ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

5-AMINO-2-[(5-METHYL-THIAZOL-2-YL)AMINO]BENZOIC ACID
CAS:1184456-53-8
Formula: C11H11N3O2S
KIN05314263
5-AMINO-2-[(BENZYL)AMINO]-4(3H)-PYRIMIDINETHIONE
CAS:19835-18-8
Formula: C11H12N4S
KIN02085227
5-AMINO-2-[(BENZYL)AMINO]-4-THIAZOLECARBOXAMIDE
CAS:60598-58-5
Formula: C11H12N4OS
KIN02445967
5-AMINO-2-[(BENZYL)AMINO]BENZENESULFONIC ACID
CAS:108225-09-8
KIN03087675
5-AMINO-2-[(BENZYL)AMINO]BENZOIC ACID
CAS:107947-05-7
KIN03085976
5-AMINO-2-[(BENZYL)AMINO]PYRIDIN-3-CARBONITRILE
CAS:1178337-34-2
Formula: C13H12N4
KIN05275751
5-AMINO-2-[(BENZYL)THIO]BENZONITRILE
CAS:308088-17-7
KIN03483840
5-AMINO-2-[(BENZYL)THIO]PHENOL
CAS:146310-37-4
KIN03282071
5-AMINO-2-[(CYCLOBUTYLMETHYL)AMINO]BENZOIC ACID
CAS:1178049-60-9
Formula: C12H16N2O2
KIN05272646
5-AMINO-2-[(CYCLOHEXYLAMINO)METHYL]BENZENESULFONIC ACID
CAS:1089336-70-8
Formula: C13H20N2O3S
KIN05128414
5-AMINO-2-[(CYCLOHEXYLMETHYL)AMINO]BENZOIC ACID
CAS:1179669-18-1
Formula: C14H20N2O2
KIN05286278
5-AMINO-2-[(CYCLOPENTYLMETHYL)AMINO]BENZOIC ACID
CAS:1183343-41-0
Formula: C13H18N2O2
KIN05303141
5-AMINO-2-[(CYCLOPROPYLMETHYL)AMINO]BENZOIC ACID
CAS:1184370-48-6
Formula: C11H14N2O2
KIN05313394
5-AMINO-2-[(DIMETHYLAMINO)METHYL]-PHENOL
CAS:133914-79-1
Formula: C9H14N2O
KIN03225946
5-AMINO-2-[(DIMETHYLAMINO)METHYL]BENZENESULFONIC ACID
CAS:1089337-10-9
Formula: C9H14N2O3S
KIN05128417
5-AMINO-2-[(ETHYLSULFONYL)AMINO]BENZOIC ACID
CAS:1154379-15-3
Formula: C9H12N2O4S
KIN05217190
5-AMINO-2-[(FURAN-2-YLCARBONYL)AMINO]BENZOIC ACID
CAS:1098067-74-3
Formula: C12H10N2O4
KIN05162006
5-AMINO-2-[(FURAN-2-YLMETHYL)AMINO]-4(3H)-PYRIMIDINONE
CAS:77961-45-6
Formula: C9H10N4O2
KIN02628516
5-AMINO-2-[(FURAN-2-YLMETHYL)AMINO]BENZOIC ACID
CAS:98755-08-9
Formula: C12H12N2O3
KIN02815925
5-AMINO-2-[(FURAN-3-YLMETHYL)AMINO]-4(3H)-PYRIMIDINONE
CAS:77961-46-7
Formula: C9H10N4O2
KIN02628517
5-AMINO-2-[(METHYLAMINO)METHYL]BENZENESULFONIC ACID
CAS:3638-64-0
Formula: C2H3NO2
KIN01092991
5-AMINO-2-[(METHYLSULFONYL)AMINO]BENZOIC ACID
CAS:1154379-40-4
Formula: C8H10N2O4S
KIN05217193
5-AMINO-2-[(METHYLSULFONYLOXY)]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:105969-85-5
KIN03072623
5-AMINO-2-[(METHYLSULFONYLOXY)]BENZOIC ACID HCL
CAS:94088-81-0
Formula: C8H9NO5S.ClH
KIN02777605
5-AMINO-2-[(PHENYLMETHYL)THIO]-3-PYRIDINECARBONITRILE
CAS:1182946-36-6
Formula: C13H11N3S
KIN05298761
5-AMINO-2-[(PYRIDIN-2-YLMETHYL)AMINO]BENZOIC ACID
CAS:1183675-61-7
Formula: C13H13N3O2
KIN05306708
5-AMINO-2-[(PYRIDIN-3-YLMETHYL)AMINO]BENZOIC ACID
CAS:425662-35-7
Formula: C13H13N3O2
KIN03576237
5-AMINO-2-[(TERT-BUTYL)AMINO]BENZOIC ACID
CAS:1183113-18-9
Formula: C11H16N2O2
KIN05300598
5-AMINO-2-[(TETRAHYDRO-2H-PYRAN-4-YL)AMINO]BENZOIC ACID
CAS:1183878-35-4
Formula: C12H16N2O3
KIN05308834
5-AMINO-2-[(TETRAHYDRO-FURAN-2-YL)METHOXY]BENZOIC ACID
CAS:1096863-23-8
Formula: C12H15NO4
KIN05156896
5-AMINO-2-[(TETRAHYDROFURAN-2-YL)METHYL]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:434297-53-7
Formula: C13H14N2O3
KIN03579688
5-AMINO-2-[(THIOPHEN-2-YLMETHYL)AMINO]BENZOIC ACID
CAS:1182903-65-6
Formula: C12H12N2O2S
KIN05298280
5-AMINO-2-[[(2-HYDROXYETHYL)AMINO]METHYL]BENZENESULFONIC ACID
CAS:3638-53-7
KIN01092990
5-AMINO-2-[[(2S)-2-AMINO-3-HYDROXY-1-OXO-3-(7-OXO-4-OXA-1-AZABICYCLO[3.2.0]HEPT-3-YL)-PROPYL]AMINO]-2,5-DIDEOXY-PENTONIC ACID
CAS:103080-36-0
Formula: C13H22N4O8
KIN03051755
5-AMINO-2-[[(3-CYANO-5-IODO-4,6-DIMETHYLPYRIDIN-2-YL)THIO]METHYL]-4-METHYL-10BH-PYRANO[3,4-C]QUINOLIN-1-CARBOXYLIC ACID PROPAN-2-YL ESTER
CAS:382609-55-4
Formula: C26H25IN4O3S
KIN03550768
5-AMINO-2-[[(3-CYANO-6-ETHYL-5-IODO-PYRIDIN-2-YL)THIO]METHYL]-4-METHYL-10BH-PYRANO[3,4-C]QUINOLIN-1-CARBOXYLIC ACID ETHYL ESTER
CAS:383157-45-7
Formula: C25H23IN4O3S
KIN03551686
5-AMINO-2-[[(4-IODO-PHENYL)SULFONYL]AMINO]BENZOIC ACID
CAS:1154378-65-0
Formula: C13H11IN2O4S
KIN05217189
5-AMINO-2-[[(PYRIDINYLAMINO)-PYRIDINYL]AZO]PHENOL
CAS:65946-40-9
Formula: C16H14N6O
KIN02534770
5-AMINO-2-[[(TRIBUTYL-STANNYLOXY)]CARBONYL]PHENOL
CAS:89683-88-5
Formula: C19H33NO3Sn
KIN02715423
5-AMINO-2-[[1-(FURAN-2-YL)ETHYL]AMINO]BENZOIC ACID
CAS:1178404-72-2
Formula: C13H14N2O3
KIN05276460
5-AMINO-2-[[2-(DIFLUOROMETHOXY)-PHENYL]AMINO]BENZOIC ACID
CAS:1179276-38-0
Formula: C14H12F2N2O3
KIN05284049
5-AMINO-2-[[2-(DIMETHYLAMINO)ETHYL]AMINO]BENZOIC ACID
CAS:215460-88-1
KIN03652657
5-AMINO-2-[[2-(THIOPHEN-2-YL)ETHYL]AMINO]BENZOIC ACID
CAS:1183325-51-0
Formula: C13H14N2O2S
KIN05302946
5-AMINO-2-[[3-(DIMETHYLAMINO)-PROPYL]AMINO]BENZOIC ACID
CAS:1184024-19-8
Formula: C12H19N3O2
KIN05310433
5-AMINO-2-[[3-(TRIFLUOROMETHYL)PHENYL]AMINO]BENZOIC ACID
CAS:39053-09-3
Formula: C14H11F3N2O2
KIN02252287
5-AMINO-2-[[3-(TRIFLUOROMETHYL)PHENYL]THIO]BENZONITRILE
CAS:320421-51-0
Formula: C14H9F3N2S
KIN03492434
5-AMINO-2-[[4-(1-METHYLETHYL)PHENYL]THIO]BENZOIC ACID
CAS:1178856-25-1
Formula: C16H17NO2S
KIN05280537
5-AMINO-2-[[4-(BUTYLAMINO)PHENYL]SULFONYL]PHENOL
CAS:123862-38-4
KIN03181483
5-AMINO-2-[[4-(DIFLUOROMETHOXY)-PHENYL]AMINO]BENZOIC ACID
CAS:1178208-58-6
Formula: C14H12F2N2O3
KIN05274359
5-AMINO-2-[[4-(ETHYLAMINO)PHENYL]SULFONYL]PHENOL
CAS:109688-83-7
KIN03096829
5-AMINO-2-[[4-(HEXYLAMINO)PHENYL]SULFONYL]PHENOL
CAS:123862-39-5
KIN03181484
5-AMINO-2-[[4-(METHYLAMINO)PHENYL]SULFONYL]PHENOL
CAS:123862-36-2
KIN03019344
5-AMINO-2-[[4-(PROPYLAMINO)PHENYL]SULFONYL]PHENOL
CAS:123862-37-3
KIN03019345
5-AMINO-2-[[4-(TERT-BUTYL)PHENYL]METHYL]-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:51859-88-2
KIN02312739
5-AMINO-2-[[4-(TERT-BUTYL)PHENYL]THIO]BENZOIC ACID
CAS:1178741-95-1
Formula: C17H19NO2S
KIN05279286
5-AMINO-2-[[8-[ETHYL-[(4-SULFOPHENYL)METHYL]AMINO]-10-(3-SULFOPHENYL)-2,3,4,4A,5,5A,6,7,8,9,9A,10A-DODECAHYDRO-1H-PHENAZIN-2-YL]AMINO]BENZENESULFONIC ACID
CAS:7476-86-0
Formula: C17H15NO2
KIN01188688
5-AMINO-2-[1-(4-FLUOROPHENYL)ETHYL]-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:57037-79-3
KIN02392835
5-AMINO-2-[2,6-DI(PROPAN-2-YL)PHENYL]ISOINDOL-1,3-DIONE
CAS:100823-03-8
Formula: C20H22N2O2
KIN03034847
5-AMINO-2-[2-(1-METHYLETHOXY)ETHOXY]BENZOIC ACID
CAS:1183190-72-8
Formula: C12H17NO4
KIN05301465
5-AMINO-2-[2-(1-METHYLETHYL)PHENOXY]BENZOIC ACID
CAS:1179116-33-6
Formula: C16H17NO3
KIN05282361
5-AMINO-2-[2-(1-METHYLPROPYL)PHENOXY]BENZOIC ACID
CAS:1183639-57-7
Formula: C17H19NO3
KIN05306295
5-AMINO-2-[2-(2-HYDROXYETHOXY)ETHOXY]PHENOL
CAS:86817-45-0
Formula: C10H15NO4
KIN02682734
5-AMINO-2-[2-(2-HYDROXYETHOXY)ETHYL]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:51419-29-5
Formula: C12H14N2O4
KIN02306170
5-AMINO-2-[2-(2H-TETRAZOL-5-YL)DIAZENYL]PHENOL
CAS:95654-20-9
Formula: C7H7N7O
KIN02793884
5-AMINO-2-[2-(3,4-DIMETHYLPHENOXY)ETHYL]-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:55294-23-0
KIN02364088
5-AMINO-2-[2-(3-AMINOPHENYL)ETHENYL]BENZENESULFONIC ACID
CAS:100870-74-4
KIN03618839
5-AMINO-2-[2-(3-CHLOROPHENYL)ETHYL]-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:55294-19-4
KIN02364085
5-AMINO-2-[2-(3-PHOSPHONOPHENYL)DIAZENYL]-BENZOIC ACID
CAS:178698-16-3
Formula: C13H12N3O5P
KIN03641403
5-AMINO-2-[2-(4-AMINOPHENYL)ETHENYL]BENZENESULFONIC ACID
CAS:131032-76-3
Formula: C14H14N2O3S
KIN03212558
5-AMINO-2-[2-(4-FLUOROPHENYL)ETHYL]BENZOIC ACID METHYL ESTER
CAS:203855-07-6
Formula: [C16H16FNO2]
KIN03412728
5-AMINO-2-[2-(5-BROMOPYRIDIN-2-YL)DIAZENYL]PHENOL
CAS:57074-64-3
KIN02393693
5-AMINO-2-[2-(5-CHLOROPYRIDIN-2-YL)DIAZENYL]-4-METHYLPHENOL
CAS:42757-84-6
KIN02280083
5-AMINO-2-[2-(AMINOCARBONYL)PHENOXY]BENZOIC ACID
CAS:1184361-29-2
Formula: C14H12N2O4
KIN05313298
5-AMINO-2-[2-(DIMETHYLAMINO)-2-OXOETHOXY]BENZOIC ACID
CAS:1096863-20-5
Formula: C11H14N2O4
KIN05156894
5-AMINO-2-[2-(DIMETHYLAMINO)ETHOXY]BENZOIC ACID
CAS:1096863-19-2
Formula: C11H16N2O3
KIN05156893
5-AMINO-2-[2-(DIMETHYLAMINO)ETHYL]-1H-BENZO[B]PYRIMIDO[5,6,1-JK]CARBAZOL-1,3(2H)-DIONE 2HCL
CAS:185555-57-1
Formula: C22H20N4O2.2ClH
KIN03380073
5-AMINO-2-[2-(DIMETHYLAMINO)ETHYL]-1H-BENZO[C]PYRIMIDO[5,6,1-JK]CARBAZOL-1,3(2H)-DIONE 2HCL
CAS:185555-89-9
Formula: C22H20N4O2.2ClH
KIN03380076
5-AMINO-2-[2-(DIMETHYLAMINO)ETHYL]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:152294-81-0
Formula: C12H15N3O2
KIN03301643
5-AMINO-2-[2-(DIMETHYLAMINO)ETHYL]-1H-PYRIMIDO[5,6,1-JK]CARBAZOL-1,3(2H)-DIONE 2HCL
CAS:194415-34-4
Formula: C18H18N4O2.2ClH
KIN03398285
5-AMINO-2-[2-(DIMETHYLAMINO)ETHYL]BENZO[DE]ISOQUINOLIN-1,3-DIONE, 2HCL
CAS:150091-68-2
Formula: C16H19Cl2N3O2
KIN03295174
5-AMINO-2-[2-(DIMETHYLOXIDOAMINO)ETHYL]BENZO[DE]ISOQUINOLIN-1,3(2H)-DIONE
CAS:112726-97-3
Formula: C16H17N3O3
KIN03117683
5-AMINO-2-[2-(ETHYLAMINO)-2-OXOETHOXY]BENZOIC ACID
CAS:1096332-56-7
Formula: C11H14N2O4
KIN05154473
5-AMINO-2-[2-(ETHYLAMINO)-2-OXOETHYL]BENZOIC ACID
CAS:161427-75-4
Formula: C11H14N2O3
KIN03022089
5-AMINO-2-[2-(METHYLAMINO)-2-OXOETHOXY]BENZOIC ACID
CAS:1096901-05-1
Formula: C10H12N2O4
KIN05157643
5-AMINO-2-[2-(METHYLAMINO)ETHOXY]BENZOIC ACID
CAS:129018-80-0
Formula: [C10H14N2O3]
KIN03204028
5-AMINO-2-[2-(METHYLAMINO)ETHYL]BENZO[DE]ISOQUINOLIN-1,3(2H)-DIONE
CAS:114991-16-1
Formula: C15H15N3O2
KIN03134619
5-AMINO-2-[2-(PYRROLIDINE-1-YL)ETHOXY]BENZONITRILE
CAS:1126431-30-8
KIN05180496
5-AMINO-2-[2-(TERT-BUTYL)PHENOXY]BENZOIC ACID
CAS:1183581-62-5
Formula: C17H19NO3
KIN05305691
5-AMINO-2-[2-(TERT-BUTYL)PHENOXY]PYRIDIN-3-CARBONITRILE
CAS:1184570-00-0
Formula: C16H17N3O
KIN05315479
5-AMINO-2-[2-(THIOPHEN-2-YL)ETHYL]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:1042634-51-4
KIN05090631
5-AMINO-2-[2-(TRIFLUOROMETHOXY)PHENYL]-4-OXAZOLECARBONITRILE
CAS:260973-58-8
Formula: C11H6F3N3O2
KIN03458606
5-AMINO-2-[2-(TRIFLUOROMETHYL)PHENOXY]BENZOIC ACID
CAS:1184202-51-4
Formula: C14H10F3NO3
KIN05312199
5-AMINO-2-[2-[4-(4,5-DIHYDRO-3-METHYL-5-OXO-1H-PYRAZOL-1-YL)-2-YLSULFOPHENYL]VINYL]BENZENESULFONIC ACID
CAS:119-75-5
Formula: C12H10N2O2
KIN01004897
5-AMINO-2-[2-[4-(BENZOYLAMINO)-2-SULFOPHENYL]-ETHENYL]BENZENESULFONIC ACID
CAS:25431-18-9
Formula: C21H17N2O7S2-
KIN02139629
Benzoylamido-4'-aminostilben-2,2'-disulfon
5-AMINO-2-[3-(1-METHYLETHYL)PHENOXY]BENZOIC ACID
CAS:1183630-90-1
Formula: C16H17NO3
KIN05306200
5-AMINO-2-[3-(5-AMINO-1,3-DIOXOISOINDOL-2-YL)-PROPYL]ISOINDOL-1,3-DIONE
CAS:111953-88-9
Formula: C19H16N4O4
KIN03111378
5-AMINO-2-[3-(5-AMINO-3-ETHYL-2(3H)-BENZO[D]THIAZOLYLIDENE)-1-PROPENYL]-3-ETHYLBENZO[D]THIAZOLIUM
CAS:58089-24-0
Formula: C21H23N4S2
KIN02410257
5-AMINO-2-[3-(AMINOCARBONYL)PHENOXY]BENZOIC ACID
CAS:1179658-96-8
Formula: C14H12N2O4
KIN05286169
5-AMINO-2-[3-(BENZYL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1042516-86-8
Formula: C15H13N3O2
KIN05089079
5-AMINO-2-[3-(PYRAZIN-2-YL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1157516-30-7
Formula: C12H9N5O2
KIN05247405
5-AMINO-2-[3-(PYRIDIN-2-YL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1036498-06-2
Formula: C13H10N4O2
KIN05070897
5-AMINO-2-[3-(PYRIDIN-3-YL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1042517-65-6
Formula: C13H10N4O2
KIN05089088
5-AMINO-2-[3-(PYRIDIN-4-YL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1036606-06-0
Formula: C13H10N4O2
KIN05072293
5-AMINO-2-[3-(TERT-BUTYL)-1,2,4-OXADIAZOL-5-YL]PHENOL
CAS:1036573-56-4
Formula: C12H15N3O2
KIN05071865
5-AMINO-2-[3-(TERT-BUTYL)PHENOXY]BENZOIC ACID
CAS:1179705-36-2
Formula: C17H19NO3
KIN05286663
5-AMINO-2-[3-(TERT-BUTYL)PHENOXY]PYRIDIN-3-CARBONITRILE
CAS:1184766-38-8
Formula: C16H17N3O
KIN05317215
5-AMINO-2-[3-(TRIFLUOROMETHYL)PHENOXY]BENZOIC ACID
CAS:1178251-94-9
Formula: C14H10F3NO3
KIN05274772
5-AMINO-2-[3-(TRIFLUOROMETHYL)PHENYL]-3(2H)-PYRIDAZINONE
CAS:121442-72-6
Formula: C11H8F3N3O
KIN03169743
5-AMINO-2-[4-(1-METHYLETHYL)PHENOXY]BENZOIC ACID
CAS:1183722-84-0
Formula: C16H17NO3
KIN05307225
5-AMINO-2-[4-(1-METHYLETHYL)PHENOXY]BENZONITRILE
CAS:1030431-23-2
Formula: C16H16N2O
KIN05065213
5-AMINO-2-[4-(1-METHYLETHYL)PIPERAZIN-1-YL]BENZOIC ACID
CAS:1179251-72-9
Formula: C14H21N3O2
KIN05283790
5-AMINO-2-[4-(2-HYDROXYETHYL)PIPERAZIN-1-YL]BENZOIC ACID
CAS:168123-43-1
KIN03618838
5-AMINO-2-[4-(2-HYDROXYETHYL)PIPERAZIN-1-YL]BENZONITRILE
CAS:288251-80-9
KIN03618837
5-AMINO-2-[4-(2-HYDROXYETHYL)PIPERIDIN-1-YL]BENZONITRILE
CAS:288252-61-9
Formula: C14H19N3O
KIN03618836
5-AMINO-2-[4-(2-METHOXYETHYL)PHENOXY]BENZOIC ACID
CAS:1178835-09-0
Formula: C16H17NO4
KIN05280312
