CAS:172469-79-3
Formula: [C12H10N2O3S
KIN03350962
5-METHYL-3-NITRO-4-(PYRIDIN-2-YLTHIO)-2(1H)-PYRIDINONE
CAS:172469-90-8
Formula: C11H9N3O3S
KIN03350973
5-METHYL-3-NITRO-6-PROPYL-2(1H)-ALPHA-PYRIDINONE
CAS:1042154-20-0
Formula: C9H12N2O3
KIN05088659
5-METHYL-3-NITRO-ISOXAZOLE
CAS:75079-82-2
Formula: C4H4N2O3
KIN02610244
5-METHYL-3-NITRO-N,N-DI-ALLYL-1H-PYRAZOL-1-ACETAMIDE
CAS:1006556-00-8
Formula: C12H16N4O3
KIN05013050
5-METHYL-3-NITRO-N-[4-(TRIFLUOROMETHOXY)PHENYL]PYRAZOL-1-ACETAMIDE
CAS:353455-39-7
Formula: C13H11F3N4O4
KIN03530921
5-METHYL-3-NITRO-N-PHENYLPYRIDIN-2-YLAMINE
CAS:106690-42-0
KIN03077925
5-METHYL-3-NITRO-N-PYRIDIN-2-YL-1H-PYRAZOL-1-ACETAMIDE
CAS:296799-44-5
KIN03641122
5-METHYL-3-NITROPYRIDAZINE 1-OXIDE
CAS:81437-18-5
Formula: C5H5N3O3
KIN02649781
5-METHYL-3-NITROPYRIDAZINE 2-OXIDE
CAS:81437-24-3
Formula: C5H5N3O3
KIN02649785
5-METHYL-3-NITROPYRIDIN-2-CARBOXYLIC ACID
CAS:52381-08-5
Formula: C7H6N2O4
KIN02320374
5-METHYL-3-NITROPYRIDIN-2-YLAMINE
CAS:7598-27-8
Formula: C22H17BrO3
KIN01191990
5-METHYL-3-NITROQUINOLINE
CAS:107000-10-2
Formula: C10H8N2O2
KIN03080354
5-METHYL-3-NITROSO-2-PHENYL-1H-INDOLE
CAS:105492-07-7
Formula: C15H12N2O
KIN03068634
5-METHYL-3-NITROSO-2-PHENYL-1H-INDOLIZINE
CAS:39077-73-1
KIN02252584
5-METHYL-3-NITROSO-2-PHENYL-1H-PYRROLE
CAS:34714-74-4
KIN02216368
5-METHYL-3-NITROSO-4-OXAZOLIDINECARBOXYLIC ACID
CAS:95326-11-7
Formula: C5H8N2O4
KIN02790375
5-METHYL-3-NITROSO-OXAZOLIDIN-2-ONE
CAS:79624-33-2
Formula: C4H5N2O3
KIN02638869
5-METHYL-3-NONANONE
CAS:89932-41-2
Formula: C10H20O
KIN02719411
5-METHYL-3-NONEN-2-ONE
CAS:64087-32-7
Formula: C10H18O
KIN02504220
5-METHYL-3-NONYNE-1,5-DIOL
CAS:1559-26-8
Formula: C8H15O5P
KIN01050090
5-METHYL-3-OCTANOL
CAS:147046-82-0
KIN03284627
5-METHYL-3-OCTYL-1,2,4-OXADIAZOLE
CAS:103499-18-9
KIN03054241
5-METHYL-3-OCTYLBENZENE-1,2-DIOL
CAS:201858-80-2
Formula: C15H24O2
KIN03409725
5-METHYL-3-OCTYNE-1,5-DIOL
CAS:1559-70-2
Formula: C8H17NO3
KIN01050102
5-METHYL-3-OXA-BICYCLO[3.2.0]HEPT-2-ONE
CAS:59664-81-2
Formula: C7H10O2
KIN02435079
5-METHYL-3-OXAZOLIDINECARBONYL CHLORIDE
CAS:39885-53-5
Formula: C5H8ClNO2-
KIN02258248
5-METHYL-3-OXAZOLIDINECARBOTHIOIC ACID S-(BENZYL) ESTER
CAS:39885-68-2
KIN02258252
5-METHYL-3-OXAZOLIDINECARBOXYLIC ACID ETHYL ESTER
CAS:35627-20-4
KIN02224868
5-METHYL-3-OXIDO-6,8-DIPHENYL-[1,2,5]OXADIAZOLO[1,2]PYRIDO[4,5-B]PYRIMIDIN-3-IUM-4,7,9-TRIONE
CAS:189998-40-1
Formula: C20H13N5O5
KIN03390266
5-METHYL-3-OXO-1(1H)-PYRAZOLIDINECARBONYL CHLORIDE
CAS:54944-91-1
Formula: C5H7ClN2O2-
KIN02357967
5-METHYL-3-OXO-1-(PHENYLMETHYLENE)-1H-PYRAZOLIDINIUM INNER SALT
CAS:14893-83-5
Formula: C11H12N2O
KIN02036509
5-METHYL-3-OXO-1-CYCLOHEXENE-1-ACETIC ACID METHYL ESTER
CAS:51352-22-8
Formula: C10H14O3
KIN02305348
5-METHYL-3-OXO-1-CYCLOPENTENE-1-CARBOXYLIC ACID METHYL ESTER
CAS:115514-31-3
Formula: C8H10O3
KIN03137580
5-METHYL-3-OXO-1H-PYRAZOL-2-CARBOTHIOAMIDE
CAS:5325-88-2
Formula: C10H8S2
KIN01125871
5-METHYL-3-OXO-2(3H)-ISOXAZOLECARBONYL CHLORIDE
CAS:42158-16-7
Formula: C5H4ClNO3-
KIN02276337
