HomeText SearchStructure Searche-Chemicals.comList Your CompanyContactAccountLogoff






























Chem-Impex International




Country: USA

Chem-Impex International
935 Dillon Drive
Wood Dale, IL 60191 (USA)


Phone: (800) 869-9290
Phone 2: 630-766-2112
FAX: 630-766-2218
E-Mail:E-Mail this Supplier

Contact: Patrick Mehta

http://www.chemimpex.com/

Chem-Impex International, Inc.(CII) started operations in 1981. With our continued success, we have expanded and now operate from two commercial establishments, manufacturing and distribution.

CII offers over 15,000 unique chemical entities. These chemicals range from amino acids , unnatural amino acids and their derivatives, peptide reagents, resins, nucleosides, diagnostic chemicals and tissue culture reagents, molecular bio chemicals etc.

CII has the capabilities to supply quantities based on customer requirements: from grams to kilograms.

We at CII have the infrastructure to produce any specific requirement on a customized basis. With the state of the art production facilities, excellently supported by a group of organic chemists, CII can boast of satisfying any customer need.

At CII our unbending and proud commitment to quality at every level ensures product consistency and transaction integrity at all times.

The President and staff at CII are proud that our products are the industry standards for the leading and cutting edge research and many expanding frontiers in chemistry. We are committed to accelerating the process of bringing exciting new compounds to market.

Product List: 17,368

PON:Page:1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 |


 


