Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-METHANOL
CAS:1126636-96-1
Formula: C8H7ClN2O
KIN05180794
5-CHLORO-IMIDAZO[1,2-A]PYRIMIDIN-2-CARBALDEHYDE
CAS:1020034-74-5
Formula: C7H4ClN3O
KIN05048692
5-CHLORO-IMIDAZO[1,2-A]PYRIMIDIN-2-CARBOXYLIC ACID
CAS:1020038-63-4
Formula: C7H4ClN3O2
KIN05048835
5-CHLORO-IMIDAZO[1,2-A]PYRIMIDIN-2-METHANAMINE
CAS:1020035-09-9
Formula: C7H7ClN4
KIN05048706
5-CHLORO-IMIDAZO[1,2-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1019021-49-8
Formula: C7H4ClN3O2
KIN05040470
5-CHLORO-IMIDAZO[1,2-A]QUINAZOLINE
CAS:109224-74-0
Formula: C10H6ClN3
KIN03093944
5-CHLORO-IMIDAZO[1,5-A]PYRIDINE
CAS:141912-70-1
Formula: C7H5ClN2
KIN03262582
5-CHLORO-INDAN-1-ONE
CAS:423428-86-7
KIN03574930
5-CHLORO-INDOL-2-CARBOSYLIC ACID
CAS:10517-21-1
KIN02007435
5-CHLORO-INDOL-2-CARBOXYLIC ACID
CAS:10517-21-2
Formula: C9H6ClNO2
KIN02007436
MFCD00005613
5-CHLORO-INDOL-3-ACETIC ACID
CAS:1012-48-2
Formula: C11H12O3
KIN01037014
5-CHLORO-INDOLINE
CAS:25658-80-4
Formula: C8H8CIN
KIN02141759
MFCD01941330
5-CHLORO-INDOLINE-2-CARBOXYLIC ACID
CAS:10241-98-2
Formula: C9H8ClNO2
KIN02003658
MFCD08059776
5-CHLORO-ISOINDOLINE
CAS:127168-76-7
Formula: C8H6ClN
KIN03196198
5-CHLORO-ISOPHTHALIC ACID MONOMETHYL ESTER
CAS:153203-57-7
Formula: C9H7ClO4
KIN03304410
5-CHLORO-ISOPHTHALIC ACID POLYESTER WITH 4,4'-FLUOREN-9-YLIDENEDIPHENOL
CAS:30475-56-0
KIN02182574
5-CHLORO-ISOPHTHALOYL CHLORIDE POLYESTER WITH 4,4'-FLUOREN-9-YLIDENEDIPHENOL
CAS:29008-16-0
KIN02170668
5-CHLORO-ISOPHTHALOYL DICHLORIDE
CAS:2855-08-5
Formula: C6H13Cl
KIN01077468
5-CHLORO-ISOQUINOLINE
CAS:5430-46-6
Formula: C10H10N2O4S
KIN01130527
5-CHLORO-ISOQUINOLINE 2-OXIDE
CAS:70810-25-2
Formula: C9H6ClNO
KIN02580051
5-CHLORO-ISOTHIAZOLE
CAS:56535-95-6
Formula: C3H2ClNS
KIN02384483
5-CHLORO-ISOXAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:25979-26-4
Formula: C6H6ClNO3
KIN02144484
5-CHLORO-ISOXAZOLE
CAS:1146207-55-7
Formula: C3H2ClNO
KIN05193999
5-CHLORO-ISOXAZOLO[5,4-B]PYRIDIN-3(2H)-ONE
CAS:196708-45-9
Formula: C6H3ClN2O2
KIN03401467
5-CHLORO-L-HISTIDINE
CAS:102974-88-9
Formula: C6H8ClN3O2
KIN03051018
5-CHLORO-L-TRYPTOPHAN METHYL ESTER
CAS:93299-36-6
Formula: C12H13ClN2O2
KIN02767862
5-CHLORO-N,1-BIS[(4-CHLOROPHENYL)METHYL]-1H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:106157-47-5
KIN03074427
5-CHLORO-N,1-DIMETHYL-1H-BENZO[D]IMIDAZOL-2-YLAMINE
CAS:342382-59-6
Formula: C9H10ClN3
KIN03515783
5-CHLORO-N,1-DIMETHYL-1H-IMIDAZOL-2-METHANAMINE
CAS:1094415-06-1
Formula: C6H10ClN3
KIN05140637
5-CHLORO-N,1-DIMETHYL-1H-IMIDAZOL-4-SULFONAMIDE
CAS:1154873-96-7
Formula: C5H8ClN3O2S
KIN05220315
5-CHLORO-N,1-DIMETHYL-1H-INDOL-3-CARBOXAMIDE
CAS:1088708-69-3
Formula: C11H11ClN2O
KIN05127914
5-CHLORO-N,1-DIMETHYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:1020713-28-3
Formula: C6H8ClN3O
KIN05049823
5-CHLORO-N,1-DIMETHYL-3-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:318237-81-9
KIN03630080
5-CHLORO-N,2,6-TRIMETHYLPYRIMIDIN-4-YLAMINE
CAS:476330-94-6
Formula: C7H10ClN3
KIN03603174
5-CHLORO-N,2-DIETHYL-ANILINE
CAS:103273-63-8
Formula: C10H14ClN
KIN03052882
5-CHLORO-N,2-DIHYDROXY-3-IODO-BENZAMIDE
CAS:4068-64-8
Formula: C7H5BrFNO3
KIN01100396
5-CHLORO-N,2-DIHYDROXY-BENZAMIDE
CAS:37551-43-2
Formula: C7H6ClNO3
KIN02240402
5-Chloro-N,2-dihydroxybenzamide
MFCD00203857
5-CHLORO-N,2-DIHYDROXY-BENZIMIDAMIDE
CAS:101251-14-3
Formula: C7H7ClN2O2
KIN03037946
5-CHLORO-N,2-DIHYDROXY-N-PHENYLBENZAMIDE
CAS:65220-20-4
Formula: C13H10ClNO3
KIN02523199
5-CHLORO-N,2-DIMETHOXY-BENZAMIDE
CAS:1031094-67-3
Formula: C9H10ClNO3
KIN05066042
5-CHLORO-N,2-DIMETHOXY-BENZENEACETAMIDE
CAS:1119230-80-6
Formula: C10H12ClNO3
KIN05176826
5-CHLORO-N,2-DIMETHOXY-N-METHYLBENZAMIDE
CAS:187396-78-7
Formula: C10H12ClNO3
KIN03383149
5-CHLORO-N,2-DIMETHYL-ANILINE
CAS:41456-54-6
Formula: C8H10ClN
KIN02271301
5-CHLORO-N,2-DIMETHYLBENZENESULFONAMIDE
CAS:36065-91-5
Formula: C8H10ClNO2S
KIN02228671
5-CHLORO-N,2-DIPHENYLPYRIMIDIN-4-YLAMINE
CAS:26740-78-3
Formula: C16H12ClN3
KIN02150865
5-CHLORO-N,3-DI-ALLYL-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YLAMINE
CAS:181862-32-8
Formula: C10H11ClN6
KIN03371651
5-CHLORO-N,3-DIHYDROXY-2-THIOPHENECARBOXAMIDE
CAS:151824-97-4
Formula: C5H4ClNO3S
KIN03300483
5-CHLORO-N,4-DIMETHYL-1H-IMIDAZOL-1-CARBOXAMIDE
CAS:97566-47-7
Formula: C6H8ClN3O
KIN02806651
5-CHLORO-N,4-DIMETHYL-2-NITRO-ANILINE
CAS:81449-96-9
Formula: C8H9ClN2O2
KIN02649859
5-CHLORO-N,4-DIMETHYL-6-(METHYLTHIO)-PYRIMIDIN-2-YLAMINE
CAS:102609-17-6
Formula: C7H10ClN3S
KIN03618691
5-CHLORO-N,4-DIMETHYL-6-PHENYL-3-PYRIDAZINAMINE
CAS:95473-82-8
Formula: C12H12ClN3
KIN02791814
5-CHLORO-N,4-DIPHENYL-2-OXAZOLAMINE
CAS:72546-23-7
Formula: C15H11ClN2O
KIN02592136
5-CHLORO-N,6-DIMETHYL-2-PYRIDIN-2-YLPYRIMIDIN-4-YLAMINE
CAS:256370-24-8
Formula: C11H11ClN4
KIN03630079
5-CHLORO-N,6-DIPHENYLPYRAZIN-2-AMINE
CAS:1180659-27-1
Formula: C16H12ClN3
KIN05290071
5-CHLORO-N,ALPHA,2-TRIHYDROXY-BENZENEETHANIMIDAMIDE
CAS:98490-73-4
Formula: C8H9ClN2O3
KIN02814327
5-CHLORO-N,ALPHA,BETA-TRIMETHYL-2-THIOPHENEPROPANAMINE
CAS:1179613-19-4
Formula: C10H16ClNS
KIN05285623
5-CHLORO-N,ALPHA-DIETHYL-2-THIOPHENEMETHANAMINE
CAS:1154228-66-6
Formula: C9H14ClNS
KIN05215650
5-CHLORO-N,ALPHA-DIMETHYL-2-THIOPHENEPROPANAMINE
CAS:1183769-16-5
Formula: C9H14ClNS
KIN05307698
5-CHLORO-N,N 3-TRIMETHYL-1-BENZOFURAN-2-CARBOXAMIDE
CAS:52819-44-0
Formula: C12H12ClNO2
KIN02326278
5-CHLORO-N,N'-DIHYDROXY-BENZO[D]ISOXAZOL-3-ETHANIMIDAMIDE
CAS:57268-61-8
KIN02396805
5-CHLORO-N,N,1,3-TETRAMETHYL-1H-PYRAZOL-4-METHANAMINE
CAS:1183735-85-4
Formula: C8H14ClN3
KIN05307356
5-CHLORO-N,N,1,3-TETRAMETHYL-1H-PYRAZOL-4-SULFONAMIDE
CAS:88398-94-1
Formula: C7H12ClN3O2S
KIN02697649
5-CHLORO-N,N,1-TRIMETHYL-1H-IMIDAZOL-2-CARBOXAMIDE
CAS:129378-62-7
Formula: C7H10ClN3O
KIN03008727
5-CHLORO-N,N,2-TRIMETHYL-1H-INDOL-3-CARBOXAMIDE
CAS:40729-24-6
Formula: C12H13ClN2O
KIN02265235
5-CHLORO-N,N,2-TRIMETHYL-1H-PYRROLO[2,3-B]PYRIDIN-3-METHANAMINE
CAS:145934-82-3
KIN03281129
5-CHLORO-N,N,2-TRIMETHYL-3-PYRIDINECARBOXAMIDE
CAS:350597-50-1
Formula: C9H11ClN2O
KIN03015352
5-CHLORO-N,N,2-TRIMETHYL-BENZENAMINE
CAS:136041-67-3
Formula: C9H12ClN
KIN03235331
5-CHLORO-N,N,2-TRIMETHYLBENZAMIDE
CAS:130396-63-3
Formula: C10H12ClNO
KIN03209665
5-CHLORO-N,N,2-TRIMETHYLBENZENEMETHANAMINE
CAS:69773-58-6
Formula: C10H14ClN
KIN02572749
5-CHLORO-N,N,2-TRIMETHYLBENZENESULFONAMIDE
CAS:473476-99-2
Formula: C9H12ClNO2S
KIN03600071
5-CHLORO-N,N,2-TRIMETHYLCYCLOHEXAN-CARBOXAMIDE
CAS:95715-68-7
Formula: C10H18ClNO
KIN02794402
5-CHLORO-N,N,3,4-TETRAMETHYL-1H-PYRROL-2-METHANAMINIUM INNER SALT
CAS:19713-88-3
Formula: C9H13ClN2
KIN02083673
5-CHLORO-N,N,3,6-TETRAMETHYLPYRAZIN-2-YLAMINE HCL
CAS:938-75-0
Formula: C9H13NO2
KIN01034536
5-CHLORO-N,N,3-TRIMETHYL-1-PHENYL-1H-PYRAZOL-4-YLAMINE
CAS:21672-57-1
Formula: C12H14ClN3
KIN02103105
5-CHLORO-N,N,3-TRIMETHYL-1-PHENYL-1H-PYRAZOL-4-YLAMINE HCL
CAS:23110-69-2
Formula: C12H14ClN3.xClH
KIN02116867
5-CHLORO-N,N,3-TRIMETHYL-1H-PYRAZOL-1-CARBOXAMIDE
CAS:89728-43-8
Formula: C7H10ClN3O
KIN02716137
5-CHLORO-N,N,3-TRIMETHYLPYRAZIN-2-YLAMINE
CAS:936-12-9
Formula: C8H11NO2
KIN01034379
5-CHLORO-N,N,4-TRIMETHYL-3-ISOXAZOLECARBOXAMIDE
CAS:3357-06-0
KIN01087521
5-CHLORO-N,N,4-TRIMETHYL-4H-[1,2,4]-TRIAZOL-3-AMINE
CAS:1019031-01-6
Formula: C5H9ClN4
KIN05040821
5-CHLORO-N,N,4-TRIMETHYL-6-PHENYL-3-PYRIDAZINAMINE
CAS:95641-57-9
Formula: C13H14ClN3
KIN02793647
5-CHLORO-N,N,6-TRIMETHYL-1,2,4-TRIAZIN-3-YLAMINE
CAS:90150-76-8
Formula: C6H9ClN4
KIN02723136
5-CHLORO-N,N,N',N'-TETRAKIS(3-METHYLPHENYL)-3-AMINO-ANILINE
CAS:142017-30-9
Formula: C34H31ClN2
KIN03263174
5-CHLORO-N,N,N-TRIMETHYL-2-FURANMETHANAMINIUM
CAS:71510-27-5
Formula: C8H13ClNO
KIN02584835
5-CHLORO-N,N-BIS(1-METHYLETHYL)-2-PYRIDINEBUTYRAMIDE
CAS:137628-27-4
KIN03663765
5-CHLORO-N,N-BIS(2-CHLORO-ETHYL)-2-ETHOXY-BENZENEMETHANAMINE HCL
CAS:27057-92-7
Formula: C13H18Cl3NO.ClH
KIN02153568
5-CHLORO-N,N-BIS(2-CHLORO-ETHYL)-2-METHOXY-BENZENEMETHANAMINE HCL
CAS:27057-91-6
Formula: C12H16Cl3NO.ClH
KIN02153567
5-CHLORO-N,N-BIS(2-CHLORO-ETHYL)-PYRIMIDIN-2-YLAMINE
CAS:59467-40-2
KIN02431906
5-CHLORO-N,N-BIS(2-METHOXYETHYL) -2-PYRIDINEMETHANAMINE
CAS:1181210-49-0
Formula: C12H19ClN2O2
KIN05290653
5-CHLORO-N,N-BIS(BENZYL)-2-BENZO[D]OXAZOLAMINE
CAS:94058-87-4
Formula: C21H17ClN2O
KIN02777156
5-CHLORO-N,N-BIS(CYANOMETHYL)-2-HYDROXY-BENZAMIDE
CAS:1019365-96-8
Formula: C11H8ClN3O2
KIN05042268
5-CHLORO-N,N-BIS(CYANOMETHYL)-2-NITRO-BENZAMIDE
CAS:1016719-81-5
Formula: C11H7ClN4O3
KIN05024450
5-CHLORO-N,N-BIS(TRIFLUOROMETHYL)-PYRIDIN-2-YLAMINE
CAS:78859-56-0
Formula: C7H3ClF6N2
KIN02634047
5-CHLORO-N,N-BIS(TRIFLUOROMETHYL)-PYRIDIN-3-YLAMINE
CAS:78859-54-8
Formula: C7H3ClF6N2
KIN02634045
5-CHLORO-N,N-BISPROPAN-2-YL-4'-(1-OXO-PROPYL) -BIPHENYL-2-CARBOXAMIDE
CAS:156641-73-5
Formula: C22H26ClNO2
KIN03316040
5-CHLORO-N,N-DIETHYL-1,3,3A,4,7,7A-HEXAHYDRO-N-(2-HYDROXYETHYL) -1,3-DIOXO-2H-ISOINDOL-2-PROPANAMINIUM
CAS:431077-07-5
Formula: C17H28ClN2O3
KIN03578027
5-CHLORO-N,N-DIETHYL-1-PENTANAMINE
CAS:90652-31-6
Formula: C9H20ClN
KIN02731265
5-CHLORO-N,N-DIETHYL-2,6-DIFLUORO-4-PYRIMIDINAMINE
CAS:1132972-38-3
Formula: C8H10ClF2N3
KIN05184649
5-CHLORO-N,N-DIETHYL-2-FLUORO-4-NITRO-ANILINE
CAS:212914-52-8
Formula: C10H12ClFN2O2
KIN03424495
5-CHLORO-N,N-DIETHYL-2-FORMYLBENZAMIDE
CAS:121425-09-0
Formula: C12H14ClNO2
KIN03169621
5-CHLORO-N,N-DIETHYL-2-FURANCARBOXAMIDE
CAS:1090441-85-2
Formula: C9H12ClNO2
KIN05130366
5-CHLORO-N,N-DIETHYL-2-HYDROXY-BENZAMIDE
CAS:85630-33-7
Formula: C11H14ClNO2
KIN02675617
5-CHLORO-N,N-DIETHYL-2-METHOXY-BENZAMIDE
CAS:349088-35-3
Formula: C12H16ClNO2
KIN03525194
5-CHLORO-N,N-DIETHYL-2-METHOXY-BENZENEMETHANAMINE
CAS:23426-47-3
Formula: C12H18ClNO
KIN02119802
5-CHLORO-N,N-DIETHYL-2-METHYL-ANILINE
CAS:196938-09-7
Formula: C11H16ClN
KIN03401714
5-CHLORO-N,N-DIETHYL-2-METHYLBENZAMIDE
CAS:476493-21-7
Formula: C12H16ClNO
KIN03603742
5-CHLORO-N,N-DIETHYL-2-METHYLCYCLOHEXAN-CARBOXAMIDE
CAS:95715-69-8
Formula: C12H22ClNO
KIN02794403
5-CHLORO-N,N-DIETHYL-2-THIOPHENECARBOXAMIDE
CAS:1197969-47-3
Formula: C9H12ClNOS
KIN05341739
5-CHLORO-N,N-DIETHYL-2-THIOPHENEMETHANAMINE
CAS:93439-05-5
Formula: C9H14ClNS
KIN02769338
5-CHLORO-N,N-DIETHYL-3,4,6-TRIFLUOROPYRIDIN-2-YLAMINE
CAS:199383-99-8
Formula: C9H10ClF3N2
KIN03652476
5-CHLORO-N,N-DIETHYL-3-AMINO-1H-INDAZOLE
CAS:98083-55-7
Formula: C11H14ClN3
KIN02810619
5-CHLORO-N,N-DIETHYL-3-AMINO-1H-INDAZOLE HCL
CAS:98083-57-9
Formula: C11H14ClN3.ClH
KIN02810621
5-CHLORO-N,N-DIETHYL-4,6-DIFLUOROPYRIMIDIN-2-YLAMINE
CAS:2707-86-0
KIN01074655
5-CHLORO-N,N-DIETHYL-IMIDAZO[1,2-A]PYRIMIDIN-7-YLAMINE
CAS:89099-87-6
Formula: C10H13ClN4
KIN02706997
5-CHLORO-N,N-DIETHYLPYRIDIN-2-CARBOXAMIDE
CAS:227453-45-4
KIN03441177
5-CHLORO-N,N-DIMETHYL-1,2,4-THIADIAZOL-3-YLAMINE
CAS:41248-08-2
Formula: C4H6ClN3S
KIN02269619
5-CHLORO-N,N-DIMETHYL-1,2,4-TRIAZIN-3-YLAMINE
CAS:98021-94-4
Formula: C5H7ClN4
KIN02809832
5-Chloro-N,N-dimethyl-1,2,4-triazin-3-ylamine; 5-C
5-CHLORO-N,N-DIMETHYL-1,3,4-THIADIAZOL-2-ETHANAMINE
CAS:1089131-33-8
Formula: C6H10ClN3S
KIN05127999
5-CHLORO-N,N-DIMETHYL-1,3,4-THIADIAZOL-2-PROPANAMINE
CAS:1089131-35-0
Formula: C7H12ClN3S
KIN05128000
5-CHLORO-N,N-DIMETHYL-1-PENTANAMINE HCL
CAS:56824-25-0
Formula: C7H16ClN.ClH
KIN02389229
5-CHLORO-N,N-DIMETHYL-1-PHENYL-1H-PYRAZOL-4-YLAMINE
CAS:19730-23-5
Formula: C11H12ClN3
KIN02083886
5-CHLORO-N,N-DIMETHYL-1-PHENYL-1H-PYRAZOL-4-YLAMINE HCL
CAS:21318-63-8
Formula: C11H12ClN3.xClH
KIN02099649
5-CHLORO-N,N-DIMETHYL-1H-[1,2,4]-TRIAZOL-3-AMINE
CAS:1019030-74-0
Formula: C4H7ClN4
KIN05040811
5-CHLORO-N,N-DIMETHYL-1H-1,2,3-TRIAZOL-4-CARBOXIMIDAMIDE HCL
CAS:173165-27-0
Formula: [C5H9Cl2N5
KIN03352929
5-CHLORO-N,N-DIMETHYL-1H-BENZO[D]IMIDAZOL-2-YLAMINE
CAS:5955-71-5
Formula: C9H10N4O2
KIN01145949
5-CHLORO-N,N-DIMETHYL-1H-BENZO[D]IMIDAZOL-7-SULFONAMIDE
CAS:14225-96-8
Formula: C9H10ClN3O2S
KIN02029667
5-CHLORO-N,N-DIMETHYL-1H-INDAZOL-3-YLAMINE
CAS:61317-27-9
Formula: C9H10ClN3
KIN02454234
5-CHLORO-N,N-DIMETHYL-2-(1-METHYLETHOXY) -BENZENEMETHANAMINE
CAS:23426-42-8
Formula: C12H18ClNO
KIN02119799
5-CHLORO-N,N-DIMETHYL-2-(2-METHYLPROPOXY) -BENZENEMETHANAMINE
CAS:23426-44-0
Formula: C13H20ClNO
KIN02119801
5-CHLORO-N,N-DIMETHYL-2-(4-METHYLPHENYL)-3H-IMIDAZO[4,5-B]PYRIDIN-3-ACETAMIDE
CAS:118697-12-4
Formula: [C17H17ClN4O
KIN03155509
5-CHLORO-N,N-DIMETHYL-2-NITRO-ANILINE
CAS:96994-74-0
Formula: C8H9ClN2O2
KIN02803911
5-CHLORO-N,N-DIMETHYL-2-NITRO-BENZAMIDE
CAS:480451-75-0
Formula: C9H9ClN2O3
KIN03608592
5-CHLORO-N,N-DIMETHYL-2-NITRO-BENZENEACETAMIDE
CAS:175658-08-9
Formula: C10H11ClN2O3
KIN03359365
5-CHLORO-N,N-DIMETHYL-2-PHENYL-4-THIAZOLEACETAMIDE
CAS:130559-76-1
KIN03008838
5-CHLORO-N,N-DIMETHYL-2-PROPOXY-BENZENEMETHANAMINE
CAS:23426-41-7
Formula: C12H18ClNO
KIN02119798
5-CHLORO-N,N-DIMETHYL-2-PYRIDINECARBOXAMIDE
CAS:89544-34-3
Formula: C8H9CLN2O
KIN02713373
5-CHLORO-N,N-DIMETHYL-2-THIOPHENECARBOXAMIDE
CAS:88777-57-5
Formula: C7H8ClNOS
KIN02702572
5-CHLORO-N,N-DIMETHYL-2-THIOPHENEMETHANAMINE
CAS:81882-02-2
Formula: C7H10ClNS
KIN02652301
5-CHLORO-N,N-DIMETHYL-3,6-DIPROPYLPYRAZIN-2-YLAMINE
CAS:67714-58-3
Formula: C12H20ClN3
KIN02557017
5-CHLORO-N,N-DIMETHYL-3-AMINO-1H-INDAZOLE HCL
CAS:98083-54-6
Formula: C9H10ClN3.ClH
KIN02810618
5-CHLORO-N,N-DIMETHYL-4-PHENYL-1H-IMIDAZOL-1-SULFONAMIDE
CAS:129399-84-4
Formula: C11H12ClN3O2S
KIN03618690
5-CHLORO-N,N-DIMETHYLBENZO[D][1,3]DIOXOL-2-YLAMINE
CAS:39931-05-0
Formula: C9H10ClNO2
KIN02258624
5-CHLORO-N,N-DIMETHYLBENZO[D][1,3]DIOXOLE-2-METHANAMINE
CAS:4020-96-6