5-METHYL-3-OXO-2(3H)-ISOXAZOLECARBOXAMIDE
CAS:77643-87-9
Formula: C5H6N2O3
KIN02626748
5-METHYL-3-OXO-2(3H)-ISOXAZOLECARBOXYLIC ACID 4-(2,4-DICHLOROBENZOYL)-1,3-DIMETHYL-1H-PYRAZOL-5-YL ESTER
CAS:58011-75-9
Formula: C17H13Cl2N3O5
KIN02409008
5-METHYL-3-OXO-2,3-DIHYDROPYRIDAZIN-4-CARBOXYLIC ACID
CAS:342402-51-1
Formula: N1=CC(=C(C(=O)N1)C(=O)O)C
KIN03515883
5-METHYL-3-OXO-2-AZABICYCLO[3.3.1]NONAN-1-ACETIC ACID
CAS:6331-25-5
Formula: C11H20O8S2
KIN01158923
5-METHYL-3-OXO-2-PIPERAZINEACETIC ACID ETHYL ESTER
CAS:5194-04-7
Formula: C13H13N3O3
KIN01122613
5-METHYL-3-OXO-2-PROPYL-4-HEXENOIC ACID METHYL ESTER
CAS:90784-54-6
Formula: C11H18O3
KIN02733250
5-METHYL-3-OXO-3H-PYRAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:1195528-22-3
Formula: C7H8N2O3
KIN05337393
5-METHYL-3-OXO-3H-PYRAZOL-4-PROPANENITRILE
CAS:1195643-55-0
Formula: C7H7N3O
KIN05338003
5-METHYL-3-OXO-4-HEXENOIC ACID
CAS:32830-85-6
KIN02200290
5-METHYL-3-OXO-4-HEXENOIC ACID ETHYL ESTER
CAS:25556-51-8
Formula: C9H14O3
KIN02140894
5-METHYL-3-OXO-4-HEXENOIC ACID METHYL ESTER
CAS:32804-67-4
KIN02200065
5-METHYL-3-OXO-4-HEXENOIC ACID TERT-BUTYL ESTER
CAS:132117-98-7
Formula: C11H18O3
KIN03217242
5-METHYL-3-OXO-4-OCTENOIC ACID ETHYL ESTER
CAS:344400-89-1
Formula: C11H18O3
KIN03520092
5-METHYL-3-OXO-5-HEXENOIC ACID ETHYL ESTER
CAS:69357-08-0
KIN02569712
5-METHYL-3-OXO-5-HEXENOIC ACID METHYL ESTER
CAS:1160846-85-4
Formula: C8H12O3
KIN05258284
5-METHYL-3-OXO-6-HEPTENOIC ACID METHYL ESTER
CAS:125801-46-9
Formula: C9H14O3
KIN03190282
5-METHYL-3-OXO-BENZISOTHIAZOLIN-1,1-DIOXID
CAS:29083-15-6
Formula: C8H7NO3S
KIN02171286
5-METHYL-3-OXO-HEPTANOIC ACID ETHYL ESTER
CAS:1062139-66-5
KIN05107925
5-METHYL-3-OXO-HEX-4-ENAL
CAS:32830-84-5
Formula: C7H10O2
KIN02200289
5-METHYL-3-OXO-HEXANAL ION(I) SODIUM
CAS:80065-98-1
Formula: C7H11O2.Na
KIN02641644
5-METHYL-3-OXO-HEXANENITRILE
CAS:64373-43-9
Formula: C7H11NO
KIN02508887
5-METHYL-3-OXO-HEXANOIC ACID
CAS:131991-42-9
Formula: C7H12O3
KIN03216713
5-METHYL-3-OXO-HEXANOIC ACID 2-BUTYN-1-YL ESTER
CAS:35650-65-8
KIN02225055
5-METHYL-3-OXO-HEXANOIC ACID ETHYL ESTER
CAS:13001-24-6
KIN02013376
5-METHYL-3-OXO-HEXANOIC ACID METHYL ESTER
CAS:30414-55-2
Formula: C8H14O3
KIN02182089
MFCD12031307
5-METHYL-3-OXO-N-(BENZYL)-N-PROPYL-2(3H)-ISOXAZOLECARBOXAMIDE
CAS:53707-53-2
Formula: C15H18N2O3
KIN02339422
5-METHYL-3-OXO-N-PYRIDIN-2-YL-HEXANAMIDE
CAS:146380-01-0
KIN03282344
5-METHYL-3-OXO-OCTANOIC ACID METHYL ESTER
CAS:128651-34-3
Formula: C10H18O3
KIN03202572
5-METHYL-3-OXOHEXANAL
CAS:51673-62-2
Formula: C7H12O2
KIN02309975
5-METHYL-3-PENTYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-DIETHYL ESTER
CAS:27171-98-8
KIN02154789
5-METHYL-3-PENTYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL ESTER
CAS:27171-99-9
KIN02154790
5-METHYL-3-PENTYL-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:27172-00-5
KIN02154791
5-METHYL-3-PENTYL-2(5H)-FURANONE
CAS:62527-73-5
Formula: C10H16O2
KIN02475643
5-METHYL-3-PENTYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19360-44-2
Formula: C9H16N2O2
KIN02080622