5-AMINO-2-[4-(2-METHOXYETHYL)PIPERAZIN-1-YL]BENZONITRILE
CAS:288252-62-0
KIN03618835
5-AMINO-2-[4-(4-METHYL-PIPERAZIN-1-YL)PIPERIDIN-1-YL]BENZONITRILE
CAS:288252-23-3
Formula: C17H25N5
KIN03469901
5-AMINO-2-[4-(AMINOCARBONYL)PHENOXY]BENZOIC ACID
CAS:1179891-26-9
Formula: C14H12N2O4
KIN05288402
5-AMINO-2-[4-(CYANOMETHYL)PHENOXY]BENZOIC ACID
CAS:1178761-27-7
Formula: C15H12N2O3
KIN05279508
5-AMINO-2-[4-(DIMETHYLAMINO)PIPERIDIN-1-YL]BENZONITRILE
CAS:288252-25-5
KIN03630222
5-AMINO-2-[4-(HEXADECYLSULFONYL)PHENYL]-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:2046-44-8
Formula: C16H14N4O2
KIN01061610
5-AMINO-2-[4-(METHYLAMINO)PHENYL]-4(3H)-PYRIMIDINONE
CAS:75423-77-7
Formula: C11H12N4O
KIN02612581
5-AMINO-2-[4-(METHYLTHIO)PHENOXY]BENZONITRILE
CAS:364324-20-9
Formula: C14H12N2OS
KIN03538827
5-AMINO-2-[4-(TERT-BUTYL)PHENOXY]BENZENESULFONIC ACID
CAS:95971-23-6
Formula: C16H19NO4S
KIN02796832
5-AMINO-2-[4-(TERT-BUTYL)PHENOXY]BENZOIC ACID
CAS:1182924-75-9
Formula: C17H19NO3
KIN05298522
5-AMINO-2-[4-(TERT-BUTYL)PHENOXY]BENZONITRILE
CAS:1030430-00-2
Formula: C17H18N2O
KIN05065195
5-AMINO-2-[4-(TERT-BUTYL)PHENOXY]PYRIDIN-3-CARBONITRILE
CAS:1183691-22-6
Formula: C16H17N3O
KIN05306875
5-AMINO-2-[4-(TERT-BUTYL)PHENYL]-1,3-DIOXANE-5-METHANOL
CAS:169813-66-5
KIN03630221
5-AMINO-2-[4-(TRIFLUOROMETHOXY)PHENYL]-2H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:405279-33-6
Formula: C10H8F3N5O2
KIN03566478
5-AMINO-2-[4-(TRIFLUOROMETHYL)PHENOXY]BENZOIC ACID
CAS:1178631-53-2
Formula: C14H10F3NO3
KIN05278100
5-AMINO-2-[4-[4-(5-AMINO-1,3-DIOXOISOINDOL-2-YL)PHENYL]SULFONYLPHENYL]ISOINDOL-1,3-DIONE
CAS:139061-93-1
Formula: C28H18N4O6S
KIN03250439
5-AMINO-2-[4-HYDROXY-5-(HYDROXYMETHYL)OXOLAN-2-YL][1,2,4]-TRIAZIN-3-ONE
CAS:50-94-2
Formula: C7H4N4O5
KIN01000080
5-AMINO-2-[4-OXO-4-[(2S)-2-(PYRROLIDINE-1-YLCARBONYL)-PYRROLIDINE-1-YL]BUTYL]-1H-ISOINDOL-1,3(2H)-DIONE
CAS:188589-74-4
Formula: C21H26N4O4
KIN03385220
5-AMINO-2-[4-PROPAN-2-YL-PIPERIDIN-1-YL]BENZOIC ACID
CAS:78243-95-5
KIN02630297
5-AMINO-2-[4-PYRIDIN-2-YL-PIPERAZIN-1-YL]BENZOIC ACID
CAS:78243-78-4
Formula: C16H18N4O2%
KIN02630292
5-AMINO-2-[5-(1,3-DIOXOISOINDOL-2-YL)PENTOXY]BENZAMIDE
CAS:13738-12-0
Formula: C20H21N3O4
KIN02023849
5-AMINO-2-[5-(1,3-DIOXOISOINDOL-2-YL)PENTOXY]BENZOIC ACID
CAS:13737-98-9
Formula: C20H20N2O5
KIN02023847
5-AMINO-2-[BIS(2-HYDROXYETHYL)AMINO]BENZENESULFONIC ACID
CAS:1147317-91-6
Formula: C10H16N2O5S
KIN05195237
5-AMINO-2-[METHYL(1-METHYLETHYL)AMINO]BENZOIC ACID
CAS:1183767-87-4
Formula: C11H16N2O2
KIN05307683
5-AMINO-2-[METHYL(BENZYL)AMINO]PYRIDIN-3-CARBONITRILE
CAS:1179767-27-1
Formula: C14H14N4
KIN05287313
5-AMINO-2-[PYRIDIN-2-YLAZO]PHENOL
CAS:51790-22-8
Formula: C11H10N4O
KIN02311738
5-Amino-2-[pyridin-2-ylazo]phenol
5-AMINO-2-ALLYLPHENOL
CAS:102878-27-3
Formula: C9H11NO
KIN03050608
5-AMINO-2-AZEPAN-1-YLBENZONITRILE
CAS:78252-09-2
Formula: C13H17N3
KIN02630351
MFCD11053931
5-AMINO-2-BENZO[D]OXAZOL-2-YLPHENOL
CAS:88877-61-6
Formula: C13H10N2O2
KIN02703879
MFCD00440125
5-AMINO-2-BENZO[D]THIAZOLECARBOXYLIC ACID
CAS:353487-33-9
Formula: C8H6N2O2S
KIN03531035
5-AMINO-2-BENZOFURANMETHANAMINE
CAS:165735-69-3
Formula: C9H10N2O
KIN03337794
5-AMINO-2-BENZOYL-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:129027-75-4
KIN03204052
5-AMINO-2-BENZOYL-4-BENZYL-1,2-OXAZOL-3(2H)-ONE
CAS:6940-67-6
Formula: C17H16N2O4S
KIN01173327
5-AMINO-2-BENZOYLBENZOIC ACID
CAS:2162-61-0
Formula: C15H22O
KIN01063935
5-AMINO-2-BENZYL-2H-1,2,6-THIADIAZINE-3(4H)-ONE, 1,1-DIOXIDE
CAS:115347-01-8
Formula: C10H11N3O3S
KIN03136650
5-AMINO-2-BENZYL-4-CHLORO-2H-PYRIDAZIN-3-ONE
CAS:37626-99-6
Formula: C11H10ClN3O
KIN02241171
5-AMINO-2-BENZYLBENZO[DE]ISOQUINOLIN-1,3-DIONE
CAS:24782-10-3
Formula: C19H14N2O2
KIN02133766
5-AMINO-2-BROMO-1-[3,4-DIHYDROXY-5-(HYDROXYMETHYL)OXOLAN-2-YL]IMIDAZOL-4-CARBOXAMIDE
CAS:52906-35-1
Formula: C9H13BrN4O5
KIN02327517
5-AMINO-2-BROMO-1-METHYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:1102466-66-9
Formula: C5H7BrN4O
KIN05168245
5-AMINO-2-BROMO-3,4-DIMETHYLBENZENESULFONIC ACID
CAS:74319-91-8
Formula: C8H10BrNO3S
KIN02604939
5-AMINO-2-BROMO-3-FLUOROBENZOIC ACID METHYL ESTER
CAS:1036389-05-5
Formula: C8H7BrFNO2
KIN05069978
5-AMINO-2-BROMO-3-HYDROXY-BENZOIC ACID
CAS:1025127-27-8
Formula: C7H6BrNO3
KIN05058873
5-AMINO-2-BROMO-3-METHYL-1,4-NAPHTHALENEDIONE
CAS:258498-22-5
Formula: C11H8BrNO2
KIN03456687
5-AMINO-2-BROMO-3-METHYLBENZOIC ACID
CAS:1121583-46-7
Formula: C8H8BrNO2
KIN05177583
5-AMINO-2-BROMO-4-(PYRROLIDIN-1-YL)-BENZOIC ACID ETHYL ESTER
CAS:59504-47-1
Formula: C13H17BrN2O2
KIN02432524
5-AMINO-2-BROMO-4-(TRIFLUOROMETHYL)-BENZOIC ACID
CAS:18729-08-3
Formula: C8H5BrF3NO2
KIN02074694
5-Amino-2-bromo-alpha,alpha,alpha-trifluoro-4-meth
5-AMINO-2-BROMO-4-FLUOROBENZOIC ACID METHYL ESTER
CAS:1036389-86-2
Formula: C8H7BrFNO2
KIN05069985
5-AMINO-2-BROMO-4-FLUOROPHENOL
CAS:84478-73-9
Formula: C6H5BrFNO
KIN02667750
5-Amino-2-bromo-4-fluorophenol
5-AMINO-2-BROMO-4-HYDROXY-BENZENESULFONAMIDE
CAS:34958-45-7
Formula: C6H7BrN2O3S
KIN02218507
5-AMINO-2-BROMO-4-HYDROXY-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:42356-89-8
Formula: C8H11BrN2O3S
KIN02277792
5-AMINO-2-BROMO-4-HYDROXY-N-METHYLBENZENESULFONAMIDE
CAS:42356-88-7
Formula: C7H9BrN2O3S
KIN02277791
5-AMINO-2-BROMO-4-METHYLBENZOIC ACID METHYL ESTER
CAS:474330-54-6
Formula: C9H10BrNO2
KIN03601107
5-AMINO-2-BROMO-4-METHYLPHENOL 1-ACETATE
CAS:92238-17-0
Formula: C9H10BrNO2
KIN02754540
5-Amino-2-bromo-4-methylphenyl acetate; 5-Amino-2-
5-AMINO-2-BROMO-N,4-DIMETHYL-BENZENESULFONAMIDE
CAS:113162-49-5
Formula: C8H11BrN2O2S
KIN03681573
5-AMINO-2-BROMO-N,N-DIETHYLBENZENEMETHANAMINE
CAS:1001057-09-5
Formula: C11H17BrN2
KIN05005335
5-AMINO-2-BROMO-N-ETHYL-4-HYDROXY-BENZENESULFONAMIDE
CAS:42356-90-1
Formula: C8H11BrN2O3S
KIN02277793
5-AMINO-2-BROMOBENZAMIDE
CAS:220583-56-2
Formula: C7H7BrN2O
KIN03434522
5-AMINO-2-BROMOBENZENEACETONITRILE
CAS:173026-38-5
Formula: C8H7BrN2
KIN03352596
5-AMINO-2-BROMOBENZENESULFONAMIDE
CAS:100367-51-9
Formula: C6H7BrN2O2S
KIN03030952
5-AMINO-2-BROMOBENZENESULFONIC ACID
CAS:150454-14-1
Formula: C6H6BrNO3S
KIN03296262
5-AMINO-2-BROMOBENZOIC ACID
CAS:2840-04-2
Formula: C8H9NO2
KIN01077107
5-AMINO-2-BROMOBENZOIC ACID ETHYL ESTER
CAS:208176-32-3
Formula: C9H10BrNO2
KIN03418478
5-AMINO-2-BROMOBENZOIC ACID METHYL ESTER
CAS:6942-39-8
Formula: C8H6BrFO2
KIN01173462
5-AMINO-2-BROMOBENZOIC ACID PROPAN-2-YL ESTER
CAS:86819-53-6
Formula: C10H12BrNO2
KIN02682751
5-AMINO-2-BROMOBENZONITRILE
CAS:72115-09-4
Formula: C7H5BrN2
KIN02589206
MFCD00234259
5-AMINO-2-BROMOPHENOL
CAS:55120-56-4
Formula: C6H6BrNO
KIN02361056
5-AMINO-2-BUTOXY-3-PYRIDINECARBONITRILE
CAS:1178703-28-0
Formula: C10H13N3O
KIN05278835
5-AMINO-2-BUTOXY-4-CHLOROBENZOIC ACID
CAS:112767-66-5
Formula: C11H14ClNO3
KIN03118029
5-AMINO-2-BUTOXY-BENZAMIDE
CAS:117821-52-0
KIN03150877
5-AMINO-2-BUTOXY-BENZOIC ACID
CAS:13737-90-1
Formula: C11H15NO3
KIN02023842
5-AMINO-2-BUTOXY-BENZOIC ACID ETHYL ESTER
CAS:80074-93-7
Formula: C13H19NO3
KIN02641714
5-AMINO-2-BUTOXY-N-CYCLOPROPYLBENZAMIDE
CAS:117821-57-5
KIN03150881
5-AMINO-2-BUTYL-[1,2,4]-TRIAZOLO[1,5-C]PYRIMIDIN-8-CARBONITRILE
CAS:193554-21-1
KIN03396662
5-AMINO-2-BUTYL-1H-BENZO[DE]ISOQUINOLIN-1,3(2H)-DIONE
CAS:130001-49-9
Formula: C16H16N2O2
KIN03652656
5-AMINO-2-BUTYL-1H-IMIDAZOL-4-CARBONITRILE
CAS:150437-99-3
KIN03296197
5-AMINO-2-BUTYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:106232-25-1
Formula: C8H14N4O
KIN03074996
5-AMINO-2-BUTYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:68930-97-2
Formula: C12H14N2O2
KIN02566650
5-Amino-2-butyl-1H-isoindol-1,3(2H)-dione; 5-Amino
5-AMINO-2-BUTYL-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:117320-52-2
Formula: [C7H13N3O
KIN03148367
5-AMINO-2-BUTYL-6-CHLORO-4(1H)-PYRIMIDINETHIONE
CAS:61457-07-6
Formula: C8H12ClN3S
KIN02456406
5-Amino-2-butyl-6-chloro-4(1H)-pyrimidinethione
5-AMINO-2-BUTYL-6-ETHOXY-4-PYRIMIDINECARBONITRILE
CAS:342823-94-3
Formula: [C11H16N4O
KIN03516851
5-AMINO-2-BUTYL-6-HYDROXY-4(3H)-ALPHA-PYRIMIDINONE
CAS:1188173-99-0
Formula: C8H13N3O2
KIN05326499
5-AMINO-2-CARBAMOYL-1H-IMIDAZOL-1-YLPHOSPHONATE
CAS:68984-62-3
Formula: C4H5N4O4P-2
KIN02567075
5-AMINO-2-CARBOXY-BENZENEACETIC ACID
CAS:408335-76-2
Formula: C9H9NO4
KIN03568332
5-AMINO-2-CHLORO-1,3-BENZENEDICARBONITRILE
CAS:110846-26-9
Formula: C8H4ClN3
KIN03103939
5-AMINO-2-CHLORO-1,3-BENZENEDICARBOXYLIC ACID
CAS:1032277-94-3
Formula: C8H6ClNO4
KIN05066917
5-AMINO-2-CHLORO-1-METHYL-1H-INDOL-3-CARBOXYLIC ACID
CAS:199849-92-8
Formula: C10H9ClN2O2
KIN03663925
5-AMINO-2-CHLORO-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:7009-30-5
KIN01176323
5-AMINO-2-CHLORO-3,4-DIMETHYLBENZENESULFONIC ACID
CAS:74319-92-9
Formula: C8H10ClNO3S
KIN02604940
5-AMINO-2-CHLORO-3-(TRIFLUOROMETHYL)-BENZENESULFONIC ACID
CAS:1643-65-8
KIN01052330
5-AMINO-2-CHLORO-3-ETHYL-BENZOIC ACID
CAS:1110696-93-9
Formula: C9H10ClNO2
KIN05172594
5-AMINO-2-CHLORO-3-HYDROXY-BENZOIC ACID
CAS:93561-94-5
Formula: C7H6ClNO3
KIN02770647
5-Amino-2-chloro-3-hydroxy-benzoic acid
5-AMINO-2-CHLORO-3-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:93561-92-3
Formula: C8H8ClNO3
KIN02770645
5-AMINO-2-CHLORO-3-METHYL-2,5-CYCLOHEXADIENE-1,4-DIONE
CAS:351004-63-2
Formula: C7H6ClNO2
KIN03528239
5-AMINO-2-CHLORO-3-METHYLBENZENESULFONIC ACID
CAS:186639-37-2
Formula: C7H8ClNO3S
KIN03382002
5-AMINO-2-CHLORO-3-METHYLPYRIDINE
CAS:38168-82-2
Formula: C6H7ClN2
KIN02245792
5-AMINO-2-CHLORO-4(3H)-PYRIMIDINETHIONE
CAS:14623-59-7
Formula: C4H4ClN3S
KIN02033926
5-AMINO-2-CHLORO-4,6-DIMETHYLPYRIDIN-3-CARBONITRILE
CAS:6972-37-8
Formula: C10H12N2O5
KIN01175461
5-AMINO-2-CHLORO-4,6-DIMETHYLPYRIDIN-3-CARBOXAMIDE
CAS:6971-65-9
Formula: C8H11NO2S.ClH
KIN01175410
5-AMINO-2-CHLORO-4-(METHOXYMETHYL)-6-METHYLPYRIDIN-3-CARBONITRILE
CAS:6333-72-8
Formula: C4H8N2OS.ClH
KIN01159116
5-AMINO-2-CHLORO-4-(PYRROLIDIN-1-YL)-BENZOIC ACID ETHYL ESTER
CAS:59504-45-9
Formula: C13H17ClN2O2
KIN02432522
5-AMINO-2-CHLORO-4-BROMO-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:27721-81-9
Formula: C7H5BrClNO
KIN02159810
5-AMINO-2-CHLORO-4-ETHOXY-BENZOIC ACID
CAS:1143622-13-2
Formula: C9H10ClNO3
KIN05192235
5-AMINO-2-CHLORO-4-ETHOXY-BENZOIC ACID METHYL ESTER
CAS:1143026-57-6
Formula: C10H12ClNO3
KIN05192083
5-AMINO-2-CHLORO-4-FLUORO-ALPHA-METHYLBENZENEACETIC ACID
CAS:114800-09-8
Formula: C9H9ClFNO2
KIN03618834
5-AMINO-2-CHLORO-4-FLUORO-N-(1-METHYLETHYL)-BENZAMIDE
CAS:122618-63-7
Formula: C10H12ClFN2O
KIN03652655
5-AMINO-2-CHLORO-4-FLUORO-N-ALLYLBENZAMIDE
CAS:1139129-57-9
Formula: C10H10ClFN2O
KIN05188622
5-AMINO-2-CHLORO-4-FLUORO-N-HYDROXY-BENZIMIDAMIDE
CAS:123614-83-5
Formula: C7H7ClFN3O
KIN03019329
5-AMINO-2-CHLORO-4-FLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:122618-62-6
Formula: C9H10ClFN2O2
KIN03652654
5-AMINO-2-CHLORO-4-FLUORO-N-PROPARGYLBENZAMIDE
CAS:132070-05-4
Formula: C10H8ClFN2O
KIN03217046
5-AMINO-2-CHLORO-4-FLUORO-N-PROPARGYLBENZENESULFONAMIDE
CAS:131191-65-6
Formula: C9H8ClFN2O2S
KIN03630220
5-AMINO-2-CHLORO-4-FLUOROBENZALDEHYDE
CAS:131191-64-5
Formula: C7H5ClFNO
KIN03213303
5-AMINO-2-CHLORO-4-FLUOROBENZALDEHYDE O-METHYLOXIME
CAS:99329-76-7
Formula: C8H8ClFN2O
KIN02819585
5-AMINO-2-CHLORO-4-FLUOROBENZALDEHYDE OXIME
CAS:99329-87-0
Formula: C7H6ClFN2O
KIN02819588
5-AMINO-2-CHLORO-4-FLUOROBENZENEACETIC ACID ETHYL ESTER
CAS:1012880-10-2
Formula: C10H11ClFNO2
KIN05019116
5-AMINO-2-CHLORO-4-FLUOROBENZENEACETONITRILE
CAS:110323-16-5
Formula: C8H6ClFN2
KIN03100763
5-AMINO-2-CHLORO-4-FLUOROBENZENEMETHANOL
CAS:101329-82-2
Formula: C7H7ClFNO
KIN03038602
5-AMINO-2-CHLORO-4-FLUOROBENZENESULFONAMIDE
CAS:69156-33-8
Formula: C6H6ClFN2O2S
KIN02568362
5-AMINO-2-CHLORO-4-FLUOROBENZENESULFONIC ACID
CAS:153092-38-7
Formula: C6H5ClFNO3S
KIN03304077
5-AMINO-2-CHLORO-4-FLUOROBENZENETHIOL
CAS:99719-10-5
Formula: C6H5ClFNS
KIN02822038
5-AMINO-2-CHLORO-4-FLUOROBENZOIC ACID
CAS:172404-33-0
Formula: C7H5ClFNO2
KIN03350826
5-AMINO-2-CHLORO-4-FLUOROBENZOIC ACID ALLYL ESTER
CAS:174489-46-4
Formula: C10H9ClFNO2
KIN03022631
5-AMINO-2-CHLORO-4-FLUOROBENZOIC ACID CYCLOPENTYL ESTER
CAS:120890-68-8
KIN03166867
5-AMINO-2-CHLORO-4-FLUOROBENZOIC ACID ETHYL ESTER
CAS:81664-52-0
Formula: C9H9ClFNO2
KIN02651038
5-AMINO-2-CHLORO-4-FLUOROBENZOIC ACID METHYL ESTER
CAS:141772-31-8
