ChemBuyersGuide.com

+1-212-348-5610

Chemical Search
 


























Chemlin India Private Limited




Country: India

Plot No. 36, B.N. Reddy Colony, Road No.14
Banjara Hills, Hyderabad 500034
Telangana State, India


Phone: +91 90009 25431
Phone 2: +86 135 1098-9824
Phone 3: +91 90009 25431 (wechat)
E-Mail:E-Mail this Supplier

Contact: Sandra Lin

http://www.chemlin.in/

Chemlin India Private Limited

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | 494 | 495 | 496 | 497 | 498 | 499 | 500 | 501 | 502 | 503 | 504 | 505 | 506 | 507 | 508 | 509 | 510 | 511 | 512 | 513 | 514 | 515 | 516 | 517 | 518 | 519 | 520 | 521 | 522 | 523 | 524 | 525 | 526 | 527 | 528 | 529 | 530 | 531 | 532 | 533 | 534 | 535 | 536 | 537 | 538 | 539 | 540 | 541 | 542 | 543 | 544 | 545 | 546 | 547 | 548 | 549 | 550 | 551 | 552 | 553 | 554 | 555 | 556 | 557 | 558 | 559 | 560 | 561 | 562 | 563 | 564 | 565 | 566 | 567 | 568 | 569 | 570 | 571 | 572 | 573 | 574 | 575 | 576 | 577 | 578 | 579 | 580 | 581 | 582 | 583 | 584 | 585 | 586 | 587 | 588 | 589 | 590 | 591 | 592 | 593 | 594 | 595 | 596 | 597 | 598 | 599 | 600 | 601 | 602 | 603 | 604 | 605 | 606 | 607 | 608 | 609 | 610 | 611 | 612 | 613 | 614 | 615 | 616 | 617 | 618 | 619 | 620 | 621 | 622 | 623 | 624 | 625 | 626 | 627 | 628 | 629 | 630 | 631 | 632 | 633 | 634 | 635 | 636 | 637 | 638 | 639 | 640 | 641 | 642 | 643 | 644 | 645 | 646 | 647 | 648 | 649 | 650 | 651 | 652 | 653 | 654 | 655 | 656 | 657 | 658 | 659 | 660 | 661 | 662 | 663 | 664 | 665 | 666 | 667 | 668 | 669 | 670 | 671 | 672 | 673 | 674 | 675 | 676 | 677 | 678 | 679 | 680 | 681 | 682 | 683 | 684 | 685 | 686 | 687 | 688 | 689 | 690 | 691 | 692 | 693 | 694 | 695 | 696 | 697 | 698 | 699 | 700 | 701 | 702 | 703 | 704 | 705 | 706 | 707 | 708 | 709 | 710 | 711 | 712 | 713 | 714 | 715 | 716 | 717 | 718 | 719 | 720 | 721 | 722 | 723 | 724 | 725 | 726 | 727 | 728 | 729 | 730 | 731 | 732 | 733 | 734 | 735 | 736 | 737 | 738 | 739 | 740 | 741 | 742 | 743 | 744 | 745 | 746 | 747 | 748 | 749 | 750 | 751 | 752 | 753 | 754 | 755 | 756 | 757 | 758 | 759 | 760 | 761 | 762 | 763 | 764 | 765 | 766 | 767 | 768 | 769 | 770 | 771 | 772 | 773 | 774 | 775 | 776 | 777 | 778 | 779 | 780 | 781 | 782 | 783 | 784 | 785 | 786 | 787 | 788 | 789 | 790 | 791 | 792 | 793 | 794 | 795 | 796 | 797 | 798 | 799 | 800 | 801 | 802 | 803 | 804 | 805 | 806 | 807 | 808 | 809 | 810 | 811 | 812 | 813 | 814 | 815 | 816 | 817 | 818 | 819 | 820 | 821 | 822 | 823 | 824 | 825 | 826 | 827 | 828 | 829 | 830 | 831 | 832 | 833 | 834 | 835 | 836 | 837 | 838 | 839 | 840 | 841 | 842 | 843 | 844 | 845 | 846 | 847 | 848 | 849 | 850 | 851 | 852 | 853 | 854 | 855 | 856 | 857 | 858 | 859 | 860 | 861 | 862 | 863 | 864 | 865 | 866 | 867 | 868 | 869 | 870 | 871 | 872 | 873 | 874 | 875 | 876 | 877 | 878 | 879 | 880 | 881 | 882 | 883 | 884 | 885 | 886 | 887 | 888 | 889 | 890 | 891 | 892 | 893 | 894 | 895 | 896 | 897 | 898 | 899 | 900 | 901 | 902 | 903 | 904 | 905 | 906 | 907 | 908 | 909 | 910 | 911 | 912 | 913 | 914 | 915 | 916 | 917 | 918 | 919 | 920 | 921 | 922 | 923 | 924 | 925 | 926 | 927 | 928 | 929 | 930 | 931 | 932 | 933 | 934 | 935 | 936 | 937 | 938 | 939 | 940 | 941 | 942 | 943 | 944 | 945 | 946 | 947 | 948 | 949 | 950 | 951 | 952 | 953 | 954 | 955 | 956 | 957 | 958 | 959 | 960 | 961 | 962 | 963 | 964 | 965 | 966 | 967 | 968 | 969 | 970 | 971 | 972 | 973 | 974 | 975 | 976 | 977 | 978 | 979 | 980 | 981 | 982 | 983 | 984 | 985 | 986 | 987 | 988 | 989 | 990 | 991 | 992 | 993 | 994 | 995 | 996 | 997 | 998 | 999 | 1000 | 1001 | 1002 | 1003 | 1004 | 1005 | 1006 | 1007 | 1008 | 1009 | 1010 | 1011 | 1012 | 1013 | 1014 | 1015 | 1016 | 1017 | 1018 | 1019 | 1020 | 1021 | 1022 | 1023 | 1024 | 1025 | 1026 | 1027 | 1028 | 1029 | 1030 | 1031 | 1032 | 1033 | 1034 | 1035 | 1036 | 1037 | 1038 | 1039 | 1040 | 1041 | 1042 | 1043 | 1044 | 1045 | 1046 | 1047 | 1048 | 1049 | 1050 | 1051 | 1052 | 1053 | 1054 | 1055 | 1056 | 1057 | 1058 | 1059 | 1060 | 1061 | 1062 | 1063 | 1064 | 1065 | 1066 | 1067 | 1068 | 1069 | 1070 | 1071 | 1072 | 1073 | 1074 | 1075 | 1076 | 1077 | 1078 | 1079 | 1080 | 1081 | 1082 | 1083 | 1084 | 1085 | 1086 | 1087 | 1088 | 1089 | 1090 | 1091 | 1092 | 1093 | 1094 | 1095 | 1096 | 1097 | 1098 | 1099 | 1100 | 1101 | 1102 | 1103 | 1104 | 1105 | 1106 | 1107 | 1108 | 1109 | 1110 | 1111 | 1112 | 1113 | 1114 | 1115 | 1116 | 1117 | 1118 | 1119 | 1120 | 1121 | 1122 | 1123 | 1124 | 1125 | 1126 | 1127 | 1128 | 1129 | 1130 | 1131 | 1132 | 1133 | 1134 | 1135 | 1136 | 1137 | 1138 | 1139 | 1140 | 1141 | 1142 | 1143 | 1144 | 1145 | 1146 | 1147 | 1148 | 1149 | 1150 | 1151 | 1152 | 1153 | 1154 | 1155 | 1156 | 1157 | 1158 | 1159 | 1160 | 1161 | 1162 | 1163 | 1164 | 1165 | 1166 | 1167 | 1168 | 1169 | 1170 | 1171 | 1172 | 1173 | 1174 | 1175 | 1176 | 1177 | 1178 | 1179 | 1180 | 1181 | 1182 | 1183 | 1184 | 1185 | 1186 | 1187 | 1188 | 1189 | 1190 | 1191 | 1192 | 1193 | 1194 | 1195 | 1196 | 1197 | 1198 | 1199 | 1200 | 1201 | 1202 | 1203 | 1204 | 1205 | 1206 | 1207 | 1208 | 1209 | 1210 | 1211 | 1212 | 1213 | 1214 | 1215 | 1216 | 1217 | 1218 | 1219 | 1220 | 1221 | 1222 | 1223 | 1224 | 1225 | 1226 | 1227 | 1228 | 1229 | 1230 | 1231 | 1232 | 1233 | 1234 | 1235 | 1236 | 1237 | 1238 | 1239 | 1240 | 1241 | 1242 | 1243 | 1244 | 1245 | 1246 | 1247 | 1248 | 1249 | 1250 | 1251 | 1252 | 1253 | 1254 | 1255 | 1256 | 1257 | 1258 | 1259 | 1260 | 1261 | 1262 | 1263 | 1264 | 1265 | 1266 | 1267 | 1268 | 1269 | 1270 | 1271 | 1272 | 1273 | 1274 | 1275 | 1276 | 1277 | 1278 | 1279 | 1280 | 1281 | 1282 | 1283 | 1284 | 1285 | 1286 | 1287 | 1288 | 1289 | 1290 | 1291 | 1292 | 1293 | 1294 | 1295 | 1296 | 1297 | 1298 | 1299 | 1300 | 1301 | 1302 | 1303 | 1304 | 1305 | 1306 | 1307 | 1308 | 1309 | 1310 | 1311 | 1312 | 1313 | 1314 | 1315 | 1316 | 1317 | 1318 | 1319 | 1320 | 1321 | 1322 | 1323 | 1324 | 1325 | 1326 | 1327 | 1328 | 1329 | 1330 | 1331 | 1332 | 1333 | 1334 | 1335 | 1336 | 1337 | 1338 | 1339 | 1340 | 1341 | 1342 | 1343 | 1344 | 1345 | 1346 | 1347 | 1348 | 1349 | 1350 | 1351 | 1352 | 1353 | 1354 | 1355 | 1356 | 1357 | 1358 | 1359 | 1360 | 1361 | 1362 | 1363 | 1364 | 1365 | 1366 | 1367 | 1368 | 1369 | 1370 | 1371 | 1372 | 1373 | 1374 | 1375 | 1376 | 1377 | 1378 | 1379 | 1380 | 1381 | 1382 | 1383 | 1384 | 1385 | 1386 | 1387 | 1388 | 1389 | 1390 | 1391 | 1392 | 1393 | 1394 | 1395 | 1396 | 1397 | 1398 | 1399 | 1400 | 1401 | 1402 | 1403 | 1404 | 1405 | 1406 | 1407 | 1408 | 1409 | 1410 | 1411 | 1412 | 1413 | 1414 | 1415 | 1416 | 1417 | 1418 | 1419 | 1420 | 1421 | 1422 | 1423 | 1424 | 1425 | 1426 | 1427 | 1428 | 1429 | 1430 | 1431 | 1432 | 1433 | 1434 | 1435 | 1436 | 1437 | 1438 | 1439 | 1440 | 1441 | 1442 | 1443 | 1444 | 1445 | 1446 | 1447 | 1448 | 1449 | 1450 | 1451 | 1452 | 1453 | 1454 | 1455 | 1456 | 1457 | 1458 | 1459 | 1460 | 1461 | 1462 | 1463 | 1464 | 1465 | 1466 | 1467 | 1468 | 1469 | 1470 | 1471 | 1472 | 1473 | 1474 | 1475 | 1476 | 1477 | 1478 | 1479 | 1480 | 1481 | 1482 | 1483 | 1484 | 1485 | 1486 | 1487 | 1488 | 1489 | 1490 | 1491 | 1492 | 1493 | 1494 | 1495 | 1496 | 1497 | 1498 | 1499 | 1500 | 1501 | 1502 | 1503 | 1504 | 1505 | 1506 | 1507 | 1508 | 1509 | 1510 | 1511 | 1512 | 1513 | 1514 | 1515 | 1516 | 1517 | 1518 | 1519 | 1520 | 1521 | 1522 | 1523 | 1524 | 1525 | 1526 | 1527 | 1528 | 1529 | 1530 | 1531 | 1532 | 1533 | 1534 | 1535 | 1536 | 1537 | 1538 | 1539 | 1540 | 1541 | 1542 | 1543 | 1544 | 1545 | 1546 | 1547 | 1548 | 1549 | 1550 | 1551 | 1552 | 1553 | 1554 | 1555 | 1556 | 1557 | 1558 | 1559 | 1560 | 1561 | 1562 | 1563 | 1564 | 1565 | 1566 | 1567 | 1568 | 1569 | 1570 | 1571 | 1572 | 1573 | 1574 | 1575 | 1576 | 1577 | 1578 | 1579 | 1580 | 1581 | 1582 | 1583 | 1584 | 1585 | 1586 | 1587 | 1588 | 1589 | 1590 | 1591 | 1592 | 1593 | 1594 | 1595 | 1596 | 1597 | 1598 | 1599 | 1600 | 1601 | 1602 | 1603 | 1604 | 1605 | 1606 | 1607 | 1608 | 1609 | 1610 | 1611 | 1612 | 1613 | 1614 | 1615 | 1616 | 1617 | 1618 | 1619 | 1620 | 1621 | 1622 | 1623 | 1624 | 1625 | 1626 | 1627 | 1628 | 1629 | 1630 | 1631 | 1632 | 1633 | 1634 | 1635 | 1636 | 1637 | 1638 | 1639 | 1640 | 1641 | 1642 | 1643 | 1644 | 1645 | 1646 | 1647 | 1648 | 1649 | 1650 | 1651 | 1652 | 1653 | 1654 | 1655 | 1656 | 1657 | 1658 | 1659 | 1660 | 1661 | 1662 | 1663 | 1664 | 1665 | 1666 | 1667 | 1668 | 1669 | 1670 | 1671 | 1672 | 1673 | 1674 | 1675 | 1676 | 1677 | 1678 | 1679 | 1680 | 1681 | 1682 | 1683 | 1684 | 1685 | 1686 | 1687 | 1688 | 1689 | 1690 | 1691 | 1692 | 1693 | 1694 | 1695 | 1696 | 1697 | 1698 | 1699 | 1700 | 1701 | 1702 | 1703 | 1704 | 1705 | 1706 | 1707 | 1708 | 1709 | 1710 | 1711 | 1712 | 1713 | 1714 | 1715 | 1716 | 1717 | 1718 | 1719 | 1720 | 1721 | 1722 | 1723 | 1724 | 1725 | 1726 | 1727 | 1728 | 1729 | 1730 | 1731 | 1732 | 1733 | 1734 | 1735 | 1736 | 1737 | 1738 | 1739 | 1740 | 1741 | 1742 | 1743 | 1744 | 1745 | 1746 | 1747 | 1748 | 1749 | 1750 | 1751 | 1752 | 1753 | 1754 | 1755 | 1756 | 1757 | 1758 | 1759 | 1760 | 1761 | 1762 | 1763 | 1764 | 1765 | 1766 | 1767 | 1768 | 1769 | 1770 | 1771 | 1772 | 1773 | 1774 | 1775 | 1776 | 1777 | 1778 | 1779 | 1780 | 1781 | 1782 | 1783 | 1784 | 1785 | 1786 | 1787 | 1788 | 1789 | 1790 | 1791 | 1792 | 1793 | 1794 | 1795 | 1796 | 1797 | 1798 | 1799 | 1800 | 1801 | 1802 | 1803 | 1804 | 1805 | 1806 | 1807 | 1808 | 1809 | 1810 | 1811 | 1812 | 1813 | 1814 | 1815 | 1816 | 1817 | 1818 | 1819 | 1820 | 1821 | 1822 | 1823 | 1824 | 1825 | 1826 | 1827 | 1828 | 1829 | 1830 | 1831 | 1832 | 1833 | 1834 | 1835 | 1836 | 1837 | 1838 | 1839 | 1840 | 1841 | 1842 | 1843 | 1844 | 1845 | 1846 | 1847 | 1848 | 1849 | 1850 | 1851 | 1852 | 1853 | 1854 | 1855 | 1856 | 1857 | 1858 | 1859 | 1860 | 1861 | 1862 | 1863 | 1864 | 1865 | 1866 | 1867 | 1868 | 1869 | 1870 | 1871 | 1872 | 1873 | 1874 | 1875 | 1876 | 1877 | 1878 | 1879 | 1880 | 1881 | 1882 | 1883 | 1884 | 1885 | 1886 | 1887 | 1888 | 1889 | 1890 | 1891 | 1892 | 1893 | 1894 | 1895 | 1896 | 1897 | 1898 | 1899 | 1900 | 1901 | 1902 | 1903 | 1904 | 1905 | 1906 | 1907 | 1908 | 1909 | 1910 | 1911 | 1912 | 1913 | 1914 | 1915 | 1916 | 1917 | 1918 | 1919 | 1920 | 1921 | 1922 | 1923 | 1924 | 1925 | 1926 | 1927 | 1928 | 1929 | 1930 | 1931 | 1932 | 1933 | 1934 | 1935 | 1936 | 1937 | 1938 | 1939 | 1940 | 1941 | 1942 | 1943 | 1944 | 1945 | 1946 | 1947 | 1948 | 1949 | 1950 | 1951 | 1952 | 1953 | 1954 | 1955 | 1956 | 1957 | 1958 | 1959 | 1960 | 1961 | 1962 | 1963 | 1964 | 1965 | 1966 | 1967 | 1968 | 1969 | 1970 | 1971 | 1972 | 1973 | 1974 | 1975 | 1976 | 1977 | 1978 | 1979 | 1980 | 1981 | 1982 | 1983 | 1984 | 1985 | 1986 | 1987 | 1988 | 1989 | 1990 | 1991 | 1992 | 1993 | 1994 | 1995 | 1996 | 1997 | 1998 | 1999 | 2000 | 2001 | 2002 | 2003 | 2004 | 2005 | 2006 | 2007 | 2008 | 2009 | 2010 | 2011 | 2012 | 2013 | 2014 | 2015 | 2016 | 2017 | 2018 |
 


Product List

3-METHYL-1-AZULENECARBONYL CHLORIDE
CAS:120221-76-3
Formula: C12H9ClO
KIN03163093
3-METHYL-1-AZULENECARBOXYLIC ACID METHYL ESTER
CAS:54654-47-6
Formula: C13H12O2
KIN02353351
3-METHYL-1-AZULENESULFONIC ACID
CAS:96519-27-6
Formula: C11H10O3S
KIN02801296
3-METHYL-1-AZULENESULFONIC ACID SODIUM SALT
CAS:97683-29-9
Formula: C11H10O3S.Na
KIN02807241
3-METHYL-1-BENZO[B]THIOPHEN-5-CARBOXYLIC ACID
CAS:19404-24-1
Formula: C10H8O2S
KIN02081083
3-METHYL-1-BENZOFURAN-7-OL
CAS:102624-65-7
Formula: C9H8O2
KIN03048913
3-METHYL-1-BENZOPYRYLIUM PERCHLORATE
CAS:53405-82-6
Formula: C10H9O.ClO4
KIN02334733
3-METHYL-1-BENZOSELENOPHEN-2-CARBONITRILE
CAS:37007-55-9
Formula: C10H7NSe
KIN02236122
3-METHYL-1-BENZOYL-1H-1,2-DIAZEPINE
CAS:69298-66-4
Formula: C13H12N2O
KIN02569350
3-METHYL-1-BENZYL-1H-PYRROL-2,5-DIONE
CAS:73383-82-1
Formula: C12H11NO2
KIN02597888
3-METHYL-1-BENZYL-3-HYDROXY-PIPERIDINE
CAS:6560-75-4
Formula: C13H19N
KIN01164947
3-METHYL-1-BENZYLPYRAZINIUM BROMIDE
CAS:3139-00-2
Formula: C13H15N2.Br
KIN01083090
3-METHYL-1-BENZYLPYRIDINIUM CHLORIDE
CAS:16214-99-6
Formula: C13H14ClN
KIN02049029
3-METHYL-1-BUTANESULFINOTHIOIC ACID ANHYDROSULFIDE WITH O,O-DIMETHYL HYDROGEN PHOSPHORO-THIOATE
CAS:115-95-7
Formula: CH3CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2
KIN01004630
3-METHYL-1-BUTANESULFONIC ACID
CAS:16066-21-0
Formula: C5H12O3S
KIN02047326
3-METHYL-1-BUTANESULFONIC ACID 1,1-DIMETHYL-4-PENTEN-2-YN-1-YL ESTER
CAS:6998-03-4
Formula: C12H20N2O5Si2
KIN01176093
3-METHYL-1-BUTANESULFONIC ACID 1,4-BUTANEDIYL ESTER
CAS:4239-24-1
Formula: C8H18O6S2
KIN01103656
3-METHYL-1-BUTANESULFONIC ACID 1,6-DIHYDRO-6-OXO-PYRIDAZIN-3-YL ESTER
CAS:16771-16-7
KIN02054765
3-METHYL-1-BUTANETHIOL MERCURY(II) SALT (2:1)