5-METHYL-3-PENTYLBENZO[D]ISOXAZOLE
CAS:393525-19-4
Formula: C13H17NO
KIN03558055
5-METHYL-3-PHENOXY-ISOXAZOLE
CAS:72309-42-3
Formula: C10H9NO2
KIN02590504
5-METHYL-3-PHENOXY-PYRIDAZINE 1-OXIDE
CAS:182237-67-8
KIN03372452
5-METHYL-3-PHENYL-[1,2,3]TRIAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:25476-69-1
KIN02140251
5-METHYL-3-PHENYL-1'-(BENZYL)-[3,4'-BIPIPERIDINE]-2,6-DIONE HCL
CAS:20340-49-2
KIN02090271
5-METHYL-3-PHENYL-1,2,4-OXADIAZOLE
CAS:1198-99-8
Formula: C7H5N3O2
KIN01043070
5-METHYL-3-PHENYL-1,2,4-THIADIAZOLE
CAS:90418-03-4
Formula: C9H8N2S
KIN02727605
5-METHYL-3-PHENYL-1,2,4-TRIAZIN-6(1H)-ONE
CAS:69991-83-9
Formula: C10H9N3O
KIN02574428
5-METHYL-3-PHENYL-1,2-BENZO[D]THIAZOLE
CAS:117136-81-9
Formula: C14H11NS
KIN03147587
5-METHYL-3-PHENYL-1,2-OXATHIOLAN-4-ONE 2,2-DIOXIDE
CAS:58742-85-1
KIN02420332
5-METHYL-3-PHENYL-1,3,4-OXADIAZOL-2(3H)-ONE
CAS:28740-63-8
Formula: C9H8N2O2
KIN02168469
5-METHYL-3-PHENYL-1,3-OXAZINAN-2-ONE
CAS:103897-20-7
Formula: C11H13NO2
KIN03057120
5-METHYL-3-PHENYL-1,4,2-DIOXAZOLE
CAS:13715-48-5
Formula: C9H9NO2
KIN02023548
5-METHYL-3-PHENYL-1,7-NAPHTHYRIDINE
CAS:147440-87-7
Formula: C15H12N2
KIN03286117
5-METHYL-3-PHENYL-1-(2-PHENYLETHYL)-3-PYRROLIDINOL
CAS:23771-91-7
KIN02123340
5-Methyl-1-phenethyl-3-phenyl-3-pyrrolidinol
5-METHYL-3-PHENYL-1-(2-PHENYLETHYL)-3-PYRROLIDINOL 3-PROPANOATE
CAS:23771-89-3
KIN02123339
5-Methyl-1-phenethyl-3-phenyl-3-pyrrolidinol propa
5-METHYL-3-PHENYL-1-(BENZENESULFONYL)-1H-PYRAZOLE
CAS:66047-13-0
Formula: C16H14N2O2S
KIN02536130
5-METHYL-3-PHENYL-1-(BENZYL)-1H-PYRAZOLE
CAS:79991-38-1
Formula: C17H16N2
KIN02641111
5-METHYL-3-PHENYL-1-(PROPAN-2-YL)-2-THIOXOTETRAHYDROPYRIMIDIN-4(1H)-ONE
CAS:6625-61-2
Formula: C21H19NO3
KIN01166541
5-METHYL-3-PHENYL-1-(PROPAN-2-YL)DIHYDROPYRIMIDIN-2,4(1H,3H)-DIONE
CAS:6297-67-2
Formula: C13H19NO2
KIN01156254
5-METHYL-3-PHENYL-1-(THIOPHEN-2-YL)-2(1H)-PYRIDINONE
CAS:53428-01-6
Formula: C16H13NOS
KIN02335113
5-METHYL-3-PHENYL-1H-INDAZOLE
CAS:57614-16-1
Formula: C14H12N2
KIN02402325
5-METHYL-3-PHENYL-1H-INDOL-2-CARBALDEHYDE
CAS:41019-01-6
KIN02267788
5-METHYL-3-PHENYL-1H-INDOL-2-CARBALDEHYDE OXIME
CAS:106659-41-0
KIN03077709
5-METHYL-3-PHENYL-1H-INDOL-2-CARBOHYDRAZIDE
CAS:105492-13-5
Formula: C16H15N3O
KIN03068637
5-METHYL-3-PHENYL-1H-INDOL-2-CARBONITRILE
CAS:27294-15-1
KIN02155982
5-METHYL-3-PHENYL-1H-INDOL-2-CARBOXYLIC ACID 2-[[(4-CHLOROPHENYL)AMINO]THIOXOMETHYL]HYDRAZIDE
CAS:148372-28-5
Formula: C23H19ClN4OS
KIN03289221
5-METHYL-3-PHENYL-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:138043-77-3
KIN03244615
5-METHYL-3-PHENYL-1H-INDOLE
CAS:56366-15-5
KIN02381681
5-METHYL-3-PHENYL-1H-PYRAZOL-1-CARBOXAMIDE
CAS:10222-79-4
Formula: C11H11N3O
KIN02003414
5-METHYL-3-PHENYL-1H-PYRAZOL-1-CARBOXYLIC ACID METHYL ESTER
CAS:51108-55-5
KIN02301856
5-METHYL-3-PHENYL-1H-PYRAZOL-1-ETHANOL
CAS:196810-78-3
Formula: C12H14N2O
KIN03401561
5-METHYL-3-PHENYL-1H-PYRAZOL-1-ETHANOL 1-ACETATE
CAS:67000-30-0
Formula: C14H16N2O2
KIN02547556
5-METHYL-3-PHENYL-1H-PYRAZOL-1-METHANOL
CAS:369401-86-5
KIN03541757
