Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

5-BROMO-3-(4-METHOXY-PHENYL) -4-ISOXAZOLECARBALDEHYDE
CAS:1188133-50-7
Formula: C11H8BrNO3
KIN05325845
5-BROMO-3-(4-METHOXY-PHENYL) -4-ISOXAZOLEMETHANOL
CAS:1188137-37-2
Formula: C11H10BrNO3
KIN05325873
5-BROMO-3-(4-METHOXY-PHENYL) -BENZO[C]ISOXAZOLE
CAS:728-22-3
Formula: C14H10ClNO2
KIN01027603
5-BROMO-3-(4-METHOXY-PHENYL) -PYRAZIN-2-YLAMINE
CAS:174680-65-0
KIN03356560
5-BROMO-3-(4-METHOXY-PHENYL) ISOXAZOLE
CAS:51726-00-2
Formula: C10H8BrNO2
KIN02310681
5-BROMO-3-(4-METHYL-PIPERAZIN-1-YL)-1H-INDAZOLE
CAS:131633-91-5
Formula: C12H15BrN4
KIN03215024
5-BROMO-3-(4-METHYLPHENYL)-2,4-THIAZOLIDINEDIONE
CAS:331675-83-3
Formula: C10H8BrNO2S
KIN03503812
5-BROMO-3-(4-METHYLPHENYL)-2-THIOIDENE-THIAZOLIDIN-4-ONE
CAS:56921-39-2
Formula: C10H8BrNOS2
KIN02390941
5-BROMO-3-(4-METHYLPHENYL)-4-ISOXAZOLECARBALDEHYDE
CAS:1188092-28-5
Formula: C11H8BrNO2
KIN05325414
5-BROMO-3-(4-METHYLPHENYL)-4-ISOXAZOLEMETHANOL
CAS:1188047-89-3
Formula: C11H10BrNO2
KIN05324930
5-BROMO-3-(4-METHYLPHENYL)-BENZO[C]ISOXAZOLE
CAS:385386-97-0
KIN03553014
5-BROMO-3-(4-METHYLPHENYL)ISOXAZOLE
CAS:51725-95-2
Formula: C10H8BrNO
KIN02310676
5-BROMO-3-(4-NITRO-1,3-BUTADIEN-1-YL)-1H-INDOLE
CAS:253437-70-6
KIN03453506
5-BROMO-3-(4-NITROPHENYL)-4-ISOXAZOLECARBALDEHYDE
CAS:1188161-31-0
Formula: C10H5BrN2O4
KIN05326210
5-BROMO-3-(4-NITROPHENYL)ISOXAZOLE
CAS:142598-84-3
Formula: C9H5BrN2O3
KIN03265723
5-BROMO-3-(4-PROPYLPHENYL)ISOXAZOLE
CAS:51726-05-7
KIN02310686
5-BROMO-3-(4H-[1,2,4]-TRIAZOL-4-YL)-1H-[1,2,4]-TRIAZOLE
CAS:233600-16-3
KIN03630180
5-BROMO-3-(5-CHLORO-2-METHOXY-PHENYL) ISOXAZOLE
CAS:1188189-23-2
Formula: C10H7BrClNO2
KIN05326735
5-BROMO-3-(5-FLUORO-2-METHOXY-PHENYL) ISOXAZOLE
CAS:1188074-61-4
Formula: C10H7BrFNO2
KIN05325206
5-BROMO-3-(ALLYLTHIO)-1H-INDOLE
CAS:1092497-86-3
Formula: C11H10BrNS
KIN05134215
5-BROMO-3-(BENZYL)-1H-INDOLE
CAS:1033196-15-4
Formula: C15H12BrN
KIN05067569
5-BROMO-3-(BENZYL)-2(1H)-ALPHA-PYRAZINONE
CAS:1131005-48-5
Formula: C11H9BrN2O
KIN05182777
5-BROMO-3-(BENZYL)-4(3H)-PYRIMIDINONE
CAS:89185-09-1
Formula: C11H9BrN2O
KIN02708175
5-BROMO-3-(BENZYL)-PYRAZIN-2-YLAMINE
CAS:174680-55-8
Formula: C11H10BrN3
KIN03356551
5-BROMO-3-(BENZYLOXY) -2,4(1H,3H)-PYRIMIDINEDIONE
CAS:18009-42-2
Formula: C11H9BrN2O3
KIN02067894
5-BROMO-3-(BENZYLOXY) -PYRAZIN-2-YLAMINE
CAS:187973-44-0
Formula: C11H10BrN3O
KIN03384121
5-BROMO-3-(BENZYLOXYMETHYL) -IMIDAZOL-4-CARBALDEHYDE
CAS:189014-06-0
Formula: C12H11BrN2O2
KIN03387120
5-BROMO-3-(BUTYLAMINO)-1,3-DIHYDRO-2H-INDOL-2-ONE
CAS:1104835-40-6
Formula: C12H15BrN2O
KIN05169937
5-BROMO-3-(CARBOXYMETHYL) -1H-INDOL-1-YL
CAS:170660-53-4
Formula: [C10H7BrNO2?]
KIN03347127
5-BROMO-3-(CHLOROMETHYL)-1,2,4-OXADIAZOLE
CAS:155742-36-2
KIN03313241
5-BROMO-3-(CHLOROMETHYL)-1H-INDAZOLE
CAS:201483-69-4
Formula: C8H6BrClN2
KIN03409061
5-BROMO-3-(CHLOROMETHYL)-2-METHOXY-PYRIDINE
CAS:351410-54-3
Formula: C7H7BrClNO
KIN03528909
5-BROMO-3-(CHLOROSULFONYL)-2-FLUOROBENZOIC ACID ETHYL ESTER
CAS:1154154-87-6
Formula: C9H7BrClFO4S
KIN05214845
5-BROMO-3-(CHLOROSULFONYL)-2-FLUOROBENZOIC ACID METHYL ESTER
CAS:1155909-81-1
Formula: C8H5BrClFO4S
KIN05227659
5-BROMO-3-(CHLOROSULFONYL)-2-IODO-BENZOIC ACID
CAS:1099186-61-4
Formula: C7H3BrClIO4S
KIN05163920
5-BROMO-3-(CHLOROSULFONYL)-2-IODO-BENZOIC ACID ETHYL ESTER
CAS:1155084-13-1
Formula: C9H7BrClIO4S
KIN05223343
5-BROMO-3-(CYCLOBUTYLMETHOXY) -2-(PYRROLIDINE-1-YL)-PYRAZINE
CAS:1017603-69-8
Formula: C13H18BrN3O
KIN05034645
5-BROMO-3-(CYCLOBUTYLMETHOXY) -PYRAZIN-2-AMINE
CAS:1017603-67-6
Formula: C9H12BrN3O
KIN05034644
5-BROMO-3-(CYCLOPENTYLMETHOXY) -PYRAZIN-2-AMINE
CAS:1017603-72-3
Formula: C10H14BrN3O
KIN05034646
5-BROMO-3-(CYCLOPENTYLOXY) -PYRIDIN-2-YLAMINE
CAS:1065607-82-0
Formula: C10H13BrN2O
KIN05109588
5-BROMO-3-(DIBROMOMETHYL)-1-BENZO[B]THIOPHENE
CAS:109771-37-1
Formula: C9H5Br3S
KIN03097279
5-BROMO-3-(DIBROMOMETHYL)-2-METHOXY-PYRIDINE
CAS:113844-38-5
Formula: C9H12BrNO3
KIN03126425
5-BROMO-3-(DICHLOROMETHYL)-2-NITRO-THIOPHENE
CAS:1093878-17-1
Formula: C5H2BrCl2NO2S
KIN05136162
5-BROMO-3-(DICYCLOPROPYLMETHYL)-6-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:51043-71-1
Formula: C12H15BrN2O2
KIN02300855
5-BROMO-3-(DIFLUOROMETHYL)-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-84-9
Formula: C6H5BrF2N2O2
KIN05021102
5-BROMO-3-(DIFLUOROMETHYL)-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015783-19-3
Formula: C6H4BrClF2N2O
KIN05021115
5-BROMO-3-(DIMETHOXYMETHYL) -2-METHOXY-PYRIDINE
CAS:351410-59-8
KIN03528914
5-BROMO-3-(ETHOXYMETHYL) -1-[4-(4-METHOXY-PHENOXY)-2-BUTYN-1-YL]-2-[(4-METHOXY-PHENOXY)METHYL]INDOLE
CAS:56327-82-3
Formula: C30H30BrNO5
KIN02380991
5-BROMO-3-(ETHOXYMETHYLENE) -1,3-DIHYDRO-1-METHYL-2H-INDOL-2-ONE
CAS:14179-75-0
KIN02029112
5-BROMO-3-(ETHOXYMETHYLENE) -1,3-DIHYDRO-2H-PYRROLO[2,3-B]PYRIDIN-2-ONE
CAS:295327-33-2
Formula: C10H9BrN2O2
KIN03473450
5-BROMO-3-(ETHYLAMINO)-1,3-DIHYDRO-2H-INDOL-2-ONE
CAS:1163304-15-1
Formula: C10H11BrN2O
KIN05259435
5-BROMO-3-(HYDROXYMETHYL) -2(3H)-BENZO[D]OXAZOLONE
CAS:343856-12-2
Formula: C8H6BrNO3
KIN03025845
5-BROMO-3-(METHOXYMETHYL) -1,2,4-THIADIAZOLE
CAS:115443-56-6
KIN03137262
5-BROMO-3-(METHYLAMINO)-2H-INDOL-2-ONE
CAS:1024521-41-2
Formula: C9H7BrN2O
KIN05058536
5-BROMO-3-(METHYLSULFINYL)-1H-INDAZOLE
CAS:201483-68-3
Formula: C8H7BrN2OS
KIN03409060
5-BROMO-3-(METHYLSULFONYL)-1-PIPERIDIN-4-YL-1H-INDAZOLE
CAS:201227-19-2
KIN03630179
5-BROMO-3-(METHYLSULFONYL)-1H-INDAZOLE
CAS:201227-17-0
Formula: C8H7BrN2O2S
KIN03408694
5-BROMO-3-(METHYLSULFONYL)-PYRAZIN-2-YLAMINE
CAS:87444-39-1
Formula: C5H6BrN3O2S
KIN02686824
5-BROMO-3-(METHYLTHIO)-1H-[1,2,4]-TRIAZOLE
CAS:15777-62-5
Formula: C3H4BrN3S
KIN02044044
MFCD13188591
5-BROMO-3-(METHYLTHIO)-1H-INDAZOLE
CAS:201227-23-8
Formula: C8H7BrN2S
KIN03408696
5-BROMO-3-(METHYLTHIO)-1H-INDOLE
CAS:153261-50-8
Formula: C9H8BrNS
KIN03304613
5-BROMO-3-(METHYLTHIO)-2-THIOPHENECARBOXYLIC ACID
CAS:94781-41-6
Formula: C6H5BrO2S2
KIN02785081
5-BROMO-3-(METHYLTHIO)-PYRAZIN-2-YLAMINE
CAS:87444-38-0
Formula: C5H6BrN3S
KIN02686823
5-BROMO-3-(MORPHOLIN-4-YLMETHYL)-1H-INDOLE
CAS:102043-55-0
Formula: C13H15BrN2O
KIN03044006
5-BROMO-3-(N-BOC-AMINO)THIOPHEN-2-CARBOXYLIC ACID
CAS:494833-77-1
Formula: C10H12BrNO4S
KIN03614069
5-BROMO-3-(PHENYLAMINO)-2(1H)-ALPHA-PYRAZINONE
CAS:1148027-28-4
Formula: C10H8BrN3O
KIN05196228
5-BROMO-3-(PHENYLMETHYLENE)-1(3H)-ISOBENZOFURANTHIONE
CAS:62497-56-7
Formula: C15H9BrOS
KIN02475163
5-BROMO-3-(PIPERAZIN-1-YLMETHYL)-1H-INDOLE
CAS:1182978-67-1
Formula: C13H16BrN3
KIN05299099
5-BROMO-3-(PIPERIDIN-1-YLMETHYL)-1H-INDOLE
CAS:1108616-49-4
Formula: C14H17BrN2
KIN05172033
5-BROMO-3-(PIPERIDIN-4-YLMETHYL)-1H-INDOLE
CAS:75259-63-1
Formula: C14H17BrN2
KIN02611403
5-BROMO-3-(PROPARGYL)-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:7027-96-5
Formula: C8H8O2S.Na
KIN01176716
5-BROMO-3-(PROPARGYLOXY) -BENZO[D]ISOXAZOLE
CAS:66571-01-5
Formula: C10H6BrNO2
KIN02543596
5-BROMO-3-(PYRIDIN-3-YLMETHYL)-1H-INDOLE
CAS:160419-44-3
KIN03325928
5-BROMO-3-(PYRROLIDIN-1-YLMETHYL)-1H-INDOLE
CAS:1108616-48-3
Formula: C13H15BrN2
KIN05172032
5-BROMO-3-(PYRROLIDIN-3-YLMETHYL)-1H-INDOLE
CAS:158554-18-8
KIN03320739
5-BROMO-3-(SEC-BUTYL)-6-METHYLPYRIMIDIN-2,4(1H,3H)-DIONE
CAS:314-41-0
Formula: C6HF4NO2
KIN01009968
5-BROMO-3-(SEC-BUTYL)-PYRIMIDIN-2,4(1H,3H)-DIONE
CAS:6982-09-8
Formula: C16H33NO2
KIN01175856
5-BROMO-3-(TERT-BUTYL)-1H-[1,2,4]-TRIAZOLE
CAS:146858-36-8
Formula: C6H10BrN3
KIN03283943
5-BROMO-3-(TERT-BUTYL)-1H-INDOLE
CAS:1161939-92-9
Formula: C12H14BrN
KIN05258936
5-BROMO-3-(TERT-BUTYL)-2-(METHOXYMETHOXY)PHENOL
CAS:474555-31-2
Formula: C12H17BrO3
KIN03601440
5-BROMO-3-(TERT-BUTYL)-2-ETHYNYLBENZALDEHYDE
CAS:360785-02-0
Formula: C13H13BrO
KIN03536555
5-BROMO-3-(TERT-BUTYL)-2-HYDROXY-BENZALDEHYDE
CAS:153759-58-1
Formula: C11H13BrO2
KIN03306299
5-BROMO-3-(TERT-BUTYL)-2-HYDROXY-PHENOL
CAS:261903-06-4
Formula: C10H13BrO2
KIN03459413
5-BROMO-3-(TERT-BUTYL)-2-METHOXY-ANILINE
CAS:474554-51-3
Formula: C11H16BrNO
KIN03601431
5-BROMO-3-(TERT-BUTYL)-2-METHOXY-BENZALDEHYDE
CAS:417715-87-8
Formula: C12H15BrO2
KIN03573064
5-BROMO-3-(TERT-BUTYL)-6-METHYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:7286-84-2
Formula: C8H7Cl2NO2
KIN01183620
5-BROMO-3-(TERT-BUTYL)-PYRIMIDIN-2,4(1H,3H)-DIONE
CAS:5079-29-8
Formula: C17H11Cl2NO4
KIN01120331
5-BROMO-3-(THIOPHEN-2-YL)-PYRAZIN-2-YLAMINE
CAS:174680-66-1
KIN03356561
5-BROMO-3-(THIOPHEN-2-YLMETHYL)-1H-INDOLE
CAS:1033196-26-7
Formula: C13H10BrNS
KIN05067570
5-BROMO-3-(TRIFLUOROMETHYL)-1H-[1,2,4]-TRIAZOLE
CAS:1185320-36-8
Formula: C3HBrF3N3
KIN05319679
5-BROMO-3-(TRIFLUOROMETHYL)-1H-INDAZOLE
CAS:57631-11-5
Formula: C8H4BrF3N2
KIN02402628
5-BROMO-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-ACETIC ACID
CAS:1003320-23-7
Formula: C6H4BrF3N2O2
KIN05008116
5-BROMO-3-(TRIFLUOROMETHYL)-1H-PYRAZOLE
CAS:19968-16-2
KIN02086676
5-BROMO-3-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1150618-36-2
Formula: C8H4BrF3N2
KIN05197136
5-BROMO-3-(TRIFLUOROMETHYL)-2(1H)-PYRIDINONE
CAS:76041-79-7
Formula: C6H3BrF3NO
KIN02616559
5-BROMO-3-(TRIFLUOROMETHYL)-2-AMINO-ANILINE
CAS:157026-19-2
Formula: C7H6BrF3N2
KIN03317052
5-BROMO-3-(TRIFLUOROMETHYL)-PYRIDIN-2-YLAMINE
CAS:79456-34-1
Formula: C6H4BrF3N2
KIN02637797
MFCD10758088
5-BROMO-3-[(1,2,5,6-TETRAHYDROPYRIDIN-3-YL)METHYL]INDOLE
CAS:160419-41-0
KIN03618786
5-BROMO-3-[(1-METHYLPYRROLIDIN-2-YL)METHYL]INDOLE
CAS:312949-16-9
Formula: [C14H17BrN2
KIN03487187
5-BROMO-3-[(1E)-2-NITRO-ETHENYL]INDOLE
CAS:131653-79-7
KIN03215132
5-BROMO-3-[(1E)-2-PHENYLETHENYL]PYRAZIN-2-YLAMINE
CAS:208525-82-0
KIN03023857
5-BROMO-3-[(2-METHYLPYRIDIN-3-YLOXY) ]PYRIDIN-2-YLAMINE
CAS:1065607-67-1
Formula: C11H10BrN3O
KIN05109583
5-BROMO-3-[(3-ETHOXY-4-HYDROXY-5-IODO-PHENYL) METHYLENE]-1,3-DIHYDRO-2H-INDOL-2-ONE
CAS:486993-39-9
Formula: C17H13BrINO3
KIN03610864
5-BROMO-3-[(4-METHOXY-PHENYL) METHYL]IMIDAZOL-4-CARBALDEHYDE
CAS:101853-88-7
Formula: C12H11BrN2O2
KIN03042276
5-BROMO-3-[(DIMETHYLAMINO)METHYLENE]-2,3-DIHYDRO-2-OXO-1H-INDOL-1-CARBALDEHYDE
CAS:23872-31-3
KIN02124332
5-BROMO-3-[(METHYLTHIO)METHYL]PYRIDIN-2-AMINE
CAS:1101059-43-1
Formula: C7H9BrN2S
KIN05167144
5-BROMO-3-[(TRIFLUOROMETHYL)THIO]INDOLE
CAS:1045822-97-6
Formula: C9H5BrF3NS
KIN05094997
5-BROMO-3-[[(2S)-1-METHYLPYRROLIDIN-2-YL]METHYL]INDOLE
CAS:208464-41-9
Formula: [C14H17BrN2
KIN03418841
5-BROMO-3-[1-(1H-INDOL-3-YL)-2-NITRO-ETHYL]-1-METHYL-1H-INDOLE
CAS:353455-86-4
Formula: C19H16BrN3O2
KIN03530923
5-BROMO-3-[1-(BENZYL)-PYRROLIDINE-3-YL]INDOLE
CAS:167303-75-5
KIN03340332
5-BROMO-3-[1-(ETHOXYAMINO) -PROPYLIDENE]-6-ETHYL-2H-PYRAN-2,4(3H)-DIONE
CAS:52852-10-5
Formula: C12H16BrNO4
KIN02326818
5-BROMO-3-[1-(ETHOXYAMINO) BUTYLIDENE]-6-METHYL-2H-PYRAN-2,4(3H)-DIONE
CAS:52852-13-8
Formula: C12H16BrNO4
KIN02326821
5-BROMO-3-[1-(ETHOXYAMINO) BUTYLIDENE]-6-PROPYL-2H-PYRAN-2,4(3H)-DIONE
CAS:52852-30-9
Formula: C14H20BrNO4
KIN02326823
5-BROMO-3-[2-(2-NITROPHENYL)HYDRAZINYL]INDOL-2-ONE
CAS:21303-39-9
Formula: C14H9BrN4O3
KIN02099442
5-BROMO-3-[2-(3-CHLOROPHENYL)ETHYL]PYRIDIN-2-CARBONITRILE
CAS:156073-03-9
Formula: C14H10BrClN2
KIN03314293
5-BROMO-3-[2-(DIMETHYLAMINO)ETHYL]INDOL-4-OL
CAS:404887-86-1
Formula: C12H15BrN2O
KIN03565549
5-BROMO-3-[2-(DIMETHYLAMINO)ETHYL]INDOL-4-OL ACETATE (ESTER)
CAS:404887-89-4
KIN03565551
5-BROMO-3-[2-(PYRROLIDIN-1-YL)ETHYL]INDOLE
CAS:17274-68-9
Formula: C14H17BrN2
KIN02060168
5-BROMO-3-[2-(TRIFLUOROMETHYL)PHENYL]ISOXAZOLE
CAS:1188056-18-9
Formula: C10H5BrF3NO
KIN05325114
5-BROMO-3-[2-TERT-BUTOXYETHENYL]PYRIDIN-2-YLAMINE
CAS:1111638-00-6
Formula: C11H15BrN2O
KIN05174463
5-BROMO-3-[3-(TRIFLUOROMETHYL)PHENYL]ISOXAZOLE
CAS:1188091-70-4
Formula: C10H5BrF3NO