Formula: C8H7ClFNO2
KIN03261895
5-AMINO-2-CHLORO-4-FLUOROBENZONITRILE
CAS:123614-87-9
Formula: C7H4ClFN2
KIN03180392
5-AMINO-2-CHLORO-4-FLUOROBENZOYL CHLORIDE
CAS:132070-04-3
Formula: C7H4Cl2FNO
KIN03217045
5-AMINO-2-CHLORO-4-FLUOROPHENOL
CAS:84478-72-8
Formula: C6H5ClFNO
KIN02667749
MFCD00055622
5-AMINO-2-CHLORO-4-FLUOROPHENOL 1-(HYDROGENSULFATE)
CAS:151230-83-0
KIN03674987
5-AMINO-2-CHLORO-4-FLUOROPHENOL 1-METHANESULFONATE
CAS:106123-86-8
KIN03006551
5-AMINO-2-CHLORO-4-FLUOROPHENOL CARBONATE (2:1) (ESTER)
CAS:143659-40-9
Formula: C13H8Cl2F2N2O3
KIN03271548
5-AMINO-2-CHLORO-4-HYDROXY-BENZENESULFONIC ACID
CAS:132396-97-5
Formula: C6H6ClNO4S
KIN03218636
5-AMINO-2-CHLORO-4-METHOXY-BENZOIC ACID
CAS:1143622-07-4
Formula: C8H8ClNO3
KIN05192232
5-AMINO-2-CHLORO-4-METHOXY-BENZOIC ACID METHYL ESTER
CAS:104253-47-6
Formula: C9H10ClNO3
KIN03059922
5-AMINO-2-CHLORO-4-METHYL-BENZOIC ACID METHYL ESTER
CAS:1143026-47-4
Formula: C9H10ClNO2
KIN05192081
5-AMINO-2-CHLORO-4-METHYLBENZENESULFONAMIDE
CAS:29092-29-3
Formula: C7H9ClN2O2S
KIN02171342
5-AMINO-2-CHLORO-4-METHYLBENZENESULFONIC ACID
CAS:83543-94-6
Formula: C7H8ClNO3S
KIN02661804
3-Amino-6-chloro-4-methylbenzenesulfonic acid; 5-A
5-AMINO-2-CHLORO-4-METHYLPHENOL
CAS:16296-57-4
Formula: C7H8ClNO
KIN02049968
5-AMINO-2-CHLORO-4-NITRO-BENZENETHIOL
CAS:150985-38-9
Formula: C6H5ClN2O2S
KIN03297799
5-AMINO-2-CHLORO-4-NITRO-BENZOIC ACID
CAS:193481-80-0
Formula: C7H5ClN2O4
KIN03396538
5-AMINO-2-CHLORO-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:106125-56-8
Formula: C8H7ClN2O4
KIN03006553
5-AMINO-2-CHLORO-4-NITROPHENOL
CAS:89581-59-9
Formula: C6H5ClN2O3
KIN02713893
5-AMINO-2-CHLORO-4-PYRIDINEACETONITRILE
CAS:136888-16-9
Formula: C7H6ClN3
KIN03239173
5-AMINO-2-CHLORO-4-PYRIDINECARBALDEHYDE
CAS:1060804-23-0
Formula: C6H5ClN2O
KIN05106053
5-AMINO-2-CHLORO-4-PYRIDINOL
CAS:138084-66-9
Formula: C5H5CLN2O
KIN03244773
5-AMINO-2-CHLORO-4-PYRIMIDINECARBOXAMIDE
CAS:189747-29-3
Formula: C5H5ClN4O
KIN03389659
5-AMINO-2-CHLORO-4-THIAZOLECARBOXYLIC ACID METHYL ESTER
CAS:136538-94-8
Formula: C5H5ClN2O2S
KIN03237380
5-AMINO-2-CHLORO-4-YLSULFO-BENZOIC ACID
CAS:5855-79-8
KIN01143563
5-AMINO-2-CHLORO-6-(METHOXYMETHYL)-4-METHYLPYRIDIN-3-CARBONITRILE
CAS:40548-88-7
Formula: C9H10ClN3O
KIN02263799
5-Amino-2-chloro-6-(methoxymethyl)-4-methyl-nicoti
5-AMINO-2-CHLORO-6-(TRIFLUOROMETHYL)-4(3H)-PYRIMIDINETHIONE
CAS:1480-82-6
Formula: C5H3Cl2F5O2
KIN01048060
5-AMINO-2-CHLORO-6-HYDRAZINYLPYRIMIDIN-4-CARBOXYLIC ACID ETHYL ESTER
CAS:54368-63-7
Formula: C7H10ClN5O2
KIN02348833
5-AMINO-2-CHLORO-6-METHYL-3,4-PYRIDINEDICARBOXYLIC ACID 3,4-DIETHYL ESTER
CAS:143323-63-1
Formula: C12H15ClN2O4
KIN03269449
5-AMINO-2-CHLORO-6-METHYL-3,4-PYRIDINEDIMETHANOL
CAS:15816-37-2
Formula: C8H11ClN2O2
KIN02044431
5-AMINO-2-CHLORO-6-METHYL-3-PYRIDINEMETHANOL
CAS:1104455-44-8
Formula: C7H9ClN2O
KIN05169415
5-AMINO-2-CHLORO-6-METHYL-4-(TRIFLUOROMETHYL)-PYRIDIN-3-CARBONITRILE
CAS:651-80-9
Formula: C7HF7
KIN01024435
5-AMINO-2-CHLORO-6-METHYLPYRIDIN-3-CARBONITRILE
CAS:57183-29-6
Formula: C7H6ClN3
KIN02395275
5-Amino-2-chloro-6-methyl-pyridin-3-carbonitrile;
5-AMINO-2-CHLORO-ALPHA-(4-CHLOROPHENYL)-BENZENEMETHANOL
CAS:1015850-51-7
Formula: C13H11Cl2NO
KIN05021257
5-AMINO-2-CHLORO-ALPHA-METHYLBENZENEMETHANOL
CAS:150295-22-0
Formula: C8H10ClNO
KIN03295738
5-AMINO-2-CHLORO-ALPHA-PROPYLBENZENEMETHANOL
CAS:150295-24-2
Formula: C10H14ClNO
KIN03295739
5-AMINO-2-CHLORO-BENZOIC ACID 1,1-DIMETHYLETHYL ESTER
CAS:1179133-92-6
Formula: C11H14ClNO2
KIN05282538
5-AMINO-2-CHLORO-BENZOIC ACID 2-PROPYN-1-YLESTER
CAS:1139129-94-4
Formula: C10H8ClNO2
KIN05188624
5-AMINO-2-CHLORO-N,N-BIS(CYANOMETHYL)-BENZAMIDE
CAS:1016677-02-3
Formula: C11H9ClN4O
KIN05023329
5-AMINO-2-CHLORO-N,N-DIETHYL-4-FLUOROBENZAMIDE
CAS:122618-64-8
Formula: C11H14ClFN2O
KIN03175877
5-AMINO-2-CHLORO-N,N-DIETHYL-BENZENEMETHANAMINE
CAS:1018565-06-4
Formula: C11H17ClN2
KIN05038051
5-AMINO-2-CHLORO-N,N-DIETHYLBENZENEPROPANAMINE
CAS:474941-18-9
Formula: C13H21ClN2
KIN03601907
5-AMINO-2-CHLORO-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:10475-06-6
Formula: C8H11ClN2O2S
KIN02006857
5-Amino-2-chloro-N,N-dimethyl-benzenesulfonamide
MFCD02700603
5-AMINO-2-CHLORO-N,N-DIPROPYL-BENZENEMETHANAMINE
CAS:1094508-23-2
Formula: C13H21ClN2
KIN05142116
5-AMINO-2-CHLORO-N-(1,2-DIMETHYLPROPYL)-BENZAMIDE
CAS:1039870-90-0
Formula: C12H17ClN2O
KIN05081063
5-AMINO-2-CHLORO-N-(1-CYCLOPROPYLETHYL)-BENZAMIDE
CAS:1153248-53-3
Formula: C12H15ClN2O
KIN05207247
5-AMINO-2-CHLORO-N-(1-METHYL-ALLYL)-BENZAMIDE
CAS:1139130-25-8
Formula: C11H13ClN2O
KIN05188628
5-AMINO-2-CHLORO-N-(1-METHYLBUTYL)-BENZAMIDE
CAS:1016522-37-4
Formula: C12H17ClN2O
KIN05022644
5-AMINO-2-CHLORO-N-(1-METHYLETHYL)-BENZENESULFONAMIDE
CAS:1040343-36-9
Formula: C9H13ClN2O2S
KIN05086228
5-AMINO-2-CHLORO-N-(2,3-DICHLOROPHENYL)-BENZAMIDE
CAS:111362-58-4
Formula: C13H9Cl3N2O
KIN03018212
5-AMINO-2-CHLORO-N-(2,3-DIMETHYL-CYCLOHEXYL)-BENZAMIDE
CAS:1052551-87-7
KIN05100743
5-AMINO-2-CHLORO-N-(2,4-DICHLOROPHENYL)-BENZAMIDE
CAS:111362-53-9
Formula: C13H9Cl3N2O
KIN03018211
5-AMINO-2-CHLORO-N-(2,5-DICHLOROPHENYL)-BENZAMIDE
CAS:111362-60-8
Formula: C13H9Cl3N2O
KIN03018214
5-AMINO-2-CHLORO-N-(2-CHLORO-4-METHYLPHENYL)-BENZAMIDE
CAS:1039897-46-5
Formula: C14H12Cl2N2O
KIN05081755
5-AMINO-2-CHLORO-N-(2-CYANOETHYL)-N-METHYLBENZAMIDE
CAS:1019394-31-0
Formula: C11H12ClN3O
KIN05042877
5-AMINO-2-CHLORO-N-(2-CYCLOHEXYLETHYL)-BENZAMIDE
CAS:1184460-49-8
Formula: C15H21ClN2O
KIN05314305
5-AMINO-2-CHLORO-N-(2-ETHOXYETHYL)-BENZAMIDE
CAS:1156244-84-6
Formula: C11H15ClN2O2
KIN05231821
5-AMINO-2-CHLORO-N-(2-HYDROXY-1-METHYLETHYL)-BENZAMIDE
CAS:1155158-25-0
Formula: C10H13ClN2O2
KIN05224325
5-AMINO-2-CHLORO-N-(2-HYDROXY-PROPYL)-BENZAMIDE
CAS:1155157-20-2
Formula: C10H13ClN2O2
KIN05224298
5-AMINO-2-CHLORO-N-(2-HYDROXY-TERT-BUTYL)-BENZAMIDE
CAS:1155166-36-1
Formula: C11H15ClN2O2
KIN05224484
5-AMINO-2-CHLORO-N-(2-HYDROXYETHYL)-BENZAMIDE
CAS:1098363-55-3
Formula: C9H11ClN2O2
KIN05162757
5-AMINO-2-CHLORO-N-(2-HYDROXYETHYL)-N-METHYLBENZAMIDE
CAS:1094477-34-5
Formula: C10H13ClN2O2
KIN05141767
5-AMINO-2-CHLORO-N-(2-IODO-PHENYL)-BENZAMIDE
CAS:1038718-18-1
KIN05077444
5-AMINO-2-CHLORO-N-(2-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1152552-62-9
Formula: C12H10ClIN2O2S
KIN05199247
5-AMINO-2-CHLORO-N-(2-METHOXY-1-METHYLETHYL)-BENZAMIDE
CAS:1016762-96-1
Formula: C11H15ClN2O2
KIN05025552
5-AMINO-2-CHLORO-N-(3,4-DICHLOROPHENYL)-BENZAMIDE
CAS:111362-59-5
Formula: C13H9Cl3N2O
KIN03018213
5-AMINO-2-CHLORO-N-(3-CHLORO-2-METHYLPHENYL)-BENZAMIDE
CAS:111362-56-2
Formula: C14H12Cl2N2O
KIN03641402
5-AMINO-2-CHLORO-N-(3-CHLORO-4-METHYLPHENYL)-BENZAMIDE
CAS:1016524-94-9
Formula: C14H12Cl2N2O
KIN05022710
5-AMINO-2-CHLORO-N-(3-CHLOROPHENYL)-BENZENESULFONAMIDE
CAS:325724-65-0
Formula: C12H10Cl2N2O2S
KIN03495355
5-AMINO-2-CHLORO-N-(3-HYDROXY-PROPYL)-BENZAMIDE
CAS:1097782-39-2
Formula: C10H13ClN2O2
KIN05160935
5-AMINO-2-CHLORO-N-(3-IODO-PHENYL)-BENZAMIDE
CAS:1037156-97-0
KIN05073678
5-AMINO-2-CHLORO-N-(3-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1152556-69-8
Formula: C12H10ClIN2O2S
KIN05199322
5-AMINO-2-CHLORO-N-(3-METHYLBUTYL)-BENZAMIDE
CAS:1016499-29-8
Formula: C12H17ClN2O
KIN05021982
5-AMINO-2-CHLORO-N-(4-CHLORO-2-METHYLPHENYL)-BENZAMIDE
CAS:111362-55-1
Formula: C14H12Cl2N2O
KIN03641401
5-AMINO-2-CHLORO-N-(4-CHLOROPHENYL)-BENZENESULFONAMIDE
CAS:328028-10-0
Formula: C12H10Cl2N2O2S
KIN03498012
5-AMINO-2-CHLORO-N-(4-IODO-PHENYL)-BENZAMIDE
CAS:1038982-52-3
KIN05078564
5-AMINO-2-CHLORO-N-(4-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:380431-60-7
Formula: C12H10ClIN2O2S
KIN03548799
5-AMINO-2-CHLORO-N-(5-CHLORO-2-FLUOROPHENYL)-BENZAMIDE
CAS:1156855-65-0
Formula: C13H9Cl2FN2O
KIN05239263
5-AMINO-2-CHLORO-N-(5-CHLORO-2-METHYLPHENYL)-BENZAMIDE
CAS:111362-54-0
Formula: C14H12Cl2N2O
KIN03641400
5-AMINO-2-CHLORO-N-(5-CHLORO-PYRIDIN-2-YL)-BENZAMIDE
CAS:1040066-55-4
Formula: C12H9Cl2N3O
KIN05085029
5-AMINO-2-CHLORO-N-(BENZYL)-N-PROPYLBENZENEMETHANAMINE
CAS:1153055-84-5
Formula: C17H21ClN2
KIN05204293
5-AMINO-2-CHLORO-N-(CYCLOBUTYLMETHYL)-BENZAMIDE
CAS:1095523-77-5
Formula: C12H15ClN2O
KIN05150903
5-AMINO-2-CHLORO-N-(CYCLOBUTYLMETHYL)-BENZENESULFONAMIDE
CAS:1095619-19-4
Formula: C11H15ClN2O2S
KIN05152032
5-AMINO-2-CHLORO-N-(TETRAHYDRO-2H-PYRAN-4-YL)-BENZAMIDE
CAS:1153062-01-1
Formula: C12H15ClN2O2
KIN05204400
5-AMINO-2-CHLORO-N-[(2-CHLOROPHENYL)METHYL]BENZAMIDE
CAS:1016534-91-0
Formula: C14H12Cl2N2O
KIN05022991
5-AMINO-2-CHLORO-N-[(4-CHLOROPHENYL)METHYL]BENZAMIDE
CAS:1018545-68-0
Formula: C14H12Cl2N2O
KIN05037835
5-AMINO-2-CHLORO-N-[1-(HYDROXYMETHYL)-PROPYL]BENZAMIDE
CAS:1155165-45-9
Formula: C11H15ClN2O2
KIN05224477
5-AMINO-2-CHLORO-N-[2-(1-CYCLOHEXEN-1-YL)ETHYL]BENZAMIDE
CAS:1018545-60-2
KIN05037833
5-AMINO-2-CHLORO-N-1H-PYRAZOL-4-YLBENZAMIDE
CAS:1154593-01-7
Formula: C10H9ClN4O
KIN05218413
5-AMINO-2-CHLORO-N-ALLYLBENZAMIDE
CAS:174489-49-7
Formula: C10H11ClN2O
KIN03355842
5-AMINO-2-CHLORO-N-CYCLOHEPTYL-N-METHYLBENZAMIDE
CAS:1154568-59-8
Formula: C15H21ClN2O
KIN05218117
5-AMINO-2-CHLORO-N-CYCLOOCTYLBENZAMIDE
CAS:1016525-25-9
KIN05022722
5-AMINO-2-CHLORO-N-CYCLOPROPYL-N-ETHYLBENZAMIDE
CAS:1094808-00-0
Formula: C12H15ClN2O
KIN05145776
5-AMINO-2-CHLORO-N-CYCLOPROPYL-N-METHYLBENZAMIDE
CAS:1095037-87-8
Formula: C11H13ClN2O
KIN05148171
5-AMINO-2-CHLORO-N-CYCLOPROPYLBENZENESULFONAMIDE
CAS:1036618-68-4
Formula: C9H11ClN2O2S
KIN05072431
5-AMINO-2-CHLORO-N-ETHYL-N-(1-METHYLETHYL)-BENZAMIDE
CAS:1094910-07-2
Formula: C12H17ClN2O
KIN05147143
5-AMINO-2-CHLORO-N-ETHYL-N-(2-HYDROXYETHYL)-BENZAMIDE
CAS:1183471-80-8
Formula: C11H15ClN2O2
KIN05304522
5-AMINO-2-CHLORO-N-ETHYL-N-(BENZYL)-BENZENEMETHANAMINE
CAS:1018276-49-7
Formula: C16H19ClN2
KIN05036337
5-AMINO-2-CHLORO-N-ETHYL-N-METHYL-BENZENEMETHANAMINE
CAS:1095021-80-9
Formula: C10H15ClN2
KIN05147969
5-AMINO-2-CHLORO-N-ETHYL-N-METHYLBENZAMIDE
CAS:1094831-44-3
Formula: C10H13ClN2O
KIN05146073
5-AMINO-2-CHLORO-N-ETHYL-N-METHYLBENZENESULFONAMIDE
CAS:1094890-70-6
Formula: C9H13ClN2O2S
KIN05146860
5-AMINO-2-CHLORO-N-ETHYL-N-PROPYL-BENZENEMETHANAMINE
CAS:1094855-77-2
Formula: C12H19ClN2
KIN05146368
5-AMINO-2-CHLORO-N-ETHYL-N-PROPYLBENZAMIDE
CAS:1094934-58-3
Formula: C12H17ClN2O
KIN05147482
5-AMINO-2-CHLORO-N-ETHYLBENZAMIDE
CAS:150108-52-4
Formula: C9H11ClN2O
KIN03295227
5-AMINO-2-CHLORO-N-ETHYLBENZENESULFONAMIDE
CAS:1041509-90-3
Formula: C8H11ClN2O2S
KIN05087096
5-AMINO-2-CHLORO-N-HYDROXY-BENZAMIDE
CAS:1081804-58-1
Formula: C7H7ClN2O2
KIN05117801
5-AMINO-2-CHLORO-N-METHOXY-BENZAMIDE
CAS:1081804-24-1
Formula: C8H9ClN2O2
KIN05117797
5-AMINO-2-CHLORO-N-METHOXY-BENZENECARBOTHIOAMIDE
CAS:1081804-08-1
Formula: C8H9ClN2OS
KIN05117795
5-AMINO-2-CHLORO-N-METHOXY-N-METHYL-BENZENEMETHANAMINE
CAS:1156152-96-3
Formula: C9H13ClN2O
KIN05230233
5-AMINO-2-CHLORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:1154376-68-7
Formula: C9H11ClN2O2
KIN05217176
5-AMINO-2-CHLORO-N-METHYL-N-(1-METHYLPROPYL)-BENZAMIDE
CAS:1095063-91-4
Formula: C12H17ClN2O
KIN05148434
5-AMINO-2-CHLORO-N-METHYL-N-(2-METHYLPROPYL)-BENZAMIDE
CAS:1094790-77-8
Formula: C12H17ClN2O
KIN05145547
5-AMINO-2-CHLORO-N-METHYL-N-(BENZYL)-BENZENEMETHANAMINE
CAS:1018242-87-9
Formula: C15H17ClN2
KIN05035889
5-AMINO-2-CHLORO-N-METHYL-N-ALLYLBENZAMIDE
CAS:1139130-87-2
Formula: C11H13ClN2O
KIN05188636
5-AMINO-2-CHLORO-N-METHYL-N-PENTYL-BENZENEMETHANAMINE
CAS:1095613-11-8
Formula: C13H21ClN2
KIN05151970
5-AMINO-2-CHLORO-N-METHYL-N-PHENYL-BENZENEMETHANAMINE
CAS:1018565-14-4
Formula: C14H15ClN2
KIN05038057
5-AMINO-2-CHLORO-N-METHYL-N-PROPYL-BENZENEMETHANAMINE
CAS:1094979-28-8
Formula: C11H17ClN2
KIN05147697
5-AMINO-2-CHLORO-N-METHYL-N-PROPYLBENZAMIDE
CAS:1094978-85-4
Formula: C11H15ClN2O
KIN05147695
5-AMINO-2-CHLORO-N-METHYLBENZAMIDE
CAS:111362-49-3
Formula: C8H9CLN2O
KIN03107312
5-AMINO-2-CHLORO-N-METHYLBENZAMIDE HCL
CAS:1193389-36-4
Formula: C8H10Cl2N2O
KIN05335040
5-AMINO-2-CHLORO-N-METHYLBENZENESULFONAMIDE
CAS:91783-85-6
Formula: C7H9ClN2O2S
KIN02748623
5-AMINO-2-CHLORO-N-PENTYLBENZAMIDE
CAS:1016703-93-7
Formula: C12H17ClN2O
KIN05024014
5-AMINO-2-CHLORO-N-PHENYLBENZAMIDE
CAS:111362-57-3
Formula: C13H11ClN2O
KIN03107314
5-AMINO-2-CHLORO-N-PHENYLBENZENESULFONAMIDE
CAS:107701-06-4
Formula: C12H11ClN2O2S
KIN03084393
5-AMINO-2-CHLORO-N-PROPYLBENZENESULFONAMIDE