5-METHYL-3-PHENYL-1H-PYRAZOL-1-PROPANENITRILE
CAS:95170-59-5
Formula: C13H13N3
KIN02788848
5-METHYL-3-PHENYL-1H-PYRAZOL-1-YLAMINE
CAS:77202-05-2
Formula: C10H11N3
KIN02624094
5-METHYL-3-PHENYL-1H-PYRAZOL-4-YLAMINE
CAS:1056929-68-0
KIN05103074
5-METHYL-3-PHENYL-1H-PYRAZOLE
CAS:56426-41-6
Formula: C10H10N2
KIN02382607
5-METHYL-3-PHENYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4,6(5H,7H)-DIONE
CAS:42748-33-4
KIN02280010
5-METHYL-3-PHENYL-1H-PYRAZOLO[4,3-C]ISOQUINOLINE
CAS:112884-55-6
Formula: C17H13N3
KIN03118774
5-METHYL-3-PHENYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-DIETHYL ESTER
CAS:3651-14-7
Formula: C22H21NO4
KIN01093228
5-METHYL-3-PHENYL-1H-PYRROL-2-ACETIC ACID ETHYL ESTER
CAS:1194750-73-6
Formula: C15H17NO2
KIN05335885
5-METHYL-3-PHENYL-1H-PYRROL-2-CARBALDEHYDE
CAS:14533-78-9
KIN02032964
5-METHYL-3-PHENYL-1H-PYRROL-2-CARBONITRILE
CAS:131475-15-5
KIN03214396
5-METHYL-3-PHENYL-1H-PYRROL-2-CARBOXYLIC ACID
CAS:1195220-94-0
Formula: C12H11NO2
KIN05336549
5-METHYL-3-PHENYL-1H-PYRROL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:21756-95-6
KIN02103971
5-METHYL-3-PHENYL-2(1H)-PYRAZINONE
CAS:86731-82-0
Formula: C11H10N2O
KIN02682143
5-METHYL-3-PHENYL-2(1H)-PYRIDINONE
CAS:53428-05-0
Formula: C12H11NO
KIN02335117
5-METHYL-3-PHENYL-2(3H)-BENZOFURANONE
CAS:39531-24-3
Formula: C15H12O2
KIN02255596
5-METHYL-3-PHENYL-2(3H)-OXAZOLONE
CAS:15572-13-1
KIN02042702
5-METHYL-3-PHENYL-2(5H)-FURANONE
CAS:55091-68-4
Formula: C11H10O2
KIN02360469
5-METHYL-3-PHENYL-2(5H)-THIOPHENONE
CAS:153649-20-8
KIN03305870
5-METHYL-3-PHENYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:37620-60-3
Formula: C16H14O
KIN02241127
5-METHYL-3-PHENYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:93781-91-0
KIN02773590
5-METHYL-3-PHENYL-2,4-PYRROLIDINEDIONE
CAS:92288-10-3
Formula: C11H11NO2
KIN02755136
5-METHYL-3-PHENYL-2,4-THIAZOLIDINEDIONE
CAS:1012-89-1
Formula: C9H8N2O3
KIN01037033
5-METHYL-3-PHENYL-2-(2-PHENYLETHENYL)-OXAZOLIDINE
CAS:67066-46-0
Formula: C18H19NO
KIN02548275
5-METHYL-3-PHENYL-2-(BENZYL)-1H-PYRROLE
CAS:167500-65-4
KIN03340783
5-METHYL-3-PHENYL-2-(BENZYL)-2H-PYRAZOLO[3,4-D]PYRIMIDIN-4,6(5H,7H)-DIONE
CAS:54058-37-6
Formula: C19H16N4O2
KIN02344521
5-METHYL-3-PHENYL-2-(BENZYL)THIOPHENE
CAS:119566-92-6
KIN03159559
5-METHYL-3-PHENYL-2-[(TRIMETHYLSILYLOXY)]PYRAZINE
CAS:243472-85-7
KIN03024501
5-METHYL-3-PHENYL-2-CYCLOHEXEN-1-ONE
CAS:29490-59-3
Formula: C13H14O
KIN02174442
5-METHYL-3-PHENYL-2-OXAZOLIDINONE
CAS:708-58-7
Formula: C8H5FN2O2
KIN01026683
5-METHYL-3-PHENYL-2-PYRAZINECARBONITRILE
CAS:124629-53-4
KIN03185041
5-METHYL-3-PHENYL-2-PYRAZINOL 1-OXIDE
CAS:86725-78-2
Formula: C11H10N2O2
KIN02682101
5-METHYL-3-PHENYL-2-PYRAZINOL 2-ACETATE
CAS:86731-81-9
Formula: C13H12N2O2
KIN02682142
5-METHYL-3-PHENYL-2-PYRIDINAMINE
CAS:351001-77-9
Formula: C12H12N2
KIN03528135
5-METHYL-3-PHENYL-2-THIOIDENE-1,3-DIAZINAN-4-ONE
CAS:30695-37-5
Formula: C11H12N2OS
KIN02184100
5-METHYL-3-PHENYL-2-THIOIDENE-5,6,7,8-TETRAHYDRO-1H-[1]BENZOTHIOLO[2,3-D]PYRIMIDIN-4-ONE
CAS:132605-29-9
Formula: C17H16N2OS2