KIN05325393
5-BROMO-3-[4-(1-METHYLETHYL)PHENYL]-4-ISOXAZOLEMETHANOL
CAS:1188050-44-3
Formula: C13H14BrNO2
KIN05324993
5-BROMO-3-[4-(1-METHYLETHYL)PHENYL]ISOXAZOLE
CAS:1188141-67-4
Formula: C12H12BrNO
KIN05325936
5-BROMO-3-[4-(METHYLAMINO)-1-BUTEN-1-YL]PYRIDIN-2-YLAMINE
CAS:31932-55-5
KIN02193203
5-BROMO-3-[4-(TERT-BUTYL)PHENYL]ISOXAZOLE
CAS:1188140-71-7
Formula: C13H14BrNO
KIN05325921
5-BROMO-3-[4-(TRIFLUOROMETHYL)PHENYL]ISOXAZOLE
CAS:1188133-22-3
Formula: C10H5BrF3NO
KIN05325841
5-BROMO-3-{OXO[4-(PYRIMIDIN-2-YL)PIPERAZIN-1-YL]ACETYL}-1H-INDOLE, 1-[(5-BROMO-1H-INDOL-3-YL)(OXO)-ACETYL]-4-(PYRIMIDIN-2-YL)PIPERAZINE
CAS:256417-42-2
Formula: C18H16BrN5O2
KIN03455474
5-BROMO-3-ALLYL-BIPHENYL-2-OL
CAS:100915-37-5
Formula: C15H13BrO
KIN03035604
5-BROMO-3-AMINO-1H-INDAZOLE
CAS:61272-71-7
Formula: C7H6BrN3
KIN02453564
MFCD03426696
5-BROMO-3-AMINO-ANILINE
CAS:33786-90-2
Formula: C6H7BrN2
KIN02208802
MFCD09036306
5-BROMO-3-BENZOFURANETHANOL
CAS:200204-86-0
Formula: C10H9BrO2
KIN03407151
5-BROMO-3-BROMOMETHYL-2-AMINOPYRIDINE HBR
CAS:335033-38-0
Formula: C6H7Br3N2
KIN03508303
5-BROMO-3-BROMOMETHYL-2-CHLORO-THIOPHENE
CAS:1185727-35-8
KIN05320255
5-BROMO-3-BROMOMETHYL-2-METHYL-2-PENTENE
CAS:85221-99-4
Formula: C7H12Br2
KIN02672798
5-BROMO-3-BROMOMETHYL-2-PHENYLTHIOPHENE
CAS:62404-11-9
Formula: C11H8Br2S
KIN02473557
5-BROMO-3-BROMOMETHYL-ISOTHIAZOLE
CAS:4576-96-9
Formula: C4H3Br2NS
KIN01110761
5-BROMO-3-BROMOMETHYL-QUINOLINE
CAS:397322-47-3
KIN03559965
5-BROMO-3-BROMOMETHYLBENZO[B]THIOPHEN-2-CARBOXYLIC ACID ETHYL ESTER
CAS:31310-31-3
KIN02188464
5-BROMO-3-BROMOMETHYLBENZO[B]THIOPHENE
CAS:1757-28-4
Formula: C5H4ClNO
KIN01055127
5-BROMO-3-BROMOMETHYLBENZO[D]ISOTHIAZOLE
CAS:73437-12-4
Formula: C8H5Br2NS
KIN02598309
5-BROMO-3-BROMOMETHYLTHIENO[2,3-D][1,2]OXAZOLE
CAS:112499-97-5
Formula: C6H3Br2NOS
KIN03115909
5-BROMO-3-BUTYL-2-PYRIDINAMINE
CAS:168982-95-4
Formula: C9H13BrN2
KIN03343749
5-BROMO-3-CHLORO-1(2H)-ISOQUINOLINONE
CAS:476492-83-8
Formula: C9H5BrClNO
KIN03603724
5-BROMO-3-CHLORO-1,2,4-THIADIAZOLE
CAS:213325-82-7
KIN03424927
5-BROMO-3-CHLORO-1,2-BENZENEDICARBOXYLIC ACID
CAS:1192548-76-7
Formula: C8H4BrClO4
KIN05333924
5-BROMO-3-CHLORO-1-METHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:1057404-45-1
Formula: C10H7BrClNO2
KIN05104292
5-BROMO-3-CHLORO-1H-[1,2,4]-TRIAZOLE
CAS:15777-55-6
Formula: C2HBrClN3
KIN02044040
5-BROMO-3-CHLORO-1H-INDAZOLE
CAS:36760-19-7
Formula: C7H4BrClN2
KIN02233929
MFCD06738284
5-BROMO-3-CHLORO-1H-INDOL-2-CARBALDEHYDE
CAS:181861-48-3
Formula: C9H5BrClNO
KIN03371646
5-BROMO-3-CHLORO-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-43-0
Formula: C5H4BrClN2O2
KIN05021081
5-BROMO-3-CHLORO-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015780-29-6
Formula: C7H8BrClN2O2
KIN05021042
5-BROMO-3-CHLORO-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015782-81-6
Formula: C5H3BrCl2N2O
KIN05021101
5-BROMO-3-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190311-03-5
KIN05330098
5-Bromo-3-chloro-4-aza-1H-indole
5-BROMO-3-CHLORO-2(1H)-PYRAZINONE
CAS:21943-17-9
KIN02105704
5-BROMO-3-CHLORO-2(1H)-PYRIDINONE
CAS:58236-70-7
Formula: C5H3BrClNO
KIN02412489
MFCD00234010
5-BROMO-3-CHLORO-2,4-DIFLUORO-ANILINE
CAS:122452-23-7
KIN03174852
5-BROMO-3-CHLORO-2,4-DIFLUOROBENZOIC ACID
CAS:221221-02-9
KIN03436061
5-BROMO-3-CHLORO-2,4-DIFLUOROBENZOIC ACID ETHYL ESTER
CAS:229180-33-0
KIN03652582
5-BROMO-3-CHLORO-2,4-DIFLUOROBENZOYL CHLORIDE
CAS:221221-04-1
KIN03436063
5-BROMO-3-CHLORO-2,4-DIHYDROXY-BENZALDEHYDE
CAS:135310-27-9
Formula: C7H4BrClO3
KIN03232274
5-BROMO-3-CHLORO-2-(1-METHYL-1H-PYRAZOL-5-YL)-PYRIDINE
CAS:1159186-44-3
Formula: C9H7BrClN3
KIN05254702
5-BROMO-3-CHLORO-2-(1-METHYLETHOXY) -BENZENESULFONYL CHLORIDE
CAS:1152516-42-1
Formula: C9H9BrCl2O3S
KIN05198319
5-BROMO-3-CHLORO-2-(2-ETHOXYETHOXY) -BENZENESULFONYL CHLORIDE
CAS:1154966-66-1
Formula: C10H11BrCl2O4S
KIN05221756
5-BROMO-3-CHLORO-2-(2-PHENYLETHOXY) -BENZENESULFONYL CHLORIDE
CAS:1039940-62-9
Formula: C14H11BrCl2O3S
KIN05082707
5-BROMO-3-CHLORO-2-(3-METHYLBUTOXY) -BENZENESULFONYL CHLORIDE
CAS:1152516-72-7
Formula: C11H13BrCl2O3S
KIN05198332
5-BROMO-3-CHLORO-2-(BENZYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1152516-34-1
Formula: C13H9BrCl2O3S
KIN05198317
5-BROMO-3-CHLORO-2-(CYCLOHEXYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1152549-74-0
Formula: C12H13BrCl2O3S
KIN05199184
5-BROMO-3-CHLORO-2-(CYCLOPENTYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1152516-67-0
Formula: C11H11BrCl2O3S
KIN05198330
5-BROMO-3-CHLORO-2-(ETHYLAMINO)-BENZOHYDRAZIDE
CAS:1049107-98-3
Formula: C9H11BrClN3O
KIN05097351
5-BROMO-3-CHLORO-2-(ETHYLAMINO)-BENZOIC ACID
CAS:1049137-77-0
Formula: C9H9BrClNO2
KIN05097504
5-BROMO-3-CHLORO-2-(HEPTYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1039947-59-5
Formula: C13H17BrCl2O3S
KIN05082834
5-BROMO-3-CHLORO-2-(HEXYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1038722-51-8
Formula: C12H15BrCl2O3S
KIN05077560
5-BROMO-3-CHLORO-2-(METHYLAMINO)-BENZOHYDRAZIDE
CAS:1049107-77-8
Formula: C8H9BrClN3O
KIN05097348
5-BROMO-3-CHLORO-2-(METHYLAMINO)-BENZOIC ACID
CAS:1049105-67-0
Formula: C8H7BrClNO2
KIN05097328
5-BROMO-3-CHLORO-2-(METHYLTHIO)-PYRIDINE
CAS:261625-68-7
Formula: C6H5BrClNS
KIN03458976
5-BROMO-3-CHLORO-2-(OCTYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1039900-37-2
Formula: C14H19BrCl2O3S
KIN05081835
5-BROMO-3-CHLORO-2-(PENTYLOXY) -BENZENESULFONYL CHLORIDE
CAS:1152549-89-7
Formula: C11H13BrCl2O3S
KIN05199185
5-BROMO-3-CHLORO-2-(PROPYLAMINO)-BENZOIC ACID
CAS:1049105-87-4
Formula: C10H11BrClNO2
KIN05097333
5-BROMO-3-CHLORO-2-[(1-METHYLETHYL)AMINO]BENZOIC ACID
CAS:1049105-96-5
Formula: C10H11BrClNO2
KIN05097335
5-BROMO-3-CHLORO-2-AMINO-ANILINE
CAS:16429-44-0
Formula: C6H6BrClN2
KIN02051274
5-BROMO-3-CHLORO-2-ETHOXY-BENZENESULFONYL CHLORIDE
CAS:1152516-83-0
Formula: C8H7BrCl2O3S
KIN05198336
5-BROMO-3-CHLORO-2-FLUORO-PYRIDINE
CAS:1166390-93-7
KIN05260026
5-BROMO-3-CHLORO-2-FLUOROBENZONITRILE
CAS:1000577-76-3
Formula: C7H2BrClFN
KIN05004394
5-BROMO-3-CHLORO-2-FLUOROPYRIDINE
CAS:38185-56-7
Formula: C5H2BrClFN
KIN02245914
MFCD09834365
5-BROMO-3-CHLORO-2-HYDROXY-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:93224-84-1
Formula: C7H4BrClO2
KIN02766676
5-BROMO-3-CHLORO-2-HYDROXY-BENZALDEHYDE
CAS:19652-33-6
Formula: C7H4BrClO2
KIN02083049
5-BROMO-3-CHLORO-2-HYDROXY-BENZENEMETHANOL
CAS:29922-43-8
Formula: C7H6BrClO2
KIN02177697
5-BROMO-3-CHLORO-2-HYDROXY-BENZOHYDRAZIDE
CAS:67657-89-0
Formula: C7H6BrClN2O2
KIN02556446
5-BROMO-3-CHLORO-2-HYDROXY-BENZOIC ACID
CAS:2200-86-4
Formula: C9H8N2O5
KIN01064647
5-BROMO-3-CHLORO-2-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:4068-73-9
Formula: C8H6BrFO3
KIN01100405
5-BROMO-3-CHLORO-2-IODO-ALPHA-BENZONITRILE
CAS:1000577-40-1
Formula: C7H2BrClIN
KIN05004368
5-BROMO-3-CHLORO-2-IODO-ALPHA-PYRIDINE
CAS:1159186-43-2
Formula: C5H2BrClIN
KIN05254701
5-BROMO-3-CHLORO-2-METHOXY-BENZALDEHYDE
CAS:25299-27-8
Formula: C8H6BrClO2
KIN02138190
5-BROMO-3-CHLORO-2-METHOXY-BENZENESULFONYL CHLORIDE
CAS:1152516-62-5
Formula: C7H5BrCl2O3S
KIN05198327
5-BROMO-3-CHLORO-2-METHOXY-PYRAZINE
CAS:1161497-36-4
Formula: C5H4BrClN2O
KIN05258633
5-BROMO-3-CHLORO-2-METHYLPYRIDIN-4-AMINE
CAS:1188140-67-1
Formula: C6H6BrClN2
KIN05325920
5-BROMO-3-CHLORO-2-PENTANONE
CAS:63141-06-0
Formula: C5H8BrClO
KIN02487174
5-BROMO-3-CHLORO-2-PIPERAZIN-1-YLPYRAZINE
CAS:313657-61-3
KIN03488518
5-BROMO-3-CHLORO-2-PROPOXY-BENZENESULFONYL CHLORIDE
CAS:1152516-47-6
Formula: C9H9BrCl2O3S
KIN05198321
5-BROMO-3-CHLORO-2-PYRIDINECARBOXYLIC ACID
CAS:1189513-51-6
Formula: C6H3BrClNO2
KIN05329071
5-BROMO-3-CHLORO-2-PYRIDINONE
CAS:58236-20-7
Formula: C15H8Cl2O2
KIN02412485
5-BROMO-3-CHLORO-2-THIOPHENEETHANAMINE
CAS:1093363-96-2
KIN05135664
5-BROMO-3-CHLORO-3-PHENYL-1(3H)-ISOBENZOFURANONE
CAS:92261-00-2
Formula: C14H8BrClO2
KIN02754824
5-BROMO-3-CHLORO-4-HYDROXY-2(1H)-PYRIDINONE
CAS:408326-40-9
Formula: C5H3BrClNO2
KIN03568208
5-BROMO-3-CHLORO-4-ISOTHIAZOLAMINE
CAS:312318-16-4
KIN03485997
5-BROMO-3-CHLORO-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190314-14-7
KIN05330264
5-Bromo-3-chloro-4-methyl-7-aza-1H-indole
5-BROMO-3-CHLORO-4-PHENYL-QUINOLIN-2(1H)-ONE
CAS:65983-75-7
Formula: C15H9BrClNO
KIN02535241
5-BROMO-3-CHLORO-6-METHYL-2(1H)-ALPHA-PYRIDINONE
CAS:1091599-75-5
Formula: C6H5BrClNO
KIN05131958
5-BROMO-3-CHLORO-7-NITRO-1H-INDOLE
CAS:289483-88-1
KIN03470698
5-BROMO-3-CHLORO-IMIDAZO[1,2-A]PYRIDINE
CAS:69214-13-7
Formula: C7H4BrClN2
KIN02568784
MFCD12828073
5-BROMO-3-CHLORO-ISOQUINOLINE
CAS:1029720-67-9
KIN05064548
5-BROMO-3-CHLORO-N,2-DIHYDROXY-BENZAMIDE
CAS:4180-57-8
Formula: C10H12O5
KIN01102523
5-BROMO-3-CHLORO-N-CYCLOPROPYL-2-THIOPHENEETHANAMINE
CAS:1093374-82-3
KIN05135666
5-BROMO-3-CHLORO-N-METHYLPYRAZIN-2-YLAMINE
CAS:446286-77-7
Formula: C5H5BrClN3
KIN03588562
5-BROMO-3-CHLORO-N-PROPYLPYRAZIN-2-YLAMINE
CAS:446286-79-9
Formula: C7H9BrClN3
KIN03588563
5-BROMO-3-CHLORO-PHTHALONITRILE
CAS:1192548-75-6
Formula: C8H2BrClN2
KIN05333923
5-BROMO-3-CHLORO-PYRIDAZINE
CAS:1196155-33-5
Formula: C4H2BrClN2
KIN05339456
5-BROMO-3-CHLOROBENZO[D]ISOXAZOLE
CAS:401567-43-9
Formula: C7H3BrClNO
KIN03562274
5-BROMO-3-CHLOROISATOIC ANHYDRIDE
CAS:1006619-82-4
Formula: C8H3BrClNO3
KIN05013233
5-BROMO-3-CHLOROPYRAZIN-2-YLAMINE
CAS:21943-13-5
Formula: C4H3BrClN3
KIN02105700
5-BROMO-3-CHLOROPYRIDIN-2-YLAMINE
CAS:38185-55-6
Formula: C5H4BrClN2
KIN02245913
MFCD11110443
5-BROMO-3-CYANO-1-METHOXY-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:17403-38-2
KIN02061667
5-BROMO-3-CYANO-1H-INDAZOLE
CAS:211227-39-6
KIN03422441
5-BROMO-3-CYANO-2-HYDROXY-BENZOIC ACID
CAS:57688-26-3
Formula: C8H4BrNO3
KIN02403663
5-BROMO-3-CYANO-4-(METHOXYMETHYL) -6-METHYL-2-OXO-1(2H)-PYRIDINEACETIC ACID 2-[[4-[(2,4-DICHLOROPHENYL)METHOXY]-3-IODO-5-METHOXY-PHENYL]METHYLENE]HYDRAZIDE
CAS:355821-31-7
Formula: C26H22BrCl2IN4O5
KIN03532827
5-BROMO-3-CYANOINDAZOLE
CAS:211227-39-3
Formula: [C8H4BrN3]
KIN03422440
5-BROMO-3-CYCLOBUTYL-1H-[1,2,4]-TRIAZOLE
CAS:1199215-81-0
Formula: C6H8BrN3
KIN05343089
5-BROMO-3-CYCLOHEXYL-1H-INDOLE
CAS:1092574-93-0
Formula: C14H16BrN
KIN05134496
5-BROMO-3-CYCLOHEXYL-2-HYDROXY-BENZAMIDE
CAS:6284-51-1
Formula: C31H36N2O2
KIN01155414
5-BROMO-3-CYCLOHEXYL-6-(METHYLTHIO)-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:59750-80-0
KIN02436638
5-BROMO-3-CYCLOHEXYL-6-CYCLOPROPYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:19577-06-1
Formula: C13H17BrN2O2
KIN02082497
5-BROMO-3-CYCLOPENTYL-1,6-DIMETHYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:32000-82-1
Formula: C11H15BrN2O2
KIN02193680
5-BROMO-3-CYCLOPROPYL-1H-[1,2,4]-TRIAZOLE
CAS:82767-64-4
Formula: C5H6BRN3
KIN02657488
MFCD19103366
5-BROMO-3-CYCLOPROPYL-1H-PYRAZOLO[3,4-C]PYRIDINE
CAS:1114523-64-6
Formula: C9H8BrN3
KIN05175381
5-BROMO-3-CYCLOPROPYL-2-METHYLTHIOPHENE
CAS:1159821-48-3
Formula: C8H9BrS
KIN05256248
5-BROMO-3-CYCLOPROPYL-6-METHYL-2(1H)-ALPHA--PYRIDINONE
CAS:1064064-32-9
Formula: C9H10BrNO
KIN05108651
5-BROMO-3-DEOXY-CYTIDINE
CAS:122857-65-2
Formula: C9H12BrN3O4
KIN03177010
5-BROMO-3-ETHENYL-1,3-DIHYDRO-3-HYDROXY-2H-INDOL-2-ONE
CAS:1190314-82-9
Formula: C10H8BrNO2
KIN05330303
5-BROMO-3-ETHENYL-1-(4-METHYLPHENYL)SULFONYL-1H-INDOLE
CAS:452305-60-1
Formula: C17H14BrNO2S
KIN03592531
5-BROMO-3-ETHENYL-1H-INDOLE
CAS:1104643-63-1
Formula: C10H8BrN
KIN05169626
5-BROMO-3-ETHOXY-1H-[1,2,4]-TRIAZOLE
CAS:1181206-92-7
Formula: C4H6BrN3O
KIN05290639
5-BROMO-3-ETHOXY-2-HYDROXY-BENZENEMETHANOL
CAS:35090-67-6
Formula: C9H11BrO3
KIN02219717
5-BROMO-3-ETHOXY-2-HYDROXY-BENZOIC ACID
CAS:35093-67-5
Formula: C9H9BrO4
KIN02219748
5-BROMO-3-ETHOXY-2-METHOXY-BENZOIC ACID