CAS:1039998-78-1
Formula: C9H13ClN2O2S
KIN05083928
5-AMINO-2-CHLORO-N-PYRAZIN-2-YLBENZAMIDE
CAS:1155981-31-9
Formula: C11H9ClN4O
KIN05228334
5-AMINO-2-CHLORO-N-PYRIMIDIN-2-YLBENZAMIDE
CAS:1016794-86-7
Formula: C11H9ClN4O
KIN05026357
5-AMINO-2-CHLORO-PYRIMIDIN-4-CARBOXYLIC ACID
CAS:1052714-41-6
Formula: C5H4ClN3O2
KIN05101105
5-AMINO-2-CHLORO-THIAZOLO[4,5-D]PYRIMIDIN-7(6H)-ONE
CAS:30161-95-6
Formula: C5H3ClN4OS
KIN02179792
5-Amino-2-chloro-2,3-dihydrothiazolo[4,5-d]pyrimid
MFCD09753601
5-AMINO-2-CHLOROBENZALDEHYDE
CAS:6361-21-3
Formula: C7H4ClNO3
KIN01160290
5-AMINO-2-CHLOROBENZALDEHYDE O-(1-METHYLETHYL)OXIME
CAS:173058-92-9
Formula: C10H13ClN2O
KIN03674986
5-AMINO-2-CHLOROBENZALDEHYDE O-ETHYLOXIME
CAS:111284-81-2
Formula: C9H11ClN2O
KIN03106920
5-AMINO-2-CHLOROBENZALDEHYDE O-METHYLOXIME
CAS:111284-80-1
Formula: C8H9CLN2O
KIN03106919
5-AMINO-2-CHLOROBENZALDEHYDE O-PROPYLOXIME
CAS:111284-82-3
Formula: C10H13ClN2O
KIN03106921
5-AMINO-2-CHLOROBENZAMIDE
CAS:111362-50-6
Formula: C7H7ClN2O
KIN03107313
5-AMINO-2-CHLOROBENZENEACETIC ACID ETHYL ESTER
CAS:409082-02-6
Formula: C10H12ClNO2
KIN03569180
5-AMINO-2-CHLOROBENZENEACETIC ACID TERT-BUTYL ESTER
CAS:364610-07-1
KIN03674985
5-AMINO-2-CHLOROBENZENEACETYL CHLORIDE
CAS:203314-54-9
Formula: C8H7Cl2NO
KIN03411883
5-AMINO-2-CHLOROBENZENEETHANOL
CAS:364610-09-3
Formula: C8H10ClNO
KIN03539085
5-AMINO-2-CHLOROBENZENEMETHANAMINE
CAS:50977-88-3
Formula: C7H9ClN2
KIN02299867
5-AMINO-2-CHLOROBENZENEMETHANOL
CAS:89951-56-4
Formula: C7H8ClNO
KIN02719784
MFCD05664329
5-AMINO-2-CHLOROBENZENEMETHANOL 1-ACETATE
CAS:124877-63-0
Formula: C9H10ClNO2
KIN03186120
5-AMINO-2-CHLOROBENZENEPROPANENITRILE
CAS:90691-36-4
Formula: C9H9ClN2
KIN02731906
5-AMINO-2-CHLOROBENZENEPROPANOIC ACID METHYL ESTER
CAS:269072-29-9
Formula: C10H12ClNO2
KIN03463401
5-AMINO-2-CHLOROBENZENESULFONAMIDE
CAS:2015-20-5
Formula: C8H8N2O3
KIN01060923
5-AMINO-2-CHLOROBENZENESULFONIC ACID
CAS:88-44-8
Formula: C7H9NO3S
KIN01002263
5-AMINO-2-CHLOROBENZENESULFONIC ACID MONOSODIUM SALT
CAS:34005-11-3
Formula: C6H5ClNNaO3S
KIN02210498
5-AMINO-2-CHLOROBENZENESULFONYL CHLORIDE
CAS:133121-38-7
Formula: C6H5Cl2NO2S
KIN03222231
5-AMINO-2-CHLOROBENZENESULFONYL FLUORIDE
CAS:1996-51-6
Formula: C6H5ClFNO2S
KIN01060483
5-AMINO-2-CHLOROBENZENETHIOL
CAS:97094-83-2
Formula: C6H6ClNS
KIN02804429
5-AMINO-2-CHLOROBENZOIC ACID
CAS:89-55-4
Formula: C7H5BrO3
KIN01002350
5-AMINO-2-CHLOROBENZOIC ACID 1-CYANOETHYL ESTER
CAS:84054-81-9
Formula: C10H9ClN2O2
KIN02665113
5-AMINO-2-CHLOROBENZOIC ACID 1-METHYL-ALLYL ESTER
CAS:174489-48-6
Formula: C11H12ClNO2
KIN03022632
5-AMINO-2-CHLOROBENZOIC ACID 1-METHYLETHYL ESTER
CAS:86819-50-3
Formula: C10H12ClNO2
KIN02682750
MFCD05133182
5-AMINO-2-CHLOROBENZOIC ACID ALLYL ESTER
CAS:153774-20-0
Formula: C10H10ClNO2
KIN03306326
5-AMINO-2-CHLOROBENZOIC ACID BUTYL ESTER
CAS:135813-38-6
Formula: C11H14ClNO2
KIN03234494
5-AMINO-2-CHLOROBENZOIC ACID ETHYL ESTER
CAS:64401-55-4
Formula: C9H10ClNO2
KIN02509383
MFCD00115822
5-AMINO-2-CHLOROBENZOIC ACID METHYL ESTER
CAS:42122-75-8
Formula: C8H8ClNO2
KIN02276091
MFCD07800315
5-AMINO-2-CHLOROBENZOIC ACID PENTYL ESTER
CAS:135813-42-2
Formula: C12H16ClNO2
KIN03234496
5-AMINO-2-CHLOROBENZOIC ACID PHENYL ESTER
CAS:216585-78-3
Formula: C13H10ClNO2
KIN03429356
5-AMINO-2-CHLOROBENZOIC ACID PROPYL ESTER
CAS:135813-37-5
Formula: C10H12ClNO2
KIN03234493
5-AMINO-2-CHLOROBENZOIC ACID SULFATE
CAS:37984-73-9
Formula: C7H8ClNO6S
KIN02244341
5-AMINO-2-CHLOROBENZONITRILE
CAS:35747-58-1
Formula: C7H5ClN2
KIN02226006
MFCD00800459
5-AMINO-2-CHLOROPHENOL
CAS:6358-02-7
Formula: C19H17NO2
KIN01160135
5-AMINO-2-CHLOROPHENOL ACETATE (ESTER)
CAS:81701-92-0
Formula: C8H8ClNO2
KIN02651230
5-Amino-2-chlorophenol acetate (ester)
5-AMINO-2-CHLOROPYRIDIN-3-CARBONITRILE
CAS:13600-46-9
Formula: C6H4ClN3
KIN02021945
MFCD11040612
5-AMINO-2-CHLOROPYRIDIN-3-CARBOXYLIC ACID
CAS:42959-39-7
Formula: C6H5ClN2O2
KIN02281699
MFCD06658302
5-AMINO-2-CHLOROPYRIDIN-4-CARBOXYLIC ACID
CAS:58483-95-7
Formula: C6H5ClN2O2
KIN02416337
MFCD06659499
5-AMINO-2-CHLOROPYRIMIDIN-4-CARBOXYLIC ACID ETHYL ESTER
CAS:59950-50-4
Formula: C7H8ClN3O2
KIN02439960
5-AMINO-2-CYANO-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:89994-82-1
Formula: C5H5N5O
KIN02720547
5-Amino-2-cyano-1H-imidazol-4-carboxamide
5-AMINO-2-CYANO-2,4-PENTADIENOIC ACID
CAS:63446-37-7
Formula: C6H6N2O2
KIN02492819
5-Amino-2-cyano-2,4-pentadienoic acid
5-AMINO-2-CYANO-3-FLUOROBENZOIC ACID METHYL ESTER
CAS:1036389-07-7
Formula: C9H7FN2O2
KIN05069979
5-AMINO-2-CYANO-3-METHYLBENZOIC ACID METHYL ESTER
CAS:1036389-15-7
Formula: C10H10N2O2
KIN05069980
5-AMINO-2-CYANO-4-FLUORO-BENZOIC ACID 1-[1-[[(1-METHYL-2-PROPEN-1-YL)OXY]CARBONYL]CYCLOPENTYL]ETHYL ESTER
CAS:1139130-29-2
Formula: C20H23FN2O4
KIN05188629
5-AMINO-2-CYANO-4-FLUOROBENZENEACETIC ACID ETHYL ESTER
CAS:1012879-19-4
KIN05019094
5-AMINO-2-CYANO-4-FLUOROBENZOIC ACID 1-METHYLETHYL ESTER
CAS:208663-41-6
Formula: C11H11FN2O2
KIN03618833
5-AMINO-2-CYANO-4-FLUOROBENZOIC ACID ALLYL ESTER
CAS:174489-47-5
Formula: C11H9FN2O2
KIN03355841
5-AMINO-2-CYANO-4-FLUOROBENZOIC ACID METHYL ESTER
CAS:1036389-88-4
Formula: C9H7FN2O2
KIN05069986
5-AMINO-2-CYANO-PENTANOIC ACID
CAS:25055-45-2
Formula: C6H10N2O2
KIN02135980
5-AMINO-2-CYANOBENZENESULFONIC ACID
CAS:69851-84-9
Formula: C7H6N2O3S
KIN02573446
5-AMINO-2-CYANOBENZOIC ACID
CAS:165185-24-0
Formula: C8H6N2O2
KIN03336800
5-AMINO-2-CYANOBENZOIC ACID 1,1-DIMETHYL-ALLYL ESTER
CAS:1139130-21-4
Formula: C13H14N2O2
KIN05188627
5-AMINO-2-CYANOBENZOIC ACID 1-METHYL-ALLYL ESTER
CAS:1139129-59-1
Formula: C12H12N2O2
KIN05188623
5-AMINO-2-CYANOBENZOIC ACID 2-BUTYN-1-YL ESTER
CAS:1139130-80-5
Formula: C12H10N2O2
KIN05188635
5-AMINO-2-CYCLOBUTYL-1(2H)-ISOQUINOLINONE
CAS:1001092-21-2
Formula: C13H14N2O
KIN05005414
5-AMINO-2-CYCLOHEXYL-1,2-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:1199215-98-9
Formula: C9H15N3O
KIN05343096
5-AMINO-2-CYCLOHEXYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:106232-26-2
Formula: C10H16N4O
KIN03074997
5-AMINO-2-CYCLOHEXYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:4636-69-5
KIN01111728
5-AMINO-2-CYCLOPENTYL-4-METHYL-PHENOL
CAS:1161025-14-4
Formula: C12H17NO
KIN05258483
5-AMINO-2-CYCLOPENTYL-BENZOIC ACID METHYL ESTER
CAS:346732-10-3
Formula: C13H17NO2
KIN03681572
5-AMINO-2-CYCLOPROPYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:307990-29-0
Formula: C11H10N2O2
KIN03483788
5-AMINO-2-CYCLOPROPYL-4(3H)-PYRIMIDINONE
CAS:77996-65-7
Formula: C7H9N3O
KIN02628710
5-Amino-2-cyclopropyl-4(3H)-pyrimidinone; 5-Amino-
5-AMINO-2-CYCLOPROPYL-4-OXAZOLECARBONITRILE
CAS:196411-04-8
Formula: C7H7N3O
KIN03401214
5-AMINO-2-DECOXY-BENZOIC ACID
CAS:13737-96-7
Formula: C17H27NO3
KIN02023846
5-AMINO-2-DODECYL-2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:101452-27-1
KIN03039504
5-AMINO-2-DODECYLBENZENESULFONIC ACID
CAS:80822-87-3
Formula: C18H31NO3S
KIN02646304
5-AMINO-2-ETHOXY-3-PYRIDINECARBONITRILE
CAS:1184148-75-1
Formula: C8H9N3O
KIN05311751
5-Amino-2-ethoxy-nicotinonitrile
5-AMINO-2-ETHOXY-3-PYRIDINECARBOXYLIC ACID
CAS:459833-80-8
Formula: C8H10N2O3
KIN03595114
5-AMINO-2-ETHOXY-3-PYRIDINECARBOXYLIC ACID ETHYL ESTER
CAS:247582-59-8
Formula: C10H14N2O3
KIN03449494
5-AMINO-2-ETHOXY-4(3H)-PYRIMIDINETHIONE
CAS:98197-18-3
Formula: C6H9N3OS
KIN02811718
5-AMINO-2-ETHOXY-4(3H)-PYRIMIDINONE
CAS:72410-44-7
Formula: C6H9N3O2
KIN02591219
5-Amino-2-ethoxy-pyrimidin-4(1H)-one
5-AMINO-2-ETHOXY-4-METHYLBENZOIC ACID METHYL ESTER
CAS:70752-26-0
Formula: C11H15NO3
KIN02579633
5-AMINO-2-ETHOXY-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:106125-39-7
KIN03006552
5-AMINO-2-ETHOXY-6-METHOXY-BENZO[D]THIAZOLE
CAS:99068-48-1
Formula: C10H12N2O2S
KIN02817779
5-AMINO-2-ETHOXY-BENZAMIDE
CAS:81929-48-8
Formula: C9H12N2O2
KIN02652512
5-AMINO-2-ETHOXY-BENZENEPROPANETHIOL
CAS:90060-79-0
Formula: C11H17NOS
KIN02721788
5-AMINO-2-ETHOXY-BENZENESULFONAMIDE
CAS:1050886-42-4
Formula: C8H12N2O3S
KIN05099502
5-AMINO-2-ETHOXY-BENZENESULFONIC ACID
CAS:6375-03-7
KIN01160734
5-AMINO-2-ETHOXY-BENZOIC ACID
CAS:106262-38-8
Formula: C9H11NO3
KIN03075220
5-AMINO-2-ETHOXY-BENZOIC ACID 1-METHYLETHYLESTER
CAS:1071291-19-4
Formula: C12H17NO3
KIN05112199
5-AMINO-2-ETHOXY-BENZOIC ACID 1-METHYLPROPYLESTER
CAS:1071396-42-3
Formula: C13H19NO3
KIN05112510
5-AMINO-2-ETHOXY-BENZOIC ACID 2-METHOXYETHYL ESTER
CAS:1071396-50-3
Formula: C12H17NO4
KIN05112512
5-AMINO-2-ETHOXY-BENZOIC ACID BUTYL ESTER
CAS:80075-06-5
Formula: C13H19NO3
KIN02641717
5-AMINO-2-ETHOXY-BENZOIC ACID CYCLOPENTYLESTER
CAS:1071363-07-9
Formula: C14H19NO3
KIN05112415
5-AMINO-2-ETHOXY-BENZOIC ACID CYCLOPROPYLMETHYL ESTER
CAS:1071344-70-1
Formula: C13H17NO3
KIN05112337
5-AMINO-2-ETHOXY-BENZOIC ACID ETHYL ESTER
CAS:80074-91-5
Formula: C11H15NO3
KIN02641713
5-AMINO-2-ETHOXY-BENZOIC ACID METHYL ESTER
CAS:80074-95-9
Formula: C10H13NO3
KIN02641715
5-AMINO-2-ETHOXY-BENZOIC ACID PROPYL ESTER
CAS:80074-97-1
Formula: C12H17NO3
KIN02641716
5-AMINO-2-ETHOXY-BENZOIC ACID TERT-BUTYL ESTER
CAS:1071363-00-2
Formula: C13H19NO3
KIN05112414
5-AMINO-2-ETHOXY-BENZONITRILE
CAS:1020046-39-2
Formula: C9H10N2O
KIN05049047
5-Amino-2-ethoxy-benzonitrile
5-AMINO-2-ETHOXY-N,N-DIMETHYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:1027892-00-7
Formula: C8H14N4O2
KIN05063235
5-AMINO-2-ETHOXY-N,N-DIMETHYLBENZAMIDE
CAS:1071396-58-1
Formula: C11H16N2O2
KIN05112514
5-AMINO-2-ETHOXY-N,N-DIMETHYLBENZENEMETHANAMINE
CAS:96284-81-0
Formula: C11H18N2O
KIN02799430
5-AMINO-2-ETHOXY-N-(2-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1157104-15-8
Formula: C14H15IN2O3S
KIN05243405
5-AMINO-2-ETHOXY-N-(3-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1156424-30-4
Formula: C14H15IN2O3S
KIN05234742
5-AMINO-2-ETHOXY-N-(4-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1156424-26-8
Formula: C14H15IN2O3S
KIN05234741
5-AMINO-2-ETHOXY-N-ETHYL-N-(BENZYL)-BENZENEMETHANAMINE
CAS:1094779-89-1
Formula: C18H24N2O
KIN05145382
5-AMINO-2-ETHOXY-N-ETHYL-N-METHYLBENZENEMETHANAMINE
CAS:1094831-47-6
Formula: C12H20N2O
KIN05146075
5-AMINO-2-ETHOXY-N-ETHYLBENZAMIDE
CAS:1071363-14-8
Formula: C11H16N2O2
KIN05112416
5-AMINO-2-ETHOXY-N-ETHYLBENZENESULFONAMIDE
CAS:1156421-58-7
KIN05234723
5-AMINO-2-ETHOXY-N-METHOXY-N-METHYLBENZENEMETHANAMINE
CAS:1154213-73-6
Formula: C11H18N2O2
KIN05215480
5-AMINO-2-ETHOXY-N-METHYL-N-(BENZYL)-BENZENEMETHANAMINE
CAS:1094892-12-2
Formula: C17H22N2O
KIN05146881
5-AMINO-2-ETHOXY-N-METHYLBENZAMIDE
CAS:1071344-22-3
Formula: C10H14N2O2
KIN05112333
5-AMINO-2-ETHOXY-N-METHYLBENZENESULFONAMIDE
CAS:1156421-49-6
KIN05234721
5-AMINO-2-ETHOXY-PHENOL
CAS:55274-57-2
Formula: C8H11NO2
KIN02363708
5-Amino-2-ethoxyphenol
5-AMINO-2-ETHYL-[3,4'-BIPYRIDIN]-6(1H)-ONE
CAS:80047-28-5
Formula: C12H13N3O
KIN02641539
5-AMINO-2-ETHYL-1,7-DIHYDRO-7-PYRIDIN-4-YLPYRANO[2,3-D]IMIDAZOL-6-CARBONITRILE
CAS:374612-98-3
Formula: [C14H13N5O]
KIN03544751
5-AMINO-2-ETHYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:90521-74-7
Formula: C6H10N4O
KIN02729290
5-Amino-2-ethyl-1H-imidazol-4-carboxamide
5-AMINO-2-ETHYL-1H-IMIDAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:211929-24-7
Formula: C8H13N3O2
KIN03423292
5-AMINO-2-ETHYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:55080-55-2
Formula: C10H10N2O2
KIN02360318
5-Amino-2-ethyl-1H-isoindol-1,3(2H)-dione; 4-Amino
5-AMINO-2-ETHYL-2,3-DIHYDRO-2,4-FURANDICARBONITRILE
CAS:100805-17-2
Formula: C8H9N3O
KIN03674984
5-AMINO-2-ETHYL-2-METHYL-3(2H)-FURANONE
CAS:120533-53-1
Formula: C7H11NO2
KIN03164882
5-AMINO-2-ETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ALPHA-ONE
CAS:1176027-13-6
Formula: C10H12N2O2
KIN05268489
5-AMINO-2-ETHYL-2H-INDAZOLE
CAS:5228-56-8
Formula: C22H23NO6S3
KIN01123302
5-AMINO-2-ETHYL-3-(METHOXYMETHYL)-BENZENEMETHANOL
CAS:107490-42-6
Formula: C11H17NO2
KIN03017869
5-AMINO-2-ETHYL-3-HYDROXY-BENZOIC ACID
CAS:1025127-26-7
Formula: C9H11NO3
KIN05058872
5-AMINO-2-ETHYL-3-METHOXY-BENZOIC ACID METHYL ESTER
CAS:107490-25-5
Formula: C11H15NO3
KIN03674983
5-AMINO-2-ETHYL-3-METHYLBENZOIC ACID METHYL ESTER
CAS:107490-30-2
Formula: C11H15NO2
KIN03083082
5-AMINO-2-ETHYL-4-FLUOROBENZENEACETIC ACID ETHYL ESTER
CAS:1012879-16-1
KIN05019093
5-AMINO-2-ETHYL-4-FLUOROPHENOL
CAS:139443-59-7
Formula: C8H10FNO
KIN03252805
5-AMINO-2-ETHYL-4-OXAZOLECARBONITRILE