Formula: C18H23N2OP
KIN01099547
5-CHLORO-N,N-DIMETHYLBENZO[D]OXAZOL-2-YLAMINE
CAS:64037-20-3
Formula: C9H9ClN2O
KIN02503363
5-CHLORO-N,N-DIMETHYLPENTANAMIDE
CAS:53101-21-6
Formula: C7H14ClNO
KIN02330273
5-CHLORO-N,N-DIMETHYLPYRAZIN-2-YLAMINE
CAS:136309-13-2
Formula: C6H8ClN3
KIN03236301
5-CHLORO-N,N-DIMETHYLPYRIDIN-2-YLAMINE
CAS:26163-06-4
Formula: C7H9ClN2
KIN02145926
5-CHLORO-N,N-DIMETHYLPYRIDIN-2-YLAMINE 1-OXIDE
CAS:314272-28-1
Formula: C7H9ClN2O
KIN03489463
5-CHLORO-N,N-DIMETHYLPYRIMIDIN-2-YLAMINE
CAS:81568-09-4
Formula: C6H8ClN3
KIN02650532
5-CHLORO-N,N-DIMETHYLTRYPTAMINE
CAS:22120-32-7
Formula: C12H15ClN2
KIN02107506
MFCD04114286
5-CHLORO-N-((1S)-1-((4-FLUOROPHENYL)METHYL)-2-(4-HYDROXY-PIPERIDIN-1-YL)-2-OXOETHYL)-1H-INDOL-2-CARBOXAMIDE
CAS:186430-23-9
Formula: C23H23ClFN3O3
KIN03002429
5-CHLORO-N-((P-NITROPHENOXY) -ACETYL)-ANTHRANILIC ACID
CAS:20916-28-3
Formula: C15H11ClN2O6
KIN02095318
5-CHLORO-N-(1,1-DIMETHYL-2-PHENOXYETHYL) PENTANAMIDE
CAS:167762-16-5
KIN03341233
5-CHLORO-N-(1,1-DIMETHYLETHYL)-2-PYRIDINAMINE
CAS:121953-61-5
Formula: C9H13ClN2
KIN03172505
5-CHLORO-N-(1,1-DIMETHYLPROPYL)-2-HYDROXY-BENZAMIDE
CAS:1019466-15-9
Formula: C12H16ClNO2
KIN05043650
5-CHLORO-N-(1,1-DIMETHYLPROPYL)-2-THIOPHENEMETHANAMINE
CAS:1020959-52-7
Formula: C10H16ClNS
KIN05051001
5-CHLORO-N-(1,2-DIMETHYLBUTYL)-2-FLUORO-ANILINE
CAS:1156336-68-3
Formula: C12H17ClFN
KIN05233220
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-1-PENTANAMINE HCL
CAS:6947-80-4
Formula: C11H12N4O3S
KIN01173887
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-2-FLUORO-ANILINE
CAS:1155046-85-7
Formula: C11H15ClFN
KIN05222765
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-2-HYDROXY-BENZAMIDE
CAS:1040325-81-2
Formula: C12H16ClNO2
KIN05085953
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-2-METHYL-BENZENAMINE
CAS:1041519-15-6
Formula: C12H18ClN
KIN05087227
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-2-NITRO-ANILINE
CAS:1156611-73-2
Formula: C11H15ClN2O2
KIN05235900
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-2-THIOPHENEMETHANAMINE
CAS:1039977-35-9
Formula: C10H16ClNS
KIN05083624
5-CHLORO-N-(1,2-DIMETHYLPROPYL)-PYRIDIN-2-AMINE
CAS:1038384-53-0
Formula: C10H15ClN2
KIN05076840
5-CHLORO-N-(1,3,5-TRIMETHYL-1H-PYRAZOL-4-YL)PENTANAMIDE
CAS:1152644-90-0
Formula: C11H18ClN3O
KIN05200799
5-CHLORO-N-(1,3-DIHYDRO-1,1,3-TRIMETHYL-4-ISOBENZOFURANYL)-1,3-DIMETHYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:123572-88-3
Formula: C17H20ClN3O2
KIN03180277
5-CHLORO-N-(1,3-DIMETHYLBUTYL)-2-FLUORO-ANILINE
CAS:1156334-32-5
Formula: C12H17ClFN
KIN05233190
5-CHLORO-N-(1,3-DIMETHYLBUTYL)-PYRIDIN-2-YLAMINE
CAS:1096325-03-9
Formula: C11H17ClN2
KIN05154298
5-CHLORO-N-(1,4-DIMETHYLPENTYL)-2-FLUORO-ANILINE
CAS:1156040-82-2
Formula: C13H19ClFN
KIN05228685
5-CHLORO-N-(1,4-DIOXAN-2-YLMETHYL) -PYRIDIN-2-YLAMINE
CAS:1184143-08-5
Formula: C10H13ClN2O2
KIN05311688
5-CHLORO-N-(1-CYANOCYCLOBUTYL)-PENTANAMIDE
CAS:1156818-96-0
Formula: C10H15ClN2O
KIN05238750
5-CHLORO-N-(1-CYCLOHEXYLETHYL) -2-FLUORO-ANILINE
CAS:1158049-36-5
Formula: C14H19ClFN
KIN05252214
5-CHLORO-N-(1-CYCLOHEXYLETHYL) -2-NITRO-ANILINE
CAS:1157318-39-2
Formula: C14H19ClN2O2
KIN05245390
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-FLUORO-ANILINE
CAS:1156333-61-7
Formula: C11H13ClFN
KIN05233178
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-FURANCARBOXAMIDE
CAS:1050788-11-8
Formula: C10H12ClNO2
KIN05099395
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-HYDROXY-BENZAMIDE
CAS:1156377-31-9
Formula: C12H14ClNO2
KIN05233999
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-METHYL-BENZENAMINE
CAS:1019581-44-2
Formula: C12H16ClN
KIN05046773
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-NITRO-ANILINE
CAS:1156613-41-0
Formula: C11H13ClN2O2
KIN05235913
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-2-THIOPHENEMETHANAMINE
CAS:1155506-68-5
Formula: C10H14ClNS
KIN05225178
5-CHLORO-N-(1-CYCLOPROPYLETHYL)-PYRIDIN-2-AMINE
CAS:1153251-75-2
Formula: C10H13ClN2
KIN05207327
5-CHLORO-N-(1-ETHYL-1H-PYRAZOL-4-YL)-PYRIDIN-2-AMINE
CAS:1153212-65-7
Formula: C10H11ClN4
KIN05206765
5-CHLORO-N-(1-ETHYL-1H-PYRAZOL-4-YL)PENTANAMIDE
CAS:1153211-35-8
Formula: C10H16ClN3O
KIN05206723
5-CHLORO-N-(1-ETHYL-2-METHYLPROPYL)-2-FLUORO-ANILINE
CAS:1158049-05-8
Formula: C12H17ClFN
KIN05252204
5-CHLORO-N-(1-ETHYL-3-METHYLPENTYL)-2-FLUORO-ANILINE
CAS:1155045-96-7
Formula: C14H21ClFN
KIN05222756
5-CHLORO-N-(1-ETHYL-PIPERIDIN-4-YL)-PYRIDIN-2-AMINE
CAS:1178194-18-7
Formula: C12H18ClN3
KIN05274197
5-CHLORO-N-(1-ETHYL-PIPERIDIN-4-YL)PENTANAMIDE
CAS:1183905-93-2
Formula: C12H23ClN2O
KIN05309118
5-CHLORO-N-(1-ETHYLPROPYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1178161-73-3
Formula: C14H18ClN3
KIN05273845
5-CHLORO-N-(1-ETHYLPROPYL)-2-FLUORO-ANILINE
CAS:1156333-72-0
Formula: C11H15ClFN
KIN05233181
5-CHLORO-N-(1-ETHYLPROPYL)-2-HYDROXY-BENZAMIDE
CAS:1019363-99-5
Formula: C12H16ClNO2
KIN05042221
5-CHLORO-N-(1-ETHYLPROPYL)-2-METHOXY-BENZENEMETHANAMINE
CAS:1153937-46-2
Formula: C13H20ClNO
KIN05213359
5-CHLORO-N-(1-ETHYLPROPYL)-2-METHYL-BENZENAMINE
CAS:1040342-89-9
Formula: C12H18ClN
KIN05086223
5-CHLORO-N-(1-ETHYLPROPYL)-2-NITRO-ANILINE
CAS:1156613-27-2
Formula: C11H15ClN2O2
KIN05235911
5-CHLORO-N-(1-ETHYLPROPYL)-2-THIOPHENEMETHANAMINE
CAS:1021132-62-6
Formula: C10H16ClNS
KIN05053925
5-CHLORO-N-(1-ETHYLPROPYL)-PYRIDIN-2-AMINE
CAS:1041561-91-4
Formula: C10H15ClN2
KIN05087787
5-CHLORO-N-(1-METHYL-1H-PYRAZOL-3-YL)PENTANAMIDE
CAS:1178094-06-8
Formula: C9H14ClN3O
KIN05273114
5-CHLORO-N-(1-METHYL-1H-PYRAZOL-4-YL)-PYRIDIN-2-AMINE
CAS:1153211-14-3
Formula: C9H9ClN4
KIN05206719
5-CHLORO-N-(1-METHYL-1H-PYRAZOL-4-YL)PENTANAMIDE
CAS:1154268-00-4
Formula: C9H14ClN3O
KIN05216048
5-CHLORO-N-(1-METHYL-PIPERIDIN-4-YL)-PYRIDIN-2-AMINE
CAS:1096821-86-1
Formula: C11H16ClN3
KIN05156000
5-CHLORO-N-(1-METHYL-PIPERIDIN-4-YL)PENTANAMIDE
CAS:1096339-65-9
Formula: C11H21ClN2O
KIN05154702
5-CHLORO-N-(1-METHYLBUTYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1184598-85-3
Formula: C14H18ClN3
KIN05315778
5-CHLORO-N-(1-METHYLBUTYL)-2-NITRO-ANILINE
CAS:1156610-98-8
Formula: C11H15ClN2O2
KIN05235895
5-CHLORO-N-(1-METHYLBUTYL)-2-THIOPHENEMETHANAMINE
CAS:1020975-25-0
Formula: C10H16ClNS
KIN05051357
5-CHLORO-N-(1-METHYLBUTYL)-PYRIDIN-2-AMINE
CAS:1036584-78-7
Formula: C10H15ClN2
KIN05072007
5-CHLORO-N-(1-METHYLCYCLOPROPYL)-2-THIAZOLAMINE
CAS:20415-80-9
KIN02090934
5-CHLORO-N-(1-METHYLETHYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1179016-99-9
Formula: C12H14ClN3
KIN05281276
5-CHLORO-N-(1-METHYLETHYL)-2-NITRO-ANILINE
CAS:101167-01-5
Formula: C9H11ClN2O2
KIN03037438
5-CHLORO-N-(1-METHYLETHYL)-2-PROPOXY-ANILINE
CAS:1178176-63-0
Formula: C12H18ClNO
KIN05274027
5-CHLORO-N-(1-METHYLETHYL)-2-PROPOXY-BENZENEMETHANAMINE
CAS:1095234-10-8
Formula: C13H20ClNO
KIN05150041
5-CHLORO-N-(1-METHYLETHYL)-2-THIOPHENEMETHANAMINE
CAS:1016504-63-4
Formula: C8H12ClNS
KIN05022133
5-CHLORO-N-(1-METHYLETHYL)-PYRIDIN-2-AMINE
CAS:1036489-78-7
Formula: C8H11ClN2
KIN05070793
5-CHLORO-N-(1-METHYLETHYL)-PYRIMIDIN-2-YLAMINE
CAS:77476-96-1
Formula: C7H10ClN3
KIN02625860
(5-Chloro-pyrimidin-2-yl)isopropylamine
MFCD02102213
5-CHLORO-N-(1-METHYLPROPYL)-1-PENTANAMINE HCL
CAS:6622-27-1
Formula: C9H21NO
KIN01166268
5-CHLORO-N-(1-METHYLPROPYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1183247-92-8
Formula: C13H16ClN3
KIN05302102
5-CHLORO-N-(1-METHYLPROPYL)-2-BENZO[D]THIAZOLAMINE
CAS:1096264-29-7
KIN05153213
5-CHLORO-N-(1-METHYLPROPYL)-2-FURANCARBOXAMIDE
CAS:1090346-86-3
Formula: C9H12ClNO2
KIN05129898
5-CHLORO-N-(1-METHYLPROPYL)-2-NITRO-ANILINE
CAS:1156610-76-2
Formula: C10H13ClN2O2
KIN05235893
5-CHLORO-N-(1-METHYLPROPYL)-2-THIOPHENECARBOXAMIDE
CAS:1090354-84-9
Formula: C9H12ClNOS
KIN05129928
5-CHLORO-N-(1-METHYLPROPYL)-2-THIOPHENEMETHANAMINE
CAS:1021071-68-0
Formula: C9H14ClNS
KIN05053068
5-CHLORO-N-(1-METHYLPROPYL)-PYRIDIN-2-AMINE
CAS:1036533-74-0
Formula: C9H13ClN2
KIN05071363
5-CHLORO-N-(1-PHENYLETHYL)-2-FURANMETHANAMINE
CAS:1182798-44-2
Formula: C13H14ClNO
KIN05297500
5-CHLORO-N-(1-PHENYLETHYL)-6-PROPYLPYRIMIDIN-4-YLAMINE
CAS:91665-29-1
Formula: C15H18ClN3
KIN02747261
5-CHLORO-N-(1-PHENYLETHYL)-PYRIDIN-2-AMINE
CAS:1041585-04-9
Formula: C13H13ClN2
KIN05088107
5-CHLORO-N-(1-PHENYLETHYL)PENTANAMIDE
CAS:1039330-43-2
Formula: C13H18ClNO
KIN05079255
5-CHLORO-N-(1H-[1,2,4]-TRIAZOL-5-YLMETHYL)PENTANAMIDE
CAS:1179782-74-1
Formula: C8H13ClN4O
KIN05287471
5-CHLORO-N-(1H-INDOL-3-YLMETHYLENE)-PYRIDIN-2-YLAMINE
CAS:412945-44-9
Formula: C14H10ClN3
KIN03652481
5-CHLORO-N-(1H-INDOL-5-YLMETHYL)-PYRIDIN-2-CARBOXAMIDE
CAS:1178606-92-2
Formula: C15H12ClN3O
KIN05277846
5-CHLORO-N-(1H-PYRAZOL-4-YLMETHYL)-PYRIDIN-2-YLAMINE
CAS:1178322-04-7
Formula: C9H9ClN4
KIN05275565
5-CHLORO-N-(2,2,2-TRIFLUORO-ETHYL)-PYRIDIN-2-YLAMINE
CAS:1036511-17-7
Formula: C7H6ClF3N2
KIN05071035
5-CHLORO-N-(2,2-DICHLORO-ETHENYL)-2-HYDROXY-BENZAMIDE
CAS:62513-75-1
Formula: C9H6Cl3NO2
KIN02475410
5-CHLORO-N-(2,2-DIFLUORO-ETHYL)-2-FLUORO-ANILINE
CAS:1184610-90-9
Formula: C8H7ClF3N
KIN05315896
5-CHLORO-N-(2,2-DIFLUORO-ETHYL)-2-PYRIDINEMETHANAMINE
CAS:1189759-55-4
Formula: C8H9ClF2N2
KIN05329374
5-CHLORO-N-(2,2-DIFLUOROETHYL)-2-METHYL-BENZENAMINE
CAS:1179086-05-5
Formula: C9H10ClF2N
KIN05282034
5-CHLORO-N-(2,2-DIMETHOXYETHYL) -2-METHYL-ANILINE
CAS:60710-63-6
Formula: C11H16ClNO2
KIN02447051
5-CHLORO-N-(2,3-DICHLOROPHENYL)-2-IODO-BENZAMIDE
CAS:1100098-92-7
Formula: C13H7Cl3INO
KIN05166257
5-CHLORO-N-(2,3-DIHYDRO-1,5-DIMETHYL-3-OXO-2-PHENYL-1H-PYRAZOL-4-YL) -2- HYDROXY-BENZAMIDE
CAS:977-79-7
Formula: C23H32O2
KIN01035868
5-CHLORO-N-(2,3-DIHYDRO-1H-INDEN-1-YL)-PENTANAMIDE
CAS:1153776-61-4
Formula: C14H18ClNO
KIN05212161
5-CHLORO-N-(2,3-DIHYDRO-1H-INDEN-5-YL)-PENTANAMIDE
CAS:1039948-42-9
Formula: C14H18ClNO
KIN05082848
5-CHLORO-N-(2,3-DIMETHYLPHENYL)-2-HYDROXY-BENZAMIDE
CAS:84629-56-1
Formula: C15H14ClNO2
KIN02668871
5-CHLORO-N-(2,4,6-TRIIODO-PHENYL) -PENTANAMIDE
CAS:1154582-59-8
Formula: C11H11ClI3NO
KIN05218255
5-CHLORO-N-(2,4-DIBROMOPHENYL)-2-HYDROXY-BENZAMIDE
CAS:6149-75-3
Formula: C18H19NO4
KIN01151108
5-CHLORO-N-(2,4-DICHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:6137-51-5
Formula: C13H8BrCl2NO2
KIN01150720
5-CHLORO-N-(2,4-DIFLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1178264-61-3
KIN05274902
5-CHLORO-N-(2,4-DIFLUOROPHENYL)-2-IODO-BENZAMIDE
CAS:1100203-44-8
Formula: C13H7ClF2INO
KIN05166443
5-CHLORO-N-(2,4-DIFLUOROPHENYL)PENTANAMIDE
CAS:27471-48-3
KIN02157694
5-CHLORO-N-(2,4-DIFLUOROPHENYL)THIOPHEN-2-SULFONAMIDE
CAS:411207-61-9
Formula: C10H7ClF2N2O2S2
KIN03569790
5-CHLORO-N-(2,4-DIMETHOXY-PHENYL) -2-BENZO[D]OXAZOLECARBOXIMIDAMIDE
CAS:56735-28-5
Formula: C16H14ClN3O3
KIN02387739
5-CHLORO-N-(2,5-DICHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:78154-57-1
Formula: C13H8Cl3NO2
KIN02629619
5-CHLORO-N-(2,5-DICHLOROPHENYL)-2-HYDROXY-BIPHENYL-3-CARBOXAMIDE
CAS:5607-64-7
Formula: C8H6Cl2O2
KIN01136773
5-CHLORO-N-(2,5-DICHLOROPHENYL)-2-IODO-BENZAMIDE
CAS:1100274-15-4
Formula: C13H7Cl3INO
KIN05166539
5-CHLORO-N-(2,5-DIFLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1184169-00-3
KIN05311939
5-CHLORO-N-(2,5-DIFLUOROPHENYL)-PENTANAMIDE
CAS:1038977-54-6
KIN05078430
5-CHLORO-N-(2,6-DIETHYLPHENYL)PENTANAMIDE
CAS:1039947-73-3
Formula: C15H22ClNO
KIN05082837
5-CHLORO-N-(2,6-DIFLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1184480-31-6
KIN05314508
5-CHLORO-N-(2,6-DIFLUOROPHENYL)-PENTANAMIDE
CAS:1038980-07-2
KIN05078498
5-CHLORO-N-(2,6-DIHYDRO-2-PHENYL-4H-THIENO[3,4-C]PYRAZOL-3-YL)-2-METHOXY-BENZAMIDE
CAS:361166-93-0
Formula: C19H16ClN3O2S
KIN03536722
5-CHLORO-N-(2,6-DIMETHYL-CYCLOHEXYL) -2-FLUORO-ANILINE
CAS:1156853-04-1
Formula: C14H19ClFN
KIN05239196
5-CHLORO-N-(2,6-DIMETHYL-CYCLOHEXYL) -2-NITRO-ANILINE
CAS:1156054-68-0
Formula: C14H19ClN2O2
KIN05228826
5-CHLORO-N-(2-((2-HYDROXYETHYL) METHYLAMINO)ETHYL)-2-OXO-3(2H)-BENZO[D]THIAZOLEACETAMIDE
CAS:33353-28-5
KIN02204926
5-CHLORO-N-(2-(2-HYDROXYETHOXY) ETHYL)-2-OXO-3(2H)-BENZO[D]THIAZOLEACETAMIDE
CAS:34002-93-2
KIN02210477
5-CHLORO-N-(2-(4-HYDROXY-PHENYL) ETHYL)-1-METHYL-1H-IMIDAZOL-4-SULFONAMIDE
CAS:137048-71-6
Formula: [C12H14ClN3O3S
KIN03239879
5-CHLORO-N-(2-(DIETHYLAMINO)ETHYL)-4-((4,5-DIHYDRO-2-OXAZOLYL)AMINO)-2-METHOXY-BENZAMIDE
CAS:111049-33-3
Formula: C17H25ClN4O3
KIN03105310
5-CHLORO-N-(2-(DIETHYLAMINO)ETHYL)-4-((4,5-DIHYDROTHIAZOL-2-YL)AMINO)-2-METHOXY-BENZAMIDE
CAS:111049-32-2
Formula: C17H25ClN4O2S
KIN03105309
5-CHLORO-N-(2-CHLORO-4-HYDROXY-PHENYL) -2-HYDROXY-BENZAMIDE
CAS:427880-80-6
Formula: C13H9Cl2NO3
KIN03576758
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)-2-FURANMETHANAMINE
CAS:1184407-65-5
Formula: C11H8Cl2INO
KIN05313777
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)-2-METHOXY-BENZAMIDE
CAS:424807-68-1
Formula: C14H10Cl2INO2
KIN03575365
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)-2-NITRO-BENZAMIDE
CAS:1179701-55-3
Formula: C13H7Cl2IN2O3
KIN05286621
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)-2-THIOPHENEMETHANAMINE
CAS:1157142-41-0
Formula: C11H8Cl2INS
KIN05243880
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)-3-METHYL-2-BENZOFURANCARBOXAMIDE
CAS:424802-55-1
Formula: C16H10Cl2INO2
KIN03575318
5-CHLORO-N-(2-CHLORO-4-IODO-PHENYL)PENTANAMIDE
CAS:1155496-44-8
Formula: C11H12Cl2INO
KIN05225056
5-CHLORO-N-(2-CHLORO-4-ISOTHIOCYANATOPHENYL)-2-HYDROXY-BENZAMIDE
CAS:2112-48-3
KIN01062932
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-3-METHYLBENZAMIDE
CAS:16739-19-8