CAS:23601-64-1
Formula: C5H12S.1/2Hg
KIN02121824
3-METHYL-1-BUTANETHIOL SODIUM SALT
CAS:63720-94-5
Formula: C5H12S.Na
KIN02497732
3-METHYL-1-BUTANOL 1,1',1''-PHOSPHITE
CAS:924-06-1
Formula: C15H32O2
KIN01033704
3-METHYL-1-BUTANOL 1-ACETATE
CAS:29732-50-1
KIN02176106
3-METHYL-1-BUTANOL BARIUM SALT
CAS:58114-86-6
Formula: C5H12O.1/2Ba
KIN02410724
3-METHYL-1-BUTANOL HYDROGEN PHOSPHORO-THIOATE
CAS:354134-37-5
Formula: C10H23O3PS
KIN03531496
3-METHYL-1-BUTANOL PHENYLCARBAMATE
CAS:95469-42-4
Formula: C12H19NO3
KIN02791771
3-METHYL-1-BUTANOL POTASSIUM SALT
CAS:78972-96-0
Formula: C5H12O.K
KIN02634815
3-METHYL-1-BUTANOL SODIUM SALT
CAS:19533-24-5
Formula: C5H12O.Na
KIN02082103
3-METHYL-1-BUTANOL TITANIUM(IV) SALT
CAS:19480-47-8
Formula: C5H12O.1/4Ti
KIN02081662
3-METHYL-1-BUTEN-1-OL
CAS:43000-45-9
Formula: C5H10O
KIN02281979
3-METHYL-1-BUTEN-1-ONE
CAS:69009-29-6
Formula: C5H8O
KIN02567254
3-METHYL-1-BUTEN-2-OL
CAS:79144-27-7
Formula: C5H10O
KIN02635892
3-METHYL-1-BUTEN-2-OL ACETATE
CAS:3814-46-8
Formula: C6H11NO2
KIN01096411
3-METHYL-1-BUTEN-2-OL LITHIUM SALT
CAS:59357-02-7
Formula: C5H10O.Li
KIN02430258
3-METHYL-1-BUTOXIDE
CAS:35730-35-9
Formula: C5H11O-
KIN02225872
3-METHYL-1-BUTYL N,N-DIMETHYLCARBAMATE
CAS:341547-63-5
Formula: C8H17NO2
KIN03515226
3-METHYL-1-BUTYN-1-OL
CAS:99807-58-6
Formula: C5H8O
KIN02822527
3-METHYL-1-BUTYNE DIMER
CAS:31016-30-5
Formula: (C5H8)2
KIN02186480
3-METHYL-1-BUTYNE ION(I)
CAS:54448-44-1
Formula: C5H7
KIN02350194
3-METHYL-1-BUTYNE MONOPROTONATED
CAS:54448-47-4
Formula: C5H8.H
KIN02350196
3-METHYL-1-BUTYNE-1-D
CAS:49570-12-9
Formula: C5H7D
KIN02288711
3-METHYL-1-BUTYNE-3-D
CAS:72012-68-1
Formula: C5H7D
KIN02588408
3-METHYL-1-CYCLOBUTEN-1-CARBOXYLIC ACID METHYL ESTER
CAS:60697-54-3
Formula: C7H10O2
KIN02446907
3-METHYL-1-CYCLOHEXEN-1-CARBALDEHYDE
CAS:63282-01-9
Formula: C8H12O
KIN02489774
3-METHYL-1-CYCLOHEXEN-1-CARBOXYLIC ACID
CAS:184032-60-8
Formula: [C8H12O2
KIN03376147
3-METHYL-1-CYCLOHEXENE-1-CARBONITRILE
CAS:41198-88-3
Formula: C8H11N
KIN02269182
3-METHYL-1-CYCLOHEXENE-1-PROPANETHIOL
CAS:63715-30-0
Formula: C10H18S
KIN02497597
3-METHYL-1-CYCLOHEXENE-1-PROPANOIC ACID ETHYL ESTER
CAS:63715-00-4
Formula: C12H20O2
KIN02497579
3-METHYL-1-CYCLOHEXENE-1-PROPANOL METHANESULFONATE
CAS:63715-14-0
Formula: C11H20O3S
KIN02497589
3-METHYL-1-CYCLOHEXENE-PROPANOL
CAS:63715-06-0
Formula: C10H18O
KIN02497583
3-METHYL-1-CYCLOPENTEN-1,2-DICARBOXYLIC ACID
CAS:106950-17-8
Formula: C8H10O4
KIN03079985
3-METHYL-1-CYCLOPENTEN-1-CARBALDEHYDE
CAS:90049-64-2
Formula: C7H10O
KIN02721543
3-METHYL-1-CYCLOPENTEN-1-CARBOXYLIC ACID METHYL ESTER
CAS:114614-92-5
Formula: [C8H12O2
KIN03132101
3-METHYL-1-CYCLOPENTEN-1-OL
CAS:321692-64-2
Formula: C6H10O
KIN03493339
3-METHYL-1-CYCLOPENTENE
CAS:1759-88-2
Formula: CH8Si2
KIN01055192
3-METHYL-1-CYCLOPENTENE-1-ACETONITRILE
CAS:1195728-49-4
Formula: C8H11N
KIN05338536
3-METHYL-1-CYCLOPENTENE-1-CARBONYL CHLORIDE
CAS:64229-93-2
KIN02506465
3-METHYL-1-CYCLOPENTENE-1-CARBOXYLIC ACID
CAS:64229-92-1
KIN02506464
3-METHYL-1-CYCLOPENTENE-1-CARBOXYLIC ACID 1 TERT-BUTYL ESTER
CAS:479201-45-1
Formula: C11H18O2
KIN03607699
3-METHYL-1-CYCLOPENTENE-1-METHANOL 1-( TOSYLATE)
CAS:185030-41-5
KIN03378228
3-METHYL-1-CYCLOPENTENYLMETHANOL
CAS:114615-09-7
Formula: C7H12O
KIN03132102
3-METHYL-1-DECENE-3,5-DIOL
CAS:91525-88-1
Formula: C11H22O2
KIN02745081
3-METHYL-1-DIBENZO[B]THIOPHENECARBOXYLIC ACID
CAS:54470-34-7
KIN02350530
3-METHYL-1-DIBENZO[B]THIOPHENECARBOXYLIC ACID ETHYL ESTER
CAS:34724-65-7
KIN02216448
3-METHYL-1-DIBENZO[B]THIOPHENEMETHANOL
CAS:54470-35-8
KIN02350531
3-METHYL-1-DODECYN-3-OL
CAS:24424-78-0
Formula: C13H24O
KIN02130364
MFCD00041583
3-METHYL-1-DODECYN-3-OL ACETATE
CAS:72152-85-3
Formula: C15H26O2
KIN02589487
3-METHYL-1-HEPTANOL
CAS:1070-34-4
Formula: C6H10O4
KIN01038519
3-METHYL-1-HEPTEN-4-ONE
CAS:760-10-1
Formula: C5H7FO3
KIN01028397
3-METHYL-1-HEPTEN-6-YNE
CAS:65939-60-8
Formula: C8H12
KIN02534698
3-METHYL-1-HEPTENE
CAS:4810-10-0
KIN01115111
3-METHYL-1-HEPTYN-3-OL
CAS:17356-17-1
Formula: C8H14O
KIN02061182
3-METHYL-1-HEXANAMINE
CAS:65530-93-0
Formula: C7H17N
KIN02528323
3-METHYL-1-HEXANOL
CAS:111768-08-2
Formula: C7H16O
KIN03109952
3-METHYL-1-HEXENE
CAS:3404-62-4
Formula: C7H14
KIN01088533
3-METHYL-1-HEXYLCYCLOHEXANE
CAS:52886-35-8
Formula: C13H26
KIN02327237
3-METHYL-1-HEXYN-3-OL CARBAMATE
CAS:98426-09-6
Formula: C8H13NO2
KIN02813602
3-METHYL-1-HEXYNE
CAS:40276-93-5
Formula: C7H12
KIN02261442
MFCD00041671
3-METHYL-1-HEXYNE-3-OL
CAS:4339-07-5
KIN01105448
3-METHYL-1-HYDROXYNAPHTHALENE
CAS:13615-40-2
Formula: C11H10O
KIN02022196
3-METHYL-1-INDOLIZINECARBONITRILE
CAS:348637-40-1
KIN03525056
3-METHYL-1-INDOLIZINECARBOXYLIC ACID
CAS:3243-83-2
KIN01085194
3-METHYL-1-INDOLIZINECARBOXYLIC ACID ETHYL ESTER
CAS:36830-25-8
KIN02234578
Ethyl 3-methyl-1H-indolizin-1-carboxylate
3-METHYL-1-INDOLIZINOL 1-ACETATE
CAS:1002754-60-0
Formula: C11H11NO2
KIN05007451
3-METHYL-1-ISOQUINOLINAMINE
CAS:155999-48-7
Formula: C10H10N2
KIN03314062
3-METHYL-1-ISOQUINOLINEACETONITRILE
CAS:100136-23-0
Formula: C12H10N2
KIN03029034
3-METHYL-1-ISOQUINOLINECARBALDEHYDE
CAS:35967-12-5
Formula: C11H9NO
KIN02227747
3-METHYL-1-ISOQUINOLINECARBOXAMIDE
CAS:1089328-16-4
Formula: C11H10N2O
KIN05128332
3-METHYL-1-ISOQUINOLINECARBOXYLIC ACID
CAS:105956-71-6
Formula: C11H9NO2
KIN03072525
3-METHYL-1-ISOQUINOLINEMETHANAMINE
CAS:3340-37-2
KIN01087132
3-METHYL-1-ISOQUINOLINEMETHANOL
CAS:35967-08-9
Formula: C11H11NO
KIN02227743
3-METHYL-1-METHYLSULFONYL-1H-INDOLE
CAS:108665-97-0
Formula: C10H11NO2S
KIN03090469
3-METHYL-1-MORPHOLIN-4-YLBUTAN-2-ONE
CAS:67082-23-9
Formula: C9H17NO2
KIN02548401
3-METHYL-1-NAPHTHALEN-1-YL-1-PHENYL-UREA
CAS:116311-29-6
Formula: C18H16N2O
KIN03142453
3-METHYL-1-NAPHTHALEN-1-YLTHIOUREA
CAS:2741-00-6
KIN01075258
3-METHYL-1-NAPHTHALENEACETIC ACID METHYL ESTER
CAS:298694-72-1
Formula: C14H14O2
KIN03474641
3-METHYL-1-NAPHTHALENEMETHANOL 1-ACETATE
CAS:102606-08-6
Formula: C14H14O2
KIN03048688
3-METHYL-1-NITRO-10H-PHENOTHIAZINE
CAS:73414-07-0
KIN02598164
3-METHYL-1-NITRO-1H-PYRAZOL-5-CARBOXYLIC ACID ETHYL ESTER
CAS:328026-04-6
Formula: [C7H9N3O4]
KIN03497993
3-METHYL-1-NITRO-1H-PYRAZOLE
CAS:31163-84-5
Formula: C4H5N3O2
KIN02187449
3-METHYL-1-NITRO-2-DIBENZOFURANOL
CAS:51368-64-0
Formula: C13H9NO4
KIN02305685
3-METHYL-1-NITRO-2-PHENYL-1H-INDOLIZINE
CAS:90995-73-6
Formula: C15H12N2O2
KIN02736997
3-METHYL-1-NITRO-4-OCTANONE
CAS:232924-00-4
KIN03443484
3-METHYL-1-NITRO-5-PHENYL-1H-PYRAZOLE
CAS:328025-97-4
KIN03497990
3-METHYL-1-NITRO-BUTAN-2-OL
CAS:2224-39-7
Formula: C8H17NO3
KIN01065244
3-METHYL-1-NITRO-BUTAN-2-ONE
CAS:62087-36-9
Formula: C5H9NO3
KIN02467494
3-METHYL-1-NITRO-BUTANE
CAS:627-68-9
Formula: C5H9ClO2
KIN01023445
3-METHYL-1-NITRO-CYCLOHEXENE
CAS:68216-48-8
Formula: C7H11NO2
KIN02561558
3-METHYL-1-NITRO-FLUORANTHEN
CAS:36272-00-1
Formula: C17H11NO2
KIN02230473
3-METHYL-1-NITRO-HEXANE
CAS:1035694-86-0
Formula: C7H15NO2
KIN05069473
3-Methyl-1-nitrohexane
3-METHYL-1-NITRO-IMIDAZO[1,5-A]PYRIDINE
CAS:72315-48-1
Formula: C8H7N3O2
KIN02590577
3-Methyl-1-nitro-imidazo[1,5-a]pyridine
3-METHYL-1-NITRO-ISOQUINOLINE
CAS:182184-82-3
Formula: C10H8N2O2
KIN03372288
3-METHYL-1-NITRO-PENTANE
CAS:66553-36-4
Formula: C6H13NO2
KIN02543406
3-Methyl-1-nitro-pentane
3-METHYL-1-NITRO-PIPERIDINE
CAS:64605-08-9
Formula: C6H12N2O2
KIN02512528
3-METHYL-1-NITRO-SO-5-PHENYL-1H-PYRAZOLE
CAS:3380-02-7
KIN01088025
3-METHYL-1-NITROBUT-2-ENE
CAS:1809-67-2
Formula: C5H9NO2
KIN01056348
3-METHYL-1-NITROPYRIDINIUM TETRAFLUOROBORATE(I)
CAS:62375-00-2
Formula: C6H7N2O2.BF4
KIN02472945
3-METHYL-1-NITROSO-2-PHENYL-1H-INDOLIZINE
CAS:22900-49-8
KIN02114700
3-METHYL-1-NITROSO-PIPERIDIN-4-ONE
CAS:71677-48-0
Formula: C6H10N2O2
KIN02586024
3-METHYL-1-NITROSO-PIPERIDINE
CAS:13603-07-1
Formula: C6H12N2O
KIN02022011
3-METHYL-1-NONANOL
CAS:22663-64-5
Formula: C10H22O
KIN02112642
3-METHYL-1-NONEN-3-OL
CAS:22616-15-5
Formula: C10H20O
KIN02112268
3-METHYL-1-NONEN-4-YNE
CAS:65668-90-8
Formula: C10H16
KIN02530544
3-METHYL-1-NONYL-1H-PYRAZOLE
CAS:90578-08-8
Formula: C13H24N2
KIN02730260
3-METHYL-1-NONYL-2,5-PYRROLIDINEDIONE
CAS:252900-83-7
KIN03452851
3-METHYL-1-NONYN-3-OL
CAS:5430-02-4
Formula: C10H20O
KIN01130484
3-METHYL-1-NONYN-3-OL PHOSPHITE (3:1)
CAS:89784-73-6
Formula: C30H57O6P
KIN02716913
3-METHYL-1-OCTADECYL-1H-IMIDAZOLIUM CHLORIDE
CAS:171058-19-8
Formula: C22H43ClN2
KIN03348331
3-METHYL-1-OCTADECYL-1H-IMIDAZOLIUM HEXAFLUOROPHOSPHONATE
CAS:219947-96-3
Formula: [C54H110
KIN03432719
3-METHYL-1-OCTADECYLPYRAZOLE
CAS:113501-95-4
Formula: C22H42N2
KIN03123528
3-METHYL-1-OCTADECYLPYRIDINIUM IODIDE
CAS:47461-28-9
Formula: C24H44N.I
KIN02287500
3-METHYL-1-OCTANOL
CAS:38514-02-2
Formula: C9H20O
KIN02248581
3-METHYL-1-OCTEN-3-OL
CAS:24089-00-7
Formula: C9H18O
KIN02126765
3-METHYL-1-OCTEN-3-OL ACETATE
CAS:66008-66-0
Formula: C11H20O2
KIN02535589
3-METHYL-1-OCTEN-4-ONE
CAS:61122-64-3
Formula: C9H16O
KIN02451181
3-METHYL-1-OCTOXYXANTHEN-9-ONE
CAS:127731-65-1
Formula: C22H26O3
KIN03198605
3-METHYL-1-OCTYL-1H-PYRAZOL-4-CARBOXYLIC ACID
CAS:113100-48-4
Formula: C13H22N2O2
KIN03120231
3-METHYL-1-OCTYL-2,5-PYRROLIDINEDIONE
CAS:252900-81-5
KIN03452850
3-METHYL-1-OCTYL-PIPERAZINE
CAS:1192122-29-4
Formula: C13H28N2
KIN05332764
3-METHYL-1-OCTYLPYRIDIN-1-IUM, IODIDE
CAS:258279-32-2
Formula: C14H24N.I
KIN03456502
3-METHYL-1-OCTYN-3-OL
CAS:23580-51-0
Formula: C9H16O
KIN02121418
MFCD00041581
3-METHYL-1-OXA-2-AZASPIRO[4.5]DECA-2,6,9-TRIEN-8-ONE
CAS:50563-25-2
Formula: C9H9NO2
KIN02294488
3-METHYL-1-OXA-2-AZASPIRO[4.5]DECA-2,7,9-TRIEN-6-ONE
CAS:1071016-32-4
Formula: C9H9NO2
KIN05111438
3-METHYL-1-OXA-3,8-DIAZASPIRO[4.5]DECAN-2-ONE
CAS:77225-15-1
Formula: C8H14N2O2
KIN02624247
3-METHYL-1-OXA-3-AZASPIRO[4.5]DECAN-2-ONE
CAS:95891-59-1
Formula: C9H15NO2
KIN02796162
3-METHYL-1-OXA-4,6,9-TRITHIA-5-GERMASPIRO[4.4]NONAN-2-ONE
CAS:185396-83-2
Formula: C5H8GeO2S3
KIN03379438
3-METHYL-1-OXA-4-AZASPIRO[4.5]DECAN-3-METHANOL
CAS:69184-33-4
Formula: C10H19NO2
KIN02568558
3-METHYL-1-OXA-4-AZASPIRO[4.5]DECANE
CAS:69552-24-5
Formula: C9H17NO
KIN02571177
3-METHYL-1-OXA-5-AZASPIRO[5.5]UNDECANE
CAS:88523-25-5
Formula: C10H19NO
KIN02699386
3-METHYL-1-OXASPIRO[4.5]DECAN-2-OL
CAS:87746-87-0
Formula: C10H18O2
KIN02689332
3-METHYL-1-OXO-1H-2-BENZOPYRAN-4-CARBALDEHYDE
CAS:186028-42-2
Formula: C11H8O3
KIN03380850
3-METHYL-1-OXO-1H-2-BENZOPYRAN-4-CARBOXYLIC ACID
CAS:16984-81-9
Formula: C11H8O4
KIN02056989
(1S)-(-)-Camphor; (1R)-(+)-Camphor
MFCD00666002
3-METHYL-1-OXO-1H-2-BENZOPYRAN-4-CARBOXYLIC ACID METHYL ESTER
CAS:25113-15-9
Formula: C12H10O4
KIN02136505
3-METHYL-1-OXO-1H-BENZO[C]PYRAZOLO[1,2-A]CINNOLIN-2-CARBAMIC ACID ETHYL ESTER
CAS:15568-23-7
Formula: C19H17N3O3
KIN02042658
3-METHYL-1-OXO-2,3-DIHYDROINDENE-4-CARBOXYLIC ACID
CAS:99846-16-9
Formula: C11H10O3
KIN02822860
3-METHYL-1-OXO-2-[(PYRIDIN-3-YLAMINO)METHYLENE]PYRIDO[1,2-A]BENZO[D]IMIDAZOL-4-CARBONITRILE
CAS:6455-80-7
Formula: C8H9N5O2S
KIN01162680
3-METHYL-1-OXO-BUT-2-ENYL 2-PHENOXY-CYCLOPROPYL KETONE
CAS:120760-15-8
Formula: C14H16O2
KIN03166236
3-METHYL-1-OXO-BUTENYLIUM
CAS:44391-34-6
Formula: C5H7O
KIN02283671
3-METHYL-1-OXO-BUTENYLIUM TETRAFLUOROBORATE(I)
CAS:95521-34-9
Formula: C5H7O.BF4
KIN02792331
3-METHYL-1-OXO-BUTYLIUM
CAS:69423-61-6
Formula: C5H9O
KIN02570268
3-METHYL-1-OXOBENZO[C]-2,1-OXATHIANE
CAS:111396-79-3
Formula: C9H10O2S
KIN03107545
3-METHYL-1-P-TOLYLTRIAZENE
CAS:21124-13-0
Formula: C8H11N3
KIN02097563
MFCD00008282
3-METHYL-1-PENTADECEN-3-OL
CAS:88591-10-0
Formula: C16H32O
KIN02700136
3-METHYL-1-PENTANESULFONYL AZIDE
CAS:89584-87-2
Formula: C6H13N3O2S
KIN02713970
3-METHYL-1-PENTEN-1-OL 1-( TOSYLATE)
CAS:110745-73-8
KIN03103450
3-METHYL-1-PENTEN-2-OL LITHIUM SALT
CAS:63858-65-1
Formula: C6H12O.Li
KIN02500027
3-METHYL-1-PENTEN-3-OL
CAS:918-86-5
Formula: C6H10O
KIN01033549
3-METHYL-1-PENTEN-4-YN-3-OL_X000D_
CAS:3230-75-9
Formula: C20H30O2
KIN01084937
3-METHYL-1-PENTENE
CAS:760-21-4
Formula: C6H12
KIN01028400
3-METHYL-1-PENTYL-1H-PYRAZOL-5-YLAMINE
CAS:2629-99-4
KIN01073330
3-METHYL-1-PENTYL-1H-PYRAZOLE
CAS:86327-88-0
Formula: C9H16N2
KIN02679762
3-METHYL-1-PENTYL-1H-PYRROL-2,5-DIONE
CAS:143659-00-1
KIN03271530
3-METHYL-1-PENTYL-1H-PYRROLE
CAS:58124-11-1
KIN02410826
3-METHYL-1-PENTYL-QUINOXALINE-2(1H)-ONE
CAS:437987-33-2
Formula: C14H18N2O
KIN03581238
3-METHYL-1-PENTYN-1-OL 1-( TOSYLATE)
CAS:104808-01-7
Formula: C13H16O3S
KIN03064127
3-METHYL-1-PENTYN-1-OL LITHIUM SALT
CAS:104808-02-8
Formula: C6H10O.Li
KIN03064128
3-METHYL-1-PENTYN-3-OL 3-ACETATE