CAS:5098-18-0
Formula: C10H7N3O
KIN01120668
5-AMINO-2-ETHYL-6-(2-HYDROXY-PHENYL)-4(3H)-PYRIMIDINONE
CAS:110566-02-4
Formula: C12H13N3O2
KIN03630219
5-AMINO-2-ETHYL-6-[(4-OXOCYCLOHEXA-2,5-DIEN-1-YLIDENE)METHYL][1,3,4]THIADIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:6223-59-2
KIN01152797
5-AMINO-2-ETHYL-6-HYDROXY-4(3H)-ALPHA-PYRIMIDINONE
CAS:1188047-38-2
Formula: C6H9N3O2
KIN05324920
5-AMINO-2-ETHYL-BENZENEMETHANAMINE
CAS:200281-28-3
Formula: C9H14N2
KIN03407259
5-AMINO-2-ETHYL-N,N-DIMETHYLBENZENEMETHANAMINE
CAS:63789-19-5
Formula: C11H18N2
KIN02498891
5-AMINO-2-ETHYL-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:1094804-44-0
KIN05145721
5-AMINO-2-ETHYL-N-(1-METHYLETHYL)-BENZENESULFONAMIDE
CAS:1094862-22-2
KIN05146462
5-AMINO-2-ETHYL-N-(2-HYDROXYETHYL)-BENZENESULFONAMIDE
CAS:1094811-66-1
KIN05145795
5-AMINO-2-ETHYL-N-(2-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1094987-40-2
KIN05147703
5-AMINO-2-ETHYL-N-(3-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1094811-49-0
KIN05145791
5-AMINO-2-ETHYL-N-(4-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1094987-22-0
KIN05147700
5-AMINO-2-ETHYL-N-METHOXY-N-METHYLBENZENESULFONAMIDE
CAS:1154375-92-4
KIN05217166
5-AMINO-2-ETHYL-N-METHYLBENZENESULFONAMIDE
CAS:1094912-52-3
Formula: C9H14N2O2S
KIN05147214
5-AMINO-2-ETHYL-N-PROPYLBENZENESULFONAMIDE
CAS:1095015-40-9
KIN05147877
5-AMINO-2-ETHYLBENZENESULFONAMIDE
CAS:1094938-11-0
Formula: C8H12N2O2S
KIN05147561
5-AMINO-2-ETHYLBENZENESULFONIC ACID%
CAS:58443-50-8
Formula: C8H11NO3S
KIN02415645
5-AMINO-2-ETHYLBENZENETHIOL
CAS:89189-33-3
Formula: C8H11NS
KIN02708294
5-AMINO-2-ETHYLBENZO[D]ISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE
CAS:55798-31-7
Formula: C9H10N2O3S
KIN02372407
5-AMINO-2-ETHYLBENZOIC ACID
CAS:118785-95-8
Formula: C9H11NO2
KIN03155944
5-AMINO-2-ETHYLBENZOIC ACID METHYL ESTER
CAS:103095-32-5
Formula: C10H13NO2
KIN03051821
5-AMINO-2-ETHYLPENTANOIC ACID
CAS:82169-61-7
Formula: C7H15NO2
KIN02653921
5-AMINO-2-ETHYLPHENOL
CAS:207923-07-7
Formula: C8H11NO
KIN03418134
5-AMINO-2-FLUORO-3-HYDROXY-BENZOIC ACID
CAS:1025127-32-5
Formula: C7H6FNO3
KIN05058875
5-AMINO-2-FLUORO-3-IODO-ALPHA-BENZOIC ACID METHYL ESTER
CAS:1161859-82-0
Formula: C8H7FINO2
KIN05258841
5-AMINO-2-FLUORO-4-CHLORO-ALPHA-METHYLBENZENEMETHANOL
CAS:1131737-10-4
Formula: C8H9ClFNO
KIN05183418
5-AMINO-2-FLUORO-4-CHLOROBENZALDEHYDE
CAS:99329-86-9
Formula: C7H5ClFNO
KIN02819587
5-AMINO-2-FLUORO-4-CHLOROBENZENETHIOL
CAS:1073435-95-6
Formula: C6H5ClFNS
KIN05115217
5-AMINO-2-FLUORO-4-CHLOROBENZOIC ACID ETHYL ESTER
CAS:145862-49-3
Formula: C9H9ClFNO2
KIN03021077
5-AMINO-2-FLUORO-4-CHLOROPHENOL
CAS:270899-93-9
Formula: C6H5ClFNO
KIN03463980
5-AMINO-2-FLUORO-4-HYDROXY-BENZENESULFONIC ACID
CAS:132396-96-4
KIN03218635
5-AMINO-2-FLUORO-4-HYDROXY-BENZONITRILE
CAS:388091-38-1
Formula: C7H5FN2O
KIN03554671
5-AMINO-2-FLUORO-4-METHOXY-BENZOIC ACID
CAS:1131314-68-5
Formula: C8H8FNO3
KIN05182862
5-AMINO-2-FLUORO-4-PYRIDINECARBOXYLIC ACID
CAS:171178-43-1
Formula: C6H5FN2O2
KIN03348544
5-AMINO-2-FLUORO-ALPHA-METHYLBENZENEMETHANOL
CAS:150295-25-3
Formula: C8H10FNO
KIN03295740
5-AMINO-2-FLUORO-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:1094853-59-4
Formula: C8H11FN2O2S
KIN05146358
5-AMINO-2-FLUORO-N,N-DIPROPYLBENZAMIDE
CAS:1156817-95-6
Formula: C13H19FN2O
KIN05238719
5-AMINO-2-FLUORO-N-(1-METHYL-1H-PYRAZOL-3-YL)-BENZAMIDE
CAS:1182755-11-8
Formula: C11H11FN4O
KIN05297019
5-AMINO-2-FLUORO-N-(1-METHYL-1H-PYRAZOL-4-YL)-BENZAMIDE
CAS:1153970-30-9
Formula: C11H11FN4O
KIN05213695
5-AMINO-2-FLUORO-N-(1-METHYLBUTYL)-BENZAMIDE
CAS:1153247-95-0
Formula: C12H17FN2O
KIN05207233
5-AMINO-2-FLUORO-N-(1-METHYLBUTYL)-BENZENESULFONAMIDE
CAS:1094888-26-2
Formula: C11H17FN2O2S
KIN05146813
5-AMINO-2-FLUORO-N-(1-METHYLETHYL)-BENZAMIDE
CAS:1043391-04-3
Formula: C10H13FN2O
KIN05092623
5-AMINO-2-FLUORO-N-(1-METHYLETHYL)-BENZENESULFONAMIDE
CAS:1094853-36-7
Formula: C9H13FN2O2S
KIN05146353
5-AMINO-2-FLUORO-N-(1-METHYLETHYL)-N-PROPYLBENZAMIDE
CAS:1153404-91-1
Formula: C13H19FN2O
KIN05209543
5-AMINO-2-FLUORO-N-(1-METHYLPROPYL)-BENZAMIDE
CAS:1153287-71-8
Formula: C11H15FN2O
KIN05207879
5-AMINO-2-FLUORO-N-(1-METHYLPROPYL)-BENZENESULFONAMIDE
CAS:1094853-37-8
Formula: C10H15FN2O2S
KIN05146354
5-AMINO-2-FLUORO-N-(2,2,2-TRIFLUORO-ETHYL)-BENZAMIDE
CAS:1156992-77-6
Formula: C9H8F4N2O
KIN05241235
5-AMINO-2-FLUORO-N-(2-FLUOROPHENYL)-BENZAMIDE
CAS:1156992-46-9
Formula: C13H10F2N2O
KIN05241232
5-AMINO-2-FLUORO-N-(2-HYDROXY-1-METHYLETHYL)-BENZAMIDE
CAS:1156987-41-5
Formula: C10H13FN2O2
KIN05241191
5-AMINO-2-FLUORO-N-(2-HYDROXY-PROPYL)-BENZAMIDE
CAS:1156987-30-2
Formula: C10H13FN2O2
KIN05241189
5-AMINO-2-FLUORO-N-(2-HYDROXY-TERT-BUTYL)-BENZAMIDE
CAS:1156987-20-0
Formula: C11H15FN2O2
KIN05241188
5-AMINO-2-FLUORO-N-(2-HYDROXYETHYL)-BENZAMIDE
CAS:1156985-28-2
Formula: C9H11FN2O2
KIN05241156
5-AMINO-2-FLUORO-N-(2-HYDROXYETHYL)-BENZENESULFONAMIDE
CAS:1095015-30-7
Formula: C8H11FN2O3S
KIN05147875
5-AMINO-2-FLUORO-N-(2-HYDROXYETHYL)-N-METHYLBENZAMIDE
CAS:1156599-33-5
Formula: C10H13FN2O2
KIN05235813
5-AMINO-2-FLUORO-N-(2-IODO-PHENYL)-BENZAMIDE
CAS:1153287-77-4
Formula: C13H10FIN2O
KIN05207881
5-AMINO-2-FLUORO-N-(2-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1094853-83-4
KIN05146359
5-AMINO-2-FLUORO-N-(2-METHOXY-1-METHYLETHYL)-BENZAMIDE
CAS:1153291-02-1
Formula: C11H15FN2O2
KIN05207922
5-AMINO-2-FLUORO-N-(2-METHOXYETHYL)-BENZAMIDE
CAS:1156817-86-5
Formula: C10H13FN2O2
KIN05238715
5-AMINO-2-FLUORO-N-(2-METHOXYETHYL)-BENZENESULFONAMIDE
CAS:1095014-75-7
Formula: C9H13FN2O3S
KIN05147869
5-AMINO-2-FLUORO-N-(2-METHYLPHENYL)-BENZAMIDE
CAS:1156069-62-3
Formula: C14H13FN2O
KIN05228964
5-AMINO-2-FLUORO-N-(2-METHYLPROPYL)-BENZAMIDE
CAS:1156065-19-8
Formula: C11H15FN2O
KIN05228899
5-AMINO-2-FLUORO-N-(2-METHYLPROPYL)-BENZENESULFONAMIDE
CAS:1094822-21-5
Formula: C10H15FN2O2S
KIN05145915
5-AMINO-2-FLUORO-N-(3-FLUOROPHENYL)-BENZAMIDE
CAS:1156064-85-5
Formula: C13H10F2N2O
KIN05228890
5-AMINO-2-FLUORO-N-(3-HYDROXY-PROPYL)-BENZAMIDE
CAS:1153404-61-5
Formula: C10H13FN2O2
KIN05209539
5-AMINO-2-FLUORO-N-(3-IODO-PHENYL)-BENZAMIDE
CAS:1156599-06-2
Formula: C13H10FIN2O
KIN05235806
5-AMINO-2-FLUORO-N-(3-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1094888-44-4
KIN05146815
5-AMINO-2-FLUORO-N-(3-METHOXY-PROPYL)-BENZAMIDE
CAS:1153288-51-7
Formula: C11H15FN2O2
KIN05207893
5-AMINO-2-FLUORO-N-(3-METHYL-ISOXAZOL-5-YL)-BENZAMIDE
CAS:1153290-68-6
Formula: C11H10FN3O2
KIN05207916
5-AMINO-2-FLUORO-N-(3-METHYLBUTYL)-BENZAMIDE
CAS:1153248-68-0
Formula: C12H17FN2O
KIN05207252
5-AMINO-2-FLUORO-N-(3-METHYLBUTYL)-BENZENESULFONAMIDE
CAS:1094888-32-0
Formula: C11H17FN2O2S
KIN05146814
5-AMINO-2-FLUORO-N-(3-METHYLPHENYL)-BENZAMIDE
CAS:1153289-00-9
Formula: C14H13FN2O
KIN05207899
5-AMINO-2-FLUORO-N-(3-METHYLPYRIDIN-2-YL)-BENZAMIDE
CAS:1153292-70-6
Formula: C13H12FN3O
KIN05207952
5-AMINO-2-FLUORO-N-(4-FLUOROPHENYL)-BENZAMIDE
CAS:1156070-90-4
Formula: C13H10F2N2O
KIN05228993
5-AMINO-2-FLUORO-N-(4-IODO-PHENYL)-BENZAMIDE
CAS:1153294-40-6
Formula: C13H10FIN2O
KIN05207991
5-AMINO-2-FLUORO-N-(4-IODO-PHENYL)-BENZENESULFONAMIDE
CAS:1095015-26-1
KIN05147874
5-AMINO-2-FLUORO-N-(4-METHYLPHENYL)-BENZAMIDE
CAS:1156991-79-5
Formula: C14H13FN2O
KIN05241222
5-AMINO-2-FLUORO-N-(4-METHYLPYRIDIN-2-YL)-BENZAMIDE
CAS:1156598-98-9
Formula: C13H12FN3O
KIN05235805
5-AMINO-2-FLUORO-N-(5-METHYL-ISOXAZOL-3-YL)-BENZAMIDE
CAS:1153288-33-5
Formula: C11H10FN3O2
KIN05207889
5-AMINO-2-FLUORO-N-(5-METHYLPYRIDIN-2-YL)-BENZAMIDE
CAS:1153292-63-7
Formula: C13H12FN3O
KIN05207949
5-AMINO-2-FLUORO-N-(6-METHYLPYRIDIN-2-YL)-BENZAMIDE
CAS:1156598-86-5
Formula: C13H12FN3O
KIN05235803
5-AMINO-2-FLUORO-N-(BENZYL)-BENZAMIDE
CAS:301527-67-3
Formula: C14H13FN2O
KIN03477472
5-AMINO-2-FLUORO-N-(FURAN-2-YLMETHYL)-BENZAMIDE
CAS:1156817-75-2
Formula: C12H11FN2O2
KIN05238710
5-AMINO-2-FLUORO-N-(FURAN-2-YLMETHYL)-N-METHYLBENZAMIDE
CAS:1156181-47-3
Formula: C13H13FN2O2
KIN05230748
5-AMINO-2-FLUORO-N-(PYRIDIN-2-YLMETHYL)-BENZAMIDE
CAS:1156070-40-4
Formula: C13H12FN3O
KIN05228980
5-AMINO-2-FLUORO-N-(PYRIDIN-3-YLMETHYL)-BENZAMIDE
CAS:1153293-48-1
Formula: C13H12FN3O
KIN05207979
5-AMINO-2-FLUORO-N-(PYRIDIN-4-YLMETHYL)-BENZAMIDE
CAS:1153293-68-5
Formula: C13H12FN3O
KIN05207982
5-AMINO-2-FLUORO-N-(TETRAHYDRO-2H-PYRAN-4-YL)-BENZAMIDE
CAS:1153062-58-8
Formula: C12H15FN2O2
KIN05204405
5-AMINO-2-FLUORO-N-[1-(FURAN-2-YL)ETHYL]BENZAMIDE
CAS:1153292-96-6
Formula: C13H13FN2O2
KIN05207957
5-AMINO-2-FLUORO-N-[1-(HYDROXYMETHYL)-PROPYL]BENZAMIDE
CAS:1156987-02-8
Formula: C11H15FN2O2
KIN05241182
5-AMINO-2-FLUORO-N-[2-(THIOPHEN-2-YL)ETHYL]BENZAMIDE
CAS:1153289-39-4
Formula: C13H13FN2OS
KIN05207902
5-AMINO-2-FLUORO-N-1,3,4-THIADIAZOL-2-YLBENZAMIDE
CAS:1156984-75-6
Formula: C9H7FN4OS
KIN05241153
5-AMINO-2-FLUORO-N-1H-PYRAZOL-4-YLBENZAMIDE
CAS:1154178-16-1
Formula: C10H9FN4O
KIN05215249
5-AMINO-2-FLUORO-N-1H-PYRAZOL-4-YLBENZENESULFONAMIDE
CAS:1154177-48-6
Formula: C9H9FN4O2S
KIN05215235
5-AMINO-2-FLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:1154376-30-3
Formula: C9H11FN2O2
KIN05217173
5-AMINO-2-FLUORO-N-METHOXY-N-METHYLBENZENESULFONAMIDE
CAS:1156154-23-2
Formula: C8H11FN2O3S
KIN05230266
5-AMINO-2-FLUORO-N-METHYL-N-(1-METHYLBUTYL)-BENZAMIDE
CAS:1156699-97-6
Formula: C13H19FN2O
KIN05237016
5-AMINO-2-FLUORO-N-METHYL-N-(1-METHYLETHYL)-BENZAMIDE
CAS:1153288-47-1
Formula: C11H15FN2O
KIN05207891
5-AMINO-2-FLUORO-N-METHYL-N-(1-METHYLPROPYL)-BENZAMIDE
CAS:1156599-56-2
Formula: C12H17FN2O
KIN05235819
5-AMINO-2-FLUORO-N-METHYL-N-(2-METHYLBUTYL)-BENZAMIDE
CAS:1156985-67-9
Formula: C13H19FN2O
KIN05241162
5-AMINO-2-FLUORO-N-METHYL-N-(2-METHYLPROPYL)-BENZAMIDE
CAS:1156599-51-7
Formula: C12H17FN2O
KIN05235817
5-AMINO-2-FLUORO-N-METHYL-N-PENTYLBENZAMIDE
CAS:1153405-04-9
Formula: C13H19FN2O
KIN05209547
5-AMINO-2-FLUORO-N-METHYL-N-PHENYLBENZAMIDE
CAS:1156065-14-3
Formula: C14H13FN2O
KIN05228897
5-AMINO-2-FLUORO-N-METHYL-N-PROPYLBENZAMIDE
CAS:1153404-96-6
Formula: C11H15FN2O
KIN05209545
5-AMINO-2-FLUORO-N-METHYL-N-PROPYLBENZENESULFONAMIDE
CAS:1095034-13-1
Formula: C10H15FN2O2S
KIN05148105
5-AMINO-2-FLUORO-N-METHYL-N-PYRIDIN-2-YLBENZAMIDE
CAS:1156598-90-1
Formula: C13H12FN3O
KIN05235804
5-AMINO-2-FLUORO-N-METHYLBENZAMIDE
CAS:1153287-97-8
Formula: C8H9FN2O
KIN05207884
5-amino-2-fluoro-N-methylbenzamide
5-AMINO-2-FLUORO-N-METHYLBENZENESULFONAMIDE
CAS:1094887-98-5
Formula: C7H9FN2O2S
KIN05146811
5-AMINO-2-FLUORO-N-PENTYLBENZAMIDE
CAS:1153247-28-9
Formula: C12H17FN2O
KIN05207217
5-AMINO-2-FLUORO-N-PENTYLBENZENESULFONAMIDE
CAS:1094797-26-8
Formula: C11H17FN2O2S
KIN05145628
5-AMINO-2-FLUORO-N-PHENYLBENZAMIDE
CAS:228425-68-1
Formula: C13H11FN2O
KIN03441835
5-AMINO-2-FLUORO-N-PROPYLBENZAMIDE
CAS:1156817-63-8
Formula: C10H13FN2O
KIN05238706
5-AMINO-2-FLUORO-N-PROPYLBENZENESULFONAMIDE
CAS:1094822-18-0
Formula: C9H13FN2O2S
KIN05145913
5-AMINO-2-FLUORO-N-PYRAZIN-2-YLBENZAMIDE
CAS:1156404-57-7
Formula: C11H9FN4O
KIN05234394
5-AMINO-2-FLUORO-N-PYRIDIN-2-YLBENZAMIDE
CAS:1156065-05-2
Formula: C12H10FN3O
KIN05228895
5-AMINO-2-FLUORO-N-PYRIDIN-4-YLBENZAMIDE
CAS:1153288-42-6
Formula: C12H10FN3O
KIN05207890
5-AMINO-2-FLUORO-N-PYRIMIDIN-2-YLBENZAMIDE
CAS:1156598-82-1
Formula: C11H9FN4O
KIN05235802
5-AMINO-2-FLUORO-N-THIAZOL-2-YLBENZAMIDE
CAS:1156817-69-4
Formula: C10H8FN3OS
KIN05238709
5-AMINO-2-FLUOROBENZENEMETHANOL
CAS:84832-00-8
Formula: C7H8FNO
KIN02670148
MFCD03094257
5-AMINO-2-FLUOROBENZENEPROPANOIC ACID TERT-BUTYL ESTER
CAS:1192040-13-3
KIN05332648
5-AMINO-2-FLUOROBENZENESULFONIC ACID
CAS:38962-61-7
Formula: C6H6FNO3S
KIN02251755
MFCD01861146
5-AMINO-2-FLUOROBENZOIC ACID
CAS:56741-33-4
Formula: C7H6FNO2
KIN02387896
MFCD00077449
5-AMINO-2-FLUOROBENZOIC ACID 1-METHYLETHYLESTER
CAS:1183485-33-7
Formula: C10H12FNO2
KIN05304660
5-AMINO-2-FLUOROBENZOIC ACID ALLYL ESTER
CAS:153774-34-6
Formula: C10H10FNO2
KIN03306330
5-AMINO-2-FLUOROBENZOIC ACID BUTYL ESTER
CAS:1179635-07-4
Formula: C11H14FNO2
KIN05285887
5-AMINO-2-FLUOROBENZOIC ACID ETHYL ESTER
CAS:123207-39-6
Formula: C9H10FNO2
KIN03178525
5-AMINO-2-FLUOROBENZOIC ACID HCL
CAS:130047-15-3
Formula: C7H7ClFNO2
KIN03208405
5-AMINO-2-FLUOROBENZOIC ACID METHYL ESTER
CAS:56741-34-5
Formula: C8H8FNO2
KIN02387897
MFCD09037918
5-AMINO-2-FLUOROBENZOIC ACID METHYL ESTER HCL
CAS:269071-91-2