Formula: C14H10Cl2N2O4
KIN02054439
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:50-66-8
Formula: C6H6N4S
KIN01000058
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BENZAMIDE COMPOUND WITH 2-AMINOETHANOL
CAS:1420-06-0
Formula: C23H23NO
KIN01046598
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BENZAMIDE MIXT. WITH 2,2'-METHYLENEBIS[4-CHLOROPHENOL]
CAS:8065-10-9
KIN01196568
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BENZAMIDE SODIUM SALT
CAS:40321-86-6
Formula: C13H8Cl2N2O4.Na
KIN02261848
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BENZAMIDE, MIXT. WITH 4-NITRO-3-(TRIFLUOROMETHYL)PHENOL
CAS:57036-29-0
KIN02392793
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-HYDROXY-BIPHENYL-3-CARBOXAMIDE
CAS:16716-67-9
Formula: C19H12Cl2N2O4
KIN02054187
5-CHLORO-N-(2-CHLORO-4-NITROPHENYL)-2-METHOXY-BENZAMIDE
CAS:32060-31-4
Formula: C14H10Cl2N2O4
KIN02194093
5-CHLORO-N-(2-CHLORO-6-NITROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:1008121-01-4
Formula: C13H8Cl2N2O4
KIN05015424
5-CHLORO-N-(2-CHLORO-ACETYL)-2-HYDROXY-BENZAMIDE
CAS:30001-20-8
Formula: C9H7Cl2NO3
KIN02178380
5-CHLORO-N-(2-CHLORO-ALLYL)-2-FLUORO-ANILINE
CAS:1178020-12-6
Formula: C9H8Cl2FN
KIN05272336
5-CHLORO-N-(2-CHLORO-ETHYL)-2-METHOXY-BENZAMIDE
CAS:160538-62-5
Formula: C10H11Cl2NO2
KIN03326369
5-CHLORO-N-(2-CHLORO-ETHYL)-N-(BENZYL)-BENZO[B]THIOPHEN-3-METHANAMINE HCL
CAS:16584-16-0
Formula: C18H17Cl2NS.ClH
KIN02052832
5-CHLORO-N-(2-CHLORO-PYRIDIN-3-YL)PENTANAMIDE
CAS:1098347-48-8
Formula: C10H12Cl2N2O
KIN05162360
5-CHLORO-N-(2-CHLORO-PYRIMIDIN-5-YL)-2-FURANCARBOXAMIDE
CAS:1026423-50-6
Formula: C9H5Cl2N3O2
KIN05060575
5-CHLORO-N-(2-CHLOROPHENYL)-2-(METHYLAMINO)-BENZAMIDE
CAS:32615-76-2
Formula: C14H12Cl2N2O
KIN02198624
5-CHLORO-N-(2-CHLOROPHENYL)-2-FURANMETHANAMINE
CAS:1178961-49-3
Formula: C11H9Cl2NO
KIN05281194
5-CHLORO-N-(2-CHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:6626-93-3
Formula: C7H9ClN2O4
KIN01166646
5-CHLORO-N-(2-CHLOROPHENYL)-N-[2-(CYCLOHEXYLAMINO)-1-(4-METHOXY-PHENYL)-2-OXOETHYL]-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:478483-18-0
Formula: C32H32Cl2N4O3
KIN03606851
5-CHLORO-N-(2-CYANOETHYL)-2-FLUORO-N-METHYLBENZAMIDE
CAS:1019124-64-1
Formula: C11H10ClFN2O
KIN05041351
5-CHLORO-N-(2-CYANOETHYL)-2-HYDROXY-N-METHYLBENZAMIDE
CAS:1019447-89-2
Formula: C11H11ClN2O2
KIN05043258
5-CHLORO-N-(2-CYCLOPENTYLETHYL)-PYRIDIN-2-YLAMINE
CAS:1178491-51-4
Formula: C12H17ClN2
KIN05277463
5-CHLORO-N-(2-ETHOXY-PHENYL) -2-METHOXY-BENZENEACETAMIDE
CAS:1043203-15-1
Formula: C17H18ClNO3
KIN05092386
5-CHLORO-N-(2-ETHOXYETHYL) -2-FLUORO-ANILINE
CAS:1156199-94-8
Formula: C10H13ClFNO
KIN05231001
5-CHLORO-N-(2-ETHOXYETHYL) -2-HYDROXY-BENZAMIDE
CAS:1155141-48-2
Formula: C11H14ClNO3
KIN05223981
5-CHLORO-N-(2-ETHOXYETHYL) -2-METHOXY-BENZENEMETHANAMINE
CAS:1155099-28-7
Formula: C12H18ClNO2
KIN05223470
5-CHLORO-N-(2-ETHOXYETHYL) -2-METHYL-BENZENAMINE
CAS:1156199-47-1
Formula: C11H16ClNO
KIN05230986
5-CHLORO-N-(2-ETHOXYETHYL) -2-THIOPHENEMETHANAMINE
CAS:1156246-02-4
Formula: C9H14ClNOS
KIN05231843
5-CHLORO-N-(2-ETHOXYETHYL) -PYRIDIN-2-YLAMINE
CAS:1154559-91-7
Formula: C9H13ClN2O
KIN05217998
5-CHLORO-N-(2-ETHYL-1-PHENYLBUTYL)-PENTANAMIDE
CAS:1155502-83-2
Formula: C17H26ClNO
KIN05225126
5-CHLORO-N-(2-ETHYLBUTYL)-2-FLUORO-ANILINE
CAS:1156335-10-2
Formula: C12H17ClFN
KIN05233198
5-CHLORO-N-(2-FLUORO-4-CHLOROPHENYL)-2-IODO-BENZAMIDE
CAS:1100309-66-7
Formula: C13H7Cl2FINO
KIN05166576
5-CHLORO-N-(2-FLUORO-4-METHYLPHENYL)-2-FURANMETHANAMINE
CAS:1183447-72-4
Formula: C12H11ClFNO
KIN05304254
5-CHLORO-N-(2-FLUORO-4-METHYLPHENYL)PENTANAMIDE
CAS:1038978-98-1
Formula: C12H15ClFNO
KIN05078473
5-CHLORO-N-(2-FLUORO-5-METHYLPHENYL)-2-FURANMETHANAMINE
CAS:1184581-10-9
Formula: C12H11ClFNO
KIN05315600
5-CHLORO-N-(2-FLUORO-5-METHYLPHENYL)PENTANAMIDE
CAS:1038979-19-9
Formula: C12H15ClFNO
KIN05078478
5-CHLORO-N-(2-FLUOROBENZYL)-2-FURANMETHANAMINE
CAS:1178943-02-6
KIN05280981
5-CHLORO-N-(2-FLUOROBENZYL)-2-IODO-ALPHA-BENZAMIDE
CAS:1147663-13-5
Formula: C14H10ClFINO
KIN05195713
5-CHLORO-N-(2-FLUOROBENZYL)-2-METHYL-ANILINE
CAS:1036483-41-6
Formula: C14H13ClFN
KIN05070732
5-CHLORO-N-(2-FLUOROBENZYL)-PENTANAMIDE
CAS:1039946-61-6
KIN05082812
5-CHLORO-N-(2-FLUOROBENZYL)-PYRIDIN-2-YLAMINE
CAS:1041552-25-3
Formula: C12H10ClFN2
KIN05087639
5-CHLORO-N-(2-FLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1179703-97-9
KIN05286643
5-CHLORO-N-(2-FLUOROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1020917-43-4
KIN05050141
5-CHLORO-N-(2-FLUOROPHENYL)-PENTANAMIDE
CAS:1039946-53-6
KIN05082810
5-CHLORO-N-(2-HYDROXY-5-METHYLPHENYL) -1-(BENZYL)-1H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:106157-37-3
KIN03074423
5-CHLORO-N-(2-HYDROXY-PHENYL) -1-(BENZYL)-1H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:106157-36-2
KIN03074422
5-CHLORO-N-(2-HYDROXY-PHENYL) -1-[(4-METHOXY-PHENYL)METHYL]-1H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:106157-40-8
KIN03074426
5-CHLORO-N-(2-HYDROXY-PROPYL) -2-METHOXY-BENZAMIDE
CAS:1157069-27-6
Formula: C11H14ClNO3
KIN05242926
5-CHLORO-N-(2-HYDROXY-PROPYL) -2-OXO-3(2H)-BENZO[D]THIAZOLEACETAMIDE
CAS:33353-01-4
Formula: C12H12ClN2O3S
KIN02204923
5-CHLORO-N-(2-HYDROXY-PROPYL) -2-THIOPHENECARBOXAMIDE
CAS:1153111-33-1
Formula: C8H10ClNO2S
KIN05205454
5-CHLORO-N-(2-HYDROXY-TERT-BUTYL) -4-IODO-2-METHOXY-BENZAMIDE
CAS:1155573-03-7
Formula: C12H15ClINO3
KIN05226021
5-CHLORO-N-(2-HYDROXY-TERT-BUTYL) -PYRIDIN-2-CARBOXAMIDE
CAS:223445-00-9
KIN03630083
5-CHLORO-N-(2-HYDROXYETHYL) -2-(METHYLAMINO)-BENZAMIDE
CAS:4927-77-9
Formula: C10H13ClN2O
KIN01117408
5-CHLORO-N-(2-HYDROXYETHYL) -2-METHOXY-BENZAMIDE
CAS:81538-19-4
Formula: C10H12ClNO3
KIN02650342
5-CHLORO-N-(2-HYDROXYETHYL) -2-METHOXY-BENZENEACETAMIDE
CAS:1156929-79-1
Formula: C11H14ClNO3
KIN05240468
5-CHLORO-N-(2-HYDROXYETHYL) -2-METHOXY-N-METHYLBENZAMIDE
CAS:1184575-28-7
Formula: C11H14ClNO3
KIN05315538
5-CHLORO-N-(2-HYDROXYETHYL) -2-METHYLBENZENESULFONAMIDE
CAS:59724-47-9
Formula: C9H12ClNO3S
KIN02436175
5-CHLORO-N-(2-HYDROXYETHYL) -2-NITRO-BENZAMIDE
CAS:1153066-27-3
Formula: C9H9ClN2O4
KIN05204434
5-CHLORO-N-(2-HYDROXYETHYL) -2-THIOPHENECARBOXAMIDE
CAS:1156042-75-9
Formula: C7H8ClNO2S
KIN05228717
5-CHLORO-N-(2-HYDROXYETHYL) -N-(BENZYL)-PYRIDIN-3-CARBOXAMIDE
CAS:106877-05-8
KIN03079389
5-CHLORO-N-(2-IODO-PHENYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095644-85-1
KIN05152375
5-CHLORO-N-(2-IODO-PHENYL)-2-FURANMETHANAMINE
CAS:1178360-97-8
Formula: C11H9ClINO
KIN05276013
5-CHLORO-N-(2-IODO-PHENYL)-2-METHOXY-BENZAMIDE
CAS:349088-22-8
Formula: C14H11ClINO2
KIN03525190
5-CHLORO-N-(2-IODO-PHENYL)-2-METHOXY-BENZENEMETHANAMINE
CAS:1153792-19-8
Formula: C14H13ClINO
KIN05212320
5-CHLORO-N-(2-IODO-PHENYL)-2-METHOXY-BENZENESULFONAMIDE
CAS:1092259-08-9
KIN05132474
5-CHLORO-N-(2-IODO-PHENYL)-2-THIOPHENECARBOXAMIDE
CAS:444998-76-9
Formula: C11H7ClINOS
KIN03587228
5-CHLORO-N-(2-IODO-PHENYL)-2-THIOPHENEMETHANAMINE
CAS:1040017-91-1
Formula: C11H9ClINS
KIN05084180
5-CHLORO-N-(2-IODO-PHENYL)-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:376354-73-3
Formula: C17H13ClIN3O
KIN03546058
5-CHLORO-N-(2-IODO-PHENYL)-BENZO[C]ISOTHIAZOL-3-CARBOXAMIDE
CAS:327089-67-8
Formula: C14H8ClIN2OS
KIN03497413
5-CHLORO-N-(2-IODO-PHENYL)PENTANAMIDE
CAS:1039912-33-8
Formula: C11H13ClINO
KIN05082087
5-CHLORO-N-(2-METHOXY-1-METHYLETHYL) -PYRIDIN-2-YLAMINE
CAS:1040026-88-7
Formula: C9H13ClN2O
KIN05084356
5-CHLORO-N-(2-METHOXYETHYL) -2-(BENZYLOXY)-BENZAMIDE
CAS:1001989-81-6
Formula: C17H18ClNO3
KIN05006571
5-CHLORO-N-(2-METHOXYETHYL) -2-BENZO[D]THIAZOLAMINE
CAS:1095212-23-9
KIN05149815
5-CHLORO-N-(2-METHOXYETHYL) -2-METHYL-BENZENAMINE
CAS:1020971-87-2
Formula: C10H14ClNO
KIN05051259
5-CHLORO-N-(2-METHOXYETHYL) -2-NITRO-ANILINE
CAS:146718-49-2
KIN03283368
5-CHLORO-N-(2-METHOXYETHYL) -2-THIOPHENEMETHANAMINE
CAS:1021071-36-2
Formula: C8H12ClNOS
KIN05053062
5-CHLORO-N-(2-METHOXYETHYL) -4-(TRIFLUOROMETHYL)-2-THIAZOLAMINE
CAS:134880-97-0
Formula: C7H8ClF3N2OS
KIN03230203
5-CHLORO-N-(2-METHOXYETHYL) -7-NITRO-2-BENZO[D]THIAZOLECARBOXAMIDE 3-OXIDE
CAS:40647-13-0
KIN02264615
5-CHLORO-N-(2-METHOXYETHYL) -PYRIDIN-2-AMINE
CAS:1039813-28-9
Formula: C8H11ClN2O
KIN05079900
5-CHLORO-N-(2-METHYL-1-PROPEN-1-YL)-2-NITRO-ANILINE
CAS:424799-68-8
Formula: C10H11ClN2O2
KIN03005110
5-CHLORO-N-(2-METHYL-2-PHENYLPROPYL)-PYRIDIN-2-YLAMINE
CAS:1182423-73-9
Formula: C15H17ClN2
KIN05296256
5-CHLORO-N-(2-METHYL-3-NITROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1154099-00-9
Formula: C12H11ClN2O2S
KIN05214205
5-CHLORO-N-(2-METHYL-4-NITROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1157072-37-1
Formula: C12H11ClN2O2S
KIN05242956
5-CHLORO-N-(2-METHYL-5-BENZO[D]OXAZOLYL) -2-FURANCARBOXAMIDE
CAS:1090369-02-0
Formula: C13H9ClN2O3
KIN05130001
5-CHLORO-N-(2-METHYL-5-NITROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1157071-65-2
Formula: C12H11ClN2O2S
KIN05242944
5-CHLORO-N-(2-METHYL-CYCLOHEXYL) -PYRIDIN-2-YLAMINE
CAS:1036584-94-7
Formula: C12H17ClN2
KIN05072010
5-CHLORO-N-(2-METHYLBUTYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1178921-69-1
Formula: C14H18ClN3
KIN05280747
5-CHLORO-N-(2-METHYLBUTYL)-2-NITRO-ANILINE
CAS:1156057-95-2
Formula: C11H15ClN2O2
KIN05228840
5-CHLORO-N-(2-METHYLPHENYL)-2-FURANCARBOXAMIDE
CAS:1090440-79-1
Formula: C12H10ClNO2
KIN05130357
5-CHLORO-N-(2-METHYLPHENYL)-2-NITRO-ANILINE
CAS:106474-97-9
Formula: C13H11ClN2O2
KIN03076607
5-CHLORO-N-(2-METHYLPROPYL)-1-PENTANAMINE HCL
CAS:7402-21-3
KIN01186074
5-CHLORO-N-(2-METHYLPROPYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1184768-52-2
Formula: C13H16ClN3
KIN05317242
5-CHLORO-N-(2-METHYLPROPYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095139-81-3
KIN05149166
5-CHLORO-N-(2-METHYLPROPYL)-2-FURANCARBOXAMIDE
CAS:127119-51-1
Formula: C9H12ClNO2
KIN03195985
5-CHLORO-N-(2-METHYLPROPYL)-2-PHENYLPYRIMIDIN-4-YLAMINE
CAS:26740-77-2
Formula: C14H16ClN3
KIN02150864
5-CHLORO-N-(2-METHYLPROPYL)-2-THIOPHENECARBOXAMIDE
CAS:1090578-31-6
Formula: C9H12ClNOS
KIN05131100
5-CHLORO-N-(2-METHYLPROPYL)-2-THIOPHENEMETHANAMINE
CAS:1021131-71-4
Formula: C9H14ClNS
KIN05053904
5-CHLORO-N-(2-METHYLPROPYL)-7-NITRO-2-BENZO[D]THIAZOLECARBOXAMIDE 3-OXIDE
CAS:40647-17-4
KIN02264618
5-CHLORO-N-(2-METHYLPROPYL)-PYRIDIN-2-AMINE
CAS:1042501-60-9
Formula: C9H13ClN2
KIN05088872
5-CHLORO-N-(2-NITROPHENYL)-PYRIDIN-2-YLAMINE
CAS:474711-36-9
Formula: C11H8ClN3O2
KIN03601692
5-CHLORO-N-(2-OXIRANYLMETHYL) -2-THIOPHENECARBOXAMIDE
CAS:348626-26-6
KIN03663769
5-CHLORO-N-(2-PHENOXY-PHENYL) -2-FURANMETHANAMINE
CAS:1178341-20-2
Formula: C17H14ClNO2
KIN05275800
5-CHLORO-N-(2-PHENYL-5-OXAZOLYL) -PYRIDIN-2-YLAMINE
CAS:35041-63-5
Formula: C14H10ClN3O
KIN02219296
5-CHLORO-N-(2-PHENYL-5-PYRIMIDINYL)-PENTANAMIDE
CAS:1153505-84-0
Formula: C15H16ClN3O
KIN05210975
5-CHLORO-N-(2-PHENYLETHYL)-PYRIDIN-2-CARBOXAMIDE
CAS:199478-05-2
KIN03405986
5-CHLORO-N-(2-PHENYLETHYL)-PYRIDIN-2-YLAMINE
CAS:111098-49-8
KIN03105673
5-CHLORO-N-(3,3-DIMETHYL-1-PHENYLBUTYL)-PENTANAMIDE
CAS:1155897-88-3
Formula: C17H26ClNO
KIN05227533
5-CHLORO-N-(3,4-DICHLOROPHENYL)-2-(1H-TETRAZOL-5-YLMETHOXY)-BENZAMIDE
CAS:24024-01-9
Formula: C15H10Cl3N5O2
KIN02126094
5-CHLORO-N-(3,4-DICHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:642-91-1
Formula: C8H5NO3
KIN01024161
5-CHLORO-N-(3,4-DICHLOROPHENYL)-2-HYDROXY-BIPHENYL-3-CARBOXAMIDE
CAS:5213-08-1
Formula: C8H5Cl3O2
KIN01122968
5-CHLORO-N-(3,4-DIFLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1179636-51-1
Formula: C11H8ClF2NO
KIN05285903
5-CHLORO-N-(3,4-DIFLUOROPHENYL)PENTANAMIDE
CAS:1039911-71-1
Formula: C11H12ClF2NO
KIN05082071
5-CHLORO-N-(3,5-DIFLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1184406-42-5
KIN05313763
5-CHLORO-N-(3,5-DIFLUOROPHENYL)-2-IODO-BENZAMIDE
CAS:1100266-63-4
Formula: C13H7ClF2INO
KIN05166531
5-CHLORO-N-(3,5-DIFLUOROPHENYL)-PENTANAMIDE
CAS:1038969-30-0
KIN05078224
5-CHLORO-N-(3,5-DIMETHYL-1H-PYRAZOL-4-YL)PENTANAMIDE
CAS:1186633-52-2
Formula: C10H16ClN3O
KIN05321552
5-CHLORO-N-(3-(4-(CYCLOPROPYLMETHYL)PIPERAZIN-1-YL)-4-METHOXY-PHENYL)-3-METHYLBENZO[B]THIOPHEN-2-SULFONAMIDE
CAS:209481-49-2
KIN03419891
5-CHLORO-N-(3-CHLORO-2,6-DIETHYLPHENYL)-2-IODO-BENZAMIDE
CAS:1100281-72-8
Formula: C17H16Cl2INO
KIN05166552
5-CHLORO-N-(3-CHLORO-4-CYANOPHENYL)-2-FURANCARBOXAMIDE
CAS:1088214-90-7
Formula: C12H6Cl2N2O2
KIN05127745
5-CHLORO-N-(3-CHLORO-4-CYANOPHENYL)-2-IODO-BENZAMIDE
CAS:1100136-99-9
Formula: C14H7Cl2IN2O
KIN05166324
5-CHLORO-N-(3-CHLORO-4-CYANOPHENYL)PENTANAMIDE
CAS:1094529-72-2
Formula: C12H12Cl2N2O
KIN05142417
5-CHLORO-N-(3-CHLORO-4-FLUOROPHENYL)-PYRIDIN-2-YLAMINE
CAS:1039902-19-6
Formula: C11H7Cl2FN2
KIN05081872
5-CHLORO-N-(3-CHLOROPHENYL)-2-FURANMETHANAMINE
CAS:1179141-38-8
Formula: C11H9Cl2NO
KIN05282628
5-CHLORO-N-(3-CHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:22203-98-1
Formula: C13H9Cl2NO2
KIN02108397
5-CHLORO-N-(3-CHLOROPHENYL)-PYRIDIN-2-AMINE
CAS:1125865-84-0
Formula: C11H8Cl2N2
KIN05179630
5-CHLORO-N-(3-CHLOROPROPYL)-2-(PHENYLTHIO)-ANILINE
CAS:180145-03-3
KIN03011857
5-CHLORO-N-(3-CYANOPHENYL)-2-HYDROXY-BENZAMIDE
CAS:380656-56-4
KIN03549539
5-CHLORO-N-(3-CYCLOHEXEN-1-YLMETHYL) -2-FLUORO-ANILINE
CAS:1155050-68-2
Formula: C13H15ClFN
KIN05222834
5-CHLORO-N-(3-CYCLOHEXEN-1-YLMETHYL) -2-METHOXY-ANILINE
CAS:1040000-34-7
Formula: C14H18ClNO
KIN05083942
5-CHLORO-N-(3-ETHOXY-PROPYL) -PYRIDIN-2-YLAMINE
CAS:1036517-87-9
Formula: C10H15ClN2O
KIN05071124
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-FLUOROBENZAMIDE