KIN03219595
5-METHYL-3-PHENYL-2-THIOPHENAMINE
CAS:1056999-21-3
Formula: C11H11NS
KIN05103528
5-METHYL-3-PHENYL-2-THIOPHENECARBOXYLIC ACID
CAS:91368-46-6
Formula: C12H10O2S
KIN02742597
5-METHYL-3-PHENYL-2-THIOPHENECARBOXYLIC ACID ETHYL ESTER
CAS:132039-32-8
KIN03618583
5-METHYL-3-PHENYL-2-THIOPHENEMETHANAMINE
CAS:341030-07-7
KIN03515065
5-METHYL-3-PHENYL-2-THIOXO-2,3-DIHYDROTHIAZOLO[4,5-D]PYRIMIDIN-7(6H)-ONE
CAS:141622-32-4
Formula: C12H9N3OS2
KIN03261154
5-METHYL-3-PHENYL-2-THIOXO-4(1H)-IMIDAZOLIDINONE
CAS:4333-20-4
Formula: C12H14N2OS
KIN01105341
5-METHYL-3-PHENYL-2-THIOXO-4-OXAZOLIDINONE
CAS:88103-65-5
Formula: C10H9NO2S
KIN02693270
5-METHYL-3-PHENYL-2H-THIOPYRAN-2-THIONE
CAS:66600-35-9
Formula: C12H10S2
KIN02543956
5-METHYL-3-PHENYL-3-ALLYL-2(3H)-FURANONE
CAS:1044507-27-8
Formula: C14H14O2
KIN05093896
5-METHYL-3-PHENYL-3-PYRROLIDINOL
CAS:91246-29-6
Formula: C11H15NO
KIN02740860
5-METHYL-3-PHENYL-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-CARBONITRILE
CAS:141210-07-3
Formula: C12H8N6
KIN03258823
5-METHYL-3-PHENYL-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDINE
CAS:116944-01-5
Formula: C11H9N5
KIN03146652
5-METHYL-3-PHENYL-3H-PYRAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:35313-53-2
KIN02221905
5-METHYL-3-PHENYL-4(1H)-CINNOLINONE
CAS:151026-56-1
KIN03297943
5-METHYL-3-PHENYL-4-(1H-PYRAZOL-3-YL)ISOXAZOLE
CAS:265125-69-7
Formula: [C13H11N3O
KIN03461903
5-METHYL-3-PHENYL-4-(2-PHENYLDIAZENYL)ISOXAZOLE
CAS:72701-81-6
Formula: C16H13N3O
KIN02593241
5-METHYL-3-PHENYL-4-(2-PHENYLETHENYL)ISOXAZOLE
CAS:1021864-75-4
Formula: C18H15NO
KIN05055430
5-METHYL-3-PHENYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOXAZOLE
CAS:374715-24-9
Formula: C16H20BNO3
KIN03545107
5-METHYL-3-PHENYL-4-(BENZENESULFONYL)ISOXAZOLE
CAS:113648-20-7
KIN03124881
5-METHYL-3-PHENYL-4-(BENZYL)ISOXAZOLE
CAS:139395-94-1
Formula: C17H15NO
KIN03252559
5-METHYL-3-PHENYL-4-(TRIMETHYLSILYL)-5H-PYRIDO[4,3-B]INDOLE
CAS:491595-75-6
KIN03612671
5-METHYL-3-PHENYL-4-(TRIMETHYLSILYL)ISOTHIAZOLE
CAS:154445-88-2
KIN03308813
5-METHYL-3-PHENYL-4-HEXEN-2-ONE
CAS:66628-92-0
Formula: C13H16O
KIN02544240
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBONITRILE
CAS:13950-63-5
Formula: C11H8N2S
KIN02026378
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBONYL CHLORIDE
CAS:16187-99-8
KIN02048662
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBOXAMIDE
CAS:16187-97-6
KIN02048661
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBOXYLIC ACID
CAS:13950-59-9
KIN02026375
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:13950-62-4
KIN02026377
5-METHYL-3-PHENYL-4-ISOTHIAZOLECARBOXYLIC ACID METHYL ESTER
CAS:21905-49-7
KIN02105343
5-METHYL-3-PHENYL-4-ISOTHIAZOLOL
CAS:19389-29-8
Formula: C10H9NOS
KIN02080938
5-METHYL-3-PHENYL-4-ISOTHIAZOLOL 4-ACETATE
CAS:19389-37-8
KIN02080945
5-METHYL-3-PHENYL-4-ISOXAZOLAMINE
CAS:21169-65-3
Formula: C10H10N2O
KIN02098014
MFCD02677726
5-METHYL-3-PHENYL-4-ISOXAZOLEACETIC ACID
CAS:23118-28-7
Formula: C12H11NO3
KIN02116931
5-METHYL-3-PHENYL-4-ISOXAZOLEACETIC ACID ETHYL ESTER