Product List

(+) BIOTINYL-6-AMINOHEXANOIC ACID
CAS:72040-64-3
Trade Name: Biotin caproic acid
Formula: C16H27N3O4S
14003
MW: 357.47
= 98% (HPLC)
(+)-(1R,4S)-4-AMINOCYCLOPENT-2-ENECARBOXYLIC ACID
CAS:134003-04-6
Trade Name: (+)-(1R,4S)-gamma-Homocycloleu-2-ene
Formula: C6H9NO2
15211
MW: 127.14
= 99% (HPLC)
(+)-(1R,4S)-N-BOC-4-AMINOCYCLOPENT-2-ENECARBOXYLIC ACID
CAS:151907-80-1
Trade Name: (+)-(1R,4S)-N-Boc-gamma-homocycloleu-2-ene
Formula: C11H17NO4
15215
MW: 227.26
= 99% (HPLC)
(+)-(1S,3R)-3-AMINO-CYCLOPENTANE CARBOXYLIC ACID
CAS:71830-07-4
Trade Name: (+)-(1S,3R)-b-Homocycloleucine
Formula: C6H11NO2
15487
MW: 129.16
= 98% (HPLC)
(+)-(1S,3R)-N-BOC-3-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:261165-05-3
Trade Name: (+)-(1S,3R)-N-Boc-beta-homocycloleucine
Formula: C11H19NO4
15260
MW: 229.28
= 97% (HPLC)
(+)-(1S,3R)-N-FMOC-3-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:220497-66-5
Trade Name: (+)-(1S,3R)-N-Fmoc-beta-homocycloleucine
Formula: C21H21NO4
15254
MW: 351.4
= 95%
(+)-(4,6-O-BENZYLIDENE)METHYL-A-D-GLUCOPYRANOSIDE
CAS:3162-96-7
Trade Name: 4,6-O-benzylidene methyl-alpha-D-glucopyranoside
Formula: C14H18O6
27083
MW: 282.29
= 98% (HPLC)
(+)-A-TOCOPHEROL NHS SUCCINATE
Formula: C37H57NO7
23044
MW: 627.86
= 99% (NMR)
(+)-A-TOCOPHEROL SULFO-NHS SUCCINATE
Formula: C37H56NO10SNa
23159
MW: 729.92
= 99% (NMR)
(+)-BIOTIN HYDRAZIDE
CAS:66640-86-6
Formula: C10H18N4SO2
23022
MW: 258.34
= 95% (NMR)
(+)-BIOTIN N-HYDROXYSUCCINIMIDE ESTER
CAS:35013-72-0
Trade Name: d-Biotin NHS ester
Formula: C14H19N3O5S
00946
MW: 341.4
= 99%
(+)-BIOTIN-(PEG)2-MALEIMIDE
CAS:305372-39-8
Trade Name: N-Biotinyl-N'-(3-maleimidopropionyl)-3,6-dioxaoctane-1,8-diamine
Formula: C23H35N5SO7
23107
MW: 525.63
= 99% (HPLC)
(+)-BIOTIN-(PEO)3-FLUORESCEIN
Formula: C36H40N4SO10
23130
MW: 720.8
(+)-BIOTIN-(PEO)3-IODOACETAMIDE
Formula: C18H31N4SO5I
23069
MW: 542.44
= 98% (HPLC)
(+)-BIOTIN-(PEO)3-MALEIMIDE
Formula: C20H30N4SO6
23089
MW: 454.54
= 99% (NMR)
(+)-BIOTIN-(PEO)4-AMINE
CAS:359860-27-8
Formula: C18H34N4SO5
23062
MW: 418.55
= 95% (NMR)
(+)-BIOTIN-(PEO)4-NHS-PROPIONATE
Formula: C25H40N4SO10
23091
MW: 588.67
= 99% (NMR)
(+)-BIOTIN-(PEO)4-PROPIONIC HYDRAZIDE
Formula: C21H39N5SO7
23128
MW: 505.63
(+)-BIOTIN-(PEO)4-PSORALEN
Formula: C33H44N4SO10
23058
MW: 688.79
= 99% (NMR)
(+)-BIOTIN-(PEO)4-TFPA
Formula: C25H33N7F4SO6
23037
MW: 635.63
99%
(+)-BIOTIN-(PEO)6-(+)-BIOTIN
CAS:440680-87-5
Formula: C32H56N6S2O9
23042
MW: 732.92
= 96% (HPLC)
(+)-BIOTIN-C12-(+)-BIOTIN
Formula: C32H41N6S2O4
23055
MW: 652.96
99%
(+)-BIOTIN-PDA
Formula: C17H24N4S3O2
23048
MW: 412.6
99%
(+)-BIOTIN-PFP-ESTER
CAS:120550-35-8
Formula: C16H15N2SO3F5
23053
MW: 410.36
= 98% (HPLC)
(+)-BIOTIN-SARCOSINE
Trade Name: Biotin-Sarcosine
Formula: C13H21N3SO4
14400
MW: 315.39
= 97% (NMR)
(+)-BIOTIN-X-X-SULFO-NHS
Formula: C26H40N5S2O10Na
23155
MW: 669.75
= 99% (NMR)
(+)-BIOTINAMIDOHEXANOIC ACID HYDRAZIDE
CAS:109276-34-8
Trade Name: LC-(+)-Biotin hydrazide
Formula: C16H29N5SO3
22980
MW: 371.47
= 99% (NMR)
(+)-BIOTINYL HEXYLAMINE
Formula: C16H30N4SO2
23072
MW: 342.51
= 95% (HPLC)
(+)-CIS,TRANS-ABSCISIC ACID
CAS:21293-29-8
Trade Name: (+)-Abscisic acid
Formula: C15H20O4
21598
MW: 264.32
= 95% (HPLC)
(+)-CIS-TRAMADOL (S)-(+)-MANDELATE
CAS:280565-80-2
Formula: C16H25NO2?C8H8O3
24398
MW: 415.53
(+)-DI-P-ANISOYL-D-TARTARIC ACID
CAS:191605-10-4
Formula: C20H18O10
30339
MW: 418.35
=99% by GC
(+)-DI-P-TOLUOYL-D-TARTARIC ACID MONOHYDRATE
CAS:71607-32-4
Formula: C20H18O8 H2O
30435
MW: 404.37
= 99% (HPLC)
(+)-DIBENZOYL-D-TARTARIC ACID MONOHYDRATE
CAS:80822-15-7
Trade Name: (+)-2,3-Dibenzoyl-D-tartaric acid monohydrate
Formula: C18H14O8 H2O
21991
MW: 376.32
= 99% (Assay)
(+)-DIBUTYL-L-TARTRATE
CAS:87-92-3
Trade Name: L-(+)-Tartaric Acid Dibutyl Ester
Formula: C12H22O6
30703
MW: 262.3
= 98% (GC)
(+)-DIETHYL L-TARTRATE
CAS:87-91-2
Trade Name: L-(+)-Tartaric acid diethyl ester
Formula: C8H14O6
30349
MW: 206.19
= 98% (GC)
(+)-DIISOPROPYL L-TARTRATE
CAS:2217-15-4
Trade Name: L-(+)-Tartaric acid diisopropyl ester
Formula: C10H18O6
30350
MW: 234.25
= 98% (GC)
(+)-DIMETHYL L-TARTRATE
CAS:608-68-4
Formula: C6H10O6
30348
MW: 178.14
ee =99% (GC)
(+)-O,O'-DI-P-TOLUOYL-D-TARTARIC ACID, ANHYDROUS MADE FROM SYNTHETIC SOURCE
CAS:32634-68-7
Trade Name: Di-p-toluyl-D-tartaric acid
Formula: C20H18O8
24538
MW: 386.35
= 99% (HPLC)
(+)-SODIUM L-ASCORBATE CRYSTALLINE
CAS:134-03-2
Trade Name: L(+)-Ascorbic acid sodium salt
Formula: C6H7O6Na
30768
MW: 198.1
99.0-101.0% (Assay, dried basis)
(+)-USNIC ACID FROM USNEA LONGISSIMA ACH
CAS:7562-61-0
Trade Name: 2,6-Diacetyl-7,9-Dihydroxy-8,9B-Dimethyldibenzofuran-1,3(2H,9Bh)-Dione
Formula: C18H16O7
22067
MW: 344.32
= 99% (HPLC)
(+/-)-2-HYDROXYDECANOIC ACID
CAS:37639-46-6,5393-81-7
Trade Name: alpha-Hydroxycapric acid
Formula: C10H20O3
24154
MW: 188.27
= 97% (GC)
(+/-)-FMOC-CIS-2-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:352707-76-7
Trade Name: Fmoc-cis-Acpc
Formula: C21H21NO4
22763
MW: 351.4
= 98% (HPLC)
(-)-(1R,3S)-3-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:71830-08-5
Trade Name: (-)-(1R,3S)-b-Homocycloleucine
Formula: C6H11NO2
15488
MW: 129.16
= 95% (HPLC)
(-)-(1R,3S)-N-BOC-3-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:161660-94-2
Trade Name: (-)-(1R,3S)-N-Boc-beta-homocycloleucine
Formula: C11H19NO4
15221
MW: 229.28
= 95% (HPLC)
(-)-(1R,3S)-N-FMOC-3-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:220497-67-6
Trade Name: (-)-(1R,3S)-N-Fmoc-beta-homocycloleucine
Formula: C21H21NO4
15255
MW: 351.4
= 95%
(-)-(1S,4R)-4-AMINOCYCLOPENT-2-ENECARBOXYLIC ACID
CAS:168471-40-7
Trade Name: (-)-(1S,4R)-gamma-Homocycloleu-2-ene
Formula: C6H9NO2
15223
MW: 127.14
= 99% (HPLC)
(-)-(1S,4R)-N-BOC-4-AMINOCYCLOPENT-2-ENECARBOXYLIC ACID
CAS:151907-79-8
Trade Name: (-)-(1S,4R)-N-Boc-gamma-homocycloleu-2-ene
Formula: C11H17NO4
15214
MW: 227.26
= 98% (HPLC)
(-)-1-[(4-CHLOROPHENYL)PHENYLMETHYL]PIPERAZINE
CAS:130018-88-1,300543-56-0
Formula: C17H19ClN2
24373
MW: 286.8
= 99.5% (HPLC, Chiral purity)
(-)-A-(4-CHLOROPHENYL)BENZYLAMINE (+)-TARTRATE SALT
CAS:163837-57-8
Formula: C13H12ClN C4H6O6
24385
MW: 367.78
(-)-CHOLESTEROL NHS SUCCINATE
Formula: C35H53NO6
23103
MW: 583.81
= 99% (NMR)
(-)-CHOLESTEROL SULFO-NHS SUCCINATE
Formula: C35H52NO9SNa
23157
MW: 685.86
(-)-COLCHICINE
CAS:64-86-8
Formula: C22H25NO6
23019
MW: 399.43
94.0 to 101.0% (HPLC)
(-)-DI-P-ANISOYL-L-TARTARIC ACID
CAS:50583-51-2
Formula: C20H18O10
30338
MW: 418.35
=99% by GC
(-)-DI-P-TOLUOYL-L-TARTARIC ACID (ANHYDROUS)
CAS:32634-66-5
Formula: C20H18O8
30400
MW: 386.35
= 99% (HPLC)
(-)-DI-P-TOLUOYL-L-TARTARIC ACID MONOHYDRATE
CAS:71607-31-3
Formula: C20H18O8 H2O
30434
MW: 404.37
= 99% (HPLC)
(-)-DIBENZOYL-L-TARTARIC ACID
CAS:2743-38-6
Trade Name: (-)-O,O'-Dibenzoyl-L-tartaric acid
Formula: C18H14O8
24464
MW: 358.3
= 99.0% (HPLC)
(-)-DIBENZOYL-L-TARTARIC ACID MONOHYDRATE
CAS:62708-56-9
Trade Name: (-)-2,3-Dibenzoyl-L-tartaric acid monohydrate
Formula: C18H14O8 H2O
21834
MW: 376.32
= 99% (HPLC)
(-)-DIETHYL D-TARTRATE
CAS:13811-71-7
Trade Name: D-(-)-Tartaric Acid Diethyl Ester
Formula: C8H14O6
24597
MW: 206.19
= 99% (GC, Chiral purity)
(-)-DIISOPROPYL D-TARTRATE
CAS:62961-64-2
Trade Name: D-(-)-Tartaric acid diisopropyl ester
Formula: C10H18O6
24542
MW: 234.25
= 99% (GC)
(-)-ETHYL L-LACTATE NATURAL
CAS:687-47-8
Trade Name: (S)-(-)-2-Hydroxypropionic acid ethyl ester
Formula: C5H10O3
27780
MW: 118.13
= 99% (GC)
(-)-FORSKOLIN
CAS:66575-29-9
Formula: C22H34O7
23021
MW: 410.5
= 99% (HPLC)
(-)-O,O'-DI-P-TOLUOYL-L-TARTARIC ACID
CAS:217968-14-4
Trade Name: Di-p-toluyl-L-tartaric acid
Formula: C20H18O8
24596
MW: 386.35
= 99.9% (HPLC)
(-)-PACLITAXEL-2'-HEMISUCCINATE
Formula: C51H55NO17
23120
MW: 953.99
99%
(-)-RIBOFLAVIN
CAS:83-88-5
Trade Name: Vitamin B2
Formula: C17H20N4O6
01463
MW: 376.4
98.0-102.0% (Assay)
(-)-TRI-O-ACETYL-D-GLUCAL
CAS:2873-29-2
Trade Name: 1,2-Dideoxy-3,4,6-tri-O-acetyl-D-arabino-1-hexenopyranose
Formula: C12H16O7
22054
MW: 272.25
= 99% (Assay)
([2-(METHYLAMINO)ETHYL]SULFONYL)BENZENE
CAS:61097-92-5
Trade Name: N-Methyl-2-(phenylsulfonyl)ethan-1-amine
Formula: C9H13NO2S
23459
MW: 199.27
= 96% (HPLC)
([3,5-BIS(TRIFLUOROMETHYL)PHENYL]METHYL)SULFONYL CHLORIDE
Formula: C9H5ClF6O2S
23449
MW: 326.64
= 97% (HPLC)
([4-(TRIFLUOROMETHYL)PHENYL]PHENYLMETHYL)PIPERAZINE DIHYDROCHLORIDE
Formula: C18H19F3N2 2HCl
23836
MW: 393.28
(±)-(1,1'-BINAPHTHALENE-2,2'-DIYL)BIS(DIPHENYLPHOSPHINE)
CAS:98327-87-8
Trade Name: (±)-BINAP
Formula: C44H32P2
16600
MW: 622.67
= 98% (HPLC)
(±)-2-AMINOBUTAN-1-OL 2-CHLOROTRITYL RESIN
04290
MW:
(±)-2-PHENYLBUTYRIC ACID
CAS:90-27-7
Formula: C10H12O2
30847
MW: 164.2
(±)-8A-METHYL-3,4,8,8A-TETRAHYDRO-1,6(2H,7H)-NAPHTHALENEDIONE
CAS:20007-72-1
Trade Name: (±)-9-Methyl-5(10)-octaline-1,6-dione
Formula: C11H14O2
24118
MW: 178.23
= 98.5% (GC)
(±)-ABSCISIC ACID
CAS:14375-45-2
Formula: C15H20O4
01467
MW: 264.3
= 99% (HPLC)
(±)-BOC-ALPHA-PHOSPHONOGLYCINE TRIMETHYL ESTER
CAS:89524-98-1
Trade Name: (±)-Trimethyl-Boc-alpha-phosphonoglycinate
Formula: C10H20NO7P
14126
MW: 297.24
= 98% (TLC)
(±)-EPICHLOROHYDRIN
CAS:106-89-8
Trade Name: 1-Chloro-2,3-epoxypropane
Formula: C3H5ClO
24484
MW: 92.52
= 99.9% (GC)
(±)-GOSSYPOL-ACETIC ACID
CAS:12542-36-8
31186
MW:
(±)-MEVALONOLACTONE
CAS:674-26-0
Trade Name: DL-Mevalonic acid lactone
Formula: C6H10O3
21625
MW: 130.14
= 98% (GC)
(±)-TRANS-1,2-DIAMINOCYCLOHEXANE TRITYL RESIN
04304
MW:
(±)-TRANS-4-(1-NAPHTHYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(1-naphthyl)-OH HCl
Formula: C15H15NO2 HCl
16012
MW: 277.75
= 98% (HPLC)
(±)-TRANS-4-(2,3-DICHLOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2,3-dichlorophenyl)-OH HCl
Formula: C11H12Cl3NO2
16018
MW: 296.58
= 98% (HPLC)
(±)-TRANS-4-(2,3-DIMETHOXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2,3-dimethoxyphenyl)-OH HCl
Formula: C13H17NO4 HCl
16043
MW: 287.74
(±)-TRANS-4-(2,5-DICHLOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1049734-30-6
Trade Name: trans-DL-beta-Pro-4-(2,5-dichlorophenyl)-OH
Formula: C11H12Cl3NO2
16016
MW: 296.58
= 98% (HPLC)
(±)-TRANS-4-(2-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
15994
MW: 306.59
(±)-TRANS-4-(2-CHLOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
15988
MW: 262.14
= 98% (HPLC)
(±)-TRANS-4-(2-CYANOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
16025
MW: 252.7
= 98% (TLC)
(±)-TRANS-4-(2-FLUOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
15983
MW: 245.68
= 98% (HPLC)
(±)-TRANS-4-(2-FURANYL)PYRROLIDINE-3-CARBOXYLIC ACID
Trade Name: trans-DL-beta-Pro-4-(2-furanyl)-OH
Formula: C9H11NO3
16060
MW: 181.19
= 98% (TLC)
(±)-TRANS-4-(2-HYDROXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
16037
MW: 243.69
= 98% (TLC)
(±)-TRANS-4-(2-METHOXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
16031
MW: 257.72
= 98% (NMR)
(±)-TRANS-4-(2-METHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
16000
MW: 241.72
= 98% (HPLC)
(±)-TRANS-4-(2-NAPHTHYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-naphthyl)-OH HCl
Formula: C15H15NO2 HCl
16014
MW: 277.75
= 98% (HPLC)
(±)-TRANS-4-(2-PYRIDINYL)PYRROLIDINE-3-CARBOXYLIC ACID DIHYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-pyridinyl)-OH 2HCl
Formula: C10H12N2O2 2HCl
16049
MW: 265.14
= 98% (HPLC)
(±)-TRANS-4-(2-THIENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(2-thienyl)-OH HCl
Formula: C9H11NO2S HCl
16056
MW: 233.71
= 98% (TLC)
(±)-TRANS-4-(2-TRIFLUOROMETHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1049978-59-7
Trade Name: trans-DL-beta-Pro-4-(2-trifluoromethylphenyl)-OH
Formula: C12H13ClF3NO2
16020
MW: 295.69
= 98% (HPLC)
(±)-TRANS-4-(3-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
15996
MW: 306.59
= 98% (HPLC)
(±)-TRANS-4-(3-CHLOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1284228-59-6
Trade Name: trans-DL-beta-Pro-4-(3-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
15990
MW: 262.14
= 98% (TLC)
(±)-TRANS-4-(3-CYANOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
16027
MW: 252.7
= 98% (HPLC)
(±)-TRANS-4-(3-FLUOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
15985
MW: 245.68
= 98% (TLC)
(±)-TRANS-4-(3-HYDROXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
16039
MW: 243.69
= 98% (HPLC)
(±)-TRANS-4-(3-METHOXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
16033
MW: 257.72
= 98% (HPLC)
(±)-TRANS-4-(3-METHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1049976-06-8
Trade Name: trans-DL-beta-Pro-4-(3-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
16002
MW: 241.72
= 98% (TLC)
(±)-TRANS-4-(3-PYRIDINYL)PYRROLIDINE-3-CARBOXYLIC ACID DIHYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-pyridinyl)-OH 2HCl
Formula: C10H14Cl2N2O2
16050
MW: 265.14
= 99% (HPLC)
(±)-TRANS-4-(3-THIENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-thienyl)-OH HCl
Formula: C9H11NO2S HCl
16058
MW: 233.71
= 98% (HPLC)
(±)-TRANS-4-(3-TRIFLUOROMETHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(3-trifluoromethylphenyl)-OH HCl
Formula: C12H12F3NO2 HCl
16022
MW: 295.69
= 98% (HPLC)
(±)-TRANS-4-(4-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(4-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
15998
MW: 306.59
(±)-TRANS-4-(4-CHLOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1047651-82-0
Trade Name: trans-DL-beta-Pro-4-(4-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
15992
MW: 262.14
= 98% (NMR)
(±)-TRANS-4-(4-CYANOPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(4-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
16029
MW: 252.7
= 98% (HPLC)
(±)-TRANS-4-(4-FLUOROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1330750-50-9
Trade Name: trans-DL-beta-Pro-4-(4-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
15986
MW: 245.68
= 98% (NMR)
(±)-TRANS-4-(4-HYDROXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(4-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
16041
MW: 243.69
= 98% (HPLC)
(±)-TRANS-4-(4-METHOXYPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(4-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
16035
MW: 257.72
= 98% (HPLC)
(±)-TRANS-4-(4-METHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:959577-53-8(net.)
Trade Name: trans-DL-beta-Pro-4-(4-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
16004
MW: 241.72
= 98% (HPLC)
(±)-TRANS-4-(4-NITROPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(4-nitrophenyl)-OH HCl
Formula: C11H12N2O4 HCl
16010
MW: 272.69
(±)-TRANS-4-(4-PYRIDINYL)PYRROLIDINE-3-CARBOXYLIC ACID DIHYDROCHLORIDE
Trade Name: trans-DL-b-Pro-4-(4-pyridinyl)-OH·2HCl
Formula: C10H12N2O2 2HCl
16054
MW: 265.14
= 98% (HPLC)
(±)-TRANS-4-(4-TRIFLUOROMETHYLPHENYL)PYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1049978-66-6
Trade Name: trans-DL-beta-Pro-4-(4-trifluoromethylphenyl)-OH HCl
Formula: C12H13ClF3NO2
16023
MW: 295.69
= 99% (HPLC)
(±)-TRANS-4-(6-METHOXY-3-PYRIDINYL)PYRROLIDINE-3-CARBOXYLIC ACID
CAS:1048330-63-7
Trade Name: trans-DL-beta-Pro-4-(6-methoxy-3-pyridinyl)-OH
Formula: C11H14N2O3
16052
MW: 220.1
= 95% (NMR)
(±)-TRANS-4-ISOPROPYLPYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
Trade Name: trans-DL-beta-Pro-4-(isopropyl)-OH HCl
Formula: C8H15NO2 HCl
16062
MW: 193.67
= 98% (NMR)
(±)-TRANS-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1049755-65-8
Trade Name: trans-DL-beta-Pro-4-(phenyl)-OH HCl
Formula: C11H13NO2 HCl
15981
MW: 227.69
= 98% (NMR)
(±)-Z-ALPHA-PHOSPHONOGLYCINE TRIMETHYL ESTER
CAS:88568-95-0
Trade Name: (±)-Methyl 2-benzyloxycarbonylamino-2-(dimethoxyphosphinyl)acetate
Formula: C13H18NO7P
14125
MW: 331.27
97.0 +%
(1,2,3,4-TETRAHYDRONAPHTHALEN-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:136759-34-7
Formula: C11H15N HCl
19302
MW: 197.75
= 96% (Assay)
(1,2-DIBROMOETHYL)BENZENE
CAS:93-52-7
Trade Name: 1,2-Dibromo-1-phenylethane
Formula: C8H8Br2
26738
MW: 263.96
= 98% (HPLC)
(1,3-BIS(DIPHENYLPHOSPHINO)PROPANE)PALLADIUM(II) CHLORIDE DICHLOROMETHANE ADDUCT
CAS:59831-02-6
Trade Name: Dichloro[1,3-bis(diphenylphosphino)propane]palladium(II) Dichloromethane Adduct
Formula: C27H26P2 PdCl2
28808
MW: 589.78
= 15% (Pd)
(1,3-DIMETHYL-1H-PYRAZOL-4-YL)METHYLAMINE
CAS:400756-28-7
Trade Name: 1-(1,3-dimethyl-1H-pyrazol-4-yl)methanamine
Formula: C6H11N3
17299
MW: 125.17
= 99% (Assay)
(1-(2-FLUOROPHENYL)-3-PHENYL-1H-PYRAZOL-4-YL)METHANOL
CAS:618441-71-7
Formula: C16H13FN2O
25405
MW: 268.29
(1-(4-METHYLPHENYL)-3-(4-(METHYLTHIO)PHENYL)-1H-PYRAZOL-4-YL)METHANOL
CAS:618383-33-8
Formula: C18H18N2OS
25380
MW: 310.42
(1-AMINOCYCLOHEXYL)-ACETIC ACID METHYL ESTER HYDROCHLORIDE
CAS:1016258-17-5
Trade Name: Methyl 2-(1-aminocyclohexyl)acetate hydrochloride
Formula: C9H17NO2 HCl
23824
MW: 207.7
(1-BENZYL-1H-BENZOIMIDAZOL-2-YL)METHYLAMINE
CAS:20028-36-8
Formula: C15H15N3
19303
MW: 237.31
(1-BENZYL-PIPERIDIN-4-YL)-(4-FLUORO-PHENYL)-METHANONE
CAS:144734-31-6
Formula: C19H20FNO
26384
MW: 297.37
(1-BENZYL-PYRROLIDIN-3-YL)METHYLAMINE
CAS:93138-61-5
Trade Name: 1-Benzyl-3-aminomethylpyrrolidine
Formula: C12H18N2
17676
MW: 190.29
(1-BENZYLAZETIDIN-2-YL)METHANAMINE
CAS:46193-94-6
Trade Name: 1-(Phenylmethyl)-2-azetidinemethanamine
Formula: C11H16N2
19304
MW: 176.26
= 97% (GC)
(1-BROMONAPHTHALEN-4-YL)METHANOL
CAS:56052-26-7
Formula: C11H9BrO
18291
MW: 237.1
= 96% (HPLC)
(1-BUTYL)TRIETHYLAMMONIUM BROMIDE
CAS:13028-69-8
Trade Name: Triethyl N-butylammonium bromide
Formula: C10H24NBr
30374
MW: 238.21
= 99% (Assay)
(1-CYANO-2-ETHOXY-2-OXOETHYLIDENAMINOOXY)DIMETHYLAMINO-MORPHOLINO-CARBENIUM HEXAFLUOROPHOSPHATE
CAS:1075198-30-9
Trade Name: COMU
Formula: C12H19N4O4 F6P
26427
MW: 428.27
= 99% (HPLC)
(1-METHYL-1H-[1,2,4]TRIAZOL-5-YL)METHANOL
CAS:91616-36-3
Trade Name: (1-Methyl-1H-[1,2,4]triazol-3-yl)methanol
Formula: C4H7N3O
17820
MW: 113.12
= 99% (NMR)
(1-METHYL-1H-BENZIMIDAZOL-2-YL)METHYLAMINE
CAS:20028-40-4
Trade Name: 2-(Aminomethyl)-1-methyl-1H-benzimidazole
Formula: C9H11N3
17069
MW: 161.21
= 98% (GC)
(1-METHYL-1H-IMIDAZOL-4-YL)METHANOL
CAS:17289-25-7
Formula: C5H8N2O