CAS:1031198-71-6
KIN05066193
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-FURANCARBOXAMIDE
CAS:1031138-89-2
Formula: C13H8ClNO2
KIN05066107
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-FURANMETHANAMINE
CAS:1183913-38-3
Formula: C13H10CLNO
KIN05309205
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-METHOXY-BENZAMIDE
CAS:1016388-11-6
KIN05021715
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-METHOXY-BENZENEMETHANAMINE
CAS:1155104-49-6
Formula: C16H14ClNO
KIN05223540
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-NITRO-BENZAMIDE
CAS:1036561-46-2
KIN05071704
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1050607-14-1
KIN05099187
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1020975-26-1
Formula: C13H10ClNS
KIN05051358
5-CHLORO-N-(3-ETHYNYLPHENYL)-2-THIOPHENESULFONAMIDE
CAS:1061371-88-7
KIN05107121
5-CHLORO-N-(3-ETHYNYLPHENYL)-7H-PYRROLO[2,3-D]PYRIMIDIN-4-YLAMINE
CAS:252853-94-4
Formula: C14H9ClN4
KIN03452748
5-CHLORO-N-(3-ETHYNYLPHENYL)PENTANAMIDE
CAS:1038971-44-6
Formula: C13H14ClNO
KIN05078268
5-CHLORO-N-(3-FLUORO-4-METHYLPHENYL)-2-FURANMETHANAMINE
CAS:1183127-66-3
Formula: C12H11ClFNO
KIN05300774
5-CHLORO-N-(3-FLUORO-4-METHYLPHENYL)PENTANAMIDE
CAS:1038969-16-2
Formula: C12H15ClFNO
KIN05078218
5-CHLORO-N-(3-FLUOROBENZYL)-2-FURANMETHANAMINE
CAS:1178226-81-7
KIN05274525
5-CHLORO-N-(3-FLUOROBENZYL)-2-METHYL-ANILINE
CAS:1036621-04-1
Formula: C14H13ClFN
KIN05072464
5-CHLORO-N-(3-FLUOROBENZYL)-PENTANAMIDE
CAS:1039915-15-5
KIN05082144
5-CHLORO-N-(3-FLUOROBENZYL)-PYRIDIN-2-YLAMINE
CAS:1039843-43-0
Formula: C12H10ClFN2
KIN05080522
5-CHLORO-N-(3-FLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1183530-62-2
KIN05305124
5-CHLORO-N-(3-FLUOROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1020917-85-4
KIN05050145
5-CHLORO-N-(3-FLUOROPHENYL)-PENTANAMIDE
CAS:1038968-88-5
KIN05078209
5-CHLORO-N-(3-HYDROXY-PROPYL) -2-METHOXY-BENZAMIDE
CAS:1156589-35-3
Formula: C11H14ClNO3
KIN05235662
5-CHLORO-N-(3-HYDROXY-PROPYL) -2-THIOPHENECARBOXAMIDE
CAS:1153113-12-2
Formula: C8H10ClNO2S
KIN05205471
5-CHLORO-N-(3-HYDROXY-PYRIDIN-2-YL) -2-FURANCARBOXAMIDE
CAS:1043052-99-8
Formula: C10H7ClN2O3
KIN05092259
5-CHLORO-N-(3-IODO-4-METHYLPHENYL)-2-NITRO-BENZAMIDE
CAS:1184271-72-4
Formula: C14H10ClIN2O3
KIN05312925
5-CHLORO-N-(3-IODO-4-METHYLPHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1003737-13-0
KIN05008644
5-CHLORO-N-(3-IODO-4-METHYLPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1152885-03-4
Formula: C12H11ClINS
KIN05202549
5-CHLORO-N-(3-IODO-4-METHYLPHENYL)-PENTANAMIDE
CAS:1153345-03-9
Formula: C12H15ClINO
KIN05208746
5-CHLORO-N-(3-IODO-PHENYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095636-91-1
KIN05152277
5-CHLORO-N-(3-IODO-PHENYL)-2-FURANMETHANAMINE
CAS:1178624-70-8
Formula: C11H9ClINO
KIN05278031
5-CHLORO-N-(3-IODO-PHENYL)-2-METHOXY-BENZENEACETAMIDE
CAS:1043307-16-9
KIN05092540
5-CHLORO-N-(3-IODO-PHENYL)-2-METHOXY-BENZENEMETHANAMINE
CAS:1153311-89-7
Formula: C14H13ClINO
KIN05208231
5-CHLORO-N-(3-IODO-PHENYL)-2-NITRO-BENZAMIDE
CAS:1040315-48-7
KIN05085763
5-CHLORO-N-(3-IODO-PHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1004739-01-8
KIN05009805
5-CHLORO-N-(3-IODO-PHENYL)-2-THIOPHENEMETHANAMINE
CAS:1040315-03-4
Formula: C11H9ClINS
KIN05085751
5-CHLORO-N-(3-IODO-PHENYL)PENTANAMIDE
CAS:1038716-85-6
Formula: C11H13ClINO
KIN05077402
5-CHLORO-N-(3-METHOXY-PROPYL) -2-NITRO-ANILINE
CAS:149669-22-7
Formula: C10H13ClN2O3
KIN03293397
5-CHLORO-N-(3-METHOXY-PROPYL) -2-THIOPHENEMETHANAMINE
CAS:1042591-08-1
Formula: C9H14ClNOS
KIN05090048
5-CHLORO-N-(3-METHOXY-PROPYL) -PYRIDIN-2-YLAMINE
CAS:1094360-71-0
Formula: C9H13ClN2O
KIN05139602
5-CHLORO-N-(3-METHOXYPROPYL) -2-METHYL-BENZENAMINE
CAS:1178470-73-9
Formula: C11H16ClNO
KIN05277227
5-CHLORO-N-(3-METHYL-5-ISOXAZOLYL) -PENTANAMIDE
CAS:1038969-95-7
Formula: C9H13ClN2O2
KIN05078240
5-CHLORO-N-(3-METHYL-CYCLOHEXYL) -PYRIDIN-2-YLAMINE
CAS:1096306-56-7
Formula: C12H17ClN2
KIN05153944
5-CHLORO-N-(3-METHYLBUTYL)-1-PENTANAMINE HCL
CAS:7596-95-4
Formula: C17H18N2O4
KIN01191888
5-CHLORO-N-(3-METHYLBUTYL)-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1183365-76-5
Formula: C14H18ClN3
KIN05303384
5-CHLORO-N-(3-METHYLBUTYL)-2-NITRO-ANILINE
CAS:1026615-36-0
Formula: C11H15ClN2O2
KIN05060989
5-CHLORO-N-(3-METHYLBUTYL)-2-THIOPHENEMETHANAMINE
CAS:1021100-90-2
Formula: C10H16ClNS
KIN05053429
5-CHLORO-N-(3-METHYLBUTYL)-PYRIDIN-2-AMINE
CAS:1041575-20-5
Formula: C10H15ClN2
KIN05087965
5-CHLORO-N-(3-METHYLPHENYL)-2-NITRO-ANILINE
CAS:350235-33-5
Formula: C13H11ClN2O2
KIN03527440
5-CHLORO-N-(3-METHYLPYRIDIN-2-YL)-2-FURANCARBOXAMIDE
CAS:1090407-73-0
Formula: C11H9ClN2O2
KIN05130174
5-CHLORO-N-(3-METHYLPYRIDIN-2-YL)PENTANAMIDE
CAS:1039948-92-9
Formula: C11H15ClN2O
KIN05082856
5-CHLORO-N-(3-PHENYL-CYCLOBUTYL)-4-BENZO[D]THIAZOLAMINE
CAS:1156607-83-8
Formula: C17H15ClN2S
KIN05235885
5-CHLORO-N-(3-PHENYLPROPYL)-PYRIDIN-2-YLAMINE
CAS:1184448-40-5
Formula: C14H15ClN2
KIN05314193
5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-1,5-DIHYDRO-QUINOXALIN-6(4H)-IMINE; 5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-6-QUINOXALIAMINE
CAS:91147-46-5
Formula: C11H10ClN5
KIN02739477
UK-14819
5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-3-METHYLPYRIDIN-2-YLAMINE
CAS:31430-35-0
Formula: C9H11ClN4
KIN02189376
5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-BENZO[C][1,2,5]THIADIAZOL-4-YLAMINE HBR
CAS:51323-06-9
Formula: C9H8ClN5S.BrH
KIN02304915
5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-BENZO[C][1,2,5]THIADIAZOL-4-YLAMINE; 4-(CYCLOPENT-1-EN-1-YLMETHYL)-5-METHYL-2H-INDENE; 5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-BENZO[C][1,2,5]THIADIAZOL-4-YLAMINE
CAS:51322-75-9
Formula: C9H9Cl2N5S
KIN02304893
Tizanidine
MFCD00865192
5-CHLORO-N-(4,5-DIHYDRO-1H-IMIDAZOL-2-YL)-PYRIDIN-2-YLAMINE
CAS:31430-29-2
Formula: C8H9ClN4
KIN02189374
5-Chloro-2-(2(1H)-imidazolin-2-ylamino)-pyridine
5-CHLORO-N-(4,5-DIHYDROACENAPHTHO[5,4-D]THIAZOL-8-YL)-2-THIOPHENECARBOXAMIDE
CAS:477486-06-9
Formula: C18H11ClN2OS2
KIN03604464
5-CHLORO-N-(4,5-DIMETHYLTHIAZOL-2-YL)-2-HYDROXY-BENZAMIDE
CAS:1043102-69-7
Formula: C12H11ClN2O2S
KIN05092298
5-CHLORO-N-(4,6-DIMETHYLPYRIMIDIN-2-YL)PENTANAMIDE
CAS:1038978-57-2
Formula: C11H16ClN3O
KIN05078461
5-CHLORO-N-(4-(1,2-DIHYDROXYETHYL) -3-(TRIFLUOROMETHYL)PHENYL)-1H-INDOL-2-CARBOXAMIDE
CAS:35633-27-3
KIN02224937
5-CHLORO-N-(4-(DIETHYLAMINO)-1-METHYLBUTYL)-1H-BENZO[D]IMIDAZOL-2-SULFONAMIDE
CAS:115243-15-7
Formula: [C16H25ClN4O2S
KIN03136145
5-CHLORO-N-(4-(DIETHYLAMINO)-1-METHYLBUTYL)-2-(METHYLAMINO)-BENZAMIDE
CAS:32615-77-3
Formula: C17H28ClN3O
KIN02198625
5-CHLORO-N-(4-CHLORO-2,6-DINITROPHENYL)-2-(1,1,2,2-TETRAFLUORO-ETHYL)-PYRIMIDIN-4-YLAMINE POTASSIUM SALT
CAS:112940-16-6
KIN03119341
5-CHLORO-N-(4-CHLORO-2-NITROPHENYL)-PYRIDIN-2-YLAMINE
CAS:24591-18-2
KIN02131945
5-CHLORO-N-(4-CHLORO-3-CYANOPHENYL)PENTANAMIDE
CAS:1098358-30-5
Formula: C12H12Cl2N2O
KIN05162635
5-CHLORO-N-(4-CHLORO-3-NITROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:56961-08-1
Formula: C13H8Cl2N2O4
KIN02391576
5-CHLORO-N-(4-CHLOROPHENYL)-1H-BENZO[D]IMIDAZOL-2-SULFONAMIDE
CAS:115243-14-6
Formula: [C13H9Cl2N3O2S
KIN03136144
5-CHLORO-N-(4-CHLOROPHENYL)-2-[(4-CHLOROPHENYL)SULFONYLAMINO]BENZAMIDE
CAS:4595-84-0
Formula: C16H12N2O4S
KIN01111085
5-CHLORO-N-(4-CHLOROPHENYL)-2-FURANMETHANAMINE
CAS:1178856-72-8
Formula: C11H9Cl2NO
KIN05280544
5-CHLORO-N-(4-CHLOROPHENYL)-2-HYDROXY-3-(2-NITRO-ETHENYL)-BENZAMIDE
CAS:111870-31-6
Formula: C15H10Cl2N2O4
KIN03110736
5-CHLORO-N-(4-CHLOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:1148-01-2
KIN01041581
5-CHLORO-N-(4-CHLOROPHENYL)-2-NITRO-BENZAMIDE
CAS:188604-94-6
Formula: C13H8Cl2N2O3
KIN03385257
5-CHLORO-N-(4-CHLOROPHENYL)-2-NITRO-BENZO[B]THIOPHEN-3-YLAMINE
CAS:149338-25-0
Formula: C14H8Cl2N2O2S
KIN03292098
5-CHLORO-N-(4-CHLOROPHENYL)-3-[[(4-FLUOROPHENYL)IMINO]METHYL]-2-HYDROXY-BENZAMIDE
CAS:111870-33-8
Formula: C20H13Cl2FN2O2
KIN03110738
5-CHLORO-N-(4-CYANO-1,2,4A,5,6,7-HEXAHYDRO-1-OXO-2-PHENYLPYRROLO[1,2-C]PYRIMIDIN-3-YL) PENTANAMIDE
CAS:177662-83-8
Formula: C19H21ClN4O2
KIN03362858
5-CHLORO-N-(4-DODECYLPHENYL)-2-HYDROXY-BENZAMIDE
CAS:62469-12-9
Formula: C25H34ClNO2
KIN02474620
5-CHLORO-N-(4-ETHOXY-PHENYL) -2-METHOXY-BENZENEACETAMIDE
CAS:1043287-37-1
Formula: C17H18ClNO3
KIN05092502
5-CHLORO-N-(4-ETHYL-CYCLOHEXYL) -2-FLUORO-ANILINE
CAS:1155047-74-7
Formula: C14H19ClFN
KIN05222784
5-CHLORO-N-(4-ETHYL-CYCLOHEXYL) -2-NITRO-ANILINE
CAS:1156055-29-6
Formula: C14H19ClN2O2
KIN05228828
5-CHLORO-N-(4-ETHYNYLPHENYL)-2-[[2-FLUORO-4-(IMINO-PIPERIDIN-1-YLMETHYL)-BENZOYL]AMINO]-3-METHOXY-BENZAMIDE
CAS:467433-03-0
Formula: C29H26ClFN4O3
KIN03598319
5-CHLORO-N-(4-ETHYNYLPHENYL)-2-[[2-FLUORO-4-[[4-(HYDROXYMETHYL)PIPERIDIN-1-YL]IMINOMETHYL]BENZOYL]AMINO]-3-METHOXY-BENZAMIDE
CAS:467432-99-1
Formula: C30H28ClFN4O4
KIN03598315
5-CHLORO-N-(4-ETHYNYLPHENYL)-2-[[4-(IMINO-PIPERIDIN-1-YLMETHYL)-BENZOYL]AMINO]-3-METHOXY-BENZAMIDE
CAS:467433-14-3
Formula: C29H27ClN4O3
KIN03598330
5-CHLORO-N-(4-ETHYNYLPHENYL)-2-[[4-[[4-(HYDROXYMETHYL)PIPERIDIN-1-YL]IMINOMETHYL]BENZOYL]AMINO]BENZAMIDE
CAS:467430-52-0
Formula: C29H27ClN4O3
KIN03598233
5-CHLORO-N-(4-ETHYNYLPHENYL)-2-NITRO-BENZAMIDE
CAS:467430-46-2
Formula: C15H9ClN2O3
KIN03598227
5-CHLORO-N-(4-FLUORO-2-METHYLPHENYL)-2-FURANMETHANAMINE
CAS:1179717-40-8
Formula: C12H11ClFNO
KIN05286794
5-CHLORO-N-(4-FLUORO-2-METHYLPHENYL)PENTANAMIDE
CAS:1039911-55-1
Formula: C12H15ClFNO
KIN05082066
5-CHLORO-N-(4-FLUORO-3-NITROPHENYL)-2-IODO-BENZAMIDE
CAS:1100176-30-4
Formula: C13H7ClFIN2O3
KIN05166378
5-CHLORO-N-(4-FLUOROBENZYL)-2-FURANMETHANAMINE
CAS:1179797-25-1
KIN05287619
5-CHLORO-N-(4-FLUOROBENZYL)-2-IODO-ALPHA-BENZAMIDE
CAS:1147754-28-6
Formula: C14H10ClFINO
KIN05195908
5-CHLORO-N-(4-FLUOROBENZYL)-2-METHYL-ANILINE
CAS:1041586-19-9
Formula: C14H13ClFN
KIN05088121
5-CHLORO-N-(4-FLUOROBENZYL)-PENTANAMIDE
CAS:1038968-95-4
KIN05078212
5-CHLORO-N-(4-FLUOROBENZYL)-PYRIDIN-2-YLAMINE
CAS:1036556-38-3
Formula: C12H10ClFN2
KIN05071637
5-CHLORO-N-(4-FLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1184695-82-6
KIN05316673
5-CHLORO-N-(4-FLUOROPHENYL)-2-HYDROXY-3-(2-NITRO-ETHENYL)-BENZAMIDE
CAS:111870-32-7
Formula: C15H10ClFN2O4
KIN03110737
5-CHLORO-N-(4-FLUOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:343-61-3
KIN01011099
5-CHLORO-N-(4-FLUOROPHENYL)-2-NITRO-ANILINE
CAS:1477-88-9
KIN01047995
5-CHLORO-N-(4-FLUOROPHENYL)-2-NITRO-BENZO[B]THIOPHEN-3-YLAMINE
CAS:149338-26-1
Formula: [C14H8ClFN2O2S
KIN03292099
5-CHLORO-N-(4-FLUOROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:51305-83-0
KIN02304604
5-CHLORO-N-(4-FLUOROPHENYL)-3-[[(4-FLUOROPHENYL)IMINO]METHYL]-2-HYDROXY-BENZAMIDE
CAS:111870-34-9
Formula: C20H13ClF2N2O2
KIN03110739
5-CHLORO-N-(4-FLUOROPHENYL)PENTANAMIDE
CAS:27471-39-2
KIN02157691
5-CHLORO-N-(4-HYDROXY-CYCLOHEXYL) -2-FURANCARBOXAMIDE
CAS:1156978-01-6
Formula: C11H14ClNO3
KIN05241079
5-CHLORO-N-(4-HYDROXY-CYCLOHEXYL) -4-IODO-2-METHOXY-BENZAMIDE
CAS:1156849-09-0
Formula: C14H17ClINO3
KIN05239143
5-CHLORO-N-(4-HYDROXY-CYCLOHEXYL) -PENTANAMIDE
CAS:1039330-36-3
Formula: C11H20ClNO2
KIN05079253
5-CHLORO-N-(4-IODO-2-METHYLPHENYL)-2-METHOXY-BENZAMIDE
CAS:462079-39-6
Formula: C15H13ClINO2
KIN03596702
5-CHLORO-N-(4-IODO-2-METHYLPHENYL)-2-NITRO-BENZAMIDE
CAS:1178341-80-4
Formula: C14H10ClIN2O3
KIN05275807
5-CHLORO-N-(4-IODO-2-METHYLPHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1180352-50-4
Formula: C12H9ClINOS
KIN05289635
5-CHLORO-N-(4-IODO-2-METHYLPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1152887-34-7
Formula: C12H11ClINS
KIN05202574
5-CHLORO-N-(4-IODO-2-METHYLPHENYL)-PENTANAMIDE
CAS:1153345-37-9
Formula: C12H15ClINO
KIN05208754
5-CHLORO-N-(4-IODO-PHENYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095665-07-8
KIN05152585
5-CHLORO-N-(4-IODO-PHENYL)-2-FURANMETHANAMINE
CAS:1183275-00-4
Formula: C11H9ClINO
KIN05302391
5-CHLORO-N-(4-IODO-PHENYL)-2-METHOXY-BENZAMIDE
CAS:349425-49-6
Formula: C14H11ClINO2
KIN03526203
5-CHLORO-N-(4-IODO-PHENYL)-2-METHOXY-BENZENEACETAMIDE
CAS:1036674-81-3
KIN05072655
5-CHLORO-N-(4-IODO-PHENYL)-2-METHOXY-BENZENEMETHANAMINE
CAS:1153311-04-6
Formula: C14H13ClINO
KIN05208227
5-CHLORO-N-(4-IODO-PHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1004101-49-8
KIN05009088
5-CHLORO-N-(4-IODO-PHENYL)-2-THIOPHENEMETHANAMINE
CAS:1040064-60-5
Formula: C11H9ClINS
KIN05084971
5-CHLORO-N-(4-IODO-PHENYL)-2-THIOPHENESULFONAMIDE
CAS:384847-73-8
Formula: C10H7ClINO2S2
KIN03552826
5-CHLORO-N-(4-IODO-PHENYL)-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:356783-92-1
Formula: C17H13ClIN3O
KIN03533704
5-CHLORO-N-(4-IODO-PHENYL)PENTANAMIDE
CAS:1039872-78-0
Formula: C11H13ClINO
KIN05081110
5-CHLORO-N-(4-METHOXY-3-PIPERAZIN-1-YLPHENYL) -3-METHYL-1-BENZO[B]THIOPHEN-2-SULFONAMIDE
CAS:209481-20-9
Formula: C20H23Cl2N3O3S2
KIN03002679
5-CHLORO-N-(4-METHOXY-3-PIPERAZIN-1-YLPHENYL) -3-METHYL-1-BENZO[B]THIOPHEN-2-SULFONAMIDE HCL
CAS:209481-24-3
Formula: C20H22ClN3O3S2.ClH
KIN03002680
5-CHLORO-N-(4-METHOXY-PHENYL) -2-NITRO-ANILINE
CAS:92022-96-3
Formula: C13H11ClN2O3
KIN02751925
5-CHLORO-N-(4-METHOXY-PHENYL) -3-NITROPYRIDIN-2-YLAMINE
CAS:75806-89-2
Formula: C12H10ClN3O3
KIN02614919
5-CHLORO-N-(4-METHOXY-PHENYL) -PYRIMIDIN-2-YLAMINE
CAS:76234-18-9
Formula: C11H10ClN3O
KIN02617768
5-CHLORO-N-(4-METHYL-2-NITROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1157524-42-9
Formula: C12H11ClN2O2S
KIN05247530
5-CHLORO-N-(4-METHYL-3-NITROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1157071-39-0