KIN03463394
5-AMINO-2-FLUOROBENZOIC ACID PHENYLMETHYL ESTER
CAS:167993-18-2
Formula: C14H12FNO2
KIN03341835
5-AMINO-2-FLUOROBENZOIC ACID PROPYL ESTER
CAS:1178637-88-1
Formula: C10H12FNO2
KIN05278166
5-AMINO-2-FLUOROBENZONITRILE
CAS:53312-81-5
Formula: C7H5FN2
KIN02333204
MFCD00277872
5-AMINO-2-FLUOROPHENOL
CAS:100367-48-4
Formula: C6H6FNO
KIN03030950
5-AMINO-2-FORMYLBENZENESULFONIC ACID
CAS:69851-86-1
Formula: C7H7NO4S
KIN02573447
5-AMINO-2-FORMYLBENZENESULFONIC ACID MONOSODIUM SALT
CAS:116293-76-6
Formula: C7H7NO4S.Na
KIN03663924
5-AMINO-2-FURANCARBALDEHYDE
CAS:39116-21-7
Formula: C5H5NO2
KIN02253030
5-AMINO-2-FURANCARBOXYLIC ACID
CAS:341007-99-6
Formula: [C5H5NO3
KIN03514897
5-AMINO-2-FURANCARBOXYLIC ACID ETHYL ESTER
CAS:15856-35-6
Formula: C7H9NO3
KIN02044811
5-AMINO-2-HEPTOXY-BENZOIC ACID
CAS:13737-92-3
Formula: C14H21NO3
KIN02023844
5-AMINO-2-HEXENEDIOIC ACID
CAS:74743-93-4
Formula: C6H9NO4
KIN02608069
5-AMINO-2-HEXYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:51419-26-2
Formula: C14H18N2O2
KIN02306168
5-AMINO-2-HYDRAZINYL-2-METHYLPENTANOIC ACID HCL
CAS:56937-71-4
Formula: C6H16ClN3O2
KIN02391252
5-AMINO-2-HYDRAZINYLPHENOL
CAS:100507-45-7
Formula: C6H9N3O
KIN03032310
5-AMINO-2-HYDROXY-3-(1-METHYLETHYL)-BENZOIC ACID
CAS:72998-02-8
Formula: C10H13NO3
KIN02595202
5-Amino-2-hydroxy-3-isopropylbenzoic acid
5-AMINO-2-HYDROXY-3-(1-OXO-PROPYL)-BENZOIC ACID
CAS:101371-47-5
Formula: C10H11NO4
KIN03038883
5-AMINO-2-HYDROXY-3-METHOXY-BENZOIC ACID
CAS:90764-83-3
Formula: C8H9NO4
KIN02732864
5-AMINO-2-HYDROXY-3-METHYLBENZOIC ACID
CAS:6265-15-2
Formula: C15H14N2O4
KIN01153863
5-AMINO-2-HYDROXY-3-METHYLBENZOIC ACID METHYL ESTER
CAS:69318-39-4
KIN02569457
5-AMINO-2-HYDROXY-3-NITRO-BENZOIC ACID
CAS:945-21-1
KIN01034874
5-AMINO-2-HYDROXY-3-YLSULFOBENZOIC ACID
CAS:6201-88-3
Formula: C7H5BrO6S
KIN01152294
5-AMINO-2-HYDROXY-4-(TRIFLUOROMETHYL)-BENZOIC ACID
CAS:393-47-5
KIN01013228
5-AMINO-2-HYDROXY-4-IODO-ALPHA-BENZOIC ACID METHYL ESTER
CAS:1143580-02-2
Formula: C8H8INO3
KIN05192215
5-AMINO-2-HYDROXY-4-METHYLBENZOIC ACID
CAS:13066-89-2
Formula: C8H9NO3
KIN02014267
5-AMINO-2-HYDROXY-4-NITRO-BENZENEPROPANOIC ACID
CAS:146767-17-1
KIN03283531
5-AMINO-2-HYDROXY-6-METHYL-2,4,6-CYCLOHEPTATRIEN-1-ONE
CAS:412324-04-0
Formula: C8H9NO2
KIN03570671
5-AMINO-2-HYDROXY-BENZALDEHYDE O-METHYLOXIME
CAS:106837-42-7
Formula: C8H10N2O2
KIN03078908
5-AMINO-2-HYDROXY-BENZALDEHYDE OXIME
CAS:1020479-08-6
Formula: C7H8N2O2
KIN05049588
5-AMINO-2-HYDROXY-BENZAMIDE
CAS:59393-77-0
Formula: C7H8N2O2
KIN02430765
5-AMINO-2-HYDROXY-BENZENE-1,3-DISULFONIC ACID
CAS:6362-58-9
Formula: C10H10O3
KIN01160332
5-AMINO-2-HYDROXY-BENZENEACETIC ACID ETHYL ESTER
CAS:155388-86-6
Formula: C10H13NO3
KIN03312132
5-AMINO-2-HYDROXY-BENZENEACETIC ACID METHYL ESTER
CAS:155388-85-5
Formula: C9H11NO3
KIN03021697
5-AMINO-2-HYDROXY-BENZENEETHANOL
CAS:104333-08-6
Formula: C8H11NO2
KIN03060534
5-AMINO-2-HYDROXY-BENZENEMETHANOL HCL
CAS:57361-57-6
Formula: C7H9NO2.ClH
KIN02398485
5-Amino-2-hydroxy-benzenemethanol HCl
5-AMINO-2-HYDROXY-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:146767-12-6
KIN03674982
5-AMINO-2-HYDROXY-BENZENEPROPANOIC ACID METHYL ESTER
CAS:1016274-45-5
Formula: C10H13NO3
KIN05021650
5-AMINO-2-HYDROXY-BENZENESULFONAMIDE
CAS:89533-02-8
Formula: C6H8N2O3S
KIN02713167
5-Amino-2-hydroxy-benzenesulfonamide; 6-Hydroxy-me
5-AMINO-2-HYDROXY-BENZENESULFONIC ACID
CAS:2835-05-4
Formula: C6H7NO4S
KIN01077035
5-AMINO-2-HYDROXY-BENZOIC ACID
CAS:1189709-96-3
Formula: C7H7NO3
KIN05329315
5-AMINO-2-HYDROXY-BENZOIC ACID 1-METHYLETHYL ESTER
CAS:64240-87-5
Formula: C10H13NO3
KIN02506622
5-Amino-2-hydroxy-benzoic acid isopropyl ester; 5-
5-AMINO-2-HYDROXY-BENZOIC ACID 2-HYDROXYETHYL ESTER
CAS:228412-49-5
Formula: [C9H11NO4
KIN03441793
5-AMINO-2-HYDROXY-BENZOIC ACID 2-METHYLPROPYL ESTER
CAS:64240-88-6
Formula: C11H15NO3
KIN02506623
5-AMINO-2-HYDROXY-BENZOIC ACID 3,3-DIMETHYLBUTYL ESTER
CAS:155388-94-6
KIN03641399
5-AMINO-2-HYDROXY-BENZOIC ACID 3-HYDROXY-PHENYL ESTER
CAS:155389-00-7
KIN03652653
5-AMINO-2-HYDROXY-BENZOIC ACID 4-(NITRO-OXY)BUTYL ESTER
CAS:256499-26-0
Formula: C11H14N2O6
KIN03455660
5-AMINO-2-HYDROXY-BENZOIC ACID ALLYL ESTER
CAS:64241-20-9
Formula: C10H11NO3
KIN02506653
5-Amino-2-hydroxy-benzoic acid allyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID BUTYL ESTER
CAS:62773-64-2
Formula: C11H15NO3
KIN02480164
5-Amino-2-hydroxy-benzoic acid butyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID CYCLOHEXYL ESTER
CAS:64241-00-5
Formula: C13H17NO3
KIN02506634
5-Amino-2-hydroxy-benzoic acid cyclohexyl ester; 5
5-AMINO-2-HYDROXY-BENZOIC ACID CYCLOHEXYLMETHYL ESTER
CAS:154737-72-1
KIN03652652
5-AMINO-2-HYDROXY-BENZOIC ACID DECYL ESTER
CAS:64240-94-4
Formula: C17H27NO3
KIN02506629
5-Amino-2-hydroxy-benzoic acid decyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID DODECYL ESTER
CAS:64240-95-5
Formula: C19H31NO3
KIN02506630
5-AMINO-2-HYDROXY-BENZOIC ACID ETHENYL ESTER
CAS:64241-19-6
Formula: C9H9NO3
KIN02506652
5-AMINO-2-HYDROXY-BENZOIC ACID ETHYL ESTER
CAS:64240-86-4
KIN02506621
5-AMINO-2-HYDROXY-BENZOIC ACID HCL
CAS:6291-39-0
Formula: C23H21ClN4O3S
KIN01155881
5-AMINO-2-HYDROXY-BENZOIC ACID HEPTYL ESTER
CAS:64240-91-1
Formula: C14H21NO3
KIN02506626
5-AMINO-2-HYDROXY-BENZOIC ACID HEXADECYL ESTER
CAS:64240-97-7
Formula: C23H39NO3
KIN02506632
5-Amino-2-hydroxy-benzoic acid hexadecyl ester; 5-
5-AMINO-2-HYDROXY-BENZOIC ACID HEXYL ESTER
CAS:64240-90-0
Formula: C13H19NO3
KIN02506625
5-Amino-2-hydroxy-benzoic acid hexyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID METHYL ESTER
CAS:42753-75-3
Formula: C8H9NO3
KIN02280032
5-Amino-2-hydroxy-benzoic acid methyl ester
MFCD01317557
5-AMINO-2-HYDROXY-BENZOIC ACID NONYL ESTER
CAS:64240-93-3
Formula: C16H25NO3
KIN02506628
5-Amino-2-hydroxy-benzoic acid nonyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID OCTADECYL ESTER
CAS:64240-98-8
Formula: C25H43NO3
KIN02506633
5-Amino-2-hydroxy-benzoic acid octadecyl ester; 5-
5-AMINO-2-HYDROXY-BENZOIC ACID OCTYL ESTER
CAS:64240-92-2
Formula: C15H23NO3
KIN02506627
5-Amino-2-hydroxy-benzoic acid octyl ester; 5-Amin
5-AMINO-2-HYDROXY-BENZOIC ACID PENTYL ESTER
CAS:64240-89-7
Formula: C12H17NO3
KIN02506624
5-AMINO-2-HYDROXY-BENZOIC ACID PHENYL ESTER
CAS:64240-78-4
Formula: C13H11NO3
KIN02506617
5-AMINO-2-HYDROXY-BENZOIC ACID PHENYLMETHYL ESTER
CAS:154737-65-2
KIN03021663
5-AMINO-2-HYDROXY-BENZOIC ACID PROPYL ESTER
CAS:62773-63-1
Formula: C10H13NO3
KIN02480163
5-AMINO-2-HYDROXY-BENZOIC ACID TERT-BUTYL ESTER
CAS:155388-93-5
Formula: [C11H15NO3
KIN03312134
5-AMINO-2-HYDROXY-BENZOIC ACID TETRADECYL ESTER
CAS:64240-96-6
Formula: C21H35NO3
KIN02506631
5-Amino-2-hydroxy-benzoic acid tetradecyl ester; 5
5-AMINO-2-HYDROXY-BENZOIC ACID UNDECENYL ESTER
CAS:64239-92-5
Formula: C18H27NO3
KIN02506604
5-Amino-2-hydroxy-benzoic acid undecenyl ester; 5-
5-AMINO-2-HYDROXY-BENZONITRILE
CAS:87029-84-3
Formula: C7H6N2O
KIN02683951
4-Amino-2-cyanophenol; 5-Amino-2-hydroxy-benzonitr
MFCD01646169
5-AMINO-2-HYDROXY-CYCLOHEPTA-2,4,6-TRIENONE
CAS:7021-47-8
Formula: C13H9N3O4
KIN01176579
5-AMINO-2-HYDROXY-ISOINDOL-1,3-DIONE
CAS:105969-84-4
Formula: C8H6N2O3
KIN03072622
5-AMINO-2-HYDROXY-N-1H-TETRAZOL-5-YLBENZAMIDE HBR
CAS:67127-38-2
KIN02548794
5-AMINO-2-HYDROXY-PENTANOIC ACID
CAS:66960-54-1
Formula: C5H11NO3
KIN02547283
5-Amino-2-hydroxy-pentanoic acid
5-AMINO-2-HYDROXY-PHENYL-ACETIC ACID
CAS:155388-84-4
Formula: C8H9NO3
KIN03312131
5-AMINO-2-HYDROXYHEXANOIC ACID
CAS:89584-49-6
Formula: C6H13NO3
KIN02713967
5-AMINO-2-HYDROXYNAPHTHALENE
CAS:86-98-6
Formula: C9H5Cl2N
KIN01002136
5-AMINO-2-IMINO-3,4-DIMETHYL-2H-PYRROLE
CAS:98197-08-1
Formula: C6H9N3
KIN02811708
5-AMINO-2-IMINO-PENTANOIC ACID
CAS:1042391-99-0
Formula: C5H10N2O2
KIN05088770
5-AMINO-2-IODO-1,3-BENZENEDICARBOXYLIC ACID
CAS:127324-00-9
Formula: C8H6INO4
KIN03196876
5-AMINO-2-IODO-4-NITRO-BENZENEACETONITRILE
CAS:335349-74-1
KIN03508797
5-AMINO-2-IODO-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:335349-59-2
KIN03508793
5-AMINO-2-IODO-ALPHA--BENZOIC ACID METHYL ESTER
CAS:1065102-79-5
Formula: C8H8INO2
KIN05109262
5-AMINO-2-IODO-ALPHA-BENZONITRILE
CAS:1082454-14-5
Formula: C7H5IN2
KIN05120326
5-AMINO-2-IODO-BENZAMIDE
CAS:214556-40-8
KIN03426714
5-AMINO-2-IODO-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:99255-44-4
Formula: C11H14INO2
KIN02819178
5-Amino-2-iodo-benzenepropanoic acid ethyl ester;
5-AMINO-2-IODO-BENZENESULFONAMIDE
CAS:477932-67-5
Formula: C6H7IN2O2S
KIN03605753
5-AMINO-2-IODO-BENZOIC ACID
CAS:57772-59-5
Formula: C7H6INO2
KIN02405141
MFCD17276482
5-AMINO-2-IODO-N,N-DIMETHYLBENZENEPROPANAMIDE
CAS:215949-68-1
KIN03428620
5-AMINO-2-IODO-N,N-DIMETHYLBENZENEPROPANAMINE
CAS:215949-69-2
KIN03428621
5-AMINO-2-IODO-PHENOL
CAS:39075-33-7
Formula: C6H6INO
KIN02252537
5-Amino-2-iodo-phenol
5-AMINO-2-ISOTHIOCYANATO-BENZONITRILE
CAS:73600-75-6
Formula: C8H5N3S
KIN02599326
5-AMINO-2-METHOXY-3,4-DIMETHYL-PHENOL
CAS:125771-79-1
Formula: C9H13NO2
KIN03190098
5-AMINO-2-METHOXY-3,4-DIMETHYL-PHENOL 1-ACETATE
CAS:147623-20-9
Formula: C11H15NO3
KIN03681571
5-AMINO-2-METHOXY-3-(METHYLAMINO)-1,4-NAPHTHALENEDIONE
CAS:71408-38-3
Formula: C12H12N2O3
KIN02584114
5-AMINO-2-METHOXY-3-METHYLBENZOIC ACID METHYL ESTER
CAS:70752-23-7
KIN02579631
5-AMINO-2-METHOXY-3-METHYLPYRIDINE HCL
CAS:1159811-59-2
Formula: C7H11ClN2O;C7H10N2O.ClH
KIN05255604
5-AMINO-2-METHOXY-3-PYRIDINECARBONITRILE
CAS:1184216-65-6
Formula: C7H7N3O
KIN05312341
5-AMINO-2-METHOXY-3-PYRIDINECARBOXYLIC ACID METHYL ESTER
CAS:122433-51-6
Formula: C8H10N2O3
KIN03174746
5-AMINO-2-METHOXY-4-(METHYLTHIO)PHENOL
CAS:155821-44-6
KIN03313503
5-AMINO-2-METHOXY-4-METHYLBENZOIC ACID
CAS:70752-50-0
Formula: C9H11NO3
KIN02579641
5-Amino-2-methoxy-4-methylbenzoic acid
5-AMINO-2-METHOXY-4-METHYLBENZOYL CHLORIDE
CAS:90763-49-8
Formula: C9H10ClNO2
KIN02732851
5-AMINO-2-METHOXY-4-METHYLPHENOL 1-ACETATE
CAS:408352-94-3
Formula: C10H13NO3
KIN03568473
5-AMINO-2-METHOXY-4-NITRO-BENZOIC ACID
CAS:106125-57-9
Formula: C8H8N2O5
KIN03074097
5-AMINO-2-METHOXY-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:79893-21-3
Formula: C9H10N2O5
KIN02640542
5-AMINO-2-METHOXY-4-NITROPHENOL
CAS:105834-01-3
KIN03071362
5-AMINO-2-METHOXY-4-NITROPHENYL-ALANINE
CAS:66137-04-0
Formula: C10H13N3O5
KIN02537542
5-Amino-2-methoxy-4-nitrophenyl-alanine
5-AMINO-2-METHOXY-4-PROPOXY-BENZOIC ACID METHYL ESTER
CAS:174261-21-3
KIN03652651
5-AMINO-2-METHOXY-4-PROPYLPHENOL
CAS:1071659-76-1
Formula: C10H15NO2
KIN05113246
5-AMINO-2-METHOXY-4-PYRIDINECARBOXYLIC ACID
CAS:183741-91-5
Formula: C7H8N2O3
KIN03375455
5-AMINO-2-METHOXY-6-METHYLBENZO[D]THIAZOLE
CAS:102308-99-6
Formula: [C9H10N2OS]
KIN03046258
5-AMINO-2-METHOXY-BENZALDEHYDE
CAS:1137622-03-7
Formula: C8H9NO2
KIN05187801
5-AMINO-2-METHOXY-BENZAMIDE
CAS:22961-58-6
Formula: C8H10N2O2
KIN02115351
MFCD11505326
5-AMINO-2-METHOXY-BENZENEACETIC ACID
CAS:90972-26-2
KIN02736724
5-Amino-2-methoxyphenyl-acetic acid; (5-Amino-2-me
5-AMINO-2-METHOXY-BENZENEACETIC ACID METHYL ESTER
CAS:138563-97-0
Formula: C10H13NO3
KIN03247504
5-AMINO-2-METHOXY-BENZENEACETIC ACID TERT-BUTYL ESTER
CAS:354516-83-9
KIN03652650
5-AMINO-2-METHOXY-BENZENEACETONITRILE
CAS:90557-39-4
Formula: C9H10N2O
KIN02729913
(5-Amino-2-methoxyphenyl)-acetonitrile; (2-Methoxy
5-AMINO-2-METHOXY-BENZENEETHANOL
CAS:354516-88-4
Formula: [C9H13NO2
KIN03531587
5-AMINO-2-METHOXY-BENZENEMETHANAMINE
CAS:79352-75-3
Formula: C8H12N2O
KIN02637133
5-AMINO-2-METHOXY-BENZENEMETHANAMINE 2HCL
CAS:102677-73-6
Formula: C8H14Cl2N2O
KIN03049348
5-AMINO-2-METHOXY-BENZENEMETHANOL
CAS:135-97-7
Formula: C8H15NO
KIN01005927
5-AMINO-2-METHOXY-BENZENEMETHANOL 1-ACETATE
CAS:54509-48-7
KIN02351099
5-AMINO-2-METHOXY-BENZENEPROPANOIC ACID
CAS:69447-76-3
Formula: C10H13NO3
KIN02570399
5-AMINO-2-METHOXY-BENZENEPROPANOIC ACID ETHYL ESTER
CAS:476660-49-8
Formula: C12H17NO3
KIN03005598
5-AMINO-2-METHOXY-BENZENEPROPANOIC ACID HCL
CAS:71130-64-8
Formula: C10H13NO3
KIN02582152
5-AMINO-2-METHOXY-BENZENEPROPANOIC ACID METHYL ESTER
CAS:207341-07-9
KIN03663923
5-AMINO-2-METHOXY-BENZENESULFINIC ACID
CAS:85419-60-9
Formula: C7H9NO3S
KIN02674290
5-Amino-2-methoxy-benzenesulfinic acid
5-AMINO-2-METHOXY-BENZENESULFONAMIDE
CAS:88508-44-5
Formula: C7H10N2O3S
KIN02699155
MFCD04614621