CAS:1185-98-4
Formula: C10H19N
KIN01042428
3-METHYL-1-PENTYN-3-OL 3-BENZOATE
CAS:102586-14-1
Formula: C13H14O2
KIN03048534
3-METHYL-1-PENTYN-3-OL 3-PROPANOATE
CAS:100144-74-9
Formula: C9H14O2
KIN03029168
3-METHYL-1-PENTYN-3-OL 4-NITRO-BENZOATE
CAS:56009-23-5
KIN02375767
3-METHYL-1-PENTYN-3-OL METHANESULFONATE
CAS:59967-07-6
Formula: C7H12O3S
KIN02440231
3-METHYL-1-PENTYNE
CAS:922-61-2
Formula: C6H12
KIN01033658
3-METHYL-1-PHENETHYL-PIPERIDIN-4-ONE
CAS:129164-39-2
Formula: C14H19NO
KIN03204647
3-METHYL-1-PHENETHYLBUTYLAMINE
CAS:6397-02-0
Formula: C23H19N2NaO5S
KIN01161277
3-METHYL-1-PHENOXY-3-BUTEN-2-OL
CAS:91107-01-6
Formula: C11H14O2
KIN02738837
3-METHYL-1-PHENOXY-3-BUTEN-2-ONE
CAS:87385-70-4
Formula: C11H12O2
KIN02686267
3-METHYL-1-PHENYL-1,2-BUTANEDIAMINE 2HCL
CAS:66278-61-3
Formula: C11H18N2.2ClH
KIN02539741
3-METHYL-1-PHENYL-1,2-BUTANEDIONE
CAS:7332-96-9
KIN01184485
3-METHYL-1-PHENYL-1,2-HEXANEDIONE
CAS:64497-30-9
Formula: C13H16O2
KIN02510777
3-METHYL-1-PHENYL-1,3,8-TRIAZASPIRO[4,5]DECAN-4-ONE HCL
CAS:1023-86-5
Formula: C14H19N3O
KIN01037475
3-METHYL-1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:63214-60-8
Formula: C14H19N3O
KIN02488570
3-METHYL-1-PHENYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE 2HCL
CAS:1047655-39-9
KIN05096051
3-METHYL-1-PHENYL-1,3-BUTANEDIOL
CAS:104174-42-7
Formula: C11H16O2
KIN03059278
3-METHYL-1-PHENYL-1,4,5-HEXATRIEN-3-OL
CAS:91671-35-1
Formula: C13H14O
KIN02747351
3-METHYL-1-PHENYL-1,8-NAPHTHYRIDINE-2-ONE
CAS:116288-88-1
Formula: [C15H12N2O
KIN03142313
3-METHYL-1-PHENYL-1-[(TRIMETHYLSILYLOXY)]-2-PENTANONE
CAS:89393-05-5
Formula: C15H24O2Si
KIN02711171
3-METHYL-1-PHENYL-1-BUTANONE PHENYLHYDRAZONE
CAS:65746-54-5
Formula: C17H20N2
KIN02531701
3-METHYL-1-PHENYL-1-HEPTANONE
CAS:57001-88-4
Formula: C14H20O
KIN02392341
3-METHYL-1-PHENYL-1-PENTEN-3-OL
CAS:62232-91-1
Formula: C12H16O
KIN02470542
3-METHYL-1-PHENYL-1H,4H-CHROMENO[4,3-C]PYRAZOL-4(1H)-ONE
CAS:2764-35-4
KIN01075737
3-METHYL-1-PHENYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE
CAS:68557-26-6
Formula: C9H10N4
KIN02564245
3-METHYL-1-PHENYL-1H-2-BENZOPYRAN
CAS:93645-89-7
Formula: C16H14O
KIN02771883
3-METHYL-1-PHENYL-1H-BENZO[D]IMIDAZOL-3-IUM IODIDE
CAS:39778-14-8
Formula: C14H13IN2
KIN02257373
3-METHYL-1-PHENYL-1H-INDAZOLE
CAS:1575-35-5
KIN01050530
3-METHYL-1-PHENYL-1H-INDOL-2-ACETONITRILE
CAS:74371-46-3
KIN02605288
3-METHYL-1-PHENYL-1H-INDOL-2-CARBONYL CHLORIDE
CAS:30490-16-5
KIN02182717
3-METHYL-1-PHENYL-1H-INDOL-2-CARBOXAMIDE
CAS:30490-17-6
KIN02182718
3-METHYL-1-PHENYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:30490-15-4
KIN02182716
3-METHYL-1-PHENYL-1H-INDOL-2-ETHANAMINE
CAS:74371-90-7
KIN02605289
3-METHYL-1-PHENYL-1H-INDOL-2-METHANOL
CAS:74371-44-1
KIN02605286
3-METHYL-1-PHENYL-1H-INDOL-5-OL
CAS:113966-76-0
Formula: C15H13NO
KIN03127397
3-METHYL-1-PHENYL-1H-INDOLE
CAS:112817-88-6
Formula: C15H13N
KIN03118439
3-METHYL-1-PHENYL-1H-INDOLIZINE
CAS:108714-12-1
Formula: C15H13N
KIN03090706
3-METHYL-1-PHENYL-1H-ISOINDOL-1-OL
CAS:18120-25-7
Formula: C15H13NO
KIN02068945
3-METHYL-1-PHENYL-1H-PHOSPHOLE HCL
CAS:104629-22-3
Formula: C11H12ClP
KIN03062652
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIAMINE
CAS:52943-88-1
Formula: C10H12N4
KIN02328014
MFCD00462186
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIAMINE 2HCL
CAS:64068-33-3
Formula: C10H12N4.2ClH
KIN02504037
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIOL
CAS:37409-69-1
KIN02239075
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4,5-DIOXIME
CAS:23047-87-2
KIN02116217
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-(O-METHYLOXIME)
CAS:102204-37-5
KIN03620611
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-(PHENYLHYDRAZONE)
CAS:7625-04-9
Formula: C16H12Cl2N4O
KIN01192389
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[(2-ACETYLPHENYL)HYDRAZONE]
CAS:53847-65-7
Formula: C18H16N4O2
KIN02341287
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[(2-METHOXY-PHENYL)HYDRAZONE]
CAS:16335-66-3
Formula: C17H16N4O2
KIN02050324
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[(2-METHYLPHENYL)HYDRAZONE]
CAS:16335-59-4
Formula: C17H16N4O
KIN02050323
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[(4-CHLOROPHENYL)HYDRAZONE]
CAS:15095-21-3
Formula: C16H13ClN4O
KIN02038398
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[(4-NITROPHENYL)HYDRAZONE]
CAS:16335-56-1
Formula: C16H13N5O3
KIN02050322
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[2-(4-IODO-PHENYL)HYDRAZONE]
CAS:314291-32-2
Formula: C16H13IN4O
KIN03489535
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-[2-PYRIDIN-3-YLHYDRAZONE]
CAS:51138-13-7
KIN02302345
3-METHYL-1-PHENYL-1H-PYRAZOL-4,5-DIONE 4-HYDRAZONE
CAS:1457-02-9
Formula: C27H26O3Si3
KIN01047460
3-METHYL-1-PHENYL-1H-PYRAZOL-4-ACETIC ACID
CAS:1082827-70-0
Formula: C12H12N2O2
KIN05122656
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:21487-48-9
Formula: C11H10N2O
KIN02101319
MFCD02705915
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE 2-[3-[(2-CHLOROPHENYL)METHYL]-3H-1,2,3-TRIAZOLO[4,5-D]PYRIMIDIN-7-YL]HYDRAZONE
CAS:495404-55-2
Formula: C22H18ClN9
KIN03614320
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE HYDRAZONE
CAS:246229-74-3
KIN03654387
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBALDEHYDE OXIME
CAS:96286-04-3
Formula: C11H11N3O
KIN02799446
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBONITRILE
CAS:18093-92-0
Formula: C11H9N3
KIN02068672
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOTHIOAMIDE
CAS:137576-87-5
KIN03242202
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXYLIC ACID
CAS:77169-11-0
Formula: C11H10N2O2
KIN02623806
3-METHYL-1-PHENYL-1H-PYRAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:18093-95-3
KIN02068673
3-METHYL-1-PHENYL-1H-PYRAZOL-4-METHANAMINE
CAS:1020718-05-1
Formula: C11H13N3
KIN05049847
3-METHYL-1-PHENYL-1H-PYRAZOL-4-OL
CAS:103037-92-9
Formula: C10H10N2O
KIN03051455
3-METHYL-1-PHENYL-1H-PYRAZOL-4-PROPANAMINE
CAS:25080-59-5
KIN02136211
3-METHYL-1-PHENYL-1H-PYRAZOL-4-SULFONIC ACID
CAS:78123-18-9
Formula: C10H10N2O3S
KIN02629444
3-METHYL-1-PHENYL-1H-PYRAZOL-4-YLAMINE
CAS:103095-51-8
KIN03051829
3-METHYL-1-PHENYL-1H-PYRAZOL-5-ACETONITRILE
CAS:225220-81-5
KIN03439883
3-METHYL-1-PHENYL-1H-PYRAZOL-5-CARBALDEHYDE
CAS:32464-77-0
KIN02197342
3-METHYL-1-PHENYL-1H-PYRAZOL-5-CARBOHYDRAZIDE
CAS:32464-79-2
Formula: C11H12N4O
KIN02197344
3-METHYL-1-PHENYL-1H-PYRAZOL-5-CARBONITRILE
CAS:65735-09-3
Formula: C11H9N3
KIN02531528
3-METHYL-1-PHENYL-1H-PYRAZOL-5-CARBOXYLIC ACID METHYL ESTER
CAS:55115-11-2
Formula: C12H12N2O2
KIN02360891
3-METHYL-1-PHENYL-1H-PYRAZOL-5-ETHANOL
CAS:91027-08-6
Formula: C12H14N2O
KIN02737498
3-METHYL-1-PHENYL-1H-PYRAZOL-5-METHANOL
CAS:1020058-26-7
Formula: C11H12N2O
KIN05049093
3-METHYL-1-PHENYL-1H-PYRAZOL-5-OL
CAS:942-33-6
Formula: C9H15N3O.ClH
KIN01034718
3-METHYL-1-PHENYL-1H-PYRAZOL-5-OL 5-ACETATE
CAS:138853-66-4
KIN03249229
3-METHYL-1-PHENYL-1H-PYRAZOL-5-OL BENZOATE (ESTER)
CAS:56159-67-2
Formula: C17H14N2O2
KIN02378348
3-METHYL-1-PHENYL-1H-PYRAZOL-5-PROPANAL
CAS:1055192-83-0
Formula: C13H14N2O
KIN05102077
3-METHYL-1-PHENYL-1H-PYRAZOL-5-THIOL
CAS:1131-20-0
Formula: C8H10N2O3
KIN01040830
3-METHYL-1-PHENYL-1H-PYRAZOL-5-YLAMINE HCL
CAS:78119-06-9
KIN02629423
3-METHYL-1-PHENYL-1H-PYRAZOLE
CAS:1128-55-8
Formula: C9H7ClN2
KIN01040682
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-B]PYRIDIN-4-OL
CAS:182275-65-6
KIN03372542
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-B]PYRIDINE
CAS:96200-44-1
KIN02798780
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-YLAMINE
CAS:1181669-30-6
KIN05294247
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-B]QUINOLINE
CAS:894-93-9
Formula: C17H13NO2
KIN01033187
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4,6(5H,7H)-DIONE
CAS:57578-93-5
Formula: C12H10N4O2
KIN02401832
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-D]PYRIMIDINE
CAS:52217-39-7
Formula: C12H10N4
KIN02318112
3-METHYL-1-PHENYL-1H-PYRAZOLO[3,4-D]PYRIMIDINE 5-OXIDE
CAS:77746-95-3
Formula: C12H10N4O
KIN02627221
3-METHYL-1-PHENYL-1H-PYRAZOLO[4,3-B]PYRIDINE
CAS:109129-64-8
Formula: C13H11N3
KIN03093478
3-METHYL-1-PHENYL-1H-PYRAZOLO[4,3-D]OXAZOLE
CAS:96498-69-0
Formula: C11H9N3O
KIN02801135
3-METHYL-1-PHENYL-1H-PYRROL-2,5-DIONE
CAS:3120-06-7
KIN01082704
3-METHYL-1-PHENYL-1H-PYRROLE
CAS:4293-78-1
KIN01104620
3-METHYL-1-PHENYL-1H-TETRAZOLIUM METHYLSULFATE
CAS:64473-45-6
Formula: C8H9N4.CH3O4S
KIN02510403
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID
CAS:24086-27-9
Formula: C13H10N2O2S
KIN02126737
MFCD01244991
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID 2-[(3-ACETYLPHENYL)AMINO]-1-METHYL-2-OXOETHYL ESTER
CAS:437745-27-2
Formula: C24H21N3O4S
KIN03581148
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID 2-[(3-ACETYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:399580-96-2
Formula: C23H19N3O4S
KIN03560740
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID 2-[(4-ACETYLPHENYL)AMINO]-1-METHYL-2-OXOETHYL ESTER
CAS:438012-25-0
Formula: C24H21N3O4S
KIN03581291
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID 2-[(4-IODO-2-METHYLPHENYL)AMINO]-2-OXOETHYL ESTER
CAS:378226-83-6
Formula: C22H18IN3O3S
KIN03547112
3-METHYL-1-PHENYL-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXYLIC ACID 2-[(4-IODO-PHENYL)AMINO]-2-OXOETHYL ESTER
CAS:380176-78-3
Formula: C21H16IN3O3S
KIN03548102
3-METHYL-1-PHENYL-2(1H)-PYRAZINONE
CAS:72615-76-0
Formula: C11H10N2O
KIN02592599
3-METHYL-1-PHENYL-2(1H)-PYRIDINONE
CAS:53427-93-3
Formula: C12H11NO
KIN02335105
3-METHYL-1-PHENYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE, HCL
CAS:13574-93-1
Formula: C18H19ClN2
KIN02021542
3-METHYL-1-PHENYL-2,3-BUTANEDIAMINE
CAS:126376-27-0
Formula: C11H18N2
KIN03192741
3-METHYL-1-PHENYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:55889-14-0
Formula: C10H10N2O2
KIN02373947
3-METHYL-1-PHENYL-2,4-AZETIDINEDIONE
CAS:223802-38-8
Formula: C10H9NO2
KIN03439085
3-METHYL-1-PHENYL-2,4-HEXADIEN-1-ONE
CAS:93626-99-4
Formula: C13H14O
KIN02771546
3-METHYL-1-PHENYL-2,4-PENTADIEN-1-ONE
CAS:57767-42-7
Formula: C12H12O
KIN02405040
3-METHYL-1-PHENYL-2,4-PENTANEDIONE
CAS:109839-22-7
Formula: C12H14O2
KIN03097655
3-METHYL-1-PHENYL-2,5-PYRROLIDINEDIONE
CAS:75619-07-7
Formula: C11H11NO2
KIN02613868
3-METHYL-1-PHENYL-2-(ALLYLTHIO)-1H-INDOLE
CAS:125214-25-7
KIN03187606
3-METHYL-1-PHENYL-2-(PHENYLTHIO)-1-BUTANONE
CAS:63620-78-0
Formula: C17H18OS
KIN02496108
3-METHYL-1-PHENYL-2-(THIOPHEN-3-YL)-1H-PYRROLE
CAS:315179-73-8
KIN03489869
3-METHYL-1-PHENYL-2-[(TRIMETHYLSILYL)METHYL]-BUT-2-EN-1-ONE
CAS:55532-06-4
Formula: C15H22OSi
KIN02368066
3-METHYL-1-PHENYL-2-[2-(PYRROLIDIN-1-YL)ETHYL]INDOLE
CAS:74371-32-7
KIN02605284
3-METHYL-1-PHENYL-2-AZABICYCLO[3.1.0]HEX-2-ENE
CAS:56434-98-1
Formula: C12H13N
KIN02382805
3-METHYL-1-PHENYL-2-AZIRIDINECARBOXYLIC ACID METHYL ESTER
CAS:4916-22-7
KIN01117143
3-METHYL-1-PHENYL-2-BENZOPYRYLIUM PERCHLORATE
CAS:73585-73-6
Formula: C16H15ClO5
KIN02599235
3-METHYL-1-PHENYL-2-BUTYL TOSYLATE
CAS:33740-54-4
Formula: C18H22O3S
KIN02208463
3-METHYL-1-PHENYL-2-PHOSPHOLENE 1,1-DICHLORIDE
CAS:17154-12-0
Formula: C11H13Cl2P
KIN02058790
3-METHYL-1-PHENYL-2-PHOSPHOLENE 1-OXIDE
CAS:707-63-1
Formula: C8H12N2O2S
KIN01026624
3-METHYL-1-PHENYL-2-PIPERIDINAMINE
CAS:63921-27-7
KIN02501385
3-METHYL-1-PHENYL-2-PYRIDIN-2-YLBUTANONE
CAS:7154-12-3
Formula: C16H26N2O
KIN01180210
3-METHYL-1-PHENYL-2-PYRROLIDINEMETHANOL
CAS:18133-15-8
KIN02069048
3-METHYL-1-PHENYL-2-PYRROLIDINOL
CAS:405232-72-6
KIN03566359
3-METHYL-1-PHENYL-2-THIOXO-4(1H)-IMIDAZOLIDINONE
CAS:80944-82-7
Formula: C10H10N2OS
KIN02647039
3-METHYL-1-PHENYL-2-UNDECEN-1-ONE
CAS:88068-41-1
Formula: C18H26O
KIN02692617
3-METHYL-1-PHENYL-3,4-PENTADIEN-2-ONE
CAS:67515-50-8
Formula: C12H12O
KIN02554473
3-METHYL-1-PHENYL-3-(BENZENESULFONYL)-1-BUTANONE
CAS:105604-30-6
KIN03069593
3-METHYL-1-PHENYL-3-(BENZENESULFONYL)CYCLOBUTANOL
CAS:88068-21-7
Formula: C17H18O3S
KIN02692599
3-METHYL-1-PHENYL-3-(PHENYLSULFINYL)-1-BUTANONE
CAS:105604-24-8
KIN03069587
3-METHYL-1-PHENYL-3-(PHENYLTHIO)BUTAN-2-ONE
CAS:95110-58-0
Formula: C17H18OS
KIN02788428
3-METHYL-1-PHENYL-3-AZABICYCLO[3.1.0]HEXAN-2,4-DIONE
CAS:66503-93-3
Formula: C12H11NO2
KIN02542798
3-METHYL-1-PHENYL-3-AZABICYCLO[3.1.0]HEXANE
CAS:86215-13-6
KIN02679007
3-METHYL-1-PHENYL-3-AZABICYCLO[3.1.0]HEXANE HCL
CAS:66503-92-2
Formula: C12H15N.ClH
KIN02542797
3-Methyl-1-phenyl-3-azabicyclo[3.1.0]hexane HCl; 3