Formula: C12H11ClN2O2S
KIN05242940
5-CHLORO-N-(4-METHYL-CYCLOHEXYL) -PYRIDIN-2-YLAMINE
CAS:1036525-26-4
Formula: C12H17ClN2
KIN05071239
5-CHLORO-N-(4-METHYLPENTYL)-PYRIDIN-2-AMINE
CAS:1182902-06-2
Formula: C11H17ClN2
KIN05298261
5-CHLORO-N-(4-METHYLPHENYL)-2,4-DINITRO-ANILINE
CAS:7508-51-2
Formula: C26H34N4O8S
KIN01190144
5-CHLORO-N-(4-METHYLPHENYL)-2-(METHYLTHIO)-4-PYRIMIDINECARBOXAMIDE
CAS:306958-67-8
KIN03482852
5-CHLORO-N-(4-METHYLPHENYL)-2-NITRO-ANILINE
CAS:32724-92-8
KIN02199428
p-Toluidine, N-(5-chloro-2-nitrophenyl)-; 2-Nitro-
5-CHLORO-N-(4-METHYLPYRIDIN-2-YL)-2-FURANCARBOXAMIDE
CAS:1043110-13-9
Formula: C11H9ClN2O2
KIN05092306
5-CHLORO-N-(4-METHYLPYRIDIN-2-YL)PENTANAMIDE
CAS:1038971-74-2
Formula: C11H15ClN2O
KIN05078280
5-CHLORO-N-(4-NITROPHENYL)-PENTANAMIDE
CAS:1039914-85-6
Formula: C11H13ClN2O3
KIN05082136
5-CHLORO-N-(4-PHENOXY-PHENYL) -2-FURANMETHANAMINE
CAS:1183324-82-4
Formula: C17H14ClNO2
KIN05302939
5-CHLORO-N-(4-PYRIDINYLMETHYL)-PENTANAMIDE
CAS:1039949-26-2
Formula: C11H15ClN2O
KIN05082867
5-CHLORO-N-(5-CHLORO-2-CYANOPHENYL)PENTANAMIDE
CAS:1156619-04-3
Formula: C12H12Cl2N2O
KIN05235976
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-BENZO[D]THIAZOLAMINE
CAS:1156039-44-9
Formula: C13H7Cl2FN2S
KIN05228660
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-FURANMETHANAMINE
CAS:1178079-74-7
Formula: C11H8Cl2FNO
KIN05272958
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-HYDROXY-BENZAMIDE
CAS:1155986-23-4
Formula: C13H8Cl2FNO2
KIN05228382
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-METHOXY-BENZAMIDE
CAS:1181001-29-5
Formula: C14H10Cl2FNO2
KIN05290439
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-NITRO-BENZAMIDE
CAS:1155987-47-5
Formula: C13H7Cl2FN2O3
KIN05228395
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-THIOPHENECARBOXAMIDE
CAS:1190499-37-6
Formula: C11H6Cl2FNOS
KIN05331113
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-2-THIOPHENEMETHANAMINE
CAS:1156150-83-2
Formula: C11H8Cl2FNS
KIN05230186
5-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-PENTANAMIDE
CAS:1098346-61-2
KIN05162340
5-CHLORO-N-(5-CHLORO-2-HYDROXY-PHENYL) -1-[(4-CHLOROPHENYL)METHYL]-1H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:106157-39-5
KIN03074425
5-CHLORO-N-(5-CHLORO-2-METHOXY-PHENYL) -2-IODO-BENZAMIDE
CAS:1100203-01-7
Formula: C14H10Cl2INO2
KIN05166435
5-CHLORO-N-(5-CHLORO-PYRIDIN-2-YL)-2-FLUOROBENZAMIDE
CAS:1100018-31-2
Formula: C12H7Cl2FN2O
KIN05166168
5-CHLORO-N-(5-CHLORO-PYRIDIN-2-YL)PENTANAMIDE
CAS:1039949-32-0
Formula: C10H12Cl2N2O
KIN05082871
5-CHLORO-N-(5-CHLOROPYRIDIN-2-YL)-2-METHOXY-BENZAMIDE
CAS:312591-32-5
KIN03652480
5-CHLORO-N-(5-ETHOXY-PENTYL) -6-ETHYLPYRIMIDIN-4-YLAMINE
CAS:124310-42-5
KIN03630082
5-CHLORO-N-(5-FLUORO-2-METHYLPHENYL)-2-FURANMETHANAMINE
CAS:1178929-38-8
Formula: C12H11ClFNO
KIN05280828
5-CHLORO-N-(5-FLUORO-2-METHYLPHENYL)PENTANAMIDE
CAS:1039946-69-4
Formula: C12H15ClFNO
KIN05082815
5-CHLORO-N-(5-FLUOROPYRIDIN-2-YL)-2-NITRO-BENZAMIDE
CAS:280772-21-6
KIN03674846
5-CHLORO-N-(5-METHYL-3-ISOXAZOLYL) -PENTANAMIDE
CAS:1039946-05-8
Formula: C9H13ClN2O2
KIN05082806
5-CHLORO-N-(5-METHYLPYRIDIN-2-YL)-2-FURANCARBOXAMIDE
CAS:1090535-50-4
Formula: C11H9ClN2O2
KIN05130878
5-CHLORO-N-(5-METHYLPYRIDIN-2-YL)PENTANAMIDE
CAS:1038971-59-3
Formula: C11H15ClN2O
KIN05078273
5-CHLORO-N-(5-PHENYL-1,3,4-OXADIAZOL-2-YL) PENTANAMIDE
CAS:1154235-26-3
Formula: C13H14ClN3O2
KIN05215690
5-CHLORO-N-(5-PHENYL-THIAZOL-2-YL)-PYRIDIN-2-YLAMINE
CAS:329792-48-5
KIN03663768
5-CHLORO-N-(6-CHLORO-3H-1,2,4-THIADIAZOLO[4,3-A]PYRIDIN-3-YLIDENE)-PYRIDIN-2-YLAMINE
CAS:24097-98-1
KIN02126849
5-CHLORO-N-(6-CHLORO-PYRIDIN-3-YL)-2-OXAZOLECARBOXAMIDE
CAS:1026297-15-3
Formula: C9H5Cl2N3O2
KIN05060315
5-CHLORO-N-(6-CHLOROPYRIDIN-3-YL)-2-FURANCARBOXAMIDE
CAS:325458-06-8
KIN03663767
5-CHLORO-N-(6-CHLOROPYRIDIN-3-YL)-2-HYDROXY-BENZAMIDE
CAS:439144-12-4
Formula: C12H8Cl2N2O2
KIN03652479
5-CHLORO-N-(6-CHLOROPYRIDIN-3-YL)-2-THIOPHENECARBOXAMIDE
CAS:325458-05-7
KIN03618692
5-CHLORO-N-(6-METHYLPYRIDIN-2-YL)-2-FURANCARBOXAMIDE
CAS:1043095-23-3
Formula: C11H9ClN2O2
KIN05092291
5-CHLORO-N-(6-METHYLPYRIDIN-2-YL)PENTANAMIDE
CAS:1039914-29-8
Formula: C11H15ClN2O
KIN05082125
5-CHLORO-N-(6-PHENYLHEXYL) -NAPHTHALEN-1-YLSULFONAMIDE
CAS:102649-78-5
Formula: C22H24ClNO2S
KIN03049211
5-CHLORO-N-(8-CHLORO-QUINOLIN-5-YL)-2-IODO-BENZAMIDE
CAS:1100203-69-7
Formula: C16H9Cl2IN2O
KIN05166448
5-CHLORO-N-(BENZYL)-2-PROPOXY-BENZENEMETHANAMINE
CAS:1158945-26-6
Formula: C17H20ClNO
KIN05254523
5-CHLORO-N-(BENZYL)-N-[2-(2,4,6-TRICHLOROPHENOXY)ETHYL]PYRIDIN-3-CARBOXAMIDE
CAS:106876-91-9
KIN03079375
5-CHLORO-N-(BENZYL)-PYRIDIN-2-YLAMINE
CAS:280116-82-7
Formula: C12H11ClN2
KIN03466615
5-CHLORO-N-(CYANOMETHYL)-2-FLUOROBENZAMIDE
CAS:1184220-00-5
Formula: C9H6ClFN2O
KIN05312381
5-CHLORO-N-(CYANOMETHYL)-2-HYDROXY-BENZAMIDE
CAS:1183404-65-0
Formula: C9H7ClN2O2
KIN05303773
5-CHLORO-N-(CYANOMETHYL)-2-METHOXY-BENZAMIDE
CAS:335204-64-3
Formula: C10H9ClN2O2
KIN03508500
5-CHLORO-N-(CYANOMETHYL)-2-METHYLBENZAMIDE
CAS:143153-80-4
Formula: C10H9ClN2O
KIN03268499
5-CHLORO-N-(CYANOMETHYL)-2-NITRO-BENZAMIDE
CAS:22978-10-5
Formula: C9H6ClN3O3
KIN02115575
5-CHLORO-N-(CYANOPHENYLMETHYL)-1H-PYRROL-2-CARBOXAMIDE
CAS:118880-69-6
KIN03641244
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095557-79-1
Formula: C12H13ClN2S
KIN05151301
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-FURANMETHANAMINE
CAS:1178458-63-3
Formula: C10H14ClNO
KIN05277084
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-HYDROXY-BENZAMIDE
CAS:1095174-39-2
Formula: C12H14ClNO2
KIN05149492
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-METHOXY-BENZAMIDE
CAS:1111546-73-6
Formula: C13H16ClNO2
KIN05174376
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-NITRO-BENZAMIDE
CAS:1095241-93-2
Formula: C12H13ClN2O3
KIN05150087
5-CHLORO-N-(CYCLOBUTYLMETHYL)-2-THIOPHENEMETHANAMINE
CAS:1096275-74-9
Formula: C10H14ClNS
KIN05153371
5-CHLORO-N-(CYCLOBUTYLMETHYL)-PENTANAMIDE
CAS:1095592-80-5
KIN05151712
5-CHLORO-N-(CYCLOBUTYLMETHYL)-PYRIDIN-2-AMINE
CAS:1095650-92-2
Formula: C10H13ClN2
KIN05152460
5-CHLORO-N-(CYCLOHEXYLMETHYL) -2-FLUORO-ANILINE
CAS:1156153-02-4
Formula: C13H17ClFN
KIN05230235
5-CHLORO-N-(CYCLOHEXYLMETHYL) -2-IODO-ALPHA-BENZAMIDE
CAS:1100203-30-2
Formula: C14H17ClINO
KIN05166441
5-CHLORO-N-(CYCLOHEXYLMETHYL) -2-NITRO-ANILINE
CAS:162140-06-9
Formula: C13H17ClN2O2
KIN03330806
5-CHLORO-N-(CYCLOHEXYLMETHYL) -PYRIDIN-2-YLAMINE
CAS:1096293-84-3
Formula: C12H17ClN2
KIN05153690
5-CHLORO-N-(CYCLOHEXYLMETHYLENE) -2-METHOXY-ANILINE
CAS:172224-64-5
Formula: C14H18ClNO
KIN03011452
5-CHLORO-N-(CYCLOPENTYLMETHYL)-2-FURANMETHANAMINE
CAS:1183620-08-7
Formula: C11H16ClNO
KIN05306087
5-CHLORO-N-(CYCLOPENTYLMETHYL)-2-IODO-ALPHA-BENZAMIDE
CAS:1147763-15-2
Formula: C13H15ClINO
KIN05195923
5-CHLORO-N-(CYCLOPENTYLMETHYL)-PENTANAMIDE
CAS:1096341-10-4
KIN05154752
5-CHLORO-N-(CYCLOPENTYLMETHYL)-PYRIDIN-2-YLAMINE
CAS:1096893-14-9
Formula: C11H15ClN2
KIN05157513
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095509-71-9
KIN05150793
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-FLUORO-ANILINE
CAS:1156168-88-5
Formula: C10H11ClFN
KIN05230596
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-FLUOROBENZAMIDE
CAS:1090467-34-7
Formula: C11H11ClFNO
KIN05130500
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-FURANCARBOXAMIDE
CAS:1090948-34-7
Formula: C9H10ClNO2
KIN05131791
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-HYDROXY-BENZAMIDE
CAS:1019376-69-2
Formula: C11H12ClNO2
KIN05042497
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-IODO-ALPHA-BENZAMIDE
CAS:1147703-11-4
Formula: C11H11ClINO
KIN05195786
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-METHOXY-ANILINE
CAS:1154386-74-9
Formula: C11H14ClNO
KIN05217306
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-METHOXY-BENZAMIDE
CAS:1090524-44-9
Formula: C12H14ClNO2
KIN05130823
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-METHYL-BENZENAMINE
CAS:1154343-02-8
Formula: C11H14ClN
KIN05216945
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-NITRO-N-PROPYLBENZENEMETHANAMINE
CAS:415932-69-3
Formula: C14H19ClN2O2
KIN03572272
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-PROPOXY-ANILINE
CAS:1178490-67-9
Formula: C13H18ClNO
KIN05277453
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-THIOPHENECARBOXAMIDE
CAS:1089623-17-5
Formula: C9H10ClNOS
KIN05129327
5-CHLORO-N-(CYCLOPROPYLMETHYL)-2-THIOPHENEMETHANAMINE
CAS:1020979-91-2
Formula: C9H12ClNS
KIN05051428
5-CHLORO-N-(CYCLOPROPYLMETHYL)-PYRIDIN-2-AMINE
CAS:1042515-86-5
Formula: C9H11ClN2
KIN05089066
5-CHLORO-N-(CYCLOPROPYLMETHYL)-PYRIDIN-2-CARBOXAMIDE
CAS:1195251-17-2
Formula: C10H11ClN2O
KIN05336663
5-CHLORO-N-(DIAMINOPHOSPHINYL)-2-THIOPHENECARBOXAMIDE
CAS:189330-44-7
KIN03388689
5-CHLORO-N-(DIBENZYL)-1H-PYRAZOLO[3,4-C]PYRIDINE-1-ACETAMIDE
CAS:1119448-93-9
Formula: C21H17ClN4O
KIN05177131
5-CHLORO-N-(DICYCLOPROPYLMETHYL)-2-FLUORO-ANILINE
CAS:1156038-78-6
Formula: C13H15ClFN
KIN05228652
5-CHLORO-N-(DICYCLOPROPYLMETHYL)-2-METHOXY-ANILINE
CAS:1094673-04-7
Formula: C14H18ClNO
KIN05143907
5-CHLORO-N-(DIMETHYL-LAMBDA4-THIOIDENE)-PYRIDIN-2-YLAMINE
CAS:134251-85-7
Formula: C7H9ClN2S
KIN03227380
5-CHLORO-N-(DIPHENYLMETHYL)-PYRIDIN-2-YLAMINE
CAS:1098342-33-6
Formula: C18H15ClN2
KIN05162266
5-CHLORO-N-(FURAN-2-YLMETHYL)-2-THIAZOLAMINE
CAS:1071757-57-7
Formula: C8H7ClN2OS
KIN05113622
5-CHLORO-N-(FURAN-2-YLMETHYL)-4-IODO-2-METHOXY-BENZAMIDE
CAS:1147808-60-3
Formula: C13H11ClINO3
KIN05195960
5-CHLORO-N-(FURAN-2-YLMETHYL)-PYRIDIN-2-YLAMINE
CAS:1041547-69-6
Formula: C10H9ClN2O
KIN05087576
5-CHLORO-N-(INDOL-3-YLMETHYLENE)-ANTHRANILIC ACID
CAS:22394-36-1
Formula: C16H11ClN2O2
KIN02110242
5-CHLORO-N-(METHOXYCARBONYL) -D-TRYPTOPHAN METHYL ESTER
CAS:93272-10-7
Formula: C14H15ClN2O4
KIN02767461
5-CHLORO-N-(METHOXYCARBONYL) -L-TRYPTOPHAN METHYL ESTER
CAS:93272-04-9
Formula: C14H15ClN2O4
KIN02767458
5-CHLORO-N-(METHOXYCARBONYL) -TRYPTOPHAN METHYL ESTER
CAS:67811-44-3
Formula: C14H15ClN2O4
KIN02558290
5-CHLORO-N-(NAPHTHALEN-1-YLMETHYLENE)-PYRIDIN-2-YLAMINE
CAS:329937-00-0
KIN03630081
5-CHLORO-N-(PHENOXYACETYL) ANTHRANILIC ACID
CAS:70796-18-8
Formula: C15H12ClNO4
KIN02579971
5-CHLORO-N-(PHENYLMETHYLENE)-1H-TETRAZOL-1-YLAMINE
CAS:84143-59-9
Formula: C8H6ClN5
KIN02665521
5-CHLORO-N-(PHENYLMETHYLENE)-PYRIDIN-2-YLAMINE
CAS:196959-66-7
KIN03401787
5-CHLORO-N-(PYRIDIN-4-YLMETHYLENE)-PYRIDIN-2-YLAMINE
CAS:339065-69-9
KIN03663766
5-CHLORO-N-(TERT-BUTYL)-1H-IMIDAZOL-2-CARBOXAMIDE
CAS:79711-31-2
Formula: C8H12ClN3O
KIN02639447
5-CHLORO-N-(TERT-BUTYL)-2,6-DIFLUORO-4-PYRIMIDINAMINE
CAS:1132972-49-6
Formula: C8H10ClF2N3
KIN05184652
5-CHLORO-N-(TERT-BUTYL)-2-[(METHYLTHIO)METHYL]-ANILINE
CAS:56660-01-6
Formula: C12H18ClNS
KIN02386498
5-CHLORO-N-(TERT-BUTYL)-2-BENZO[D]THIAZOLAMINE
CAS:1095509-50-4
KIN05150787
5-CHLORO-N-(TERT-BUTYL)-2-FURANCARBOXAMIDE
CAS:98950-21-1
Formula: C9H12ClNO2
KIN02816708
5-CHLORO-N-(TERT-BUTYL)-2-HYDROXY-BENZAMIDE
CAS:6626-88-6
Formula: C14H20ClNO2
KIN01166641
5-CHLORO-N-(TERT-BUTYL)-2-METHOXY-BENZAMIDE
CAS:329043-05-2
Formula: C12H16ClNO2
KIN03499708
5-CHLORO-N-(TERT-BUTYL)-2-PYRAZINECARBOTHIOAMIDE
CAS:252189-91-6
KIN03452143
5-CHLORO-N-(TERT-BUTYL)-2-THIOPHENECARBOXAMIDE
CAS:190076-86-9
Formula: C9H12ClNOS
KIN03390451
5-CHLORO-N-(TERT-BUTYL)-2-THIOPHENEMETHANAMINE
CAS:1020958-96-6
Formula: C9H14ClNS
KIN05050987
5-CHLORO-N-(TERT-BUTYL)-3,6-DIFLUOROPYRIDIN-2-YLAMINE
CAS:189281-53-6
KIN03388335
5-CHLORO-N-(TERT-BUTYL)-3-METHYLPYRIDIN-2-CARBOXAMIDE
CAS:156072-89-8
KIN03652478
5-CHLORO-N-(TERT-BUTYL)-4,6-DIFLUORO-2-PYRIMIDINAMINE
CAS:1132972-52-1
Formula: C8H10ClF2N3
KIN05184653
5-CHLORO-N-(TERT-BUTYL)-PYRIDAZIN-3-CARBOTHIOAMIDE
CAS:457613-37-5
Formula: C9H12ClN3S
KIN03016619
5-CHLORO-N-(TERT-BUTYL)-PYRIDIN-2-CARBOXAMIDE
CAS:223444-87-9
KIN03438013
5-CHLORO-N-(TERT-BUTYL)-PYRIDIN-2-CARBOXAMIDE 1-OXIDE
CAS:223444-89-1
KIN03652477
5-CHLORO-N-(TETRAHYDRO-2H-PYRAN-4-YL)-8-QUINOLINAMINE
CAS:1184418-94-7
Formula: C14H15ClN2O
KIN05313895
5-CHLORO-N-(TETRAHYDRO-2H-PYRAN-4-YL)-PYRIDIN-2-AMINE
CAS:1153380-99-4
Formula: C10H13ClN2O
KIN05209252
5-CHLORO-N-(TETRAHYDRO-2H-PYRAN-4-YL)PENTANAMIDE
CAS:1153229-35-6
Formula: C10H18ClNO2
KIN05206994
5-CHLORO-N-(THIOPHEN-2-YLMETHYL)-PYRIDIN-2-YLAMINE
CAS:1099689-14-1
Formula: C10H9ClN2S
KIN05165871
5-CHLORO-N-(TRIMETHYLSILYL)-2-[(TRIMETHYLSILYLOXY)]PYRIMIDIN-4-YLAMINE
CAS:111878-22-9
Formula: C10H20ClN3OSi2
KIN03110816
5-CHLORO-N-[(1-ETHYL-1H-PYRROLIDIN-2-YL)METHYL]-2-METHOXY-4-METHYLBENZAMIDE
CAS:28478-50-4
Formula: C16H23ClN2O2
KIN02166413
5-CHLORO-N-[(1-ETHYL-1H-PYRROLIDIN-2-YL)METHYL]-3-METHOXY-1H-INDOL-2-CARBOXAMIDE HCL
CAS:21716-65-4
Formula: C17H23Cl2N3O2
KIN02103528
5-CHLORO-N-[(1-ETHYLPYRROLIDIN-2-YL)METHYL]-4-HYDROXY-2-METHOXY-BENZAMIDE
CAS:28626-33-7
KIN02167533
5-Chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-hydr
5-CHLORO-N-[(1-ETHYLPYRROLIDIN-2-YL)METHYL]-4-HYDROXY-2-METHOXY-BENZAMIDE HCL
CAS:28478-48-0
Formula: C15H21ClN2O3.ClH
KIN02166411
5-CHLORO-N-[(1-ETHYLPYRROLIDIN-2-YL)METHYL]-PENTANAMIDE
CAS:1039946-85-4
Formula: C12H23ClN2O
KIN05082819
5-CHLORO-N-[(1-ETHYLPYRROLIDIN-3-YL)METHYL]-PENTANAMIDE
CAS:1183951-24-7
Formula: C12H23ClN2O
KIN05309618
5-CHLORO-N-[(1-METHYLPYRROLIDINE-3-YL)METHYL]-4-AMINO-QUINAZOLINE
CAS:2149-24-8
KIN01063633
5-CHLORO-N-[(1S)-2,2,2-TRIFLUORO-1-METHYLETHYL]-6-(2,4,6-TRIFLUOROPHENYL)-[1,2,4]-TRIAZOLO[1,5-A]PYRIMIDIN-7-YLAMINE
CAS:249648-16-6