17817
MW: 112.13
= 95% (NMR)
(1-METHYL-1H-PYRAZOL-4-YL)METHYLAMINE HYDROCHLORIDE
CAS:400877-05-6
Trade Name: 1-(1-Methyl-1H-pyrazol-4-yl)methanamine hydrochloride
Formula: C5H9N3 HCl
17300
MW: 147.65
= 95%
(1-METHYL-5-TRIFLUOROMETHYL-1H-BENZOIMIDAZOL-2-YL)METHYLAMINE
CAS:828241-99-2
Formula: C10H10F3N3
19308
MW: 229.2
= 95% (NMR)
(1-METHYLETHYL)BORONIC ACID
CAS:80041-89-0
Trade Name: Isopropylboronic acid
Formula: C3H9BO2
28500
MW: 87.91
= 99% (GC)
(1-METHYLNAPHTHALEN-4-YL)METHANOL
CAS:57322-44-8
Trade Name: (4-Methylnaphthalen-1-yl)methanol
Formula: C12H12O
18300
MW: 172.23
= 96% (HPLC)
(1-NAPHTHYL)-D-BETA-HOMOALANINE HYDROCHLORIDE
CAS:269398-88-1(net)
Trade Name: D-beta-HomoAla(1-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
15299
MW: 265.74
= 98% (Chiral Purity)
(1-PHENYL-1-TOSYL)METHYL ISOCYANIDE
CAS:36635-66-2
Trade Name: 1-([(Isocyano)(phenyl)methyl]sulphonyl)-4-methylbenzene
Formula: C15H13NO2S
19670
MW: 271.34
= 97% (NMR)
(1-PHENYL-2-PYRROLIDINYLETHYL)METHYLAMINE
CAS:136329-39-0
Formula: C13H20N2
23436
MW: 204.32
(1-PYRENYL)BUTYRL HYDRAZIDE
CAS:55486-13-0
Trade Name: 4-(1-Pyrenyl)butyric hydrazide
Formula: C20H18N2O
23007
MW: 302.37
(1-TRITYL-1H-TETRAZOL-5-YL)METHYLAMINE
CAS:885278-28-4
Formula: C21H19N5
20648
MW: 341.42
(1A,5A,6A)-3-BENZYL-6-NITRO-3-AZABICYCLO[3.1.0]HEXANE
Formula: C12H14N2O2
23918
MW: 218.26
(1H-BENZOIMIDAZOL-2-YL)ACETIC ACID
CAS:13570-08-6
Formula: C9H8N2O2
17130
MW: 176.17
(1H-BENZOIMIDAZOL-2-YLMETHYL)METHYLAMINE
CAS:98997-01-4
Trade Name: (1H-1,3-Benzodiazol-2-ylmethyl)(methyl)amine
Formula: C9H11N3 2HCl
17816
MW: 234.21
= 98% (NMR)
(1H-BENZOIMIDAZOL-5-YL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885270-97-3
Trade Name: 5-Boc-amino-benzoimidazole
Formula: C12H15N3O2
20378
MW: 233.27
= 96%
(1H-IMIDAZOL-2-YL)METHYLAMINE
CAS:53332-80-2
Trade Name: 1H-Imidazole-2-methanamine
Formula: C4H7N3
18174
MW: 97.12
= 96% (HPLC)
(1H-INDOL-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:21109-25-1(net)
Formula: C9H10N2 HCl
20647
MW: 182.65
(1H-INDOL-2-YLMETHYL)AMINE
CAS:21109-25-1
Formula: C9H10N2
17139
MW: 146.19
= 95% (NMR)
(1H-INDOL-5-YL)METHYLAMINE
CAS:81881-74-5
Trade Name: 5-(Aminomethyl)indole
Formula: C9H10N2
17522
MW: 146.19
= 97% (GC)
(1H-INDOL-6-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS:885273-73-4
Trade Name: 6-Boc-amino-1H-indole
Formula: C13H16N2O2
20484
MW: 232.28
(1H-INDOL-7-YL)METHYLAMINE OXALATE
CAS:408356-52-5(net)
Trade Name: 7-(Aminomethyl)indole oxalate
Formula: C9H10N2 C2H2O4
17916
MW: 236.22
= 96% (Assay)
(1R,2R)-(+)-1,2-DIPHENYLETHYLENEDIAMINE
CAS:35132-20-8
Trade Name: (1R,2R)-(+)-1,2-Diamino-1,2-diphenylethane
Formula: C14H16N2
30700
MW: 212.29
= 99.5% (HPLC, Chiral purity)
(1R,2R)-(-)-1,2-DIAMINOCYCLOHEXANE
CAS:20439-47-8
Formula: C6H14N2
23182
MW: 114.2
= 98% (GC)
(1R,2R)-(-)-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL
CAS:716-61-0
Trade Name: D-(-)-threo-2-Amino-1-(p-nitrophenyl)-1,3-propanediol
Formula: C9H12N2O4
30780
MW: 212.2
= 99% (Assay)
(1R,2R)-(-)-N-P-TOSYL-1,2-DIPHENYLETHYLENEDIAMINE
CAS:144222-34-4
Formula: C21H22N2O2S
30716
MW: 366.48
= 99% (Assay, Chiral purity)
(1R,2R)-1,2-DI(4'-METHOXYPHENYL)-1,2-DIAMINOETHANE
CAS:58520-04-0
Formula: C16H20N2O2
23184
MW: 272.3
>97%
(1R,2R)-BOC-1,2-DIAMINOCYCLOHEXANE
CAS:137731-41-0,146504-07-6
Formula: C11H22N2O2
22743
MW: 214.31
= 98% (GC)
(1R,2R)-BOC-1,2-DIAMINOCYCLOPENTANE
CAS:1016971-66-6
Formula: C10H20N2O2
22745
MW: 200.28
= 98% (NMR)
(1R,2R)-BOC-AMINOCYCLOHEXANE CARBOXYLIC ACID
CAS:233661-54-6
Trade Name: (1R,2R)-Boc-Achc
Formula: C12H21NO4
14466
MW: 243.3
= 98% (HPLC)
(1R,2R)-BOC-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:245115-25-7
Trade Name: (1R,2R)-Boc-Acpc
Formula: C11H19NO4
14468
MW: 229.28
= 98% (NMR)
(1R,2S)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPANAMINE HYDROCHLORIDE
CAS:1156491-10-9
31025
MW:
(1R,2S)-2-(3,4-DIFLUOROPHENYL)CYCLOPROPANAMINIUM (2R)-HYDROXY(PHENYL)ETHANOATE
CAS:376608-71-8
31024
MW:
(1S)-(-)-CAMPHANIC CHLORIDE
CAS:39637-74-6
Trade Name: (-)-Camphanoyl chloride
Formula: C10H13ClO3
24609
MW: 216.66
(1S,2R)-BOC-2-AMINOCYCLOHEXANE CARBOXYLIC ACID
CAS:865689-36-7
Trade Name: (1S,2R)-Boc-Achc
Formula: C12H21NO4
29607
MW: 243.3
= 97% (assay)
(1S,2R)-FMOC-AMINOCYCLOHEXANE CARBOXYLIC ACID
CAS:430460-38-1
Trade Name: (1S,2R)-Fmoc-Achc
Formula: C22H23NO4
14467
MW: 365.43
= 97% (HPLC)
(1S,2S)-(+)-1,2-DIAMINOCYCLOHEXANE
CAS:21436-03-3
Formula: C6H14N2
23183
MW: 114.2
= 99% (GC, Chiral purity)
(1S,2S)-(+)-N-P-TOSYL-1,2-DIPHENYLETHYLENEDIAMINE
CAS:167316-27-0
Formula: C21H22N2O2S
30717
MW: 366.48
= 99% (Assay, Chiral purity)
(1S,2S)-(-)-1,2-DIPHENYLETHYLENEDIAMINE
CAS:29841-69-8
Trade Name: (1S,2S)-(-)-1,2-Diamino-1,2-diphenylethane
Formula: C14H16N2
30701
MW: 212.29
= 99.5% (HPLC, Chiral purity)
(1S,2S)-BOC-1,2-DIAMINOCYCLOHEXANE
CAS:180683-64-1
Formula: C11H22N2O2
22744
MW: 214.31
= 97% (TLC)
(1S,2S)-BOC-AMINOCYCLOPENTANE CARBOXYLIC ACID
CAS:143679-80-5
Trade Name: (1S,2S)-Boc-Acpc
Formula: C11H19NO4
14469
MW: 229.28
= 96% (HPLC)
(1S,2S)-TRANS-N-BOC-1,2-CYCLOPENTANEDIAMINE
CAS:586961-34-4
Trade Name: (1S,2S)-Boc-1,2-diaminocyclopentane
Formula: C10H20N2O2
22746
MW: 200.28
= 98% (Chiral Purity)
(1S,4R)-(- )-4-(FMOC-AMINO)-2-CYCLOPENTENE-1-CARBOXYLIC ACID
CAS:220497-64-3
Trade Name: (-)-(1S,4R)-N-Fmoc-4-aminocyclopent-2-ene-1-carboxylic acid
Formula: C21H19NO4
12900
MW: 349.39
= 98% (HPLC)
(2,2')BIPYRIDINYL-3,3'-DICARBOXYLIC ACID DIMETHYL ESTER
CAS:39775-31-0
31829
MW:
(2,2,2-TRIFLUORO-1-PYRIDIN-3-YLETHYL)AMINE·2HCL
Formula: C7H7F3N2 2HCl
17959
MW: 249.06
= 99% (Assay)
(2,3-DICHLOROPHENYL)ETHYLAMINE
CAS:49850-15-9
Trade Name: 2,3-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
18230
MW: 190.07
= 96% (HPLC)
(2,3-DIHYDRO-BENZO[1,4]DIOXIN-6-YL)HYDRAZINE
CAS:299165-45-0
Trade Name: 2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine
Formula: C8H10N2O2
17546
MW: 166.18
= 95% (NMR)
(2,3-DIMETHOXY-5-METHYLPHENYL)BORONIC ACID
CAS:396102-17-3
Formula: C9H13BO4
26704
MW: 196
= 95% (NMR)
(2,4-DICHLOROPHENYL)ETHYLAMINE
CAS:35113-89-4
Trade Name: 2,4-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
18231
MW: 190.07
= 96% (HPLC)
(2,5-DICHLOROPHENYL)ETHYLAMINE
CAS:42265-81-6
Trade Name: 2,5-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
18232
MW: 190.07
= 96% (HPLC)
(2,6-DIMETHOXY-4-METHYLPHENYL)BORONIC ACID
CAS:176528-19-1
Formula: C9H13BO4
26705
MW: 196
= 95% (NMR)
(2-[(4-OXOPIPERIDIN-1-YL)METHYL]PHENYL)BORONIC ACID
CAS:697739-42-7
Formula: C12H16BNO3
17955
MW: 233.07
(2-[BIOTINAMIDO]ETHYLAMIDO)-3,3'-DITHIODIPROPIONIC ACID N-HYDROXYSUCCINIMIDE ESTER
CAS:142439-92-7
Trade Name: NHS-SS-(+)-Biotin
Formula: C19H28N4S3O6
22986
MW: 504.65
99%
(2-AMINO-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHYL)DIMETHYLAMINE DIHYDROCHLORIDE
Formula: C11H15F3N2 2HCl
23688
MW: 305.17
(2-AMINO-1-PHENYLETHYL)DIMETHYLAMINE
CAS:6342-21-8
Trade Name: N-(2-Dimethylamino-2-phenylethyl)amine
Formula: C10H16N2
23394
MW: 164.25
= 98% (NMR)
(2-AMINO-2-PHENYL-ETHYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:167298-44-4
Formula: C13H20N2O2
17547
MW: 236.31
(2-AMINO-2-PHENYLETHYL)DIMETHYLAMINE
CAS:31788-88-2
Trade Name: N2,N2-Dimethyl-1-phenyl-ethane-1,2-diamine
Formula: C10H16N2
23435
MW: 164.25
= 95% (HPLC)
(2-AMINO-3-METHYL-3H-IMIDAZOL-4-YL)METHANOL
CAS:885281-27-6
Formula: C5H9N3O
18237
MW: 127.15
= 98% (HPLC)
(2-AMINO-5-BROMO-3-PYRIDINYL)METHANOL
CAS:335031-01-1
Trade Name: 2-Amino-5-bromo-3-(hydroxymethyl)pyridine
Formula: C6H7BrN2O
17818
MW: 203.04
= 98%
(2-AMINO-5-METHYL-PHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885270-77-9
Formula: C12H18N2O2
19526
MW: 222.29
(2-AMINO-6-METHYL-PHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885270-79-1
Formula: C12H18N2O2
19527
MW: 222.29
(2-AMINO-ETHYL)ETHYL-CARBAMIC ACID TERT-BUTYL ESTER
CAS:105628-63-5
Trade Name: N-Boc-N-ethylethylenediamine
Formula: C9H20N2O2
17548
MW: 188.27
> 96% (HPLC)
(2-AMINOMETHYLBENZYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:439116-13-9
Formula: C13H20N2O2
18239
MW: 236.31
= 90%
(2-AMINOPHENYL)METHYL-CARBAMIC ACID TERT-BUTYL ESTER
CAS:885270-83-7
Formula: C12H18N2O2
19528
MW: 222.29
(2-AMINOPYRIDIN-3-YL)METHANOL
CAS:23612-57-9
Trade Name: 2-Amino-3-(hydroxymethyl)pyridine
Formula: C6H8N2O
17074
MW: 124.14
= 99% (Assay)
(2-AMINOTHIOPHEN-3-YL)(4-BROMOPHENYL)METHANONE
CAS:399043-24-4
Trade Name: 2-Amino-3-(4-bromobenzoyl)thiophene
Formula: C11H8BrNOS
25856
MW: 282.16
= 98% (HPLC)
(2-BENZIMIDAZOLYL)ACETONITRILE
CAS:4414-88-4
Trade Name: 2-(Cyanomethyl)benzimidazole
Formula: C9H7N3
25001
MW: 157.18
(2-BENZOTHIAZOLYLTHIO)ACETIC ACID
CAS:6295-57-4
Trade Name: 2-(1,3-Benzothiazol-2-ylsulfanyl)acetic acid
Formula: C9H7NO2S2
28228
MW: 225.29
= 98% (Titration)
(2-BENZYL-THIAZOL-4-YL)METHYLAMINE
CAS:608515-43-1
Formula: C11H12N2S
19311
MW: 204.3
= 95% (NMR)
(2-BENZYL-THIAZOL-4-YL)METHYLAMINE DIHYDROCHLORIDE
Formula: C11H12N2S 2HCl
20649
MW: 277.22
(2-BROMOTHIAZOL-4-YL)METHANOL
CAS:5198-86-7
Trade Name: 2-Bromo-4-(hydroxymethyl)-1,3-thiazole
Formula: C4H4BrNOS
24018
MW: 194.05
= 95% (NMR)
(2-CHLORO-4-NITROPHENYL)METHANOL
CAS:52301-88-9
Formula: C7H6ClNO3
23983
MW: 187.58
(2-CHLORO-ETHOXY)-CYCLOPROPANE
CAS:17714-18-0
Formula: C5H9ClO
19529
MW: 120.58
= 95% (NMR)
(2-CHLORO-ETHOXYMETHYL)-PHOSPHONIC ACID DIETHYL ESTER
CAS:116384-56-6
Formula: C7H16ClO4P
29358
MW: 230.63
= 98% (GC)
(2-CHLOROPYRIDIN-3-YL)METHYLAMINE
CAS:205744-14-5
Trade Name: 2-Chloro-3-pyridine methylamine
Formula: C6H7ClN2
19530
MW: 142.59
= 98% (HPLC)
(2-CYANOPHENYL)ACETIC ACID ETHYL ESTER
CAS:67237-76-7
Trade Name: Ethyl 2-(2-cyanophenyl)acetate
Formula: C11H11NO2
19531
MW: 189.21
(2-FLUOROPHENYL)OXO-ACETONITRILE
CAS:80277-41-4
Trade Name: 2-Fluorobenzoyl cyanide
Formula: C8H4FNO
18246
MW: 149.12
= 95% (NMR)
(2-FURYL)-L-BETA-HOMOALANINE
CAS:270263-05-3
Trade Name: L-beta-HomoAla(2-furyl)-OH
Formula: C8H11NO3
15402
MW: 169.18
= 98% (TLC)
(2-HYDROXY-4-MORPHOLINOPHENYL)(4-METHOXYPHENYL)METHANONE
Formula: C18H19NO4
23902
MW: 313.35
(2-HYDROXYETHYL)ACETYLENE
CAS:927-74-2
Trade Name: 3-Butyn-1-ol
Formula: C4H6O
24463
MW: 70.09
= 99% (GC)
(2-HYDROXYETHYL)PHENYL-CARBAMIC ACID TERT-BUTYL ESTER
CAS:121492-10-2
Trade Name: tert-Butyl (2-hydroxyethyl)phenylcarbamate
Formula: C13H19NO3
24246
MW: 237.3
(2-HYDROXYETHYL)PROPYL-CARBAMIC ACID TERT-BUTYL ESTER
CAS:152192-96-6
Trade Name: 2-(N-Boc-propylamino)ethanol
Formula: C10H21NO3
18247
MW: 203.28
> 96% (HPLC)
(2-HYDROXYMETHYL-CYCLOHEXYL)CARBAMIC ACID BENZYL ESTER
CAS:213672-68-5
Trade Name: Benzyl trans-(2-hydroxymethyl)cyclohexylcarbamate
Formula: C15H21NO3
24236
MW: 263.34
(2-M-TOLYL-THIAZOL-4-YL)METHYLAMINE
CAS:89152-85-2
Formula: C11H12N2S
19314
MW: 204.3
(2-METHOXY-4-NITROPHENYL)METHANEDIOL DIACETATE
CAS:198821-77-1
Trade Name: (Acetyloxy)(2-methoxy-4-nitrophenyl)methyl acetate
Formula: C12H13NO7
24317
MW: 283.24
(2-METHOXY-ETHYL)-TRIPHENYL-PHOSPHONIUM BROMIDE
CAS:55894-16-1
Formula: C21H22BrOP
28190
MW: 401.28
= 98% (Assay)
(2-METHOXYCARBONYLMETHOXY-5-METHYL-PHENOXY)ACETIC ACID METHYL ESTER
CAS:52589-39-6
Trade Name: 4-Methylcatecholdimethylacetate
Formula: C13H16O6
19532
MW: 268.26
(2-METHYL-IMIDAZO[1,2-A]PYRIDIN-3-YL)METHYLAMINE
CAS:34164-91-5
Formula: C9H11N3
19313
MW: 161.21
= 96% (NMR)
(2-METHYL-QUINOLIN-4-YL)METHANOL
CAS:4939-28-0
Formula: C11H11NO
19533
MW: 173.21
(2-METHYL-THIAZOL-4-YL)METHYLAMINE
CAS:103694-26-4
Trade Name: (2-Methyl-1,3-thiazol-4-yl)methylamine
Formula: C5H8N2S
17362
MW: 128.2
= 95% (NMR)
(2-MORPHOLIN-4-YL-1-PHENYLETHYL)METHYLAMINE
CAS:863204-01-7
Trade Name: N-Methyl-2-(4-morpholinyl)-1-phenylethanamine
Formula: C13H20N2O
23438
MW: 220.31
= 95% (HPLC)
(2-NAPHTHYL)-D-BETA-HOMOALANINE HYDROCHLORIDE
CAS:269398-90-5
Trade Name: D-beta-HomoAla(2-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
15301
MW: 265.74
= 99% (HPLC)
(2-NAPHTHYL)-L-BETA-HOMOALANINE HYDROCHLORIDE
CAS:270063-39-3
Trade Name: L-beta-HomoAla(2-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
15351
MW: 265.74
= 98%
(2-O-TOLYL-THIAZOL-4-YL)METHYLAMINE
CAS:885280-68-2
Formula: C11H12N2S
19315
MW: 204.3
= 95% (NMR)
(2-OXO-1(2H)-PYRIMIDINYL)ACETIC ACID
CAS:95209-83-9
Trade Name: 2-(2-Oxo-1,2-dihydropyrimidin-1-yl)acetic acid
Formula: C6H6N2O3
25013
MW: 154.12
= 98% (HPLC)
(2-OXO-1,3-BENZOXAZOL-3(2H)-YL)ACETALDEHYDE
CAS:13610-81-6
Formula: C9H7NO3
26628
MW: 177.2
= 95% (NMR)
(2-OXO-3-PYRIDIN-4-YL-PROPYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885269-81-8
Trade Name: 1-(Boc-amino)-3-pyridin-4-yl-propan-2-one
Formula: C13H18N2O3
19731
MW: 250.3
= 96% (HPLC)
(2-P-TOLYL-THIAZOL-4-YL)METHYLAMINE
CAS:89152-86-3
Trade Name: (2-(4-Methylphenyl)-1,3-thiazol-4-yl)methylamine
Formula: C11H12N2S
19319
MW: 204.3
(2-PHENYL-OXAZOL-4-YL)METHYLAMINE HYDROCHLORIDE
CAS:33105-95-2
Formula: C10H10N2O HCl
19316
MW: 210.66
= 95% (NMR)
(2-PHENYL-THIAZOL-5-YL)METHYLAMINE
CAS:298705-56-3
Formula: C10H10N2S
19317
MW: 190.27
(2-PYRIDYLMETHYL)SULFONYL CHLORIDE TRIFLATE
CAS:882564-09-2
Trade Name: (Pyridin-2-yl)methylsulfonyl chloride trifluoromethylsulphonic acid salt
Formula: C6H6ClNO2S CHF3O3S
23499
MW: 341.71
(2-THIENYL)-D-BETA-HOMOALANINE HYDROCHLORIDE
CAS:269726-88-7
Trade Name: D-beta-HomoAla(2-thienyl)-OH HCl
Formula: C8H11NO2S HCl
15323
MW: 221.7
= 98% (HPLC)
(2-THIENYL)-L-BETA-HOMOALANINE HYDROCHLORIDE
CAS:270065-91-3
Trade Name: L-beta-HomoAla(2-thienyl)-OH HCl
Formula: C8H11NO2S HCl
15393
MW: 221.7
= 98% (HPLC)
(2H)1,4-BENZOTHIAZIN-3(4H)-ONE
CAS:5325-20-2
Trade Name: 3,4-Dihydro-2H-1,4-benzothiazin-3-one
Formula: C8H7NOS
25858
MW: 165.22
= 99% (HPLC)
(2H-TETRAZOL-5-YL)METHYLAMINE
CAS:31602-63-8
Formula: C2H5N5
19312
MW: 99.1
= 95% (NMR)
(2R)-(-)-GLYCIDYL TOSYLATE
CAS:113826-06-5
Trade Name: (R)-(-)-Oxirane-2-methanol p-toluenesulfonate
Formula: C10H12O4S
16518
MW: 228.26
= 99% (HPLC, Chiral purity)
(2R,3R)-(FMOC-AMINO)-3-(BOC-AMINO)BUTYRIC ACID
CAS:338972-24-0
Trade Name: Fmoc-D-Abu(3R-Boc-Amino)-OH
Formula: C24H28N2O6
30539
MW: 440.5
= 99% (HPLC)
(2R,3R)-(FMOC-AMINO)-3-ALLYLOXY-CARBONYLAMINOBUTYRIC ACID
CAS:1263047-57-9
Trade Name: Fmoc-D-Abu(3R-Alloc-amino)-OH
Formula: C23H24N2O6
30538
MW: 424.4
= 98% (HPLC)
(2R,3R)-(FMOC-AMINO)-3-AZIDOBUTYRIC ACID
CAS:1229394-75-5
Trade Name: Fmoc-D-Abu(3R-N3)-OH
Formula: C19H18N4O4
30535
MW: 366.4
= 98% (HPLC)
(2R,3R)-3-AMINO-2-HYDROXY-3-PHENYL-PROPIONIC ACID
CAS:55325-50-3
Formula: C9H11NO3
16872
MW: 181.19
= 98% (TLC)
(2R,3R)-3-AMINO-2-HYDROXY-4-PHENYLBUTYRIC ACID
CAS:128223-55-2
Formula: C10H13NO3
16851
MW: 195.22
= 95% (HPLC)
(2R,3S)-(FMOC-AMINO)-3-AZIDOBUTYRIC ACID
Trade Name: Fmoc-D-Abu(3S-N3)-OH
Formula: C19H18N4O4
30547
MW: 366.4
= 99% (HPLC)
(2R,4R)-BOC-4-AMINO-1-FMOC-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C25H28N2O6
29663
MW: 452.51
= 99% (HPLC)
(2R,4R)-BOC-4-PHENYL-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:158567-91-0
Trade Name: (2R,4R)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
22760
MW: 291.35
= 99% (HPLC)
(2R,4R)-FMOC-4-AMINO-1-BOC-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:1018332-24-5
Formula: C25H28N2O6
29661
MW: 452.51
= 99% (HPLC)
(2R,4S)-3-TERT-BUTYL 4-METHYL 2-TERT-BUTYLOXAZOLIDINE-3,4-DICARBOXYLATE
CAS:145625-08-7
Formula: C14H25NO5
24401
MW: 287.35
= 95% (NMR)
(2R,4S)-BOC-4-AMINO-1-FMOC-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C25H28N2O6
29664
MW: 452.51
= 99% (HPLC)
(2R,4S)-BOC-4-HYDROXYPIPERIDINE-2-CARBOXYLIC ACID
CAS:917835-93-9,1212688-40-8
Formula: C11H19NO5
22637
MW: 245.28
= 97% (NMR)
(2R,4S)-BOC-4-PHENYL-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:144069-70-5
Trade Name: (2R,4S)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
22761
MW: 291.35
= 97% (HPLC)
(2R,4S)-FMOC-4-AMINO-1-BOC-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:1018332-23-4
Formula: C25H28N2O6
29662
MW: 452.51
= 98% (HPLC)
(2R,4S)-FMOC-4-HYDROXYPIPERIDINE-2-CARBOXYLIC ACID
CAS:917099-02-6
Formula: C21H21NO5
22638
MW: 367.4
= 97% (HPLC)
(2R,5S)-2-TRICHLOROMETHYL-3-OXA-1-AZABICYCLO[3·3·0]OCTAN-4-ONE
CAS:97538-67-5
Trade Name: (3R)-Trichloromethyl-cis-tetrahydropyrrolo[1,2-c]oxazol-1-one
Formula: C7H8Cl3NO2
16581
MW: 244.5
= 97%
(2S)-(+)-GLYCIDYL TOSYLATE
CAS:70987-78-9
Trade Name: (S)-(+)-Oxirane-2-methanol p-toluenesulfonate
Formula: C10H12O4S
16611
MW: 228.26
= 99% (HPLC, Chiral purity)
(2S)-(-)-PROPANOLOL HYDROCHLORIDE
CAS:4199-10-4
Formula: C16H21NO2 HCl
04466
MW: 295.81
= 95% (NMR)
(2S)-1-N-BOC-2-ISOBUTYLPIPERAZINE
CAS:674792-06-4
Trade Name: (S)-2-Isobutyl-piperazine-1-carboxylic acid tert-butyl ester
Formula: C13H26N2O2
26170
MW: 242.36
(2S)-2-AMINO-5-(2-AMINO-5-METHYL-4-OXO-4,5-DIHYDRO-IMIDAZOL-1-YL)PENTANOIC ACID. ACETATE (MIXTURE OF TWO DIASTEREOISOMERS)
Formula: C9H16N4O3 C2H4O2
22730
MW: 228.25
= 97% (HPLC)
(2S)-2-AMINO-5-(5-METHYL-4-OXO-4,5-DIHYDRO-1H-IMIDAZOL-2-YLAMINO)PENTANOIC ACID (MIXTURE OF FOUR ISOMERS)
Formula: C9H16N4O3
22729
MW: 228.25
= 96% (HPLC)
(2S)-BOC-2-AMINO-6-(3,5-DIFORMYL-4-METHYL-4H-PYRIDIN-1-YL)-HEXANOIC ACID TERT-BUTYL ESTER
Formula: C23H36N2O6
22731
MW: 436.55
= 95% (HPLC)
(2S)-METHYLGLYCIDATE
CAS:118712-39-3
Trade Name: Methyl-(S)-oxiranecarboxylate
Formula: C4H6O3
16521
MW: 102.09
= 98% (GC)
(2S, 4R)-FMOC-4-(N'-PBF-GUANIDINO)-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C34H38N4O7S
29714
MW: 646.76
= 98% (HPLC)
(2S, 4S)-FMOC-4-(N'-PBF-GUANIDINO)-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C34H38N4O7S
29715
MW: 646.76
= 98% (HPLC)
(2S, 4S)-N-BOC-4-TRIFLUOROMETHYLPROLINE
CAS:470482-41-8
Trade Name: (2S,4S)-Boc-4-trifluoromethyl-pyrrolidine-2-carboxylic acid
Formula: C11H16F3NO4
29119
MW: 283.24
= 99% (HPLC)
(2S,11AS)-FMOC-2-AMINO-10-CARBOXYMETHYL-1,2,3,11A-TETRAHYDRO-10H-PYRROLO[2,1-C][1,4]-BENZODIAZEPINE-5,11-DIONE
CAS:182624-46-0
Trade Name: Fmoc-PBD
Formula: C29H25N3O6
22680
MW: 511.53
= 99% (HPLC)
(2S,3'S)-2-(4'-BOC-3'-BENZYL-2'-OXO-PIPERAZIN-1-YL)-3-PHENYLPROPIONIC ACID
CAS:193091-13-3
Formula: C25H30N2O5
22683