3-METHYL-1-PHENYL-3-AZABICYCLO[3.3.1]NONANE HCL
CAS:64543-17-5
Formula: C15H21N.ClH
KIN02511461
3-METHYL-1-PHENYL-3-BUTEN-1-ONE
CAS:52813-35-1
Formula: C11H12O
KIN02326155
3-METHYL-1-PHENYL-3-BUTEN-2-ONE
CAS:55956-30-4
KIN02374994
3-METHYL-1-PHENYL-3-PYRROLIDINOL
CAS:245093-66-7
KIN03447780
3-METHYL-1-PHENYL-3-TRIMETHYLSILYLOXY-BUTAN-1-ONE
CAS:144741-40-2
Formula: C14H22O2Si
KIN03277075
3-METHYL-1-PHENYL-4,4,4-TRIS(PHENYLTHIO)-1-BUTANONE
CAS:69814-16-0
Formula: C29H26OS3
KIN02573104
3-METHYL-1-PHENYL-4,5-DIHYDRO-1H-PYRAZOL-5-ONE
CAS:89-26-9
Formula: C10H9N3O3
KIN01002323
3-METHYL-1-PHENYL-4,5-DIHYDROPYRAZOLE
CAS:10252-46-7
Formula: C10H12N2
KIN02003824
3-METHYL-1-PHENYL-4-(((3-(TRIFLUOROMETHYL)PHENYL)AMINO)METHYLENE)-2-PYRAZOLIN-5-ONE
CAS:320424-82-6
KIN03492464
3-METHYL-1-PHENYL-4-((PYRROLIDIN-1-YL)METHYLENE)-1H-PYRAZOLONE-5
CAS:24664-56-0
Formula: C15H17N3O
KIN02132771
3-METHYL-1-PHENYL-4-(1-PHENYLETHYL)-2,5-PYRROLIDINEDIONE
CAS:132750-77-7
KIN03620610
3-METHYL-1-PHENYL-4-(2-PHENYLHYDRAZINYL)-1H-PYRAZOLO[3,4-B]PYRIDIN-5-CARBOXYLIC ACID ETHYL ESTER
CAS:203719-79-3
KIN03412551
3-METHYL-1-PHENYL-4-(BENZENESULFONYL)-1H-PYRAZOLE
CAS:106910-57-0
KIN03017800
3-METHYL-1-PHENYL-4-(BENZENESULFONYL)-1H-PYRROLE
CAS:117113-19-6
KIN03147473
3-METHYL-1-PHENYL-4-(PHENYLAMINO)-1H-PYRAZOLO[3,4-B]PYRIDIN-5-CARBOXYLIC ACID
CAS:183546-48-7
KIN03374916
3-METHYL-1-PHENYL-4-(PHENYLAMINO)-1H-PYRAZOLO[3,4-B]PYRIDIN-5-CARBOXYLIC ACID ETHYL ESTER
CAS:183546-38-5
KIN03374913
3-METHYL-1-PHENYL-4-(PIPERIDIN-1-YLMETHYLENE)-1H-PYRAZOL-5(4H)-ONE
CAS:5496-05-9
KIN01134169
3-METHYL-1-PHENYL-4-(PROPYLTHIO)-1H-PYRAZOL-5-YLAMINE
CAS:32527-77-8
KIN02197817
3-METHYL-1-PHENYL-4-(TRIFLUORO-ACETYL)-2(1H)-PYRAZOLIN-5-ONE
CAS:1691-95-8
Formula: C12H9F3O
KIN01053496
3-METHYL-1-PHENYL-4-[2-PYRIDIN-3-YLDIAZENYL]PYRAZOL-5-YLAMINE
CAS:40306-42-1
KIN02261695
3-METHYL-1-PHENYL-4-ALLYL-1H-PYRAZOL-5-OL
CAS:160348-54-9
KIN03325694
3-METHYL-1-PHENYL-4-ALLYL-1H-PYRAZOL-5-YLAMINE
CAS:100373-71-5
KIN03031104
3-METHYL-1-PHENYL-4-HEXEN-1-ONE
CAS:62834-98-4
Formula: C13H16O
KIN02481293
3-METHYL-1-PHENYL-4-PHOSPHORINANONE
CAS:94988-36-0
Formula: C12H15OP
KIN02787031
3-METHYL-1-PHENYL-4-PIPERIDIN-1-YL-2,5-PYRROLIDINEDIONE
CAS:408510-54-3
Formula: C16H20N2O2
KIN03631840
3-METHYL-1-PHENYL-4-PROPYL-1H-PYRAZOL-5-AMINE
CAS:1195870-71-3
Formula: C13H17N3
KIN05338716
3-METHYL-1-PHENYL-4-PROPYLPYRANO[2,3-C]PYRAZOL-6-ONE
CAS:219766-70-8
Formula: C16H16N2O2
KIN03432216
3-METHYL-1-PHENYL-5-(1-PROPEN-1-YL)-1H-PYRAZOLE
CAS:71623-04-6
Formula: C13H14N2
KIN02585608
3-METHYL-1-PHENYL-5-(2-PHENYLETHYL)-1H-PYRAZOLE
CAS:94775-24-3
Formula: C18H18N2
KIN02784979
3-METHYL-1-PHENYL-5-(2-TRIAZEN-1-YL)-1H-PYRAZOLE
CAS:1195585-79-5
Formula: C10H11N5
KIN05337637
3-METHYL-1-PHENYL-5-(ALLYLOXY)-1H-PYRAZOL-4-CARBALDEHYDE
CAS:160348-52-7
KIN03620609
3-METHYL-1-PHENYL-5-(ALLYLOXY)-1H-PYRAZOL-4-METHANOL
CAS:1177344-80-7
Formula: C14H16N2O2
KIN05271504
3-METHYL-1-PHENYL-5-(ALLYLTHIO)-1H-PYRAZOL-4-CARBALDEHYDE
CAS:160348-38-9
Formula: C14H14N2OS
KIN03325693
3-METHYL-1-PHENYL-5-(BENZYL)-1H-PYRAZOLE
CAS:74441-32-0
Formula: C17H16N2
KIN02605904
3-METHYL-1-PHENYL-5-(BENZYLOXY)-1H-PYRAZOLE
CAS:84333-82-4
Formula: C17H16N2O
KIN02666736
3-METHYL-1-PHENYL-5-(PHENYLTHIO)-1H-PYRAZOL-4-CARBALDEHYDE
CAS:24628-83-9
KIN02132347
3-METHYL-1-PHENYL-5-(PHENYLTHIO)-1H-PYRAZOL-4-METHANOL
CAS:181121-50-6
KIN03643118
3-METHYL-1-PHENYL-5-(PROPYLTHIO)-1H-PYRAZOL-4-METHANOL
CAS:181121-48-2
KIN03643117
3-METHYL-1-PHENYL-5-(TRIFLUOROMETHYL)-1H-PYRAZOLE
CAS:129585-50-8
Formula: C11H9F3N2
KIN03206417
3-METHYL-1-PHENYL-5-(Z-DL-PHENYL-ALANYLOXY)-1H-PYRAZOL
CAS:2688-22-4
KIN01074350
3-METHYL-1-PHENYL-5-[(1,2,2,2-TETRACHLORO-ETHYL)IMINO]-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:54094-94-9
Formula: C12H9Cl4N3O2
KIN02344914
3-METHYL-1-PHENYL-5-[(TRICHLORO-ETHENYL)IMINO]-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:54094-99-4
Formula: C12H8Cl3N3O2
KIN02344919
3-METHYL-1-PHENYL-5-[2-PHENYL-1-(BENZYL)ETHYL]PYRAZOLE
CAS:94775-25-4
Formula: C25H24N2
KIN02784980
3-METHYL-1-PHENYL-5-HEXENE-1,3-DIOL
CAS:89358-10-1
Formula: C13H18O2
KIN02710689
3-METHYL-1-PHENYL-5-PIPERIDIN-1-YL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:5499-83-2
Formula: C23H34N2O3.ClH
KIN01134246
3-METHYL-1-PHENYL-5-PIPERIDIN-1-YL-1H-PYRAZOL-4-CARBALDEHYDE 2-(6,7-DIHYDRO-5H-CYCLOPENTA[4,5]THIENO[2,3-D]PYRIMIDIN-4-YL)HYDRAZONE
CAS:304646-47-7
Formula: C25H27N7S
KIN03480944
3-METHYL-1-PHENYL-5-PROPOXY-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1177291-50-7
Formula: C14H16N2O2
KIN05271231
3-METHYL-1-PHENYL-5-PROPOXY-1H-PYRAZOL-4-METHANAMINE
CAS:1177295-93-0
Formula: C14H19N3O
KIN05271251
3-METHYL-1-PHENYL-5-PROPOXY-1H-PYRAZOL-4-METHANOL
CAS:1177276-99-1
Formula: C14H18N2O2
KIN05271154
3-METHYL-1-PHENYL-5-SELENO-1H-PYRAZOL-4-CARBALDEHYDE
CAS:125656-22-6
KIN03665651
3-METHYL-1-PHENYL-5H-IMIDAZO[1,5-A]QUINOXALIN-4-ONE
CAS:39597-93-8
Formula: C17H13N3O
KIN02256095
3-METHYL-1-PHENYL-6-(TRIFLUOROMETHYL)-1H-PYRAZOLO[3,4-B]PYRIDIN-4-CARBONITRILE
CAS:319923-89-2
Formula: [C15H9F3N4]
KIN03492207
3-METHYL-1-PHENYL-8-(3-(2-(THIOPHEN-2-YL)-[1,3]DIOXOLAN-2-YL)-PROPYL)-1,3,8-TRIAZASPIRO[4,5]DECAN-4-ONE FUMARATE
CAS:102504-98-3
Formula: C24H31N3O3S.C4H4O4
KIN03047738
3-METHYL-1-PHENYL-8-(4-PHENYL-3-BUTYN-1-YL)-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:102504-94-9
Formula: C24H27N3O
KIN03047734
3-METHYL-1-PHENYL-8-(5-PHENYL-4-PENTYN-1-YL)-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:102504-95-0
Formula: C25H29N3O
KIN03047735
3-METHYL-1-PHENYL-8-[3-(PHENYLTHIO)-PROPYL]-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:102504-96-1
Formula: C23H29N3OS
KIN03047736
3-METHYL-1-PHENYL-8-[3-[2-(THIOPHEN-2-YL)-[1,3]DIOXOLAN-2-YL]PROPYL]-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:102504-97-2
Formula: C24H31N3O3S
KIN03047737
3-METHYL-1-PHENYL-8-BENZYL-1,3,8-TRIAZASPIRO[4.5]DECAN-4-ONE
CAS:1048-13-1
KIN01038072
3-METHYL-1-PHENYL-9H-INDENO[2,1-C]PYRIDIN-9-ONE
CAS:62578-45-4
Formula: C19H13NO
KIN02476535
3-METHYL-1-PHENYL-9H-INDENO[2,1-C]PYRIDINE
CAS:62578-39-6
Formula: C19H15N
KIN02476529
3-METHYL-1-PHENYL-9H-INDENO[2,1-C]PYRIDINE HCL
CAS:62578-40-9
Formula: C19H15N.ClH
KIN02476530
3-METHYL-1-PHENYL-9H-XANTHEN-9-ONE
CAS:1159405-17-0
Formula: C20H14O2
KIN05254860
3-METHYL-1-PHENYL-CHROMENO[2,3-C]PYRAZOL-4-ONE
CAS:30241-53-3
Formula: C17H12N2O2
KIN02180479
3-METHYL-1-PHENYL-CYCLOPENTANOL
CAS:82245-46-3
Formula: C12H16O
KIN02654458
3-Methyl-1-phenyl-cyclopentanol; 3-Methyl-1-phenyl
3-METHYL-1-PHENYL-DIAZIRIDINE
CAS:90151-61-4
Formula: C8H10N2
KIN02723163
3-Methyl-1-phenyl-diaziridine
3-METHYL-1-PHENYL-HEPT-3-OL
CAS:107943-05-5
Formula: C14H22O
KIN03085941
3-METHYL-1-PHENYL-HEPT-6-EN-1-YN-3-OL
CAS:112399-72-1
Formula: C14H16O
KIN03115123
3-METHYL-1-PHENYL-IMIDAZO[1,5-A]PYRIDINE
CAS:75427-24-6
Formula: C14H12N2
KIN02612630
3-Methyl-1-phenyl-imidazo[1,5-a]pyridine
3-METHYL-1-PHENYL-IMIDAZO[1,5-A]PYRIDINE OXALATE
CAS:1185688-64-5
Formula: C16H14N2O4
KIN05320208
3-METHYL-1-PHENYL-IMIDAZO[1,5-A]PYRIDINE SULFATE (2:1)
CAS:75427-25-7
Formula: C14H12N2.1/2H2O4S
KIN02612631
3-METHYL-1-PHENYL-ISOQUINOLINE
CAS:1616-51-9
Formula: C9H10O2
KIN01051583
3-METHYL-1-PHENYL-N-(TETRAHYDRO-2-OXO-THIOPHEN-3-YL)-1H-THIENO[2,3-C]PYRAZOL-5-CARBOXAMIDE
CAS:380489-89-4
Formula: C17H15N3O2S2
KIN03548994
3-METHYL-1-PHENYL-N-PROPYL-1H-PYRAZOL-4-SULFONAMIDE
CAS:1170584-21-0
Formula: C13H17N3O2S
KIN05261373
3-METHYL-1-PHENYL-NAPHTHALENE
CAS:29304-65-2
Formula: C17H14
KIN02173094
3-METHYL-1-PHENYL-NITROSO-UREA
CAS:110396-87-7
Formula: C8H9N3O2
KIN03101275
3-METHYL-1-PHENYL-PHOSPHOLANE 1-OXIDE
CAS:34868-22-9
Formula: C11H15OP
KIN02217633
3-METHYL-1-PHENYL-PIPERAZIN-2-ONE
CAS:72615-77-1
Formula: C11H14N2O
KIN02592600
3-METHYL-1-PHENYL-PIPERAZINE
CAS:72615-78-2
Formula: C11H16N2
KIN02592601
MFCD06804051
3-METHYL-1-PHENYL-PIPERAZINE 2HCL
CAS:1185299-85-7
Formula: C11H16N2.2ClH
KIN05318915
3-METHYL-1-PHENYL-PIPERIDINE
CAS:169123-90-4
KIN03343983
3-METHYL-1-PHENYL-TRICYCLO[3.3.1.13,7]DECAN-2,4,6-TRIONE
CAS:100033-90-7
KIN03027783
3-METHYL-1-PHENYLBUT-2-ENE
CAS:4489-90-1
KIN01109199
3-METHYL-1-PHENYLBUT-2-ENYLIDENE
CAS:98115-40-3
Formula: C11H12
KIN02810886
3-METHYL-1-PHENYLBUTAN-1-ONE, O-VINYL OXIME
CAS:104189-76-6
Formula: C13H17NO
KIN03059470
3-METHYL-1-PHENYLBUTAN-2-OL
CAS:705-59-9
Formula: C9H11NO2
KIN01026530
3-METHYL-1-PHENYLBUTAN-2-ONE (TERT-BUTYL)HYDRAZONE
CAS:88631-04-3
Formula: C15H24N2
KIN02700643
3-METHYL-1-PHENYLBUTANOIC ACID
CAS:55001-00-8
KIN02359044
3-METHYL-1-PHENYLBUTANONE
CAS:582-65-0
Formula: C10H6F4O2
KIN01020716
3-METHYL-1-PHENYLCYCLOBUTANE-CARBONITRILE
CAS:105907-49-1
Formula: C12H13N
KIN03072032
3-METHYL-1-PHENYLCYCLOBUTANOL
CAS:101019-12-9
Formula: C11H14O
KIN03036530
3-METHYL-1-PHENYLCYCLOHEXANOL
CAS:63007-44-3
KIN02484540
3-METHYL-1-PHENYLHEX-5-EN-1-ONE
CAS:112255-39-7
Formula: C13H16O
KIN03113916
3-METHYL-1-PHENYLHEXA-1,5-DIEN-3-OL
CAS:100840-12-8
Formula: C13H16O
KIN03034954
3-METHYL-1-PHENYLPENT-4-EN-1-ONE
CAS:3240-34-4
Formula: C10H13IO4
KIN01085121
3-METHYL-1-PHENYLPENT-4-EN-2-ONE
CAS:135987-22-3
Formula: C12H14O
KIN03235127
3-METHYL-1-PHENYLPENTA-1,4-DIEN-3-OL
CAS:199329-80-1
Formula: C12H14O
KIN03405708
3-METHYL-1-PHENYLPHOSPHOLANE
CAS:24901-29-9
Formula: C11H15P
KIN02134877
3-METHYL-1-PHENYLPYRIDO[2,3-D]PYRIMIDIN-2,4(1H,3H)-DIONE
CAS:51701-55-4
Formula: C14H11N3O2
KIN02310312
3-METHYL-1-PHENYLPYRROLIDIN-2-ONE
CAS:91596-64-4
Formula: C11H13NO
KIN02746175
3-METHYL-1-PHENYLPYRROLIDINE
CAS:106027-38-7
KIN03073195
3-METHYL-1-PHENYLSELENO-2-(PHENYLSELENOMETHYL)BUT-1-ENE
CAS:140705-64-2
Formula: C18H20Se2
KIN03257230
3-METHYL-1-PHENYLURACIL
CAS:37721-30-5
Formula: C11H10N2O2
KIN02242021
3-METHYL-1-PHTHALIMIDOHEX-3-EN-2,5-DIONE
CAS:343361-85-3
Formula: C15H13NO4
KIN03517688
3-METHYL-1-PIPERAZINE-1-YL-2-(4-PROPYLPHENOXY)-1-BUTANONE
CAS:1181609-56-2
Formula: C18H28N2O2
KIN05293583
3-METHYL-1-PIPERAZINE-1-YL-2-[2-ALLYLPHENOXY]-1-BUTANONE
CAS:1181410-09-2
Formula: C18H26N2O2
KIN05292234
3-METHYL-1-PIPERAZINE-1-YL-CYCLOHEXAN-CARBONITRILE
CAS:1016534-95-4
KIN05022992
3-METHYL-1-PIPERAZINE-1-YLBUTANONE HCL
CAS:1181458-07-0
KIN05292527
3-METHYL-1-PIPERAZINEACETIC ACID
CAS:1060813-48-0
Formula: C7H14N2O2
KIN05106470
3-METHYL-1-PIPERAZINECARBODITHIOIC ACID
CAS:22316-97-8
Formula: C6H12N2S2
KIN02109529
3-METHYL-1-PIPERAZINECARBODITHIOIC ACID ETHYL ESTER
CAS:22316-99-0
KIN02109530
3-METHYL-1-PIPERAZINECARBODITHIOIC ACID SODIUM SALT
CAS:22317-03-9
Formula: C6H12N2S2.Na
KIN02109533
3-METHYL-1-PIPERAZINECARBOXIMIDAMIDE
CAS:92564-58-4
Formula: C6H14N4
KIN02758464
3-Methyl-1-piperazinecarboximidamide
3-METHYL-1-PIPERAZINECARBOXIMIDAMIDE SULFATE
CAS:105628-19-1
KIN03069779
3-METHYL-1-PIPERAZINECARBOXIMIDAMIDE SULFATE(2:1)
CAS:92564-59-5
Formula: C6H14N4.1/2H2O4S
KIN02758465
3-METHYL-1-PIPERAZINECARBOXYLIC ACID 4-BROMOPHENYL ESTER
CAS:1184936-93-3
Formula: C12H15BrN2O2
KIN05318177
3-METHYL-1-PIPERAZINECARBOXYLIC ACID ETHYL ESTER
CAS:126458-34-2
Formula: C8H16N2O2
KIN03193130
3-METHYL-1-PIPERAZINECARBOXYLIC ACID METHYL ESTER
CAS:26942-39-2
Formula: C7H14N2O2
KIN02152581
3-METHYL-1-PIPERAZINECARBOXYLIC ACID TERT-BUTYL ESTER HCL
CAS:313657-42-0
Formula: C10H20N2O2.ClH
KIN03488511
3-METHYL-1-PIPERAZINEETHANOL
CAS:3366-27-6
Formula: C7H16N2
KIN01087738
3-METHYL-1-PIPERAZINEETHANOL COMPD. WITHDIPICRATE
CAS:3477-41-6
KIN01090005
3-METHYL-1-PIPERAZINEETHANOL HEXACHLOROPLATINATE(II)
CAS:3477-40-5
KIN01090004
3-METHYL-1-PIPERAZINEMETHANOL HCL%
CAS:91400-16-7
Formula: C6H14N2O.ClH
KIN02743051
3-METHYL-1-PIPERAZINEPROPANAMINE
CAS:91913-67-6
Formula: C8H19N3
KIN02750486
3-Methyl-1-piperazinepropanamine
3-METHYL-1-PIPERAZINEPROPANOIC ACID
CAS:1060813-87-7
Formula: C8H16N2O2
KIN05106491
3-METHYL-1-PIPERIDIN-1-IUM-1-YL-OCT-4-YN-3-OL, CHLORIDE
CAS:53310-27-3
Formula: C14H26ClNO
KIN02333175
3-METHYL-1-PIPERIDIN-1-YLBUTAN-2-ONE
CAS:67082-22-8
Formula: C10H19NO
KIN02548400
3-METHYL-1-PIPERIDIN-4-YL-2,5-PYRROLIDINEDIONE
CAS:75483-77-1
Formula: C10H16N2O2
KIN02612963
3-METHYL-1-PIPERIDINE-1-YL-CYCLOHEXANEMETHANAMINE
CAS:1016675-66-3
KIN05023297
3-METHYL-1-PIPERIDINEACETIC ACID HCL%
CAS:1185294-82-9
Formula: C8H15NO2.ClH
KIN05318761
3-METHYL-1-PIPERIDINEACETOHYDRAZIDE
CAS:1087613-99-7
Formula: C8H17N3O
KIN05126529
3-METHYL-1-PIPERIDINEBUTANENITRILE
CAS:92231-96-4
Formula: C10H18N2
KIN02754407
3-METHYL-1-PIPERIDINEBUTANIMIDAMIDE
CAS:1016844-84-0
Formula: C10H21N3
KIN05027578
3-METHYL-1-PIPERIDINECARBODITHIOIC ACID POTASSIUM SALT