Formula: C14H8ClF6N5
KIN03450279
5-CHLORO-N-[(1S)-2-ETHYL-1-(HYDROXYMETHYL)BUTYL]-2-THIOPHENESULFONAMIDE
CAS:443989-01-3
Formula: C11H18ClNO3S2
KIN03003411
5-CHLORO-N-[(1S,2R)-2-HYDROXY-3-(METHOXYMETHYLAMINO)-3-OXO-1-BENZYLPROPYL]INDOL-2-CARBOXAMIDE
CAS:186392-43-8
Formula: [C21H22ClN3O4
KIN03381501
5-CHLORO-N-[(2-CHLORO-3,6-DIFLUOROPHENYL)METHYL]-1,3-DIMETHYLPYRAZOL-4-SULFONAMIDE
CAS:4075-55-2
Formula: C5H9NO2
KIN01100553
5-CHLORO-N-[(2-CHLOROPHENYL)METHYL]PYRIDIN-2-YLAMINE
CAS:1040007-52-0
Formula: C12H10Cl2N2
KIN05084034
5-CHLORO-N-[(2-CHLOROPHENYL)METHYLENE]PYRIDIN-2-YLAMINE
CAS:329937-32-8
KIN03630078
5-CHLORO-N-[(2-METHOXY-PHENYL) METHYL]PYRIDIN-2-YLAMINE
CAS:1036564-58-5
Formula: C13H13ClN2O
KIN05071745
5-CHLORO-N-[(2-METHYLPYRIMIDIN-4-YL)METHYL]-PENTANAMIDE
CAS:1184251-27-1
Formula: C11H16ClN3O
KIN05312719
5-CHLORO-N-[(3-ETHOXY-PHENYL) METHYL]PYRIDIN-2-YLAMINE
CAS:1183318-62-8
Formula: C14H15ClN2O
KIN05302878
5-CHLORO-N-[(3-METHOXY-PHENYL) METHYL]PYRIDIN-2-YLAMINE
CAS:1182896-56-5
Formula: C13H13ClN2O
KIN05298190
5-CHLORO-N-[(3-NITROPHENYL)METHYLENE]-2-BENZO[D]OXAZOLAMINE
CAS:114424-80-5
Formula: C14H8ClN3O3
KIN03130683
5-CHLORO-N-[(4-CHLOROPHENYL)METHYL]-2-HYDROXY-BENZAMIDE
CAS:13156-83-7
Formula: C14H11Cl2NO2
KIN02015715
5-CHLORO-N-[(4-CHLOROPHENYL)METHYL]PYRIDIN-2-YLAMINE
CAS:1007798-23-3
Formula: C12H10Cl2N2
KIN05015022
5-CHLORO-N-[(4-CHLOROPHENYL)METHYLENE]PYRIDIN-2-YLAMINE
CAS:329937-06-6
KIN03630077
5-CHLORO-N-[(4-ETHENYLPHENYL)METHYL]-PENTANAMIDE
CAS:184360-82-5
Formula: C14H18ClNO
KIN03376657
5-CHLORO-N-[(4-ETHOXY-PHENYL) METHYLENE]PYRIDIN-2-YLAMINE
CAS:329937-34-0
KIN03618689
5-CHLORO-N-[(4-FLUOROPHENYL)METHYLENE]PYRIDIN-2-YLAMINE
CAS:329937-02-2
KIN03630076
5-CHLORO-N-[(4-METHOXY-PHENYL) METHYLENE]-2-BENZO[D]OXAZOLAMINE
CAS:16779-24-1
Formula: C15H11ClN2O2
KIN02054844
5-CHLORO-N-[(4-METHYLPHENYL)METHYL]PYRIDIN-2-YLAMINE
CAS:1036514-26-7
Formula: C13H13ClN2
KIN05071078
5-CHLORO-N-[(4-METHYLPHENYL)METHYLENE]PYRIDIN-2-YLAMINE
CAS:329935-84-4
KIN03630075
5-CHLORO-N-[(4-NITROPHENYL)METHYL]-2-THIOPHENEMETHANAMINE
CAS:1184463-56-6
Formula: C12H11ClN2O2S
KIN05314335
5-CHLORO-N-[(4-NITROPHENYL)METHYL]PYRIDIN-2-YLAMINE
CAS:1184827-65-3
Formula: C12H10ClN3O2
KIN05317810
5-CHLORO-N-[(4-NITROPHENYL)METHYLENE]PYRIDIN-2-YLAMINE
CAS:383168-63-6
KIN03641243
5-CHLORO-N-[(DIMETHYLAMINO)METHYLENE]-2-METHYLBENZAMIDE
CAS:1028252-12-1
Formula: C11H13ClN2O
KIN05063597
5-CHLORO-N-[(Z)-(2-IMINO-4-METHYL-THIAZOL-5-YLIDENE)AMINO]-2,4-DIMETHOXY-ANILINE
CAS:33175-14-3
Formula: C12H13ClN4O2S
KIN02203247
5-CHLORO-N-[[(2-CHLORO-4-IODO-PHENYL)AMINO]THIOXOMETHYL]-2-METHOXY-BENZAMIDE
CAS:380313-45-1
Formula: C15H11Cl2IN2O2S
KIN03548379
5-CHLORO-N-[[(2-IODO-PHENYL)AMINO]THIOXOMETHYL]-2-METHOXY-BENZAMIDE
CAS:445418-64-4
Formula: C15H12ClIN2O2S
KIN03587913
5-CHLORO-N-[[(4-IODO-2-METHYLPHENYL)AMINO]THIOXOMETHYL]-2-METHOXY-BENZAMIDE
CAS:431941-46-7
Formula: C16H14ClIN2O2S
KIN03578258
5-CHLORO-N-[[(5-CHLOROPYRIMIDIN-2-YL)AMINO]PHENYLPHOSPHORYL]PYRIMIDIN-2-YLAMINE
CAS:5455-87-8
Formula: C14H12N2O3
KIN01132457
5-CHLORO-N-[[(5S)-2-OXO-3-[4-(3-OXO-MORPHOLIN-4-YL)PHENYL]-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE DIHYDRATE
CAS:366789-02-8
Formula: C19H18ClN3O5S
KIN03003246
5-CHLORO-N-[[(5S)-3-[3-FLUORO-4-(3-OXO-MORPHOLIN-4-YL)PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482308-00-9
Formula: C19H17ClFN3O5S
KIN03609013
5-CHLORO-N-[[2-(DIFLUOROMETHOXY) -PHENYL]METHYL]-PENTANAMIDE
CAS:1098347-56-8
KIN05162361
5-CHLORO-N-[[2-(TRIFLUOROMETHOXY) -PHENYL]METHYL]-PENTANAMIDE
CAS:1097823-41-0
KIN05161647
5-CHLORO-N-[[2-OXO-3-[4-(3-OXO-MORPHOLIN-4-YL) -3-(TRIFLUOROMETHYL)PHENYL]-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-49-0
Formula: C20H17ClF3N3O5S
KIN03609006
5-CHLORO-N-[[2-OXO-3-[4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-32-1
Formula: C19H18ClN3O5S
KIN03609004
5-CHLORO-N-[[3-[3,5-DIMETHYL-4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-54-7
Formula: C21H22ClN3O5S
KIN03609009
5-CHLORO-N-[[3-[3-CHLORO-4-(2-METHYL-3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-59-2
Formula: C20H19Cl2N3O5S
KIN03609011
5-CHLORO-N-[[3-[3-CHLORO-4-(2-METHYL-5-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-60-5
Formula: C20H19Cl2N3O5S
KIN03609012
5-CHLORO-N-[[3-[3-CHLORO-4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-48-9
Formula: C19H17Cl2N3O5S
KIN03609005
5-CHLORO-N-[[3-[3-CYANO-4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-51-4
Formula: C20H17ClN4O5S
KIN03609008
5-CHLORO-N-[[3-[3-FLUORO-4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-30-9
Formula: C19H17ClFN3O5S
KIN03609003
5-CHLORO-N-[[3-[3-METHYL-4-(3-OXO-MORPHOLIN-4-YL) PHENYL]-2-OXO-5-OXAZOLIDINYL]METHYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-50-3
Formula: C20H20ClN3O5S
KIN03609007
5-CHLORO-N-[[4-(TRIFLUOROMETHOXY) -PHENYL]METHYL]-PENTANAMIDE
CAS:1099158-52-7
KIN05163855
5-CHLORO-N-[1-(1H-PYRAZOL-3-YL)ETHYL]-8-QUINOLINAMINE
CAS:1178114-29-8
Formula: C14H13ClN4
KIN05273311
5-CHLORO-N-[1-(2,4-DIFLUOROPHENYL)ETHYL]-2-IODO-BENZAMIDE
CAS:1100166-76-4
Formula: C15H11ClF2INO
KIN05166357
5-CHLORO-N-[1-(2-FLUOROPHENYL)ETHYL]-2-FURANMETHANAMINE
CAS:1179117-60-2
Formula: C13H13ClFNO
KIN05282372
5-CHLORO-N-[1-(2-FLUOROPHENYL)ETHYL]-2-HYDROXY-BENZAMIDE
CAS:1180582-00-6
Formula: C15H13ClFNO2
KIN05289986
5-CHLORO-N-[1-(2-FLUOROPHENYL)ETHYL]-PENTANAMIDE
CAS:1098345-00-6
Formula: C13H17ClFNO
KIN05162315
5-CHLORO-N-[1-(2-METHYLPHENYL)ETHYL]-2-FURANMETHANAMINE
CAS:1179035-65-4
Formula: C14H16ClNO
KIN05281497
5-CHLORO-N-[1-(3-CHLOROPHENYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1184034-29-4
Formula: C13H12Cl2N2
KIN05310542
5-CHLORO-N-[1-(4-ETHYLPHENYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1178473-84-1
Formula: C15H17ClN2
KIN05277269
5-CHLORO-N-[1-(4-IODO-PHENYL)ETHYL]-4-BENZO[D]THIAZOLAMINE
CAS:1157243-44-1
Formula: C15H12ClIN2S
KIN05244850
5-CHLORO-N-[1-(4-METHYLPHENYL)ETHYL]-2-FURANMETHANAMINE
CAS:1178273-10-3
Formula: C14H16ClNO
KIN05274991
5-CHLORO-N-[1-(BENZYL)-PYRROLIDIN-3-YL]-PENTANAMIDE
CAS:1153341-44-6
Formula: C16H23ClN2O
KIN05208680
5-CHLORO-N-[1-(FURAN-2-YL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1154262-60-8
Formula: C11H11ClN2O
KIN05215971
5-CHLORO-N-[1-(PYRIDIN-2-YL)ETHYL]-PENTANAMIDE
CAS:1156126-03-2
Formula: C12H17ClN2O
KIN05229917
5-CHLORO-N-[1-(PYRIDIN-3-YL)ETHYL]-PENTANAMIDE
CAS:1154139-00-0
Formula: C12H17ClN2O
KIN05214611
5-CHLORO-N-[1-(PYRIDIN-4-YL)ETHYL]-PENTANAMIDE
CAS:1154988-55-2
Formula: C12H17ClN2O
KIN05222067
5-CHLORO-N-[1-(THIOPHEN-2-YL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1153974-02-7
Formula: C11H11ClN2S
KIN05213778
5-CHLORO-N-[1-[4-(2-METHYLPROPYL)-PHENYL]-ETHYL]-PENTANAMIDE
CAS:1156614-43-5
Formula: C17H26ClNO
KIN05235924
5-CHLORO-N-[1-[5-[[[6-(1,1-DIMETHYLETHYL)-4-PYRIMIDINYL]AMINO]CARBONYL]-2-THIAZOLYL]ETHYL]-6-(1H-IMIDAZOL-2-YL)-4-PYRIMIDINECARBOXAMIDE
CAS:1096361-65-7
Formula: C22 H22 ClN9 O2 S
KIN05154992
5-CHLORO-N-[1-[5-[[[6-(1,1-DIMETHYLETHYL)-4-PYRIMIDINYL]AMINO]CARBONYL]-2-THIAZOLYL]ETHYL]-6-(4-PYRIDINYLAMINO)-4-PYRIMIDINECARBOXAMIDE
CAS:1096361-66-8
Formula: C22 H21 Cl2 N9 O2 S
KIN05154993
5-CHLORO-N-[1-[5-[[[6-(1,1-DIMETHYLETHYL)-4-PYRIMIDINYL]AMINO]CARBONYL]-2-THIAZOLYL]ETHYL]-6-[(2-HYDROXYETHYL)AMINO]-4-PYRIMIDINECARBOXAMIDE
CAS:1096361-44-2
Formula: C23 H18 ClF4 N5 O3 S
KIN05154991
5-CHLORO-N-[2,6-DIHYDRO-2-(2-METHYLPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450340-23-5
Formula: C20H18ClN3O2S
KIN03591298
5-CHLORO-N-[2,6-DIHYDRO-2-(2-METHYLPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-68-9
Formula: C19H15ClN4O3S
KIN03559554
5-CHLORO-N-[2,6-DIHYDRO-2-(2-METHYLPHENYL)-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:449786-13-4
Formula: C20H18ClN3O4S
KIN03590569
5-CHLORO-N-[2,6-DIHYDRO-2-(2-METHYLPHENYL)-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:449785-99-3
Formula: C19H15ClN4O5S
KIN03590562
5-CHLORO-N-[2,6-DIHYDRO-2-(3-METHYLPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:361167-02-4
Formula: C20H18ClN3O2S
KIN03536731
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHOXY-PHENYL) -4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:391866-46-9
Formula: C20H18ClN3O3S
KIN03556785
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHOXY-PHENYL) -4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:392255-81-1
Formula: C19H15ClN4O4S
KIN03557163
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHOXY-PHENYL) -5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450338-09-7
Formula: C20H18ClN3O5S
KIN03591085
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHOXY-PHENYL) -5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450338-02-0
Formula: C19H15ClN4O6S
KIN03591078
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHYLPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450340-35-9
Formula: C20H18ClN3O2S
KIN03591310
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHYLPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-70-3
Formula: C19H15ClN4O3S
KIN03559555
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHYLPHENYL)-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:449787-85-3
Formula: C20H18ClN3O4S
KIN03590655
5-CHLORO-N-[2,6-DIHYDRO-2-(4-METHYLPHENYL)-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:449787-70-6
Formula: C19H15ClN4O5S
KIN03590647
5-CHLORO-N-[2,6-DIHYDRO-2-(4-NITROPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450341-41-0
Formula: C19H15ClN4O4S
KIN03591414
5-CHLORO-N-[2,6-DIHYDRO-2-(4-NITROPHENYL)-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-71-4
Formula: C18H12ClN5O5S
KIN03559556
5-CHLORO-N-[2,6-DIHYDRO-2-(4-NITROPHENYL)-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450336-49-9
Formula: C19H15ClN4O6S
KIN03590926
5-CHLORO-N-[2,6-DIHYDRO-2-(4-PHENOXY-PHENYL) -4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-76-9
Formula: C24H17ClN4O4S
KIN03559559
5-CHLORO-N-[2-(1-CYCLOHEXEN-1-YL) ETHYL]-2-FURANMETHANAMINE
CAS:1183891-11-3
Formula: C13H18ClNO
KIN05308964
5-CHLORO-N-[2-(1-CYCLOHEXEN-1-YL) ETHYL]-PENTANAMIDE
CAS:1097821-22-1
KIN05161627
5-CHLORO-N-[2-(1-METHYLETHYL)PHENYL]-2-FURANMETHANAMINE
CAS:1178838-36-2
Formula: C14H16ClNO
KIN05280346
5-CHLORO-N-[2-(1H-IMIDAZOL-1-YL)ETHYL]INDOL-2-CARBOXAMIDE
CAS:106876-25-9
KIN03079317
5-CHLORO-N-[2-(1H-PYRAZOL-1-YL)PHENYL]-PENTANAMIDE
CAS:1153183-33-5
Formula: C14H16ClN3O
KIN05206321
5-CHLORO-N-[2-(2,3-DICHLOROPHENYL)-5-BENZO[D]OXAZOLYL]-2-IODO-BENZAMIDE
CAS:328252-34-2
Formula: C20H10Cl3IN2O2
KIN03498539
5-CHLORO-N-[2-(2,3-DIMETHYLPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450344-23-7
Formula: C21H20ClN3O2S
KIN03591579
5-CHLORO-N-[2-(2,3-DIMETHYLPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450344-16-8
Formula: C20H17ClN4O3S
KIN03591572
5-CHLORO-N-[2-(2,3-DIMETHYLPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450338-97-3
Formula: C21H20ClN3O4S
KIN03591172
5-CHLORO-N-[2-(2,3-DIMETHYLPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450338-90-6
Formula: C20H17ClN4O5S
KIN03591165
5-CHLORO-N-[2-(2,4-DICHLORO-6-METHYLPHENOXY) ETHYL]-N-(BENZYL)-PYRIDIN-3-CARBOXAMIDE
CAS:106876-93-1
KIN03079377
5-CHLORO-N-[2-(2,4-DICHLORO-6-METHYLPHENOXY) ETHYL]-N-ETHYLPYRIDIN-3-CARBOXAMIDE
CAS:106876-89-5
KIN03079373
5-CHLORO-N-[2-(2,4-DICHLORO-6-METHYLPHENOXY) ETHYL]-N-PROPYLPYRIDIN-3-CARBOXAMIDE
CAS:106876-66-8
KIN03079350
5-CHLORO-N-[2-(2,4-DIMETHYLPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450344-61-3
Formula: C21H20ClN3O2S
KIN03591617
5-CHLORO-N-[2-(2,4-DIMETHYLPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-72-5
Formula: C20H17ClN4O3S
KIN03559557
5-CHLORO-N-[2-(2,4-DIMETHYLPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450339-78-3
Formula: C21H20ClN3O4S
KIN03591253
5-CHLORO-N-[2-(2,4-DIMETHYLPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450339-71-6
Formula: C20H17ClN4O5S
KIN03591246
5-CHLORO-N-[2-(2,6-DICHLOROPHENOXY) ETHYL]-N-(BENZYL)-PYRIDIN-3-CARBOXAMIDE
CAS:106876-92-0
KIN03079376
5-CHLORO-N-[2-(2,6-DICHLOROPHENOXY) ETHYL]-N-ETHYLPYRIDIN-3-CARBOXAMIDE
CAS:106876-90-8
KIN03079374
5-CHLORO-N-[2-(2,6-DICHLOROPHENOXY) ETHYL]-N-PROPYLPYRIDIN-3-CARBOXAMIDE
CAS:106876-70-4
KIN03079354
5-CHLORO-N-[2-(2-CHLORO-4-FLUOROPHENYL)-5-BENZO[D]OXAZOLYL]-2-IODO-BENZAMIDE
CAS:328252-03-5
Formula: C20H10Cl2FIN2O2
KIN03498536
5-CHLORO-N-[2-(2-FLUOROPHENYL)ETHYL]-2-IODO-BENZAMIDE
CAS:1100176-17-7
Formula: C15H12ClFINO
KIN05166377
5-CHLORO-N-[2-(2-FLUOROPHENYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1041538-90-2
Formula: C13H12ClFN2
KIN05087473
5-CHLORO-N-[2-(3,4-DIMETHYLPHENYL)-2H-BENZOTRIAZOL-5-YL]-2-IODO-BENZAMIDE
CAS:372084-49-6
Formula: C21H16ClIN4O
KIN03543577
5-CHLORO-N-[2-(3,5-DIMETHYLPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:396721-74-7
Formula: C20H17ClN4O3S
KIN03559558
5-CHLORO-N-[2-(3-CHLOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450340-94-0
Formula: C19H15Cl2N3O2S
KIN03591369
5-CHLORO-N-[2-(3-CHLOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:496775-54-3
Formula: C18H12Cl2N4O3S
KIN03614848
5-CHLORO-N-[2-(3-FLUOROPHENYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1153537-33-7
Formula: C13H12ClFN2
KIN05211401
5-CHLORO-N-[2-(4-CHLOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:361166-98-5
Formula: C19H15Cl2N3O2S
KIN03536727
5-CHLORO-N-[2-(4-CHLOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450341-26-1
Formula: C18H12Cl2N4O3S
KIN03591401
5-CHLORO-N-[2-(4-CHLOROPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:449791-37-1