MW: 438.52
= 99% (HPLC)
(2S,3R)-(FMOC-AMINO)-3-ALLYLOXYCARBONYLAMINOBUTYRIC ACID
Trade Name: Fmoc-L-Abu(3R-Alloc-amino)-OH
Formula: C23H24N2O6
30541
MW: 424.4
= 98% (HPLC)
(2S,3R)-(FMOC-AMINO)-3-AZIDOBUTYRIC ACID
CAS:146306-79-8
Trade Name: Fmoc-L-Abu(3R-N3)-OH
Formula: C19H18N4O4
30542
MW: 366.4
= 99% (HPLC)
(2S,3R)-2-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
CAS:110287-80-4
Formula: C7H13NO2
20049
MW: 143.19
(2S,3R)-3-(BOC-AMINO)-2-HYDROXY-4-(4-NITROPHENYL)BUTYRIC ACID
CAS:112898-24-5
Trade Name: Boc-(2S,3R)-AHNPB-OH
Formula: C15H20N2O7
04056
MW: 340.3
= 99% (TLC)
(2S,3S)-(FMOC-AMINO)-3-(BOC-AMINO)BUTYRIC ACID
CAS:370865-67-1
Trade Name: Fmoc-L-Abu(3S-Boc-Amino)-OH
Formula: C24H28N2O6
30540
MW: 440.5
= 98% (HPLC)
(2S,3S)-(FMOC-AMINO)-3-ALLYLOXYCARBONYL-AMINOBUTYRIC ACID
CAS:1272754-91-2
Trade Name: Fmoc-L-Abu(3S-Alloc-amino)-OH
Formula: C23H24N2O6
30537
MW: 424.4
= 99% (HPLC)
(2S,3S)-(FMOC-AMINO)-3-AZIDOBUTYRIC ACID
CAS:131669-42-6
Trade Name: Fmoc-L-Abu(3S-N3)-OH
Formula: C19H18N4O4
30532
MW: 366.4
= 99% (HPLC)
(2S,3S)-1-FMOC-2-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C22H23NO4
20052
MW: 365.43
(2S,3S)-2-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
CAS:110287-65-5
Formula: C7H13NO2
20053
MW: 143.19
(2S,3S)-3-AMINO-1,1,1-TRIFLUORO-4-METHYL-PENTAN-2-OL HYDROCHLORIDE
Formula: C6H12F3NO HCl
29584
MW: 207.62
= 99% (TLC)
(2S,3S)-3-AMINO-2-HYDROXY-3-PHENYLPROPIONIC ACID
CAS:55325-50-3
Formula: C9H11NO3
16682
MW: 181.19
(2S,3S)-3-AMINO-2-HYDROXY-4-PHENYLBUTYRIC ACID HYDROCHLORIDE SALT
CAS:62023-62-5
Trade Name: (2S,3S)-H-Apns-OH HCl
Formula: C10H13NO3 HCl
07163
MW: 231.68
= 99% (HPLC)
(2S,3S)-3-AMINO-2-HYDROXY-5-METHYLHEXANOIC ACID
CAS:73397-20-3
Formula: C7H15NO3
16732
MW: 161.2
= 99% (TLC)
(2S,3S)-FMOC-APNS-OH
CAS:210754-59-9
Trade Name: Fmoc-(2S,3S)-3-amino-2-hydroxy-4-phenylbutyric acid
Formula: C25H23NO5
03739
MW: 417.46
99%
(2S,3S)-FMOC-MPC(TRT)-OH
Trade Name: (2S,4S)-Fmoc-4-tritylmercapto-pyrrolidine-2-carboxylic acid
Formula: C39H33NO4S
22675
MW: 611.76
= 99% (HPLC)
(2S,3S,5S)-5-AMINO-2-(N-((5-THIAZOLYL)-METHOXYCARBONYL)AMINO)-1,6-DIPHENYL-3-HYDROXYHEXANE
CAS:144164-11-4
Formula: C23H27N3O3S
29011
MW: 425.55
= 98% (HPLC)
(2S,3S,5S)-5-TERT-BUTYLOXYCARBONYLAMINO-2-AMINO-3-HYDROXY-1,6-DIPHENYLHEXANE SUCCINATE
CAS:183388-64-9
Trade Name: [2S,3S,5S]-2-amino-3-hydroxy-5-tert-butyloxycarbonylamino-1,6-diphenylhexane succinate salt
Formula: (C23H32N2O3 C4H6O4
29401
MW: 887.121
(2S,4R)-4-AMINO-1-[BENZYLOXYCARBONYL]PYRROLIDINE-2-METHYLCARBOXYLATE HYDROCHLORIDE
CAS:409325-33-3
Formula: C14H18N2O4 HCl
23787
MW: 314.77
(2S,4R)-4-AZIDO-1-(TERT-BUTOXYCARBONYL)PYRROLIDINE-2-CARBOXYLIC ACID DICYCLOHEXYLAMINE SALT
CAS:132622-68-5(net)
Trade Name: Boc-(2S,4R)-Pro(N3)-OH DCHA
Formula: C22H39N5O4
30474
MW: 437.6
= 98% (HPLC)
(2S,4R)-4-FLUORO-1-FMOC-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:203866-20-0
Trade Name: Fmoc-trans-4-fluoro-L-Pro-OH
Formula: C20H18FNO4
15170
MW: 355.37
= 97% (HPLC, Chiral purity)
(2S,4R)-4-FLUORO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:2507-61-1
Trade Name: trans-4-Fluoro-L-Pro-OH
Formula: C5H8FNO2
11435
MW: 133.12
= 97% (HPLC)
(2S,4R)-Boc- 4-azido-pyrrolidine-2-carboxylic acid·DCHA
CAS:132622-68-5(net)
Trade Name: Boc-trans-Pro(4-azido)-OH DCHA
Formula: C10H16N4O4 C12H23N
29780
MW: 437.58
(2S,4R)-BOC-4-(2-NAPHTHYLMETHOXY)PYRROLIDINE-2-CARBOXYLIC ACID
CAS:630425-40-0
Trade Name: (2S,4R)-Boc-4-(2-naphthylmethoxy)-Pro-OH
Formula: C21H25NO5
22646
MW: 371.43
= 99% (HPLC)
(2S,4R)-BOC-4-(2-NAPHTHYLOXY)PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (2S,4R)-Boc-4-(2-naphthyloxy)-Pro-OH
Formula: C20H23NO5
22647
MW: 357.41
= 97% (HPLC)
(2S,4R)-BOC-4-AMINO-1-FMOC-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:273222-06-3
Formula: C25H28N2O6
29660
MW: 452.51
= 97% (HPLC)
(2S,4R)-BOC-4-CYCLOHEXYL-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:934470-83-4
Formula: C16H27NO4
29609
MW: 297.39
= 99% (HPLC)
(2S,4R)-BOC-4-PHENOXY-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:147267-15-0
Trade Name: (2S,4R)-Boc-4-phenoxy-Pro-OH
Formula: C16H21NO5
22654
MW: 307.35
= 99% (HPLC)
(2S,4R)-BOC-4-PHENYL-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:336818-78-1
Trade Name: (2S,4R)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
22662
MW: 291.35
= 97% (HPLC)
(2S,4R)-FMOC-4-(2-NAPHTHYLMETHYL)PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (2S,4R)-Fmoc-4-(2-naphthylmethyl)-Pro-OH
Formula: C31H27NO4
22649
MW: 477.56
= 98% (HPLC)
(2S,4R)-FMOC-4-(4-BROMOBENZYL)PYRROLIDINE-2-CARBOXYLIC ACID
CAS:959580-40-6
Trade Name: (2S,4R)-Fmoc-4-(4-bromobenzyl)-Pro-OH
Formula: C27H24NO4Br
14482
MW: 506.4
= 98% (HPLC)
(2S,4R)-FMOC-4-(4-FLUOROBENZYL)PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (2S,4R)-Fmoc-4-(4-fluorobenzyl)-Pro-OH
Formula: C27H24NO4F
22658
MW: 445.49
= 97% (HPLC)
(2S,4R)-FMOC-4-(4-PHENYLBENZYL)PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (2S,4R)-Fmoc-4-(4-phenylbenzyl)-Pro-OH
Formula: C33H29NO4
22659
MW: 503.6
= 99% (HPLC)
(2S,4R)-FMOC-4-AMINOMETHYL-1-BOC-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: Boc-L-cis-Pro(4-CH2NH-Fmoc)-OH
Formula: C26H30N2O6
31655
MW: 466.53
= 98% (HPLC)
(2S,4R)-FMOC-4-AZIDO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:702679-55-8
Trade Name: Fmoc-(4R)-azido-L-Proline
Formula: C20H18N4O4
30536
MW: 378.4
= 99% (HPLC)
(2S,4R)-FMOC-4-CYCLOHEXYL-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C26H29NO4
29687
MW: 419.52
= 99% (HPLC)
(2S,4R)-FMOC-4-PHENOXY-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C26H23NO5
29689
MW: 429.47
= 98% (HPLC)
(2S,4R)-FMOC-4-PHENYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (2S,4R)-Fmoc-4-phenyl-Pro-OH
Formula: C26H23NO4
22663
MW: 413.47
= 99% (HPLC)
(2S,4R)-FMOC-MPT(TRT)-OH
Trade Name: (2S,4R)-Fmoc-4-tritylmercapto-pyrrolidine-2-carboxylic acid
Formula: C24H23NO2S
22674
MW: 611.75
= 99% (HPLC)
(2S,4R)-GAMMA-HYDROXY-L-GLUTAMIC ACID
CAS:2485-33-8
Trade Name: (2S,4R)-gamma-Hydroxy-L-Glu-OH
Formula: C5H9NO5
07066
MW: 163.1
= 98% (TLC)
(2S,4S)-4-AMINO-1-[BENZYLOXYCARBONYL]PYRROLIDINE-2-METHYLCARBOXYLATE HYDROCHLORIDE
CAS:1212395-57-7
Formula: C14H18N2O4 HCl
23788
MW: 314.77
(2S,4S)-4-FLUORO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:2438-57-5
Trade Name: cis-4-Fluoro-L-Pro-OH
Formula: C5H8FNO2
11436
MW: 133.12
= 97% (NMR)
(2S,4S)-BOC- 4-AZIDO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:132622-65-2
Trade Name: Boc-cis-Pro(4-azido)-OH
Formula: C10H16N4O4
29778
MW: 256.26
= 99% (HPLC)
(2S,4S)-BOC-4-(2-NAPHTHYLOXY)PYRROLIDINE-2-CARBOXYLIC ACID
CAS:317357-42-9
Trade Name: (2S,4S)-Boc-4-(2-naphthyloxy)-Pro-OH
Formula: C20H23NO5
22648
MW: 357.41
= 98% (HPLC)
(2S,4S)-BOC-4-CYCLOHEXYL-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:394734-77-1
Trade Name: (2S,4S)-Boc-4-cyclohexyl-Pro-OH
Formula: C16H27NO4
14490
MW: 297.39
= 97% (assay)
(2S,4S)-BOC-4-PHENOXY-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:147266-79-3
Trade Name: (2S,4S)-Boc-4-phenoxy-Pro-OH
Formula: C16H21NO5
22655
MW: 307.35
= 99% (HPLC)
(2S,4S)-FMOC-(4-FMOCNH)HOMOPROLINE
CAS:252029-00-8
Trade Name: Fmoc-HoPro(Fmoc)-OH
Formula: C36H32N2O6
07061
MW: 588.66
99%
(2S,4S)-FMOC-4-AMINOMETHYL-1-BOC-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: Boc-L-trans-Pro(4-CH2NH-Fmoc)-OH
Formula: C26H30N2O6
31654
MW: 466.53
= 97% (HPLC)
(2S,4S)-FMOC-4-AZIDO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:263847-08-1
Trade Name: Fmoc-cis-Pro(4-azido)-OH
Formula: C20H18N4O4
29779
MW: 378.39
= 99% (HPLC)
(2S,4S)-FMOC-4-CYCLOHEXYLPYRROLIDINE-2-CARBOXYLIC ACID
CAS:467438-40-0
Trade Name: (2S,4S)-Fmoc-4-cyclohexyl-Pro-OH
Formula: C26H29NO4
14491
MW: 419.52
= 99% (HPLC)
(2S,4S)-FMOC-4-FLUORO-PYRROLIDINE-2-CARBOXYLIC ACID
CAS:203866-19-7
Trade Name: Fmoc-cis-4-fluoro-Pro-OH
Formula: C20H18NO4F
14494
MW: 355.36
= 99% (HPLC)
(2S,4S)-FMOC-4-PHENOXY-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: Fmoc-L-cis-4-phenoxyproline
Formula: C26H23NO5
29688
MW: 429.47
= 98% (HPLC)
(2S,4S)-FMOC-4-TRIFLUOROMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Formula: C21H18F3NO4
29691
MW: 405.37
= 98% (HPLC)
(2S,4S)-GAMMA-HYDROXY-L-GLUTAMIC ACID
CAS:3913-68-6
Trade Name: (2S,4S)-gamma-Hydroxy-L-Glu-OH
Formula: C5H9NO5
07065
MW: 163.1
= 96% (TLC)
(2S,5R)-5-PHENYLPYRROLIDINE-2-CARBOXYLIC ACID
CAS:158567-93-2,203645-40-3
Formula: C11H13NO2
07186
MW: 191.26
98+%
(2S,5S)-BOC-5-METHYLPYRROLIDINE-2-CARBOXYLIC ACID
CAS:334769-80-1
Trade Name: Boc-cis-5-methyl-Pro-OH
Formula: C11H19NO4
29775
MW: 229.28
(2S,5S)-FMOC-5-METHYLPYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: Fmoc-cis-5-methyl-Pro-OH
Formula: C21H21NO4
29776
MW: 351.4
(3,3-DIMETHOXYCYCLOBUTYL)METHANOL
CAS:175021-11-1
Formula: C7H14O3
29315
MW: 146.19
(3,4-DICHLOROPHENYL)-METHANESULFONYL CHLORIDE
CAS:85952-30-3
Trade Name: [(3,4-Dichlorophenyl)methyl]sulfonyl chloride
Formula: C7H5Cl3O2S
23389
MW: 259.54
= 95% (HPLC)
(3,4-DICHLOROPHENYL)ETHYLAMINE
CAS:17847-40-4
Trade Name: 3,4-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
18259
MW: 190.07
= 96% (HPLC)
(3,5-DICHLOROPHENYL)ETHYLAMINE
CAS:42266-02-4
Trade Name: 3,5-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
18260
MW: 190.07
= 96% (HPLC)
(3,5-DICHLOROPHENYL)METHANESULFONYL CHLORIDE
CAS:163295-70-3
Trade Name: 3,5-Dichloro-alpha-toluenesulfonyl chloride
Formula: C7H5Cl3O2S
23388
MW: 259.54
= 95% (NMR)
(3,5-DIMETHYL-[1,2,4]TRIAZOL-1-YL)ACETIC ACID
CAS:684249-99-8
Formula: C6H9N3O2
17551
MW: 155.16
(3,5-DIMETHYL-1H-PYRAZOL-4-YLMETHYL)METHYLAMINE DIHYDROCHLORIDE
CAS:919347-92-5(net)
Formula: C7H13N3 2HCl
18261
MW: 211.06
= 98%
(3,5-DIMETHYL-ISOXAZOL-4-YL)ACETIC ACID
CAS:2510-27-2
Trade Name: 2-(3,5-Dimethyl-1,2-oxazol-4-yl)acetic acid
Formula: C7H9NO3
17132
MW: 155.15
= 99% (HPLC)
(3,5-DIMETHYLPYRAZOL-1-YL)ACETIC ACID
CAS:16034-49-4
Formula: C7H10N2O2
17013
MW: 154.17
= 95% (NMR)
(3,5-DIPHENYLPHENYL)BORONIC ACID
CAS:128388-54-5
31071
MW:
(3-(4-BROMOPHENYL)-1-(3-CHLOROPHENYL)-1H-PYRAZOL-4-YL)METHANOL
CAS:618441-69-3
Formula: C16H12BrClN2O
25403
MW: 363.64
(3-(4-CHLOROPHENYL)-1-PHENYL-1H-PYRAZOL-4-YL)METHANOL
CAS:36640-39-8
Formula: C16H13ClN2O
25342
MW: 284.75
= 99% (HPLC)
(3-(4-FLUOROPHENYL)-1-PHENYL-1H-PYRAZOL-4-YL)METHANOL
CAS:36640-54-7
Formula: C16H13FN2O
25332
MW: 268.29
= 98% (HPLC)
(3-[3,5-BIS(TRIFLUOROMETHYL)PHENOXY]PHENYL)SULFONYL CHLORIDE
Formula: C14H7ClF6O3S
23488
MW: 404.71
(3-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PHENYL)SULFONYLCHLORIDE
Trade Name: 3-[3,5-Bis(trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C14H7ClF6O2S
23359
MW: 388.71
(3-[4-(TRIFLUOROMETHYL)PHENOXY]PHENYL)SULFONYL CHLORIDE
Formula: C13H8ClF3O3S
23487
MW: 336.72
(3-[4-(TRIFLUOROMETHYL)PHENYL]PHENYL)SULFONYLCHLORIDE
CAS:731779-91-2
Formula: C13H8ClF3O2S
23358
MW: 320.72
= 95% (Assay)
(3-AMINO-1-METHYL-PROPYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:176982-57-3
Trade Name: 3-Boc-aminobutylamine
Formula: C9H20N2O2
18875
MW: 188.27
= 98% (NMR)
(3-AMINO-2-METHYL-PHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:179898-27-2
Trade Name: tert-Butyl 3-amino-2-methylphenylcarbamate
Formula: C12H18N2O2
19539
MW: 222.29
(3-AMINO-4-CHLOROPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885270-73-5
Formula: C11H15ClN2O2
19541
MW: 242.7
(3-AMINO-4-FLUOROPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:361548-95-0
Trade Name: tert-Butyl 3-amino-4-fluorophenylcarbamate
Formula: C11H15FN2O2
19542
MW: 226.25
(3-AMINO-4-TERT-BUTYLPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:873055-92-6
Formula: C15H24N2O2
29396
MW: 264.37
(3-AMINO-PYRROLIDIN-1-YL)ACETIC ACID
CAS:885277-64-5
Formula: C6H12N2O2
18264
MW: 144.17
(3-AMINOMETHYL) BENZOIC ACID HYDROCHLORIDE
CAS:876-03-9
Trade Name: 3-Amb-OH HCl
Formula: C8H9NO2 HCl
07165
MW: 187.64
99%
(3-AMINOPYRIDIN-4-YL)METHANOL
CAS:152398-05-5
Trade Name: 3-Amino-4-hydroxymethylpyridine
Formula: C6H8N2O
17398
MW: 124.14
= 95% (NMR)
(3-BENZOTHIENYL)-D-BETA-HOMOALANINE HYDROCHLORIDE
CAS:269398-95-0
Trade Name: D-beta-HomoAla(3-benzothienyl)-OH HCl
Formula: C12H13NO2S HCl
15306
MW: 271.76
= 98% (HPLC)
(3-BENZYLOXYPHENYL)ACETIC ACID
CAS:1860-58-8
Formula: C15H14O3
28634
MW: 242.27
= 99% (HPLC)
(3-BENZYLOXYPHENYL)HYDRAZINE HYDROCHLORIDE
CAS:56468-67-8
Trade Name: N'-(3-Benzyloxyphenyl)-hydrazinium chloride
Formula: C13H14N2O HCl
17552
MW: 250.73
= 98% (HPLC)
(3-BOC-AMINOAZETIDIN-1-YL)-(1H-INDOL-2-YL)ACETIC ACID
CAS:885276-02-8
Formula: C18H23N3O4
19546
MW: 345.4
(3-BOC-AMINOAZETIDIN-1-YL)PYRIDIN-3-YL-ACETIC ACID
CAS:885275-93-4
Formula: C15H21N3O4
19547
MW: 307.35
(3-BOC-AMINOAZETIDIN-1-YL)PYRIDIN-4-YL-ACETIC ACID
CAS:885275-96-7
Formula: C15H21N3O4
19548
MW: 307.35
(3-BOC-AMINOPIPERIDIN-1-YL)NAPHTHALEN-2-YL-ACETIC ACID
CAS:885276-52-8
Formula: C22H28N2O4
19551
MW: 384.47
(3-BROMO-PYRIDIN-4-YL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:257937-08-9
Trade Name: tert-Butyl 3-bromopyridin-4-ylcarbamate
Formula: C10H13BrN2O2
18978
MW: 273.13
= 95% (HPLC)
(3-BROMOPHENYL)OXO-ACETONITRILE
CAS:24999-51-7
Trade Name: 3-Bromobenzoyl cyanide
Formula: C8H4BrNO
18270
MW: 210.03
= 95% (NMR)
(3-CHLORO-PYRIDIN-2-YL)METHYLAMINE DIHYDROCHLORIDE
CAS:500305-98-6
Formula: C6H7ClN2 2HCl
19564
MW: 215.51
= 99% (Assay)
(3-CHLOROMETHYL-PHENYL)ACETIC ACID
CAS:857165-45-8
Formula: C9H9ClO2
17553
MW: 184.62
= 96% (Assay)
(3-CHLOROPHENYL)OXO-ACETONITRILE
CAS:26152-02-3
Trade Name: 3-Chlorobenzoyl cyanide
Formula: C8H4ClNO
17824
MW: 165.58
= 96% (HPLC)
(3-CHLOROPYRIDIN-4-YL)PHENYL METHANOL
Formula: C12H10ClNO
23963
MW: 219.67
(3-ETHYL-3H-IMIDAZOL-4-YL)METHANOL
CAS:215872-62-1
Trade Name: (1-Ethyl-1H-imidazol-5-yl)methanol
Formula: C6H10N2O
18272
MW: 126.16
= 95% (NMR)
(3-FORMYL-1-INDOLYL)ACETIC ACID
CAS:138423-98-0
Trade Name: 1-(Carboxymethyl)indole-3-carboxaldehyde
Formula: C11H9NO3
14121
MW: 203.19
= 97% (HPLC)
(3-FORMYL-1H-INDOL-1-YL)ACETONITRILE
CAS:328973-78-0
Formula: C11H8N2O
24197
MW: 184.2
= 99% (HPLC)
(3-GLYCIDYLOXYPROPYL)TRIETHOXYSILANE
CAS:2602-34-8
Trade Name: 3-(2,3-Epoxypropyloxy)propyltriethoxysilane
Formula: C12H26O5Si
28491
MW: 278.42
= 98% (GC)
(3-HYDROXY-CYCLOHEXYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:610302-03-9
Trade Name: tert-Butyl 3-hydroxycyclohexyl carbamate
Formula: C11H21NO3
17826
MW: 215.29
= 98% (NMR)
(3-HYDROXY-PYRROLIDIN-1-YL)ACETIC ACID
CAS:258530-57-3
Formula: C6H11NO3
19565
MW: 145.16
= 97% (HPLC)
(3-HYDROXYMETHYL-1H-INDOL-4-YL)-CARBAMIC ACID TERT-BUTYL ESTER
Trade Name: tert-Butyl 3-(hydroxymethyl)-1H-indol-4-ylcarbamate
Formula: C14H18N2O3
24344
MW: 262.31
(3-HYDROXYPHENYL)ACETIC ACID ETHYL ESTER
CAS:22446-38-4
Trade Name: Ethyl 3-hydroxyphenylacetate
Formula: C10H12O3
29024
MW: 180.2
= 99% (GC)
(3-IODO-PYRIDIN-4-YL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:211029-67-3
Trade Name: 4-(Boc-amino)-3-iodopyridine
Formula: C10H13IN2O2
17372
MW: 320.13
= 95% (HPLC)
(3-MERCAPTOPROPYL)TRIMETHOXYSILANE
CAS:4420-74-0
Trade Name: 3-(Trimethoxysilyl)-1-propanethiol
Formula: C6H16O3SSi
26923
MW: 196.34
= 98.5% (TIPT)
(3-METHOXYPHENYL)OXO-ACETONITRILE
CAS:23194-66-3
Trade Name: 3-Methoxybenzoyl cyanide
Formula: C9H7NO2
18274
MW: 161.16
= 96% (HPLC)
(3-METHOXYPHENYL)PIPERAZIN-1-YL-METHANONE
CAS:100939-89-7
Trade Name: 1-(3-Methoxybenzoyl)piperazine
Formula: C12H16N2O2
17827
MW: 220.27
= 95% (NMR)
(3-METHYL-2-NITRO-3H-IMIDAZOL-4-YL)METHANOL
CAS:39070-14-9
Formula: C5H7N3O3
18276
MW: 157.13
= 95% (NMR)
(3-METHYL-ISOXAZOL-5-YL)METHYLAMINE HYDROCHLORIDE
CAS:154016-55-4
Formula: C5H8N2O HCl
19321
MW: 148.59
= 98% (NMR)
(3-METHYL-PYRAZOL-1-YL)ACETIC ACID
CAS:180741-30-4
Formula: C6H8N2O2
17224
MW: 140.14
(3-O-TOLYL-ISOXAZOL-5-YL)METHYLAMINE
CAS:543713-37-7
Formula: C11H12N2O
19322
MW: 188.23
(3-PHENOXYPHENYL)HYDRAZINE HYDROCHLORIDE
CAS:109221-90-1
Trade Name: N'-(3-Phenoxyphenyl)hydrazinium chloride
Formula: C12H12N2O HCl
18279
MW: 236.7
= 95% (HPLC)
(3-PHENYL-1H-PYRAZOL-4-YL)METHYLAMINE
CAS:936940-58-8
Trade Name: 1-(3-Phenyl-1H-pyrazol-4-yl)methanamine
Formula: C10H11N3
18176
MW: 173.22
= 95% (NMR)
(3-PHENYL-5-ISOXAZOLYL)METHANAMINE
CAS:54408-35-4
Trade Name: 5-(Aminomethyl)-3-phenylisoxazole
Formula: C10H10N2O
17685
MW: 174.2
= 99%
(3-PHENYLPROPYL)METHYLAMINE
CAS:23580-89-4
Trade Name: Methyl-(3-phenyl-propyl)amine
Formula: C10H15N
23460
MW: 149.24
= 95%
(3-PYRIDYL)-D-BETA-HOMOALANINE DIHYDROCHLORIDE
CAS:269396-64-7
Trade Name: (3-Pyridyl)-D-beta-homoalanine dihydrochloride
Formula: C9H12N2O2 2HCl
15278
MW: 253.13
= 98% (HPLC)
(3-PYRIDYL)-THIOPHEN-2-YL-METHANOL
CAS:21314-77-2
Trade Name: Pyridin-3-yl(2-thienyl)methanol
Formula: C10H9NOS
23309
MW: 191.25
(3-PYRIDYLMETHYL)SULFONYL CHLORIDE TRIFLATE
CAS:928140-28-7
Formula: C6H6ClNO2S CHF3O3S
23500
MW: 341.71
= 95% (NMR)
(3-THIENYL)-D-BETA-HOMOALANINE HYDROCHLORIDE
CAS:269726-91-2
Trade Name: D-beta-HomoAla(3-thienyl)-OH HCl
Formula: C8H11NO2S HCl
15328
MW: 221.7
= 99%
(3-THIENYL)-L-BETA-HOMOALANINE
CAS:270262-99-2
Trade Name: L-beta-HomoAla(3-thienyl)-OH
Formula: C8H12ClNO2S
15396
MW: 221.7
= 98% (TLC)
(3-TRANS-CHLOROALLYL)OXYAMINE HYDROCHLORIDE
CAS:96992-71-1
Formula: C3H6ClNO HCl
29100
MW: 144
(3-TRIFLUOROMETHYL-PYRIDIN-2-YL) METHANOL HYDROCHLORIDE
Formula: C7H6F3NO HCl
23840
MW: 213.59
= 98.0% (HPLC)
(3-TRIFLUOROMETHYL-PYRIDIN-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:1187932-68-8(net)
Formula: C7H7F3N2 HCl
23749
MW: 212.6
= 90% (NMR)
(3R)-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID
CAS:103733-65-9
Trade Name: D-Tic-OH
Formula: C10H11NO2
02598
MW: 177.2
= 99% (Assay)
(3R)-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID TERT-BUTYL ESTER HYDROCHLORIDE
CAS:103733-29-5
Trade Name: D-Tic-OtBu HCl
Formula: C14H19NO2 HCl
07091
MW: 269.7
= 98% (HPLC)
(3R)-1,2,3,4-TETRAHYDROISOQUINOLINE-7-HYDROXY-3-CARBOXYLIC ACID
CAS:152286-30-1
Trade Name: D-Tic(OH)-OH
Formula: C10H11NO3
05010
MW: 193.2
= 98% (HPLC)