CAS:119304-14-2
Formula: C7H13NS2.K
KIN03158496
3-METHYL-1-PIPERIDINECARBODITHIOIC ACID SODIUM SALT
CAS:98789-79-8
Formula: C7H13NS2.Na
KIN02816044
3-METHYL-1-PIPERIDINECARBONITRILE
CAS:150932-26-6
Formula: [C7H12N2
KIN03297669
3-METHYL-1-PIPERIDINECARBONYL CHLORIDE
CAS:64920-80-5
Formula: C7H12ClNO-
KIN02517881
3-METHYL-1-PIPERIDINECARBOTHIOIC ACID S-BUTYL ESTER
CAS:67587-14-8
Formula: C11H21NOS
KIN02555341
3-METHYL-1-PIPERIDINECARBOXIMIDAMIDE
CAS:132856-77-0
Formula: C7H15N3
KIN03220895
3-METHYL-1-PIPERIDINECARBOXIMIDAMIDE HCL
CAS:1185294-26-1
Formula: C7H15N3.ClH
KIN05318738
3-METHYL-1-PIPERIDINEETHANAMINE
CAS:85723-75-7
Formula: C8H18N2
KIN02676317
MFCD03701703
3-METHYL-1-PIPERIDINEETHANESULFONIC ACID
CAS:1158244-32-6
KIN05253220
3-METHYL-1-PIPERIDINEPROPANIMIDAMIDE
CAS:1016885-16-7
Formula: C9H19N3
KIN05028555
3-METHYL-1-PIPERIDINEPROPANIMIDAMIDE HCL
CAS:1174309-21-7
Formula: C9H19N3.ClH
KIN05265789
3-METHYL-1-PIPERIDINEPROPANOIC ACID HCL
CAS:1158363-16-6
Formula: C9H17NO2.ClH
KIN05253415
3-METHYL-1-PIPERIDINEPROPANOIC ACID METHYL ESTER
CAS:1040073-86-6
KIN05085164
3-METHYL-1-PIPERIDINESULFONAMIDE
CAS:4108-93-4
KIN01101188
3-METHYL-1-PIPERIDINESULFONIC ACID
CAS:1082108-67-5
Formula: C6H13NO3S
KIN05118430
3-METHYL-1-PIPERIDINESULFONIC ACID SODIUM SALT%
CAS:1081563-39-4
Formula: C6H13NO3S.Na
KIN05117408
3-METHYL-1-PROP-2-ENYL-1H-INDOL-2-CARBALDEHYDE
CAS:123731-75-9
Formula: C13H13NO
KIN03180887
3-METHYL-1-PROP-2-ENYL-4-THIOIDENEPYRIMIDIN-2-ONE
CAS:108803-91-4
Formula: C8H10N2OS
KIN03091378
3-METHYL-1-PROP-2-ENYLCYCLOHEXANOL
CAS:24580-57-2
Formula: C10H18O
KIN02131799
3-METHYL-1-PROP-2-YNYL-PIPERIDINE
CAS:77975-79-2
Formula: C9H15N
KIN02628601
3-METHYL-1-PROPAN-2-YL-1H-INDOLE
CAS:10560-08-4
Formula: C12H15N
KIN02008123
3-METHYL-1-PROPAN-2-YL-1H-PYRAZOL-4,5-DIONE
CAS:197651-73-3
Formula: C7H10N2O2
KIN03402841
3-METHYL-1-PROPAN-2-YL-1H-PYRAZOLO[3,4-B]QUINOXALINE
CAS:73023-84-4
Formula: C13H14N4
KIN02595422
3-METHYL-1-PROPAN-2-YL-1H-PYRROL-2,5-DIONE
CAS:73383-86-5
Formula: C8H11NO2
KIN02597890
3-Methyl-1-isopropyl-1H-pyrrol-2,5-dione
3-METHYL-1-PROPAN-2-YL-3-AZABICYCLO[3.1.0]HEXAN-2,4-DIONE
CAS:148236-95-7
Formula: C9H13NO2
KIN03288763
3-METHYL-1-PROPAN-2-YL-INDENO[1,2-C]PYRAZOL-4(1H)-ONE
CAS:69700-42-1
Formula: C14H14N2O
KIN02572210
3-METHYL-1-PROPAN-2-YLAZETIDINE
CAS:55683-33-5
Formula: C7H15N
KIN02370219
3-METHYL-1-PROPAN-2-YLCYCLOPENTANE-CARBALDEHYDE
CAS:75744-57-9
KIN02614533
3-Methyl-1-isopropyl-cyclopentane-carbaldehyde
3-METHYL-1-PROPANOYL-7H-PURIN-2,6-DIONE
CAS:189264-26-4
Formula: C9H10N4O3
KIN03388219
3-METHYL-1-PROPOXY-2-BUTANAMINE HCL
CAS:1185164-25-3
Formula: C8H19NO?HCl;C8H20ClNO
KIN05318537
3-METHYL-1-PROPYL-1H-PYRAZOL-4,5-DIAMINE
CAS:216320-84-2
Formula: [C7H14N4
KIN03429002
3-METHYL-1-PROPYL-1H-PYRAZOL-4,5-DIONE 4-OXIME
CAS:114849-05-7
KIN03133671
3-METHYL-1-PROPYL-1H-PYRAZOL-4-AMINE
CAS:1006457-04-0
Formula: C7H13N3
KIN05012181
3-METHYL-1-PROPYL-1H-PYRAZOL-4-CARBALDEHYDE OXIME
CAS:1006519-05-6
Formula: C8H13N3O
KIN05012934
3-METHYL-1-PROPYL-1H-PYRAZOL-4-CARBONITRILE
CAS:1177346-71-2
Formula: C8H11N3
KIN05271515
3-METHYL-1-PROPYL-1H-PYRAZOL-4-CARBONYL CHLORIDE
CAS:1103427-17-3
Formula: C8H11ClN2O
KIN05168689
3-METHYL-1-PROPYL-1H-PYRAZOL-4-CARBOXIMIDAMIDE
CAS:1103573-07-4
Formula: C8H14N4
KIN05168841
3-METHYL-1-PROPYL-1H-PYRAZOL-4-CARBOXIMIDAMIDE HCL
CAS:1103426-68-1
Formula: C8H14N4.xClH
KIN05168685
3-METHYL-1-PROPYL-1H-PYRAZOL-4-ETHANAMINE
CAS:1007461-28-0
Formula: C9H17N3
KIN05014142
3-METHYL-1-PROPYL-1H-PYRAZOL-4-METHANOL
CAS:1007542-13-3
Formula: C8H14N2O
KIN05014506
3-METHYL-1-PROPYL-1H-PYRAZOL-4-PROPANOIC ACID
CAS:1007485-71-3
Formula: C10H16N2O2
KIN05014211
3-METHYL-1-PROPYL-1H-PYRAZOL-4-PROPANOL
CAS:1007486-97-6
Formula: C10H18N2O
KIN05014231
3-METHYL-1-PROPYL-1H-PYRAZOL-4-SULFONYL CHLORIDE
CAS:1006453-67-3
Formula: C7H11ClN2O2S
KIN05012126
3-METHYL-1-PROPYL-1H-PYRAZOL-5-CARBOXYLIC ACID
CAS:39658-16-7
KIN02256555
3-METHYL-1-PROPYL-1H-PYRAZOL-5-CARBOXYLIC ACID ETHYL ESTER
CAS:39658-15-6
KIN02256554
3-METHYL-1-PROPYL-1H-PYRAZOL-5-METHANAMINE
CAS:1007541-55-0
Formula: C8H15N3
KIN05014490
3-METHYL-1-PROPYL-1H-PYRAZOL-5-METHANOL
CAS:1007514-10-4
Formula: C8H14N2O
KIN05014330
3-METHYL-1-PROPYL-1H-PYRAZOL-5-OL
CAS:29939-26-2
KIN02177831
3-METHYL-1-PROPYL-1H-PYRAZOL-5-OL 5-(N-METHYLCARBAMATE)
CAS:14891-69-1
KIN02036494
3-METHYL-1-PROPYL-1H-PYRAZOL-5-YLAMINE HCL
CAS:91411-63-1
Formula: C7H13N3.ClH
KIN02743240
3-METHYL-1-PROPYL-1H-PYRAZOLE
CAS:32493-02-0
Formula: C7H12N2
KIN02197521
3-METHYL-1-PROPYL-1H-PYRROL-2,5-DIONE
CAS:78066-90-7
Formula: C8H11NO2
KIN02629089
3-Methyl-1-propyl-1H-pyrrol-2,5-dione; N-Propylcit
3-METHYL-1-PROPYL-1H-PYRROLE
CAS:10524-66-0
KIN02007555
3-METHYL-1-PROPYL-2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1013629-58-7
Formula: C11H16N2
KIN05019646
3-METHYL-1-PROPYL-2-OXA-6,10-DITHIASPIRO[4.5]DECAN-1-OL
CAS:141523-78-6
Formula: C11H20O2S2
KIN03260674
3-METHYL-1-PROPYL-2-SULFINOOXY-4-[(4-TERT-BUTYLPHENOXY)METHYL]BENZENE
CAS:3376-94-1
Formula: C21H27NO2
KIN01087937
3-METHYL-1-PROPYL-9H-PYRIDO[3,4-B]INDOLE HCL
CAS:65109-65-1
Formula: C15H16N2.HCL
KIN02521171
3-METHYL-1-PROPYL-ISOQUINOLINE
CAS:91956-28-4
Formula: C13H15N
KIN02750951
3-METHYL-1-PROPYL-PIPERAZINE
CAS:90414-79-2
Formula: C8H18N2
KIN02727489
3-Methyl-1-propyl-piperazine
3-METHYL-1-PROPYL-QUINOXALIN-2(1H)-ONE
CAS:32293-38-2
Formula: C12H14N2O
KIN02195727
3-METHYL-1-PROPYLBENZOTHIENO[2,3-C]PYRIDINE
CAS:80521-83-1
Formula: C15H15NS
KIN02644605
3-METHYL-1-PROPYLBENZOTHIENO[2,3-C]PYRIDINE HCL
CAS:98157-41-6
Formula: C15H15NS.ClH
KIN02811426
3-Methyl-1-propyl-[1]benzothieno[2,3-c]pyridine HC
3-METHYL-1-PROPYLBENZOTHIENO[2,3-C]PYRIDINE PICRATE
CAS:80521-94-4
Formula: C15H15NS.C6H3N3O7
KIN02644616
3-METHYL-1-PROPYLCYCLOPENTENE
CAS:87712-65-0
Formula: C9H16
KIN02688983
3-METHYL-1-PROPYLPYRIDIN-2(1H)-ONE
CAS:77475-05-9
Formula: C9H13NO
KIN02625852
3-Methyl-1-propylpyridin-2(1H)-one
3-METHYL-1-PROPYLPYRIDINIUM
CAS:64111-53-1
Formula: C9H14N
KIN02504487
3-METHYL-1-PROPYLPYRIDINIUM BROMIDE
CAS:67021-55-0
Formula: C9H14N.Br
KIN02547774
3-METHYL-1-PROPYLPYRIDINIUM IODIDE
CAS:67021-57-2
Formula: C9H14N.I
KIN02547776
3-METHYL-1-PYRIDIN-1-IUM-1-YLBUTAN-2-ONE, IODIDE
CAS:6322-28-7
Formula: C13H20NO.C4H2N3O5
KIN01158193
3-METHYL-1-PYRIDIN-2-YL-1-BUTANONE
CAS:6952-54-1
Formula: C18H14O3
KIN01174202
3-METHYL-1-PYRIDIN-2-YL-1-BUTEN-2-OL
CAS:13314-41-5
KIN02017851
3-METHYL-1-PYRIDIN-2-YL-1H-INDOLE
CAS:116359-75-2
Formula: C14H12N2
KIN03142786
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-4,5-DIONE 4-OXIME
CAS:98879-82-4
Formula: C9H8N4O2
KIN02816415
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1152502-73-2
Formula: C10H9N3O
KIN05197958
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:342023-89-6
Formula: C12H13N3O2
KIN03515601
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-4-SULFONIC ACID
CAS:104771-01-9
KIN03006417
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-4-SULFONYL CHLORIDE
CAS:104771-02-0
KIN03643116
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-5-CARBOXYLIC ACID
CAS:209960-82-7
KIN03665650
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-5-OL
CAS:38695-92-0
Formula: C9H9N3O
KIN02249812
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOL-5-YLAMINE
CAS:19541-96-9
Formula: C9H10N4
KIN02082165
2-(5-Amino-3-methylpyrazol-1-yl)-pyridine; 3-Methy
MFCD02708434
3-METHYL-1-PYRIDIN-2-YL-1H-PYRAZOLO[3,4-B]PYRIDIN-4-OL
CAS:364727-25-3
Formula: C12H10N4O
KIN03643115
3-METHYL-1-PYRIDIN-2-YL-IMIDAZO[1,5-A]PYRIDINE
CAS:107345-21-1
Formula: C13H11N3
KIN03082107
3-METHYL-1-PYRIDIN-2-YL-PIPERAZINE
CAS:63286-11-3
Formula: C10H15N3
KIN02489868
MFCD06858505
3-METHYL-1-PYRIDIN-2-YL-PIPERAZINE HBR
CAS:474417-40-8
Formula: C10H15N3.BrH
KIN03601206
3-METHYL-1-PYRIDIN-2-YL-PIPERAZINE MALEATE (1:2)
CAS:63286-12-4
Formula: C10H15N3.2C4H4O4%
KIN02489869
3-Methyl-1-pyridin-2-yl-piperazine dimaleate
3-METHYL-1-PYRIDIN-2-YLBUTAN-2-ONE
CAS:10330-59-3
Formula: C10H13NO
KIN02005015
3-METHYL-1-PYRIDIN-3-YL-1H-PYRAZOL-5-YLAMINE
CAS:19541-72-1
Formula: C9H10N4
KIN02082159
3-METHYL-1-PYRIDIN-3-YLBUTAN-2-ONE
CAS:53872-97-2
Formula: C10H13NO
KIN02341637
3-METHYL-1-PYRIDIN-4-YL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:1153043-06-1
Formula: C10H9N3O
KIN05204175
3-METHYL-1-PYRIDIN-4-YL-1H-PYRAZOL-5-YLAMINE
CAS:3524-45-6
KIN01090832
3-METHYL-1-PYRIDIN-4-YLBUTAN-2-ONE
CAS:6304-30-9
Formula: C10H13NO
KIN01156756
3-METHYL-1-PYRIDINE-4-YL-1-BUTANAMINE
CAS:1178634-82-6
Formula: C10H16N2
KIN05278135
3-METHYL-1-SULFO-PYRIDINIUM INNER SALT
CAS:55546-46-8
Formula: C6H7NO3S
KIN02368285
3-METHYL-1-TETRADECEN-3-OL
CAS:6966-51-4
Formula: C18H16N2OS
KIN01175085
3-METHYL-1-TETRADECYL-1H-IMIDAZOL-3-IUM BROMIDE
CAS:471907-87-6
Formula: C18H35BrN2
KIN03599601
3-METHYL-1-THIASPIRO[4.5]DEC-3-ENE
CAS:65005-97-2
Formula: C10H16S
KIN02519527
3-METHYL-1-THIASPIRO[4.5]DECANE
CAS:63714-78-3
Formula: C10H18S
KIN02497567
3-METHYL-1-THIOCYANATOBUT-2-ENE
CAS:1936-18-1
Formula: C19H21NO4
KIN01059243
3-METHYL-1-TOSYL-1H-INDOLE
CAS:36797-43-0
Formula: C16H15NO2S
KIN02234292
3-METHYL-1-TOSYL-PIPERAZINE
CAS:178624-90-3
Formula: C12H18N2O2S
KIN03365139
3-METHYL-1-TRICYCLO[3.3.1.13,7]DEC-1-YL-1H-PYRAZOLE
CAS:154378-28-6
KIN03676487
3-METHYL-1-TRIDECEN-4-OL
CAS:87963-66-4
Formula: C14H28O
KIN02691125
3-METHYL-1-TRIDECYN-3-OL
CAS:100912-15-0
Formula: [C14H26O
KIN03035583
3-METHYL-1-TRIMETHYLGERMYL-1-BUTYNE
CAS:61228-16-8
Formula: C8H16Ge
KIN02453019
3-METHYL-1-TRIPHENYLENOL
CAS:106914-42-5
KIN03079633
3-METHYL-1-TRITYL-[1,2,4]-TRIAZOLE
CAS:95166-16-8
Formula: C22H19N3
KIN02788839
3-METHYL-1-UNDECEN-4-ONE
CAS:95827-02-4
Formula: C12H22O
KIN02795492
3-METHYL-1-VINYL-1H-[1,2,4]-TRIAZOLE
CAS:80904-17-2
Formula: C5H7N3
KIN02646830
3-METHYL-1-VINYL-1H-IMIDAZOLIUM CHLORIDE
CAS:13474-25-4
Formula: C6H9ClN2
KIN02020119
HE031828,1-Ethenyl-3-methyl-1,2-dihydroimidazol-1-
3-METHYL-1-VINYL-1H-IMIDAZOLIUM METHYLSULFATE
CAS:26591-72-0
Formula: C7H12N2O4S
KIN02149681
3-METHYL-1.LAMBDA.~5~-PYRIDIN-1,2-DIAMINE
CAS:4931-40-2
Formula: C6H9N3.HI
KIN01117492
3-METHYL-10-(1'-NAPHTHYL)ISOALLOXAZINE
CAS:116138-29-5
Formula: C21H14N4O2
KIN03141196
3-METHYL-10-(1-METHYL-PIPERIDIN-3-YL)PHENOTHIAZINE
CAS:101976-50-5
Formula: [C19H22N2S
KIN03043419
3-METHYL-10-(1-PROPYL-PIPERIDIN-3-YL)-10H-PHENOTHIAZINE
CAS:111029-97-1
KIN03631842
3-METHYL-10-(BENZYL)-10H-PHENOTHIAZINE
CAS:132257-08-0
KIN03217877
3-METHYL-10-(PIPERIDIN-1-YLMETHYL)-10H-PHENOTHIAZINE
CAS:109400-02-4
KIN03665652
3-METHYL-10-[2-(PYRROLIDIN-1-YL)ETHYL]-10H-PHENOTHIAZINE
CAS:54027-73-5
KIN02344074
3-METHYL-10-[2-PIPERIDIN-1-YLETHYL]-10H-PHENOTHIAZINE
CAS:54027-74-6
KIN02344075
3-METHYL-10-[3-(PYRROLIDINE-1-YL)BUTYL]-10H-PHENOTHIAZINE
CAS:1195722-31-6
KIN05338499
3-METHYL-10-NAPHTHALEN-1-YLBENZO[G]PTERIDINE-2,4-DIONE
CAS:160510-39-4
Formula: C21H14N4O2
KIN03326227
3-METHYL-10-OCTADECYLBENZO[G]PTERIDIN-2,4(3H,10H)-DIONE
CAS:55788-05-1
Formula: C29H44N4O2
KIN02372198
3-METHYL-10-PROPYLBENZO[G]PTERIDIN-2,4(3H,10H)-DIONE 5-OXIDE
CAS:58668-92-1
Formula: C14H14N4O3
KIN02419242
3-METHYL-10-PROPYLPYRIMIDO[4,5-B]QUINOLIN-2,4(3H,10H)-DIONE
CAS:59997-15-8
Formula: C15H15N3O2
KIN02440624
3-METHYL-10H-DIPYRIDO[2,3-B:2',3'-E][1,4]THIAZINE
CAS:4869-36-7
Formula: C12H14N2O
KIN01116219
3-METHYL-10H-PHENOTHIAZIN-10-YL
CAS:63245-49-8
Formula: C13 H10 NS
KIN02489121
3-METHYL-10H-PHENOTHIAZIN-10-YLOXY
CAS:63245-62-5
Formula: C13 H10 NOS
KIN02489134
3-METHYL-10H-PHENOTHIAZINE
CAS:3939-71-7
KIN01098292
3-METHYL-10H-PHENOTHIAZINE 5,5-DIOXIDE
CAS:61174-78-5
Formula: C13H11NO2S
KIN02452119
3-METHYL-10H-PHENOTHIAZINE 5-OXIDE
CAS:91718-40-0
KIN02747890
3-METHYL-10H-PHENOTHIAZINE-10-PROPANENITRILE
CAS:33566-88-0
KIN02206852
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID
CAS:33566-86-8
KIN02206850
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID 2-(1-OXO-PROPYL)HYDRAZIDE
CAS:37448-21-8
KIN02239400
N'-Propanoyl-3-(3-methylphenothiazin-10-yl)-pr
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID 2-(FURAN-2-YLMETHYLENE)HYDRAZIDE
CAS:37448-04-7
KIN02239394
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID 2-(PHENYLMETHYLENE)HYDRAZIDE
CAS:37447-93-1
KIN02239393
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID 2-[(ALLYLAMINO)THIOXOMETHYL]HYDRAZIDE
CAS:36894-41-4
KIN02235125
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID 2-ACETYLHYDRAZIDE
CAS:37448-19-4
KIN02239399
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID CYANOMETHYL ESTER