5-AMINO-2-METHOXY-BENZENESULFONAMIDE HCL
CAS:1181458-70-7
Formula: C7H11ClN2O3S
KIN05292557
5-AMINO-2-METHOXY-BENZENESULFONIC ACID
CAS:6470-18-4
Formula: C12H11NO2
KIN01163017
5-AMINO-2-METHOXY-BENZENETHIOL
CAS:1024226-63-8
Formula: C7H9NOS
KIN05058177
5-AMINO-2-METHOXY-BENZO[D]THIAZOLE
CAS:99584-07-3
Formula: C8H8N2OS
KIN02821365
5-Amino-2-methoxy-benzo[d]thiazole
5-AMINO-2-METHOXY-BENZOIC ACID
CAS:3403-52-9
KIN01088518
5-AMINO-2-METHOXY-BENZOIC ACID 1-METHYLETHYL ESTER
CAS:1071397-50-6
Formula: C11H15NO3
KIN05112525
5-AMINO-2-METHOXY-BENZOIC ACID 1-METHYLPROPYL ESTER
CAS:1071345-10-2
Formula: C12H17NO3
KIN05112341
5-AMINO-2-METHOXY-BENZOIC ACID 2-METHOXYETHYL ESTER
CAS:1071292-47-1
Formula: C11H15NO4
KIN05112218
5-AMINO-2-METHOXY-BENZOIC ACID ALLYL ESTER
CAS:153775-10-1
Formula: C11H13NO3
KIN03306340
5-AMINO-2-METHOXY-BENZOIC ACID BUTYL ESTER
CAS:1071292-39-1
Formula: C12H17NO3
KIN05112216
5-AMINO-2-METHOXY-BENZOIC ACID CYCLOHEXYLESTER
CAS:1071397-66-4
Formula: C14H19NO3
KIN05112526
5-AMINO-2-METHOXY-BENZOIC ACID CYCLOPENTYLESTER
CAS:1071345-17-9
Formula: C13H17NO3
KIN05112342
5-AMINO-2-METHOXY-BENZOIC ACID CYCLOPROPYLMETHYL ESTER
CAS:1071398-18-9
Formula: C12H15NO3
KIN05112527
5-AMINO-2-METHOXY-BENZOIC ACID ETHYL ESTER
CAS:301666-04-6
Formula: C10H13NO3
KIN03477612
5-AMINO-2-METHOXY-BENZOIC ACID METHYL ESTER
CAS:22802-67-1
Formula: C9H11NO3
KIN02113898
MFCD08458835
5-AMINO-2-METHOXY-BENZOIC ACID METHYL ESTER HCL
CAS:99450-55-2
KIN02820427
MFCD09878889
5-AMINO-2-METHOXY-BENZOIC ACID PROPYL ESTER
CAS:1071345-03-3
Formula: C11H15NO3
KIN05112339
5-AMINO-2-METHOXY-BENZOIC ACID TERT-BUTYL ESTER
CAS:194025-90-6
KIN03397581
5-AMINO-2-METHOXY-BENZONITRILE
CAS:214623-57-1
Formula: C8H8N2O
KIN03426816
5-AMINO-2-METHOXY-BENZOYL CHLORIDE
CAS:90763-48-7
Formula: C8H8ClNO2
KIN02732850
5-Amino-2-methoxy-benzoyl chloride; 5-Amino-2-meth
5-AMINO-2-METHOXY-CYCLOHEPTA-2,4,6-TRIENONE
CAS:701-07-5
Formula: C9H11BrO
KIN01026239
5-AMINO-2-METHOXY-N,N-DIMETHYL-4-NITRO-BENZAMIDE
CAS:106125-59-1
KIN03074098
5-AMINO-2-METHOXY-N,N-DIMETHYLBENZAMIDE
CAS:22802-73-9
Formula: C10H14N2O2
KIN02113900
5-AMINO-2-METHOXY-N,N-DIMETHYLBENZENEMETHANAMINE
CAS:96284-83-2
Formula: C10H16N2O
KIN02799432
5-AMINO-2-METHOXY-N-(1-METHYLETHYL)-BENZENESULFONAMIDE
CAS:1040340-31-5
KIN05086182
5-AMINO-2-METHOXY-N-(3-METHYL-CYCLOHEXYL)-BENZAMIDE
CAS:1071377-83-7
KIN05112453
5-AMINO-2-METHOXY-N-(4-METHOXY-PHENYL)-BENZENESULFONAMIDE
CAS:327975-71-3
Formula: C14H16N2O4S
KIN03497732
5-AMINO-2-METHOXY-N-(4-METHYL-CYCLOHEXYL)-BENZAMIDE
CAS:1071293-10-1
KIN05112228
5-AMINO-2-METHOXY-N-(BENZYL)-N-PROPYLBENZENEMETHANAMINE
CAS:1153052-91-5
Formula: C18H24N2O
KIN05204283
5-AMINO-2-METHOXY-N-[[4-(TRIFLUOROMETHYL)PHENYL]METHYL]BENZAMIDE
CAS:311769-61-6
Formula: C16H15F3N2O2
KIN03485523
5-AMINO-2-METHOXY-N-[1-(BENZYL)PIPERIDIN-4-YL]-BENZAMIDE 2HCL
CAS:130260-10-5
Formula: C20H25N3O2.2ClH
KIN03209153
5-AMINO-2-METHOXY-N-METHYLBENZAMIDE
CAS:194025-85-9
Formula: C9H12N2O2
KIN03397578
5-AMINO-2-METHOXY-N-METHYLBENZAMIDE HCL
CAS:194025-87-1
Formula: C9H12N2O2.ClH
KIN03397579
5-AMINO-2-METHOXY-N-METHYLBENZENESULFONAMIDE
CAS:88508-45-6
KIN02699156
5-AMINO-2-METHOXY-N-PROPYLBENZENESULFONAMIDE
CAS:1042513-69-8
KIN05089033
5-AMINO-2-METHOXY-PHENOL
CAS:1687-58-7
Formula: C15H14N2S
KIN01053370
5-AMINO-2-METHOXY-PHENOL 1-( TOSYLATE)
CAS:89625-37-6
Formula: C14H15NO4S
KIN02714452
5-Amino-2-methoxyphenyl tosylate
5-AMINO-2-METHOXY-PHENOL 1-ACETATE
CAS:53606-43-2
Formula: C9H11NO3
KIN02337750
5-Amino-2-methoxyphenol acetate (ester); 5-Amino-2
5-AMINO-2-METHYL-[3,4'-BIPYRIDIN]-6(1H)-ONE
CAS:80047-27-4
Formula: C11H11N3O
KIN02641538
5-AMINO-2-METHYL-1(2H)-ISOQUINOLINONE
CAS:42792-97-2
KIN02280469
5-Amino-2-methyl-1(2H)-isoquinolinone
5-AMINO-2-METHYL-1,2,4-TRIAZIN-3(2H)-THIONE
CAS:6944-71-4
Formula: C5H4N2O2S
KIN01173627
5-AMINO-2-METHYL-1,3-BENZENEDIACETIC ACID 1,3-BIS(2-HYDROXYETHYL) ESTER
CAS:2770-49-2
Formula: C24H10O10
KIN01075879
5-AMINO-2-METHYL-1,3-BENZENEDICARBOXYLIC ACID
CAS:1070979-77-9
Formula: C9H9NO4
KIN05111301
5-AMINO-2-METHYL-1,3-BENZENEDISULFONIC ACID
CAS:343956-47-8
KIN03518998
5-AMINO-2-METHYL-1,4-NAPHTHOCHINON
CAS:116415-35-1
Formula: C11H9NO2
KIN03143448
5-AMINO-2-METHYL-1-(3-METHYLBUTYL)-1H-IMIDAZOL-4-CARBONITRILE
CAS:27700-56-7
Formula: C10H16N4
KIN02159638
5-AMINO-2-METHYL-1-(3-METHYLBUTYL)-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:27700-55-6
Formula: C10H18N4O
KIN02159637
5-AMINO-2-METHYL-1-(BENZYL)-1H-IMIDAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:118778-41-9
Formula: C14H17N3O2
KIN03155910
5-AMINO-2-METHYL-1-PENTEN-3-OL
CAS:117754-47-9
Formula: C6H13NO
KIN03150553
5-AMINO-2-METHYL-1-PROPYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:334497-11-9
Formula: C8H14N4O
KIN03674981
5-AMINO-2-METHYL-1H-BENZO[D]IMIDAZOL-1-ETHANOL
CAS:247109-31-5
Formula: C10H13N3O
KIN03449016
5-AMINO-2-METHYL-1H-BENZO[D]IMIDAZOL-7-METHANOL
CAS:1169789-89-2
Formula: C9H11N3O;C9H11N3O
KIN05260719
5-AMINO-2-METHYL-1H-BENZO[D]IMIDAZOL-7-OL
CAS:101257-96-9
Formula: C8H9N3O
KIN03038078
5-AMINO-2-METHYL-1H-IMIDAZOL-1-ETHANOL
CAS:84145-87-9
Formula: C6H11N3O
KIN02665593
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBONITRILE
CAS:57258-81-8
KIN02396597
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBOTHIOAMIDE
CAS:108513-29-7
Formula: [C5H8N4S]
KIN03089525
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:37800-98-9
Formula: C5H8N4O
KIN02242783
MFCD05861394
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBOXAMIDE HCL
CAS:94190-02-0
Formula: C5H8N4O.xClH
KIN02778866
5-Amino-2-methyl-1H-imidazol-4-carboxamide HCl
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:32704-58-8
Formula: C7H11N3O2
KIN02199256
5-AMINO-2-METHYL-1H-IMIDAZOL-4-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:211929-23-6
Formula: C9H15N3O2
KIN03423291
5-AMINO-2-METHYL-1H-ISOINDOL-1,3(2H)-DIONE COMPD. WITH ACETONITRILE
CAS:192463-49-3
Formula: C9H8N2O2.C2H3N
KIN03394146
5-AMINO-2-METHYL-2,3-DIHYDRO-1,2-OXAZOL-3-ONE
CAS:121619-81-6
Formula: C4H6N2O2
KIN03170623
5-AMINO-2-METHYL-2,3-DIHYDRO-1H-ISOINDOL-1-ONE
CAS:1190380-38-1
Formula: C9H10N2O;C9H10N2O
KIN05330930
5-AMINO-2-METHYL-2-(2-(MORPHOLIN-4-YL)ETHYL)-BENZO[D][1,3]DIOXOLE 2HCL HEMIHYDRATE
CAS:52401-15-7
Formula: C14H22Cl2N2O3
KIN02320650
5-AMINO-2-METHYL-2-HEXANOL
CAS:61734-45-0
Formula: C7H17NO
KIN02460830
5-Amino-2-methyl-2-hexanol
5-AMINO-2-METHYL-2H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:16208-53-0
Formula: C4H7N5O
KIN02048944
5-Amino-2-methyl-2H-1,2,3-triazol-4-carboxamide
5-AMINO-2-METHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ALPHA-ONE
CAS:1176714-94-5
Formula: C9H10N2O2
KIN05270147
5-AMINO-2-METHYL-2H-PYRAN-3(6H)-ONE
CAS:372120-64-4
Formula: C6H9NO2
KIN03543704
5-AMINO-2-METHYL-2H-TETRAZOLE
CAS:6154-06-9
KIN01151236
5-AMINO-2-METHYL-3(2H)-BENZOFURANONE
CAS:1135298-33-7
Formula: C9H9NO2
KIN05186200
5-AMINO-2-METHYL-3(2H)-ISOTHIAZOLONE
CAS:297731-21-6
Formula: C4H6N2OS
KIN03474274
5-AMINO-2-METHYL-3,4-PYRIDINEDICARBOXYLIC ACID
CAS:89977-06-0
Formula: C8H8N2O4
KIN02720184
5-Amino-2-methyl-3,4-pyridinedicarboxylic acid
5-AMINO-2-METHYL-3-HYDROXY-PYRIDINE
CAS:57183-27-4
Formula: C6H8N2O
KIN02395273
5-Amino-3-hydroxy-2-methylpyridine
5-AMINO-2-METHYL-3-NITRO-BENZAMIDE
CAS:90223-31-7
Formula: C8H9N3O3
KIN02724255
5-AMINO-2-METHYL-3-NITRO-BENZENEMETHANOL
CAS:131475-19-9
KIN03214398
5-AMINO-2-METHYL-3-NITRO-BENZOIC ACID
CAS:89977-12-8
Formula: C8H8N2O4
KIN02720190
5-Amino-2-methyl-3-nitro-benzoic acid; 5-Amino-3-n
5-AMINO-2-METHYL-3-NITRO-BENZOIC ACID METHYL ESTER
CAS:88132-48-3
Formula: C9H10N2O4
KIN02693673
5-AMINO-2-METHYL-3-PENTEN-1-OL
CAS:137862-11-4
Formula: C6H13NO
KIN03243715
5-AMINO-2-METHYL-3-PYRIDINECARBOXAMIDE
CAS:1181458-78-5
Formula: C7H9N3O
KIN05292561
5-AMINO-2-METHYL-3-PYRIDINECARBOXYLIC ACID
CAS:1092286-36-6
Formula: C7H8N2O2
KIN05132662
5-AMINO-2-METHYL-4(3H)-PYRIMIDINONE
CAS:53135-22-1
Formula: C5H7N3O
KIN02330724
MFCD09263466
5-AMINO-2-METHYL-4-[[4-(METHYLAMINO)PHENYL]AMINO]PHENOL
CAS:57838-93-4
Formula: C14H17N3O
KIN02406106
5-AMINO-2-METHYL-4-BENZO[D]THIAZOLOL 2HCL
CAS:67002-80-6
Formula: C8H8N2OS.2ClH
KIN02547612
5-Amino-2-methyl-4-benzo[d]thiazolol 2HCl
5-AMINO-2-METHYL-4-HEXEN-3-ONE
CAS:94775-17-4
Formula: C7H13NO
KIN02784972
5-AMINO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-ACETIC ACID
CAS:26314-27-2
Formula: C6H8N4O4
KIN02147333
5-AMINO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-ETHANOL
CAS:114153-79-6
Formula: C6H10N4O3
KIN03128893
5-AMINO-2-METHYL-4-NITRO-1H-IMIDAZOL-1-PROPANOIC ACID
CAS:26314-28-3
Formula: C7H10N4O4
KIN02147334
5-AMINO-2-METHYL-4-NITRO-BENZOIC ACID METHYL ESTER
CAS:116448-91-0
Formula: [C9H10N2O4
KIN03143720
5-AMINO-2-METHYL-4-NITROPHENOL
CAS:37066-92-5
Formula: C7H8N2O3
KIN02236754
5-AMINO-2-METHYL-4-OXAZOLECARBONITRILE
CAS:5098-17-9
Formula: C6H7N3O
KIN01120667
5-AMINO-2-METHYL-4-OXAZOLECARBOXAMIDE
CAS:30380-28-0
Formula: C5H7N3O2
KIN02181778
5-AMINO-2-METHYL-4-OXAZOLECARBOXAMIDE HCL
CAS:64013-96-3
Formula: C5H7N3O2.ClH
KIN02502898
5-Amino-2-methyl-4-oxazolecarboxamide HCl
5-AMINO-2-METHYL-4-OXAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:3357-55-9
Formula: C9H13NO4
KIN01087539
5-AMINO-2-METHYL-4-OXAZOLECARBOXYLIC ACID ETHYL ESTER HCL
CAS:3356-83-0
Formula: C7H10N2O3
KIN01087501
5-AMINO-2-METHYL-4-PYRIDINECARBOXYLIC ACID
CAS:88482-17-1
Formula: C7H8N2O2
KIN02698794
5-Amino-2-methylpyridin-4-carboxylic acid; 5-Amino
5-AMINO-2-METHYL-4-THIAZOLECARBONITRILE
CAS:31785-16-7
Formula: C5H5N3S
KIN02192053
5-AMINO-2-METHYL-4-THIAZOLECARBOXAMIDE
CAS:5021-69-2
KIN01119162
5-AMINO-2-METHYL-4-THIAZOLECARBOXYLIC ACID
CAS:36405-01-3
Formula: C5H6N2O2S
KIN02231641
5-AMINO-2-METHYL-4-THIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:31785-05-4
Formula: C7H10N2O2S
KIN02192047
Ethyl 5-amino-2-methylthiazol-4-carboxylate; Ethyl
5-AMINO-2-METHYL-6-(1-METHYLETHYL)-4(3H)-PYRIMIDINONE
CAS:155082-36-3
Formula: C8H13N3O
KIN03311036
5-AMINO-2-METHYL-6-(METHYLAMINO)-4(3H)-PYRIMIDINETHIONE
CAS:15996-44-8
Formula: C6H10N4S
KIN02046483
5-AMINO-2-METHYL-6-(METHYLAMINO)-4(3H)-PYRIMIDINONE
CAS:52904-85-5
Formula: C6H10N4O
KIN02327498
5-AMINO-2-METHYL-6-(PROPYLTHIO)-4(3H)-PYRIMIDINETHIONE
CAS:155082-31-8
Formula: C8H13N3S2
KIN03641398
5-AMINO-2-METHYL-6-[(BENZYL)THIO][1,2,4]-TRIAZIN-3(2H)-ONE
CAS:23469-29-6
Formula: C11H12N4OS
KIN02120262
5-AMINO-2-METHYL-6-BENZO[D]THIAZOLOL
CAS:99584-08-4
Formula: C8H8N2OS
KIN02821366
5-Amino-2-methyl-6-benzo[d]thiazolol
5-AMINO-2-METHYL-6-MORPHOLIN-4-YL-4(3H)-PYRIMIDINETHIONE
CAS:155082-10-3
Formula: C9H14N4OS
KIN03618832
5-AMINO-2-METHYL-6-NITRO-BENZO[D]THIAZOLE
CAS:101420-68-2
Formula: C8H7N3O2S
KIN03039285
5-AMINO-2-METHYL-9H-XANTHEN-9-ONE
CAS:35486-57-8
KIN02223508
5-AMINO-2-METHYL-BENZENEMETHANAMINE
CAS:113135-68-5
Formula: C8H12N2
KIN03120620
5-AMINO-2-METHYL-ISOINDOLIN-1,3-DIONE
CAS:2307-01-9
Formula: C11H12N2O2
KIN01066873
5-AMINO-2-METHYL-N,N-DIPROPYLPYRIDIN-3-CARBOXAMIDE
CAS:1183247-69-9
Formula: C13H21N3O
KIN05302097
5-AMINO-2-METHYL-N-(1-METHYLPROPYL)-BENZENESULFONAMIDE
CAS:1041553-34-7
KIN05087660
5-AMINO-2-METHYL-N-(1R-NAPHTHALEN-1-YLETHYL)-BENZAMIDE
CAS:1093070-16-6
Formula: C20H20N2O
KIN05135053
5-AMINO-2-METHYL-N-(2,4,6-TRIMETHYLPHENYL)-BENZAMIDE
CAS:302961-65-5
KIN03663922
5-AMINO-2-METHYL-N-(2-METHYLPROPYL)-BENZENESULFONAMIDE
CAS:68420-32-6
KIN02563144
5-AMINO-2-METHYL-N-(BENZYL)-BENZAMIDE
CAS:301527-53-7
KIN03477470
5-AMINO-2-METHYL-N-(BENZYL)-PYRIDIN-3-CARBOXAMIDE
CAS:1178850-21-9
Formula: C14H15N3O
KIN05280470
5-AMINO-2-METHYL-N-(METHYLSULFONYL)-BENZAMIDE
CAS:146374-33-6
KIN03282313
5-AMINO-2-METHYL-N-NAPHTHALEN-1-YLPYRIDIN-3-CARBOXAMIDE
CAS:1179965-41-3
Formula: C17H15N3O
KIN05289108
5-AMINO-2-METHYL-N-PENTYLPYRIDIN-3-CARBOXAMIDE
CAS:1179178-41-6
Formula: C12H19N3O
KIN05283013
5-AMINO-2-METHYL-N-PHENYLBENZENESULFONAMIDE
CAS:79-74-3
Formula: C16H26O2
KIN01001551
5-AMINO-2-METHYL-N-PHENYLPYRIDIN-3-CARBOXAMIDE
CAS:1178507-50-0
Formula: C13H13N3O
KIN05277660
5-AMINO-2-METHYL-N-PROPYL-3-PYRIDINECARBOXAMIDE
CAS:1184623-86-6
Formula: C10H15N3O
KIN05316031
5-AMINO-2-METHYL-N-PROPYLBENZENESULFONAMIDE
CAS:1017478-19-1
KIN05034277
5-AMINO-2-METHYL-N-PYRAZIN-2-YLPYRIDIN-3-CARBOXAMIDE
CAS:1179870-69-9
Formula: C11H11N5O
KIN05288189