(3R,5S)-ETHYL 4-ACETAMIDO-5-AMINO-3-(PENTAN-3-YLOXY)CYCLOHEX-1-ENECARBOXYLATE PHOSPHATE
CAS:204255-11-8
Formula: C16H28N2O4 H3O4P
29451
MW: 410.4
(3S)-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID
CAS:74163-81-8
Trade Name: Tic-OH
Formula: C10H11NO2
02597
MW: 177.2
= 98% (HPLC)
(3S)-1,2,3,4-TETRAHYDROISOQUINOLINE-7-HYDROXY-3-CARBOXYLIC ACID DIHYDRATE
CAS:128502-56-7
Trade Name: Tic(OH)-OH·2 H2O
Formula: C10H11NO3 2H2O
03687
MW: 229.2
= 99% (HPLC)
(3S)-4-BOC-1-CARBOXYMETHYL-3-BENZYL-PIPERAZIN-2-ONE
CAS:215121-89-4
Formula: C18H24N2O5
22684
MW: 348.4
= 95% (HPLC)
(3S)-4-BOC-1-CARBOXYMETHYL-3-ISOBUTYL-PIPERAZIN-2-ONE
CAS:959584-21-5
Formula: C15H26N2O5
22686
MW: 314.38
= 98% (HPLC)
(3S)-4-BOC-1-CARBOXYMETHYL-3-METHYL-PIPERAZIN-2-ONE
CAS:959571-65-4
Trade Name: (S)-4-Carboxymethyl-2-methyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester
Formula: C12H20N2O5
22688
MW: 272.3
= 97% (HPLC)
(3S)-4-FMOC-1-CARBOXYMETHYL-3-BENZYL-PIPERAZIN-2-ONE
Formula: C28H26N2O5
22685
MW: 470.52
= 99% (HPLC)
(3S)-4-FMOC-1-CARBOXYMETHYL-3-ISOBUTYL-PIPERAZIN-2-ONE
Formula: C25H28N2O5
22687
MW: 436.51
= 97% (HPLC)
(3S)-4-FMOC-1-CARBOXYMETHYL-3-METHYL-PIPERAZIN-2-ONE
Formula: C22H22N2O5
22689
MW: 394.43
= 97% (HPLC)
(3S)-TRICHLOROMETHYL-CIS-TETRAHYDROPYRROLO[1,2-C]OXAZOL-1-ONE
CAS:1330286-50-4
Formula: C7H8Cl3NO2
16617
MW: 244.5
= 97% (NMR)
(3S,4S)-4-AMINO-3-HYDROXY-5-PHENYLPENTANOIC ACID
CAS:72155-50-1
Trade Name: AHPPA-OH
Formula: C11H15NO3
04451
MW: 209.3
= 97%
(4'-(PENTYLOXY)-[1,1'-BIPHENYL]-4-YL)BORONIC ACID
CAS:158937-25-8
31442
MW:
(4'-FLUORO-BIPHENYL-4-YL)ACETIC ACID
CAS:6908-38-9
Trade Name: 2-[4-(4-fluorophenyl)phenyl]acetic acid
Formula: C14H11FO2
23360
MW: 230.24
= 95% (HPLC)
(4-(1-BENZYLPIPERIDIN-4-YLOXY)-2-CHLOROPHENYL)METHANAMINE DIHYDROCHLORIDE
Formula: C19H23ClN2O 2HCl
23842
MW: 403.78
(4-(2-PYRIDYLOXY)PHENYL)SULFONYL CHLORIDE HYDROCHLORIDE
CAS:1170110-04-9
Trade Name: 4-(2-Pyridyloxy)benzenesulfonyl chloride hydrochloride
Formula: C11H8ClNO3S HCl
23450
MW: 306.17
= 95% (NMR)
(4-(4-METHYLPHENYL)PYRROLIDIN-3-YL)CARBAMIC ACID TERT-BUTYL ESTER
Trade Name: trans-DL-(4-(4-Methylphenyl)pyrrolidin-3-yl)carbamic acid tert-butyl ester
Formula: C16H24N2O2
23534
MW: 276.38
(4-(4-PYRIDYLOXY)PHENYL)SULFONYLCHLORIDE HYDROCHLORIDE
CAS:192330-49-7
Trade Name: 4-(4-Pyridyloxy)benzenesulfonyl chloride hydrochloride
Formula: C11H8ClNO3S HCl
23366
MW: 306.17
(4-[2-(TRIFLUOROMETHYL)PHENOXY]PHENYL)SULFONYLCHLORIDE
CAS:885950-91-4
Formula: C13H8ClF3O3S
23348
MW: 336.72
(4-[3,5-BIS(TRIFLUOROMETHYL)PHENOXY]PHENYL)METHYLAMINE
CAS:771572-16-8
Formula: C15H11F6NO
23429
MW: 335.25
(4-[3,5-BIS(TRIFLUOROMETHYL)PHENOXY]PHENYL)SULFONYLCHLORIDE
CAS:885950-90-3
Formula: C14H7ClF6O3S
23344
MW: 404.71
(4-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PHENYL)METHYLAMINE HYDROCHLORIDE
CAS:1195901-45-1
Formula: C15H11F6N HCl
23473
MW: 355.71
(4-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PHENYL)SULFONYLCHLORIDE
Trade Name: 4-[3,5-Bis(trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C14H7ClF6O2S
23385
MW: 388.71
(4-[4-(TRIFLUOROMETHYL)PHENOXY]PHENYL)SULFONYLCHLORIDE
CAS:214353-91-0
Formula: C13H8ClF3O3S
23343
MW: 336.72
= 99% (HPLC)
(4-[4-(TRIFLUOROMETHYL)PHENYL]PHENYL)METHYLAMINE HYDROCHLORIDE
CAS:412950-48-2
Formula: C14H12F3N HCl
23472
MW: 287.71
= 95% (NMR)
(4-[4-(TRIFLUOROMETHYL)PHENYL]PHENYL)SULFONYLCHLORIDE
CAS:524046-23-9
Trade Name: 4-[4-(Trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C13H8ClF3O2S
23384
MW: 320.72
= 99% (GC)
(4-AMINO-2-METHYL-PHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:325953-40-0
Trade Name: tert-Butyl 4-amino-2-methylphenylcarbamate
Formula: C12H18N2O2
19571
MW: 222.29
(4-AMINO-3-METHYL-PHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:325953-41-1
Trade Name: tert-Butyl 4-amino-3-methylphenylcarbamate
Formula: C12H18N2O2
19572
MW: 222.29
(4-AMINOMETHYL-PHENYL)METHANOL HYDROCHLORIDE
CAS:34403-46-8
Trade Name: 4-(Aminomethyl)benzyl alcohol hydrochloride
Formula: C8H11NO HCl
17557
MW: 173.64
= 95% (NMR)
(4-AMINOPHENYL)BORONIC ACID PINACOL ESTER
CAS:214360-73-3
Formula: C12H18BNO2
28627
MW: 219.09
= 99% (GC)
(4-AZIDOPHENYL)ACETIC ACID
CAS:62893-37-2
Trade Name: N3-PhAc-OH
Formula: C8H7N3O2
30518
MW: 177.2
= 98% (HPLC)
(4-BENZYL-MORPHOLIN-2-YLMETHYL)DIETHYLAMINE
CAS:147465-50-7
Trade Name: N-[(4-Benzylmorpholin-2-yl)methyl]-N-ethylethanamine
Formula: C16H26N2O
18285
MW: 262.39
= 96% (HPLC)
(4-BENZYL-MORPHOLIN-2-YLMETHYL)DIMETHYLAMINE
CAS:122894-38-6
Trade Name: (4-Benzylmorpholin-2-yl)-N,N-dimethylmethanamine
Formula: C14H22N2O
18286
MW: 234.34
= 96% (HPLC)
(4-BENZYL-MORPHOLIN-2-YLMETHYL)ETHYLAMINE
CAS:868770-14-3
Trade Name: N-((4-Benzylmorpholin-2-yl)methyl)ethanamine
Formula: C14H22N2O
18287
MW: 234.34
= 96% (HPLC)
(4-BENZYL-MORPHOLIN-2-YLMETHYL)METHYLAMINE
CAS:126645-75-8
Trade Name: (4-Benzylmorpholin-2-yl)-N-methyl methanamine
Formula: C13H20N2O
18288
MW: 220.31
= 96% (HPLC)
(4-BENZYL-MORPHOLIN-3-YL)METHYLAMINE
CAS:169750-73-6
Formula: C12H18N2O
19323
MW: 206.29
= 95% (NMR)
(4-BOC-AMINO-TETRAHYDROPYRAN-4-YL)ACETIC ACID
CAS:946682-30-0
Formula: C12H21NO5
22707
MW: 259.3
= 97% (HPLC)
(4-BOC-AMINO-TETRAHYDROTHIOPYRAN-4-YL)ACETIC ACID
CAS:946761-08-6
Formula: C12H21NO4S
22709
MW: 275.36
= 99% (HPLC)
(4-BOC-AMINOPIPERIDIN-1-YL)PYRIDIN-3-YL-ACETIC ACID
CAS:885276-22-2
Formula: C17H25N3O4
19578
MW: 335.4
(4-BROMO-2-NITROPHENYL)ACETIC ACID
CAS:6127-11-3
Trade Name: 2-(4-Bromo-2-nitrophenyl)acetic acid
Formula: C8H6BrNO4
17831
MW: 260.04
= 98% (HPLC)
(4-BROMO-3-METHYLPHENYL)HYDRAZINE
CAS:112626-91-2
Formula: C7H9BrN2
17832
MW: 201.07
= 95% (NMR)
(4-BROMOBUTYL)CYCLOHEXANE
CAS:60439-16-9
Formula: C10H19Br
18290
MW: 219.16
= 95% (NMR)
(4-CARBAMIMIDOYL-PHENYL)ACETIC ACID
CAS:39244-83-2
Formula: C9H10N2O2
19582
MW: 178.19
= 96%
(4-CHLOROPHENYL)ACETALDEHYDE
CAS:4251-65-4
Trade Name: 2-(4-Chlorophenyl)acetaldehyde
Formula: C8H7ClO
17835
MW: 154.6
= 95% (NMR)
(4-CHLOROPHENYL)OXO-ACETONITRILE
CAS:13014-48-7
Trade Name: 4-Chlorobenzoyl cyanide
Formula: C8H4ClNO
18293
MW: 165.58
= 99% (GC)
(4-CHLOROPHENYL)PHENYLMETHYLAMINE
CAS:28022-43-7
Trade Name: 4-Chlorobenzhydrylamine
Formula: C13H12ClN
26090
MW: 217.7
= 97% (HPLC)
(4-ETHOXYPHENYL)(OXO)ACETALDEHYDE HYDRATE
CAS:1189873-72-0
Formula: C10H10O3 H2O
26670
MW: 196.2
= 99% (HPLC)
(4-ETHOXYPHENYL)OXO-ACETONITRILE
CAS:62869-42-5
Trade Name: 2-(4-Ethoxyphenyl)-2-oxoacetonitrile
Formula: C10H9NO2
18294
MW: 175.19
= 96% (HPLC)
(4-FLUORO-3-NITROBENZYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:885280-67-1
Trade Name: tert-Butyl 4-fluoro-3-nitrobenzylcarbamate
Formula: C12H15FN2O4
18295
MW: 270.26
= 97% (assay)
(4-FLUOROPHENYL)-[2-(3-METHOXYPHENYL)ETHYL]AMINE
CAS:295318-86-4
Formula: C15H16FNO
19587
MW: 245.3
(4-FLUOROPHENYL)ACETALDEHYDE
CAS:1736-67-0
Trade Name: 2-(4-fluorophenyl)acetaldehyde
Formula: C8H7FO
17837
MW: 138.14
= 95% (GC)
(4-FLUOROPHENYL)METHANESULFONYL CHLORIDE
CAS:103360-04-9
Trade Name: (4-Fluorobenzyl)sulfonyl chloride
Formula: C7H6ClFO2S
23390
MW: 208.64
= 95% (NMR)
(4-FLUOROPHENYL)OXO-ACETONITRILE
CAS:658-13-9
Trade Name: 4-Fluorobenzoyl cyanide
Formula: C8H4FNO
18296
MW: 149.12
> 96% (HPLC)
(4-FMOC-AMINO-1-BOC-PIPERIDIN-4-YL)ACETIC ACID
CAS:946682-26-4
Formula: C27H32N2O6
14449
MW: 480.56
= 98% (HPLC)
(4-FMOC-AMINO-TETRAHYDROPYRAN-4-YL)ACETIC ACID
CAS:946716-25-2
Formula: C22H23NO5
22710
MW: 381.43
= 97% (HPLC)
(4-FMOC-AMINO-TETRAHYDROTHIOPYRAN-4-YL)ACETIC ACID
CAS:946727-62-4
Formula: C22H23NO4S
22708
MW: 397.49
= 99% (HPLC)
(4-FORMYL-1H-[1,2,3]-TRIAZOL-1-YL)METHYL PIVALATE
Formula: C9H13N3O3
14409
MW: 211.22
= 99% (HPLC)
(4-IODOPYRIDIN-3-YL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:154048-89-2
Trade Name: N-tert-Butoxycarbonyl-3-amino-4-iodo-pyridine
Formula: C10H13IN2O2
17558
MW: 320.13
= 95% (HPLC)
(4-METHOXY-1-NAPHTHYL)BORONIC ACID
CAS:219834-95-4
Formula: C11H11BO3
26707
MW: 202
= 95% (NMR)
(4-METHYL-1,3-THIAZOL-2-YL)METHANOL
CAS:13750-63-5
Formula: C5H7NOS
26246
MW: 129.18
= 95% (GC)
(4-METHYL-2-PYRIDYL)METHYLAMINE HYDROCHLORIDE
CAS:1257535-59-3
Trade Name: 2-(Aminomethyl)-4-methylpyridine hydrochloride
Formula: C7H10N2 HCl
26193
MW: 158.63
= 95% (HPLC)
(4-METHYL-THIAZOL-2-YL)ACETIC ACID ETHYL ESTER
CAS:51221-43-3
Trade Name: Ethyl (4-methyl-1,3-thiazol-2-yl)acetate
Formula: C8H11NO2S
17839
MW: 185.25
= 99% (HPLC)
(4-METHYLPHENYLSULFONYLAMINO)ACETIC ACID
CAS:1080-44-0
Trade Name: Tos-Gly-OH
Formula: C9H11NO4S
16453
MW: 229.26
= 98% (HPLC)
(4-NITRO-1H-INDOL-3-YL)METHANOL
Formula: C9H8N2O3
24334
MW: 192.17
(4-PHENYL-MORPHOLIN-2-YL)METHYLAMINE
CAS:112913-99-2
Formula: C11H16N2O
19325
MW: 192.26
= 99% (HPLC)
(4-PHENYL-THIAZOL-2-YL)-ACETONITRILE
CAS:41381-89-9
Trade Name: 2-Cyanomethyl-4-phenylthiazole
Formula: C11H8N2S
25665
MW: 200.26
= 98% (HPLC)
(4-PHENYL-THIAZOL-2-YL)HYDRAZINE HYDROCHLORIDE
CAS:17574-10-6
Trade Name: 2-Hydrazino-4-phenyl-1,3-thiazole hydrochloride
Formula: C9H9N3S HCl
17841
MW: 227.72
= 97% (HPLC)
(4-PHENYL-THIAZOL-2-YL)METHYLAMINE
CAS:90916-45-3
Trade Name: (4-phenyl-1,3-thiazol-2-yl)methanamine
Formula: C10H10N2S
17713
MW: 190.27
= 94% (HPLC)
(4-PHENYLBUTYL)METHYLAMINE HYDROCHLORIDE
Trade Name: Methyl-(4-phenylbutyl)-amine hydrochloride
Formula: C11H17N HCl
23811
MW: 199.72
= 95% (NMR)
(4-PHENYLPYRROLIDIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS:351360-61-7
Trade Name: trans-DL-(4-Phenylpyrrolidin-3-yl)carbamic acid tert-butyl ester
Formula: C15H22N2O2
23533
MW: 262.35
= 98% (HPLC)
(4-PIPERIDIN-4-YL-PHENYL)METHANOL HYDROCHLORIDE
CAS:885274-59-9(net)
Formula: C12H17NO HCl
19591
MW: 227.73
= 96% (Assay)
(4-PYRIDIN-2-YL-PHENYL)ACETIC ACID
CAS:51061-67-7
Trade Name: 4-(2'-Pyridyl)phenylacetic acid
Formula: C13H11NO2
18302
MW: 213.24
= 96% (HPLC)
(4-PYRIDIN-4-YL-PHENYL)ACETIC ACID
CAS:55397-08-5
Trade Name: 4-(4'-Pyridyl)phenylacetic acid
Formula: C13H11NO2
18303
MW: 213.24
= 97% (HPLC)
(4-PYRIDYL)-D-BETA-HOMOALANINE DIHYDROCHLORIDE
CAS:269396-67-0
Trade Name: D-beta-HomoAla(4-pyridyl)-OH 2HCl
Formula: C9H14Cl2N2O2
15281
MW: 253.13
= 98% (HPLC)
(4-PYRIDYLMETHYL)SULFONYL CHLORIDE TRIFLATE
CAS:130820-89-2
Formula: C6H6ClNO2S CHF3O3S
23490
MW: 341.71
= 90% (NMR)
(4-TERT-BUTOXYCARBONYLAMINO-INDOL-1-YL)ACETIC ACID
Trade Name: [4-[(tert-Butoxycarbonyl)amino]-1H-indol-1-yl]acetic acid
Formula: C15H18N2O4
24322
MW: 290.32
(4-TERT-BUTYL-PHENYL)PIPERIDIN-4-YL-METHANONE HYDROCHLORIDE
CAS:42060-78-6
Formula: C16H23NO HCl
19592
MW: 281.83
(4-TRIFLUOROMETHYL-PYRIDIN-2-YL)METHYLAMINE HYDROCHLORIDE
Formula: C7H7F3N2 HCl
23748
MW: 212.6
= 99%
(4-TRIFLUOROMETHYL-PYRIDIN-3-YL)METHYLAMINE HYDROCHLORIDE
CAS:1185138-23-1
Formula: C7H7F3N2 HCl
23750
MW: 212.6
= 98% (HPLC)
(4R)-FMOC-2,2-DIMETHYL-1,3-THIAZOLIDINE-4-CARBOXYLIC ACID
CAS:873842-06-9
Trade Name: Fmoc-L-Thz(Me2)-OH
Formula: C21H21NO4S
30523
MW: 383.5
= 99% (HPLC)
(4R,5R)-FMOC-4-AMINO-5-TERT-BUTOXY-HEXANOIC ACID
Formula: C25H31NO5
14461
MW: 425.52
= 98% (HPLC)
(4R,5S)-BOC-4-AMINO-5-METHYL-HEPTANOIC ACID
CAS:331763-49-6
Trade Name: N-tert-Butoxycarbonyl-gamma-L-isoleucine
Formula: C13H25NO4
14456
MW: 259.35
= 98% (Assay)
(4R,5S)-FMOC-4-AMINO-5-METHYL-HEPTANOIC ACID
CAS:331763-50-9
Trade Name: N-(9-Fluorenylmethoxycarbonyl)-gamma-L-isoleucine
Formula: C23H27NO4
14457
MW: 381.47
= 99% (HPLC)
(4S)-3-[5-(4-FLUOROPHENYL)-1,5-DIOXOPENYL]-4-PHENYL-2-OXAZOLIDINONE
CAS:189028-93-1
Formula: C20H18FNO4
29432
MW: 355.36
= 98% (Assay)
(4S)-3-FMOC-2,2-DIMETHYL-1,3-THIAZOLIDINE-4-CARBOXYLIC ACID
Trade Name: Fmoc-2,2-dimethyl-D-thiaproline
Formula: C21H21NO4S
30522
MW: 383.5
= 99% (HPLC)
(4S)-AZIDO-L-PROLINE HYDROCHLORIDE
CAS:892128-58-4
Trade Name: H-L-Pro(4S-N3)-OH HCl
Formula: C5H9ClN4O2
30465
MW: 192.6
= 99% (HPLC)
(5-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-3-ISOXAZOLYL)METHANOL
CAS:763109-37-1
Formula: C12H11NO4
25518
MW: 233.22
= 99% (HPLC)
(5-(4-CHLOROPHENYL)-3-ISOXAZOLYL)METHANOL
CAS:81282-13-5
Formula: C10H8ClNO2
25513
MW: 209.63
= 98% (HPLC)
(5-(4-METHOXYPHENYL)-3-ISOXAZOLYL)METHANOL
CAS:58492-77-6
Formula: C11H11NO3
25516
MW: 205.21
= 98% (HPLC)
(5-(4-METHYLPHENYL)-3-ISOXAZOLYL)METHANOL
CAS:640291-93-6
Formula: C11H11NO2
25512
MW: 189.21
= 98% (HPLC)
(5-(TRIFLUOROMETHYL)PYRIDIN-2-YL)METHANAMINE HYDROCHLORIDE
Formula: C7H7F3N2 HCl
26378
MW: 212.6
= 95% (HPLC)
(5-AMINO-2-CHLOROPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:879614-93-4
Formula: C11H15ClN2O2
19594
MW: 242.7
(5-AMINO-2-FLUOROPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:535170-18-4
Trade Name: tert-Butyl 5-amino-2-fluorophenylcarbamate
Formula: C11H15FN2O2
19595
MW: 226.25
(5-AMINO-2-METHOXYPHENYL)CARBAMIC ACID TERT-BUTYL ESTER
CAS:312300-45-1
Trade Name: tert-Butyl 5-amino-2-methoxyphenylcarbamate
Formula: C12H18N2O3
19596
MW: 238.29
(5-AMINOPYRIDIN-2-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS:220731-04-4
Trade Name: tert-Butyl 5-aminopyridin-2-ylcarbamate
Formula: C10H15N3O2
26371
MW: 209.25
= 95% (HPLC)
(5-BENZYLOXYINDOL-3-YL)ACETONITRILE
CAS:2436-15-9
Trade Name: 5-Benzyloxyindole-3-acetonitrile
Formula: C17H14N2O
21743
MW: 262.31
= 97% (HPLC)
(5-BROMO-2-[(2,2-DIMETHYLPROPOXY)CARBONYL]PHENYL)BORONIC ACID
Trade Name: 2,2-Dimethylpropyl-4'-bromobenzoate-2'-boronic acid
Formula: C12H16BBrO4
23331
MW: 314.97
(5-BROMO-2-HYDROXY-PHENYL)-(1-PHENYL-1H-PYRAZOL-4-YL)KETONE
CAS:68287-72-9
Formula: C16H11BrN2O2
28595
MW: 343.18
=98.5%
(5-CHLORO-1H-BENZOIMIDAZOL-2-YL)ACETIC ACID
CAS:53350-32-6
Formula: C9H7ClN2O2
17403
MW: 210.62
= 98%
(5-CHLORO-2-[(2,2-DIMETHYLPROPOXY)CARBONYL]PHENYL)BORONIC ACID
Trade Name: 2,2-Dimethylpropyl-4'-chlorobenzoate-2'-boronic acid
Formula: C12H16BClO4
23333
MW: 270.52
(5-CHLORO-2-METHOXYPYRIDIN-3-YL)BORONIC ACID
CAS:943153-22-8
Trade Name: 5-CHLORO-2-METHOXY-PYRIDINE-3-BORONIC ACID
Formula: C6H7BClNO3
18105
MW: 187.39
= 99% (HPLC)
(5-CHLORO-2-METHYL-1H-INDOL-3-YL)ACETIC ACID
CAS:19017-52-8
Trade Name: 5-Chloro-2-methylindole-3-acetic acid
Formula: C11H10ClNO2
21166
MW: 223.66
(5-CHLORO-2-PYRROLIDIN-1-YLPHENYL)AMINE
CAS:59504-29-9
Formula: C10H13ClN2
29927
MW: 196.68
= 99% (HPLC)
(5-FLUORO-1H-INDAZOL-3-YL)ACETIC ACID
CAS:885271-22-7
Formula: C9H7FN2O2
18308
MW: 194.16
= 96% (HPLC)
(5-FLUORO-1H-INDAZOL-3-YL)ACETIC ACID ETHYL ESTER
Formula: C11H11FN2O2
18309
MW: 222.22
= 95% (NMR)
(5-METHOXY-2-NITROPHENYL)ACETIC ACID
CAS:20876-29-3
Formula: C9H9NO5
19599
MW: 211.17
(5-METHYL-[1,3,4]OXADIAZOL-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:612511-96-3
Formula: C4H7N3O HCl
18178
MW: 249.58
= 95% (NMR)
(5-METHYL-1-P-TOLYL-1H-PYRAZOL-4-YL)METHANOL
Formula: C12H14N2O
24925
MW: 202.26
(5-METHYL-2H-[1,2,4]TRIAZOL-3-YL)ACETIC ACID
CAS:720706-28-5
Formula: C5H7N3O2
18312
MW: 141.13
= 97%
(5-METHYLPYRAZOL-1-YL)ACETIC ACID
CAS:180741-44-0
Trade Name: (5-Methyl-1H-pyrazol-1-yl)acetic acid
Formula: C6H8N2O2
17312
MW: 140.14
= 96% (NMR)
(5-PHENYL-[1,3,4]OXADIAZOL-2-YL)METHYLAMINE
CAS:46182-58-5
Trade Name: 1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine
Formula: C9H9N3O
17503
MW: 175.19
= 97%
(5-PHENYL-1H-IMIDAZOL-2-YL)METHYLAMINE
CAS:175531-38-1
Formula: C10H11N3
19330
MW: 173.22
(5-PHENYL-3-ISOXAZOLYL)METHANOL
CAS:1619-37-0
Trade Name: 5-Phenyl-3-isoxazolemethanol
Formula: C10H9NO2
25511
MW: 175.19
= 98% (HPLC)
(5-PHENYLISOXAZOL-3-YL)METHYLAMINE HYDROCHLORIDE
CAS:154016-47-4,1187928-65-9
Formula: C10H10N2O HCl
17779
MW: 210.66
= 99% (HPLC)
(5-TRIFLUOROMETHYL-PYRIDIN-2-YL)METHANOL
CAS:31181-84-7
Formula: C7H6F3NO
23747
MW: 177.12
= 92% (HPLC)
(5-TRIFLUOROMETHYL-PYRIDIN-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:871826-12-9
Formula: C7H7F3N2 HCl
23778
MW: 212.6
(6-(1H-PYRAZOL-1-YL)PYRIDIN-3-YL)METHANOL
CAS:748796-38-5
Trade Name: (6-Pyrazol-1-yl-pyridin-3-yl)methanol
Formula: C9H9N3O
18316
MW: 175.19
= 96% (Assay)
(6-BROMO-2-METHYL-QUINOLIN-4-YL)METHANOL
CAS:885279-63-0
Formula: C11H10BrNO
19605
MW: 252.11
= 96% (Assay)
(6-BROMO-PYRIDIN-3-YL)METHYLAMINE
CAS:120740-10-5
Formula: C6H7BrN2
19332
MW: 187.04
(6-BROMOPYRIDIN-3-YL)METHANOL
CAS:122306-01-8
Trade Name: (2-Bromopyridin-5-yl)methanol
Formula: C6H6BrNO
17561
MW: 188.02
= 98% (HPLC)
(6-BROMOPYRIDINE-2YL)METHANOL
CAS:33674-96-3
Trade Name: 6-Bromo-2-(hydroxymethyl)pyridine
Formula: C6H6BrNO
24708
MW: 188.02
= 98% (HPLC)
(6-BROMOQUINOLIN-2-YL)AMINE
CAS:791626-58-9
Trade Name: 2-Amino-6-bromoquinoline
Formula: C9H7BrN2
17756
MW: 223.07
= 97% (HPLC)
(6-CHLORO-IMIDAZO[1,2-A]PYRIDIN-2-YL)ACETIC ACID
CAS:59128-13-1
Formula: C9H7ClN2O2
17844
MW: 210.62
= 99%
(6-METHOXY-1,2,3,4-TETRAHYDRONAPHTHALEN-2-YL)ACETIC ACID
CAS:57351-00-5
Formula: C13H16O3
19612
MW: 220.27
= 95% (NMR)
(6-METHOXY-2-OXO-2,3-DIHYDRO-1H-INDOL-3-YL)ACETIC ACID
CAS:885272-28-6
Formula: C11H11NO4
17845
MW: 221.21
= 95% (NMR)
(6-METHOXYBENZOTHIAZOL-2-YL)HYDRAZINE
CAS:20174-70-3
Trade Name: 2-Hydrazino-6-methoxy-1,3-benzothiazole
Formula: C8H9N3OS
25936
MW: 195.25
= 99% (HPLC)
(6-METHYL-1H-BENZOIMIDAZOL-2-YL)METHANOL
CAS:20034-02-0
Formula: C9H10N2O
17846
MW: 162.19
= 95% (NMR)
(6-METHYL-2-P-TOLYL-IMIDAZO[1,2-A]PYRIDIN-3-YL)ACETONITRILE
CAS:768398-03-4
Trade Name: 6-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetonitrile
Formula: C17H15N3
19618
MW: 261.33
(6-METHYL-5-QUINOLINYL)BORONIC ACID
CAS:1287753-42-7
Formula: C10H10BNO2
26700
MW: 187
= 95% (NMR)
(6-METHYL-PYRIDIN-2-YL)-CARBAMIC ACID TERT-BUTYL ESTER
CAS:205676-84-2
Trade Name: 2-(Boc-amino)-6-picoline
Formula: C11H16N2O2
26226
MW: 208.26
= 95% (HPLC)
(6-TERT-BUTOXYMETHOXYCARBONYLMETHYL-PIPERAZIN-2-YL)ACETIC ACID TRITYL ESTER
CAS:885275-35-4
Formula: C32H38N2O5
19619
MW: 530.66
(6-TRIFLUOROMETHYL-PYRIDIN-2-YL)METHYLAMINE HYDROCHLORIDE
CAS:916304-19-3
Formula: C7H7F3N2 HCl
23742
MW: 212.6
= 97% (HPLC)
(7-AZABENZOTRIAZOL-1-YLOXY)TRIS(DIMETHYLAMINO)PHOSPHONIUM HEXAFLUOROPHOSPHATE
CAS:156311-85-2
Trade Name: Tris(dimethylamino)(3H-1,2,3-triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate
Formula: C11H21F6N7OP2
31197
MW: 443.27
= 98%(HPLC)
(7-METHOXYCOUMARIN-4-YL)ACETIC ACID
CAS:62935-72-2
Trade Name: Mca-OH