CAS:33566-84-6
KIN02206848
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID ETHYL ESTER
CAS:33566-85-7
KIN02206849
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID HYDRAZIDE
CAS:36894-56-1
KIN02235132
3-METHYL-10H-PHENOTHIAZINE-10-PROPANOIC ACID METHYL ESTER
CAS:33566-87-9
KIN02206851
3-METHYL-10H-PHENOTHIAZINE-2-ACETIC ACID
CAS:17799-78-9
KIN02065714
3-METHYL-10H-PHENOTHIAZINE-2-ACETIC ACID METHYL ESTER
CAS:17799-77-8
KIN02065713
3-METHYL-10H-PHENOTHIAZINE-2-CARBOXYLIC ACID
CAS:17799-81-4
KIN02065717
3-METHYL-10H-PHENOTHIAZINE-2-CARBOXYLIC ACID METHYL ESTER
CAS:17799-80-3
KIN02065716
3-METHYL-11-(4-METHYL-PIPERAZIN-1-YL)-5H-DIBENZO[B,E][1,4]DIAZEPINE
CAS:5747-32-0
KIN01140692
3-METHYL-11-(4-METHYL-PIPERAZIN-1-YL)-DIBENZO[B,F][1,4]OXAZEPINE
CAS:3455-02-5
KIN01089549
3-METHYL-11-(4-METHYL-PIPERAZIN-1-YL)-DIBENZO[B,F][1,4]THIAZEPINE
CAS:5747-55-7
KIN01140708
3-METHYL-11-(METHYLTHIO)-5H-DIBENZO[B,E][1,4]DIAZEPINE
CAS:50373-16-5
KIN02292264
3-METHYL-11-DODECEN-2-ONE
CAS:63618-41-7
Formula: C13H24O
KIN02496054
3-METHYL-11H-DIBENZO[B,E]AZEPINE 5-OXIDE
CAS:426216-04-8
Formula: C15H13NO
KIN03576377
3-METHYL-11H-PYRIDO[4,3-A]CARBAZOLIUM IODIDE
CAS:102852-69-7
Formula: C16H13N2.I
KIN03050318
3-METHYL-12-PYRIDIN-2-YL-8,9,10,12-TETRAHYDRO-7H-BENZO[B][4,7]PHENANTHROLIN-11-ONE
CAS:5771-94-8
Formula: C3H6O4
KIN01141322
3-METHYL-12H-BENZOTHIENO[2,3-A]CARBAZOLE
CAS:63039-87-2
Formula: C19H13NS
KIN02485283
3-Methyl-12H-benzothieno[2,3-a]carbazole
3-METHYL-14C-1,1-DIPHENYL-UREA
CAS:24217-61-6
KIN02128122
3-METHYL-15,16-DIHYDRO-11H-CYCLOPENTA[A]PHENANTHREN-17(12H)-ONE
CAS:27343-50-6
Formula: C18H16O
KIN02156473
3-METHYL-15-PHENYLPENTADECANOIC ACID
CAS:116754-80-4
Formula: C22H36O2
KIN03145666
3-METHYL-15-PHENYLPENTADECANOIC ACID METHYL ESTER
CAS:116754-85-9
Formula: C23H38O2
KIN03145667
3-METHYL-16,17,18,19-TETRAHYDROYOHIMBAN-13-IUM CHLORIDE
CAS:6484-80-6
Formula: C16H24ClNO5
KIN01163344
3-METHYL-16-AZABICYCLO[10.3.1]HEXADECA-1(16),12,14-TRIENE
CAS:56912-83-5
Formula: C16H25N
KIN02390719
3-METHYL-18-NONADECYNOIC ACID
CAS:95978-45-3
Formula: C20H36O2
KIN02796895
3-METHYL-18-NONADECYNOIC ACID METHYL ESTER
CAS:95978-46-4
Formula: C21H38O2
KIN02796896
3-METHYL-1H,3H-NAPHTHO[1,8-CD]PYRAN-1-ONE
CAS:69517-57-3
Formula: C13H10O2
KIN02570914
3-METHYL-1H,3H-PYRIMIDIN-4-ONE-2-THIONE
CAS:576-36-3
Formula: C6H12O7
KIN01020475
3-METHYL-1H,5H-NAPHTHO[1,8-EF][1,3]DIOXOCIN
CAS:89453-90-7
Formula: C14H14O2
KIN02712016
3-Methyl-1H,5H-naphtho[1,8-ef][1,3]dioxocin
3-METHYL-1H,5H-PYRAZOLO[1,2-A]PYRAZOL-1,5-DIONE
CAS:78901-41-4
Formula: C7H6N2O2
KIN02634381
3-METHYL-1H,6H-PYRANO[4,3-C]ISOCHROMEN-1-ONE
CAS:1033481-33-2
Formula: C13H10O3
KIN05067953
3-METHYL-1H-[1,2,4]-TRIAZOL-1-ACETIC ACID ETHYL ESTER
CAS:96440-70-9
Formula: C7H11N3O2
KIN02800727
3-METHYL-1H-[1,2,4]-TRIAZOL-5-ACETIC ACID ETHYL ESTER
CAS:100187-10-8
Formula: [C7H11N3O2
KIN03029436
3-METHYL-1H-[1,2,4]-TRIAZOL-5-ACETONITRILE
CAS:86999-26-0
Formula: C5H6N4
KIN02683752
3-METHYL-1H-[1,2,4]-TRIAZOL-5-BUTANAMINE
CAS:325491-72-3
KIN03495203
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBALDEHYDE
CAS:56804-98-9
Formula: C4H5N3O
KIN02388950
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBOHYDRAZIDE
CAS:31100-33-1
KIN02187026
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBONITRILE
CAS:89032-86-0
Formula: C4H4N4
KIN02706114
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBOXAMIDE
CAS:31100-32-0
Formula: C4H6N4O
KIN02187025
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBOXYLIC ACID
CAS:7170-01-6
Formula: C3H5N3
KIN01180542
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBOXYLIC ACID ETHYL ESTER
CAS:40253-47-2
Formula: C6H9N3O2
KIN02261216
3-METHYL-1H-[1,2,4]-TRIAZOL-5-CARBOXYLIC ACID METHYL ESTER
CAS:31100-31-9
Formula: C5H7N3O2
KIN02187024
3-METHYL-1H-[1,2,4]-TRIAZOL-5-ETHANAMINE
CAS:61012-32-6
Formula: C5H10N4
KIN02449752
MFCD09971797
3-METHYL-1H-[1,2,4]-TRIAZOL-5-ETHANAMINE, 2HCL
CAS:462651-77-0
Formula: C5H10N4.2ClH
KIN03597165
3-METHYL-1H-[1,2,4]-TRIAZOL-5-ETHANETHIOIC ACID
CAS:198024-36-1
KIN03403777
3-METHYL-1H-[1,2,4]-TRIAZOL-5-METHANAMINE
CAS:131052-49-8
Formula: C4H8N4
KIN03212630
3-METHYL-1H-[1,2,4]-TRIAZOL-5-METHANAMINE 2HCL
CAS:1192477-93-2
Formula: C4H9ClN4;C4H10Cl2N4;C4 H8 N4 .2ClH
KIN05333782
3-METHYL-1H-[1,2,4]-TRIAZOL-5-METHANOL
CAS:1183178-48-4
Formula: C4H7N3O
KIN05301329
3-METHYL-1H-[1,2,4]-TRIAZOL-5-SELENENIC ACID
CAS:37579-20-7
KIN02240717
3-METHYL-1H-[1,2,4]-TRIAZOL-5-SULFONAMIDE
CAS:29982-54-5
Formula: C3H6N4O2S
KIN02178286
3-METHYL-1H-[1,2,4]-TRIAZOL-5-SULFONIC ACID
CAS:13789-28-1
KIN02024451
3-METHYL-1H-[1,2,4]-TRIAZOL-5-SULFONYL CHLORIDE
CAS:281221-69-0
KIN03467006
3-METHYL-1H-[1,2,4]-TRIAZOL-5-SULFONYL FLUORIDE
CAS:78201-16-8
Formula: C3H4FN3O2S
KIN02629900
3-METHYL-1H-[1,2,4]-TRIAZOL-5-THIOL
CAS:7271-45-6
Formula: C4H7N3S
KIN01183374
3-METHYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE
CAS:4923-02-8
Formula: C7H7N5S
KIN01117311
3-METHYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE HCL
CAS:23350-30-3
Formula: C3H6N4.ClH
KIN02119153
3-METHYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE HCL (1:)
CAS:89830-24-0
Formula: C3H6N4.xClH
KIN02717785
3-Amino-5-methyl-[1,2,4]-Triazole HCl
3-METHYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE NITRATE (1:1)
CAS:13040-75-0
Formula: C3H6N4.HNO3
KIN02013877
3-METHYL-1H-[1,2,4]-TRIAZOL-5-YLAMINE SILVER(I) SALT
CAS:91980-35-7
KIN02751345
3-METHYL-1H-[1,2,4]-TRIAZOLE
CAS:7170-11-8
Formula: C7H7N3.C6H3N3O7
KIN01180543
3-METHYL-1H-[1,4]OXAZINO[4,3-A]BENZO[D]IMIDAZOLE
CAS:156576-12-4
Formula: [C11H10N2O
KIN03315824
3-METHYL-1H-2,1,3-BENZOTHIADIAZIN-4(3H)-ONE 2,2-DIOXIDE
CAS:2225-41-4
Formula: C9H10N2O3S
KIN01065273
3-METHYL-1H-2,3-BENZOXAZIN-4(3H)-ONE
CAS:25804-78-8
Formula: C9H9NO2
KIN02143104
3-METHYL-1H-AZEPINE-1-CARBOXYLIC ACID METHYL ESTER
CAS:14194-60-6
Formula: C9H11NO2
KIN02029308
3-METHYL-1H-CYCLOOCTA-1H-PYRAZOLE
CAS:110661-74-0
Formula: [C10H10N2
KIN03102995
3-METHYL-1H-CYCLOPENTA[B]PYRIDINE
CAS:343269-93-2
Formula: [C9H9N]
KIN03517260
3-METHYL-1H-DIBENZO[C G]CARBAZOLE
CAS:119980-32-4
Formula: C21H15N
KIN03161639
3-METHYL-1H-FURO[2,3-G]INDAZOLE
CAS:217526-27-7
Formula: C10H8N2O
KIN03430139
3-METHYL-1H-IMIDAZOL-2-THIONE, SULFURIC ACID
CAS:113401-96-0
Formula: C4H6N2S.H2O4S
KIN03122715
3-METHYL-1H-IMIDAZOL-3-IUM-1-YLAMINE, 2,4,6-TRIMETHYLBENZENESULFONATE
CAS:54558-28-0
Formula: C13H19N3O3S
KIN02351885
3-METHYL-1H-INDAZOL-1-ACETIC ACID
CAS:191795-48-9
Formula: C10H10N2O2
KIN03393067
3-METHYL-1H-INDAZOL-1-CARBONYL BROMIDE
CAS:146941-90-4
KIN03284182
3-METHYL-1H-INDAZOL-1-CARBONYL CHLORIDE
CAS:146941-97-1
Formula: C9H7ClN2O
KIN03284185
3-METHYL-1H-INDAZOL-1-CARBOXYLIC ACID ETHYL ESTER
CAS:146941-99-3
KIN03284187
3-METHYL-1H-INDAZOL-1-CARBOXYLIC ACID METHYL ESTER
CAS:146941-98-2
Formula: C10H10N2O2
KIN03284186
3-METHYL-1H-INDAZOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:174180-72-4
Formula: C13H16N2O2
KIN03355140
3-METHYL-1H-INDAZOL-1-METHANOL
CAS:142801-04-5
Formula: C9H10N2O
KIN03266759
3-METHYL-1H-INDAZOL-1-YLAMINE
CAS:33334-09-7
Formula: C8H9N3
KIN02204769
3-METHYL-1H-INDAZOL-4-OL
CAS:149071-05-6
Formula: C8H8N2O
KIN03291289
3-METHYL-1H-INDAZOL-4-OL 4-ACETATE
CAS:149071-14-7
Formula: C10H10N2O2
KIN03291296
3-METHYL-1H-INDAZOL-5-CARBONITRILE
CAS:267875-55-8
Formula: C9H7N3
KIN03462944
3-METHYL-1H-INDAZOL-5-CARBOXYLIC ACID METHYL ESTER
CAS:1015068-76-4
Formula: C10H10N2O2
KIN05020461
3-METHYL-1H-INDAZOL-5-YLAMINE
CAS:90764-90-2
Formula: C8H9N3
KIN02732871
MFCD08272110
3-METHYL-1H-INDAZOL-6-CARBOXYLIC ACID
CAS:201286-96-6
Formula: C9H8N2O2
KIN03408771
3-METHYL-1H-INDAZOL-6-CARBOXYLIC ACID METHYL ESTER
CAS:201286-95-5
KIN03408770
3-METHYL-1H-INDAZOL-6-OL
CAS:201286-99-9
Formula: C8H8N2O
KIN03408772
3-METHYL-1H-INDAZOL-6-YLAMINE
CAS:79173-62-9
Formula: C8H9N3
KIN02636022
MFCD11007871
3-METHYL-1H-INDAZOLE
CAS:3176-63-4
Formula: C8H8N2
KIN01083905
3-METHYL-1H-INDAZOLE ION(I)
CAS:58706-39-1
KIN02419770
3-METHYL-1H-INDAZOLE PICRATE
CAS:14888-76-7
Formula: C8H8N2.xC6H3N3O7
KIN02036474
3-METHYL-1H-INDAZOLE SULFATE
CAS:1195656-97-3
Formula: C8H8N2.H2O4S;C8H8N2.H2O4S
KIN05338080
3-METHYL-1H-INDEN-1-OL
CAS:23417-85-8
Formula: C10H10O
KIN02119706
3-METHYL-1H-INDEN-2-CARBONYL CHLORIDE
CAS:184102-76-9
Formula: [C11H9ClO-
KIN03376261
3-METHYL-1H-INDENE-1,2(3H)-DIONE 2-OXIME
CAS:24273-33-4
Formula: C10H9NO2
KIN02128788
3-METHYL-1H-INDENE-2-ACETIC ACID
CAS:69381-20-0
Formula: C12H12O2
KIN02569900
3-METHYL-1H-INDENE-2-ACETONITRILE
CAS:96437-58-0
Formula: C12H11N
KIN02800694
3-METHYL-1H-INDENE-2-CARBOHYDRAZIDE
CAS:87802-09-3
Formula: C11H12N2O
KIN02689847
3-METHYL-1H-INDENE-2-CARBOXYLIC ACID ETHYL ESTER
CAS:118215-65-9
Formula: C13H14O2
KIN03153222
3-METHYL-1H-INDENE-2-CARBOXYLIC ACID METHYL ESTER
CAS:7316-69-0
Formula: C12H14O
KIN01184181
3-METHYL-1H-INDENO[4,5-C]FURAN-1,6,7(3H,8H)-TRIONE
CAS:5811-25-6
KIN01142363
3-METHYL-1H-INDOL-1-ACETALDEHYDE
CAS:51111-53-6
KIN02301897
3-METHYL-1H-INDOL-1-CARBALDEHYDE
CAS:31951-33-4
Formula: C10H9NO
KIN02193303
MFCD09030837
3-METHYL-1H-INDOL-1-CARBALDEHYDE OXIME
CAS:89725-80-4
Formula: C10H10N2O
KIN02716086
3-METHYL-1H-INDOL-1-CARBONITRILE
CAS:477862-62-7
Formula: C10H8N2
KIN03605565
3-METHYL-1H-INDOL-1-CARBOXYLIC ACID
CAS:65610-64-2
Formula: C10H9NO2
KIN02529609
3-METHYL-1H-INDOL-1-CARBOXYLIC ACID ANHYDRIDE
CAS:65610-62-0
Formula: C20H16N2O3
KIN02529607
3-METHYL-1H-INDOL-1-CARBOXYLIC ACID METHYL ESTER
CAS:63703-23-1
KIN02497411
3-METHYL-1H-INDOL-1-HEXANOIC ACID
CAS:289621-47-2
Formula: C15H19NO2
KIN03470777
3-METHYL-1H-INDOL-1-OL
CAS:3289-87-0
Formula: C10H9NO2
KIN01086116
3-METHYL-1H-INDOL-1-PROPANAMINE HCL
CAS:61985-48-6
Formula: C12H16N2.ClH
KIN02465718
3-METHYL-1H-INDOL-1-YLAMINE
CAS:3920-85-2
KIN01098006
3-METHYL-1H-INDOL-2-ACETIC ACID ETHYL ESTER
CAS:14190-78-4
KIN02029252
3-METHYL-1H-INDOL-2-CARBALDEHYDE
CAS:5257-26-1
Formula: C8H11N3O2
KIN01123864
3-METHYL-1H-INDOL-2-CARBALDEHYDE OXIME
CAS:95094-63-6
Formula: C10H10N2O
KIN02788154
3-METHYL-1H-INDOL-2-CARBOHYDRAZIDE
CAS:126400-15-5
KIN03192878
3-METHYL-1H-INDOL-2-CARBONITRILE
CAS:13006-59-2
Formula: C10H8N2
KIN02013446
3-METHYL-1H-INDOL-2-CARBONYL CHLORIDE
CAS:120608-03-9
Formula: C10H8ClNO
KIN03165326
3-METHYL-1H-INDOL-2-CARBOXYLIC ACID
CAS:10590-73-5
Formula: C10H9NO2
KIN02008523
MFCD01652241
3-METHYL-1H-INDOL-2-CARBOXYLIC ACID 2-[(PHENYLAMINO)THIOXOMETHYL]HYDRAZIDE
CAS:148372-30-9
Formula: C17H16N4OS
KIN03289222
3-METHYL-1H-INDOL-2-CARBOXYLIC ACID METHYL ESTER
CAS:104711-29-7
Formula: C11H11NO2
KIN03063327
3-METHYL-1H-INDOL-2-OL
CAS:51674-13-6
Formula: C9H9NO
KIN02309996
3-METHYL-1H-INDOL-2-OL 2-ACETATE
CAS:1094900-30-7
KIN05146976
3-METHYL-1H-INDOL-2-PROPANOIC ACID ETHYL ESTER
CAS:97182-79-1
Formula: C14H17NO2
KIN02804832
3-METHYL-1H-INDOL-2-PROPANOL
CAS:97182-73-5
Formula: C12H15NO
KIN02804829
3-METHYL-1H-INDOL-2-THIOL
CAS:61238-33-3
Formula: C9H9NS
KIN02453121
3-METHYL-1H-INDOL-4-CARBOXYLIC ACID
CAS:1159511-18-8
Formula: C10H9NO2;C10H9NO2
KIN05254961
3-METHYL-1H-INDOL-4-OL
CAS:1125-32-2
Formula: C6H5NO4
KIN01040492
3-METHYL-1H-INDOL-4-OL 4-(HYDROGEN SULFATE)
CAS:17270-52-9
KIN02060111
3-METHYL-1H-INDOL-5,6-DIOL
CAS:4813-46-1
KIN01115184
3-METHYL-1H-INDOL-5-CARBALDEHYDE
CAS:3613-09-0
Formula: C11H9NO2
KIN01092593
3-METHYL-1H-INDOL-5-CARBONITRILE
CAS:3613-07-8
Formula: C10H9NO
KIN01092592
3-METHYL-1H-INDOL-5-CARBOXAMIDE
CAS:189812-79-1
Formula: C10H10N2O
KIN03389878
3-METHYL-1H-INDOL-5-OL
CAS:1125-41-3
Formula: C9H7ClO
KIN01040497
3-METHYL-1H-INDOL-5-YLAMINE
CAS:102308-52-1
Formula: [C9H10N2
KIN03046235
3-METHYL-1H-INDOL-6-ACETIC ACID
CAS:1099493-09-0
KIN05164189
3-METHYL-1H-INDOL-6-CARBONYL CHLORIDE
CAS:1099494-40-2
Formula: C10H8ClNO
KIN05164192
3-METHYL-1H-INDOL-6-CARBOXYLIC ACID
CAS:201286-69-3
Formula: C10H9NO2
KIN03408751
3-METHYL-1H-INDOL-6-OL
CAS:1125-90-2
Formula: C9H11NO
KIN01040535
3-METHYL-1H-INDOL-6-OL HYDROGEN SULFATE (ESTER)
CAS:3929-78-0
KIN01098109
3-METHYL-1H-INDOL-6-YLAMINE
CAS:83696-97-3
Formula: C9H10N2
KIN02662734
3-METHYL-1H-INDOL-7-CARBALDEHYDE
CAS:140640-09-1
Formula: [C10H9NO
KIN03256874
3-METHYL-1H-INDOL-7-OL
CAS:1125-39-9
Formula: C6H6N4O
KIN01040495
3-METHYL-1H-INDOL-7-YLAMINE
CAS:1084328-81-3
KIN05124808
3-METHYL-1H-INDOLE
CAS:83-38-5
Formula: C7H4Cl2O
KIN01001841
3-METHYL-1H-INDOLEACETIC ACID
CAS:73544-97-5
KIN02598982
3-METHYL-1H-INDOLIZINE
CAS:1761-11-1
KIN01055236
3-METHYL-1H-INDOLIZINO[6,5,4,3-IJA]QUINOXALINE
CAS:123730-46-1
Formula: C14H10N2