CAS:193882-63-2
Formula: C10H11BrO4
KIN03397289
5-BROMO-3-ETHOXY-2-METHYL-BENZALDEHYDE
CAS:1159697-65-0
Formula: C10H11BrO2
KIN05255473
5-BROMO-3-ETHOXY-PYRAZIN-2-YLAMINE
CAS:77112-66-4
Formula: C6H8BrN3O
KIN02623330
5-BROMO-3-ETHOXY-PYRIDIN-2-CARBONITRILE
CAS:36057-51-9
Formula: C8H7BrN2O
KIN02228579
5-BROMO-3-ETHYL-1,2,3,4-TETRAHYDRO-8-METHOXY-NAPHTHALEN-1-OL
CAS:22531-29-9
Formula: C13H17BrO2
KIN02111488
5-BROMO-3-ETHYL-1,3-DIHYDRO-2H-INDOL-2-ONE
CAS:304876-05-9
Formula: [C10H10BrNO
KIN03481476
5-BROMO-3-ETHYL-1,3-DIHYDRO-3-HYDROXY-2H-INDOL-2-ONE
CAS:329695-46-7
Formula: C10H10BrNO2
KIN03663869
5-BROMO-3-ETHYL-1-(BENZENESULFONYL)-1H-INDOLE
CAS:121963-46-0
KIN03172569
5-BROMO-3-ETHYL-1-METHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:1158190-18-1
Formula: C12H12BrNO2
KIN05253119
5-BROMO-3-ETHYL-1-METHYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1188046-66-3
Formula: C7H9BrN2O
KIN05324902
5-BROMO-3-ETHYL-1-METHYL-1H-PYRAZOL-4-METHANOL
CAS:1188036-72-7
Formula: C7H11BrN2O
KIN05324683
5-BROMO-3-ETHYL-1-METHYL-1H-PYRAZOLE
CAS:1188116-84-8
Formula: C6H9BrN2
KIN05325602
5-BROMO-3-ETHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1188150-46-0
Formula: C12H11BrN2O
KIN05326079
5-BROMO-3-ETHYL-1-PHENYL-1H-PYRAZOL-4-METHANOL
CAS:1188121-95-0
Formula: C12H13BrN2O
KIN05325687
5-BROMO-3-ETHYL-1-PHENYL-1H-PYRAZOLE
CAS:1188145-89-2
Formula: C11H11BrN2
KIN05326023
5-BROMO-3-ETHYL-1H-[1,2,4]-TRIAZOLE
CAS:15777-58-9
Formula: C4H6BrN3
KIN02044041
MFCD12827510
5-BROMO-3-ETHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:446830-72-4
Formula: C11H10BrNO2
KIN03588738
5-BROMO-3-ETHYL-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-42-9
Formula: C7H9BrN2O2
KIN05021080
5-BROMO-3-ETHYL-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015780-27-4
Formula: C9H13BrN2O2
KIN05021041
5-BROMO-3-ETHYL-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015782-80-5
Formula: C7H8BrClN2O
KIN05021100
5-BROMO-3-ETHYL-2(1H)-PYRAZINONE
CAS:99418-36-7
Formula: C6H7BrN2O
KIN02820141
5-BROMO-3-ETHYL-2-(2-HYDROXYETHOXY) -BENZALDEHYDE
CAS:277324-48-8
Formula: C11H13BrO3
KIN03465799
5-BROMO-3-ETHYL-2-AMINO-ANILINE
CAS:170098-79-0
Formula: C8H11BrN2
KIN03345920
5-BROMO-3-ETHYL-2-BENZOFURANMETHANOL
CAS:86793-67-1
Formula: C11H11BrO2
KIN02682592
5-BROMO-3-ETHYL-2-HYDROXY-PHENOL
CAS:221244-58-2
Formula: C8H9BrO2
KIN03436144
5-BROMO-3-ETHYL-2-NITRO-THIOPHENE
CAS:82834-39-7
Formula: C6H6BrNO2S
KIN02657885
5-BROMO-3-ETHYL-2-OXO-2H-PYRAN-4-CARBALDEHYDE
CAS:1035638-70-0
Formula: C8H7BrO3
KIN05069431
5-BROMO-3-ETHYL-2-THIOPHENECARBOXYLIC ACID
CAS:193064-97-0
Formula: C7H7BrO2S
KIN03395633
5-BROMO-3-ETHYL-3,4-DIHYDRO-8-METHOXY-1(2H)-NAPHTHALENONE
CAS:22531-28-8
Formula: C13H15BrO2
KIN02111487
5-BROMO-3-ETHYL-3-PHENYL-PIPERIDIN-2,6-DIONE
CAS:56037-73-1
Formula: C13H14BrNO2
KIN02376208
5-BROMO-3-ETHYL-4-METHYL-1H-PYRROL-2-CARBALDEHYDE
CAS:4758-68-3
KIN01114118
5-BROMO-3-ETHYL-5-NITRO-1,3-OXAZINANE, HCL
CAS:13591-48-5
Formula: C6H12BrClN2O3
KIN02021784
5-BROMO-3-ETHYL-6-METHOXY-BENZO[D]ISOXAZOLE
CAS:73344-45-3
Formula: C10H10BrNO2
KIN02597716
5-BROMO-3-ETHYL-6-METHYL-2(1H)-PYRAZINONE
CAS:98546-56-6
Formula: C7H9BrN2O
KIN02814716
5-BROMO-3-ETHYL-6-METHYL-2(1H)-PYRIDINETHIONE
CAS:142274-32-6
Formula: C8H10BrNS
KIN03264365
5-BROMO-3-ETHYL-6-METHYL-2-PYRIDINESULFONAMIDE
CAS:142274-50-8
KIN03264374
5-BROMO-3-ETHYL-6-METHYLPYRIDIN-2-AMINE
CAS:1098652-28-8
Formula: C8H11BrN2
KIN05163251
5-BROMO-3-ETHYL-N-(1-ETHYLPROPYL)-PYRAZIN-2-YLAMINE
CAS:355836-26-9
KIN03674931
5-BROMO-3-ETHYLBENZO[C]ISOXAZOLE
CAS:60997-52-6
Formula: C9H8BrNO
KIN02449570
5-BROMO-3-ETHYLBENZO[D]ISOXAZOLE
CAS:66033-87-2
Formula: C9H8BrNO
KIN02535963
5-BROMO-3-ETHYLPENT-1-EN-4-YN-3-OL
CAS:98546-65-7
Formula: C7H9BrO
KIN02814719
5-BROMO-3-ETHYLPYRAZIN-2-YLAMINE
CAS:173253-40-2
Formula: C6H8BrN3
KIN03353130
5-BROMO-3-ETHYLPYRIDIN-2-AMINE
CAS:1037253-14-7
Formula: C7H9BrN2
KIN05073958
5-BROMO-3-FLUORO-1,2-BENZENEDICARBOXYLIC ACID
CAS:344309-11-1
KIN03519627
5-BROMO-3-FLUORO-1,2-DIHYDRO-ACENAPHTHYLENE
CAS:43017-87-4
Formula: C12H8BrF
KIN02282092
5-BROMO-3-FLUORO-1H-[1,2,4]-TRIAZOLE
CAS:42297-30-3
KIN02277435
5-BROMO-3-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1111637-68-3
KIN05174451
5-Bromo-3-fluoro-7-aza-1H-indole
5-BROMO-3-FLUORO-2(1H)-PYRIDINONE
CAS:156772-63-3
Formula: C5H3BRFNO
KIN03316374
5-BROMO-3-FLUORO-2-(BENZYLOXY) -BENZALDEHYDE
CAS:1003298-75-6
Formula: C14H10BrFO2
KIN05008093
5-BROMO-3-FLUORO-2-(HYDROXYMETHYL) -PYRIDINE
CAS:120696-89-1
Formula: C6H5BrFNO
KIN03165858
5-BROMO-3-FLUORO-2-(METHYLAMINO)-BENZOHYDRAZIDE
CAS:1049140-02-4
Formula: C8H9BrFN3O
KIN05097524
5-BROMO-3-FLUORO-2-(METHYLAMINO)-BENZOIC ACID
CAS:1049137-62-3
Formula: C8H7BrFNO2
KIN05097500
5-BROMO-3-FLUORO-2-(METHYLAMINO)-BENZOIC ACID METHYL ESTER
CAS:1049106-49-1
KIN05097342
5-BROMO-3-FLUORO-2-(OCTYLOXY) -PYRIDINE
CAS:156772-64-4
KIN03316375
5-BROMO-3-FLUORO-2-(PROPYLAMINO)-BENZOHYDRAZIDE
CAS:1049108-18-0
Formula: C10H13BrFN3O
KIN05097354
5-BROMO-3-FLUORO-2-(PROPYLAMINO)-BENZOIC ACID
CAS:1049137-86-1
KIN05097506
5-BROMO-3-FLUORO-2-(PROPYLAMINO)-BENZOIC ACID METHYL ESTER
CAS:1049106-75-3
KIN05097343
5-BROMO-3-FLUORO-2-[(1-METHYLETHYL)AMINO]BENZOIC ACID
CAS:1049137-95-2
KIN05097509
5-BROMO-3-FLUORO-2-[(2-METHYLPROPYL)AMINO]BENZOIC ACID
CAS:1049106-11-7
KIN05097337
5-BROMO-3-FLUORO-2-HYDROXY-BENZALDEHYDE
CAS:251300-28-4
Formula: C7H4BrFO2
KIN03451310
5-BROMO-3-FLUORO-2-HYDROXY-BENZENEPROPANOL
CAS:1000542-04-0
Formula: C9H10BrFO2
KIN05002765
5-BROMO-3-FLUORO-2-HYDROXY-BENZOIC ACID
CAS:251300-29-5
Formula: C7H4BrFO3
KIN03451311
5-BROMO-3-FLUORO-2-METHOXY-ANILINE
CAS:239122-51-1
Formula: C7H7BrFNO
KIN03445378
5-BROMO-3-FLUORO-2-METHOXY-BENZALDEHYDE
CAS:470668-70-3
Formula: C8H6BrFO2
KIN03599158
5-BROMO-3-FLUORO-2-METHOXY-BENZENEMETHANOL
CAS:470668-69-0
Formula: C8H8BrFO2
KIN03599157
5-BROMO-3-FLUORO-2-METHOXY-PYRIDINE
CAS:124432-70-8
Formula: C6H5BrFNO
KIN03184058
5-BROMO-3-FLUORO-2-METHYL-BENZENEACETIC ACID
CAS:1145784-92-4
Formula: C9H8BrFO2
KIN05193851
5-BROMO-3-FLUORO-2-METHYL-PYRIDINE
CAS:1162674-74-9
Formula: C6H5BrFN
KIN05259165
5-BROMO-3-FLUORO-2-NITRO-ANILINE
CAS:1193385-18-0
Formula: C6H4BrFN2O2
KIN05334939
5-BROMO-3-FLUORO-2-NITRO-BENZENE-D
CAS:251372-06-2
KIN03451442
5-BROMO-3-FLUORO-2-PENTANONE
CAS:63141-04-8
Formula: C5H8BrFO
KIN02487172
5-BROMO-3-FLUORO-BETA-OXO-2-PYRIDINEPROPANENITRILE
CAS:1107066-51-2
Formula: C8H4BrFN2O
KIN05171353
5-BROMO-3-FLUORO-L-TYROSINE
CAS:1195623-58-5
KIN05337884
5-BROMO-3-FORMYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:1082193-05-2
Formula: C10H6BrNO3
KIN05118819
5-BROMO-3-FORMYL-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:100123-25-9
Formula: C12H10BrNO3
KIN03028734
5-BROMO-3-FORMYL-2-HYDROXY-BENZOIC ACID
CAS:134948-41-7
Formula: C8H5BrO4
KIN03230626
5-BROMO-3-FORMYL-4-(BENZYLOXY) -1H-INDOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:404888-03-5
KIN03565563
5-BROMO-3-FORMYL-4-HYDROXY-1H-INDOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:404888-02-4
KIN03565562
5-BROMO-3-FORMYL-N,2-DIHYDROXY-BENZAMIDE
CAS:1082716-36-6
Formula: C8H6BrNO4
KIN05122135
5-BROMO-3-FORMYLBENZALDEHYDE
CAS:120173-41-3
Formula: C8H5BrO2
KIN03162885
5-BROMO-3-FURANCARBALDEHYDE
CAS:63387-54-2
Formula: C5H3BrO2
KIN02491827
MFCD15144204
5-BROMO-3-FURANCARBONYL CHLORIDE
CAS:162848-21-7
Formula: C5H2BrClO2
KIN03332404
5-BROMO-3-FURANCARBOXAMIDE
CAS:189330-16-3
Formula: C5H4BrNO2
KIN03388665
5-BROMO-3-HEPTENE
CAS:21964-22-7
Formula: C7H13Br
KIN02105933
5-BROMO-3-HEPTYL-1,3-DIHYDRO-3-PHENYL-2H-INDOL-2-ONE
CAS:62524-14-5
Formula: C21H24BrNO
KIN02475615
5-BROMO-3-HEXEN-1-OL 1-BENZOATE
CAS:95650-78-5
Formula: C13H15BrO2
KIN02793801
5-BROMO-3-HEXEN-1-YL ACETATE
CAS:95650-70-7
Formula: C8H13BrO2
KIN02793794
5-BROMO-3-HEXEN-2-YL NITRATE
CAS:64342-31-0
Formula: C6H10BrNO3
KIN02508335
5-BROMO-3-HEXYL-1,3-DIHYDRO-3-PHENYL-2H-INDOL-2-ONE
CAS:62524-11-2
Formula: C20H22BrNO
KIN02475612
5-BROMO-3-HYDRAZINYL-1H-[1,2,4]-TRIAZOLE
CAS:1089276-18-5
Formula: C2H4BrN5
KIN05128055
5-BROMO-3-HYDRAZINYLPYRAZIN-2-YLAMINE
CAS:91225-40-0
Formula: C4H6BrN5
KIN02740511
5-BROMO-3-HYDROXY-[3,3'-BI-1H-INDOL]-2(3H)-ONE
CAS:59212-83-8
KIN02428144
5-BROMO-3-HYDROXY-1-METHYL-3-(2'-OXO-PROPYL) -INDOLIN-2-ONE
CAS:107864-80-2
Formula: C12H12BrNO3
KIN03085503
5-BROMO-3-HYDROXY-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:153501-30-5
Formula: C11H10BrNO3
KIN03305369
5-BROMO-3-HYDROXY-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:105488-46-8
Formula: C10H8BrNO3
KIN03068621
5-BROMO-3-HYDROXY-2(1H)-PYRIDINONE
CAS:34206-49-0
Formula: C5H4BrNO2
KIN02212112
MFCD08276314
5-BROMO-3-HYDROXY-2-(METHYLAMINO)-BENZOIC ACID
CAS:149518-00-3
Formula: C8H8BrNO3
KIN03292820
5-BROMO-3-HYDROXY-2-BENZOFURANCARBONITRILE
CAS:89525-78-0
Formula: C9H4BrNO2
KIN02713035
5-BROMO-3-HYDROXY-2-BENZOFURANCARBOXYLIC ACID METHYL ESTER
CAS:112104-41-3
Formula: C10H7BrO4
KIN03112674
5-BROMO-3-HYDROXY-2-METHOXY-BENZALDEHYDE
CAS:139086-10-5
Formula: C8H7BrO3
KIN03250561
5-BROMO-3-HYDROXY-2-METHOXY-BENZENESULFONAMIDE
CAS:82020-65-3
Formula: C7H8BrNO4S
KIN02652976
5-BROMO-3-HYDROXY-2-METHOXY-BENZOIC ACID
CAS:107189-07-1
Formula: C8H7BrO4
KIN03081290
5-BROMO-3-HYDROXY-2-METHYLPYRAN-4-ONE
CAS:71001-54-2
Formula: C6H5BrO3
KIN02581202
5-BROMO-3-HYDROXY-2-PROPAN-2-YL-4H-PYRAN-4-ONE
CAS:95790-59-3
Formula: C8H9BrO3
KIN02795274
5-BROMO-3-HYDROXY-2-PROPYL-4H-PYRAN-4-ONE
CAS:95790-65-1
Formula: C8H9BrO3
KIN02795280
5-BROMO-3-HYDROXY-2-PYRIDINECARBONITRILE
CAS:1160936-51-5
Formula: C6H3BrN2O
KIN05258366
5-BROMO-3-HYDROXY-2-PYRIDINECARBOXYLIC ACID
CAS:1160994-90-0
Formula: C6H4BrNO3
KIN05258433
5-BROMO-3-HYDROXY-2-THIOPHENECARBONITRILE
CAS:117366-95-7
KIN03148659
5-BROMO-3-HYDROXY-3-(2-OXOCYCLOHEPTYL) -1H-INDOL-2-ONE
CAS:85778-19-4
Formula: C15H16BrNO3
KIN02676591
5-BROMO-3-HYDROXY-3-[2-(4-METHYLPHENYL)-2-OXOETHYL]INDOL-2-ONE
CAS:5957-75-5
Formula: C21H30O2
KIN01146012
5-BROMO-3-HYDROXY-3-PHENACYL-1H-INDOL-2-ONE
CAS:70452-19-6
Formula: C16H12BrNO3
KIN02577674
5-BROMO-3-HYDROXY-3H-2-BENZOFURAN-1-ONE
CAS:102126-71-6
Formula: C8H5BrO3
KIN03044630
5-BROMO-3-HYDROXY-4-METHYL-2-NITRO-BENZOIC ACID
CAS:34545-26-1
Formula: C8H6BrNO5
KIN02214673
5-BROMO-3-HYDROXY-PHENOL
CAS:106120-04-1
Formula: C6H5BrO2
KIN03074072
5-BROMO-3-HYDROXY-PYRIDINE 3-METHANESULFONATE
CAS:1035266-40-0
Formula: C6H6BrNO3S
KIN05069219
5-BROMO-3-HYDROXY-QUINOLIN-4-CARBOXYLIC ACID
CAS:1031929-54-0
Formula: [C10H6BrNO3];C10H6BrNO3
KIN05066738
5-BROMO-3-INDOLYL BETA-D-GALACTOPYRANOSIDE
CAS:97753-82-7
Formula: C14H16BrNO6
KIN02807583
MFCD00063691
5-BROMO-3-INDOXYL CAPRYLATE
CAS:133950-69-3
Formula: C16H20BrNO2
KIN03226077
5-BROMO-3-INDOXYL PHOSPHONATE DISODIUM SALT
CAS:16036-59-2
Formula: C8H5BrNO4P?Na
KIN02046989
5-BROMO-3-INDOXYL PHOSPHONATE P-TOLUIDINE SALT
CAS:80008-69-1
Formula: C15H16BrN2O4P
KIN02641250
MFCD03427361
5-BROMO-3-INDOXYL-BETA-D-GLUCURONIC ACID CYCLOHEXYL AMMONIUM SALT
CAS:199326-16-4
Formula: C14H14BrNO7C6H13N
KIN03405684
5-BROMO-3-IODO-1-TOSYL-1H-INDOLE
CAS:142688-28-6
Formula: C15H11BrINO2S
KIN03266174
5-BROMO-3-IODO-1H-INDAZOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:459133-68-7
Formula: C12H12BrIN2O2
KIN03594701
5-BROMO-3-IODO-1H-INDAZOLE
CAS:459133-66-5
Formula: C7H4BrIN2
KIN03594700
5-BROMO-3-IODO-2(1H)-PYRIDINONE
CAS:381233-75-6
Formula: C5H3BrINO
KIN03550212
5-BROMO-3-IODO-2-(1-METHYLETHOXY) -BENZALDEHYDE
CAS:486993-97-9
Formula: C10H10BrIO2
KIN03610869
5-BROMO-3-IODO-2-(1-METHYLETHOXY) -BENZALDEHYDE OXIME
CAS:445002-57-3
Formula: C10H11BrINO2
KIN03587250
5-BROMO-3-IODO-2-(BENZYLOXY) -BENZALDEHYDE OXIME
CAS:444939-52-0
Formula: C14H11BrINO2
KIN03587182