Formula: C19H15Cl2N3O4S
KIN03590792
5-CHLORO-N-[2-(4-CHLOROPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:449791-17-7
Formula: C18H12Cl2N4O5S
KIN03590783
5-CHLORO-N-[2-(4-FLUOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450343-20-1
Formula: C19H15ClFN3O2S
KIN03591477
5-CHLORO-N-[2-(4-FLUOROPHENYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450343-13-2
Formula: C18H12ClFN4O3S
KIN03591470
5-CHLORO-N-[2-(4-FLUOROPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:450337-23-2
Formula: C19H15ClFN3O4S
KIN03590999
5-CHLORO-N-[2-(4-FLUOROPHENYL)-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450337-16-3
Formula: C18H12ClFN4O5S
KIN03590992
5-CHLORO-N-[2-(4-FLUOROPHENYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1041576-62-8
Formula: C13H12ClFN2
KIN05087992
5-CHLORO-N-[2-(4-IODO-PHENYL)-5-BENZO[D]OXAZOLYL]-2-METHOXY-BENZAMIDE
CAS:329196-67-0
Formula: C21H14ClIN2O3
KIN03499924
5-CHLORO-N-[2-(4-IODO-PHENYL)ETHYL]-2-METHOXY-BENZAMIDE
CAS:254974-15-7
Formula: C16H15ClINO2
KIN03630074
5-CHLORO-N-[2-(4-METHOXY-PHENYL) ETHYL]PYRIDIN-2-YLAMINE
CAS:1040015-29-9
Formula: C14H15ClN2O
KIN05084129
5-CHLORO-N-[2-(BENZYL)PHENYL]-2-FURANMETHANAMINE
CAS:1183044-87-2
Formula: C18H16ClNO
KIN05299845
5-CHLORO-N-[2-(BENZYL)PHENYL]-2-THIOPHENECARBOXAMIDE
CAS:1180231-40-6
Formula: C18H14ClNOS
KIN05289519
5-CHLORO-N-[2-(BENZYL)PHENYL]-2-THIOPHENEMETHANAMINE
CAS:1040048-02-9
Formula: C18H16ClNS
KIN05084643
5-CHLORO-N-[2-(BENZYL)PHENYL]-PENTANAMIDE
CAS:1038977-94-4
Formula: C18H20ClNO
KIN05078443
5-CHLORO-N-[2-(CYANOMETHYL)-4-METHOXY-PHENYL]PENTANAMIDE
CAS:109049-83-4
Formula: C14H17ClN2O2
KIN03092954
5-CHLORO-N-[2-(CYCLOHEXYLAMINO) -1-(4-METHOXY-PHENYL)-2-OXOETHYL]-N-(2-FLUOROPHENYL)-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:478483-19-1
Formula: C32H32ClFN4O3
KIN03606852
5-CHLORO-N-[2-(CYCLOHEXYLAMINO) -1-(4-METHOXY-PHENYL)-2-OXOETHYL]-N-(4-FLUOROPHENYL)-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXAMIDE
CAS:478483-17-9
Formula: C32H32ClFN4O3
KIN03606850
5-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-2-METHOXY-4-NITRO-BENZAMIDE
CAS:22459-75-2
Formula: C14H20ClN3O4
KIN02110859
5-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-2-METHOXY-BENZAMIDE HCL
CAS:52423-55-9
Formula: C14H21ClN2O2.ClH
KIN02320990
5-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-4-[[(DIMETHYLAMINO)METHYLENE]AMINO]-2-METHOXY-BENZAMIDE 2HCL
CAS:114614-58-3
KIN03132095
5-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-4-[[(DIMETHYLAMINO)METHYLENE]AMINO]-2-METHOXY-BENZENECARBOXIMIDOYL CHLORIDE HCL
CAS:114614-59-4
KIN03132096
5-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-4-[[(DIMETHYLAMINO)METHYLENE]AMINO]-N',2-DIMETHOXY-BENZIMIDAMIDE
CAS:114614-60-7
KIN03132097
5-CHLORO-N-[2-(DIFLUOROMETHOXY) PHENYL]-PENTANAMIDE
CAS:1094341-31-7
Formula: C12H14ClF2NO2
KIN05139245
5-CHLORO-N-[2-(DIMETHYLAMINO)-PYRIDIN-3-YL]-PENTANAMIDE
CAS:1153182-54-7
Formula: C12H18ClN3O
KIN05206304
5-CHLORO-N-[2-(DIMETHYLAMINO)ETHYL]-2-HYDROXY-BENZAMIDE
CAS:1019403-61-2
Formula: C11H15ClN2O2
KIN05043021
5-CHLORO-N-[2-(DIMETHYLAMINO)ETHYL]-4-ACRIDINECARBOXAMIDE
CAS:106626-74-8
Formula: C18H18ClN3O
KIN03077503
5-CHLORO-N-[2-(ETHENYLOXY) ETHYL]-2-THIOPHENEMETHANAMINE
CAS:333432-90-9
Formula: C9H12ClNOS
KIN03630073
5-CHLORO-N-[2-(ETHYLSULFONYL)ETHYL]-2-FLUORO-ANILINE
CAS:1157436-60-6
Formula: C10H13ClFNO2S
KIN05246552
5-CHLORO-N-[2-(FURAN-2-YL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1178335-13-1
Formula: C11H11ClN2O
KIN05275728
5-CHLORO-N-[2-(METHYLSULFONYL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1183878-19-4
Formula: C8H11ClN2O2S
KIN05308833
5-CHLORO-N-[2-(METHYLSULFONYL)PHENYL]-2-FURANMETHANAMINE
CAS:1178313-46-6
Formula: C12H12ClNO3S
KIN05275468
5-CHLORO-N-[2-(METHYLSULFONYL)PHENYL]-PENTANAMIDE
CAS:1094530-22-9
Formula: C12H16ClNO3S
KIN05142425
5-CHLORO-N-[2-(METHYLTHIO)PHENYL]-3-NITROPYRIDIN-2-YLAMINE
CAS:3602-09-3
Formula: C25H38O8
KIN01092369
5-CHLORO-N-[2-(PHENYLTHIO)ETHYL]PYRIDIN-2-YLAMINE
CAS:1183634-18-5
Formula: C13H13ClN2S
KIN05306243
5-CHLORO-N-[2-(PHENYLTHIO)PHENYL]-2-FURANCARBOXAMIDE
CAS:1089992-27-7
Formula: C17H12ClNO2S
KIN05129708
5-CHLORO-N-[2-(PHENYLTHIO)PHENYL]-PENTANAMIDE
CAS:1098358-21-4
Formula: C17H18ClNOS
KIN05162632
5-CHLORO-N-[2-(PIPERAZIN-1-YL)ETHYL]-2-FURANCARBOXAMIDE
CAS:1153259-23-4
Formula: C11H16ClN3O2
KIN05207404
5-CHLORO-N-[2-(PYRROLIDIN-1-YL)PHENYL]-PENTANAMIDE
CAS:1154234-57-7
Formula: C15H21ClN2O
KIN05215683
5-CHLORO-N-[2-(TERT-BUTYL)-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:391866-55-0
Formula: C17H20ClN3O2S
KIN03556794
5-CHLORO-N-[2-(TERT-BUTYL)-PHENYL]-2-IODO-BENZAMIDE
CAS:1100309-78-1
Formula: C17H17ClINO
KIN05166578
5-CHLORO-N-[2-(TERT-BUTYL)CYCLOHEXYL]-2-FLUORO-ANILINE
CAS:1156853-09-6
Formula: C16H23ClFN
KIN05239197
5-CHLORO-N-[2-(TERT-BUTYL)CYCLOHEXYL]-2-METHOXY-ANILINE
CAS:1036498-00-6
Formula: C17H26ClNO
KIN05070895
5-CHLORO-N-[2-(TERT-BUTYL)PHENYL]-2-FURANMETHANAMINE
CAS:1184502-63-3
Formula: C15H18ClNO
KIN05314752
5-CHLORO-N-[2-(TERT-BUTYL)PHENYL]-2-THIOPHENECARBOXAMIDE
CAS:1181989-08-1
Formula: C15H16ClNOS
KIN05295556
5-CHLORO-N-[2-(TERT-BUTYL)PHENYL]-2-THIOPHENEMETHANAMINE
CAS:1152885-58-9
Formula: C15H18ClNS
KIN05202556
5-CHLORO-N-[2-(TERT-BUTYL)PHENYL]-PENTANAMIDE
CAS:1156619-63-4
Formula: C15H22ClNO
KIN05235980
5-CHLORO-N-[2-(THIOPHEN-2-YL)ETHYL]-2-BENZO[D]THIAZOLAMINE
CAS:1095059-54-3
KIN05148392
5-CHLORO-N-[2-(THIOPHEN-2-YL)ETHYL]-2-FURANMETHANAMINE
CAS:1178438-60-2
Formula: C11H12ClNOS
KIN05276861
5-CHLORO-N-[2-(THIOPHEN-2-YL)ETHYL]-2-THIOPHENECARBOXAMIDE
CAS:1037915-92-6
KIN05074344
5-CHLORO-N-[2-(THIOPHEN-2-YL)ETHYL]-PENTANAMIDE
CAS:1038969-02-6
KIN05078215
5-CHLORO-N-[2-(THIOPHEN-2-YL)ETHYL]PYRIDIN-2-YLAMINE
CAS:1041559-93-6
Formula: C11H11ClN2S
KIN05087745
5-CHLORO-N-[2-(THIOPHEN-2-YL)PHENYL]-2-FURANMETHANAMINE
CAS:1183984-22-6
Formula: C15H12ClNOS
KIN05309995
5-CHLORO-N-[2-(THIOPHEN-2-YL)PHENYL]-PENTANAMIDE
CAS:1153926-77-2
Formula: C15H16ClNOS
KIN05213285
5-CHLORO-N-[2-(TRIFLUOROMETHOXY) -PHENYL]-2-FURANCARBOXAMIDE
CAS:1090400-28-4
KIN05130139
5-CHLORO-N-[2-(TRIFLUOROMETHOXY) -PHENYL]-2-FURANMETHANAMINE
CAS:1183354-43-9
Formula: C12H9ClF3NO2
KIN05303260
5-CHLORO-N-[2-(TRIFLUOROMETHOXY) -PHENYL]-PENTANAMIDE
CAS:1039948-36-1
KIN05082845
5-CHLORO-N-[2-[(DIFLUOROMETHYL)THIO]PHENYL]-2-IODO-BENZAMIDE
CAS:1100166-88-8
Formula: C14H9ClF2INOS
KIN05166358
5-CHLORO-N-[2-[[(4-IODO-PHENYL)METHYL]METHYLAMINO]-ETHYL]-2-METHOXY-4-(METHYLAMINO)-BENZAMIDE
CAS:125141-02-8
Formula: C19H23ClIN3O2
KIN03187304
5-CHLORO-N-[2-[3-[[[(DIMETHYLAMINO)METHYLENE]AMINO]SULFONYL]-4-ETHYNYLPHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:254974-25-9
Formula: C21H22ClN3O4S
KIN03454452
5-CHLORO-N-[2-[4-[[[(CYCLOHEPTYLAMINO)CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:22363-47-9
Formula: C24H30ClN3O5S
KIN02109970
5-CHLORO-N-[2-[4-[[[(CYCLOHEXYLAMINO) CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-HYDROXY-BENZAMIDE
CAS:57334-90-4
Formula: C22H26ClN3O5S
KIN02398014
5-CHLORO-N-[2-[4-[[[(CYCLOHEXYLAMINO) CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE MONOPOTASSIUM SALT
CAS:52169-36-5
Formula: C23H28ClN3O5S.K
KIN02317234
5-CHLORO-N-[2-[4-[[[(CYCLOHEXYLAMINO) CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE MONOSODIUM SALT
CAS:16931-15-0
Formula: C23H28ClN3O5S.Na
KIN02056465
5-CHLORO-N-[2-[4-[[[(CYCLOHEXYLAMINO) CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE; 5-CHLORO-N-[2-[4-(CYCLOHEXYLCARBAMOYLSULFAMOYL)PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE; 5-CHLORO-N-[2-[4-[[[(CYCLOHEXYLAMINO)CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:10238-21-8
Formula: C23H28ClN3O5S
KIN02003629
Glibenclamide; Glyburide
MFCD00056625
5-CHLORO-N-[2-[4-[[[(CYCLOPENTYLAMINO)CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:29051-59-0
Formula: C22H26ClN3O5S
KIN02170972
5-CHLORO-N-[2-[4-[[[[(2-CHLORO-CYCLOHEXYL) AMINO]THIOXOMETHYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:59478-13-6
Formula: C23H27Cl2N3O4S2
KIN02432082
5-CHLORO-N-[2-[4-[[[[(3-ETHOXY-4-METHYLCYCLOHEXYL) AMINO]CARBONYL]AMINO] SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:59478-57-8
Formula: C26H34ClN3O6S
KIN02432085
5-CHLORO-N-[2-[4-[[[[(3-HYDROXY-CYCLOHEXYL) AMINO]CARBONYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:23074-02-4
Formula: C23H28ClN3O6S
KIN02116499
rac-cis-3-Hydroxy-glyburide
MFCD11978021
5-CHLORO-N-[2-[4-[[[[(4-HYDROXY-CYCLOHEXYL) AMINO]CARBONYL]AMINO]SULFONYL]PHENYL)ETHYL]-2-METHOXY-BENZAMIDE
CAS:23155-00-2
Formula: C23H28ClN3O6S
KIN02117306
4'-Hydroxyglibenclamide
5-CHLORO-N-[2-[4-ETHYNYL-3-[[[(METHYLAMINO)THIOXOMETHYL]AMINO]SULFONYL]PHENYL]-ETHYL]-2-METHOXY-BENZAMIDE
CAS:254973-96-1
Formula: C20H20ClN3O4S2
KIN03454451
5-CHLORO-N-[2-CHLORO-5-[(4-CHLOROPHENYL)SULFONYL]PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:315195-18-7
Formula: C19H11Cl3INO4S
KIN03489916
5-CHLORO-N-[2-HYDROXY-3-[[3-METHYL-4-(3-OXO-(MORPHOLINE-4-YL) )PHENYL]AMINO]PROPYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-16-1
Formula: C19H22ClN3O4S
KIN03609000
5-CHLORO-N-[2-HYDROXY-3-[[4-(3-OXO-(MORPHOLINE-4-YL) )-3-(TRIFLUOROMETHYL)PHENYL]AMINO]PROPYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-15-0
Formula: C19H19ClF3N3O4S
KIN03608999
5-CHLORO-N-[2-MORPHOLIN-4-YLETHYL]PYRIDIN-3-CARBOXAMIDE
CAS:1181210-75-2
Formula: C12H16ClN3O2
KIN05290654
5-CHLORO-N-[2-OXO-2-[(BENZYL)AMINO]-ETHYL]-PENTANAMIDE
CAS:1183702-08-0
Formula: C14H19ClN2O2
KIN05306999
5-CHLORO-N-[2-PIPERIDIN-1-YLPROPYL]PYRIDIN-2-YLAMINE
CAS:1178397-78-8
Formula: C13H20ClN3
KIN05276390
5-CHLORO-N-[2-TERTBUTYL-2,6-DIHYDRO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:450340-10-0
Formula: C16H17ClN4O3S
KIN03591285
5-CHLORO-N-[2-TERTBUTYL-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-METHOXY-BENZAMIDE
CAS:449784-43-4
Formula: C17H20ClN3O4S
KIN03590483
5-CHLORO-N-[2-TERTBUTYL-2,6-DIHYDRO-5,5-DIOXIDO-4H-THIENO[3,4-C]PYRAZOL-3-YL]-2-NITRO-BENZAMIDE
CAS:449784-29-6
Formula: C16H17ClN4O5S
KIN03590475
5-CHLORO-N-[3-(1-METHYLETHYL)PHENYL]-2-FURANMETHANAMINE
CAS:1179206-24-6
Formula: C14H16ClNO
KIN05283298
5-CHLORO-N-[3-(1H-IMIDAZOL-1-YL)-2-METHYLPROPYL]INDOL-2-CARBOXAMIDE
CAS:106876-27-1
KIN03079319
5-CHLORO-N-[3-(1H-IMIDAZOL-1-YL)-PROPYL]INDOL-2-CARBOXAMIDE
CAS:106876-10-2
KIN03079302
5-CHLORO-N-[3-(1H-IMIDAZOL-1-YL)BUTYL]INDOL-2-CARBOXAMIDE
CAS:106876-28-2
KIN03079320
5-CHLORO-N-[3-(1H-PYRAZOL-1-YL)PHENYL]-PENTANAMIDE
CAS:1155500-18-7
Formula: C14H16ClN3O
KIN05225099
5-CHLORO-N-[3-(1H-PYRAZOL-3-YL)PHENYL]-PENTANAMIDE
CAS:1186854-76-1
Formula: C14H16ClN3O
KIN05321765
5-CHLORO-N-[3-(2-CHLOROPHENYL)CYCLOBUTYL]-2-FLUORO-ANILINE
CAS:1156582-46-5
Formula: C16H14Cl2FN
KIN05235475
5-CHLORO-N-[3-(2-CHLOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156083-95-2
Formula: C17H17Cl2NO
KIN05229261
5-CHLORO-N-[3-(2-CHLOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-23-5
Formula: C17H17Cl2N
KIN05232271
5-CHLORO-N-[3-(2-FLUOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156083-60-1
Formula: C17H17ClFNO
KIN05229244
5-CHLORO-N-[3-(2-FLUOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156240-67-3
Formula: C17H17ClFN
KIN05231644
5-CHLORO-N-[3-(2-METHOXY-PHENYL) CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-34-8
Formula: C18H20ClNO
KIN05232275
5-CHLORO-N-[3-(2H-TETRAZOL-5-YL)PHENYL]-PENTANAMIDE
CAS:1155013-22-1
Formula: C12H14ClN5O
KIN05222393
5-CHLORO-N-[3-(3-CHLOROPHENYL)CYCLOBUTYL]-2-FLUORO-ANILINE
CAS:1153093-79-8
Formula: C16H14Cl2FN
KIN05204912
5-CHLORO-N-[3-(3-CHLOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156330-19-6
Formula: C17H17Cl2NO
KIN05233009
5-CHLORO-N-[3-(3-CHLOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156240-97-9
Formula: C17H17Cl2N
KIN05231659
5-CHLORO-N-[3-(3-FLUOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156083-82-7
Formula: C17H17ClFNO
KIN05229254
5-CHLORO-N-[3-(3-FLUOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-44-0
Formula: C17H17ClFN
KIN05232278
5-CHLORO-N-[3-(3-METHOXY-PHENYL) CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-60-0
Formula: C18H20ClNO
KIN05232284
5-CHLORO-N-[3-(4-CHLOROPHENYL)CYCLOBUTYL]-2-FLUORO-ANILINE
CAS:1153097-80-3
Formula: C16H14Cl2FN
KIN05205066
5-CHLORO-N-[3-(4-CHLOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156083-53-2
Formula: C17H17Cl2NO
KIN05229239
5-CHLORO-N-[3-(4-CHLOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-56-4
Formula: C17H17Cl2N
KIN05232283
5-CHLORO-N-[3-(4-CHLOROPHENYL)CYCLOBUTYL]-A-METHYL-2-THIOPHENEMETHANAMINE
CAS:1156965-41-1
Formula: C16H17Cl2NS
KIN05240943
5-CHLORO-N-[3-(4-FLUOROPHENYL)CYCLOBUTYL]-2-METHOXY-ANILINE
CAS:1156083-99-6
Formula: C17H17ClFNO
KIN05229264
5-CHLORO-N-[3-(4-FLUOROPHENYL)CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156240-40-2
Formula: C17H17ClFN
KIN05231633
5-CHLORO-N-[3-(4-METHOXY-PHENYL) CYCLOBUTYL]-2-METHYL-ANILINE
CAS:1156286-39-3
Formula: C18H20ClNO
KIN05232276
5-CHLORO-N-[3-(4-METHYL-1H-IMIDAZOL-1-YL)-PROPYL]INDOL-2-CARBOXAMIDE
CAS:106876-15-7
KIN03079307
5-CHLORO-N-[3-(5-OXAZOLYL) PHENYL]-2-FURANMETHANAMINE
CAS:1179653-36-1
Formula: C14H11ClN2O2
KIN05286110
5-CHLORO-N-[3-(5-OXAZOLYL) PHENYL]-PENTANAMIDE
CAS:1184747-03-2
Formula: C14H15ClN2O2
KIN05317023
5-CHLORO-N-[3-(CYCLOPROPYLAMINO)-PROPYL]-2-METHOXY-BENZAMIDE
CAS:1156833-64-5
Formula: C14H19ClN2O2
KIN05238935
5-CHLORO-N-[3-(DIFLUOROMETHOXY) PHENYL]-PENTANAMIDE
CAS:1153014-49-3
Formula: C12H14ClF2NO2
KIN05203807