CAS:23118-29-8
KIN02116932
5-METHYL-3-PHENYL-4-ISOXAZOLEACETIC ACID METHYL ESTER
CAS:354506-48-2
KIN03652365
5-METHYL-3-PHENYL-4-ISOXAZOLEACETONITRILE
CAS:354506-40-4
Formula: C12H10N2O
KIN03531575
5-METHYL-3-PHENYL-4-ISOXAZOLECARBAMIC ACID ETHYL ESTER
CAS:21169-64-2
KIN02098013
5-METHYL-3-PHENYL-4-ISOXAZOLECARBONITRILE
CAS:24400-67-7
Formula: C11H8N2O
KIN02130152
MFCD00172106
5-METHYL-3-PHENYL-4-ISOXAZOLECARBONYL CHLORIDE
CAS:16883-16-2
Formula: C11H8ClNO2
KIN02056018
5-Methyl-3-phenylisoxazole-4-carbonyl chloride
MFCD00052205
5-METHYL-3-PHENYL-4-ISOXAZOLECARBOTHIOAMIDE
CAS:302926-41-6
Formula: C11H10N2OS
KIN03478587
5-METHYL-3-PHENYL-4-ISOXAZOLECARBOXALDEHYDE
CAS:87967-95-1
Formula: C11H9NO2
KIN02691173
5-METHYL-3-PHENYL-4-ISOXAZOLECARBOXAMIDE
CAS:4340-46-9
KIN01105462
5-METHYL-3-PHENYL-4-ISOXAZOLEETHANOL
CAS:18718-77-9
Formula: C12H13NO2
KIN02074597
5-METHYL-3-PHENYL-4-ISOXAZOLEETHANOL 4-METHANESULFONATE
CAS:354507-45-2
KIN03629940
5-METHYL-3-PHENYL-4-ISOXAZOLEMETHANAMINE
CAS:306935-01-3
Formula: C11H12N2O
KIN03482585
5-METHYL-3-PHENYL-4-ISOXAZOLEMETHANOL
CAS:18718-79-1
Formula: C11H11NO2
KIN02074599
(5-Methyl-3-phenyl-4-isoxazolyl)methanol
MFCD02677724
5-METHYL-3-PHENYL-4-ISOXAZOLEPROPANAMINE
CAS:1000564-93-1
Formula: C13H16N2O
KIN05003840
5-METHYL-3-PHENYL-4-ISOXAZOLEPROPANOIC ACID ETHYL ESTER
CAS:154265-47-1
KIN03629939
5-METHYL-3-PHENYL-4-ISOXAZOLEPROPANOL
CAS:154265-48-2
Formula: C13H15NO2
KIN03308136
5-METHYL-3-PHENYL-4-ISOXAZOLOL
CAS:13054-64-3
Formula: C10H9NO2
KIN02014103
5-METHYL-3-PHENYL-4-THIAZOLIDINONE
CAS:67824-13-9
Formula: C10H11NOS
KIN02558428
5-METHYL-3-PHENYL-5,6-DIHYDROPYRAZIN-2(1H)-ONE
CAS:94934-44-8
Formula: C11H12N2O
KIN02786670
5-METHYL-3-PHENYL-5-(BENZYL)-2-THIOXO-4-OXAZOLIDINONE
CAS:88051-60-9
Formula: C17H15NO2S
KIN02692334
5-METHYL-3-PHENYL-5H-PYRAZOLO[4,3-C]PYRIDINE
CAS:113277-59-1
KIN03121653
5-METHYL-3-PHENYL-5H-PYRAZOLO[4,3-C]PYRIDINE MONOHI
CAS:113277-57-9
KIN03121651
5-METHYL-3-PHENYL-5H-PYRIDO[4,3-B]INDOLE 2-OXIDE
CAS:95104-18-0
Formula: C18H14N2O
KIN02788304
5-METHYL-3-PHENYL-6-(BENZYL)-2(1H)-PYRAZINONE
CAS:138528-45-7
KIN03247260
5-METHYL-3-PHENYL-6H-1,2-OXAZIN-6-ONE
CAS:113549-23-8
Formula: C11H9NO2
KIN03124048
5-METHYL-3-PHENYL-6H-1,2-OXAZINE
CAS:117341-66-9
Formula: C11H11NO
KIN03148564
5-METHYL-3-PHENYL-ALPHA-(BENZYL)-4-ISOXAZOLEMETHANOL
CAS:1021864-82-3
Formula: C18H17NO2
KIN05055431
5-METHYL-3-PHENYL-CINNOLINE
CAS:151026-58-3
KIN03297945
5-METHYL-3-PHENYL-ISOQUINOLINE
CAS:1138735-20-2
Formula: C16H13N
KIN05188516
5-METHYL-3-PHENYL-ISOTHIAZOLE
CAS:13369-71-6
KIN02018579
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID
CAS:1136-48-7
Formula: C13H14ClN
KIN01041103
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-(1-METHYLETHYLIDENE)HYDRAZIDE
CAS:18336-76-0
KIN02071018
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-(1-METHYLPROPYLIDENE)HYDRAZIDE
CAS:18336-77-1
KIN02071019
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-(FURAN-2-YLMETHYLENE)HYDRAZIDE
CAS:18336-85-1
KIN02071020