KIN03180875
3-METHYL-1H-INDOLO[1,2-A]QUINOXALIN-6(5H)-ONE
CAS:164533-27-1
Formula: C16H12N2O
KIN03335893
3-METHYL-1H-ISOINDOL-1-CARBOXYLIC ACID
CAS:37812-42-3
Formula: C10H9NO2
KIN02242877
3-METHYL-1H-ISOINDOL-1-ONE
CAS:404859-21-8
Formula: C9H7NO
KIN03565467
3-METHYL-1H-NAPHTHO[1,2-C]PYRAN-1-ONE
CAS:63542-35-8
Formula: C14H10O2
KIN02494756
3-METHYL-1H-NAPHTHO[2,1-B]PYRAN-1-ONE
CAS:5891-83-8
KIN01144420
3-METHYL-1H-NAPHTHO[2,3-C]PYRAN-1-ONE
CAS:56741-50-5
Formula: C14H10O2
KIN02387901
3-METHYL-1H-NAPHTHO[2,3-E]PERIMIDIN-2,8,13(3H)-TRIONE
CAS:19614-83-6
Formula: C20H12N2O3
KIN02082771
3-METHYL-1H-PHOSPHOLE
CAS:110809-10-4
Formula: C5H7P
KIN03103703
3-METHYL-1H-PYRAZOL-1,4-DICARBALDEHYDE
CAS:160310-26-9
Formula: C6H6N2O2
KIN03325610
3-METHYL-1H-PYRAZOL-1,5-DIMETHANOL
CAS:150704-08-8
KIN03297084
3-METHYL-1H-PYRAZOL-1-ACETIC ACID
CAS:180741-30-4
Formula: C6H8N2O2
KIN03369808
3-METHYL-1H-PYRAZOL-1-ACETIC ACID METHYL ESTER
CAS:1189252-00-3
Formula: C7H10N2O2
KIN05328726
3-METHYL-1H-PYRAZOL-1-ACETONITRILE
CAS:113336-25-7
KIN03122092
3-METHYL-1H-PYRAZOL-1-ACETYL CHLORIDE
CAS:1005631-33-3
Formula: C6H7ClN2O
KIN05010869
3-METHYL-1H-PYRAZOL-1-BUTANAMINE
CAS:325490-73-1
KIN03495180
3-METHYL-1H-PYRAZOL-1-BUTANOIC ACID
CAS:1006495-30-2
Formula: C8H12N2O2
KIN05012819
3-METHYL-1H-PYRAZOL-1-BUTANOIC ACID ETHYL ESTER
CAS:1171364-51-4
Formula: C10H16N2O2
KIN05262231
3-METHYL-1H-PYRAZOL-1-CARBONITRILE
CAS:74731-29-6
Formula: C5H5N3
KIN02607949
3-METHYL-1H-PYRAZOL-1-CARBONYL CHLORIDE
CAS:53881-38-2
Formula: C5H5CLN2O
KIN02341750
3-METHYL-1H-PYRAZOL-1-CARBOPEROXOIC ACID TERT-BUTYL ESTER
CAS:53881-37-1
KIN02341749
3-METHYL-1H-PYRAZOL-1-CARBOTHIOAMIDE
CAS:10514-46-2
Formula: C5H7N3S
KIN02007391
3-METHYL-1H-PYRAZOL-1-CARBOTHIOIC ACID
CAS:170678-23-6
KIN03347153
3-METHYL-1H-PYRAZOL-1-CARBOTHIOIC ACID S-PHENYL ESTER
CAS:69413-32-7
Formula: C11H10N2OS
KIN02570209
3-METHYL-1H-PYRAZOL-1-CARBOTHIOYL CHLORIDE
CAS:99103-28-3
Formula: C5H5ClN2S
KIN02818100
3-METHYL-1H-PYRAZOL-1-CARBOXAMIDE
CAS:873-51-8
Formula: C6H5BCl2
KIN01032346
3-METHYL-1H-PYRAZOL-1-CARBOXIMIDAMIDE
CAS:131737-66-1
KIN03215481
3-METHYL-1H-PYRAZOL-1-CARBOXIMIDAMIDE HCL
CAS:138474-14-3
Formula: C5H8N4.ClH
KIN03246970
3-METHYL-1H-PYRAZOL-1-CARBOXYLIC ACID BUTYL ESTER
CAS:28188-09-2
KIN02163980
3-METHYL-1H-PYRAZOL-1-CARBOXYLIC ACID ETHYL ESTER
CAS:60148-16-5
Formula: C7H10N2O2
KIN02442045
3-METHYL-1H-PYRAZOL-1-CARBOXYLIC ACID METHYL ESTER
CAS:75326-01-1
Formula: C6H8N2O2
KIN02611859
3-METHYL-1H-PYRAZOL-1-CARBOXYLIC ACID PHENYL ESTER
CAS:69413-29-2
Formula: C11H10N2O2
KIN02570208
3-METHYL-1H-PYRAZOL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:186551-70-2
Formula: C9H14N2O2
KIN03381838
3-METHYL-1H-PYRAZOL-1-ETHANAMINE
CAS:62821-90-3
Formula: C6H11N3
KIN02480968
MFCD01822277
3-METHYL-1H-PYRAZOL-1-ETHANOL
CAS:35000-51-2
Formula: C6H10N2O
KIN02218875
MFCD00607975
3-METHYL-1H-PYRAZOL-1-ETHANOL 1-ACETATE
CAS:221163-48-0
KIN03435920
3-METHYL-1H-PYRAZOL-1-METHANOL
CAS:98816-32-1
Formula: C5H8N2O
KIN02816183
3-METHYL-1H-PYRAZOL-1-PROPANAMIDE
CAS:301165-48-0
KIN03476917
3-METHYL-1H-PYRAZOL-1-PROPANAMINE
CAS:62821-91-4
Formula: C7H13N3
KIN02480969
3-Methyl-1H-pyrazol-1-propanamine; [3-(3-Methyl-1H
MFCD03194398
3-METHYL-1H-PYRAZOL-1-PROPANETHIOAMIDE
CAS:1006334-11-7
Formula: C7H11N3S
KIN05011632
3-METHYL-1H-PYRAZOL-1-PROPANOIC ACID
CAS:72145-00-7
Formula: C7H10N2O2
KIN02589435
MFCD00577274
3-METHYL-1H-PYRAZOL-1-PROPANOIC ACID ETHYL ESTER
CAS:1006348-52-2
Formula: C9H14N2O2
KIN05011672
3-METHYL-1H-PYRAZOL-1-PROPANOIC ACID METHYL ESTER
CAS:371118-71-7
KIN03026253
3-METHYL-1H-PYRAZOL-1-PROPANOL
CAS:1006334-09-3
Formula: C7H12N2O
KIN05011631
3-METHYL-1H-PYRAZOL-1-PROPANOYL CHLORIDE
CAS:1027096-78-1
Formula: C7H9ClN2O
KIN05061952
3-METHYL-1H-PYRAZOL-1-YLAMINE
CAS:77202-04-1
Formula: C4H7N3
KIN02624093
3-METHYL-1H-PYRAZOL-4,5-DIONE
CAS:52605-79-5
Formula: C4H4N2O2
KIN02323295
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(2-PHENYLHYDRAZONE)
CAS:13572-24-2
Formula: C10H10N4O
KIN02021498
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-ALLYLOXIME)
CAS:102203-78-1
KIN03045231
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-BUTYLOXIME)
CAS:102204-13-7
KIN03045232
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-CYCLOHEXYLOXIME)
CAS:102204-11-5
KIN03676488
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-DODECYCLOXIME)
CAS:102204-14-8
KIN03017385
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-ETHYLOXIME)
CAS:388624-11-1
Formula: [C6H9N3O2
KIN03555055
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-(O-METHYLOXIME)
CAS:404910-04-9
Formula: C5H7N3O2
KIN03565669
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(1H-PYRAZOL-3-YL)HYDRAZONE]
CAS:16111-72-1
KIN02047860
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(2-CHLOROPYRIDIN-3-YL)HYDRAZONE]
CAS:328280-56-4
KIN03498761
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(3-ACETYLPHENYL)HYDRAZONE]
CAS:365517-52-8
Formula: C12H12N4O2
KIN03540003
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(3-CHLORO-2-HYDROXY-5-NITROPHENYL)HYDRAZONE]
CAS:21104-05-2
KIN02097389
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(4-ACETYLPHENYL)HYDRAZONE]
CAS:328026-35-3
Formula: C12H12N4O2
KIN03497997
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(4-IODO-PHENYL)HYDRAZONE]
CAS:365517-60-8
Formula: C10H9IN4O
KIN03540004
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-(QUINOLIN-3-YL)HYDRAZONE]
CAS:51138-12-6
KIN02302344
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[2-PYRIDIN-3-YLHYDRAZONE]
CAS:51138-11-5
Formula: C9H9N5O
KIN02302343
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[O-(1-METHYLETHYL)OXIME]
CAS:102204-09-1
KIN03620612
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-[O-(BENZYL)OXIME]
CAS:102203-85-0
KIN03017384
3-METHYL-1H-PYRAZOL-4,5-DIONE 4-OXIME
CAS:6386-19-2
Formula: C14H17N3O4
KIN01161031
3-METHYL-1H-PYRAZOL-4-CARBALDEHYDE
CAS:499216-11-4
Formula: C5H6N2O
KIN03617453
3-METHYL-1H-PYRAZOL-4-CARBALDEHYDE OXIME
CAS:1173518-67-6
Formula: C5H7N3O
KIN05264941
3-METHYL-1H-PYRAZOL-4-CARBONITRILE
CAS:131661-41-1
Formula: C5H5N3
KIN03215148
3-METHYL-1H-PYRAZOL-4-CARBOXIMIDAMIDE
CAS:1105039-40-4
Formula: C5H8N4
KIN05170282
3-METHYL-1H-PYRAZOL-4-CARBOXIMIDAMIDE ACETATE
CAS:1105039-41-5
Formula: C5H8N4.C2H4O2
KIN05170283
3-METHYL-1H-PYRAZOL-4-CARBOXYLIC ACID
CAS:288251-49-0
Formula: C5H6N2O2
KIN03469875
3-METHYL-1H-PYRAZOL-4-CARBOXYLIC ACID BUTYL ESTER
CAS:121902-75-8
Formula: C9H14N2O2
KIN03019191
3-METHYL-1H-PYRAZOL-4-CARBOXYLIC ACID ETHYL ESTER
CAS:161958-17-4
Formula: C7H10N2O2
KIN03022114
3-METHYL-1H-PYRAZOL-4-CARBOXYLIC ACID METHYL ESTER
CAS:23170-45-8
Formula: C6H8N2O2
KIN02117471
3-METHYL-1H-PYRAZOL-4-ETHANAMINE
CAS:1007502-95-5
Formula: C6H11N3
KIN05014292
3-METHYL-1H-PYRAZOL-4-METHANAMINE
CAS:1007538-66-0
Formula: C5H9N3
KIN05014463
3-METHYL-1H-PYRAZOL-4-METHANOL
CAS:51445-36-4
Formula: C5H8N2O
KIN02306567
MFCD11100125
3-METHYL-1H-PYRAZOL-4-PROPANAMINE
CAS:28739-42-6
Formula: C7H13N3
KIN02168438
MFCD01314360
3-METHYL-1H-PYRAZOL-4-PROPANOIC ACID
CAS:1007515-69-6
Formula: C7H10N2O2
KIN05014348
3-METHYL-1H-PYRAZOL-4-SULFONIC ACID
CAS:54874-91-8
KIN02356803
3-METHYL-1H-PYRAZOL-4-SULFONYL CHLORIDE
CAS:1179918-36-5
Formula: C4H5ClN2O2S
KIN05288640
3-METHYL-1H-PYRAZOL-4-YLAMINE
CAS:113140-10-6
Formula: C4H8ClN3
KIN03120680
3-METHYL-1H-PYRAZOL-5-ACETIC ACID
CAS:1024606-13-0
Formula: C6H8N2O2
KIN05058667
3-METHYL-1H-PYRAZOL-5-CARBOXAMIDE
CAS:14671-10-4
Formula: C5H7N3O
KIN02034443
3-METHYL-1H-PYRAZOL-5-CARBOXYLIC ACID
CAS:402-63-1
Formula: C8H9FO
KIN01013680
3-METHYL-1H-PYRAZOL-5-METHANOL
CAS:17607-71-5
Formula: C5H8N2O
KIN02063671
3-METHYL-1H-PYRAZOL-5-OL
CAS:132712-71-1
Formula: C4H6N2O
KIN03220173
3-METHYL-1H-PYRAZOL-5-YL-DIMETHYLCARBAMATE MONOMETHYLAN
CAS:2532-49-2
Formula: C11H17N3O2
KIN01071444
3-METHYL-1H-PYRAZOL-5-YLAMINE
CAS:268724-49-8
KIN03463253
3-METHYL-1H-PYRAZOLE
CAS:1198420-88-0
Formula: C4H6N2
KIN05342692
3(or 5)-methyl-Pyrazole; 3-methyl-Pyrazole; 3-Methyl-1H-pyrazole; 3-Methylpyrazole; 5-Methylpyrazole
3-METHYL-1H-PYRAZOLE COBALT(II) SALT
CAS:54166-12-0
Formula: C4H6N2.1/2Co
KIN02346072
3-METHYL-1H-PYRAZOLE COPPER(II) SALT
CAS:71126-78-8
Formula: C4H6N2.1/2Cu
KIN02582119
3-METHYL-1H-PYRAZOLE HCL
CAS:119760-62-2
KIN03160418
3-METHYL-1H-PYRAZOLE PALLADIUM(II) SALT
CAS:93597-45-6
Formula: C4H6N2.1/2Pd
KIN02771178
3-METHYL-1H-PYRAZOLE SILVER(I) SALT
CAS:42983-91-5
Formula: C4H6N2.Ag
KIN02281886
3-METHYL-1H-PYRAZOLE ZINC SALT
CAS:71126-76-6
Formula: C4H6N2.1/2Zn
KIN02582118
3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:174180-77-9
Formula: C12H15N3O2
KIN03355143
3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE
CAS:116834-96-9
Formula: C7H7N3
KIN03146097
3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLIC ACID
CAS:1118787-14-6
Formula: C8H7N3O2
KIN05176565
3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-CARBOXYLIC ACID HCL
CAS:1171525-25-9
Formula: C8H7N3O2.ClH
KIN05262411
3-METHYL-1H-PYRAZOLO[3,4-B]PYRIDINE-5-YLAMINE
CAS:1186608-73-0
Formula: C7H8N4
KIN05321437
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLIN-4,6-DIOL
CAS:173191-72-5
Formula: C11H9N3O2
KIN03353002
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLIN-4-CARBONITRILE
CAS:94194-58-8
Formula: C12H8N4
KIN02778959
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLIN-4-CARBOXAMIDE
CAS:94194-54-4
Formula: C12H10N4O
KIN02778957
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLIN-4-CARBOXYLIC ACID
CAS:94194-51-1
Formula: C12H9N3O2
KIN02778956
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLIN-4-YLAMINE
CAS:105774-47-8
Formula: C11H10N4
KIN03070909
3-METHYL-1H-PYRAZOLO[3,4-B]QUINOLINE
CAS:89522-29-2
Formula: C11H9N3
KIN02712944
3-METHYL-1H-PYRAZOLO[3,4-C]PYRIDAZIN-4-OL
CAS:106584-73-0
Formula: C6H6N4O
KIN03077251
3-METHYL-1H-PYRAZOLO[3,4-C]PYRIDINE
CAS:1072249-89-8
Formula: C7H7N3
KIN05114266
3-METHYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4,6(5H,7H)-DIONE
CAS:2942-51-0
Formula: C6H6N4OS
KIN01079467
3-METHYL-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-OL
CAS:2942-48-5
Formula: C6H6N4S
KIN01079464
3-METHYL-1H-PYRAZOLO[4,3-B]PYRIDIN-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:194278-46-1
Formula: C12H15N3O2
KIN03398046
3-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE
CAS:194278-45-0
Formula: C7H7N3
KIN03398045
3-METHYL-1H-PYRAZOLO[4,3-C]PYRIDINE
CAS:120422-91-5
Formula: C7H7N3
KIN03164335
3-METHYL-1H-PYRAZOLO[4,3-D]PYRIMIDIN-5,7(4H,6H)-DIONE
CAS:28668-19-1
Formula: C6H6N4O2
KIN02167871
3-METHYL-1H-PYRAZOLO[4,3-D]PYRIMIDIN-7(6H)-ONE
CAS:5399-95-1
Formula: C6H5ClN4
KIN01128746
3-METHYL-1H-PYRAZOLO[4,3-D]PYRIMIDIN-7-YLAMINE
CAS:7057-27-4
Formula: C9H12N2O5
KIN01177468
3-METHYL-1H-PYRAZOLO[4,3-D]PYRIMIDINE
CAS:77816-07-0
Formula: C6H6N4
KIN02627629
3-METHYL-1H-PYRAZOLO[5,1-C][1,2,4]-TRIAZOL-6,7-DIAMINE
CAS:227611-33-8
Formula: [C5H8N6
KIN03441273
3-METHYL-1H-PYRAZOLO[5,1-C][1,2,4]-TRIAZOL-6-CARBOXYLIC ACID
CAS:197356-07-3
Formula: [C6H6N4O2
KIN03402348
3-METHYL-1H-PYRIDO[2,3-B]INDOLE
CAS:76162-60-2
Formula: C12H10N2
KIN02617336
MFCD09840937
3-METHYL-1H-PYRIMIDO[1,2-A]QUINOLIN-1-ONE
CAS:91045-75-9
Formula: C13H10N2O
KIN02737789
3-METHYL-1H-PYRIMIDO[4,5-B]INDOL-2,4(3H,9H)-DIONE
CAS:60432-02-2
Formula: C11H9N3O2
KIN02444334
3-METHYL-1H-PYRROL-1-ACETIC ACID
CAS:499214-62-9
Formula: C7H9NO2
KIN03617448
3-METHYL-1H-PYRROL-1-AMINE
CAS:1158766-55-2
Formula: C5H8N2
KIN05254325
3-METHYL-1H-PYRROL-1-CARBOXYLIC ACID ETHYL ESTER
CAS:78805-15-9
Formula: C8H11NO2
KIN02633736
3-METHYL-1H-PYRROL-1-CARBOXYLIC ACID METHYL ESTER
CAS:40611-68-5
KIN02264280
3-METHYL-1H-PYRROL-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:186898-95-3
KIN03654388
3-METHYL-1H-PYRROL-1-ETHANAMINE
CAS:23456-38-4
KIN02120122
3-METHYL-1H-PYRROL-1-PROPANAL
CAS:28333-59-7
KIN02165279
3-METHYL-1H-PYRROL-1-PROPANENITRILE
CAS:177263-29-5
Formula: [C8H10N2
KIN03362074
3-METHYL-1H-PYRROL-1-PROPANOIC ACID
CAS:1195695-33-0
Formula: C8H11NO2
KIN05338331
3-METHYL-1H-PYRROL-1-PROPANOL
CAS:28333-60-0
KIN02165280
3-METHYL-1H-PYRROL-2,4-DICARBALDEHYDE
CAS:94781-49-4
Formula: C7H7NO2
KIN02785086
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID
CAS:3780-42-5
Formula: C9H11NO4
KIN01095820
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-BIS(1-METHYLETHYL) ESTER
CAS:52921-21-8
Formula: C13H19NO4
KIN02327718
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-DIETHYL ESTER
CAS:5448-17-9