Formula: C12H10O5
05285
MW: 234.21
= 95% (NMR)
(7-Methyl-imidazo[1,2-a]pyridin-2-yl)acetic acid Hydrochloride
CAS:59128-09-5(net)
Formula: C10H10N2O2 HCl
18317
MW: 226.66
= 96% (NMR)
(7AR)-7A-METHYL-2,3,7,7A-TETRAHYDRO-1H-INDENE-1,5(6H)-DIONE
CAS:17553-89-8
Formula: C10H12O2
24374
MW: 164.2
(8-METHOXYQUINOLIN-5-YL)BORONIC ACID
CAS:1025735-47-0
Formula: C10H10BNO3
26708
MW: 203
= 95% (NMR)
(AC-L-CYS-OH)2 (DISULFIDE BOND)
CAS:5545-17-5
Trade Name: N,N'-Diacetyl-L-cystine
Formula: C10H16N2O6S2
04347
MW: 324.38
= 99.5% (GC, Chiral purity)
(ACETYLACETONATO)DICARBONYLRHODIUM(I)
CAS:14874-82-9
Trade Name: Dicarbonylacetylacetonato rhodium(I)
Formula: Rh(CO)2(C5H7O2)
27231
MW: 258.04
=99.5%, (40% Rhodium content min)
(AZETIDIN-2-YL)METHANAMINE DIHYDROCHLORIDE
CAS:103550-76-1
Trade Name: 2-(Aminomethyl)azetidine dihydrochloride
Formula: C4H12Cl2N2
19363
MW: 159.06
= 97% (HPLC)
(BENZOTRIAZOL-1-YLOXY)TRIPYRROLIDINOPHOSPHONIUM HEXAFLUOROPHOSPHATE
CAS:128625-52-5
Trade Name: BOPP
Formula: C18H28N6OP F6P
02276
MW: 520.34
= 99% (HPLC)
(BOC-4-AMINO)PIPERIDINE HYDROCHLORIDE
CAS:179110-74-8
Formula: C10H23N2O2Cl3
22697
MW: 309.66
(BOC-4-AMINOMETHYL)PIPERIDINE HYDROCHLORIDE
CAS:1049727-98-1,135632-53-0
Trade Name: Piperidin-4-ylmethyl-carbamic acid tert-butyl ester hydrochloride
Formula: C11H24N2O2Cl2
22696
MW: 287.23
= 99% (TLC)
(BOC-LYS9)-NEUROTENSIN (9-13)-METHYL ESTER HYDROCHLORIDE SALT
CAS:89545-20-0
Trade Name: Boc-Lys-Pro-Tyr-Ile-Leu-OMe HCl
Formula: C38H62N6O9 HCl
10224
MW: 783.44
= 97% (HPLC)
(BROMODIFLUOROMETHYL)TRIMETHYLSILANE
CAS:115262-01-6
Trade Name: Bromodifluoro(trimethylsilyl)methane
Formula: C4H9BrF2S
31472
MW: 203.1
= 98%
(BROMOMETHYL)CYCLOPROPANE
CAS:7051-34-5
Trade Name: Cyclopropylmethyl bromide
Formula: C4H7Br
07249
MW: 135
= 97% (GC)
(CHLOROMETHYLENE)?DIMETHYLIMINIUM CHLORIDE
CAS:3724-43-4
Formula: C3H7ClNCl
30327
MW: 128
=95%
(CIS-2-((1H-IMIDAZOL-1-YL)METHYL)-2-(2,4-DICHLOROPHENYL)-1,3-DIOXOLAN-4-YL)METHYL 4-METHYLBENZENESUL
CAS:134071-44-6
Formula: C21H20Cl2N2O5S
30873
MW: 483.37
(DIACETOXYIODO)BENZENE
CAS:3240-34-4
Trade Name: Iodosobenzene I,I-diacetate
Formula: C10H11IO4
24541
MW: 322.09
= 99% (HPLC)
(DIETHOXYMETHYL)DIPHENYLPHOSPHINE OXIDE
CAS:20570-20-1
Formula: C17H21O3P
23301
MW: 304.32
= 95% (HPLC)
(DIFLUOROMETHYL)TRIMETHYLSILANE
CAS:65864-64-4
Formula: C4H10F2Si
31481
MW: 124.21
= 98%
(E)-2-(2-BENZYLIDENEHYDRAZINYL)BENZOIC ACID
Formula: C14H12N2O2
23497
MW: 240.26
(E)-2-(4-FLUOROBENZYLIDENEAMINO)PROPANE-1,3-DIOL
Formula: C10H12FNO2
23849
MW: 197.21
(E)-2-(4-METHOXYBENZYLIDENEAMINO)-1-PHENYLETHANOL
Formula: C16H17NO2
23299
MW: 255.32
(E)-2-(BENZYLIDENEAMINO)-1-PHENYLETHANOL
Formula: C15H15NO
23305
MW: 225.29
(E)-2-MORPHOLINO-4-PHENYLBUT-3-ENOIC ACID
Formula: C14H17NO3
23969
MW: 247.29
(E)-3-(2,3-DICHLORO-4-(4-FLUOROPHENYLTHIO)PHENYL)ACRYLIC ACID
Formula: C15H9Cl2FO2S
23986
MW: 343.2
(E)-3-(3-CYANO-4-(4-FLUOROPHENYLTHIO)PHENYL)ACRYLIC ACID
Formula: C16H10FNO2S
23869
MW: 299.32
(E)-3-(4-(2-METHOXYPHENYLTHIO)PHENYL)ACRYLIC ACID
Formula: C16H14O3S
23870
MW: 286.35
(E)-3-(DIMETHYLAMINO)-1-(PYRIDIN-4-YL)PROP-2-EN-1-ONE
CAS:66521-53-7
Trade Name: 3-(Dimethylamino)-1-(4-pyridinyl)-2-propen-1-one
Formula: C10H12N2O
23257
MW: 176.22
= 99% (HPLC)
(E)-5-(2-BROMOVINYL)-2'-DEOXYURIDINE
CAS:69304-47-8
Trade Name: Brivudine
Formula: C11H13BrN2O5
27735
MW: 333.14
= 99% (Assay)
(E)-ETHYL 3-CYANO-4-((DIMETHYLAMINO) METHYLENEAMINO)PHENYLCARBAMATE
Formula: C13H16N4O2
24106
MW: 260.3
(E)-METHYL 3-(2-CHLOROPHENYL)ACRYLATE
Formula: C10H9ClO2
23862
MW: 196.63
(ETHYL CYANO(HYDROXYIMINO)ACETATO)-TRI-(1-PYRROLIDINYL)-PHOSPHONIUM · F6P
CAS:153433-21-7
Trade Name: PYOXIM
Formula: C17H29N5O3P F6P
26429
MW: 527.38
= 99% (HPLC)
(FMOC-4-AMINOMETHYL)PIPERIDINE HYDROCHLORIDE
Formula: C21H24N2O2 HCl
15085
MW: 372.89
= 99% (HPLC)
(METHANESULFONYL-PHENETHYL-AMINO)-ACETIC ACID
CAS:35839-52-2
Trade Name: 2-(N-Phenethylmethylsulfonamido)acetic acid
Formula: C11H15NO4S
23762
MW: 257.31
(METHOXYCARBONYLSULFAMOYL)TRIETHYLAMMONIUM HYDROXIDE, INNER SALT
CAS:29684-56-8
31550
MW:
(METHYLPYRAZIN-2-YL)METHYL AMINE
CAS:120739-79-9
Trade Name: N-Methyl-1-(2-pyrazinyl)methanamine
Formula: C6H9N3
17803
MW: 123.16
= 95% (NMR)
(PEO)3-BIS-AMINE  
CAS:929-59-9
Trade Name: 1,2-Bis(2-aminoethoxy)ethane
Formula: C6H16N2O2
23035
MW: 148.21
= 99% (GC)
(PEO)3-MONO-AMINE
CAS:6338-55-2
Trade Name: 2-[2-(2-aminoethoxy)ethoxy]ethanol
Formula: C6H15NO3
23017
MW: 149.19
= 99% (GC)
(PEO)4-AMINOPROPIONIC ACID
CAS:663921-15-1
Trade Name: Tetraethylene glycol alpha-amino-omega-propionic acid
Formula: C11H23NO6
23126
MW: 265.3
= 98% (HPLC)
(PEO)4-BIS-AMINE
CAS:929-75-9
Formula: C8H20N2O3
23036
MW: 192.25
= 99% (HPLC)
(PEO)4-MONO-AMINE
CAS:86770-74-3
Formula: C8H19NO4
23125
MW: 193.24
= 95% (NMR)
(PIPERIDIN-4-YLOXY)ACETIC ACID
CAS:146117-93-3
Formula: C7H13NO3
19623
MW: 159.18
(PIPERIDIN-4-YLOXY)ACETIC ACID METHYL ESTER HYDROCHLORIDE
CAS:146117-95-5
Formula: C8H15NO3 HCl
19624
MW: 209.67
= 96% (Assay)
(R)-(+)-1,1'-BI-2-NAPHTHOL
CAS:18531-94-7
Trade Name: (+)-2,2'-Dihydroxy-1,1'-binaphthyl
Formula: C20H14O2
16532
MW: 286.32
= 99.5% (HPLC, Chiral purity)
(R)-(+)-1,1'-BINAPHTHYL-2,2'-DIAMINE
CAS:18741-85-0
Trade Name: (R)-(+)-1,1'-Bi(2-naphthylamine)
Formula: C20H16N2
24622
MW: 284.36
= 99% (HPLC)
(R)-(+)-1-(1-NAPHTHYL)ETHYLAMINE
CAS:3886-70-2
Trade Name: (R)-(+)-alpha-Methyl-1-naphthalenemethylamine
Formula: C12H13N
24587
MW: 171.24
= 99% (HPLC, Chiral purity)
(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHALENE
CAS:76189-55-4
Trade Name: (R)-(+)-BINAP
Formula: C44H32P2
16566
MW: 622.67
= 98% (HPLC, Chiral purity)
(R)-(+)-2-METHYL-2-PROPANESULFINAMIDE
CAS:196929-78-9
Trade Name: (R)-(+)-tert-Butyl sulfinamide
Formula: C11H11NO2
29747
MW: 121.2
= 99% (HPLC, Chiral purity)
(R)-(+)-3-HYDROXYPIPERIDINE HYDROCHLORIDE
CAS:198976-43-1
Formula: C5H11NO HCl
29212
MW: 137.61
= 99% (HPLC, Chiral purity)
(R)-(+)-4-BENZYL-2-OXAZOLIDINONE
CAS:102029-44-7
Trade Name: (4R)-4-Benzyl-1,3-Oxazolidin-2-one
Formula: C10H11NO2
16513
MW: 177.2
= 99.5% (HPLC, Chiral purity)
(R)-(+)-4-ISOPROPYL-2-OXAZOLIDINONE
CAS:95530-58-8
Trade Name: (4R)-4-Isopropyl-1,3-oxazolidin-2-one
Formula: C6H11NO2
16579
MW: 129.16
= 99% (HPLC)
(R)-(+)-ALPHA-METHYLBENZYLAMINE
CAS:3886-69-9
Trade Name: (R)-(+)-1-Phenylethylamine
Formula: C8H11N
24594
MW: 121.18
= 98% (GC, Chiral purity)
(R)-(+)-DIPHENYL-2-PYRROLIDINEMETHANOL
CAS:22348-32-9
Trade Name: (R)-(+)-2-(Diphenylhydroxymethyl)pyrrolidine
Formula: C17H19NO
16549
MW: 253.34
(R)-(+)-GLYCIDOL
CAS:57044-25-4
Trade Name: (R)-(+)-Oxirane-2-Methanol
Formula: C3H6O2
29803
MW: 74.08
= 99% (GC)
(R)-(+)-INDOLINE-2-CARBOXYLIC ACID
CAS:98167-06-7
Trade Name: (R)-(+)-2,3-Dihydroindole-2-carboxylic acid
Formula: C9H9NO2
16595
MW: 163.17
= 98% (HPLC)
(R)-(+)-TETRAHYDRO-2-FUROIC ACID
CAS:87392-05-0
Formula: C5H8O3
30720
MW: 116.12
= 99% (GC, Chiral purity)
(R)-(-)-1,1'-BINAPHTHYL-2,2'-DIYL HYDROGEN PHOSPHATE
CAS:39648-67-4
Trade Name: (R)-4-Hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-oxide
Formula: C20H13O4P
16556
MW: 348.29
= 99% (HPLC)
(R)-(-)-1-BENZYL-3-HYDROXYPIPERIDINE
CAS:91599-81-4
Trade Name: (R)-1-Benzyl-3-piperidinol
Formula: C12H17NO
28314
MW: 191.27
= 99% (GC, Chiral purity)
(R)-(-)-1-PHENYL-1,2-ETHANEDIOL
CAS:16355-00-3
Trade Name: (-)-Styrene glycol
Formula: C8H10O2
24591
MW: 138.17
(R)-(-)-2,2-DIMETHYL-1,3-DIOXOLANE-4-METHANOL
CAS:14347-78-5
Trade Name: L-2,3-O-isopropylidene-sn-glycerol
Formula: C6H12O3
02304
MW: 132.2
= 99% (GC, Chiral purity)
(R)-(-)-2-(METHOXYMETHYL)PYRROLIDINE
CAS:84025-81-0
Trade Name: O-Methyl-D-Prolinol
Formula: C6H13NO
12146
MW: 115.16
= 99.5% (GC, Chiral purity)
(R)-(-)-2-CHLORO MANDELIC ACID
CAS:52950-18-2
Formula: C8H7ClO3
31723
MW: 186.59
(R)-(-)-2-METHOXY-1-PHENYLETHYLAMINE
CAS:64715-85-1
Trade Name: (R)-a-(Methoxymethyl)benzylamine
Formula: C9H13NO
16561
MW: 151.21
= 98% (HPLC)
(R)-(-)-2-METHYLPIPERAZINE
CAS:75336-86-6
Formula: C5H12N2
30719
MW: 100.16
= 99% (GC)
(R)-(-)-2-OCTANOL
CAS:5978-70-1
Trade Name: (R)-(-)-Hexylmethylcarbinol
Formula: C8H18O
24592
MW: 130.23
= 99% (Assay)
(R)-(-)-2-PHENYLPROPIONIC ACID
CAS:7782-26-5
Trade Name: (R)-(-)-alpha-Methylphenylacetic acid
Formula: C9H10O2
24586
MW: 150.18
= 98% (HPLC)
(R)-(-)-3,4,8,8A-TETRAHYDRO-8A-METHYL-1,6(2H,7H)-NAPHTHALENEDIONE
CAS:100348-93-4
Trade Name: (R)-Wieland-miescher ketone
Formula: C11H14O2
24147
MW: 178.23
(R)-(-)-4-BENZYL-3-PROPIONYL-2-OXAZOLIDINONE
CAS:131685-53-5
Trade Name: N-3-Propionyl-(4R)-benzyl-2-oxazolidinone
Formula: C13H15NO3
23186
MW: 233.26
= 99% (HPLC)
(R)-(-)-4-PHENYL-2-OXAZOLIDINONE
CAS:90319-52-1
Trade Name: (4R)-4-Phenyl-1,3-oxazolidin-2-one
Formula: C9H9NO2
16578
MW: 163.18
= 99% (HPLC)
(R)-(-)-5,5-DIMETHYL-4-PHENYL-2-OXAZOLIDINONE
CAS:170918-42-0
Trade Name: (R)-Phenyl superquat
Formula: C11H13NO2
29807
MW: 191.23
= 99.5% (HPLC, Chiral purity)
(R)-(-)-ALPHA-METHOXYPHENYLACETIC ACID
CAS:3966-32-3
Trade Name: O-Methyl-(R)-mandelic acid
Formula: C9H10O3
16594
MW: 166.17
= 99% (HPLC)
(R)-(-)-BOC-3-PYRROLIDINOL
CAS:109431-87-0
Trade Name: (R)-(-)-1-Boc-3-hydroxypyrrolidine
Formula: C9H17NO3
16516
MW: 187.24
= 99.5% (GC, Chiral purity)
(R)-(-)-EPICHLOROHYDRIN
CAS:51594-55-9
Trade Name: (R)-(-)-2-(Chloromethyl)oxirane
Formula: C3H5ClO
24602
MW: 92.52
= 99% (Assay)
(R)-(-)-MANDELIC ACID
CAS:611-71-2
Trade Name: (R)-alpha-Hydroxyphenylacetic acid
Formula: C8H8O3
24590
MW: 152.15
= 99.75% (HPLC, Chiral purity)
(R)-(-)-NIPECOTIC ACID
CAS:25137-00-2
Trade Name: (R)-(–)-3-Piperidinecarboxylic acid
Formula: C6H11NO2
28509
MW: 129.16
= 98% (assay by titration)
(R)-(1-BOC-PIPERIDIN-2-YL)ACETIC ACID
CAS:351410-32-7
Trade Name: (R)-1-Boc-2-piperidineacetic acid
Formula: C12H21NO4
14483
MW: 243.3
= 99% (NMR)
(R)-(1-BOC-PIPERIDIN-3-YL)ACETIC ACID
CAS:912940-89-7
Trade Name: (R)-Boc-(3-carboxymethyl)piperidine
Formula: C12H21NO4
22719
MW: 243.3
= 98% (HPLC)
(R)-(1-FMOC-PIPERIDIN-2-YL)ACETIC ACID
CAS:193693-63-9
Trade Name: (R)-Fmoc-(2-carboxymethyl)piperidine
Formula: C22H23NO4
14484
MW: 365.43
= 99% (HPLC)
(R)-(1-FMOC-PIPERIDIN-3-YL)ACETIC ACID
Trade Name: (R)-Fmoc-(3-carboxymethyl)piperidine
Formula: C22H23NO4
22720
MW: 365.43
= 98% (HPLC)
(R)-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID METHYL ESTER
CAS:191327-28-3
Trade Name: (R)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester
Formula: C11H13NO2
19431
MW: 191.23
(R)-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID METHYL ESTER HYDROCHLORIDE
CAS:41220-49-9
Formula: C11H13NO2 HCl
20743
MW: 227.69
(R)-1,2,3,4-TETRAHYDRONAPHTHOIC ACID
CAS:23357-47-3
Formula: C11H12O2
23181
MW: 176.2
98%
(R)-1,2,3,4-TETRAHYDROQUINOLINE-2-CARBOXYLIC ACID HYDROCHLORIDE
CAS:75433-76-0
Trade Name: D-1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride
Formula: C10H11NO2 HCl
18324
MW: 213.66
= 96% (Assay)
(R)-1-AMINO-2-PROPANOL
CAS:2799-16-8
Trade Name: (-)-Isopropanolamine
Formula: C3H9NO
16633
MW: 75.11
= 98%
(R)-1-BENZYLPYRROLIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1082055-65-9
Formula: C12H15NO2 HCl
17847
MW: 241.72
= 99% (Assay)
(R)-1-BOC-2-PIPERIDINEMETHANOL
CAS:134441-61-5
Trade Name: (R)-1-Boc-2-piperidinemethanol
Formula: C11H21NO3
16141
MW: 215.3
= 95% (NMR)
(R)-1-BOC-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE
CAS:119838-44-7
Trade Name: (R)-(+)-1-(tert-Butoxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone
Formula: C13H24N2O3
14119
MW: 256.35
= 99% (Titration)
(R)-1-BOC-3-(AMINOMETHYL)PYRROLIDINE
CAS:199174-29-3
Trade Name: (R)-3-Aminomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
17153
MW: 200.28
= 98%
(R)-1-BOC-3-AMINOPIPERIDINE
CAS:188111-79-7
Trade Name: (R)-3-Aminopiperidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
16109
MW: 200.28
= 99% (HPLC, Chiral purity)
(R)-1-N-BOC-3-(AMINOMETHYL)PIPERIDINE
CAS:140645-23-4
Trade Name: 3(R)-Aminomethyl-piperidine-1-carboxylic acid tert-butyl ester
Formula: C11H22N2O2
28796
MW: 214.31
= 98% (HPLC, Chiral purity)
(R)-1-Z-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE
CAS:119906-46-6
Formula: C16H22N2O3
14118
MW: 290.36
= 98% (HPLC)
(R)-2-METHOXYPHENYLGLYCINE
CAS:103889-84-5
Trade Name: (R)-Amino-(2-methoxyphenyl)acetic acid
Formula: C9H11NO3
16828
MW: 181.19
= 99% (HPLC, Chiral purity)
(R)-2-METHYLPIPERAZINE-1-CARBOXYLIC ACID BENZYL ESTER
CAS:84477-85-0
Trade Name: (R)-Benzyl 2-methylpiperazine-1-carboxylate
Formula: C13H18N2O2
17313
MW: 234.3
= 98%
(R)-2-TETRAHYDROISOQUINOLINE ACETIC ACID HYDROCHLORIDE
CAS:187218-03-7
Trade Name: D-Tqa-OH HCl
Formula: C11H13NO2 HCl
15227
MW: 227.69
= 98% (HPLC)
(R)-2-THIENYLGLYCINE
CAS:65058-23-3
Trade Name: L-2-(2-Thienyl)glycine
Formula: C6H7NO2S
16644
MW: 157.19
= 98%
(R)-3-(3-METHYLBUTANOYL)-4-BENZYLOXAZOLIDIN-2-ONE
CAS:145589-03-3
Formula: C15H19NO3
29273
MW: 261.32
(R)-3-(4-BROMOPHENYL)-B-ALANINOL
CAS:1213037-93-4
Trade Name: (R)-3-amino-3-(4-bromophenyl)propan-1-ol
Formula: C9H12BrNO
29732
MW: 230.1
= 97% (HPLC)
(R)-3-(BOC-AMINO)-2-OXO-1-PYRROLIDINE-ACETIC ACID
Formula: C11H18N2O5
11748
MW: 258.3
= 99% (NMR)
(R)-3-(FMOC-AMINO)-2-METHYLPROPIONIC ACID
CAS:211682-15-4
Trade Name: Fmoc-(R)-ampa-OH
Formula: C19H19NO4
28833
MW: 325.36
= 98% (HPLC)
(R)-3-AMINO-3-(1-NAPHTHYL)PROPIONIC ACID
CAS:775280-91-6
Trade Name: D-beta-Ala(1-naphthyl)-OH
Formula: C13H13NO2
15705
MW: 215.25
= 99% (HPLC)
(R)-3-AMINO-3-(2,3-DIMETHOXYPHENYL)PROPIONIC ACID
CAS:742691-70-9
Trade Name: D-beta-Phe(2,3-dimethoxy)-OH
Formula: C11H15NO4
15674
MW: 225.24
= 99% (TLC)
(R)-3-AMINO-3-(2,4-DICHLOROPHENYL)PROPIONIC ACID
CAS:778571-53-2
Trade Name: D-beta-Phe(2,4-DiCl)-OH
Formula: C9H9Cl2NO2
15662
MW: 234.08
= 99% (HPLC, Chiral purity)
(R)-3-AMINO-3-(2-BROMOPHENYL)PROPIONIC ACID
CAS:737751-95-0
Trade Name: D-beta-Phe(2-Br)-OH
Formula: C9H10BrNO2
15560
MW: 244.09
= 98% (NMR)
(R)-3-AMINO-3-(2-CHLOROPHENYL)PROPIONIC ACID
CAS:740794-79-0
Trade Name: D-beta-Phe(2-Cl)-OH
Formula: C9H10ClNO2
15549
MW: 199.64
(R)-3-AMINO-3-(2-FLUOROPHENYL)PROPIONIC ACID
CAS:151911-22-7
Trade Name: D-beta-Phe(2-F)-OH
Formula: C9H10FNO2
15216
MW: 183.18
= 99% (HPLC)
(R)-3-AMINO-3-(2-HYDROXYPHENYL)PROPIONIC ACID
CAS:708973-31-3
Trade Name: D-beta-Phe(2-OH)-OH
Formula: C9H11NO3
15647
MW: 181.19
= 98% (TLC)
(R)-3-AMINO-3-(2-METHYLPHENYL)PROPIONIC ACID
CAS:752198-38-2
Trade Name: D-beta-Phe(2-Me)-OH
Formula: C10H13NO2
15617
MW: 179.22
= 98%
(R)-3-AMINO-3-(2-NAPHTHYL)PROPIONIC ACID
CAS:786637-72-7
Trade Name: D-beta-Ala-(2-naphthyl)-OH
Formula: C13H13NO2
15710
MW: 215.25
= 98% (HPLC)
(R)-3-AMINO-3-(2-THIENYL)PROPIONIC ACID
CAS:73495-10-0
Trade Name: L-beta-Ala-(2-thienyl)-OH
Formula: C7H9NO2S
15490
MW: 171.21
= 99% (Chiral purity)
(R)-3-AMINO-3-(3,5-DIMETHOXYPHENYL)PROPIONIC ACID
CAS:744193-65-5
Trade Name: D-beta-Phe(3,5-dimethoxy)-OH
Formula: C11H15NO4
15686
MW: 225.24
= 98% (TLC)
(R)-3-AMINO-3-(3-BROMOPHENYL)PROPIONIC ACID
CAS:788153-27-5
Trade Name: D-beta-Phe(3-Br)-OH
Formula: C9H10BrNO2
15565
MW: 244.09
= 99% (HPLC, Chiral purity)
(R)-3-AMINO-3-(3-CHLOROPHENYL)PROPIONIC ACID
CAS:262429-49-2
Trade Name: D-beta-Phe(3-Cl)-OH
Formula: C9H10ClNO2
15264
MW: 199.64
= 98% (HPLC)
(R)-3-AMINO-3-(3-CYANOPHENYL)PROPIONIC ACID
CAS:761396-82-1
Trade Name: D-beta-Phe(3-CN)-OH
Formula: C10H10N2O2
15589
MW: 190.2
= 99% (Chiral purity)
(R)-3-AMINO-3-(3-METHOXYPHENYL)PROPIONIC ACID
CAS:765895-65-6
Trade Name: D-beta-Phe(3-OMe)-OH
Formula: C10H13NO3
15637
MW: 195.22
= 99% (HPLC)
(R)-3-AMINO-3-(3-METHYLPHENYL)PROPIONIC ACID
CAS:748128-33-8
Trade Name: D-beta-Phe(3-Me)-OH
Formula: C10H13NO2
15623
MW: 179.22
= 98% (HPLC)
(R)-3-AMINO-3-(3-PYRIDYL)PROPIONIC ACID
CAS:155050-17-2
Trade Name: D-beta-Ala-(3-pyridyl)-OH
Formula: C8H10N2O2
15220
MW: 166.18
= 98%
(R)-3-AMINO-3-(4-BROMOPHENYL)PROPIONIC ACID
CAS:479074-63-0
Trade Name: D-beta-Phe(4-Br)-OH
Formula: C9H10BrNO2
15570
MW: 244.09
= 98%
(R)-3-AMINO-3-(4-CHLOROPHENYL)PROPIONIC ACID
CAS:131690-61-4
Trade Name: D-beta-Phe(4-Cl)-OH
Formula: C9H10ClNO2
15209
MW: 199.64
= 99% (HPLC)
(R)-3-AMINO-3-(4-CYANOPHENYL)PROPIONIC ACID
CAS:738606-24-1
Trade Name: D-beta-Phe(4-CN)-OH
Formula: C10H10N2O2
15595
MW: 190.2
= 95%
(R)-3-AMINO-3-(4-FLUOROPHENYL)PROPIONIC ACID
CAS:151911-23-8
Trade Name: D-beta-Phe(4-F)-OH
Formula: C9H10FNO2
15217
MW: 183.18
= 98% (Assay)
(R)-3-AMINO-3-(4-HYDROXYPHENYL)PROPIONIC ACID
CAS:73025-69-1
Trade Name: D-beta-Phe(4-OH)-OH
Formula: C9H11NO3
15489
MW: 181.19
= 99% (HPLC)
(R)-3-AMINO-3-(4-METHYLPHENYL)PROPIONIC ACID
CAS:479064-87-4
Trade Name: D-beta-Phe(4-Me)-OH
Formula: C10H13NO2
15629
MW: 179.22
= 98% (HPLC)
(R)-3-AMINO-3-(4-TRIFLUOROMETHYLPHENYL)PROPIONIC ACID
CAS:774178-39-1
Trade Name: D-beta-Phe(4-CF3)-OH
Formula: C10H10F3NO2
15583
MW: 233.19
= 99% (HPLC)
(R)-3-AMINO-3-(6-METHOXY-3-PYRIDYL)PROPIONIC ACID
CAS:712321-46-5
Trade Name: D-beta-Ala-(6-methoxy-3-pyridyl)-OH
Formula: C9H12N2O3
15738
MW: 196.21
= 97% (HPLC)
(R)-3-AMINO-3-PHENYLPROPIONIC ACID
CAS:83649-48-3
Trade Name: D-beta-Phe-OH
Formula: C9H11NO2
15327
MW: 165.19
= 99% (Assay)
(R)-3-AMINO-5-PHENYLPENTANOIC ACID HYDROCHLORIDE SALT
CAS:147228-37-3
Trade Name: D-beta-Nva(5-phenyl)-OH HCl
Formula: C11H15NO2 HCl
15213
MW: 229.71
= 98%
(R)-3-BOC-AMINO-5-(CARBONYLMETHYL)-2,3-DIHYDRO-1,5-BENZOTHIAZEPIN-4(5H)-ONE
CAS:250349-14-5
Formula: C16H20NO5S
11749
MW: 352.4
(R)-3-BOC-AMINO-BUTYLAMINE
CAS:170367-69-8
Formula: C9H20N2O2
19632
MW: 188.27
= 98% (NMR)
(R)-3-FLUOROPYRROLIDINE HYDROCHLORIDE
CAS:136725-55-8
Formula: C4H9ClFN
16524
MW: 125.57
= 98% (NMR)
(R)-3-FMOC-AMINO-5-(CARBOXYLMETHYL)-2,3-DIHYDRO-1,5-BENZOTHIAZEPIN-4(5H)-ONE
Formula: C26H22N2O5S
15089
MW: 474.53
= 99% (HPLC)
(R)-3-HYDROXYMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:138108-72-2
Trade Name: (R)-N-Boc-pyrrolidine-3-methanol
Formula: C10H19NO3
18008
MW: 201.26
= 98% (HPLC)
(R)-3-HYDROXYPYRROLIDINE
CAS:2799-21-5
Trade Name: (R)-Pyrrolidin-3-ol
Formula: C4H9NO
16552
MW: 87.12
= 98% (GC)
(R)-3-HYDROXYPYRROLIDINE HYDROCHLORIDE
CAS:104706-47-0
Trade Name: (R)-(-)-3-Pyrrolidinol hydrochloride