5-AMINO-2-METHYL-N-PYRIDIN-2-YLPYRIDIN-3-CARBOXAMIDE
CAS:1182816-82-5
Formula: C12H12N4O
KIN05297664
5-AMINO-2-METHYL-N-PYRIDIN-3-YLPYRIDIN-3-CARBOXAMIDE
CAS:1183191-32-3
Formula: C12H12N4O
KIN05301471
5-AMINO-2-METHYL-N-PYRIDIN-4-YLPYRIDIN-3-CARBOXAMIDE
CAS:1183108-88-4
Formula: C12H12N4O
KIN05300547
5-AMINO-2-METHYL-N-PYRIMIDIN-2-YLPYRIDIN-3-CARBOXAMIDE
CAS:1182740-75-5
Formula: C11H11N5O
KIN05296858
5-AMINO-2-METHYL-N-QUINOLIN-5-YLPYRIDIN-3-CARBOXAMIDE
CAS:1183441-71-5
Formula: C16H14N4O
KIN05304187
5-AMINO-2-METHYL-N-QUINOLIN-8-YLPYRIDIN-3-CARBOXAMIDE
CAS:1178616-08-4
Formula: C16H14N4O
KIN05277939
5-AMINO-2-METHYL-N-THIAZOL-2-YLPYRIDIN-3-CARBOXAMIDE
CAS:1178318-33-6
Formula: C10H10N4OS
KIN05275521
5-AMINO-2-METHYL-NAPHTHALEN-1-OL
CAS:116415-34-0
Formula: C11H11NO
KIN03143447
5-AMINO-2-METHYL-OXAZOLO[5,4-D]PYRIMIDIN-7(6H)-ONE
CAS:364387-41-7
KIN03015566
5-AMINO-2-METHYL-QUINOLIN-3-CARBOXYLIC ACID
CAS:1089856-60-9
Formula: C11H10N2O2
KIN05129666
5-AMINO-2-METHYL-QUINOLIN-4-OL
CAS:131221-85-7
Formula: C10H10N2O
KIN03213442
5-AMINO-2-METHYL-QUINOLIN-8-OL
CAS:91613-48-8
Formula: C10H10N2O
KIN02746395
5-Amino-2-methyl-quinolin-8-ol
5-AMINO-2-METHYL-TETRAZOLE
CAS:1553-88-4
Formula: C15H20FNO.ClH
KIN01049968
5-AMINO-2-METHYL-VALERIC ACID
CAS:10483-16-6
Formula: C6H13NO2
KIN02006976
5-AMINO-2-METHYLAMINOPYRIDINE HCL
CAS:20820-36-4
KIN02094257
5-AMINO-2-METHYLBENZENEACETIC ACID ETHYL ESTER
CAS:1012879-45-6
Formula: C11H15NO2
KIN05019095
5-AMINO-2-METHYLBENZENEACETIC ACID TERT-BUTYL ESTER
CAS:354506-83-5
KIN03674980
5-AMINO-2-METHYLBENZENEETHANOL
CAS:29085-69-6
Formula: C9H13NO
KIN02171306
5-AMINO-2-METHYLBENZENEMETHANAMINE 2HCL
CAS:28096-35-7
Formula: C8H14Cl2N2
KIN02163173
MFCD03424321
5-AMINO-2-METHYLBENZENEMETHANOL
CAS:111437-10-6
Formula: C8H11NO
KIN03107752
5-AMINO-2-METHYLBENZENESULFINIC ACID
CAS:85419-59-6
Formula: C7H9NO2S
KIN02674289
5-Amino-2-methylbenzenesulfinic acid
5-AMINO-2-METHYLBENZENESULFONAMIDE
CAS:6973-12-2
Formula: C7H6N2O2
KIN01175512
5-AMINO-2-METHYLBENZENESULFONIC ACID
CAS:83156-57-4
KIN02659532
5-AMINO-2-METHYLBENZENESULFONIC ACID MONOSODIUM SALT
CAS:19024-68-1
Formula: C7H9NO3S.Na
KIN02077275
5-AMINO-2-METHYLBENZENESULFONIC ACID NICKEL SALT
CAS:61934-75-6
Formula: C7H9NO3S.xNi
KIN02464829
5-AMINO-2-METHYLBENZENESULFONIC ACID PHENYL ESTER
CAS:1089339-15-0
Formula: C13H13NO3S
KIN05128433
5-AMINO-2-METHYLBENZENESULFONYL CHLORIDE
CAS:98280-38-7
Formula: C7H8ClNO2S
KIN02812548
5-AMINO-2-METHYLBENZENESULFONYL FLUORIDE
CAS:445-07-8
Formula: C7H7FO3S
KIN01014695
5-AMINO-2-METHYLBENZO[D]ISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE
CAS:183723-75-3
Formula: C8H8N2O3S
KIN03618831
5-AMINO-2-METHYLBENZO[D]THIAZOLE 2HCL
CAS:32770-99-3
Formula: C8H10Cl2N2S
KIN02199755
MFCD00012692
5-AMINO-2-METHYLBENZOIC ACID
CAS:2840-05-3
Formula: C6H12N2O2
KIN01077108
5-AMINO-2-METHYLBENZOIC ACID 1-METHYLETHYL ESTER
CAS:135721-86-7
Formula: [C11H15NO2]
KIN03234062
5-AMINO-2-METHYLBENZOIC ACID ALLYL ESTER
CAS:153775-21-4
Formula: C11H13NO2
KIN03306344
5-AMINO-2-METHYLBENZOIC ACID ETHYL ESTER HCL
CAS:146348-81-4
Formula: C10H14ClNO2
KIN03282193
5-AMINO-2-METHYLBENZOIC ACID METHYL ESTER
CAS:18595-12-5
Formula: C9H11NO2
KIN02073325
MFCD08752568
5-AMINO-2-METHYLBENZOIC ACID METHYL ESTER HCL
CAS:383678-23-7
KIN03552066
5-AMINO-2-METHYLBENZOIC ACID PHENYLMETHYL ESTER
CAS:269071-92-3
KIN03463395
5-AMINO-2-METHYLBENZOIC ACID TERT-BUTYL ESTER
CAS:209223-88-1
Formula: [C12H17NO2
KIN03419571
5-AMINO-2-METHYLBENZONITRILE
CAS:156001-50-2
KIN03314087
5-AMINO-2-METHYLBENZOTRIFLUORIDE
CAS:65934-74-9
Formula: C8H8F3N
KIN02534589
MFCD01631582
5-AMINO-2-METHYLENE-1,3,3-TRIMETHYL-1H-INDOLINE
CAS:6872-06-6
Formula: C9H11N
KIN01171747
5-AMINO-2-METHYLENE-PENTANOIC ACID HCL
CAS:68074-15-7
Formula: C6H11NO2.ClH
KIN02560512
5-AMINO-2-METHYLPENTAN-2-OL
CAS:108262-66-4
Formula: C6H15NO
KIN03087897
5-AMINO-2-METHYLPENTANENITRILE
CAS:10483-15-5
Formula: C6H12N2
KIN02006975
5-AMINO-2-METHYLPHENOL
CAS:2636-07-9
KIN01073443
5-AMINO-2-METHYLPHENOL 1-( TOSYLATE)
CAS:1025389-67-6
Formula: C14H15NO3S
KIN05058978
5-AMINO-2-METHYLPHENOL 1-(HYDROGEN SULFATE)
CAS:1057527-71-5
Formula: C7H9NO4S
KIN05104315
5-AMINO-2-METHYLPHENOL HEMISULFATE ( SALT )
CAS:10422-66-9
Formula: C14H20N2O6S
KIN02006166
5-AMINO-2-METHYLPHENOL SULFATE
CAS:183293-62-1
Formula: C7H11NO5S
KIN03374328
5-AMINO-2-METHYLPHENYL ACETATE
CAS:61995-11-7
Formula: C9H11NO2
KIN02465819
5-Amino-2-methylphenyl acetate
5-AMINO-2-METHYLPYRIDIN-4-CARBOXYLIC ACID ETHYL ESTER
CAS:52393-72-3
Formula: C9H12N2O2
KIN02320541
5-AMINO-2-MORPHOLIN-4-YL-4(3H)-ALPHA-PYRIMIDINONE
CAS:1082508-56-2
Formula: C8H12N4O2
KIN05120914
5-AMINO-2-MORPHOLIN-4-YLBENZOIC ACID METHYL ESTER
CAS:4031-91-8
Formula: C18H18O7
KIN01099779
5-AMINO-2-MORPHOLINE-4-YLBENZAMIDE
CAS:50891-32-2
Formula: C11H15N3O2
KIN02298931
MFCD03042682
5-AMINO-2-MORPHOLINE-4-YLBENZOIC ACID
CAS:65989-45-9
Formula: C11H14N2O3
KIN02535339
MFCD01935677
5-AMINO-2-MORPHOLINE-4-YLBENZONITRILE
CAS:78252-12-7
Formula: C11H13N3O
KIN02630354
MFCD11053918
5-AMINO-2-N-PROPYL-1,2,3,4-TETRAHYDRO-ISOQUINOLINE, HBR
CAS:37481-24-6
Formula: C12H19BrN2
KIN02239703
5-AMINO-2-NITRO-1,3-BENZENEDIMETHANOL HCL
CAS:96409-76-6
Formula: C8H10N2O4.ClH
KIN02800482
5-Amino-2-nitro-1,3-benzenedimethanol HCl
5-AMINO-2-NITRO-2,4-HEXADIENOIC ACID
CAS:63446-33-3
Formula: C6H8N2O4
KIN02492815
5-Amino-2-nitro-2,4-hexadienoic acid
5-AMINO-2-NITRO-5-PHENYL-2,4-PENTADIENOIC ACID
CAS:63446-34-4
Formula: C11H10N2O4
KIN02492816
5-Amino-2-nitro-5-phenyl-2,4-pentadienoic acid
5-AMINO-2-NITRO-BENZAMIDE
CAS:73536-37-5
Formula: C7H7N3O3
KIN02598921
5-AMINO-2-NITRO-BENZENEETHANOL
CAS:123306-35-4
KIN03178945
5-AMINO-2-NITRO-BENZENEMETHANOL
CAS:77376-03-5
Formula: C7H8N2O3
KIN02625183
5-Amino-2-nitro-benzenemethanol; (5-Amino-2-nitrop
5-AMINO-2-NITRO-BENZENEMETHANOL 1-ACETATE
CAS:176540-12-8
KIN03360923
5-AMINO-2-NITRO-BENZENESULFONAMIDE
CAS:37559-31-2
Formula: C6H7N3O4S
KIN02240495
5-AMINO-2-NITRO-BENZENESULFONIC ACID
CAS:551-92-8
Formula: C5H7N3O2
KIN01019518
5-AMINO-2-NITRO-BENZOIC ACID
CAS:132080-60-9
KIN03217100
5-AMINO-2-NITRO-BENZOIC ACID ETHYL ESTER
CAS:16994-15-3
KIN02057053
5-AMINO-2-NITRO-BENZOIC ACID METHYL ESTER
CAS:35998-96-0
Formula: C8H8N2O4
KIN02228117
5-AMINO-2-NITRO-BENZONITRILE
CAS:72115-08-3
Formula: C7H5N3O2
KIN02589205
5-AMINO-2-NITROPHENOL
CAS:16292-86-7
Formula: C6H6N2O3
KIN02049933
5-AMINO-2-NITROSO-PHENOL
CAS:187097-05-8
Formula: C6H6N2O2
KIN03382655
5-AMINO-2-OCTOXY-BENZAMIDE
CAS:13738-10-8
Formula: C15H24N2O2
KIN02023848
5-AMINO-2-OCTOXY-BENZIMIDAMIDE 2HCL
CAS:13736-88-4
Formula: C15H27Cl2N3O
KIN02023823
5-AMINO-2-OCTOXY-BENZONITRILE
CAS:13724-18-0
Formula: C15H22N2O
KIN02023675
5-AMINO-2-OCTOXY-N-(THIAZOL-2-YL)-BENZAMIDE
CAS:13736-70-4
Formula: C18H25N3O2S
KIN02023815
5-AMINO-2-OCTOXY-N-PYRIDIN-2-YLBENZAMIDE
CAS:13738-17-5
Formula: C20H27N3O2
KIN02023853
5-AMINO-2-OCTOXY-N-PYRIMIDIN-2-YLBENZAMIDE
CAS:13736-72-6
Formula: C19H26N4O2
KIN02023816
5-AMINO-2-OCTYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:216144-12-6
Formula: C16H22N2O2
KIN03428815
5-AMINO-2-OXO-1(2H)-PYRIDINEACETIC ACID
CAS:1083337-87-4
Formula: C7H8N2O3
KIN05124512
5-AMINO-2-OXO-1(2H)-PYRIDINEACETONITRILE
CAS:1016712-76-7
Formula: C7H7N3O
KIN05024253
5-AMINO-2-OXO-5-PHENYLCYCLOHEXAN-CARBONITRILE
CAS:100381-51-9
KIN03031261
5-AMINO-2-OXOPENT-4-ENOIC ACID
CAS:146581-09-1
Formula: C5H7NO3
KIN03283021
5-AMINO-2-OXOVALERIC ACID HCL
CAS:80028-67-7
Formula: C5H9NO3.ClH
KIN02641417
5-AMINO-2-PENTANONE
CAS:3732-19-2
Formula: C12H15NO2
KIN01094867
5-AMINO-2-PENTOFURANOSYL-1,2,4-TRIAZIN-3(2H)-ONE
CAS:352429-36-8
Formula: C8H12N4O5
KIN03529920
5-AMINO-2-PENTYL-[1,2,4]-TRIAZOLO[1,5-C]PYRIMIDIN-8-CARBONITRILE
CAS:193554-22-2
KIN03396663
5-AMINO-2-PHENOXY-3-PYRIDINECARBONITRILE
CAS:1184417-02-4
Formula: C12H9N3O
KIN05313872
5-AMINO-2-PHENOXY-BENZAMIDE
CAS:117821-54-2
Formula: C13H12N2O2
KIN03150879
5-AMINO-2-PHENOXY-BENZENEACETIC ACID
CAS:100866-71-5
Formula: C14H13NO3
KIN03035214
5-AMINO-2-PHENOXY-BENZENESULFONIC ACID
CAS:6375-08-2
KIN01160739
5-AMINO-2-PHENOXY-BENZENESULFONIC ACID MONOSODIUM SALT
CAS:59026-38-9
Formula: C12H11NO4S.Na
KIN02425054
5-AMINO-2-PHENOXY-BENZOIC ACID
CAS:69199-96-8
Formula: C13H11NO3
KIN02568665
5-AMINO-2-PHENOXY-BENZOIC ACID METHYL ESTER
CAS:346704-91-4
Formula: C14H13NO3
KIN03523757
5-AMINO-2-PHENOXY-BENZONITRILE
CAS:288252-04-0
Formula: C13H10N2O
KIN03469896
5-AMINO-2-PHENOXY-PHENOL
CAS:287192-77-2
Formula: C12H11NO2
KIN03469046
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBONITRILE
CAS:57258-83-0
KIN02396598
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXAMIDE
CAS:41631-74-7
Formula: C10H10N4O
KIN02272428
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID 1-METHYLETHYL ESTER
CAS:36145-82-1
Formula: C13H15N3O2
KIN02229357
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID 2-CHLORO-ETHYL ESTER
CAS:36780-74-2
Formula: C12H12ClN3O2
KIN02234178
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID 2-METHYLPROPYL ESTER
CAS:36134-15-3
Formula: C14H17N3O2
KIN02229244
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID BUTYL ESTER
CAS:36145-80-9
Formula: C14H17N3O2
KIN02229355
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:32704-59-9
Formula: C12H13N3O2
KIN02199257
MFCD09033026
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID HEXYL ESTER
CAS:36134-13-1
Formula: C16H21N3O2
KIN02229243
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:36145-83-2
Formula: C11H11N3O2
KIN02229358
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID PHENYLMETHYL ESTER
CAS:36780-73-1
Formula: C17H15N3O2
KIN02234177
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID PROPYL ESTER
CAS:36145-81-0
Formula: C13H15N3O2
KIN02229356
5-AMINO-2-PHENYL-1H-IMIDAZOL-4-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:36780-69-5
Formula: C14H17N3O2
KIN02234176
5-AMINO-2-PHENYL-1H-ISOINDOL-1,3(2H)-DIONE
CAS:20871-03-8
Formula: C14H10N2O2
KIN02094727
5-AMINO-2-PHENYL-2,3-DIHYDRO-7H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-ONE
CAS:6295-28-9
Formula: C10H8O2
KIN01156080
5-AMINO-2-PHENYL-2,4-DIHYDRO-3H-[1,2,4]-TRIAZOL-3-THIONE
CAS:17418-21-2
Formula: C8H8N4S
KIN02061855
MFCD00600567
5-AMINO-2-PHENYL-2H-1,2,3-TRIAZOL-4-CARBOXAMIDE
CAS:103752-72-3
Formula: C9H9N5O
KIN03055866
5-AMINO-2-PHENYL-2H-1,2,3-TRIAZOL-4-CARBOXYLIC ACID
CAS:400073-84-9
Formula: N1(c2ccccc2)N=C(C(=N1)C(=O)O)N
KIN03003814
5-AMINO-2-PHENYL-3H-PYRROL-4-CARBOTHIOAMIDE
CAS:72130-85-9
Formula: C11H11N3S
KIN02589300
5-AMINO-2-PHENYL-4(3H)-PYRIMIDINONE
CAS:75423-81-3
Formula: C10H9N3O
KIN02612583
5-AMINO-2-PHENYL-4-OXAZOLECARBONITRILE
CAS:5098-22-6
Formula: C27H27NO4
KIN01120669
5-AMINO-2-PHENYL-4-OXAZOLECARBOTHIOAMIDE
CAS:260973-67-9
Formula: C10H9N3OS
KIN03458609
5-AMINO-2-PHENYL-4-OXAZOLECARBOXALDEHYDE
CAS:190517-98-7
Formula: C10H8N2O2
KIN03391193
5-AMINO-2-PHENYL-4-OXAZOLECARBOXAMIDE
CAS:99185-68-9
Formula: C10H9N3O2
KIN02818764
5-Amino-2-phenyl-4-oxazolecarboxamide
5-AMINO-2-PHENYL-4-OXAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:36231-81-9
Formula: C12H12N2O3
KIN02230138
5-AMINO-2-PHENYL-4-OXAZOLECARBOXYLIC ACID METHYL ESTER
CAS:1034889-77-4
Formula: C11H10N2O3
KIN05068951
5-AMINO-2-PHENYL-4-OXAZOLOL
CAS:290366-42-6
Formula: C9H8N2O2
KIN03471341
5-AMINO-2-PHENYL-4-PYRIMIDINECARBOXAMIDE
CAS:41307-36-2
Formula: C11H10N4O
KIN02270183
5-AMINO-2-PHENYL-4-THIAZOLECARBOXAMIDE
CAS:31785-03-2
KIN02192046
5-AMINO-2-PHENYL-4-THIAZOLECARBOXYLIC ACID ETHYL ESTER
CAS:31785-06-5
Formula: C12H12N2O2S
KIN02192048
5-AMINO-2-PHENYL-4-THIAZOLETHIOL
CAS:80618-66-2
Formula: C9H8N2S2
KIN02645208
5-AMINO-2-PHENYL-6-(PROPYLAMINO)-4(3H)-PYRIMIDINONE
CAS:1071944-41-6
Formula: C13H16N4O
KIN05113862
5-AMINO-2-PHENYL-7H-1,3,4-OXADIAZOLO[3,2-A]PYRIMIDIN-7-ONE
CAS:160893-86-7
Formula: C11H8N4O2
KIN03327414
5-AMINO-2-PHENYL-7H-PYRROLO[2,3-D]PYRIMIDIN-6-CARBOXAMIDE
CAS:34637-75-7
KIN02215644
5-AMINO-2-PHENYL-7H-PYRROLO[2,3-D]PYRIMIDIN-6-CARBOXYLIC ACID ETHYL ESTER
CAS:34637-76-8
KIN02215645
5-AMINO-2-PHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:96335-44-3
KIN02800003
5-AMINO-2-PHENYLPYRIDAZIN-3(2H)-ONE
CAS:13589-77-0
Formula: C10H9N3O
KIN02021763
5-AMINO-2-PHENYLPYRIMIDIN-4-CARBOHYDRAZIDE
CAS:28656-76-0
Formula: C11H11N5O
KIN02167751