5-BROMO-3-IODO-2-METHOXY-BENZALDEHYDE 2-(4-NITROPHENYL)HYDRAZONE
CAS:331820-38-3
Formula: C14H11BrIN3O3
KIN03504125
5-BROMO-3-IODO-2-PYRIDINAMINE
CAS:381233-96-1
Formula: C5H4BrIN2
KIN03550219
5-BROMO-3-IODO-4-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1092579-77-5
KIN05134509
5-BROMO-3-IODO-4-AZA-1H-INDOL
CAS:1190319-16-4
Formula: C7H4BrIN2
KIN05330556
5-BROMO-3-IODO-4-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1092579-76-4
KIN05134508
5-BROMO-3-IODO-4-METHYL-1H-INDAZOLE
CAS:1082042-12-3
Formula: C8H6BrIN2
KIN05118297
5-BROMO-3-IODO-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190313-99-5
KIN05330256
5-Bromo-3-iodo-4-methyl-7-aza-1H-indole
5-BROMO-3-IODO-6-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1000343-82-7
KIN05000842
5-Bromo-3-iodo-6-methyl-7-aza-1H-indole
5-BROMO-3-IODO-ALPHA-2-METHOXY-BENZOIC ACID
CAS:1198475-45-4
Formula: C8H6BrIO3
KIN05342775
5-BROMO-3-IODO-ALPHA-4-METHYLPYRIDIN-2-AMINE
CAS:1150618-04-4
Formula: C6H6BrIN2
KIN05197109
5-BROMO-3-IODO-ALPHA-PYRAZIN-2-AMINE
CAS:1062608-42-7
Formula: C4H3BrIN3
KIN05108288
5-BROMO-3-ISOBUTYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1188037-62-8
Formula: C14H15BrN2O
KIN05324697
5-BROMO-3-ISOBUTYL-1-PHENYL-1H-PYRAZOLE
CAS:1188116-52-0
Formula: C13H15BrN2
KIN05325596
5-BROMO-3-ISOCYANATO-1-METHYL-1H-INDOLE
CAS:1080028-71-2
Formula: C10H7BrN2O
KIN05116826
5-BROMO-3-ISOQUINOLINAMINE
CAS:1192815-01-2
Formula: C9H7BrN2;C9H7BrN2
KIN05334454
5-BROMO-3-ISOTHIAZOLECARBALDEHYDE
CAS:1151801-49-8
Formula: C4H2BrNOS
KIN05197440
5-BROMO-3-ISOTHIAZOLECARBOXAMIDE
CAS:4576-87-8
Formula: C4HBr2NO2S
KIN01110755
5-BROMO-3-ISOTHIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:1049730-13-3
Formula: C6H6BrNO2S
KIN05098063
5-BROMO-3-ISOTHIAZOLECARBOXYLIC ACID METHYL ESTER
CAS:4667-15-6
Formula: C20H32O2
KIN01112305
5-BROMO-3-ISOTHIAZOLEMETHANOL
CAS:1151801-52-3
Formula: C4H4BrNOS
KIN05197441
5-BROMO-3-ISOTHIOCYANATO-1H-INDOLE
CAS:69344-02-1
Formula: C9H5BrN2S
KIN02569597
5-BROMO-3-METHOXY-1,2-DIMETHYL-4(1H)-PYRIDINONE
CAS:71001-61-1
Formula: C8H10BrNO2
KIN02581208
5-BROMO-3-METHOXY-1-PIPERIDIN-4-YL-1H-INDAZOLE
CAS:201483-51-4
KIN03409057
5-BROMO-3-METHOXY-1H-[1,2,4]-TRIAZOLE
CAS:15777-61-4
Formula: C3H4BrN3O
KIN02044043
5-BROMO-3-METHOXY-1H-INDAZOLE
CAS:201483-49-0
Formula: C8H7BrN2O
KIN03409055
5-BROMO-3-METHOXY-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:153501-31-6
KIN03305370
5-BROMO-3-METHOXY-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-88-3
Formula: C6H7BrN2O3
KIN05021103
5-BROMO-3-METHOXY-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015780-43-4
Formula: C8H11BrN2O3
KIN05021043
5-BROMO-3-METHOXY-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1015783-24-0
Formula: C6H6BrClN2O2
KIN05021116
5-BROMO-3-METHOXY-2(1H)-ALPHA-PYRIDINONE
CAS:1189757-62-7
Formula: C6H6BrNO2
KIN05329370
5-BROMO-3-METHOXY-2(1H)-PYRAZINONE
CAS:89282-38-2
Formula: C5H5BrN2O2
KIN02709752
5-BROMO-3-METHOXY-2,2-DIMETHYL-3H-1-BENZOFURAN-4,7-DIONE
CAS:7233-19-4
Formula: C25H25NO3
KIN01182032
5-BROMO-3-METHOXY-2-(ALLYLOXY) -BENZOIC ACID
CAS:193882-79-0
Formula: C11H11BrO4
KIN03397301
5-BROMO-3-METHOXY-2-(BENZYLOXY) -BENZALDEHYDE
CAS:155351-68-1
Formula: C15H13BrO3
KIN03312057
5-BROMO-3-METHOXY-2-(ISOPROPOXY) -BENZALDEHYDE
CAS:101417-33-8
Formula: C11H13BrO3
KIN03039214
5-BROMO-3-METHOXY-2-(TRIMETHYLSILYL)-PYRIDINE
CAS:1087659-25-3
Formula: C9H14BrNOSi
KIN05126588
5-BROMO-3-METHOXY-2-HYDROXY-PHENOL
CAS:38790-07-7
Formula: C7H7BrO3
KIN02250420
5-BROMO-3-METHOXY-2-METHYL-1-PENTENE
CAS:94621-19-9
Formula: C7H13BrO
KIN02783510
5-BROMO-3-METHOXY-2-METHYL-4(1H)-PYRIDINONE
CAS:71001-57-5
Formula: C7H8BrNO2
KIN02581204
5-BROMO-3-METHOXY-2-METHYL-BENZENAMINE
CAS:1082040-45-6
Formula: C8H10BrNO
KIN05118175
5-Bromo-3-methoxy-2-methyl-aniline
5-BROMO-3-METHOXY-2-METHYL-PYRIDINE
CAS:1150617-80-3
Formula: C7H8BrNO
KIN05197087
5-BROMO-3-METHOXY-2-NITRO-BENZOIC ACID
CAS:56709-76-3
Formula: C8H6BrNO5
KIN02387389
5-BROMO-3-METHOXY-2-NITRO-PYRIDINE
CAS:152684-26-9
Formula: C6H5BrN2O3
KIN03302949
5-BROMO-3-METHOXY-2-PHENYL-IMIDAZO[1,2-A]PYRIDINE
CAS:89192-97-2
Formula: C14H11BrN2O
KIN02708313
5-BROMO-3-METHOXY-2-PHENYLPYRAZINE
CAS:489431-68-7
Formula: C11H9BrN2O
KIN03612162
5-BROMO-3-METHOXY-2-PYRIDINECARBALDEHYDE
CAS:1087659-24-2
Formula: C7H6BrNO2
KIN05126587
5-BROMO-3-METHOXY-2-PYRIDINECARBALDEHYDE OXIME
CAS:1087659-33-3
Formula: C7H7BrN2O2
KIN05126596
5-BROMO-3-METHOXY-2-PYRIDINECARBOXYLIC ACID
CAS:1142191-66-9
Formula: C7H6BrNO3
KIN05190682
5-BROMO-3-METHOXY-2-PYRIDINEMETHANOL
CAS:1087659-32-2
Formula: C7H8BrNO2
KIN05126595
(5-Bromo-3-methoxy-pyridin-2-yl)methanol
5-BROMO-3-METHOXY-2-THIOPHENECARBOXYLIC ACID METHYL ESTER
CAS:181063-64-9
Formula: C7H7BrO3S
KIN03370413
5-BROMO-3-METHOXY-4-METHYL-2-(ISOPROPOXY) -BENZALDEHYDE
CAS:287117-39-9
Formula: C12H15BrO3
KIN03641360
5-BROMO-3-METHOXY-N-ALLYL-2-PROPOXY-BENZENEMETHANAMINE
CAS:1158699-23-0
Formula: C14H20BrNO2
KIN05254006
5-BROMO-3-METHOXY-N-METHYLPYRAZIN-2-YLAMINE
CAS:446286-73-3
Formula: C6H8BrN3O
KIN03588561
5-BROMO-3-METHOXY-PYRAZIN-2-YLAMINE
CAS:5900-14-1
Formula: C24H36ClN5O4S
KIN01144624
5-BROMO-3-METHOXY-PYRIDIN-2-CARBONITRILE
CAS:36057-46-2
Formula: C7H5BrN2O
KIN02228578
MFCD11857636
5-BROMO-3-METHOXY-PYRIDIN-2-YLAMINE
CAS:42409-58-5
Formula: C6H7BrN2O
KIN02278170
MFCD09909849
5-BROMO-3-METHYL-1,2,4-THIADIAZOLE
CAS:54681-68-4
Formula: C3H3BrN2S
KIN02353767
MFCD11847500
5-BROMO-3-METHYL-1,2-PENTADIENE
CAS:68705-67-9
Formula: C6H9Br
KIN02565207
5-BROMO-3-METHYL-1,3,4-THIADIAZOL-2(3H)-IMINE
CAS:64837-32-7
Formula: C3H4BrN3S
KIN02516573
5-BROMO-3-METHYL-1-ALLYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:25028-06-2
Formula: C8H9BrN2O2
KIN02135778
5-BROMO-3-METHYL-1-HYDROPYRROLO[2,3-B]PYRIDINE
CAS:1111637-94-5
Formula: C8H7BrN2
KIN05174462
5-BROMO-3-METHYL-1-PENTEN-4-YN-3-OL 3-ACETATE
CAS:129758-82-3
Formula: C8H9BrO2
KIN03207236
5-BROMO-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1188150-56-2
Formula: C11H9BrN2O
KIN05326080
5-BROMO-3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBONYL CHLORIDE
CAS:137716-78-0
KIN03618785
5-BROMO-3-METHYL-1-PHENYL-1H-PYRAZOL-4-METHANOL
CAS:1188151-80-5
Formula: C11H11BrN2O
KIN05326095
5-BROMO-3-METHYL-1-PHENYLPYRAZOLE
CAS:41327-15-5
Formula: C10H9BrN2
KIN02270285
MFCD00462191
5-BROMO-3-METHYL-1-PROPAN-2-YL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:57712-70-6
Formula: C8H11BrN2O2
KIN02404038
5-BROMO-3-METHYL-1-PROPYL-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:57712-69-3
Formula: C8H11BrN2O2
KIN02404037
5-BROMO-3-METHYL-1H-[1,2,4]-TRIAZOLE
CAS:26557-90-4
Formula: C3H4BrN3
KIN02149387
MFCD13188583
5-BROMO-3-METHYL-1H-INDOL-1-ACETIC ACID
CAS:1144102-67-9
Formula: C11H10BrNO2
KIN05192316
5-BROMO-3-METHYL-1H-INDOL-1-ACETIC ACID ETHYL ESTER
CAS:1144102-75-9
Formula: C13H14BrNO2
KIN05192319
5-BROMO-3-METHYL-1H-INDOL-2-ACETOHYDRAZIDE
CAS:14191-00-5
KIN02029253
5-Bromo-3-methyl-1H-indol-2-acetohydrazide
5-BROMO-3-METHYL-1H-INDOL-2-CARBALDEHYDE
CAS:90766-37-3
Formula: C10H8BrNO
KIN02732911
5-BROMO-3-METHYL-1H-INDOL-2-CARBOHYDRAZIDE
CAS:70070-25-6
Formula: C10H10BrN3O
KIN02574988
5-BROMO-3-METHYL-1H-INDOL-2-CARBONYL CHLORIDE
CAS:120608-01-7
Formula: C10H7BrClNO
KIN03165324
5-BROMO-3-METHYL-1H-INDOL-2-CARBOTHIOAMIDE
CAS:126193-65-5
KIN03191853
5-BROMO-3-METHYL-1H-INDOL-2-CARBOXAMIDE
CAS:126193-60-0
KIN03191852
5-BROMO-3-METHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:70070-32-5
Formula: C10H8BrNO2
KIN02574991
MFCD01366202
5-BROMO-3-METHYL-1H-INDOL-2-YLAMINE
CAS:70070-43-8
Formula: C9H9BrN2
KIN02574993
5-BROMO-3-METHYL-1H-INDOLE
CAS:10075-48-6
Formula: C9H8BrN
KIN02001552
MFCD04038746
5-BROMO-3-METHYL-1H-PYRAZOL-1-ACETIC ACID
CAS:1015782-40-7
Formula: C6H7BrN2O2
KIN05021079
5-BROMO-3-METHYL-1H-PYRAZOL-1-ACETIC ACID ETHYL ESTER
CAS:1015780-25-2
Formula: C8H11BrN2O2
KIN05021040
5-BROMO-3-METHYL-1H-PYRAZOLE
CAS:5744-70-7
Formula: C5H7BrN2
KIN01140614
5-BROMO-3-METHYL-1H-PYRAZOLO[3,4-B]PYRAZINE
CAS:1086064-35-8
Formula: C6H5BrN4
KIN05125266
5-BROMO-3-METHYL-1H-PYRIMIDIN-2,4-DIONE
CAS:6832-13-9
Formula: C2H2N2O
KIN01171060
5-BROMO-3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID
CAS:89794-11-6
Formula: C7H6BrNO4
KIN02717174
5-BROMO-3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-DIETHYL ESTER
CAS:4458-90-6
Formula: C13H20O3S
KIN01108481
5-BROMO-3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL 4-METHYL ESTER
CAS:50296-48-5
KIN02291463
5-BROMO-3-METHYL-1H-PYRROL-2-CARBOXYLIC ACID
CAS:1082159-67-8
Formula: C6H6BrNO2
KIN05118637
5-BROMO-3-METHYL-2(1H)-PYRAZINONE
CAS:100047-56-1
Formula: C5H5BRN2O
KIN03027927
5-BROMO-3-METHYL-2(1H)-PYRIDINONE
CAS:89488-30-2
Formula: C6H6BrNO
KIN02712507
MFCD03427657
5-BROMO-3-METHYL-2(3H)-BENZO[D]OXAZOLONE
CAS:70672-82-1
Formula: C8H6BrNO2
KIN02579071
MFCD16468568
5-BROMO-3-METHYL-2(5H)-FURANONE
CAS:51799-96-3
Formula: C5H5BrO2
KIN02311917
5-BROMO-3-METHYL-2-(1,3,4-OXADIAZOL-2-YL) -1H-INDOLE
CAS:128432-67-7
KIN03674930
5-BROMO-3-METHYL-2-(2,2,2-TRIFLUORO-ETHOXY) -PYRIDINE
CAS:1187930-58-0
Formula: C8H7BrF3NO
KIN05324166
5-BROMO-3-METHYL-2-(2-OXIRANYLMETHOXY) -BENZAMIDE
CAS:58708-50-2
Formula: C11H12BrNO3
KIN02419811
5-BROMO-3-METHYL-2-(2-OXO-PROPOXY) -BENZALDEHYDE
CAS:1115285-70-5
Formula: C11H11BrO3
KIN05175891
5-BROMO-3-METHYL-2-(2-OXOETHOXY) -BENZALDEHYDE
CAS:1115284-08-6
Formula: C10H9BrO3
KIN05175859
5-BROMO-3-METHYL-2-(3-METHYLTHIOPHEN-2-YL)THIOPHENE
CAS:144432-19-9
Formula: C10H9BrS2
KIN03275609
5-BROMO-3-METHYL-2-(4H-[1,2,4]-TRIAZOL-4-YL)-PYRIDINE
CAS:1082766-52-6
Formula: C8H7BrN4
KIN05122301
5-BROMO-3-METHYL-2-(ALLYLOXY) -BENZAMIDE
CAS:40912-97-8
Formula: C11H12BrNO2
KIN02266826
5-BROMO-3-METHYL-2-(ALLYLOXY) -BENZOYL CHLORIDE
CAS:63207-81-8
Formula: C11H10BrClO2
KIN02488450
5-BROMO-3-METHYL-2-(METHYLAMINO)-BENZENESULFONAMIDE
CAS:1027026-01-2
Formula: C8H11BrN2O2S
KIN05061818
5-BROMO-3-METHYL-2-(METHYLAMINO)-BENZOIC ACID
CAS:1049137-66-7
Formula: C9H10BrNO2
KIN05097501
5-BROMO-3-METHYL-2-(METHYLTHIO)-4(3H)-PYRIMIDINONE
CAS:81560-06-7
Formula: C6H7BrN2OS
KIN02650480
5-BROMO-3-METHYL-2-(METHYLTHIO)-6-PYRIDIN-4-YLPYRIMIDIN-4(3H)-ONE
CAS:208655-22-5
Formula: C11H10BrN3OS
KIN03419062
5-BROMO-3-METHYL-2-(N-CBZ-AMINO)-BENZOIC ACID
CAS:1006620-26-3
Formula: C16H14BrNO4
KIN05013253
5-BROMO-3-METHYL-2-(PENTYLAMINO)-BENZOIC ACID
CAS:1049106-26-4
KIN05097338
5-BROMO-3-METHYL-2-(PENTYLAMINO)-BENZOIC ACID METHYL ESTER
CAS:1049107-39-2
Formula: C14H20BrNO2
KIN05097345
5-BROMO-3-METHYL-2-(PIVALOYLOXY) -BENZOIC ACID
CAS:2704-55-4
Formula: C5H13NO
KIN01074606
5-BROMO-3-METHYL-2-(PROPYLAMINO)-BENZOHYDRAZIDE
CAS:1049108-23-7
Formula: C11H16BrN3O
KIN05097355
5-BROMO-3-METHYL-2-(PROPYLAMINO)-BENZOIC ACID
CAS:1049137-89-4
Formula: C11H14BrNO2
KIN05097507
5-BROMO-3-METHYL-2-(TRIFLUOROMETHOXY) -PYRIDINE
CAS:1086392-94-0
Formula: C7H5BrF3NO
KIN05125893
5-BROMO-3-METHYL-2-(TRIFLUOROMETHYL)-PYRIDINE
CAS:1010422-52-2
Formula: C7H5BrF3N
KIN05017337
5-BROMO-3-METHYL-2-[(1-METHYLETHYL)AMINO]BENZOHYDRAZIDE
CAS:1049140-69-3
Formula: C11H16BrN3O
KIN05097532
5-BROMO-3-METHYL-2-[(1-METHYLETHYL)AMINO]BENZOIC ACID
CAS:1049137-98-5
Formula: C11H14BrNO2
KIN05097511
5-BROMO-3-METHYL-2-[(3-METHYLBUTYL)AMINO]BENZOIC ACID
CAS:1049106-38-8
KIN05097339
5-BROMO-3-METHYL-2-[(TRIMETHYLSILYLOXY) ]PYRIDINE
CAS:58934-01-3
KIN02423546
5-BROMO-3-METHYL-2-[METHYL-(4-PROP-2-YNYLOXY-BENZENESULFONYL) AMINO]BENZOIC ACID METHYL ESTER
CAS:287108-61-6
Formula: C19H18BrNO5S
KIN03468945
5-BROMO-3-METHYL-2-AMINO-ANILINE
CAS:76153-06-5
Formula: C7H9BrN2
KIN02617282
MFCD06411036
5-BROMO-3-METHYL-2-BENZOFURANCARBOHYDRAZIDE
CAS:1097788-17-4
KIN05161035