Formula: C4H9NO HCl
28168
MW: 123.58
= 98% (Assay)
(R)-3-ISOPROPYLAMINO-1,2-PROPANEDIOL
CAS:97988-45-9
Formula: C6H15NO2
10446
MW: 133.19
= 99% (TLC)
(R)-3-THIENYLGLYCINE
CAS:1194-86-1
Trade Name: H-D-(3-Thienyl)gly-OH
Formula: C6H7NO4S
16641
MW: 157.19
= 98%
(R)-4-(1-AMINOETHYL)PHENOL
CAS:134855-88-2
Formula: C8H11NO
24263
MW: 137.18
= 99% (HPLC, Chiral purity)
(R)-4-(BOC-AMINO)-3-(FMOC-AMINO)BUTYRIC ACID
CAS:763102-80-3
Trade Name: Fmoc-L-Dbu(Boc)-OH
Formula: C24H28N2O6
30485
MW: 440.5
= 99% (HPLC)
(R)-4-(BOC-AMINO)-3-(Z-AMINO)BUTYRIC ACID
CAS:108919-51-3
Trade Name: Z-D-Dbu(Boc)-OH
Formula: C17H24N2O6
16245
MW: 352.4
= 98% (HPLC)
(R)-4-(FMOC-AMINO)-3-(BOC-AMINO)BUTYRIC ACID
CAS:1409939-21-4
Trade Name: Nbeta-Boc-Ngamma-Fmoc-L-Diaminobutyric acid
Formula: C24H28N2O6
30489
MW: 440.5
= 98% (HPLC)
(R)-4-(FMOC-AMINO)-3-(Z-AMINO)BUTYRIC ACID
CAS:349547-09-7
Trade Name: Z-L-Dbu(Fmoc)-OH
Formula: C27H26N2O6
30476
MW: 474.5
= 99% (HPLC)
(R)-4-AMINO-3-(Z-AMINO)BUTYL METHYL ESTER HYDROCHLORIDE
CAS:845909-53-7
Trade Name: Z-L-Dbu-OMe HCl
Formula: C13H18N2O4 HCl
16247
MW: 302.8
= 99% (HPLC)
(R)-4-BOC-THIOMORPHOLINE-3-CARBOXYLIC ACID
CAS:114525-81-4
Trade Name: (R)-4-(tert-Butoxycarbonyl)-thiomorpholine-3-carboxylic acid
Formula: C10H17NO4S
17850
MW: 247.31
= 97% (assay)
(R)-4-FLUOROPHENYLGLYCINE HYDROCHLORIDE
CAS:144744-41-2
Trade Name: D-4-Fluorophenylglycine hydrochloride
Formula: C8H8FNO2 HCl
29249
MW: 205.62
= 97% (assay)
(R)-4-Z-THIOMORPHOLINE-3-CARBOXYLIC ACID
CAS:114580-22-2
Formula: C13H15NO4S
19635
MW: 281.33
= 99%
(R)-5,5-DIMETHYL-1,3-THIAZOLIDINE-4-CARBOXYLIC ACID
CAS:72778-00-8
Trade Name: (R)-Dtc-OH
Formula: C6H11NO2S
14358
MW: 161.22
= 99% (HPLC)
(R)-7-(2,3-DIHYDRO-1H-INDEN-2-YL)-1,7-DIAZASPIRO[4.4]NONAN-6-ONE
Formula: C16H20N2O
23974
MW: 256.35
(R)-A-PROPYNYLPROLINE·HCL
CAS:1049733-10-9
Formula: C8H11NO2 HCl
15887
MW: 189.64
= 98% (HPLC)
(R)-ALPHA-(2-NAPHTHALENYLMETHYL)PROLINE HCL
CAS:679796-42-0
Formula: C16H17NO2 HCl
15470
MW: 291.82
= 98%
(R)-ALPHA-(3-CHLOROBENZYL)PROLINE HCL
CAS:637020-80-5
Formula: C12H15Cl2NO2
15462
MW: 276.16
= 98% (HPLC)
(R)-ALPHA-(3-PHENYLPROPYL)PROLINE HCL
CAS:1217792-29-4
Formula: C14H19NO2 HCl
15833
MW: 269.77
= 98% (HPLC)
(R)-ALPHA-(4-BIPHENYLMETHYL)PROLINE HCL
CAS:1049728-81-5
Formula: C18H19NO2 HCl
15843
MW: 317.81
(R)-ALPHA-(4-BROMOBENZYL)PROLINE HCL
CAS:637020-91-8
Formula: C12H14BrNO2 HCl
15466
MW: 320.61
(R)-ALPHA-(4-CHLOROBENZYL)PROLINE HCL
CAS:1049741-04-9
Formula: C12H15Cl2NO2
15752
MW: 276.16
(R)-ALPHA-(4-FLUOROBENZYL)PROLINE HCL
CAS:637020-68-9
Formula: C12H14FNO2 HCl
15458
MW: 259.71
(R)-ALPHA-(4-METHYLBENZYL)PROLINE HCL
CAS:637020-62-3
Formula: C13H17NO2 HCl
15456
MW: 255.74
(R)-ALPHA-(4-TRIFLUOROMETHYLBENZYL)PROLINE HCL
CAS:1049728-08-6
Formula: C13H14F3NO2 HCl
15807
MW: 309.72
= 98% (HPLC)
(R)-ALPHA-(5-BROMO-2-THIOPHENYLMETHYL)PROLINE HCL
CAS:1049729-23-8
Formula: C10H12BrNO2S HCl
15859
MW: 326.64
(R)-ALPHA-ALLYLPROLINE HCL
CAS:177206-69-8
Formula: C8H13NO2 HCl
15883
MW: 191.66
= 98% (HPLC)
(R)-ALPHA-BENZYL PROLINE HCL
CAS:86116-84-9
Formula: C12H15NO2 HCl
16870
MW: 241.71
= 99% (HPLC)
(R)-ALPHA-PHENETHYLPROLINE HCL
CAS:1217684-31-5
Formula: C13H17NO2 HCl
15763
MW: 255.74
= 98% (TLC)
(R)-BOC-2-AMINO-3,3-DIMETHYL-PENT-4-ENOIC ACID
CAS:854250-89-8
Formula: C12H21NO4
29623
MW: 243.3
= 99% (HPLC)
(R)-BOC-2-AMINO-3-ETHYL-PENTANOIC ACID
Formula: C12H23NO4
29612
MW: 245.32
= 99% (HPLC)
(R)-BOC-2-AMINO-3-PHENYLSULFANYL-PROPIONIC ACID
Trade Name: Boc-L-Cys(phenyl)-OH
Formula: C14H19NO4S
29586
MW: 297.37
= 99% (HPLC)
(R)-BOC-2-AMINO-3-PROPARGYLSULFANYL-PROPIONIC ACID·DCHA
Trade Name: Boc-L-Cys(propargyl)-OH DCHA
Formula: C11H17NO4S C12H23N
29585
MW: 440.64
= 98% (HPLC)
(R)-Boc-2-amino-6-benzyloxy-hexanoic acid·DCHA
Formula: C18H27NO5 C12H23N
22738
MW: 518.74
= 97% (HPLC)
(R)-BOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C9H14F3NO4
29618
MW: 257.21
= 98% (HPLC)
(R)-BOC-3-AMINO-5-CARBOXYMETHYL-2,3-DIHYDRO-1,5-BENZOTHIAZEPIN-4(5H)-ONE
CAS:250349-14-5
Formula: C16H20N2O5S
22676
MW: 352.41
= 97% (HPLC)
(R)-BOC-3-BENZYL-PIPERIDINE-3-CARBOXYLIC ACID·DCHA
Formula: C18H25NO4 C12H23N
29628
MW: 500.72
= 99% (HPLC)
(R)-BOC-3-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C12H21NO4
31658
MW: 243.3
(R)-BOC-4-AMINO-5-(3-INDOLYL)PENTANOIC ACID
Formula: C17H22N2O4
14452
MW: 318.37
= 97% (HPLC)
(R)-BOC-4-AMINO-5-METHYLHEXANOIC ACID
CAS:197006-14-7
Trade Name: Boc-gamma-L-Val-OH
Formula: C12H23NO4
14458
MW: 245.32
= 97% (HPLC)
(R)-BOC-4-AMINO-6-METHYLTHIO-HEXANOIC ACID
CAS:959582-93-5
Formula: C12H23NO4S
14459
MW: 277.38
= 97% (HPLC)
(R)-BOC-5,5-DIMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (R)-Boc-5,5-dimethyl-Pro-OH
Formula: C12H21NO4
22756
MW: 243.3
= 99% (HPLC)
(R)-BOC-BETA2-HOMOALA-OH
CAS:132696-45-8
Trade Name: (R)-3-(Boc-amino)-2-methylpropionic acid
Formula: C9H17NO4
14282
MW: 203.3
= 98%
(R)-CHROMAN-4-YLAMINE HYDROCHLORIDE
CAS:210488-55-4
Formula: C9H11NO HCl
19637
MW: 185.65
= 98% (HPLC)
(R)-FMOC-2-AMINO-2-METHYL-3-TRITYLSULFANYL-PROPIONIC ACID
Trade Name: Fmoc-alpha-Me-L-Cys(Trt)-OH
Formula: C38H33NO4S
31665
MW: 599.74
(R)-FMOC-2-AMINO-2-METHYL-SUCCINIC ACID-4-TERT-BUTYL ESTER
CAS:1231709-26-4
Trade Name: Fmoc-alpha-Me-D-Asp(OtBu)-OH
Formula: C24H27NO6
29635
MW: 425.48
= 98% (HPLC)
(R)-FMOC-2-AMINO-3,3-DIMETHYL-PENT-4-ENOIC ACID
Formula: C22H23NO4
29707
MW: 365.43
= 99% (HPLC)
(R)-FMOC-2-AMINO-3-(2-TERT-BUTOXYCARBONYL-ETHYLSULFANYL)-PROPIONIC ACID
Trade Name: Fmoc-L-Cys(tert-butoxycarbonylethyl)-OH
Formula: C25H29NO6S
29637
MW: 471.57
= 98% (HPLC)
(R)-FMOC-2-AMINO-3-(3-(BOC-AMINO)-PROPYLSULFANYL)-PROPIONIC ACID
Trade Name: Fmoc-L-Cys(3-(Boc-amino)-propyl)-OH
Formula: C26H32N2O6S
29641
MW: 500.61
= 98% (HPLC)
(R)-FMOC-2-AMINO-3-(3-TERT-BUTOXYCARBONYL-PROPYLSULFANYL)PROPIONIC ACID
CAS:102971-73-3
Trade Name: Fmoc-L-Cys(tert-butoxycarbonylpropyl)-OH
Formula: C26H31NO6S
29323
MW: 485.6
= 99% (HPLC)
(R)-FMOC-2-AMINO-3-DODECYLSULFANYL-PROPIONIC ACID
Trade Name: Fmoc-L-Cys(dodecyl)-OH
Formula: C30H41NO4S
29690
MW: 511.72
= 99% (HPLC)
(R)-FMOC-2-AMINO-3-ETHYL-PENTANOIC ACID
Formula: C22H25NO4
29695
MW: 367.44
= 99% (HPLC)
(R)-FMOC-2-AMINO-3-PHENYLSULFANYL-PROPIONIC ACID
Trade Name: Fmoc-L-Cys(phenyl)-OH
Formula: C24H21NO4S
29639
MW: 419.5
= 98% (HPLC)
(R)-FMOC-2-AMINO-3-PROPARGYLSULFANYL-PROPIONIC ACID
Trade Name: Fmoc-L-Cys(Propargyl)-OH
Formula: C21H19NO4S
29638
MW: 381.45
= 99% (HPLC)
(R)-FMOC-2-AMINO-3-TERT-BUTOXY-2-METHYL-PROPIONIC ACID
Trade Name: Fmoc-alpha-Me-D-Ser(tBu)-OH
Formula: C23H27NO5
29648
MW: 397.47
= 99% (HPLC)
(R)-FMOC-2-AMINOMETHYL-3-METHYL-BUTYRIC ACID
Trade Name: (R)-Fmoc-beta2-homovaline
Formula: C21H23NO4
29713
MW: 353.42
= 99% (HPLC)
(R)-FMOC-3-AMINO-2-BENZYL-PROPIONIC ACID
Trade Name: (R)-Fmoc-beta2-homophenylalanine
Formula: C25H23NO4
29683
MW: 401.46
= 98% (HPLC)
(R)-FMOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C19H16F3NO4
29701
MW: 379.34
= 99% (HPLC)
(R)-FMOC-3-BENZYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C28H27NO4
29721
MW: 441.53
= 99% (HPLC)
(R)-FMOC-3-CARBOXYTHIOMORPHOLINE
Formula: C20H19NO4S
14487
MW: 369.44
= 99% (HPLC)
(R)-FMOC-3-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C22H23NO4
31676
MW: 365.43
(R)-FMOC-4-AMINO-5-(3-INDOLYL)PENTANOIC ACID
CAS:917099-01-5
Formula: C27H24N2O4
14453
MW: 454.52
= 97% (HPLC)
(R)-FMOC-4-AMINO-5-(4-TERT-BUTOXYPHENYL)PENTANOIC ACID
CAS:959573-04-7
Formula: C30H33NO5
14462
MW: 487.6
= 98% (HPLC)
(R)-FMOC-5,5-DIMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (R)-Fmoc-5,5-dimethyl-Pro-OH
Formula: C22H23NO4
22758
MW: 365.43
= 99% (HPLC)
(R)-FMOC-B-HYDROXY-VALINE
CAS:884880-39-1
Trade Name: (R)-Fmoc-2-amino-3-hydroxy-3-methyl-butyric acid
Formula: C20H21NO5
29717
MW: 355.39
= 99% (HPLC)
(R)-G-(4-PYRIDINYLMETHYL)-L-PROLINE·2HCL
CAS:1049754-26-8
Formula: C11H14N2O2 2HCl
15975
MW: 279.17
= 98% (TLC)
(R)-GAMMA-(1-NAPHTHALENYLMETHYL)-L-PROLINE HCL
CAS:1049740-26-2
Formula: C16H17NO2 HCl
15923
MW: 291.78
(R)-GAMMA-(2-NAPHTHALENYLMETHYL)-L-PROLINE HCL
CAS:1049740-41-1
Formula: C16H17NO2 HCl
15925
MW: 291.78
(R)-GAMMA-(2-TRIFLUOROMETHYLBENZYL)-L-PROLINE HCL
CAS:1049743-22-7
Formula: C13H14F3NO2 HCl
15933
MW: 309.72
= 98% (TLC)
(R)-GAMMA-(3,4-DICHLOROBENZYL)-L-PROLINE HCL
CAS:1049742-96-2
Formula: C12H14Cl3NO2
15929
MW: 310.61
(R)-GAMMA-(3-BROMOBENZYL)-L-PROLINE HCL
CAS:1049734-10-2
Formula: C12H14BrNO2 HCl
15907
MW: 320.61
(R)-GAMMA-(3-METHYLBENZYL)-L-PROLINE HCL
CAS:1049734-52-2
Formula: C13H17NO2 HCl
15913
MW: 255.74
= 98% (TLC)
(R)-GAMMA-(3-NITROBENZYL)-L-PROLINE HCL
CAS:1049740-11-5
Formula: C12H14N2O4 HCl
15919
MW: 286.71
= 99% (HPLC)
(R)-GAMMA-(3-PHENYLALLYLBENZYL)-L-PROLINE HCL
Formula: C14H17NO2 HCl
15951
MW: 267.75
(R)-GAMMA-(3-PYRIDINYLMETHYL)-L-PROLINE 2HCL
CAS:1049754-12-2
Formula: C11H14N2O2 2HCl
15973
MW: 279.17
= 98% (TLC)
(R)-GAMMA-(4-BIPHENYLMETHYL)-L-PROLINE HCL
CAS:1049745-26-7
Formula: C18H19NO2 HCl
15959
MW: 317.81
= 98% (TLC)
(R)-GAMMA-(4-BROMOBENZYL)-L-PROLINE HCL
CAS:1049734-21-5
Formula: C12H14BrNO2 HCl
15909
MW: 320.61
(R)-GAMMA-(4-CHLOROBENZYL)-L-PROLINE HCL
CAS:1049733-88-1
Formula: C12H15Cl2NO2
15903
MW: 276.16
= 95% (HPLC)
(R)-GAMMA-(4-FLUOROBENZYL)-L-PROLINE HCL
CAS:1049733-41-6
Formula: C12H14FNO2 HCl
15897
MW: 259.71
(R)-GAMMA-(4-IODOBENZYL)-L-PROLINE HCL
CAS:1049744-44-6
Formula: C12H14INO2 HCl
15949
MW: 367.61
(R)-GAMMA-(4-METHYLBENZYL)-L-PROLINE HCL
CAS:1049734-62-4
Formula: C13H17NO2 HCl
15915
MW: 255.74
= 98% (HPLC)
(R)-GAMMA-(4-TRIFLUOROMETHYLBENZYL)-L-PROLINE HCL
CAS:1049743-68-1
Formula: C13H14F3NO2 HCl
15937
MW: 309.72
= 98% (HPLC)
(R)-GAMMA-ALLYL-L-PROLINE HCL
CAS:1049755-14-7
Formula: C8H13NO2 HCl
15977
MW: 191.66
(R)-GAMMA-BENZYL-L-PROLINE HCL
Formula: C12H15NO2 HCl
15891
MW: 241.72
= 99% (TLC)
(R)-GAMMA-PROPYNYL-L-PROLINE HCL
Formula: C8H11NO2 HCl
15979
MW: 189.64
= 98% (TLC)
(R)-HEXAHYDROPYRROLO[1,2-A]PYRAZINE-1,4-DIONE
CAS:96193-26-9
Formula: C7H10N2O2
29421
MW: 154.17
(R)-METHYL 2-AMINO-3-(3',4'-DICHLOROBIPHENYL-4-YL)PROPANOATE
Formula: C16H15Cl2NO2 HCl
24405
MW: 360.67
(R)-METHYL 2-AMINO-3-(4'-FLUOROBIPHENYL-4-YL)PROPANOATE HYDROCHLORIDE
Formula: C16H16FNO2 HCl
24423
MW: 309.77
(R)-METHYL 3-(3'-ACETYLBIPHENYL-4-YL)-2-AMINOPROPANOATE HYDROCHLORIDE
Formula: C18H19NO3 HCl
24416
MW: 333.81
(R)-METHYL 3-(4'-ACETYLBIPHENYL-4-YL)-2-AMINOPROPANOATE HYDROCHLORIDE
Formula: C18H19NO3 HCl
24407
MW: 333.81
(R)-MORPHOLINE-3-CARBOXYLIC ACID
CAS:106825-81-4
Trade Name: (R)-3-Morpholinecarboxylic acid
Formula: C5H9NO3
18333
MW: 131.13
(R)-MORPHOLINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:106825-81-4
Trade Name: (R)-3-Morpholinecarboxylic acid hydrochloride
Formula: C5H9NO3 HCl
19638
MW: 167.59
= 99% (Chiral purity based on starting material)
(R)-N-(4-NITROPHENYL)ALANINE
CAS:791850-21-0
Trade Name: (2R)-2-[(4-Nitrophenyl)amino]propanoic acid
Formula: C9H10N2O4
19639
MW: 210.19
= 96% (Assay)
(R)-N-(TERT-BUTOXYCARBONYL)-3-HYDROXYPIPERIDINE
CAS:143900-43-0
Trade Name: (R)-tert-Butyl 3-hydroxypiperidine-1-carboxylate
Formula: C10H19NO3
28963
MW: 201.26
= 99% (Chiral purity)
(R)-NALPHA-BOC-NBETA-Z-2,3-DIAMINOPROPAN-1-OL
CAS:1263045-28-8
Trade Name: Boc-D-Dap(Z)-ol
Formula: C16H24N2O5
16139
MW: 324.4
= 99% (HPLC)
(R)-NALPHA-FMOC-NBETA-BOC-2,3-DIAMINOPROPAN-1-OL
CAS:1263047-54-6
Trade Name: Fmoc-D-Dap(Boc)-ol
Formula: C23H28N2O5
16188
MW: 412.5
= 99% (HPLC)
(R)-NALPHA-Z-NBETA-BOC-2,3-DIAMINOPROPAN-1-OL
CAS:412015-69-1
Trade Name: Z-D-Dap(Boc)-ol
Formula: C16H24N2O5
16252
MW: 324.4
= 99% (HPLC)
(R)-TERT-BUTYL 1-(3-(4-ETHOXYPHENYL)-4-OXO-3,4-DIHYDROQUINAZOLIN-2-YL)ETHYLCARBAMATE
Formula: C23H27N3O4
23929
MW: 409.48
(R)-THIOMORPHOLINE-3-CARBOXYLIC ACID
CAS:65527-54-0
Trade Name: (3R)-Thiomorpholinecarboxylic acid
Formula: C5H9NO2S HCl
17852
MW: 183.7
= 99% (Assay)
(R)-Z-OXAPROLINE
CAS:97534-84-4
Trade Name: (R)-(+)-3-Z-4-oxazolidinecarboxylic acid
Formula: C12H13NO5
16580
MW: 251.24
= 98% (NMR)
(R,S),-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID
CAS:41994-51-8
Trade Name: DL-Tic-OH
Formula: C10H11NO2
12373
MW: 177.2
= 99% (HPLC)
(R,S)-(BOC-3-AMINOMETHYL)-PIPERIDINE
CAS:142643-29-6
Formula: C11H22N2O2
31888
MW: 214.31
(R,S)-1,3,4,5-TETRAHYDRO-5-PHENYL-2H-1,4-BENZODIAZEPIN-2-ONE HYDROCHLORIDE
CAS:268209-92-3
Formula: C15H14N2O HCl
07372
MW: 274.72
= 98% (HPLC)
(R,S)-1,3-DIHYDRO-2H-ISOINDOLE CARBOXYLIC ACID HYDROCHLORIC ACID
CAS:66938-02-1
Trade Name: DL-Disc-OH HCl
Formula: C9H9NO2 HCl
07177
MW: 199.65
99%
(R,S)-1-AMINO-2-PHENYLETHYL-PHOSPHONIC ACID DIPHENYL ESTER HYDROCHLORIDE
Trade Name: (R,S)-PheP(OPh)2 HCl
Formula: C20H20NO3P HCl
22678
MW: 389.82
= 99% (HPLC)
(R,S)-1-BOC-2-AMINOMETHYL-PIPERIDINE HYDROCHLORIDE
CAS:370069-31-1(net)
Formula: C11H22N2O2 HCI
29630
MW: 354.23
= 98% (HPLC)
(R,S)-2-CARBOXYMORPHOLINE HYDROCHLORIDE
CAS:300582-83-6
Trade Name: (R,S)-Cop-OH HCl
Formula: C5H9NO3 HCl
07172
MW: 167.13
(R,S)-3-AMINO-3-(3-PYRIDYL)PROPIONIC ACID
CAS:62247-21-6
Formula: C8H10N2O2
11563
MW: 166.18
= 98%
(R,S)-4-BOC-3-CARBOXYMETHYL-PIPERAZIN-2-ONE
CAS:863307-54-4
Trade Name: 2-Carboxymethyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester
Formula: C11H18N2O5
22690
MW: 258.27
= 99% (HPLC)
(R,S)-4-FMOC-3-CARBOXYMETHYL-PIPERAZIN-2-ONE
CAS:1029630-75-8
Formula: C21H20N2O5
22691
MW: 380.4
= 98% (HPLC)
(R,S)-BOC-2-AMINO-3-METHYL-3-PHENYL-BUTYRIC ACID DICYCLOHEXYLAMMONIUM SALT
Trade Name: (R,S)-Boc-beta, beta-dimethyl-phenylalanine DCHA
Formula: C16H23NO4 C12H23N
29608
MW: 474.68
= 98% (HPLC)
(R,S)-BOC-2-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
CAS:544479-61-0
Formula: C9H14F3NO4
29616
MW: 257.21
= 99% (HPLC)
(R,S)-BOC-2-AMINO-4,4-DIFLUORO-BUTYRIC ACID
Formula: C9H15F2NO4
29617
MW: 239.22
= 97% (HPLC)
(R,S)-BOC-2-AMINO-TETRADECANOIC ACID
CAS:129850-62-0
Formula: C19H37NO4
14480
MW: 343.51
= 99% (HPLC)
(R,S)-BOC-3,3-DIMETHYL-PROLINE
CAS:143979-40-2
Trade Name: (R,S)-Boc-3,3-dimethyl-pyrrolidine-2-carboxylic acid
Formula: C12H21NO4
29258
MW: 243.3
= 99.9% (HPLC)
(R,S)-BOC-3-AMINO-2-(3,4-DIMETHOXY-BENZYL)-PROPIONIC ACID
Formula: C17H25NO6
29602
MW: 339.39
= 97% (HPLC)
(R,S)-BOC-3-AMINO-2-(NAPHTHALEN-1-YL)-PROPIONIC ACID
Formula: C18H21NO4
29605
MW: 315.37
= 99% (HPLC)
(R,S)-BOC-3-AMINO-2-(NAPHTHALEN-1-YLMETHYL)-PROPIONIC ACID
Formula: C19H23NO4
29603
MW: 329.4
= 97% (HPLC)
(R,S)-BOC-3-AMINO-2-(NAPHTHALEN-2-YL)-PROPIONIC ACID
CAS:1310680-21-7
Formula: C18H21NO4
29606
MW: 315.37
= 97% (HPLC)
(R,S)-BOC-3-AMINO-2-(NAPHTHALEN-2-YLMETHYL)-PROPIONIC ACID
Formula: C19H23NO4
29604
MW: 329.4
= 98% (HPLC)
(R,S)-BOC-3-AMINO-3-(TERT-BUTYL)PROPIONIC ACID
CAS:856417-59-9
Trade Name: (R,S)-Boc-3-(tert-butyl)-beta-Ala-OH
Formula: C12H23NO4
22713
MW: 245.32
= 98% (HPLC)
(R,S)-BOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C9H14F3NO4
29620
MW: 257.21
= 99% (HPLC)
(R,S)-BOC-THC(BOC)-OH
CAS:1031927-09-9
Trade Name: (R,S)-3-Boc-amino-9-Boc-1,2,3,4-tetrahydro-carbazole-3-carboxylic acid
Formula: C23H30N2O6
22706
MW: 430.5
= 98% (HPLC)
(R,S)-FMOC-2-AMINO-3-(7-METHOXY-4-COUMARYL)PROPIONIC ACID
Formula: C28H23N07
14356
MW: 485.5
= 97%
(R,S)-FMOC-2-AMINO-3-METHYL-3-PHENYL-BUTYRIC ACID
CAS:1310680-19-3
Trade Name: (R,S)-Fmoc-beta, beta-dimethyl-phenylalanine
Formula: C26H25NO4
29685
MW: 415.49
= 98% (HPLC)
(R,S)-FMOC-2-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
CAS:1219145-37-5
Formula: C19H16F3NO4
29699
MW: 379.34
= 98% (HPLC)
(R,S)-FMOC-2-AMINO-4,4-DIFLUORO-BUTYRIC ACID
Formula: C19H17F2NO4
29700
MW: 361.35
= 97% (HPLC)
(R,S)-FMOC-2-AMINO-TETRADECANOIC ACID
Formula: C29H39NO4
14481
MW: 465.63
= 98% (HPLC)
(R,S)-FMOC-3,3-DIMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (R,S)-Fmoc-3,3-dimethyl-proline
Formula: C22H23NO4
29705
MW: 365.43
= 99% (HPLC)
(R,S)-FMOC-3-AMINO-2-(3,4-DIMETHOXY-BENZYL)-PROPIONIC ACID
Formula: C27H27NO6
29678
MW: 461.51
= 97% (HPLC)
(R,S)-FMOC-3-AMINO-2-(4-METHOXYBENZYL)-PROPIONIC ACID
Formula: C26H25NO5
29677
MW: 431.49
= 99% (HPLC)
(R,S)-FMOC-3-AMINO-2-(NAPHTHALEN-1-YL)-PROPIONIC ACID
Formula: C28H23NO4
29681
MW: 437.49
= 98% (HPLC)
(R,S)-FMOC-3-AMINO-2-(NAPHTHALEN-1-YLMETHYL)-PROPIONIC ACID
Formula: C29H25NO4
29679
MW: 451.52
= 98% (HPLC)
(R,S)-FMOC-3-AMINO-2-(NAPHTHALEN-2-YL)-PROPIONIC ACID
Formula: C28H23NO4
29682
MW: 437.49
= 99% (HPLC)
(R,S)-FMOC-3-AMINO-2-(NAPHTHALEN-2-YLMETHYL)-PROPIONIC ACID
Formula: C29H25NO4
29680
MW: 451.52
= 97% (HPLC)
(R,S)-FMOC-3-AMINO-2-BENZYL-PROPIONIC ACID
Formula: C25H23NO4
29676
MW: 401.46
= 99% (HPLC)
(R,S)-FMOC-3-AMINO-3-(TERT-BUTYL)PROPIONIC ACID
Trade Name: (R,S)-Fmoc-3-(tert-butyl)-beta-Ala-OH
Formula: C22H25NO4
22714
MW: 367.44
= 98% (HPLC)
(R,S)-FMOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C19H16F3NO4
29703
MW: 379.34
= 99% (HPLC)
(R,S)-FMOC-THC(BOC)-OH
Formula: C33H32N2O6
22725
MW: 552.63
= 97% (HPLC)
(R,S)-LeuP(OPh)2·HCl
Trade Name: (R,S)-1-amino-3-methylbutyl-phosphonic acid diphenyl ester hydrochloride
Formula: C17H22NO3P HCl
22677
MW: 355.8
= 98% (HPLC)
(R,S)2-HYDROXY-3-(3-PYRIDYL)PROPIONIC ACID
CAS:889957-22-6
Formula: C8H9NO3
11562
MW: 167.16
= 95% (HPLC)
(S)-(+)-1,1'-BINAPHTHYL-2,2'-DIYL HYDROGEN PHOSPHATE
CAS:35193-64-7
Trade Name: (S)-4-Hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-oxide
Formula: C20H13O4P
16602
MW: 348.29
= 99% (HPLC)
(S)-(+)-1-AMINO-1-PHENYL-2-METHOXYETHANE
CAS:91298-74-7
Trade Name: (S)-Phenylglycinol methyl ether
Formula: C9H13NO
16597
MW: 151.21
= 98%
(S)-(+)-1-BENZYL-3-HYDROXYPIPERIDINE
CAS:91599-79-0
Trade Name: (S)-1-Benzyl-3-piperidinol
Formula: C12H17NO
28759
MW: 191.27
= 98% (HPLC, Chiral purity)
(S)-(+)-2,2-DIMETHYL-1,3-DIOXOLANE-4-METHANOL
CAS:22323-82-6
Trade Name: (S)-(+)-1,2-O-Isopropylidene-sn-glycerol
Formula: C6H12O3
10447
MW: 132.16
= 97% (GC, Chiral purity)
(S)-(+)-2,3,7,7A-TETRAHYDRO-7A-METHYL-1H-INDENE-1,5(6H)-DIONE
CAS:17553-86-5
Trade Name: (S)-(+)-Hajos-Parrish diketone
Formula: C10H12O2
24126
MW: 164.2
= 99% (HPLC)
(S)-(+)-2-METHYLPIPERAZINE
CAS:74879-18-8
Formula: C5H12N2
30718
MW: 100.16