5-CHLORO-N-[3-(ETHENYLOXY) -PROPYL]-2-FURANMETHANAMINE
CAS:1178182-30-3
Formula: C10H14ClNO2
KIN05274086
5-CHLORO-N-[3-(METHYLSULFONYL)-PROPYL]PYRIDIN-2-YLAMINE
CAS:1182883-28-8
Formula: C9H13ClN2O2S
KIN05298041
5-CHLORO-N-[3-(METHYLSULFONYL)PHENYL]-2-FURANMETHANAMINE
CAS:1184767-25-6
Formula: C12H12ClNO3S
KIN05317224
5-CHLORO-N-[3-(METHYLSULFONYL)PHENYL]-PENTANAMIDE
CAS:1097823-25-0
Formula: C12H16ClNO3S
KIN05161646
5-CHLORO-N-[3-(PYRROLIDIN-1-YL)PHENYL]-PENTANAMIDE
CAS:1182982-41-7
Formula: C15H21ClN2O
KIN05299131
5-CHLORO-N-[3-(THIAZOL-2-YL)PHENYL]-2-FURANMETHANAMINE
CAS:1183610-80-1
Formula: C14H11ClN2OS
KIN05305993
5-CHLORO-N-[3-(THIAZOL-2-YL)PHENYL]-PENTANAMIDE
CAS:1182905-18-5
Formula: C14H15ClN2OS
KIN05298293
5-CHLORO-N-[3-(TRIFLUOROMETHOXY) -PHENYL]-2-FURANMETHANAMINE
CAS:1183226-55-2
Formula: C12H9ClF3NO2
KIN05301872
5-CHLORO-N-[3-(TRIFLUOROMETHOXY) -PHENYL]-PENTANAMIDE
CAS:1039331-06-0
KIN05079262
5-CHLORO-N-[3-[(5-CHLORO-2-METHOXY-BENZOYL) AMINO]PHENAZIN-2-YL]-2-METHOXY-BENZAMIDE
CAS:108112-57-8
Formula: C28H20Cl2N4O4
KIN03086909
5-CHLORO-N-[3-[(8AR)-HEXAHYDROPYRROLO[1,2-A]PYRAZIN-2(1H)-YL]-4-METHOXY-PHENYL]-3-METHYLBENZO[B]THIOPHEN-2-SULFONAMIDE
CAS:239122-29-3
Formula: C23H26ClN3O3S2
KIN03445375
5-CHLORO-N-[3-[(8AS)-HEXAHYDROPYRROLO[1,2-A]PYRAZIN-2(1H)-YL]-4-METHOXY-PHENYL]-3-METHYLBENZO[B]THIOPHEN-2-SULFONAMIDE
CAS:239122-28-2
Formula: C23H26ClN3O3S2
KIN03445374
5-CHLORO-N-[3-[[3,5-DIMETHYL-4-(3-OXO-(MORPHOLINE-4-YL) )PHENYL]AMINO]-2-HYDROXY-PROPYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-20-7
Formula: C20H24ClN3O4S
KIN03609002
5-CHLORO-N-[3-[[3-CYANO-4-(3-OXO-(MORPHOLINE-4-YL) )PHENYL]AMINO]-2-HYDROXY-PROPYL]-2-THIOPHENECARBOXAMIDE
CAS:482306-17-2
Formula: C19H19ClN4O4S
KIN03609001
5-CHLORO-N-[3-CHLORO-2,6-DINITRO-4-(TRIFLUOROMETHYL)PHENYL]-2-(1,1,2,2-TETRAFLUORO-ETHYL)-PYRIMIDIN-4-YLAMINE POTASSIUM SALT
CAS:112940-08-6
KIN03119338
5-CHLORO-N-[3-CHLORO-4-[(1-CHLORO-NAPHTHALEN-2-YLOXY) ]PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:134336-16-6
Formula: C23H13Cl3INO3
KIN03227810
5-CHLORO-N-[3-CHLORO-4-[(5-CHLORO-QUINOLIN-8-YLOXY) ]PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:156304-49-3
Formula: C22H12Cl3IN2O3
KIN03315119
5-CHLORO-N-[4-(1-CYANO-PROPAN-2-YL)-PHENYL]-PENTANAMIDE
CAS:1156202-41-3
Formula: C15H19ClN2O
KIN05231039
5-CHLORO-N-[4-(1-METHYLETHYL)PHENYL]-2-FURANMETHANAMINE
CAS:1179265-14-5
Formula: C14H16ClNO
KIN05283929
5-CHLORO-N-[4-(1H-IMIDAZOL-1-YL)BUTYL]INDOL-2-CARBOXAMIDE
CAS:106876-18-0
KIN03079310
5-CHLORO-N-[4-(1H-IMIDAZOL-5-YL)PHENYL]-PENTANAMIDE
CAS:1153508-48-5
Formula: C14H16ClN3O
KIN05211018
5-CHLORO-N-[4-(1H-INDOL-3-YL)-THIAZOL-2-YL]-2-IODO-BENZAMIDE
CAS:1100281-93-3
Formula: C18H11ClIN3OS
KIN05166553
5-CHLORO-N-[4-(1H-PYRAZOL-1-YL)PHENYL]-PENTANAMIDE
CAS:1156794-20-5
Formula: C14H16ClN3O
KIN05238414
5-CHLORO-N-[4-(1H-PYRAZOL-3-YL)PHENYL]-PENTANAMIDE
CAS:1155011-40-7
Formula: C14H16ClN3O
KIN05222377
5-CHLORO-N-[4-(2-METHYL-4-OXAZOLYL) PHENYL]-PENTANAMIDE
CAS:1153181-28-2
Formula: C15H17ClN2O2
KIN05206282
5-CHLORO-N-[4-(4-IODO-PHENYL)-THIAZOL-2-YL]-2-NITRO-BENZAMIDE
CAS:330201-23-5
Formula: C16H9ClIN3O3S
KIN03501371
5-CHLORO-N-[4-(4-IODO-PHENYL)-THIAZOL-2-YL]-2-THIOPHENECARBOXAMIDE
CAS:330201-07-5
Formula: C14H8ClIN2OS2
KIN03501370
5-CHLORO-N-[4-(5-OXAZOLYL) PHENYL]-2-FURANMETHANAMINE
CAS:1178087-62-1
Formula: C14H11ClN2O2
KIN05273051
5-CHLORO-N-[4-(5-OXAZOLYL) PHENYL]-PENTANAMIDE
CAS:1178646-14-4
Formula: C14H15ClN2O2
KIN05278249
5-CHLORO-N-[4-(CYANOMETHYL)PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:313494-83-6
Formula: C15H10ClIN2O2
KIN03488029
5-CHLORO-N-[4-(DIFLUOROMETHOXY) -3-FLUOROPHENYL]-PENTANAMIDE
CAS:1182872-92-9
Formula: C12H13ClF3NO2
KIN05297932
5-CHLORO-N-[4-(DIFLUOROMETHOXY) PHENYL]-PENTANAMIDE
CAS:1094370-80-5
Formula: C12H14ClF2NO2
KIN05139818
5-CHLORO-N-[4-(DIMETHYLAMINO)-PYRIDIN-3-YL]-PENTANAMIDE
CAS:1156053-44-9
Formula: C12H18ClN3O
KIN05228818
5-CHLORO-N-[4-(METHYLSULFONYL)PHENYL]-2-FURANMETHANAMINE
CAS:1179946-55-4
Formula: C12H12ClNO3S
KIN05288925
5-CHLORO-N-[4-(METHYLSULFONYL)PHENYL]-PENTANAMIDE
CAS:1039948-66-7
Formula: C12H16ClNO3S
KIN05082851
5-CHLORO-N-[4-(PYRROLIDIN-1-YL)PHENYL]-PENTANAMIDE
CAS:1155015-67-0
Formula: C15H21ClN2O
KIN05222435
5-CHLORO-N-[4-(TERT-BUTYL)-THIAZOL-2-YL]-2-IODO-BENZAMIDE
CAS:1100108-20-0
Formula: C14H14ClIN2OS
KIN05166268
5-CHLORO-N-[4-(TERT-BUTYL)CYCLOHEXYL]-2-FLUORO-ANILINE
CAS:1156335-97-5
Formula: C16H23ClFN
KIN05233211
5-CHLORO-N-[4-(TERT-BUTYL)CYCLOHEXYL]-2-METHOXY-ANILINE
CAS:1040344-06-6
Formula: C17H26ClNO
KIN05086237
5-CHLORO-N-[4-(TERT-BUTYL)PHENYL]-2-FURANMETHANAMINE
CAS:1183634-94-7
Formula: C15H18ClNO
KIN05306252
5-CHLORO-N-[4-(TERT-BUTYL)PHENYL]-2-THIOPHENECARBOXAMIDE
CAS:1003739-80-7
Formula: C15H16ClNOS
KIN05008648
5-CHLORO-N-[4-(TERT-BUTYL)PHENYL]-2-THIOPHENEMETHANAMINE
CAS:1039988-65-2
Formula: C15H18ClNS
KIN05083796
5-CHLORO-N-[4-(TERT-BUTYL)PHENYL]-PENTANAMIDE
CAS:1039947-83-5
Formula: C15H22ClNO
KIN05082840
5-CHLORO-N-[4-(THIAZOL-2-YL)PHENYL]-2-FURANMETHANAMINE
CAS:1184357-19-4
Formula: C14H11ClN2OS
KIN05313261
5-CHLORO-N-[4-(THIAZOL-2-YL)PHENYL]-PENTANAMIDE
CAS:1179608-76-4
Formula: C14H15ClN2OS
KIN05285590
5-CHLORO-N-[4-(TRIFLUOROMETHOXY) -PHENYL]-2-FURANMETHANAMINE
CAS:1182814-43-2
Formula: C12H9ClF3NO2
KIN05297642
5-CHLORO-N-[4-(TRIFLUOROMETHOXY) -PHENYL]-PENTANAMIDE
CAS:1038977-78-4
KIN05078438
5-CHLORO-N-[4-(TRIFLUOROMETHOXY) PHENYL]-1,2,3-THIADIAZOL-4-METHANAMINE
CAS:339010-34-3
Formula: C10H7ClF3N3OS
KIN03511737
5-CHLORO-N-[4-[(1-OXO-PROPYL) AMINO]PHENYL]-PENTANAMIDE
CAS:1153504-19-8
Formula: C14H19ClN2O2
KIN05210944
5-CHLORO-N-[4-[(8AS)-HEXAHYDROPYRROLO[1,2-A]PYRAZIN-2(1H)-YL]-QUINOLIN-6-YL]-3-METHYLBENZO[B]THIOPHEN-2-SULFONAMIDE
CAS:389622-95-1
Formula: C25H25ClN4O2S2
KIN03555585
5-CHLORO-N-[4-[(8AS)-HEXAHYDROPYRROLO[1,2-A]PYRAZIN-2(1H)-YL]-QUINOLIN-6-YL]-3-METHYLBENZO[B]THIOPHEN-2-SULFONAMIDE HCL
CAS:338796-89-7
Formula: C25H25ClN4O2S2.xClH
KIN03511351
5-CHLORO-N-[4-CHLORO-3-(4-CHLOROBENZOYL)PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:314755-26-5
Formula: C20H11Cl3INO3
KIN03489703
5-CHLORO-N-[4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL]-2-HYDROXY-BENZAMIDE
CAS:900-43-6
Formula: C16H19BrN4S2
KIN01033301
5-CHLORO-N-[4-OXO-2-(PHENYL-IMINO)-3-THIAZOLIDINYL]-1H-INDOL-2-CARBOXAMIDE
CAS:126016-50-0
Formula: C18H13ClN4O2S
KIN03191107
5-CHLORO-N-[4-OXO-2-(PHENYL-IMINO)-3-THIAZOLIDINYL]-3-PHENYL-1H-INDOL-2-CARBOXAMIDE
CAS:121650-04-2
Formula: C24H17ClN4O2S
KIN03170797
5-CHLORO-N-[5-(1H-IMIDAZOL-1-YL)PENTYL]INDOL-2-CARBOXAMIDE
CAS:106876-23-7
KIN03079315
5-CHLORO-N-[5-(2,6-DIMETHYLPYRIDIN-4-YL)-NAPHTHALEN-1-YL]-6-[(8AS)-HEXAHYDROPYRROLO[1,2-A]PYRAZIN-2(1H)-YL]-2,3-DIHYDRO-1H-INDOL-1-CARBOXAMIDE
CAS:256923-96-3
Formula: C33H34ClN5O
KIN03455871
5-CHLORO-N-[5-(TERT-BUTYL)-2-METHOXY-PHENYL]-PENTANAMIDE
CAS:1156617-95-6
Formula: C16H24ClNO2
KIN05235962
5-CHLORO-N-[5-CHLORO-2-[(4-CHLORO-NAPHTHALEN-1-YLOXY) ]PHENYL]-2-HYDROXY-3-IODO-BENZAMIDE
CAS:134919-05-4
Formula: C23H13Cl3INO3
KIN03230427
5-CHLORO-N-[6-(1H-IMIDAZOL-1-YL)HEXYL]INDOL-2-CARBOXAMIDE
CAS:106876-31-7
KIN03079323
5-CHLORO-N-[6-(DIMETHYLAMINO)-PYRIDIN-3-YL]-PENTANAMIDE
CAS:1156965-70-6
Formula: C12H18ClN3O
KIN05240948
5-CHLORO-N-[6-MORPHOLIN-4-YLPYRIDIN-3-YL]-PENTANAMIDE
CAS:1153927-41-3
Formula: C14H20ClN3O2%
KIN05213292
5-CHLORO-N-[7-(METHYLTHIO)-BENZO[1,2-D:4,3-D']BISTHIAZOL-2-YL]-2-NITRO-BENZAMIDE
CAS:477503-55-2
Formula: C16H9ClN4O3S3
KIN03604583
5-CHLORO-N-[7-(METHYLTHIO)-BENZO[1,2-D:4,3-D']BISTHIAZOL-2-YL]-2-THIOPHENECARBOXAMIDE
CAS:477503-38-1
Formula: C14H8ClN3OS4
KIN03604566
5-CHLORO-N-[8-(1H-IMIDAZOL-1-YL)OCTYL]INDOL-2-CARBOXAMIDE
CAS:106876-24-8
KIN03079316
5-CHLORO-N-{1-[4-(DIFLUOROMETHOXY) PHENYL]PROPYL}-6-METHYLPYRIMIDIN-4-YLAMINE
CAS:130339-07-0
Formula: C15H16ClF2N3O
KIN03209436
5-CHLORO-N-1,3,4-THIADIAZOL-2-YLPENTANAMIDE
CAS:1039914-37-8
Formula: C7H10ClN3OS
KIN05082127
5-CHLORO-N-1,3-DITHIETAN-2-YLIDENE-PYRIDIN-2-YLAMINE
CAS:59754-20-0
KIN02436683
5-CHLORO-N-1H-[1,2,4]-TRIAZOL-5-YL-2-FURANCARBOXAMIDE
CAS:1050832-85-3
Formula: C7H5ClN4O2
KIN05099447
5-CHLORO-N-1H-IMIDAZOL-2-YLBENZO[C][1,2,5]THIADIAZOL-4-YLAMINE
CAS:125292-34-4
Formula: C9H6ClN5S
KIN03187917
5-CHLORO-N-1H-INDOL-5-YLPYRAZOLO[1,5-A]PYRIMIDINE-7-YLAMINE
CAS:1180526-62-8
Formula: C14H10ClN5
KIN05289849
5-CHLORO-N-1H-PYRAZOL-4-YL-2-FURANCARBOXAMIDE
CAS:1154948-64-7
Formula: C8H6ClN3O2
KIN05221495
5-CHLORO-N-1H-PYRAZOL-4-YL-2-THIOPHENECARBOXAMIDE
CAS:1154953-18-0
Formula: C8H6ClN3OS
KIN05221577
5-CHLORO-N-1H-PYRAZOL-4-YLPENTANAMIDE
CAS:1156350-10-5
Formula: C8H12ClN3O
KIN05233464
5-CHLORO-N-2-PROPEN-1-YL-2-PROPOXY-BENZENEMETHANAMINE
CAS:1158692-14-8
Formula: C13H18ClNO
KIN05253973
5-CHLORO-N-2-PROPYN-1-YL-2-PYRIDINAMINE
CAS:127542-12-5
Formula: C8H7ClN2
KIN03197767
5-CHLORO-N-2-PYRIDINYL-3-PYRIDINAMINE
CAS:370571-34-9
Formula: C10H8ClN3
KIN03542165
5-CHLORO-N-2H-TETRAZOL-5-YL-2-PYRAZINECARBOXAMIDE
CAS:122509-60-8
KIN03019234
5-CHLORO-N-3-CYCLOHEXEN-1-YL-6-ETHYLPYRIMIDIN-4-YLAMINE
CAS:177842-02-3
KIN03630072
5-CHLORO-N-3-PYRIDINYL-2-PYRIDINAMINE
CAS:370571-22-5
Formula: C10H8ClN3
KIN03542157
5-CHLORO-N-3H-1,2,4-THIADIAZOLO[4,3-A]PYRIMIDIN-3-YLIDENE-PYRIDIN-2-YLAMINE
CAS:40899-22-7
KIN02266721
5-CHLORO-N-ALLYL-2-FURANCARBOXAMIDE
CAS:1197799-95-3
Formula: C8H8ClNO2;C8H8ClNO2
KIN05341418
5-CHLORO-N-ALLYL-2-FURANMETHANAMINE
CAS:1184691-26-6
Formula: C8H10ClNO
KIN05316634
5-CHLORO-N-ALLYL-2-THIOPHENECARBOXAMIDE
CAS:348626-25-5
KIN03525028
5-CHLORO-N-ALLYL-4-(TRIFLUOROMETHYL)-2-THIAZOLAMINE
CAS:134880-94-7
Formula: C7H6ClF3N2S
KIN03230201
5-CHLORO-N-ALLYL-8-QUINOLINECARBOXAMIDE
CAS:1090433-99-0
Formula: C13H11ClN2O
KIN05130323
5-CHLORO-N-ALLYLPENTANAMIDE
CAS:146093-56-3
Formula: C8H14ClNO
KIN03281567
5-CHLORO-N-ALLYLPYRIDIN-2-YLAMINE
CAS:89981-18-0
Formula: C8H9ClN2
KIN02720325
5-CHLORO-N-CYANO-2-HYDROXY-BENZAMIDE
CAS:1099858-92-0
Formula: C8H5ClN2O2
KIN05166029
5-CHLORO-N-CYANO-2-THIOPHENECARBOXAMIDE
CAS:1070967-39-3
Formula: C6H3ClN2OS
KIN05111277
5-CHLORO-N-CYCLOBUTYL-1-PENTANESULFONAMIDE
CAS:213774-37-9
Formula: C9H18ClNO2S
KIN03425581
5-CHLORO-N-CYCLOBUTYL-2-METHOXY-BENZENESULFONAMIDE
CAS:1136632-93-3
Formula: C11H14ClNO3S
KIN05187138
5-CHLORO-N-CYCLOBUTYL-2-NITRO-BENZENESULFONAMIDE
CAS:206119-23-5
Formula: C10H11ClN2O4S
KIN03415862
5-CHLORO-N-CYCLOBUTYL-2H-1,2,4-BENZOTHIADIAZIN-3-YLAMINE 1,1-DIOXIDE
CAS:201224-40-0
Formula: C11H12ClN3O2S
KIN03408677
5-CHLORO-N-CYCLOHEPTYLPYRIDIN-2-AMINE
CAS:1097827-77-4
Formula: C12H17ClN2
KIN05161758
5-CHLORO-N-CYCLOHEXYL-2-(DIFLUOROMETHOXY) -BENZENEMETHANAMINE
CAS:1153025-25-2
Formula: C14H18ClF2NO
KIN05203922
5-CHLORO-N-CYCLOHEXYL-2-FLUORO-ANILINE
CAS:1155046-29-9
Formula: C12H15ClFN
KIN05222761
5-CHLORO-N-CYCLOHEXYL-2-FLUORO-BENZENEMETHANAMINE
CAS:1179142-71-2
Formula: C13H17ClFN
KIN05282640
5-CHLORO-N-CYCLOHEXYL-2-METHOXY-ANILINE
CAS:4477-41-2
Formula: C16H25NO
KIN01108922
5-CHLORO-N-CYCLOHEXYL-2-METHYL-ANILINE
CAS:1041566-11-3
Formula: C13H18ClN
KIN05087837
5-CHLORO-N-CYCLOHEXYL-3-FLUORO-PYRIDIN-2-YLAMINE
CAS:1020253-24-0
Formula: C11H14ClFN2
KIN05049432
5-CHLORO-N-CYCLOHEXYLPYRIDIN-2-YLAMINE
CAS:1036452-04-6
Formula: C11H15ClN2
KIN05070319
5-CHLORO-N-CYCLOOCTYLPYRIDIN-2-AMINE
CAS:1041555-17-2
Formula: C13H19ClN2
KIN05087682
5-CHLORO-N-CYCLOPENTYL-2-(1H-PYRAZOL-1-YL)-ANILINE
CAS:1182816-19-8
Formula: C14H16ClN3
KIN05297658
5-CHLORO-N-CYCLOPENTYL-2-FLUORO-ANILINE
CAS:1156853-14-3
Formula: C11H13ClFN
KIN05239199
5-CHLORO-N-CYCLOPENTYL-2-FLUORO-BENZENEMETHANAMINE
CAS:1178194-88-1
Formula: C12H15ClFN
KIN05274206
5-CHLORO-N-CYCLOPENTYL-2-FLUOROBENZAMIDE
CAS:1089643-72-0
Formula: C12H13ClFNO
KIN05129377
5-CHLORO-N-CYCLOPENTYL-2-FURANCARBOXAMIDE
CAS:1088190-61-7
Formula: C10H12ClNO2
KIN05127653
5-CHLORO-N-CYCLOPENTYL-2-FURANMETHANAMINE
CAS:1183139-40-3
Formula: C10H14ClNO
KIN05300898
5-CHLORO-N-CYCLOPENTYL-2-HYDROXY-BENZAMIDE
CAS:1019363-81-5
Formula: C12H14ClNO2
KIN05042220
5-CHLORO-N-CYCLOPENTYL-2-IODO-ALPHA-BENZAMIDE
CAS:1147663-00-0
Formula: C12H13ClINO
KIN05195712
5-CHLORO-N-CYCLOPENTYL-2-METHOXY-BENZENEMETHANAMINE
CAS:52505-16-5
Formula: C13H18ClNO
KIN02322013
5-CHLORO-N-CYCLOPENTYL-2-METHYL-BENZENAMINE
CAS:1036602-33-1
Formula: C12H16ClN
KIN05072251
5-CHLORO-N-CYCLOPENTYL-2-NITRO-ANILINE
CAS:162141-15-3
KIN03330814
5-CHLORO-N-CYCLOPENTYL-2-THIOPHENEMETHANAMINE
CAS:1020960-87-5
Formula: C10H14ClNS
KIN05051036
5-CHLORO-N-CYCLOPENTYL-3BETA-D-RIBOFURANOSYL-3H-IMIDAZO[4,5-B]PYRIDIN-7-YLAMINE
CAS:113646-62-1
Formula: C16H21ClN4O4
KIN03124865
5-CHLORO-N-CYCLOPENTYL-N-METHYLPENTANAMIDE
CAS:1095028-84-4
KIN05148023
5-CHLORO-N-CYCLOPENTYLPENTANAMIDE
CAS:1039330-10-3
KIN05079246
5-CHLORO-N-CYCLOPENTYLPYRIDIN-2-AMINE
CAS:1036452-49-9
Formula: C10H13ClN2
KIN05070324
5-CHLORO-N-CYCLOPROPYL-2-(HEPTYLOXY) -BENZENEMETHANAMINE
CAS:1095056-67-9
Formula: C17H26ClNO
KIN05148374
5-CHLORO-N-CYCLOPROPYL-2-BENZO[D]THIAZOLAMINE
CAS:1096264-32-2
KIN05153214
5-CHLORO-N-CYCLOPROPYL-2-FLUORO-BENZENEMETHANAMINE
CAS:1152879-38-3
Formula: C10H11ClFN
KIN05202464
5-CHLORO-N-CYCLOPROPYL-2-FLUOROBENZAMIDE
CAS:1090344-80-1
Formula: C10H9ClFNO
KIN05129891
5-CHLORO-N-CYCLOPROPYL-2-FURANCARBOXAMIDE
CAS:1090942-30-5
Formula: C8H8ClNO2
KIN05131780
5-CHLORO-N-CYCLOPROPYL-2-FURANMETHANAMINE
CAS:1183428-61-6
Formula: C8H10ClNO
KIN05304035
5-CHLORO-N-CYCLOPROPYL-2-HYDROXY-BENZAMIDE
CAS:1019402-85-7
Formula: C10H10ClNO2
KIN05043011
5-CHLORO-N-CYCLOPROPYL-2-HYDROXY-N-METHYLBENZAMIDE
CAS:1094909-84-8
Formula: C11H12ClNO2
KIN05147140