5-BROMO-3-METHYL-2-BENZOFURANCARBOXAMIDE
CAS:35351-27-0
Formula: C10H8BrNO2
KIN02222276
5-BROMO-3-METHYL-2-BENZOFURANMETHANOL
CAS:50638-11-4
Formula: C10H9BrO2
KIN02295617
5-BROMO-3-METHYL-2-FURANCARBOXYLIC ACID
CAS:5896-37-7
KIN01144537
5-BROMO-3-METHYL-2-FURANCARBOXYLIC ACID METHYL ESTER
CAS:2528-04-3
Formula: C7H8N2O3S
KIN01071375
5-BROMO-3-METHYL-2-NITRO-PYRIDINE
CAS:114042-02-3
Formula: C6H5BrN2O2
KIN03127948
5-BROMO-3-METHYL-2-NITRO-THIOPHENE
CAS:82834-38-6
Formula: C5H4BrNO2S
KIN02657884
5-BROMO-3-METHYL-2-NITROPHENOL
CAS:93796-61-3
Formula: C7H6BrNO3
KIN02773737
5-BROMO-3-METHYL-2-PENTANONE
CAS:1115-58-8
Formula: C5H11NO2
KIN01039904
5-BROMO-3-METHYL-2-PENTEN-4-YNOIC ACID METHYL ESTER
CAS:72594-10-6
Formula: C7H7BrO2
KIN02592457
5-BROMO-3-METHYL-2-PHENOXY-ANILINE
CAS:496853-16-8
Formula: C13H12BrNO
KIN03615117
5-BROMO-3-METHYL-2-PHENYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:145934-76-5
KIN03281123
5-BROMO-3-METHYL-2-PHENYLTHIOPHENE
CAS:62403-79-6
Formula: C11H9BrS
KIN02473541
5-BROMO-3-METHYL-2-PYRIDIN-3-YL-1H-INDOLE
CAS:210344-30-2
KIN03421240
5-BROMO-3-METHYL-2-PYRIDINEBUTANAMINE
CAS:86181-41-1
Formula: C10H15BrN2
KIN02678844
5-BROMO-3-METHYL-2-PYRIDINEBUTANOIC ACID
CAS:127807-43-6
Formula: C10H12BrNO2
KIN03198989
5-BROMO-3-METHYL-2-PYRIDINECARBONITRILE
CAS:156072-86-5
Formula: C7H5BrN2
KIN03314292
5-BROMO-3-METHYL-2-PYRIDINECARBONYL CHLORIDE
CAS:1114809-24-3
Formula: C7H5BrClNO
KIN05175595
5-BROMO-3-METHYL-2-PYRIDINECARBOXALDEHYDE
CAS:376587-53-0
Formula: C7H6BrNO
KIN03546330
5-BROMO-3-METHYL-2-PYRIDINECARBOXIMIDAMIDE
CAS:1179533-19-7
Formula: C7H8BrN3
KIN05285292
5-BROMO-3-METHYL-2-PYRIDINECARBOXIMIDAMIDE HCL
CAS:1179360-96-3
Formula: C7H8BrN3.ClH;C7H9BrClN3
KIN05284630
5-BROMO-3-METHYL-2-PYRIDINECARBOXYLIC ACID METHYL ESTER
CAS:213771-32-5
Formula: C8H8BrNO2
KIN03425575
5-BROMO-3-METHYL-2-PYRIDINEMETHANOL
CAS:245765-71-3
Formula: C7H8BrNO
KIN03448230
5-BROMO-3-METHYL-2-PYRIDINEPROPANAMINE
CAS:112860-51-2
Formula: C9H13BrN2
KIN03118695
5-BROMO-3-METHYL-2-THIOPHENECARBALDEHYDE
CAS:38239-46-2
Formula: C6H5BrOS
KIN02246407
5-BROMO-3-METHYL-2-THIOPHENECARBONITRILE
CAS:38239-48-4
Formula: C6H4BrNS
KIN02246409
5-BROMO-3-METHYL-2-THIOPHENEMETHANOL
CAS:476155-84-7
Formula: C6H7BrOS
KIN03602958
5-BROMO-3-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE-2-YLAMINE
CAS:1097725-73-9
Formula: C7H7BrN4
KIN05160794
5-BROMO-3-METHYL-3H-IMIDAZO[4,5-F]QUINOLIN-2-YLAMINE
CAS:98203-07-7
Formula: C11H9BrN4
KIN02811816
5-BROMO-3-METHYL-4(3H)-PYRIMIDINONE
CAS:14248-02-3
Formula: C5H5BRN2O
KIN02029856
5-BROMO-3-METHYL-4-ISOTHIAZOLECARBOXYLIC ACID
CAS:23310-81-8
Formula: C5H4BrNO2S
KIN02118866
5-BROMO-3-METHYL-4-ISOTHIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:23310-79-4
Formula: C7H8BrNO2S
KIN02118865
5-BROMO-3-METHYL-4-NITRO-ISOTHIAZOLE
CAS:35610-98-1
Formula: C4H3BrN2O2S
KIN02224725
5-BROMO-3-METHYL-4-PHENYL-ISOXAZOLE
CAS:3356-94-3
Formula: C7H8ClNO3
KIN01087510
5-BROMO-3-METHYL-4-PIPERIDIN-1-YL-2-PYRIDINEMETHANOL
CAS:103971-34-2
KIN03663868
5-BROMO-3-METHYL-5-NITRO-1,3-OXAZINANE, HBR
CAS:13591-47-4
Formula: C5H10Br2N2O3
KIN02021783
5-BROMO-3-METHYL-6-PHENOXY-2,4(1H,3H)-PYRIMIDINEDIONE
CAS:81077-93-2
Formula: C11H9BrN2O3
KIN02647825
5-BROMO-3-METHYL-ALPHA-PROPAN-2-YL-2-BENZOFURANMETHANOL
CAS:1186543-85-0
Formula: C13H15BrO2
KIN05321348
5-BROMO-3-METHYL-BIPHENYL-2-OL
CAS:17361-99-8
Formula: C13H11BrO
KIN02061253
5-BROMO-3-METHYL-CINNOLINE
CAS:1126824-51-8
Formula: C9H7BrN2
KIN05180876
5-BROMO-3-METHYL-IMIDAZO[1,2-A]PYRIDINE
CAS:4926-55-0
Formula: C8H10N2O3
KIN01117375
5-BROMO-3-METHYL-ISOTHIAZOLE
CAS:20493-60-1
Formula: C4H4BrNS
KIN02091520
MFCD01318949
5-BROMO-3-METHYL-ISOXAZOLO[5,4-B]PYRIDINE
CAS:58035-51-1
Formula: C7H5BrN2O
KIN02409397
5-BROMO-3-METHYL-N-PHENYLPYRIDIN-2-CARBOXAMIDE
CAS:213771-38-1
KIN03425576
5-BROMO-3-METHYL-NAPHTHO[1,2-B]THIOPHEN-2-CARBALDEHYDE
CAS:62615-31-0
Formula: C14H9BrOS
KIN02477313
5-BROMO-3-METHYL-NAPHTHO[1,2-B]THIOPHENE
CAS:62615-29-6
Formula: C13H9BrS
KIN02477311
5-BROMO-3-METHYL-QUINOLINE
CAS:397322-46-2
KIN03559964
5-BROMO-3-METHYL-QUINOXALIN-2(1H)-ONE HYDRAZONE
CAS:66125-59-5
Formula: C9H9BrN4
KIN02537334
5-BROMO-3-METHYLBENZO[B]THIOPHEN-2-YLSULFONYL CHLORIDE
CAS:338797-11-8
Formula: S1c2c(cc(cc2)Br)C(=C1S(=O)(=O)Cl)C
KIN03511357
5-BROMO-3-METHYLBENZO[B]THIOPHENE
CAS:1196-12-9
Formula: C9H11NO
KIN01042897
5-BROMO-3-METHYLBENZO[D]ISOTHIAZOLE
CAS:73437-06-6
Formula: C8H6BrNS
KIN02598306
5-BROMO-3-METHYLBENZO[D]ISOXAZOL-6-OL
CAS:329349-74-8
Formula: C8H6BrNO2
KIN03500401
5-BROMO-3-METHYLBENZO[D]ISOXAZOLE
CAS:66033-76-9
Formula: C8H6BrNO
KIN02535952
MFCD08669459
5-BROMO-3-METHYLBENZO[D]ISOXAZOLE 2-OXIDE
CAS:97937-78-5
Formula: C8H6BrNO2
KIN02808872
5-BROMO-3-METHYLBENZOFURAN
CAS:33118-85-3
Formula: C9H7BrO
KIN02202700
5-BROMO-3-METHYLBENZOFURAN-2-CARBOXYLIC ACID
CAS:50638-08-9
Formula: C10H7BrO3
KIN02295614
5-Bromo-3-methyl-benzofuran-2-carboxylic acid
MFCD03965820
5-BROMO-3-METHYLBENZOFURAN-2-CARBOXYLIC ACID ETHYL ESTER
CAS:150612-59-2
KIN03296792
5-BROMO-3-METHYLENEPENT-1-ENE
CAS:122421-57-2
Formula: C6H9Br
KIN03174665
5-BROMO-3-METHYLPENTA-1,3-DIENE
CAS:53776-92-4
Formula: C6H9Br
KIN02340393
5-BROMO-3-METHYLPENTAN-1-OL
CAS:124817-80-7
Formula: C6H13BrO
KIN03185800
5-BROMO-3-METHYLPENTYL ACETATE
CAS:125161-79-7
Formula: [C8H15BrO2
KIN03187394
5-BROMO-3-METHYLPYRAZIN-2-YLAMINE
CAS:74290-67-8
Formula: C5H6BRN3
KIN02604679
5-BROMO-3-METHYLPYRIDIN-2(1H)-ONE
CAS:98042-75-2
Formula: C6H6BrNO
KIN02810075
5-BROMO-3-METHYLPYRIDIN-2-YLAMINE
CAS:3430-22-6
Formula: C6H6BrN
KIN01089043
5-BROMO-3-METHYLPYRIDIN-2-YLAMINE 1-OXIDE
CAS:53669-67-3
Formula: C6H7BrN2O
KIN02338758
5-BROMO-3-METHYLTHIO-2-(3-METHYLTHIOTHIOPHEN-2-YL)THIOPHENE
CAS:191213-55-5
Formula: C10H9BrS4
KIN03392200
5-BROMO-3-METHYLTHIOPHEN-2-CARBOXYLIC ACID
CAS:38239-45-1
Formula: C10H14
KIN02246406
MFCD11040352
5-BROMO-3-MORPHOLIN-4-YLPYRAZIN-2-YLAMINE
CAS:117719-17-2
Formula: C8H11BrN4O
KIN03150385
5-BROMO-3-NITRO-1-PHENYLPYRIDIN-2-ONE
CAS:381233-93-8
Formula: C11H7BrN2O3
KIN03550218
5-BROMO-3-NITRO-1H-[1,2,4]-TRIAZOLE
CAS:24807-56-5
Formula: C2HBrN4O2
KIN02134027
MFCD00153930
5-BROMO-3-NITRO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1190311-16-0
Formula: C7H4BrN3O2
KIN05330104
5-BROMO-3-NITRO-2(1H)-PYRIDINONE
CAS:15862-34-7
Formula: C5H3BrN2O3
KIN02044863
MFCD00023473
5-BROMO-3-NITRO-2(1H)-PYRIDINONE HBR
CAS:246543-32-8
Formula: C5H3BrN2O3.BrH
KIN03448629
5-BROMO-3-NITRO-2-(1H-PYRAZOL-1-YL)-PYRIDINE
CAS:446284-40-8
Formula: C8H5BrN4O2
KIN03588530
5-BROMO-3-NITRO-2-(2-NITROETHENYL)-1H-PYRROLE
CAS:1112182-37-2
Formula: C6H4BrN3O4
KIN05174969
5-BROMO-3-NITRO-2-(2-NITROETHENYL)FURAN
CAS:1112177-96-4
Formula: C6H3BrN2O5
KIN05174826
5-BROMO-3-NITRO-2-(PYRROLIDIN-1-YL)-PYRIDINE
CAS:1020253-22-8
Formula: C9H10BrN3O2
KIN05049430
5-BROMO-3-NITRO-2-AMINO-ANILINE
CAS:84752-20-5
Formula: C6H6BRN3O2
KIN02669668
5-BROMO-3-NITRO-2-PIPERIDIN-1-YLPYRIDINE
CAS:1033202-41-3
Formula: C10H12BrN3O2
KIN05067633
5-BROMO-3-NITRO-2-PYRIDINEBUTANENITRILE
CAS:92508-97-9
Formula: C9H8BrN3O2
KIN02757618
5-BROMO-3-NITRO-2-PYRIDINECARBOXAMIDE
CAS:412035-35-9
Formula: C6H4BrN3O3
KIN03570196
5-BROMO-3-NITRO-2-PYRIDINEETHANAMINE
CAS:1174007-38-5
Formula: C7H8BrN3O2
KIN05265328
5-BROMO-3-NITRO-2-PYRIDINEMETHANAMINE
CAS:1174007-35-2
Formula: C6H6BRN3O2
KIN05265325
5-BROMO-3-NITRO-3H-PYRROL-2-AMINE
CAS:1081815-38-4
Formula: C4H4BrN3O2
KIN05117880
5-BROMO-3-NITRO-IMIDAZO[1,2-A]PYRIDINE
CAS:111753-05-0
Formula: C7H4BrN3O2
KIN03109859
5-BROMO-3-NITRO-N-PHENYLPYRIDIN-2-YLAMINE
CAS:77064-57-4
Formula: C11H8BrN3O2
KIN02623043
5-BROMO-3-NITRO-N-PROPYLPYRIDIN-2-YLAMINE
CAS:1033202-50-4
Formula: C8H10BrN3O2
KIN05067637
5-BROMO-3-NITRO-THIOPHEN-2-CARBOXYLIC ACID
CAS:101079-64-5
Formula: C5H2BrNO4S
KIN03036843
5-BROMO-3-NITROPYRIDIN-2-CARBALDEHYDE
CAS:1086838-46-1
Formula: C6H3BrN2O3
KIN05126163
5-BROMO-3-NITROPYRIDIN-2-YLAMINE
CAS:6945-69-3
Formula: C21H15NS
KIN01173706
5-BROMO-3-NITROPYRIDIN-2-YLOXY)-ACETIC ACID ETHYL ESTER
CAS:105544-30-7
Formula: C9H9BrN2O5
KIN03069030
5-BROMO-3-NITROSO-1H-INDOLE
CAS:76983-63-6
Formula: C8H5BrN2O
KIN02622688
5-BROMO-3-OXAZOLO[4,5-B]PYRIDIN-2-YLPYRIDIN-2-YLAMINE
CAS:1146951-79-2
Formula: C11H7BrN4O
KIN05194837
5-BROMO-3-OXAZOLO[5,4-B]PYRIDIN-2-YLPYRIDIN-2-YLAMINE
CAS:1146633-95-5
Formula: C11H7BrN4O
KIN05194571
5-BROMO-3-OXAZOLO[5,4-C]PYRIDIN-2-YLPYRIDIN-2-YLAMINE
CAS:1146633-96-6
Formula: C11H7BrN4O
KIN05194572
5-BROMO-3-PENTYN-1-YL ACETATE
CAS:91991-58-1
Formula: C7H9BrO2
KIN02751509
5-BROMO-3-PHENYL-1,2,4-THIADIAZOLE
CAS:101494-82-0
KIN03039798
5-BROMO-3-PHENYL-1H-[1,2,4]-TRIAZOLE
CAS:15777-59-0
Formula: C8H6BrN3
KIN02044042
5-BROMO-3-PHENYL-1H-BENZO[D]IMIDAZOL-2-ONE
CAS:79759-42-5
Formula: C13H9BrN2O
KIN02639720
5-BROMO-3-PHENYL-1H-INDAZOLE
CAS:57639-16-4
Formula: C13H9BrN2
KIN02402769
5-BROMO-3-PHENYL-1H-INDOL-2-CARBALDEHYDE
CAS:59394-41-1
Formula: C15H10BrNO
KIN02430776
5-BROMO-3-PHENYL-1H-INDOL-2-CARBOHYDRAZIDE
CAS:70070-24-5
Formula: C15H12BrN3O
KIN02574987
5-BROMO-3-PHENYL-1H-INDOL-2-CARBONITRILE
CAS:62039-71-8
Formula: C15H9BrN2
KIN02466711
5-BROMO-3-PHENYL-1H-INDOL-2-CARBONYL AZIDE
CAS:70070-27-8
Formula: C15H9BrN4O
KIN02574989
5-BROMO-3-PHENYL-1H-INDOL-2-CARBOXYLIC ACID ETHYL ESTER
CAS:59394-42-2
Formula: C17H14BrNO2
KIN02430777
5-BROMO-3-PHENYL-1H-INDOL-2-YLAMINE
CAS:70070-41-6
Formula: C14H11BrN2
KIN02574992
5-BROMO-3-PHENYL-1H-INDOLE
CAS:54470-19-8
Formula: C14H10BrN
KIN02350525
5-BROMO-3-PHENYL-1H-PYRAZOLO[3,4-C]PYRIDINE
CAS:1114523-60-2
Formula: C12H8BrN3
KIN05175380
5-BROMO-3-PHENYL-2(1H)-PYRAZINONE
CAS:98993-82-9
Formula: C10H7BrN2O
KIN02817114
5-BROMO-3-PHENYL-2(1H)-PYRIDINONE
CAS:130532-91-1
KIN03210325
5-BROMO-3-PHENYL-2(5H)-FURANONE
CAS:67030-93-7
Formula: C10H7BrO2
KIN02547891
5-BROMO-3-PHENYL-2,3-DIHYDROOXAZOLE
CAS:3356-93-2
KIN01087509
5-BROMO-3-PHENYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:95065-63-7
Formula: C9H7BrN2O2
KIN02787726
5-BROMO-3-PHENYL-2-PYRIDINAMINE
CAS:130532-89-7
Formula: C11H9BrN2
KIN03210323
5-BROMO-3-PHENYL-2-THIOIDENE-THIAZOLIDIN-4-ONE
CAS:56921-38-1
Formula: C9H6BrNOS2
KIN02390940
5-BROMO-3-PHENYL-2H-INDOL-2-ONE
CAS:1022160-98-0
Formula: C14H8BrNO
KIN05056063
5-BROMO-3-PHENYL-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDINE
CAS:139109-80-1
Formula: C10H6BrN5
KIN03250694
5-BROMO-3-PHENYL-4(5H)-ISOXAZOLONE
CAS:193346-71-3
KIN03396222
5-BROMO-3-PHENYL-4-ISOTHIAZOLAMINE
CAS:301686-30-6
KIN03477690
5-BROMO-3-PHENYL-4-ISOTHIAZOLECARBONITRILE
CAS:301686-28-2
KIN03477688
5-BROMO-3-PHENYL-4-ISOTHIAZOLECARBOXAMIDE
CAS:301686-29-3
KIN03477689
5-BROMO-3-PHENYL-4-ISOTHIAZOLECARBOXYLIC ACID
CAS:18160-83-3
KIN02069327
5-BROMO-3-PHENYL-4-ISOTHIAZOLECARBOXYLIC ACID METHYL ESTER
CAS:18160-84-4
KIN02069328
5-BROMO-3-PHENYL-4-ISOXAZOLECARBALDEHYDE
CAS:1188092-06-9
Formula: C10H6BrNO2
KIN05325407
5-BROMO-3-PHENYL-4-ISOXAZOLEMETHANOL
CAS:1188228-96-7
Formula: C10H8BrNO2
KIN05326887
5-BROMO-3-PHENYL-4-PENTYNE-2,3-DIOL
CAS:91065-85-9
Formula: C11H11BrO2
KIN02738196
5-BROMO-3-PHENYL-ISOTHIAZOLE
CAS:13363-44-5
Formula: C9H6BrNS
KIN02018498
5-BROMO-3-PHENYLBENZO[B]THIOPHEN-2-CARBONITRILE
CAS:58878-48-1
Formula: C15H8BrNS
KIN02422471
5-BROMO-3-PHENYLBENZO[B]THIOPHEN-2-CARBOXAMIDE
CAS:58878-46-9
Formula: C15H10BrNOS
KIN02422470
5-BROMO-3-PHENYLBENZO[B]THIOPHEN-2-CARBOXYLIC ACID
CAS:58878-45-8
Formula: C15H9BrO2S
KIN02422469
5-BROMO-3-PHENYLBENZO[B]THIOPHEN-2-CARBOXYLIC ACID METHYL ESTER
CAS:58878-43-6
Formula: C16H11BrO2S
KIN02422467
5-BROMO-3-PHENYLBENZO[C]ISOXAZOLE
CAS:885-37-0
KIN01032926
5-BROMO-3-PHENYLBENZO[D]ISOXAZOLE
CAS:402914-15-2
Formula: C13H8BrNO
KIN03563961
5-BROMO-3-PHENYLBENZOFURAN
CAS:63362-84-5