Formula: C10H13NO4
KIN01131859
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2,4-DIETHYL ESTER SODIUM SALT
CAS:118834-36-9
Formula: C11H15NO4.Na
KIN03156277
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL 4-METHYL ESTER
CAS:50296-44-1
Formula: C10H13NO4
KIN02291459
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-ETHYL ESTER
CAS:90610-57-4
Formula: C9H11NO4
KIN02730740
MFCD11007904
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 2-METHYL 4-(BENZYL) ESTER
CAS:222718-62-9
Formula: C15H15NO4
KIN03437433
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 4-ETHYL 2-(BENZYL) ESTER
CAS:4563-82-0
Formula: C13H15NO6
KIN01110544
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID 4-ETHYL ESTER
CAS:90610-58-5
Formula: C9H11NO4
KIN02730741
3-METHYL-1H-PYRROL-2,4-DICARBOXYLIC ACID DIMETHYL ESTER
CAS:3780-50-5
Formula: C14H22O2
KIN01095821
3-METHYL-1H-PYRROL-2,4-DIMETHANOL
CAS:1082041-70-0
Formula: C7H11NO2
KIN05118276
3-METHYL-1H-PYRROL-2,5-DICARBALDEHYDE
CAS:90935-74-3
Formula: C7H7NO2
KIN02736172
3-METHYL-1H-PYRROL-2,5-DICARBOXYLIC ACID
CAS:100958-69-8
Formula: C7H7NO4
KIN03035963
3-METHYL-1H-PYRROL-2,5-DICARBOXYLIC ACID 2,5-DIETHYL ESTER
CAS:29170-87-4
Formula: C11H15NO4
KIN02172020
MFCD11110360
3-METHYL-1H-PYRROL-2,5-DICARBOXYLIC ACID 2-ETHYL ESTER
CAS:110252-55-6
Formula: C9H11NO4
KIN03100325
3-METHYL-1H-PYRROL-2,5-DICARBOXYLIC ACID 5-ETHYL ESTER
CAS:25907-34-0
KIN02143887
3-METHYL-1H-PYRROL-2,5-DIONE
CAS:1072-89-5
Formula: C5H8N2O
KIN01038663
3-METHYL-1H-PYRROL-2-AMINE
CAS:1081813-88-8
Formula: C5H8N2
KIN05117876
3-METHYL-1H-PYRROL-2-CARBALDEHYDE
CAS:24014-18-4
Formula: C6H7NO
KIN02125977
MFCD00030343
3-METHYL-1H-PYRROL-2-CARBALDEHYDE OXIME
CAS:24014-20-8
KIN02125979
3-METHYL-1H-PYRROL-2-CARBOHYDRAZIDE
CAS:1023815-79-3
Formula: C6H9N3O
KIN05057776
3-METHYL-1H-PYRROL-2-CARBONITRILE
CAS:24014-22-0
Formula: C6H6N2
KIN02125981
3-METHYL-1H-PYRROL-2-CARBONYL CHLORIDE
CAS:1133931-03-9
Formula: C6H6ClNO
KIN05184986
3-METHYL-1H-PYRROL-2-CARBOXYLIC ACID
CAS:90724-57-5
Formula: C6H7NO2
KIN02732321
MFCD07440095
3-METHYL-1H-PYRROL-2-CARBOXYLIC ACID METHYL ESTER
CAS:40611-69-6
Formula: C7H9NO2
KIN02264281
3-METHYL-1H-PYRROL-2-CARBOXYLIC ACID PHENYLMETHYL ESTER
CAS:3284-47-7
Formula: C8H11NO2
KIN01085970
3-METHYL-1H-PYRROL-2-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:3284-51-3
Formula: C8H11NO2
KIN01085972
3-METHYL-1H-PYRROL-2-METHANOL
CAS:151417-50-4
KIN03299319
3-METHYL-1H-PYRROL-2-PROPANOIC ACID
CAS:101861-69-2
Formula: C8H11NO2
KIN03042459
3-METHYL-1H-PYRROLE
CAS:616-44-4
Formula: C5H6S
KIN01022640
3-METHYL-1H-PYRROLIZIN-1-ONE
CAS:33401-66-0
Formula: C8H7NO
KIN02205323
3-METHYL-1H-PYRROLO-[2,1-C][1,4]OXAZIN-1-ONE
CAS:116212-48-7
Formula: C8H7NO2
KIN03141795
3-METHYL-1H-PYRROLO[1,2-A]IMIDAZOLE
CAS:59027-59-7
Formula: C7H8N2
KIN02425084
3-METHYL-1H-PYRROLO[1,2-A]PYRAZINE
CAS:64608-61-3
Formula: C8H8N2
KIN02512584
3-METHYL-1H-PYRROLO[2,1-C][1,2,4]-TRIAZOL-5,6-DICARBONITRILE
CAS:143779-23-1
Formula: C8H5N5
KIN03272280
3-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-2-METHANOL
CAS:145934-56-1
Formula: C9H10N2O
KIN03281104
3-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:5654-94-4
Formula: C7H14N2
KIN01137991
3-METHYL-1H-PYRROLO[2,3-B]QUINOXALINE
CAS:251978-82-2
Formula: [C11H9N3
KIN03451927
3-METHYL-1H-PYRROLO[2,3-C]PYRIDINE-1-YLAMINE
CAS:1068976-12-4
Formula: C8H9N3
KIN05110477
3-METHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:25796-94-5
Formula: C8H8N2
KIN02143037
MFCD11848727
3-METHYL-1H-PYRROLO[3,2-B]PYRIDINE-5-OL
CAS:1190311-86-4
KIN05330142
5-Hydroxy-3-methyl-4-aza-1H-indole
3-METHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:22930-75-2
Formula: C8H8N2
KIN02115011
MFCD11869968
3-METHYL-1H-PYRROLO[3,2-C]PYRIDINE-1-YLAMINE
CAS:1068976-29-3
Formula: C8H9N3
KIN05110479
3-METHYL-1H-THIENO[3,2-C]PYRAZOLE
CAS:13834-53-2
KIN02024932
3-METHYL-1H-XANTHENE-1,9(4H)-DIONE
CAS:34303-64-5
KIN02212989
3-METHYL-1H-XANTHENE-4,9-DIONE
CAS:34303-65-6
KIN02212990
3-METHYL-2',3'-O-(PROPAN-2-YLIDENE)-2-THIO-URIDINE
CAS:92524-40-8
Formula: C13H18N2O5S
KIN02757913
3-METHYL-2'-(METHYLSULFONYL)-BIPHENYL-4-AMINE
CAS:1110762-04-3
Formula: C14H15NO2S
KIN05172629
3-METHYL-2'-(TRIFLUOROMETHYL)-BIPHENYL-4-CARBOXYLIC ACID
CAS:1008773-88-3
KIN05015977
3-METHYL-2'-O-METHYL-URIDINE
CAS:7103-35-7
Formula: C12H22O
KIN01178683
3-METHYL-2(1H)-PYRAZINETHIONE
CAS:5271-26-1
Formula: C10H14N2
KIN01124263
3-METHYL-2(1H)-PYRAZINETHIONE 4-OXIDE
CAS:5271-24-9
Formula: C18H17N3O3
KIN01124261
3-METHYL-2(1H)-PYRAZINONE
CAS:19838-07-4
Formula: C5H6N2O
KIN02085286
MFCD01646120
3-METHYL-2(1H)-PYRAZINONE 4-OXIDE
CAS:89322-80-5
Formula: C5H6N2O2
KIN02710267
3-METHYL-2(1H)-PYRAZOLIN-5-CARBOXYLIC ACID ETHYL ESTER
CAS:89851-94-5
Formula: C7H12N2O2
KIN02718091
3-METHYL-2(1H)-PYRIDINETHIONE
CAS:18368-66-6
Formula: C6H7NS
KIN02071325
3-METHYL-2(1H)-PYRIDINONE
CAS:1003-57-2
Formula: C5H9ClO2
KIN01036509
3-METHYL-2(1H)-QUINOLINETHIONE
CAS:183206-74-8
Formula: C10H9NS
KIN03374110
3-METHYL-2(1H)-QUINOXALINETHIONE
CAS:58773-29-8
Formula: C9H8N2S
KIN02420946
MFCD00546511
3-METHYL-2(3H)-ALPHA-PYRIDINETHIONE
CAS:1119454-16-8
Formula: C6H7NS
KIN05177211
3-METHYL-2(3H)-BENZO[D]OXAZOLESELONE
CAS:88695-02-7
Formula: C8H7NOSe
KIN02701452
3-METHYL-2(3H)-BENZO[D]OXAZOLETHIONE
CAS:13673-63-7
Formula: C8H7NOS
KIN02023017
MFCD00459943
3-METHYL-2(3H)-BENZO[D]OXAZOLONE HYDRAZONE
CAS:79639-41-1
KIN02638943
3-METHYL-2(3H)-BENZO[D]THIAZOLESELONE
CAS:2786-51-8
Formula: C7H4ClNS
KIN01076112
3-METHYL-2(3H)-BENZO[D]THIAZOLONE 2,2-BIS(4-METHYLPHENYL)HYDRAZONE
CAS:18644-20-7
Formula: C8H7NOS
KIN02073837
3-METHYL-2(3H)-BENZO[D]THIAZOLONE 2-[BIS[4-(DIMETHYLAMINO)PHENYL]METHYLENE]HYDRAZONE
CAS:240114-85-6
Formula: C25H27N5S
KIN03445612
3-METHYL-2(3H)-BENZO[D]THIAZOLONE 2-PHENYLHYDRAZONE
CAS:16599-98-7
Formula: C14H13N3S
KIN02052995
3-METHYL-2(3H)-BENZO[D]THIAZOLONE OXIME
CAS:30761-23-0
Formula: C8H8N2OS
KIN02184610
3-METHYL-2(3H)-BENZO[D]THIAZOLONE SULFINYLHYDRAZONE
CAS:75342-87-9
Formula: C8H7N3OS2
KIN02611993
3-METHYL-2(3H)-BENZO[D]THIAZOLYLIDENE
CAS:62689-06-9
Formula: C8H7NS
KIN02478672
3-METHYL-2(3H)-BENZOSELENAZOLONE HYDRAZONE
CAS:109339-79-9
KIN03094727
3-METHYL-2(3H)-INDOLIZINONE
CAS:75247-97-1
Formula: C9H9NO
KIN02611333
3-Methyl-2(3H)-indolizinone
3-METHYL-2(3H)-OXAZOLETHIONE
CAS:85556-62-3
Formula: C4H5NOS
KIN02675032
3-METHYL-2(3H)-OXAZOLONE
CAS:59581-66-7
Formula: C4H5NO2
KIN02433661
3-METHYL-2(3H)-PTERIDINONE
CAS:89795-86-8
Formula: C7H6N4O
KIN02717233
3-Methyl-2(3H)-pteridinone
3-METHYL-2(3H)-THIAZOLETHIONE
CAS:5685-13-2
Formula: C5H6N2OS2
KIN01138949
3-METHYL-2(3H)-THIAZOLIMINE MONO(TOSYLATE)
CAS:86711-57-1
Formula: C7H8O3S.C4H6N2S
KIN02681994
3-METHYL-2(3H)-THIAZOLIMINE SULFATE
CAS:89839-45-2
Formula: C4H8N2O4S2
KIN02717869
3-METHYL-2(3H)-THIOPHENETHIONE
CAS:210178-32-8
KIN03421080
3-METHYL-2(3H)-THIOPHENONE
CAS:210178-49-7
KIN03421097
3-METHYL-2(5H)-FURANONE
CAS:22122-36-7
Formula: C5H6O2
KIN02107534
MFCD00191545
3-METHYL-2(5H)-THIOPHENETHIONE
CAS:210178-10-2
KIN03421067
3-METHYL-2(5H)-THIOPHENONE
CAS:33687-85-3
Formula: C5H6OS
KIN02207994
3-METHYL-2(E)- 5-HEXADIEN-1-OL
CAS:134360-82-0
Formula: C7H12O
KIN03227917
3-METHYL-2(R)- 3(R)-EPOXY-5-HEXEN-1-OL
CAS:134360-83-1
Formula: C7H12O2
KIN03227918
3-METHYL-2,1,4-BENZOXATHIAZINE 1,1-DIOXIDE
CAS:62033-15-2
Formula: C8H7NO3S
KIN02466521
3-METHYL-2,2'-BI-1H-PYRROLE
CAS:90557-29-2
Formula: C9H10N2
KIN02729906
3-METHYL-2,2'-BI-3H-IMIDAZO[4,5-C]PYRIDINE
CAS:63572-66-7
Formula: C13H10N6
KIN02495269
3-METHYL-2,2'-BIPYRIDINE
CAS:10273-88-8
Formula: C11H10N2
KIN02004187
3-METHYL-2,2'-BITHIOPHENE
CAS:113386-73-5
KIN03122561
3-METHYL-2,2'-METHYLENEDI-PYRIDINE
CAS:29280-12-4
Formula: C12H12N2
KIN02172951
3-METHYL-2,2'-SPIROBI[2H-NAPHTHO[2,3-B]PYRAN]
CAS:78525-59-4
Formula: C26H18O2
KIN02632089
3-METHYL-2,2':5',2''-TERTHIOPHENE
CAS:113386-75-7
Formula: C13H10S3
KIN03122563
3-METHYL-2,2,3-BUTANETRICARBOXYLIC ACID 1,2,4-TRIETHYL ESTER
CAS:6945-46-6
Formula: C13H24O2
KIN01173686
3-METHYL-2,2,3-BUTANETRICARBOXYLIC ACID 1,2,4-TRIMETHYL ESTER
CAS:52003-37-9
KIN02314674
3-METHYL-2,2,3-BUTANETRICARBOXYLIC ACID 1,2-DIETHYL 4-METHYL ESTER
CAS:23904-41-8
KIN02124701
3-METHYL-2,2,3-BUTANETRICARBOXYLIC ACID 1-ETHYL ESTER
CAS:121220-14-2
KIN03654385
3-METHYL-2,2,3-BUTANETRICARBOXYLIC ACID 2,2,3-TRIMETHYL ESTER
CAS:33008-33-2
KIN02201688
3-METHYL-2,2,4-TRIETHYL-2H-CHROMENE
CAS:112307-61-6
Formula: C16H22O
KIN03114301
3-METHYL-2,2-BIS(1-METHYLETHYL)BUTANEPEROXOIC ACID TERT-BUTYL ESTER
CAS:54042-99-8
Formula: C15H30O3
KIN02344328
3-METHYL-2,2-BIS(METHYLTHIO)CYCLOPENTANONE
CAS:88525-11-5
Formula: C8H14OS2
KIN02699405
3-METHYL-2,2-BIS(TRIFLUOROMETHYL)-5-OXAZOLIDINONE
CAS:6458-46-4
KIN01162743
3-METHYL-2,2-BISPROPAN-2-YLBUTANOIC ACID
CAS:69447-94-5
Formula: C11H22O2
KIN02570403
3-METHYL-2,2-BISPROPAN-2-YLBUTANOIC ACID ETHYL ESTER
CAS:73981-22-3
Formula: C13H26O2
KIN02602371
3-METHYL-2,2-BISPROPAN-2-YLBUTANOL, 1-(N-PHENYLCARBAMATE)
CAS:7597-94-6
KIN01191963
3-METHYL-2,2-DI(PROPAN-2-YL)BUTAN-1-YLAMINE HCL
CAS:7504-41-8
Formula: C26H20N2
KIN01189815
3-METHYL-2,2-DIPHENYL-2H-AZIRINE
CAS:65817-54-1
Formula: C15H13N
KIN02532799
3-METHYL-2,2-DIPHENYL-AZIRIDINE
CAS:1071656-61-5
KIN05113223
2,2-Diphenyl-3-methylaziridine; 3-Methyl-2,2-diphenylaziridine
3-METHYL-2,2-DIPHENYL-OXAZOLIDINE
CAS:151696-82-1
Formula: C16H17NO
KIN03300159
3-METHYL-2,2-DIPHENYL-THIIRANE
CAS:88793-72-0
Formula: C15H14S
KIN02702792
3-METHYL-2,2-DIPHENYLBUT-3-ENENITRILE
CAS:7475-69-6
Formula: C17H19N3O
KIN01188588
3-METHYL-2,2-DIPHENYLBUTAN-1-YLAMINE
CAS:7475-71-0
Formula: C17H28ClN3
KIN01188590
3-METHYL-2,2-DIPHENYLOXETAN-3-OL
CAS:89867-83-4
Formula: C16H16O2
KIN02718389
3-METHYL-2,2-DIPROPAN-2-YLBUTANENITRILE
CAS:55897-66-0
Formula: C11H21N
KIN02374027
3-METHYL-2,2-OXIRANEDICARBOXYLIC ACID
CAS:343852-35-7
Formula: [C5H6O5
KIN03518387
3-METHYL-2,2-OXIRANEDICARBOXYLIC ACID 2,2-DIETHYL ESTER
CAS:100145-43-5
Formula: C9H14O5
KIN03029181
3-METHYL-2,2-PYRROLIDINEDICARBOXYLIC ACID 2,2-DIETHYL ESTER
CAS:3005-83-2
KIN01080734
3-METHYL-2,3'-BI-1H-INDOLE
CAS:88919-87-3
Formula: C17H14N2
KIN02704361
3-METHYL-2,3'-BI-1H-PYRROLE
CAS:63761-21-7
Formula: C9H10N2
KIN02498427
3-METHYL-2,3'-BIPYRIDINE
CAS:374117-67-6
Formula: C11H10N2
KIN03544549
3-METHYL-2,3,4,4A,5,6-HEXAHYDRO-1H-PYRAZINO[1,2-A]QUINOLINE, HCL
CAS:36855-63-7
KIN02234829
3-METHYL-2,3,4,4ALPHA,9,9ALPHA-HEXAHYDRO-1H-CARBAZOLE
CAS:6731-89-1
KIN01169428
3-METHYL-2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPIN-2,5-DIONE
CAS:24919-37-7
Formula: C10H10N2O2
KIN02134997
MFCD02942360
3-METHYL-2,3,4,5-TETRAHYDROPYRIDIN-6-YLAMINE
CAS:165383-73-3
Formula: C6H12N2
KIN03337203
3-METHYL-2,3,4,7,8,9-HEXAHYDRO-1H-CYCLOPENTA[F]ISOQUINOLIN-5,6-DIOL HBR
CAS:57612-22-3
Formula: C13H18BrNO2
KIN02402299
3-METHYL-2,3,4,9-TETRAHYDRO-1H-CARBAZOLE
CAS:6933-55-7
KIN01172896
3-METHYL-2,3,5,6,7,8-HEXAHYDROINDOLIZINE
CAS:132256-93-0
Formula: C9H15N
KIN03217872
3-METHYL-2,3-DIAZABICYCLO[2.2.1]HEPTANE-2-ACETONITRILE
CAS:159583-37-6
Formula: C8H13N3
KIN03323679
3-METHYL-2,3-DIAZABICYCLO[2.2.1]HEPTANE-2-ETHANAMINE
CAS:159583-38-7
Formula: [C8H17N3
KIN03323680
3-METHYL-2,3-DIHYDRO-1H-BENZO[B][1,4]DIAZEPINE
CAS:134856-51-2
Formula: C10H12N2
KIN03230051
3-METHYL-2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOLINE
CAS:31330-97-9
Formula: C13H13N
KIN02188616
3-METHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:6072-63-5
Formula: C8H8N4O2S
KIN01149049
3-METHYL-2,3-DIHYDRO-1H-INDENE-4-CARBOXYLIC ACID
CAS:208054-57-3
Formula: C11H12O2
KIN03418324
3-METHYL-2,3-DIHYDRO-1H-INDOL-2-ONE
CAS:1504-12-7
Formula: C16H23NO2
KIN01048730
3-METHYL-2,3-DIHYDRO-1H-INDOLE, HCL
CAS:21573-62-6
Formula: C9H12ClN
KIN02102127
3-METHYL-2,3-DIHYDRO-1H-NAPHTHO[1,2-E]INDOL-10-OL
CAS:98033-22-8
Formula: C17H15NO
KIN02809951
3-METHYL-2,3-DIHYDRO-CYCLOPENTA[C]PHENANTHREN-1-ONE
CAS:29049-79-4
Formula: C18H14O
KIN02170964
3-METHYL-2,3-DIHYDRO-FURAN
CAS:1708-29-8
Formula: C4H6O
KIN01053877
3-METHYL-2,3-DIHYDROFURO[2,3-B]PYRIDIN-3-YL ACETATE
CAS:109274-89-7
Formula: C10H11NO3
KIN03094242
3-METHYL-2,3-DIPHENYL-PSEUDOUREA
CAS:33965-77-4
Formula: C14H14N2O
KIN02210215
3-METHYL-2,3-DIPHENYLPENTANEDINITRILE
CAS:62379-96-8
Formula: C18H16N2
KIN02473080
3-METHYL-2,4'-BIPYRIDINE
CAS:106047-22-7
Formula: C11H10N2
KIN03073320
3-METHYL-2,4(1H)-IMIDAZOLIDINEDIONE
CAS:6843-49-8
Formula: C10H10N2O2
KIN01171298
3-METHYL-2,4(1H,3H)-PTERIDINEDIONE
CAS:50256-19-4
Formula: C7H6N4O2
KIN02291067