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-[(4-HYDROXY-3,5-DIIODO-PHENYL)METHYLENE]HYDRAZIDE
CAS:340176-26-3
Formula: C18H13I2N3O3
KIN03513911
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-[(4-HYDROXY-3-IODO-5-METHOXY-PHENYL)METHYLENE]HYDRAZIDE
CAS:353776-73-5
Formula: C19H16IN3O4
KIN03531302
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-FLUORO-ETHYL ESTER
CAS:153947-56-9
Formula: [C13H12FNO3
KIN03307006
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID 2-METHYL-2-(METHYLAMINO)-PROPYL ESTER HI
CAS:135588-54-4
Formula: C16H20N2O3.HI
KIN03233510
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID ANHYDRIDE WITH 2,2-DIMETHYLPROPANOIC ACID
CAS:23891-91-0
KIN02124512
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID ANHYDRIDE WITH ETHYL HYDROGEN CARBONATE
CAS:23891-89-6
Formula: C14H13NO5
KIN02124511
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID ANHYDRIDE WITH ISOCYANIC ACID
CAS:4340-44-7
Formula: C11H10N2O2
KIN01105461
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID HYDRAZIDE
CAS:18336-75-9
Formula: C11H11N3O2
KIN02071017
MFCD00119108
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:2065-29-4
KIN01062026
5-METHYL-3-PHENYL-ISOXAZOL-4-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:211429-79-7
Formula: C15H17NO3
KIN03422676
5-METHYL-3-PHENYL-ISOXAZOL-4-YL ISOTHIOCYANATE
CAS:30934-97-4
KIN02185955
5-METHYL-3-PHENYL-ISOXAZOLE
CAS:1008-75-9
Formula: C10H9NO
KIN01036808
5-METHYL-3-PHENYL-ISOXAZOLO[4,3-C]QUINOLIN-4(5H)-ONE
CAS:161371-35-3
Formula: C17H12N2O2
KIN03663639
5-METHYL-3-PHENYL-N,N-BIS(BENZYL)-4-ISOXAZOLECARBOXAMIDE
CAS:106833-70-9
KIN03078849
5-METHYL-3-PHENYL-N,N-DI-ALLYL-4-ISOXAZOLECARBOXAMIDE
CAS:432510-07-1
KIN03652364
5-METHYL-3-PHENYL-N-(BENZYL)-4-ISOXAZOLECARBOXAMIDE
CAS:55153-40-7
KIN02361689
5-METHYL-3-PHENYL-N-[4-[(TRIFLUOROMETHYL)THIO]PHENYL]-4-ISOXAZOLECARBOXAMIDE
CAS:153947-61-6
Formula: C18H13F3N2O2S
KIN03307007
5-METHYL-3-PHENYL-N-ALLYL-4-ISOXAZOLECARBOXAMIDE
CAS:438473-80-4
KIN03581819
5-METHYL-3-PHENYL-N-PROPYL-4-ISOXAZOLECARBOXAMIDE
CAS:424810-40-2
KIN03026784
5-METHYL-3-PHENYL-N-PYRIDIN-3-YL-4-ISOXAZOLECARBOXAMIDE
CAS:153947-63-8
KIN03629938
5-METHYL-3-PHENYL-N-THIAZOL-2-YL-4-ISOXAZOLECARBOXAMIDE
CAS:433237-33-3
KIN03629937
5-METHYL-3-PHENYL-OXAZOLIDINE
CAS:73861-82-2
Formula: C10H13NO
KIN02601462
5-METHYL-3-PHENYL-OXAZOLIDINE-2,4-DIONE
CAS:1012-88-0
KIN01037032
5-METHYL-3-PHENYL-THIAZOLO[2,3-C][1,2,4]-TRIAZOLE
CAS:26542-57-4
Formula: C11H9N3S
KIN02149235
5-METHYL-3-PHENYL[1,2,4]-TRIAZOLO[4,3-A]PYRIDINE
CAS:4926-15-2
Formula: C13H11N3
KIN01117354
5-METHYL-3-PHENYLBENZO[D]ISOXAZOL-6-AMINE
CAS:1093098-05-5
Formula: C14H12N2O
KIN05135111
5-METHYL-3-PHENYLBENZO[D]ISOXAZOL-6-OL
CAS:136741-68-9
Formula: C14H11NO2
KIN03238302
5-METHYL-3-PHENYLBENZO[D]ISOXAZOLE
CAS:7007-66-1
KIN01176286
5-METHYL-3-PHENYLBENZO[D]ISOXAZOLE 2-OXIDE
CAS:75633-03-3
Formula: C14H11NO2
KIN02613953
5-METHYL-3-PHENYLBENZO[F][1,7]NAPHTHYRIDINE
CAS:63481-82-3
Formula: C19H14N2
KIN02493700
5-METHYL-3-PHENYLBENZOFURAN
CAS:14385-52-5
Formula: C15H12O