Formula: C14H9BrO
KIN02491301
5-BROMO-3-PHENYLPYRAN-2-ONE
CAS:478704-43-7
Formula: C11H7BrO2
KIN03607091
5-BROMO-3-PHENYLPYRAZIN-2-YLAMINE
CAS:344940-70-1
Formula: C10H8BrN3
KIN03521194
5-BROMO-3-PHENYLPYRIDAZINE
CAS:207223-83-4
KIN03416995
5-BROMO-3-PIPERIDIN-1-YLPYRAZIN-2-YLAMINE
CAS:90674-84-3
Formula: C9H13BrN4
KIN02731556
MFCD08460061
5-BROMO-3-PIPERIDIN-4-YL-1H-INDOLE
CAS:149669-42-1
Formula: C13H15BrN2
KIN03293401
5-BROMO-3-PROPAN-2-YL-2-NITRO-THIOPHENE
CAS:73644-86-7
Formula: C7H8BrNO2S
KIN02599673
5-BROMO-3-PROPYL-1H-[1,2,4]-TRIAZOLE
CAS:141831-71-2
Formula: C5H8BrN3
KIN03262224
5-BROMO-3-PROPYL-1H-INDAZOLE
CAS:1197943-62-6
Formula: C10H11BrN2
KIN05341683
5-BROMO-3-PROPYLPYRAZIN-2-YLAMINE
CAS:187973-43-9
Formula: C7H10BrN3
KIN03384120
5-BROMO-3-PYRIDAZINAMINE
CAS:1187237-00-8
Formula: C4H4BrN3
KIN05322541
5-BROMO-3-PYRIDIN-2-YL-1H-INDAZOLE
CAS:82616-92-0
Formula: C12H8BrN3
KIN02656620
5-BROMO-3-PYRIDIN-2-YL-1H-INDOL-2-CARBONITRILE
CAS:53497-51-1
Formula: C14H8BrN3
KIN02336112
5-BROMO-3-PYRIDIN-2-YL-1H-INDOL-2-CARBONITRILE HBR
CAS:65076-80-4
Formula: C14H8BrN3.xBrH
KIN02520606
5-BROMO-3-PYRIDIN-4-YL-1H-INDOLE
CAS:61995-59-3
Formula: C13H9BrN2
KIN02465835
5-BROMO-3-PYRIDINEACETAMIDE
CAS:173999-43-4
Formula: C7H7BrN2O
KIN03354789
5-BROMO-3-PYRIDINEACETIC ACID
CAS:39891-12-8
Formula: C7H6BrNO2
KIN02258328
MFCD00829308
5-BROMO-3-PYRIDINEACETIC ACID METHYL ESTER
CAS:118650-08-1
Formula: C8H8BrNO2
KIN03155299
5-BROMO-3-PYRIDINEACETONITRILE
CAS:39891-08-2
Formula: C7H5BrN2
KIN02258325
(5-Bromopyridin-3-yl)acetonitrile
MFCD06657722
5-BROMO-3-PYRIDINECARBONYL CHLORIDE
CAS:39620-02-5
Formula: C6H3BrClNO
KIN02256214
5-Bromopyridin-3-carbonyl chloride; 5-Bromo-3-pyri
MFCD00173853
5-BROMO-3-PYRIDINECARBONYL ISOTHIOCYANATE
CAS:1154347-66-6
Formula: C7H3BrN2OS
KIN05216989
5-BROMO-3-PYRIDINECARBOXALDEHYDE
CAS:113118-81-3
Formula: C6H4BrNO
KIN03120421
5-BROMO-3-PYRIDINECARBOXIMIDAMIDE
CAS:345591-93-7
Formula: C6H6BrN3
KIN03521777
5-BROMO-3-PYRIDINECARBOXIMIDIC ACID ETHYL ESTER
CAS:57871-11-1
Formula: C8H9BrN2O
KIN02406748
5-BROMO-3-PYRIDINECARBOXIMIDIC ACID PROPYLESTER
CAS:1027404-38-1
Formula: C9H11BrN2O
KIN05062515
5-BROMO-3-PYRIDINECARBOXYLIC ACID AZANYL ESTER
CAS:353278-86-1
Formula: C6H5BrN2O2
KIN03015420
5-BROMO-3-PYRIDINECARBOXYLIC ACID ETHYL ESTER 1-OXIDE
CAS:279248-42-9
Formula: C8H8BrNO3
KIN03466324
5-BROMO-3-PYRIDINECARBOXYLIC ACID HYDRAZIDE 1-OXIDE
CAS:1186115-33-2
Formula: C6H6BRN3O2
KIN05320651
5-BROMO-3-PYRIDINECARBOXYLIC ACID METHYL ESTER 1-OXIDE
CAS:474744-84-8
Formula: C7H6BrNO3
KIN03601714
5-BROMO-3-PYRIDINECARBOXYLIC ACID PROPYL ESTER
CAS:1033692-96-4
Formula: C9H10BrNO2
KIN05068071
5-BROMO-3-PYRIDINECARBOXYLIC ACID, 1-OXIDE
CAS:66572-58-5
Formula: C6H4BrNO3
KIN02543646
5-BROMO-3-PYRIDINEETHANAMINE
CAS:39741-47-4
Formula: C7H9BrN2
KIN02257106
MFCD07375058
5-BROMO-3-PYRIDINEMETHANAMINE
CAS:135124-70-8
Formula: C6H7BrN2
KIN03231520
5-BROMO-3-PYRIDINEMETHANOL
CAS:37669-64-0
Formula: C6H6BrNO
KIN02241548
MFCD03265757
5-BROMO-3-PYRIDINEMETHANOL 3-ACETATE
CAS:351529-23-2
Formula: C8H8BrNO2
KIN03529181
5-BROMO-3-PYRIDINEMETHANOL 3-METHANESULFONATE
CAS:145743-86-8
Formula: C7H8BrNO3S
KIN03280528
5-BROMO-3-PYRIDINEMETHANOL CARBAMATE(ESTER)
CAS:173999-36-5
Formula: C7H7BrN2O2
KIN03354786
5-BROMO-3-PYRIDINEPROPANAMIDE
CAS:39619-92-6
Formula: C8H9BrN2O
KIN02256212
5-BROMO-3-PYRIDINEPROPANAMINE
CAS:1000553-13-8
Formula: C8H11BrN2
KIN05003271
5-BROMO-3-PYRIDINEPROPANOIC ACID
CAS:1022128-98-8
Formula: C8H8BrNO2
KIN05055944
5-BROMO-3-PYRIDINEPROPANOIC ACID METHYL ESTER
CAS:39619-90-4
Formula: C9H10BrNO2
KIN02256211
5-BROMO-3-PYRIDINESULFONAMIDE
CAS:62009-33-0
Formula: C5H5BrN2O2S
KIN02466086
MFCD08235088
5-BROMO-3-PYRIDINESULFONIC ACID SILVER(I) SALT(1:1)
CAS:62009-34-1
Formula: C5H4BrNO3S
KIN02466087
MFCD00717696
5-BROMO-3-PYRIDINESULFONYL CHLORIDE
CAS:65001-21-0
Formula: C5H3BrClNO2S
KIN02519393
MFCD08235263
5-BROMO-3-PYRIDINOL
CAS:74115-13-2
Formula: C5H4BrNO
KIN02603414
MFCD00661305
5-BROMO-3-SEC-BUTYL-1,6-DIMETHYLPYRIMIDIN-2,4(1H,3H)-DIONE
CAS:7692-49-1
Formula: C10H15ClN2O2
KIN01193461
5-BROMO-3-SEC-BUTYL-6-METHYL-1,2-DIHYDRO-2-THIOXO-PYRIMIDIN-4(3H)-ONE
CAS:24561-91-9
KIN02131626
5-BROMO-3-SEC-BUTYL-6-METHYL-4-THIOXO-3,4-DIHYDROPYRIMIDIN-2(1H)-ONE
CAS:24561-92-0
Formula: C9H13BrN2OS
KIN02131627
5-BROMO-3-TERT-BUTYL-1-METHYL-1H-PYRAZOLE
CAS:1187968-59-7
KIN05324446
5-BROMO-3-THIOPHEN-2-YLPYRAN-2-ONE
CAS:478704-60-8
Formula: C9H5BrO2S
KIN03607092
5-BROMO-3-THIOPHENAMINE
CAS:81974-99-4
Formula: C4H4BrNS
KIN02652732
5-BROMO-3-THIOPHENEACETIC ACID
CAS:1057217-28-3
Formula: C6H5BrO2S
KIN05103677
5-BROMO-3-THIOPHENEBORONIC ACID
CAS:101084-18-8
Formula: C4H4BBrO2S
KIN03036938
5-BROMO-3-THIOPHENEBORONIC ACID BIS(2-AMINOETHYL) ESTER
CAS:125928-60-1
Formula: C8H14BBrN2O2S
KIN03630177
5-BROMO-3-THIOPHENECARBALDEHYDE
CAS:18791-79-2
Formula: C5H3BrOS
KIN02075181
MFCD09042555
5-BROMO-3-THIOPHENECARBALDEHYDE OXIME
CAS:18791-96-3
Formula: C5H4BrNOS
KIN02075184
5-BROMO-3-THIOPHENECARBOHYDRAZIDE
CAS:1094734-23-2
Formula: C5H5BrN2OS
KIN05144725
5-BROMO-3-THIOPHENECARBONITRILE
CAS:18792-00-2
Formula: C5H2BrNS
KIN02075188
5-BROMO-3-THIOPHENECARBONYL CHLORIDE
CAS:98215-44-2
Formula: C5H2BrClOS
KIN02811945
5-BROMO-3-THIOPHENECARBOXAMIDE
CAS:189329-94-0
Formula: C5H4BrNOS
KIN03388645
5-BROMO-3-THIOPHENECARBOXYLIC ACID
CAS:100523-84-0
Formula: [C5H3BrO2S
KIN03032524
5-BROMO-3-THIOPHENECARBOXYLIC ACID METHYL ESTER
CAS:88770-19-8
Formula: C6H5BrO2S
KIN02702510
5-BROMO-3-THIOPHENEMETHANAMINE
CAS:1087784-61-9
Formula: C5H6BrNS
KIN05127068
5-BROMO-3-THIOPHENEMETHANOL
CAS:73919-88-7
Formula: C5H5BrOS
KIN02601860
5-BROMO-3A,4,5,6,7,7A-HEXAHYDRO-1H-4,7-METHANOINDENE
CAS:6936-54-5
Formula: C11H11N5O2
KIN01173012
5-BROMO-3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1H-INDENE
CAS:10466-45-2
KIN02006718
5-BROMO-3A,4,7,7A-TETRAHYDRO-1,3-ISOBENZOFURANDIONE
CAS:101084-40-6
Formula: C8H7BrO3
KIN03674932
5-BROMO-3H-1'-AZASPIRO[FURO[2,3-B]PYRIDIN-2,3'-BICYCLO[2.2.2]OCTANE]
CAS:220099-92-3
KIN03433022
5-BROMO-3H-BENZO[C][1,2,5]OXADIAZOL-1-IUM 1-OXIDE
CAS:7236-16-0
Formula: C7H5BrN
KIN01182213
5-BROMO-3H-BENZO[D][1,2]OXATHIOL-2,2-DIOXIDE
CAS:27238-10-4
Formula: C7H5BrO3S
KIN02155408
5-BROMO-3H-BENZO[D]IMIDAZOL-4-YLAMINE
CAS:260883-50-8
Formula: C7H6BrN3
KIN03458571
5-BROMO-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:28279-52-9
Formula: C6H4BrN3
KIN02164745
5-BROMO-3H-INDOL-2-CARBOXYLIC ACID 1-OXIDE
CAS:17422-57-0
KIN02061895
5-BROMO-3H-INDOL-3-ONE OXIME
CAS:76983-85-2
Formula: C8H5BrN2O
KIN02622694
5-BROMO-4'-(HYDROXYMETHYL) -BIPHENYL-3-CARBONITRILE
CAS:148289-84-3
KIN03010095
5-BROMO-4'-CHLORO-SALICYLANILIDE
CAS:3679-65-0
Formula: C13H12N2O2
KIN01093803
5-BROMO-4'-METHOXY-BIPHENYL-2-YLAMINE
CAS:1001274-34-5
Formula: C13H12BrNO
KIN05005599
5-BROMO-4'-METHYL-2,3'-BIPYRIDINE
CAS:1187165-97-4
Formula: C11H9BrN2
KIN05322134
5-BROMO-4'-METHYL-BIPHENYL-2-CARBOXYLIC ACID
CAS:1092455-39-4
Formula: C14H11BrO2
KIN05134022
5-BROMO-4(3H)-PYRIMIDINETHIONE
CAS:14248-03-4
Formula: C4H3BrN2S
KIN02029857
5-BROMO-4(3H)-PYRIMIDINONE
CAS:19808-30-1
Formula: C4H3BrN2O
KIN02084840
MFCD00223740
5-BROMO-4,4'-DIMETHYL-2,2'-BIPYRIDINE
CAS:162612-10-4
KIN03331898
5-BROMO-4,4,5,5-TETRAFLUOROPENTAN-1-OL
CAS:222725-20-4
Formula: C5H7BrF4O
KIN03437446
5-BROMO-4,4,5,5-TETRAFLUOROPENTANOIC ACID
CAS:234443-22-2
Formula: C5H5BrF4O2
KIN03444028
5-BROMO-4,4-DIMETHYL-1-PENTENE
CAS:76207-20-0
Formula: C7H13Br
KIN02617639
5-BROMO-4,5'-BIPYRIMIDINE
CAS:4595-64-6
Formula: C8H11BrN2
KIN01111075
5-BROMO-4,5,6,7-TETRAHYDRO-6-HYDROXY-1(3H)-ISOBENZOFURANONE
CAS:21483-55-6
Formula: C8H9BrO3
KIN02101242
5-BROMO-4,5-DIHYDRO-1,4-DIMETHYL-1H-TETRAZABOROLE
CAS:21960-50-9
Formula: C2H6BBrN4
KIN02105874
5-BROMO-4,5-DIHYDRO-5-METHYL-3,1-BENZOXAZEPIN-2(1H)-ONE
CAS:490036-02-7
Formula: C10H10BrNO2
KIN03612549
5-BROMO-4,6(1H,5H)-PYRIMIDINEDIONE
CAS:52176-13-3
Formula: C4H3BrN2O2
KIN02317357
5-BROMO-4,6,6-TRIMETHOXY-2-HEXENE
CAS:93847-06-4
Formula: C9H17BrO3
KIN02774481
5-BROMO-4,6-BIS(METHYLTHIO)-PYRIMIDINE
CAS:4786-72-5
Formula: C6H6BrClN2
KIN01114664
5-BROMO-4,6-BIS(MORPHOLIN-4-YLMETHYL)-PYRIMIDIN-2-YLAMINE
CAS:5430-56-8
Formula: C15H17NO2
KIN01130536
5-BROMO-4,6-BIS(PROPYLTHIO)-PYRIMIDINE
CAS:6310-04-9
Formula: C6H8N2S2
KIN01157218
5-BROMO-4,6-BIS(TRIFLUOROMETHYL)-PYRIDIN-2-AMINE
CAS:1000152-87-3
Formula: C7H3BrF6N2
KIN05000258
5-BROMO-4,6-BIS[(BENZYL)THIO]PYRIMIDINE
CAS:6308-37-8
Formula: C18H11BrCl4N2S2
KIN01157064
5-BROMO-4,6-BIS[[(2,4-DICHLOROPHENYL)METHYL]THIO]PYRIMIDINE
CAS:6308-38-9
Formula: C5H6N2S2
KIN01157065
5-BROMO-4,6-DI-TERT-BUTYL-2-METHYLPYRIMIDINE
CAS:128939-66-2
Formula: C13H21BrN2
KIN03203630
5-BROMO-4,6-DICHLORO-1H-INDOL-2,3-DIONE
CAS:1176058-73-3
Formula: C8H2BrCl2NO2
KIN05268571
5-BROMO-4,6-DICHLORO-2-(METHYLTHIO)-PYRIMIDINE
CAS:98136-20-0
Formula: C5H3BrCl2N2S
KIN02811086
5-BROMO-4,6-DICHLORO-2-METHANESULFONYLPYRIMIDINE
CAS:98028-01-4
KIN02809937
5-BROMO-4,6-DICHLORO-2-METHYLPYRIMIDINE
CAS:1086376-43-3
Formula: C5H3BrCl2N2
KIN05125644
5-BROMO-4,6-DICHLOROBENZO[D][1,3]DIOXOLE
CAS:72736-61-9
Formula: C7H3BrCl2O2
KIN02593422
5-BROMO-4,6-DICHLOROPYRIMIDIN-2-YLAMINE
CAS:7781-29-5
Formula: C11H12N4
KIN01195011
5-BROMO-4,6-DICHLOROPYRIMIDINE
CAS:68797-61-5
Formula: C4HBrCl2N2
KIN02565764
MFCD00047379
5-BROMO-4,6-DIETHOXY-PYRIDIN-2-YLAMINE
CAS:52311-31-6
KIN02319238
5-BROMO-4,6-DIETHOXY-PYRIMIDINE
CAS:4319-91-9
KIN01105131
5-BROMO-4,6-DIETHYL-2,3-DIHYDRO-7-NITRO-1H-INDOLE
CAS:1027039-23-1
Formula: C12H15BrN2O2
KIN05061841
5-BROMO-4,6-DIFLUORO-1H-INDOLE
CAS:1154742-51-4
Formula: C8H4BrF2N
KIN05220212
5-Bromo-4,6-difluoro-indole
5-BROMO-4,6-DIHYDRAZINYLPYRIMIDINE
CAS:825-50-3
KIN01030821
5-BROMO-4,6-DIHYDROXY-1,3-BENZENEDICARBONITRILE
CAS:73417-37-5
Formula: C8H3BrN2O2
KIN02598196
5-BROMO-4,6-DIMETHOXY-2-METHYLPYRIMIDINE
CAS:4319-84-0
Formula: C8H11BrN2O2
KIN01105125
5-BROMO-4,6-DIMETHOXY-2-PHENYLPYRIMIDINE
CAS:4319-83-9
Formula: C7H9BrN2O2
KIN01105124
5-BROMO-4,6-DIMETHOXY-2-PYRIMIDINAMINE
CAS:1158074-68-0
Formula: C6H8BrN3O2
KIN05252506
5-BROMO-4,6-DIMETHOXY-PYRIMIDINE
CAS:4319-78-2
Formula: C7H9BrN2O3
KIN01105122
5-BROMO-4,6-DIMETHYL-1,2,3-TRIAZINE
CAS:109520-03-8
Formula: C5H6BRN3
KIN03095805
5-BROMO-4,6-DIMETHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-YLAMINE
CAS:42951-65-5
Formula: C8H9BrN4
KIN02281656
5-BROMO-4,6-DIMETHYL-2(1H)-ALPHA-PYRIDINETHIONE
CAS:1021876-85-6
Formula: C7H8BrNS
KIN05055500
5-BROMO-4,6-DIMETHYL-2(1H)-PYRIDINONE
CAS:89694-55-3
Formula: C7H8BrNO
KIN02715677
5-BROMO-4,6-DIMETHYL-2(1H)-PYRIDINONE HCL
CAS:99314-63-3
KIN02819508
5-BROMO-4,6-DIMETHYL-2(1H)-PYRIMIDINONE
CAS:7781-21-7
Formula: C8H12N2O
KIN01195008
5-BROMO-4,6-DIMETHYL-2(1H)-PYRIMIDINONE HBR
CAS:63331-39-5
Formula: C6H7BrN2O.BrH
KIN02490704
5-BROMO-4,6-DIMETHYL-2,3-PYRIDINEDIAMINE
CAS:89728-15-4
Formula: C7H10BrN3
KIN02716130
5-BROMO-4,6-DIMETHYL-2-(METHYLSULFONYL)-PYRIMIDINE
CAS:1017398-55-8
Formula: C7H9BrN2O2S
KIN05033099
5-BROMO-4,6-DIMETHYL-2-PIPERIDIN-1-YLPYRIMIDINE
CAS:7749-82-8
KIN01194463
5-BROMO-4,6-DIMETHYL-2-PYRIDINAMINE
CAS:89856-44-0
Formula: C7H9BrN2
KIN02718228
MFCD00151793
5-BROMO-4,6-DIMETHYL-2-PYRIDINEACETAMIDE
CAS:90887-64-2
Formula: C9H11BrN2O
KIN02735164
5-BROMO-4,6-DIMETHYL-3-NITRO-2(1H)-PYRIDINONE
CAS:89677-52-1
Formula: C7H7BRN2O3
KIN02715341
5-BROMO-4,6-DIMETHYL-3-NITRO-2-PYRIDINAMINE
CAS:89791-76-4
Formula: C7H8BrN3O2
KIN02717071
5-BROMO-4,6-DIMETHYL-3-PYRIDINECARBONITRILE
CAS:63644-86-0
Formula: C8H7BrN2
KIN02496474
5-BROMO-4,6-DIMETHYL-3-PYRIDINECARBOXYLIC ACID
CAS:93350-01-7
Formula: C8H8BrNO2
KIN02768354
MFCD07366090
5-BROMO-4,6-DIMETHYL-3-PYRIDINEMETHANAMINE
CAS:63644-74-6
Formula: C8H11BrN2
KIN02496470
5-BROMO-4,6-DIMETHYL-3-PYRIDINEMETHANOL
CAS:63644-87-1
Formula: C8H10BrNO
KIN02496475
5-BROMO-4,6-DIMETHYL-N-NITRO-2-PYRIDINAMINE
CAS:89694-66-6
Formula: C7H8BrN3O2
KIN02715684
5-BROMO-4,6-DIMETHYLPYRIMIDIN-2-YLAMINE
CAS:4214-59-9
Formula: C11H11N3
KIN01103157
5-BROMO-4,6-DIMETHYLPYRIMIDINE
CAS:157335-97-2
Formula: C6H7BrN2
KIN03317848
5-BROMO-4,6-PYRIMIDINEDIAMINE
CAS:58023-98-6
Formula: C4H5BrN4
KIN02409235
5-BROMO-4,6-PYRIMIDINEDICARBONITRILE
CAS:1100048-00-7
Formula: C6HBrN4
KIN05166186
5-BROMO-4,7-DIHYDRO-1,3-DIOXEPINE
CAS:61253-91-6
Formula: C5H7BrO2
KIN02453276
MFCD08706212
5-BROMO-4,7-DIHYDRO-2-PROPAN-2-YL-1,3-DIOXEPIN
CAS:91477-60-0
Formula: C8H13BrO2
KIN02744285
5-BROMO-4,7-DIHYDRO-6(5H)-BENZO[D]THIAZOLONE
CAS:76989-32-7
KIN02622712
5-BROMO-4,7-DIMETHOXY-1H-INDOL-2,3-DIONE
CAS:92635-31-9
Formula: C10H8BrNO4
KIN02759489
5-BROMO-4,7-DIMETHOXY-BENZO[D][1,3]DIOXOLE
CAS:86319-74-6
Formula: C9H9BrO4
KIN02679723
5-BROMO-4,7-DIMETHYL-1H-INDOL-2,3-DIONE
CAS:65818-97-5
Formula: C10H8BrNO2
KIN02532851
5-BROMO-4,7-DIMETHYL-6-NITRO-BENZO[D][1,3]DIOXOLE
CAS:93399-26-9
Formula: C9H8BrNO4
KIN02768983
5-BROMO-4,7-DIMETHYLBENZO[D][1,3]DIOXOLE
CAS:74131-60-5
Formula: C9H9BrO2
KIN02603554
5-BROMO-4-((2-CHLOROBENZYL)THIO)-6-METHYLPYRIMIDIN-2-YLAMINE
CAS:6299-30-5
Formula: C5H6N2S3
KIN01156374
5-BROMO-4-([1,3]DIOXOLAN-2-YL) -2-METHOXY-PHENOL
CAS:472955-00-3
Formula: C10H11BrO4
KIN03599687
5-BROMO-4-(1,1 -DIMETHYLETHYL)PENTANAL
CAS:142722-52-9
Formula: C9H17BrO
KIN03266302
5-BROMO-4-(1,1-DIMETHYLETHYL)-2(5H)-OXAZOLONE
CAS:90311-66-3
Formula: C7H10BrNO2
KIN02725828
5-BROMO-4-(1-ETHOXYETHOXY) -2H-BENZO[D][1,3]DIOXOLANE
CAS:192210-65-4
Formula: C11H13BrO4
KIN03393657
5-BROMO-4-(1-METHYLETHYL)-2-PYRIMIDINAMINE
CAS:1192813-91-4
Formula: C7H10BrN3
KIN05334418
5-BROMO-4-(1-METHYLETHYL)-THIAZOLE
CAS:1025700-46-2
Formula: C6H8BrNS
KIN05059175
5-BROMO-4-(1-NAPHTHALENYL)-2-OXAZOLAMINE
CAS:70273-21-1
Formula: C13H9BrN2O
KIN02576377
5-BROMO-4-(2,5-DIMETHYLPHENYL)-2-THIAZOLAMINE
CAS:104116-22-5
KIN03058831
5-BROMO-4-(2-CHLOROPHENYL)-1H-IMIDAZOL-2-CARBONITRILE
CAS:120118-34-5
Formula: C10H5BrClN3
KIN03652581
5-BROMO-4-(2-ETHOXY-2-OXOETHOXY) -3-THIOPHENECARBOXYLIC ACID ETHYL ESTER
CAS:108291-18-5
KIN03088129
5-BROMO-4-(2-METHYL-ALLYL)-PYRIMIDINE
CAS:1131040-42-0
Formula: C8H9BrN2
KIN05182795
5-BROMO-4-(2-METHYLPHENOXY) -PYRIMIDINE
CAS:343778-34-7
Formula: C11H9BrN2O
KIN03518157
5-BROMO-4-(2-NAPHTHALENYL)-2-OXAZOLAMINE
CAS:70273-22-2
Formula: C13H9BrN2O
KIN02576378
5-BROMO-4-(2-NITROPHENYL)-1,3-DIOXANE
CAS:191338-77-9
Formula: C10H10BrNO4
KIN03392346
5-BROMO-4-(2-PHENYLETHENYL)-PYRIMIDIN-2-YLAMINE
CAS:30614-18-7
Formula: C12H10BrN3
KIN02183523
5-BROMO-4-(2-THIENYL)-2-OXAZOLAMINE
CAS:70273-25-5
Formula: C7H5BrN2OS
KIN02576381
5-BROMO-4-(3,4-DIMETHYLPHENYL)-2-THIAZOLAMINE
CAS:104115-63-1
KIN03058812
5-BROMO-4-(3-BROMOPHENYL)-NAPHTHO[2,3-C]FURAN-1,3-DIONE
CAS:58586-76-8
Formula: C18H8Br2O3
KIN02418096
5-BROMO-4-(3-BUTEN-1-YLOXY) -2(5H)-FURANONE
CAS:126680-30-6
Formula: C8H9BrO3
KIN03194097
5-BROMO-4-(3-BUTYN-1-YLOXY) -2(5H)-FURANONE
CAS:126680-31-7
Formula: C8H7BrO3
KIN03194098
5-BROMO-4-(3-NITROPHENYL)-1,3-DIOXANE
CAS:191338-78-0
Formula: C10H10BrNO4
KIN03392347
5-BROMO-4-(3-NITROPHENYL)-1H-IMIDAZOL-2-YLAMINE
CAS:76507-37-4
Formula: C9H7BrN4O2
KIN02619727
5-BROMO-4-(3-NITROPHENYL)-2-OXAZOLAMINE
CAS:343966-25-6
Formula: C9H6BrN3O3
KIN03519050
5-BROMO-4-(3-NITROPHENYL)-2-THIOPHENAMINE
CAS:79653-23-9
Formula: C10H7BrN2O2S
KIN02639035
5-BROMO-4-(4-CHLOROPHENYL)-1H-IMIDAZOL-2-YLAMINE
CAS:76507-32-9
Formula: C9H7BrClN3
KIN02619722
5-BROMO-4-(4-CHLOROPHENYL)-1H-PYRROL-2-CARBONITRILE
CAS:122454-05-1
KIN03174994
5-BROMO-4-(4-CHLOROPHENYL)-1H-PYRROL-3-CARBOXYLIC ACID ETHYL ESTER
CAS:122454-02-8
KIN03174991
5-BROMO-4-(4-CHLOROPHENYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:122454-03-9
Formula: C11H7BrClNO2
KIN03174992
5-BROMO-4-(4-CHLOROPHENYL)-2-FURANAMINE
CAS:79653-47-7
Formula: C10H7BrClNO
KIN02639047
5-BROMO-4-(4-CHLOROPHENYL)-2-OXAZOLAMINE
CAS:70273-18-6
Formula: C9H6BrClN2O
KIN02576374
5-BROMO-4-(4-CHLOROPHENYL)-2-THIAZOLAMINE
CAS:343946-25-8
Formula: C9H6BrClN2S
KIN03518888
5-BROMO-4-(4-CHLOROPHENYL)-2-THIOPHENAMINE
CAS:79653-18-2
Formula: C10H7BrClNS
KIN02639032
5-BROMO-4-(4-CHLOROPHENYL)-N-(3-PHENYL-ALLYLIDENE)-2-OXAZOLAMINE
CAS:119121-83-4
Formula: C18H12BrClN2O
KIN03157641
5-BROMO-4-(4-CHLOROPHENYL)-N-(3-PHENYL-ALLYLIDENE)-2-THIAZOLAMINE
CAS:119121-69-6
Formula: C18H12BrClN2S
KIN03157627
5-BROMO-4-(4-CHLOROPHENYL)-N-(PHENYLMETHYLENE)-2-THIAZOLAMINE
CAS:119153-21-8
Formula: C16H10BrClN2S
KIN03157760
5-BROMO-4-(4-CYANOPHENYL)-1H-IMIDAZOL-2-CARBONITRILE
CAS:120118-85-6
Formula: C11H5BrN4
KIN03663867
5-BROMO-4-(4-ETHOXY-PHENYL) -1H-IMIDAZOL-2-CARBONITRILE
CAS:120118-87-8
Formula: C12H10BrN3O
KIN03641359
5-BROMO-4-(4-ETHOXY-PHENYL) -1H-IMIDAZOL-2-YLAMINE
CAS:76507-36-3
Formula: C11H12BrN3O
KIN02619726
5-BROMO-4-(4-ETHOXY-PHENYL) -2-THIAZOLAMINE
CAS:99853-02-8
Formula: C11H11BrN2OS
KIN02823022
5-BROMO-4-(4-ETHYLPHENYL)-2-THIAZOLAMINE
CAS:99853-08-4
Formula: C11H11BrN2S
KIN02823023
5-BROMO-4-(4-FLUOROPHENYL)-1H-IMIDAZOL-2-CARBONITRILE
CAS:120118-12-9
Formula: C10H5BrFN3
KIN03652580
5-BROMO-4-(4-FLUOROPHENYL)-2-THIAZOLAMINE
CAS:1171310-59-0
Formula: C9H6BrFN2S
KIN05262176
5-BROMO-4-(4-FLUOROPHENYL)-THIAZOL-2-YLAMINE HBR
CAS:1171027-89-6
KIN05261884
5-BROMO-4-(4-METHOXY-PHENYL) -1H-IMIDAZOL-2-YLAMINE
CAS:76507-35-2
Formula: C10H10BrN3O
KIN02619725
5-BROMO-4-(4-METHOXY-PHENYL) -1H-IMIDAZOLE
CAS:67453-36-5
Formula: C10H9BrN2O
KIN02553641
5-BROMO-4-(4-METHOXY-PHENYL) -2(3H)-THIAZOLONE
CAS:116762-61-9
Formula: C10H8BrNO2S
KIN03145797
5-BROMO-4-(4-METHOXY-PHENYL) -2-FURANAMINE
CAS:79653-50-2
Formula: C11H10BrNO2
KIN02639049
5-BROMO-4-(4-METHOXY-PHENYL) -2-THIAZOLAMINE
CAS:98946-76-0
Formula: C10H9BrN2OS
KIN02816649
5-BROMO-4-(4-METHOXY-PHENYL) -2-THIOPHENAMINE
CAS:79653-20-6
Formula: C11H10BrNOS
KIN02639034
5-BROMO-4-(4-METHOXYPHENYL) -2-OXAZOLAMINE
CAS:70273-20-0
Formula: C10H9BrN2O2
KIN02576376
5-BROMO-4-(4-METHYL-PIPERAZIN-1-YL)-PYRIMIDINE
CAS:1023754-50-8
Formula: C9H13BrN4
KIN05057645
5-BROMO-4-(4-METHYLPHENYL)-1H-IMIDAZOL-2-CARBONITRILE
CAS:120118-11-8
Formula: C11H8BrN3
KIN03652579
5-BROMO-4-(4-METHYLPHENYL)-1H-IMIDAZOL-2-YLAMINE
CAS:76507-34-1
Formula: C10H10BrN3
KIN02619724
5-BROMO-4-(4-METHYLPHENYL)-2-OXAZOLAMINE
CAS:70273-24-4
Formula: C10H9BrN2O
KIN02576380
5-BROMO-4-(4-METHYLPHENYL)-2-THIAZOLAMINE
CAS:98946-85-1
Formula: C10H9BrN2S
KIN02816654
5-BROMO-4-(4-METHYLPHENYL)-2-THIOPHENAMINE
CAS:79653-25-1
Formula: C11H10BrNS
KIN02639037
5-BROMO-4-(4-METHYLPHENYL)-5-NITRO-2-PENTANONE
CAS:1161736-95-3
Formula: C12H14BrNO3
KIN05258685
5-BROMO-4-(4-METHYLPHENYL)-N-(3-PHENYL-ALLYLIDENE)-2-OXAZOLAMINE
CAS:119121-84-5
Formula: C19H15BrN2O
KIN03157642
5-BROMO-4-(4-METHYLPHENYL)-N-(3-PHENYL-ALLYLIDENE)-2-THIAZOLAMINE
CAS:119121-70-9
Formula: C19H15BrN2S
KIN03157628
5-BROMO-4-(4-METHYLPHENYL)-N-(PHENYLMETHYLENE)-2-OXAZOLAMINE
CAS:119121-93-6
Formula: C17H13BrN2O
KIN03157651
5-BROMO-4-(4-METHYLPHENYL)-N-(PHENYLMETHYLENE)-2-THIAZOLAMINE
CAS:119121-75-4
Formula: C17H13BrN2S
KIN03157633
5-BROMO-4-(4-METHYLPHENYL)-PYRIMIDINE
CAS:149323-50-2
Formula: C11H9BrN2
KIN03292032
5-BROMO-4-(4-NITROPHENYL)-1,3-DIOXANE
CAS:91715-80-9
Formula: C10H10BrNO4
KIN02747852
5-BROMO-4-(4-NITROPHENYL)-1H-IMIDAZOL-2-YLAMINE
CAS:76507-38-5
Formula: C9H7BrN4O2
KIN02619728
5-BROMO-4-(4-NITROPHENYL)-1H-IMIDAZOLE
CAS:67453-40-1
Formula: C9H6BrN3O2
KIN02553645
5-BROMO-4-(4-NITROPHENYL)-2-OXAZOLAMINE
CAS:70273-23-3
Formula: C9H6BrN3O3
KIN02576379
5-BROMO-4-(4-NITROPHENYL)-2-THIOPHENAMINE
CAS:79653-24-0
Formula: C10H7BrN2O2S
KIN02639036
5-BROMO-4-(4-PHENYL-PIPERAZIN-1-YL)-PYRIDIN-3-YLAMINE
CAS:14549-62-3
Formula: C15H17BrN4
KIN02033170
5-BROMO-4-(BENZYL)-2(1H)-PYRIDINONE
CAS:332133-62-7
KIN03505484
5-BROMO-4-(BENZYLOXY) -1H-INDOL-3-ACETONITRILE
CAS:404888-05-7
KIN03565565
5-BROMO-4-(BENZYLOXY) -1H-INDOL-3-CARBALDEHYDE
CAS:404888-04-6
KIN03565564
5-BROMO-4-(CHLOROMETHYL)-1,3-DIPHENYL-1H-PYRAZOLE
CAS:55829-01-1
KIN02373006
5-BROMO-4-(CHLOROMETHYL)-2(5H)-FURANONE
CAS:125974-02-9
Formula: C5H4BrClO2
KIN03190953
5-BROMO-4-(CHLOROMETHYL)-2-(4-CHLOROPHENYL)-OXAZOLE
CAS:36841-55-1
KIN02234684
5-BROMO-4-(CHLOROMETHYL)-2-(4-METHYLPHENYL)-OXAZOLE
CAS:36841-53-9
Formula: C11H9BrClNO
KIN02234683
5-BROMO-4-(CHLOROMETHYL)-2-METHYL-THIAZOLE
CAS:77470-55-4
Formula: C5H5BrClNS
KIN02625810
5-BROMO-4-(CHLOROMETHYL)-2-PHENYL-OXAZOLE
CAS:36841-52-8
Formula: C10H7BrClNO
KIN02234682
5-BROMO-4-(CHLOROMETHYL)-2-PHENYL-THIAZOLE
CAS:4771-37-3
KIN01114363
5-BROMO-4-(CHLOROMETHYL)-3-(2-CHLOROPHENYL)ISOXAZOLE
CAS:1188161-54-7
Formula: C10H6BrCl2NO
KIN05326218
5-BROMO-4-(CHLOROMETHYL)-3-(2-FLUOROPHENYL)ISOXAZOLE
CAS:1188048-03-4
Formula: C10H6BrClFNO
KIN05324935
5-BROMO-4-(CHLOROMETHYL)-3-(2-METHOXY-PHENYL)ISOXAZOLE
CAS:1188161-65-0
Formula: C11H9BrClNO2
KIN05326222
5-BROMO-4-(CHLOROMETHYL)-3-(2-METHYLPHENYL)ISOXAZOLE
CAS:1188048-19-2
Formula: C11H9BrClNO
KIN05324939
5-BROMO-4-(CHLOROMETHYL)-3-(3-CHLOROPHENYL)ISOXAZOLE
CAS:1188022-27-6
Formula: C10H6BrCl2NO
KIN05324512
5-BROMO-4-(CHLOROMETHYL)-3-(3-FLUOROPHENYL)ISOXAZOLE
CAS:1188032-00-9
Formula: C10H6BrClFNO
KIN05324628
5-BROMO-4-(CHLOROMETHYL)-3-(3-METHOXY-PHENYL)ISOXAZOLE
CAS:1188054-90-1
Formula: C11H9BrClNO2
KIN05325081
5-BROMO-4-(CHLOROMETHYL)-3-(3-METHYLPHENYL)ISOXAZOLE
CAS:1188053-46-4
Formula: C11H9BrClNO
KIN05325047
5-BROMO-4-(CHLOROMETHYL)-3-(4-CHLOROPHENYL)ISOXAZOLE
CAS:1188161-46-7
Formula: C10H6BrCl2NO
KIN05326215
5-BROMO-4-(CHLOROMETHYL)-3-(4-FLUOROPHENYL)ISOXAZOLE
CAS:1188230-93-4
Formula: C10H6BrClFNO
KIN05326942
5-BROMO-4-(CHLOROMETHYL)-3-(4-METHOXY-PHENYL)ISOXAZOLE
CAS:1188139-95-8
Formula: C11H9BrClNO2
KIN05325907
5-BROMO-4-(CHLOROMETHYL)-3-(4-METHYLPHENYL)ISOXAZOLE
CAS:1188085-23-5
Formula: C11H9BrClNO
KIN05325236
5-BROMO-4-(CHLOROMETHYL)-3-PHENYL-ISOXAZOLE
CAS:1188161-39-8
Formula: C10H7BrClNO
KIN05326212
5-BROMO-4-(CHLOROSULFONYL)-2-THIOPHENECARBOXYLIC ACID
CAS:172461-89-1
Formula: C5H2BrClO4S2
KIN03350935
5-BROMO-4-(DIAZOMETHYL)-QUINOLINE
CAS:74373-62-9
Formula: C10H6BrN3
KIN02605305
5-BROMO-4-(DIBROMOMETHYL)-6-METHOXY-BENZO[H]QUINOLINE
CAS:92599-14-9
Formula: C15H10Br3NO
KIN02759003
5-BROMO-4-(DICHLOROMETHYL)-2,6-DIFLUOROPYRIMIDINE
CAS:84372-20-3
Formula: C5HBrCl2F2N2
KIN02667002
5-BROMO-4-(DICHLOROMETHYL)-2-METHYLTHIAZOLE
CAS:221558-25-4
Formula: C5H4BrCl2NS
KIN03436579
5-BROMO-4-(DIETHYLAMINO)-2-HYDROXY-BENZALDEHYDE
CAS:333303-28-9
Formula: C11H14BrNO2
KIN03681569
5-BROMO-4-(DIMETHYLAMINO)-2-PYRIDINEMETHANOL
CAS:103971-45-5
Formula: C8H11BrN2O
KIN03057617
5-BROMO-4-(ETHOXYMETHYL) -2-PHENYL-OXAZOLE
CAS:99990-31-5
Formula: C12H12BrNO2
KIN02824255
5-BROMO-4-(ETHYLAMINO)-1,3-BENZENEDICARBOXYLIC ACID
CAS:1049137-74-7
Formula: C10H10BrNO4
KIN05097503
5-BROMO-4-(ETHYLTHIO)-2-METHYL-PYRIDINE 1-OXIDE
CAS:108004-92-8
Formula: C8H10BrNOS
KIN03681568
5-BROMO-4-(FURAN-2-YL)-5-NITRO-2-PENTANONE
CAS:1161737-02-5
Formula: C9H10BrNO4
KIN05258686
5-BROMO-4-(FURAN-2-YL)-PYRIMIDIN-2-YLAMINE
CAS:357285-97-3
Formula: C8H6BrN3O
KIN03534191
5-BROMO-4-(HYDROXYMETHYL) -2-METHYL-3(2H)-PYRIDAZINONE
CAS:164036-13-9
Formula: C6H7BrN2O2
KIN03652578
5-BROMO-4-(METHYLAMINO)-1,3-BENZENEDICARBOXYLIC ACID
CAS:1049105-65-8
Formula: C9H8BrNO4
KIN05097327
5-BROMO-4-(METHYLTHIO)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1092580-03-4
KIN05134515
5-BROMO-4-(METHYLTHIO)-2-THIOPHENECARBOXYLIC ACID
CAS:94781-40-5
Formula: C6H5BrO2S2
KIN02785080
5-BROMO-4-(METHYLTHIO)-7BETA-D-RIBOFURANOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:24386-90-1
Formula: C12H14BrN3O4S