KIN02031424
5-METHYL-3-PHENYLHEXAN-2-ONE
CAS:103392-12-7
Formula: C13H18O
KIN03053491
5-METHYL-3-PHENYLOXOLANE-2,4-DIONE
CAS:22884-80-6
Formula: C11H10O3
KIN02114558
5-METHYL-3-PHENYLPYRAZIN-2-AMINE 1-OXIDE
CAS:1195162-06-1
Formula: C11H11N3O
KIN05336324
5-METHYL-3-PHENYLPYRAZIN-2-YLAMINE
CAS:93034-71-0
Formula: C11H11N3
KIN02764442
5-METHYL-3-PHENYLPYRIDAZINE
CAS:32723-45-8
Formula: C11H10N2
KIN02199413
5-METHYL-3-PHENYLPYRIDAZINE 1-OXIDE
CAS:32723-51-6
KIN02199416
5-METHYL-3-PHENYLPYRROLIDIN-3-OL HCL
CAS:67465-12-7
Formula: C11H16ClNO
KIN02553844
5-METHYL-3-PHENYLRHODANINE
CAS:1986-41-0
KIN01060280
5-METHYL-3-PIPERIDIN-1-YL-2-(1H-PYRAZOL-3-YL)PHENOL
CAS:125247-31-6
KIN03674731
5-METHYL-3-PIPERIDIN-1-YL-5H-PYRIDAZINO[3,4-B][1,4]BENZOXAZINE
CAS:35669-63-7
Formula: C16H18N4O
KIN02225210
5-METHYL-3-PIPERIDIN-1-YLPYRIDAZINE
CAS:37121-75-8
KIN02237279
5-METHYL-3-PIPERIDIN-4-YL-1H-INDOLE HCL
CAS:149669-44-3
Formula: C14H19ClN2
KIN03293403
5-METHYL-3-PIPERIDIN-4-YL-2(3H)-BENZO[D]OXAZOLONE
CAS:173843-72-6
Formula: C13H16N2O2
KIN03354309
5-METHYL-3-PIPERIDIN-4-YL-2,4-OXAZOLIDINEDIONE
CAS:90892-62-9
Formula: C9H14N2O3
KIN02735244
5-METHYL-3-PROPAN-2-YL-2(3H)-THIAZOLETHIONE
CAS:53845-29-7
Formula: C7H11NS2
KIN02341242
5-METHYL-3-PROPAN-2-YL-2,4-THIAZOLIDINEDIONE
CAS:70400-92-9
Formula: C7H11NO2S
KIN02577329
5-METHYL-3-PROPAN-2-YL-2-(4-METHYLPHENYL)-2H-INDAZOLE
CAS:91266-33-0
Formula: C18H20N2
KIN02741160
5-METHYL-3-PROPAN-2-YL-2-[PROPAN-2-YL-IMINO]-4-OXAZOLIDINONE
CAS:57095-86-0
KIN02394009
5-METHYL-3-PROPAN-2-YL-2-THIAZOLIDINETHIONE
CAS:68058-08-2
Formula: C7H13NS2
KIN02560397
5-METHYL-3-PROPAN-2-YL-2H-1,4-OXAZIN-2-ONE
CAS:65479-29-0
Formula: C8H11NO2
KIN02527484
5-METHYL-3-PROPAN-2-YLOXOLAN-2-ONE
CAS:19639-01-1
Formula: C8H14O2
KIN02082964
5-METHYL-3-PROPOXY-2-PYRIDINEBUTANENITRILE
CAS:85634-90-8
Formula: C13H18N2O
KIN02675662
5-METHYL-3-PROPYL-1,2,4-OXADIAZOLE
CAS:89600-64-6
Formula: C6H10N2O
KIN02714161
5-METHYL-3-PROPYL-1,2-DIOXOLAN-3-OL
CAS:367519-09-3
Formula: [C7H14O3
KIN03541029
5-METHYL-3-PROPYL-1,3,4-THIADIAZOL-2(3H)-ONE
CAS:63857-81-8
Formula: C6H10N2OS
KIN02499991
5-METHYL-3-PROPYL-1H-INDAZOLE
CAS:110967-35-6
Formula: C11H14N2
KIN03104715
5-METHYL-3-PROPYL-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:1158397-09-1
Formula: C15H19NO2
KIN05253471
5-METHYL-3-PROPYL-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:96440-83-4
Formula: C11H18N2O2
KIN02800733
5-METHYL-3-PROPYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL 4-METHYL ESTER
CAS:34580-42-2
KIN02215044
5-METHYL-3-PROPYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 4-METHYL 2-(1-METHYLETHYL) ESTER
CAS:34577-64-5
KIN02215009
5-METHYL-3-PROPYL-1H-PYRROL-2-CARBALDEHYDE
CAS:1109276-49-4
Formula: C9H13NO
KIN05172407
5-METHYL-3-PROPYL-2(1H)-PYRAZINONE
CAS:23127-01-7
Formula: C8H12N2O
KIN02117016
5-METHYL-3-PROPYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:19360-42-0
Formula: C7H12N2O2
KIN02080620
5-Methyl-3-propyl-hydantoin
5-METHYL-3-PROPYL-2-OXAZOLIDINONE
CAS:96014-94-7
Formula: C7H13NO2
KIN02797216