KIN02129972
5-BROMO-4-(METHYLTHIO)-PYRIMIDINE
CAS:14001-68-4
Formula: C4H3BrN2S
KIN02026961
5-BROMO-4-(OXIRANYLMETHYL) -BENZO[D][1,3]DIOXOLE
CAS:92737-68-3
Formula: C10H9BrO3
KIN02760810
5-BROMO-4-(PHENYLTHIO)-PYRIDIN-3-YLAMINE
CAS:99851-83-9
Formula: C11H9BrN2S
KIN02823009
5-BROMO-4-(PROPAN-2-YL)-THIAZOL-2-YLAMINE
CAS:1025700-49-5
Formula: C6H9BrN2S
KIN05059176
5-BROMO-4-(PYRROLIDIN-1-YL)-2-PYRIDINEMETHANOL
CAS:103971-48-8
Formula: C10H13BrN2O
KIN03057618
5-BROMO-4-(PYRROLIDINE-1-YL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1168106-35-1
Formula: C10H11BrN4
KIN05260506
5-BROMO-4-(TERT-BUTYL)-6-HYDRAZINYLPYRIMIDINE
CAS:3438-58-2
Formula: C5H7BrN4
KIN01089220
5-BROMO-4-(TERT-BUTYL)-6-METHYLPYRIMIDINE
CAS:34954-29-5
Formula: C9H13BrN2
KIN02218465
5-BROMO-4-(TERT-BUTYL)-PYRIMIDIN-2-YLAMINE
CAS:17321-92-5
Formula: C8H12BrN3
KIN02060802
5-BROMO-4-(TERT-BUTYL)-PYRIMIDINE
CAS:1439-09-4
Formula: C5H5BrN2
KIN01047037
5-BROMO-4-(TERT-BUTYL)-THIAZOL-2-YLAMINE
CAS:82202-32-2
Formula: C7H11BrN2S
KIN02654115
MFCD03695812
5-BROMO-4-(TETRAHYDROFURAN-2-YL)-PYRIMIDINE
CAS:136409-51-3
Formula: C8H9BrN2O
KIN03236733
5-BROMO-4-(THIOPHEN-2-YL)-PYRIMIDINE
CAS:5162-76-5
Formula: C30H46O4.C20H24N2O2
KIN01121936
5-BROMO-4-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:219534-99-3
Formula: [C4H2BrF3N2
KIN03431583
5-BROMO-4-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1092579-98-0
KIN05134513
5-BROMO-4-(TRIFLUOROMETHYL)-2(1H)-PYRIDINONE
CAS:109919-32-6
Formula: C6H3BrF3NO
KIN03098171
5-BROMO-4-(TRIFLUOROMETHYL)-2-OXAZOLAMINE
CAS:223685-30-1
Formula: C4H2BrF3N2O
KIN03438778
5-BROMO-4-(TRIFLUOROMETHYL)-THIAZOL-2-YLAMINE
CAS:136411-21-7
Formula: C4H2BrF3N2S
KIN03236781
5-BROMO-4-[(2,4-DICHLOROBENZYL)THIO]-2-(METHYLTHIO)-PYRIMIDINE
CAS:6341-66-8
Formula: C5H10N2O4
KIN01159709
5-BROMO-4-[(2-METHYLPYRIDIN-3-YLOXY) ]PYRIDIN-2-YLAMINE
CAS:1043022-79-2
Formula: C11H10BrN3O
KIN05092250
5-BROMO-4-[(2Z)-2-(1-PHENYLETHYLIDENE)HYDRAZINYL]-1H-PYRIDAZIN-6-ONE
CAS:6954-03-6
Formula: C13H13ClN4O3
KIN01174292
5-BROMO-4-[(4-METHYL-PIPERAZIN-1-YL)SULFONYL]BENZO[C][1,2,5]THIADIAZOLE
CAS:371943-51-0
Formula: C11H13BrN4O2S2
KIN03543366
5-BROMO-4-[(FURAN-2-YLCARBONYL)AMINO]-2-METHOXY-BENZOIC ACID METHYL ESTER
CAS:477889-85-3
Formula: C14H12BrNO5
KIN03605701
5-BROMO-4-[2-(5-CHLOROPYRIDIN-2-YL)OXIRANYL]PYRIMIDINE
CAS:89544-26-3
Formula: C11H7BrClN3O
KIN02713372
5-BROMO-4-[2-[4-(DIMETHYLAMINO)PHENYL]-ETHENYL]-2,3-DIHYDRO-2,2-DIMETHYL-1,5-BENZOTHIAZEPINIUM BROMIDE
CAS:55558-22-0
Formula: C21H24BrN2S.Br
KIN02368452
5-BROMO-4-[4-(4-METHYLPHENYL)PIPERAZIN-1-YL]PYRIDIN-3-YLAMINE
CAS:14549-72-5
Formula: C16H19BrN4
KIN02033180
5-BROMO-4-AZA-1H-INDOL-3-CARBOXYLIC ACID
CAS:1167056-46-3
Formula: C8H5BrN2O2;C6H5NO2
KIN05260262
5-BROMO-4-BROMOMETHYL-2-(METHYLTHIO)-PYRIMIDINE
CAS:135645-64-6
Formula: C6H6Br2N2S
KIN03233759
5-BROMO-4-BROMOMETHYL-2-METHOXY-PYRIDINE
CAS:163914-13-4
Formula: C7H7Br2NO
KIN03334668
5-BROMO-4-BROMOMETHYL-2-PHENYL-OXAZOLE
CAS:101085-25-0
Formula: C10H7Br2NO
KIN03036974
5-BROMO-4-BROMOMETHYL-2-PHENYLTHIAZOLE
CAS:78502-84-8
KIN02631926
5-BROMO-4-BUTYL-1H-IMIDAZOLE
CAS:50880-51-8
KIN02298784
5-BROMO-4-BUTYLPYRIMIDINE
CAS:4595-66-8
Formula: C7H12O6S2
KIN01111076
5-BROMO-4-CHLORO-1,3-DIMETHYL-1H-PYRAZOLE
CAS:84703-28-6
Formula: C5H6BrClN2
KIN02669397
5-BROMO-4-CHLORO-1-METHYL-1H-INDOL-3-OL
CAS:244256-33-5
KIN03447377
5-BROMO-4-CHLORO-1H-BENZO[D]IMIDAZOLE
CAS:1008361-81-6
Formula: C7H4BrClN2
KIN05015591
5-Bromo-4-chloro-1H-benzo[d]imidazole
5-BROMO-4-CHLORO-1H-IMIDAZOLE
CAS:17487-98-8
Formula: C3H2BrClN2
KIN02062526
5-BROMO-4-CHLORO-1H-INDAZOL-3-CARBOXYLIC ACID
CAS:10502-50-8
Formula: C8H4BrClN2O2
KIN02007228
5-BROMO-4-CHLORO-1H-INDAZOLE
CAS:1082041-90-4
Formula: C7H4BrClN2;C7H4BrClN2
KIN05118286
5-BROMO-4-CHLORO-1H-INDOL-2,3-DIONE
CAS:3018-41-5
Formula: C8H20N2S
KIN01080984
5-BROMO-4-CHLORO-1H-INDOL-3-ACETIC ACID
CAS:1160425-53-5
Formula: C10H7BrClNO2
KIN05257592
5-BROMO-4-CHLORO-1H-INDOL-3-CARBALDEHYDE
CAS:115666-39-2
Formula: C9H5BrClNO
KIN03138467
5-BROMO-4-CHLORO-1H-INDOL-3-ETHANAMINE
CAS:128202-76-6
KIN03200680
5-BROMO-4-CHLORO-1H-INDOL-3-OL
CAS:117887-41-9
Formula: [C8H5BrClNO
KIN03151298
5-BROMO-4-CHLORO-1H-INDOL-3-OL DIHYDROGEN PHOSPHATE (ESTER) POTASSIUM SALT;
CAS:185335-30-2
Formula: C8H4BrClK2NO4P
KIN03379238
5-BROMO-4-CHLORO-1H-INDOL-3-OL DIHYDROGEN PHOSPHATE ESTER DISODIUM SALT HYDRATE
CAS:304656-10-8
Formula: C8H4BrClNO4PNaH2O
KIN03480987
5-BROMO-4-CHLORO-1H-INDOL-3-OL HYDROGEN SULFATE (ESTER)
CAS:46489-28-5
KIN02286022
5-BROMO-4-CHLORO-1H-INDOL-3-YL 2-(ACETAMIDO)-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE
CAS:210110-89-7
Formula: C16H18BrClN2O6
KIN03420960
5-BROMO-4-CHLORO-1H-INDOL-3-YL 2-(ACETAMIDO)-2-DEOXY-BETA-D-GALACTOPYRANOSIDE
CAS:129572-48-1
Formula: C16H18BrClN2O6
KIN03206391
5-BROMO-4-CHLORO-1H-INDOL-3-YL ACETATE
CAS:3252-43-5
Formula: C2HBr2N
KIN01085360
5-BROMO-4-CHLORO-1H-INDOL-3-YL BETA-D-GLUCOPYRANOSIDURONIC ACID SODIUM SALT TRIHYDRATE
CAS:370100-64-4
Formula: C14H12BrClNNaO7
KIN03542050
5-BROMO-4-CHLORO-1H-INDOL-3-YL DIHYDROGEN PHOSPHATE
CAS:38404-93-2
Formula: C8H6BrClNO4P
KIN02247764
MFCD00274770
5-BROMO-4-CHLORO-1H-INDOL-3-YL OCTANOATE
CAS:129541-42-0
Formula: C16H19BrClNO2
KIN03206303
5-BROMO-4-CHLORO-1H-INDOLE
CAS:217656-69-4
Formula: C8H5BrClN
KIN03430208
5-BROMO-4-CHLORO-1H-PYRAZOLO[3,4-B]PYRIDINE
CAS:1034769-88-4
Formula: C6H3BrClN3
KIN05068904
5-BROMO-4-CHLORO-1H-PYRROL-2-CARBALDEHYDE
CAS:33515-60-5
Formula: C5H3BrClNO
KIN02206308
5-BROMO-4-CHLORO-1H-PYRROL-2-CARBOXYLIC ACID
CAS:1118787-50-0
Formula: C5H3BrClNO2
KIN05176572
5-BROMO-4-CHLORO-2,3-DIHYDRO-3-OXO-1H-INDOL-1-ACETONITRILE
CAS:3030-17-9
KIN01081170
5-BROMO-4-CHLORO-2,3-DIMETHYL-PYRIDINE
CAS:103971-31-9
Formula: C7H7BrClN
KIN03057613
5-BROMO-4-CHLORO-2,3-PYRIDINEDIAMINE
CAS:1131604-99-3
Formula: C5H5BrClN3
KIN05183162
5-BROMO-4-CHLORO-2,6-DIMETHOXY-PYRIMIDINE
CAS:42362-16-3
Formula: C6H6BrClN2O2
KIN02277827
5-BROMO-4-CHLORO-2,6-DIMETHYLPYRIMIDINE
CAS:69696-35-1
Formula: C6H6BrClN2
KIN02572170
5-BROMO-4-CHLORO-2-(1-METHYLETHYL)-PYRIMIDINE
CAS:1044767-89-6
Formula: C7H8BrClN2
KIN05094310
5-BROMO-4-CHLORO-2-(CYCLOPROPYLMETHYL)-PYRIMIDINE
CAS:1044767-91-0
Formula: C8H8BrClN2
KIN05094312
5-BROMO-4-CHLORO-2-(METHOXYMETHOXY) -BENZENEACETONITRILE
CAS:162269-96-7
KIN03630176
5-BROMO-4-CHLORO-2-(METHOXYMETHOXY) -BENZENEMETHANOL
CAS:162269-95-6
KIN03674929
5-BROMO-4-CHLORO-2-(METHYLSULFINYL)-PYRIMIDINE
CAS:97229-09-9
Formula: C5H4BrClN2OS
KIN02805086
5-BROMO-4-CHLORO-2-(METHYLSULFONYL)-PYRIMIDINE
CAS:79091-24-0
Formula: C5H4BrClN2O2S
KIN02635555
MFCD11046327
5-BROMO-4-CHLORO-2-(METHYLTHIO)-7BETA-D-RIBOFURANOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE 2',3',5'-TRIBENZOATE
CAS:29914-80-5
Formula: C33H25BrClN3O7S
KIN02177638
5-BROMO-4-CHLORO-2-(METHYLTHIO)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:183274-54-6
Formula: C7H5BrClN3S
KIN03374275
5-BROMO-4-CHLORO-2-(METHYLTHIO)-PYRIMIDINE
CAS:63810-78-6
Formula: C5H4BrClN2S
KIN02499248
MFCD00023232
5-BROMO-4-CHLORO-2-(PYRIDIN-2-YL)-PYRIMIDINE
CAS:1044767-94-3
Formula: C9H5BrClN3
KIN05094315
5-BROMO-4-CHLORO-2-(PYRIDIN-3-YL)-PYRIMIDINE
CAS:1044767-95-4
Formula: C9H5BrClN3
KIN05094316
5-BROMO-4-CHLORO-2-(PYRIDIN-4-YL)-PYRIMIDINE
CAS:1044767-97-6
Formula: C9H5BrClN3
KIN05094318
5-BROMO-4-CHLORO-2-(PYRROLIDIN-1-YL)-PYRIMIDINE
CAS:57054-91-8
Formula: C8H9BrClN3
KIN02393150
5-BROMO-4-CHLORO-2-CYCLOPROPYLPYRIMIDINE
CAS:1044767-90-9
Formula: C7H6BrClN2
KIN05094311
5-BROMO-4-CHLORO-2-ETHYLPHENOL
CAS:52016-79-2
Formula: C8H8BrClO
KIN02314828
5-BROMO-4-CHLORO-2-FLUORO-PYRIDINE
CAS:1184920-15-7
Formula: C5H2BrClFN
KIN05318142
5-BROMO-4-CHLORO-2-HYDROXY-BENZAMIDE
CAS:1026449-11-5
Formula: C7H5BrClNO2
KIN05060628
5-BROMO-4-CHLORO-2-HYDROXY-BENZOIC ACID
CAS:142167-38-2
Formula: C7H4BrClO3
KIN03263860
5-BROMO-4-CHLORO-2-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:55488-81-8
Formula: C8H6BrClO3
KIN02367271
MFCD09800924
5-BROMO-4-CHLORO-2-HYDROXY-BENZONITRILE
CAS:142167-37-1
Formula: C7H3BrClNO
KIN03263859
5-BROMO-4-CHLORO-2-METHOXY-ANILINE
CAS:102169-94-8
Formula: C7H7BrClNO
KIN03045001
5-BROMO-4-CHLORO-2-METHOXY-BENZALDEHYDE
CAS:223778-51-6
Formula: C8H6BrClO2
KIN03438953
5-BROMO-4-CHLORO-2-METHOXY-BENZOIC ACID
CAS:95383-17-8
Formula: C8H6BrClO3
KIN02790950
MFCD09878363
5-BROMO-4-CHLORO-2-METHOXY-BENZOIC ACID ETHYL ESTER
CAS:95383-18-9
Formula: C10H10BrClO3
KIN02790951
5-BROMO-4-CHLORO-2-METHOXY-BENZOYL CHLORIDE
CAS:95383-23-6
Formula: C8H5BrCl2O2
KIN02790956
5-BROMO-4-CHLORO-2-METHOXY-PHENOL
CAS:86735-02-6
Formula: C7H6BrClO2
KIN02682179
5-BROMO-4-CHLORO-2-METHOXY-PYRIMIDINE
CAS:57054-93-0
Formula: C5H4BrClN2O
KIN02393152
5-BROMO-4-CHLORO-2-METHYL-6-(1-METHYLETHYL)-PYRIMIDINE
CAS:1044768-54-8
Formula: C8H10BrClN2
KIN05094364
5-BROMO-4-CHLORO-2-METHYL-6-PHENYL-PYRIMIDINE
CAS:128266-66-0
Formula: C11H8BrClN2
KIN03200983
5-BROMO-4-CHLORO-2-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1111237-76-3
Formula: C7H5BrClN3;C7H5BrClN3
KIN05174215
5-BROMO-4-CHLORO-2-METHYL-BENZENAMINE
CAS:1126367-88-1
Formula: C7H7BrClN
KIN05180432
5-BROMO-4-CHLORO-2-METHYL-PYRIDINE
CAS:1003711-85-0
Formula: C6H5BrClN
KIN05008598
5-BROMO-4-CHLORO-2-METHYL-PYRIDINE 1-OXIDE
CAS:103971-43-3
Formula: C6H5BrClNO
KIN03057615
5-BROMO-4-CHLORO-2-NITRO-BENZALDEHYDE
CAS:202808-22-8
Formula: C7H3BrClNO3
KIN03411027
5-BROMO-4-CHLORO-2-NITRO-BENZOIC ACID
CAS:392319-07-2
Formula: C7H3BrClNO4
KIN03557383
5-BROMO-4-CHLORO-2-PHENYL-THIAZOLE
CAS:141305-43-3
KIN03259402
5-BROMO-4-CHLORO-2-PHENYL-THIAZOLE 3-OXIDE
CAS:141305-67-1
KIN03259422
5-BROMO-4-CHLORO-2-PHENYLPYRIDAZIN-3(2H)-ONE
CAS:1698-64-2
Formula: C10H6Cl2N2O2
KIN01053645
5-BROMO-4-CHLORO-2-PHENYLPYRIMIDINE
CAS:26740-70-5
Formula: C10H6BrClN2
KIN02150857
5-BROMO-4-CHLORO-2-PIPERIDIN-1-YLPYRIMIDINE
CAS:62880-68-6
Formula: C9H11BrClN3
KIN02482096
5-BROMO-4-CHLORO-2-PROPYLPHENOL
CAS:52016-80-5
Formula: C9H10BrClO
KIN02314829
5-BROMO-4-CHLORO-2-PYRIDINECARBALDEHYDE
CAS:1060802-20-1
Formula: C6H3BrClNO
KIN05105980
5-BROMO-4-CHLORO-2-PYRIDINECARBOXYLIC ACID
CAS:1060802-25-6
Formula: C6H3BrClNO2
KIN05105983
5-BROMO-4-CHLORO-2-PYRIDINEMETHANOL
CAS:103971-44-4
Formula: C6H5BrClNO
KIN03057616
5-BROMO-4-CHLORO-2-PYRIMIDINAMINE
CAS:1044767-99-8
Formula: C4H3BrClN3
KIN05094320
5-BROMO-4-CHLORO-2-TERT-BUTOXY-PYRIMIDINE
CAS:57054-95-2
Formula: C8H10BrClN2O
KIN02393154
5-BROMO-4-CHLORO-2-THIAZOLAMINE
CAS:1174132-80-9
Formula: C3H2BrClN2S
KIN05265475
5-BROMO-4-CHLORO-2-THIOPHENECARBOXYLIC ACID
CAS:123418-69-9
Formula: C5H2BrClO2S
KIN03179578
5-BROMO-4-CHLORO-2-THIOPHENESULFONAMIDE
CAS:77893-75-5
Formula: C4H3BrClNO2S2
KIN02628051
5-BROMO-4-CHLORO-3(1H)-INDOLYL BUTYRATE
CAS:129541-43-1
Formula: C12H11BrClNO2
KIN03206304
5-BROMO-4-CHLORO-3(1H)-INDOLYL-TETRAPHOSPHO-5'-ADENOSINE
CAS:148778-60-3
Formula: C18H20BrClN6O16P4
KIN03290394
5-BROMO-4-CHLORO-3-(2,3-DIFLUOROPHENYL)ISOXAZOLE
CAS:1188105-17-0
Formula: C9H3BrClF2NO
KIN05325566
5-BROMO-4-CHLORO-3-(2,4-DIFLUOROPHENYL)ISOXAZOLE
CAS:1188105-44-3
Formula: C9H3BrClF2NO
KIN05325569
5-BROMO-4-CHLORO-3-(2,5-DIFLUOROPHENYL)ISOXAZOLE
CAS:1188105-85-2
Formula: C9H3BrClF2NO
KIN05325572
5-BROMO-4-CHLORO-3-(2,6-DIFLUOROPHENYL)ISOXAZOLE
CAS:1188095-61-5
Formula: C9H3BrClF2NO
KIN05325481
5-BROMO-4-CHLORO-3-(2-CHLOROPHENYL)ISOXAZOLE
CAS:1188192-35-9
Formula: C9H4BrCl2NO
KIN05326748
5-BROMO-4-CHLORO-3-(2-ETHOXY-PHENYL) ISOXAZOLE
CAS:1188126-97-7
Formula: C11H9BrClNO2
KIN05325773
5-BROMO-4-CHLORO-3-(2-FLUOROPHENYL)ISOXAZOLE
CAS:1188171-56-3
Formula: C9H4BrClFNO
KIN05326434
5-BROMO-4-CHLORO-3-(2-METHOXY-PHENYL) ISOXAZOLE
CAS:1188126-55-7
Formula: C10H7BrClNO2
KIN05325771