= 99% (GC)
(S)-(+)-2-OXO-4-PHENYL-3-OXAZOLIDINEACETIC ACID
CAS:99333-54-7
Formula: C11H11NO4
28185
MW: 221.21
=98.5%
(S)-(+)-2-PHENYLGLYCINE AMIDE
CAS:6485-52-5
Trade Name: L-(+)-Phenylglycine amide
Formula: C8H10N2O
16622
MW: 150.18
= 99%
(S)-(+)-2-PHENYLPROPIONIC ACID
CAS:7782-24-3
Trade Name: (S)-(+)-alpha-Methylphenylacetic acid
Formula: C9H10O2
24585
MW: 150.18
= 98% (HPLC)
(S)-(+)-3,4,8,8A-TETRAHYDRO-8A-METHYL-1,6(2H,7H)-NAPHTHALENEDIONE
CAS:33878-99-8
Trade Name: (S)-(+)-9-Methyl-5(10)-octaline-1,6-dione
Formula: C11H14O2
24168
MW: 178.23
= 99% (GC)
(S)-(+)-3-FLUOROPYRROLIDINE HYDROCHLORIDE
CAS:136725-53-6
Formula: C4H9ClFN
16630
MW: 125.57
= 99% (HPLC)
(S)-(+)-4-PHENYL-2-OXAZOLIDINONE
CAS:99395-88-7
Trade Name: (S)-(+)-4-Phenyloxazolidin-2-one
Formula: C9H9NO2
16615
MW: 163.17
= 99.5% (GC, Chiral purity)
(S)-(+)-5,5-DIMETHYL-4-PHENYL-2-OXAZOLIDINONE
CAS:168297-84-5
Trade Name: (S)-Phenyl superquat
Formula: C11H13NO2
29806
MW: 191.23
= 99.5% (HPLC, Chiral purity)
(S)-(+)-BOC-3-PYRROLIDINOL
CAS:101469-92-5
Trade Name: (S)-(+)-N-Boc-3-hydroxypyrrolidine
Formula: C9H17NO3
16512
MW: 187.24
= 98%
(S)-(+)-CAMPHOR-10-SULPHONIC ACID
CAS:3144-16-9
Trade Name: (+)-Camphor-10-sulfonic acid
Formula: C10H16O4S
24588
MW: 232.3
= 99% (Assay)
(S)-(+)-CAMPTOTHECIN
CAS:7689-03-4
Formula: C20H16N2O4
22069
MW: 348.35
= 99% (Assay)
(S)-(+)-EPICHLOROHYDRIN
CAS:67843-74-7
Trade Name: (S)-(+)-2-(Chloromethyl)oxirane
Formula: C3H5ClO
24603
MW: 92.52
= 99.5% (GC, Chiral purity)
(S)-(+)-METHOXYPHENYLACETIC ACID
CAS:26164-26-1
Trade Name: O-Methyl-(S)-mandelic acid
Formula: C9H10O3
16614
MW: 166.17
= 99% (HPLC)
(S)-(+)-NIPECOTIC ACID
CAS:59045-82-8
Trade Name: (S)-(+)-3-piperidinecarboxylic acid
Formula: C6H11NO2
28510
MW: 129.16
= 99% (Titration)
(S)-(-)-1,1'-BI-2-NAPHTHOL
CAS:18531-99-2
Trade Name: (-)-2,2'-Dihydroxy-1,1'-dinaphthyl
Formula: C20H14O2
16601
MW: 286.32
= 99% (Chiral HPLC)
(S)-(-)-1,1'-BINAPHTHYL-2,2'-DIAMINE
CAS:18531-95-8
Trade Name: (S)-(-)-1,1'-Bi(2-naphthylamine)
Formula: C20H16N2
24613
MW: 284.36
= 99% (HPLC)
(S)-(-)-1-(1-NAPHTHYL)ETHYLAMINE
CAS:10420-89-0
Trade Name: (S)-(-)-alpha-Methyl-1-naphthalenemethylamine
Formula: C12H13N
24589
MW: 171.24
= 98% (HPLC, Chiral purity)
(S)-(-)-2-METHYL-2-PROPANESULFINAMIDE
CAS:343338-28-3
Trade Name: (S)-(-)-tert-Butyl sulfinamide
Formula: C4H11NOS
31474
MW: 121.2
= 99%
(S)-(-)-3-(ACETYLTHIO)-2-METHYLPROPIONIC ACID
CAS:76497-39-7
Trade Name: D(-)S-Acetyl-beta-mercapto isobutyric acid
Formula: C6H10O3S
05381
MW: 162.2
= 99% ee (GC)
(S)-(-)-4-AMINO-2-HYDROXYBUTYRIC ACID
CAS:40371-51-5
Formula: C4H9NO3
30407
MW: 119.12
= 99% (Assay, Chiral purity)
(S)-(-)-4-BENZYL-2-OXAZOLIDINONE
CAS:90719-32-7
Trade Name: (4S)-4-Benzyl-1,3-oxazolidin-2-one
Formula: C10H11NO2
16606
MW: 177.2
= 99% (HPLC)
(S)-(-)-4-ISOPROPYL-2-OXAZOLIDINONE
CAS:17016-83-0
Trade Name: (4S)-4-Isopropyl-1,3-oxazolidin-2-one
Formula: C6H11NO2
16591
MW: 129.16
= 99% (GC, Chiral purity)
(S)-(-)-ALPHA-(BOC-AMINO)-GAMMA-BUTYROLACTONE
CAS:40856-59-5
Trade Name: Boc-L-homoserine lactone
Formula: C9H15NO4
16557
MW: 201.22
= 99% (HPLC)
(S)-(-)-ALPHA-METHYLBENZYLAMINE
CAS:2627-86-3
Trade Name: (S)-(-)-1-Phenylethylamine
Formula: C8H11N
24595
MW: 121.18
= 99% (GC)
(S)-(-)-DIPHENYL-2-PYRROLIDINEMETHANOL
CAS:112068-01-6
Trade Name: (S)-(-)-2-(Diphenylhydroxymethyl)pyrrolidine
Formula: C17H19NO
16607
MW: 253.34
= 98% (GC)
(S)-(-)-TETRAHYDRO-2-FUROIC ACID
CAS:87392-07-2
Formula: C5H8O3
30721
MW: 116.12
= 99% (HPLC, Chiral purity)
(S)-(1,2,3,4-TETRAHYDROISOQUINOLIN-3-YL-METHYL)CARBAMIC ACID TERT-BUTYL ESTER
Trade Name: (S)-3-Boc-aminomethyl-1,2,3,4-tetrahydroisoquinoline
Formula: C15H22N2O2
19654
MW: 262.35
(S)-(1-BOC-PIPERIDIN-3-YL)ACETIC ACID
CAS:941289-27-6
Trade Name: (S)-Boc-(3-carboxymethyl)piperidine
Formula: C12H21NO4
22721
MW: 243.3
= 96%
(S)-(1-FMOC-PIPERIDIN-2-YL)ACETIC ACID
CAS:193693-62-8
Trade Name: (S)-Fmoc-(2-carboxymethyl)piperidine
Formula: C22H23NO4
14486
MW: 365.43
= 99% (HPLC)
(S)-(1-FMOC-PIPERIDIN-3-YL)ACETIC ACID
Trade Name: (S)-Fmoc-(3-carboxymethyl)piperidine
Formula: C22H23NO4
22722
MW: 365.43
= 99% (HPLC)
(S)-(3-ACETYLTRIPHENYLPHOSPHORANYLIDENE)-4-PHENYL-OXAZOLIDIN-2-ONE
Formula: C29H24NO3P
24429
MW: 465.49
(S)-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID HYDROBROMIDE
CAS:190961-15-0
Formula: C10H11NO2 HBr
24269
MW: 258.11
= 95% (NMR)
(S)-1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOXYLIC ACID TERT-BUTYL ESTER
CAS:77497-74-6
Trade Name: (S)-tert-Butyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate
Formula: C14H19NO2
20863
MW: 233.31
(S)-1,2,3,4-TETRAHYDROISOQUINOLINE-1-CARBOXYLIC ACID
CAS:151004-92-1
Trade Name: (S)-1,2,3,4-Tetrahydro-1-isoquinoline carboxylic acid
Formula: C10H11NO2
17853
MW: 177.2
= 98%
(S)-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID METHYL ESTER
CAS:79799-05-6
Trade Name: (S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid methyl ester
Formula: C11H13NO2
19432
MW: 191.23
(S)-1,2,3,4-TETRAHYDRONAPHTHOIC ACID
CAS:85977-52-2
Formula: C11H12O2
23180
MW: 176.2
98%
(S)-1-AMINO-2-PROPANOL
CAS:2799-17-9
Trade Name: (+)-Isopropanolamine
Formula: C3H9NO
16632
MW: 75.11
= 98% (GC, Chiral purity)
(S)-1-BENZYL-3-AMINOPIPERIDINE
CAS:168466-85-1
Trade Name: (S)-1-Benzyl-piperidin-3-ylamine
Formula: C12H18N2
24204
MW: 190.29
= 99%
(S)-1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:161659-80-9
Trade Name: (S)-1-N-BENZYL-BETA-PROLINE
Formula: C12H15NO2
17854
MW: 205.26
= 98%
(S)-1-BOC-2-BENZYL-PIPERAZINE
CAS:169447-86-3
Trade Name: (S)-2-Benzylpiperazine-1-carboxylic acid tert-butyl ester
Formula: C16H24N2O2
17187
MW: 276.38
= 95%
(S)-1-BOC-2-PIPERIDINEACETIC ACID
CAS:159898-10-9
Trade Name: (S)-N-Boc-(2-carboxymethyl)piperidine
Formula: C12H21NO4
14485
MW: 243.3
= 98% (Assay)
(S)-1-BOC-2-PIPERIDINEMETHANOL
CAS:134441-93-3
Trade Name: (S)-Boc-Pip-ol
Formula: C11H21NO3
16146
MW: 215.3
= 99% (HPLC)
(S)-1-BOC-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE
CAS:119838-38-9
Formula: C13H24N2O3
14117
MW: 256.35
= 95% (NMR)
(S)-1-BOC-3-(AMINOMETHYL)PYRROLIDINE
CAS:199175-10-5
Trade Name: (S)-tert-Butyl-3-(aminomethyl)pyrrolidine-1-carboxylate
Formula: C10H20N2O2
17148
MW: 200.28
= 96% (HPLC)
(S)-1-BOC-3-(HYDROXYMETHYL)PIPERIDINE
CAS:140695-84-7
Trade Name: 3-(S)-N-Boc-piperidine methanol
Formula: C11H21NO3
23510
MW: 215.29
= 99% (GC)
(S)-1-BOC-3-AMINOPIPERIDINE
CAS:625471-18-3
Trade Name: (S)-3-Aminopiperidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
24205
MW: 200.28
= 98%
(S)-1-BOC-3-HYDROXYPIPERIDINE
CAS:143900-44-1
Trade Name: (S)-tert-Butyl 3-hydroxypiperidine-1-carboxylate
Formula: C10H19NO3
28962
MW: 201.26
= 99% (Chiral purity)
(S)-1-BOC-3-METHYLPIPERAZINE
CAS:147081-29-6
Trade Name: tert-Butyl (S)-3-methyl-1-piperazinecarboxylate
Formula: C10H20N2O2
31870
MW: 200.28
= 99% (Chiral purity by GC)
(S)-1-N-BOC-2-ETHYLPIPERAZINE
CAS:325145-35-5
Trade Name: (2S)-2-Ethyl-1-piperazinecarboxylic acid 1,1-dimethylethyl ester
Formula: C11H22N2O2
26224
MW: 214.31
= 96% (GC)
(S)-1-N-BOC-3-(AMINOMETHYL)PIPERIDINE
CAS:140645-24-5
Trade Name: 3(S)-Aminomethyl-piperidine-1-carboxylic acid tert-butyl ester
Formula: C11H22N2O2
26174
MW: 214.31
= 98% (HPLC, Chiral purity)
(S)-1-Z-2-TERT-BUTYL-3-METHYL-4-IMIDAZOLIDINONE
CAS:119906-49-9
Trade Name: (S)-(-)-1-(Benzyloxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone
Formula: C16H22N2O3
14116
MW: 290.36
= 98% (HPLC)
(S)-2-(((9H-FLUOREN-9-YL)METHOXY)CARBONYLAMINO)-3-(1,3-DIOXOISOINDOLIN-2-YL)PROPANOIC ACID
Formula: C26H20N2O6
23928
MW: 456.45
= 95% (NMR)
(S)-2-(3-((2-ISOPROPYLTHIAZOL-4-YL)METHYL)-3-METHYLUREIDO)-3-METHYLBUTANOIC ACID
CAS:154212-61-0
Formula: C14H23N3O3S
29026
MW: 313.42
= 99% (HPLC)
(S)-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-4,4-DIFLUORO-BUTYRIC ACID
CAS:467442-21-3
Formula: C19H17F2NO4
19649
MW: 361.34
= 98% (HPLC)
(S)-2-(BOC-AMINO)-4-(Z-AMINO)-1-BUTANOL
CAS:197892-14-1
Trade Name: Boc-Dab(Z)-ol
Formula: C17H26N2O5
26466
MW: 338.4
= 99% (HPLC)
(S)-2-(FMOC-AMINO)-3-(2,2-DIMETHYL-4H-BENZO[1,3]DIOXIN-6-YL)PROPIONIC ACID
CAS:252049-13-1
Formula: C28H27NO6
10938
MW: 473.53
= 98% (HPLC)
(S)-2-FORMYL-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:150521-32-7
Trade Name: (S)-tert-Butyl 2-formylpiperidine-1-carboxylate
Formula: C11H19NO3
18797
MW: 213.28
= 96% (GC)
(S)-2-HYDROXYBUTYRIC ACID
CAS:3347-90-8
Trade Name: (S)-alpha-Hydroxybutyric acid
Formula: C4H8O3
21126
MW: 104.1
= 96% (Titration)
(S)-2-INDOLINEMETHANOL
CAS:27640-33-1
Trade Name: (S)-2-(Hydroxymethyl)indoline
Formula: C9H11NO
16551
MW: 149.19
= 98% (HPLC)
(S)-2-METHOXYPHENYLGLYCINE
CAS:103889-86-7
Trade Name: (S)-Amino-(2-methoxyphenyl)acetic acid
Formula: C9H11NO3
16831
MW: 181.19
= 98%
(S)-2-TETRAHYDROISOQUINOLINE ACETIC ACID HYDROCHLORIDE
CAS:270082-22-9
Trade Name: (S)-2-Tetrahydroisoquinoline acetic acid hydrochloride
Formula: C11H13NO2 HCl
15394
MW: 227.69
= 99% (HPLC, Chiral purity)
(S)-2-THIENYLGLYCINE
CAS:43189-45-3
Trade Name: H-D-(2-Thienyl)gly-OH
Formula: C6H7NO2S
16638
MW: 157.19
= 99% (HPLC)
(S)-3-(1-Boc-pyrrolidin-2-yl)propionic acid·DCHA
Formula: C12H12NO4 C12H23N
22734
MW: 424.62
= 99% (HPLC)
(S)-3-(1-FMOC-PYRROLIDIN-2-YL)PROPIONIC ACID
Formula: C22H23NO4
22735
MW: 365.43
= 99% (HPLC)
(S)-3-(4-BOC-PIPERAZIN-1-YL)-2-(FMOC-AMINO)PROPIONIC ACID
CAS:313052-20-9
Trade Name: Fmoc-beta-(1-piperazinyl)-L-Ala(Boc)-OH
Formula: C27H33N3O6
14834
MW: 495.58
= 98% (HPLC)
(S)-3-(4-HYDROXY-3-NITROPHENYL)-2-(PHENYLSULFONAMIDO)PROPANOIC ACID
Formula: C15H14N2O7S
23980
MW: 366.35
(S)-3-(BOC-AMINO)PYRROLIDINE
CAS:122536-76-9
Trade Name: tert-Butyl (S)-3-pyrrolidinylcarbamate
Formula: C9H18N2O2
31799
MW: 186.25
=98%
(S)-3-AMINO-2(BENZYLAMINO)PROPAN-1-OL
CAS:150482-72-7
Formula: C10H16N2O
18848
MW: 180.25
= 95% (NMR)
(S)-3-AMINO-3-(1-NAPHTHYL)PROPIONIC ACID
CAS:275826-46-5
Trade Name: L-beta-Ala-(1-naphthyl)-OH
Formula: C13H13NO2
15431
MW: 215.25
= 99% (TLC)
(S)-3-AMINO-3-(2,3-DICHLOROPHENYL)PROPIONIC ACID
CAS:748128-13-4
Trade Name: L-beta-Phe(2,3-DiCl)-OH
Formula: C9H9Cl2NO2
15669
MW: 234.08
= 98% (HPLC)
(S)-3-AMINO-3-(2,3-DIMETHOXYPHENYL)PROPIONIC ACID
CAS:752198-18-8
Trade Name: L-beta-Phe(2,3-dimethoxy)-OH
Formula: C11H15NO4
15675
MW: 225.24
= 98% (HPLC)
(S)-3-AMINO-3-(2,4-DICHLOROPHENYL)PROPIONIC ACID
CAS:757937-66-9
Trade Name: L-beta-Phe(2,4-DiCl)-OH
Formula: C9H9Cl2NO2
15663
MW: 234.08
= 98% (HPLC, Chiral purity)
(S)-3-AMINO-3-(2-BROMOPHENYL)PROPIONIC ACID
CAS:275826-34-1
Trade Name: L-beta-Phe(2-Br)-OH
Formula: C9H10BrNO2
15428
MW: 244.09
= 98% (TLC)
(S)-3-AMINO-3-(2-CHLOROPHENYL)PROPIONIC ACID
CAS:763922-37-8
Trade Name: L-beta-Phe(2-Cl)-OH
Formula: C9H10ClNO2
15550
MW: 199.64
= 99% (HPLC)
(S)-3-AMINO-3-(2-FLUOROPHENYL)PROPIONIC ACID
CAS:151911-32-9
Trade Name: L-beta-Phe(2-F)-OH
Formula: C9H10FNO2
15218
MW: 183.18
= 98% (HPLC)
(S)-3-AMINO-3-(2-FURYL)PROPIONIC ACID
CAS:131829-49-7
Trade Name: D-beta-Ala-(2-furyl)-OH
Formula: C7H9NO3
15210
MW: 155.15
= 99% (HPLC)
(S)-3-AMINO-3-(2-METHOXYPHENYL)PROPIONIC ACID
CAS:720662-28-2
Trade Name: (S)-3-Amino-3-(2-methoxyphenyl)propionic acid
Formula: C10H13NO3
15632
MW: 195.22
= 99% (TLC)
(S)-3-AMINO-3-(2-METHYLPHENYL)PROPIONIC ACID
CAS:736131-48-9
Trade Name: L-beta-Phe(2-Me)-OH
Formula: C10H13NO2
15618
MW: 179.22
= 98% (HPLC)
(S)-3-AMINO-3-(2-NAPHTHYL)PROPIONIC ACID
CAS:767282-94-0
Trade Name: L-beta-Ala-(2-naphthyl)-OH
Formula: C13H13NO2
15711
MW: 215.25
= 98% (TLC)
(S)-3-AMINO-3-(2-TRIFLUOROMETHYLPHENYL)PROPIONIC ACID
CAS:755749-11-2
Trade Name: L-beta-Phe(2-CF3)-OH
Formula: C10H10F3NO2
15572
MW: 233.19
= 99% (HPLC)
(S)-3-AMINO-3-(3-BROMOPHENYL)PROPIONIC ACID
CAS:275826-35-2
Trade Name: L-beta-Phe(3-Br)-OH
Formula: C9H10BrNO2
15429
MW: 244.09
= 99% (HPLC, Chiral purity)
(S)-3-AMINO-3-(3-CYANOPHENYL)PROPIONIC ACID
CAS:791778-00-2
Trade Name: L-beta-Phe(3-CN)-OH
Formula: C10H10N2O2
15590
MW: 190.2
= 98% (HPLC)
(S)-3-AMINO-3-(3-FLUOROPHENYL)PROPIONIC ACID
CAS:723284-79-5
Trade Name: L-beta-Phe(3-F)-OH
Formula: C9H10FNO2
15544
MW: 183.18
= 95% (HPLC)
(S)-3-AMINO-3-(3-METHOXYPHENYL)PROPIONIC ACID
CAS:783300-35-6
Trade Name: L-beta-Phe(3-OMe)-OH
Formula: C10H13NO3
15638
MW: 195.22
= 98% (TLC)
(S)-3-AMINO-3-(3-METHYLPHENYL)PROPIONIC ACID
CAS:701907-44-0
Trade Name: L-beta-Phe(3-Me)-OH
Formula: C10H13NO2
15624
MW: 179.22
= 98% (HPLC)
(S)-3-AMINO-3-(3-NITROPHENYL)PROPIONIC ACID
CAS:734529-57-8
Trade Name: L-beta-Phe(3-NO2)-OH
Formula: C9H10N2O4
15608
MW: 210.19
= 98% (HPLC)
(S)-3-AMINO-3-(3-PYRIDYL)PROPIONIC ACID
CAS:129043-04-5
Trade Name: L-beta-Ala-(3-pyridyl)-OH
Formula: C8H10N2O2
15205
MW: 166.18
= 98% (TLC)
(S)-3-AMINO-3-(3-THIENYL)PROPIONIC ACID
CAS:773050-73-0
Trade Name: (S)-3-Amino-3-(3-thienyl)propionic acid
Formula: C7H9NO2S
15700
MW: 171.21
= 98% (HPLC)
(S)-3-AMINO-3-(3-TRIFLUOROMETHYLPHENYL)PROPIONIC ACID
CAS:719995-40-1
Trade Name: L-beta-Phe(3-CF3)-OH
Formula: C10H10F3NO2
15578
MW: 233.19
= 98% (TLC)
(S)-3-AMINO-3-(4-BROMOPHENYL)PROPIONIC ACID
CAS:275826-36-3
Trade Name: L-beta-Phe(4-Br)-OH
Formula: C9H10BrNO2
15430
MW: 244.09
= 99%
(S)-3-AMINO-3-(4-CHLOROPHENYL)PROPIONIC ACID
CAS:131690-60-3
Trade Name: L-beta-Phe(4-Cl)-OH
Formula: C9H10ClNO2
15208
MW: 199.64
= 98% (HPLC, Chiral purity)
(S)-3-AMINO-3-(4-CYANOPHENYL)PROPIONIC ACID
CAS:718596-77-1
Trade Name: L-beta-Phe(4-CN)-OH
Formula: C10H10N2O2
15596
MW: 190.2
= 99% (HPLC)
(S)-3-AMINO-3-(4-FLUOROPHENYL)PROPIONIC ACID
CAS:151911-33-0
Trade Name: L-beta-Phe(4-F)-OH
Formula: C9H10FNO2
15219
MW: 183
= 98% (HPLC)
(S)-3-AMINO-3-(4-HYDROXYPHENYL)PROPIONIC ACID
CAS:54732-46-6
Trade Name: L-beta-Phe(4-OH)-OH
Formula: C9H11NO3
15455
MW: 181.19
= 98% (HPLC, Chiral purity)
(S)-3-AMINO-3-(4-TRIFLUOROMETHYLPHENYL)PROPIONIC ACID
CAS:790203-84-8
Trade Name: L-beta-Phe(4-CF3)-OH
Formula: C10H10F3NO2
15584
MW: 233.19
(S)-3-AMINO-3-(6-METHOXY-3-PYRIDYL)PROPIONIC ACID
CAS:877119-70-5
Trade Name: L-beta-Ala-(6-methoxy-3-pyridyl)-OH
Formula: C9H12N2O3
15739
MW: 196.21
= 99% (HPLC)
(S)-3-AMINO-3-PHENYLPROPIONIC ACID
CAS:40856-44-8
Trade Name: L-beta-Phe-OH
Formula: C9H11NO2
15326
MW: 165.19
= 99% (HPLC)
(S)-3-AMINO-4-(2,4,5-TRIFLUOROPHENYL)BUTYRIC ACID HCL
CAS:1217809-78-3
Formula: C10H10F3NO2 HCl
16842
MW: 269.65
= 98% (HPLC)
(S)-3-AMINOADIPIC ACID HYDROCHLORIDE
CAS:61884-74-0
Trade Name: beta-HomoGlu-OH HCl
Formula: C6H11NO4 HCl
12761
MW: 197.62
= 98% (NMR)
(S)-3-AMINOBUTYRIC ACID
CAS:3775-72-2
Trade Name: L-3-Aminobutyric acid
Formula: C4H9NO2
21056
MW: 103.12
= 95% (NMR)
(S)-3-BOC-AMINO-5-(CARBONYLMETHYL)-2,3-DIHYDRO-1,5-BENZOXAZEPIN-4(5H)-ONE
CAS:250349-13-4
Trade Name: Boc-(S)-3-amino-2,3-dihydro-4-oxo-1,5-benzoxazepine-5(2H)-acetic acid
Formula: C16H20N2O6
15030
MW: 336.34
= 98% (HPLC)
(S)-3-BOC-AMINOPIPERIDINE
CAS:216854-23-8
Formula: C10H20N2O2
29093
MW: 200.28
= 99.6% (GC, Chiral purity)
(S)-3-HYDROXYMETHYL-PYRROLIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS:199174-24-8
Trade Name: (S)-1-Boc-3-(hydroxymethyl)pyrrolidine
Formula: C10H19NO3
18009
MW: 201.26
= 95% (HPLC)
(S)-3-HYDROXYPIPERIDINE
CAS:24211-55-0
Trade Name: (S)-3-Piperidinol
Formula: C5H11NO
29120
MW: 101.15
(S)-3-ISOPROPYLAMINO-1,2-PROPANEDIOL
CAS:90742-94-2
Trade Name: (S)-1-Isopropylaminopropanediol
Formula: C6H15NO2
10449
MW: 133.19
= 95% (TLC)
(S)-3-PYRROLIDINOL
CAS:100243-39-8
Trade Name: (S)-3-Hydroxypyrrolidine
Formula: C4H9NO
16510
MW: 87.12
= 99% (GC)
(S)-3-THIENYLGLYCINE
CAS:1194-87-2
Trade Name: L-2-(3-Thienyl)glycine
Formula: C6H7NO2S
16647
MW: 157.19
= 98%
(S)-4-(1-AMINOETHYL)PHENOL
CAS:134855-89-3
Formula: C8H11NO
24262
MW: 137.18
= 97% (HPLC)
(S)-4-(2-METHYL-BUTOXY)PHENYLAMINE
CAS:112418-54-9
Formula: C11H17NO
19656
MW: 179.26
(S)-4-(BOC-AMINO)-3-(Z-AMINO)BUTYRIC ACID
CAS:96186-30-0
Trade Name: Z-D-ß-Dbu(Boc)-OH
Formula: C17H24N2O6
30477
MW: 352.4
= 99% (HPLC)
(S)-4-(FMOC-AMINO)-3-(Z-AMINO)BUTYRIC ACID
CAS:1217471-94-7
Trade Name: Z-D-Dbu(Fmoc)-OH
Formula: C27H26N2O6
30478
MW: 474.5
= 99% (HPLC)
(S)-4-BENZYL-3-PROPIONYL-2-OXAZOLIDINONE
CAS:101711-78-8
Trade Name: N-3-Propionyl-(4S)-benzyl-2-oxazolidinone
Formula: C13H15NO3
23187
MW: 233.26
= 99% (HPLC)
(S)-4-BOC-MORPHOLINE-3-CARBOXYLIC ACID
CAS:783350-37-8
Trade Name: (S)-Morpholine-3,4-dicarboxylic acid 4-tert-butyl ester
Formula: C10H17NO5
17170
MW: 231.25
= 95% (NMR)
(S)-4-N-FMOC-3-MORPHOLINECARBOXYLIC ACID
CAS:281655-37-6
Formula: C20H19NO5
28559
MW: 353.37
= 99% (HPLC)
(S)-4-OXOPYRROLIDINE-1,2-DICARBOXYLIC ACID 1-TERT-BUTYL 2-METHYL DIESTER
CAS:102195-80-2
Trade Name: Boc-4-oxo-L-proline methyl ester
Formula: C11H17NO5
16608
MW: 243.26
= 99% (GC, Chiral purity)
(S)-4-TERT-BUTYL-2-OXAZOLIDINONE
CAS:54705-42-9
Formula: C7H13NO2
29790
MW: 143.18
99%
(S)-5,5-DIMETHYL-1,3-THIAZOLIDINE-4-CARBOXYLIC ACID
CAS:22916-26-3
Trade Name: (S)-Dtc-OH
Formula: C6H11NO2S
14357
MW: 161.22
= 99% (HPLC)
(S)-ACETAMIDOMETHYL-D-PENICILLAMINE HYDROCHLORIDE
Trade Name: D-Pen(Acm)-OH HCl
Formula: C8H16N2O3S HCl
07294
MW: 256.9
= 99%
(S)-ACETAMIDOMETHYL-L- PENICILLAMINE HYDROCHLORIDE
Trade Name: L-Pen(Acm)-OH HCl
Formula: C8H16N2O3S HCl
14299
MW: 256.9
= 98% (TLC)
(S)-ALPHA-(2-CYANOBENZYL)PROLINE HCL
Formula: C13H14N2O2 HCl
15813
MW: 266.73
(S)-ALPHA-(2-NAPHTHALENYLMETHYL)PROLINE HCL
CAS:679796-43-1
Formula: C16H17NO2 HCl
15471
MW: 291.78
= 99% (TLC)
(S)-ALPHA-(2-TRIFLUOROMETHYLBENZYL)PROLINE HCL
Formula: C13H14F3NO2 HCl
15801
MW: 309.71
(S)-ALPHA-(3-PYRIDINYLMETHYL)PROLINE 2HCL
CAS:1217830-70-0
Formula: C11H14N2O2 2HCl
15877
MW: 279.17
(S)-ALPHA-(4-BIPHENYLMETHYL)PROLINE HCL
CAS:1217722-65-0
Formula: C18H19NO2 HCl
15845
MW: 317.81
(S)-ALPHA-(4-CHLOROBENZYL)PROLINE HCL
CAS:1217618-69-3
Formula: C12H15Cl2NO2
15754
MW: 276.16
(S)-ALPHA-(4-FLUOROBENZYL)PROLINE HCL
CAS:637020-70-3
Formula: C12H14FNO2 HCl
15459
MW: 259.71
(S)-ALPHA-(4-TRIFLUOROMETHYLBENZYL)PROLINE HCL
CAS:1217861-80-7
Formula: C13H14F3NO2 HCl
15809
MW: 309.72
= 98% (HPLC)
(S)-ALPHA-(5-BROMO-2-THIOPHENYLMETHYL)PROLINE HCL
CAS:1217722-51-4
Formula: C10H12BrNO2S HCl
15861
MW: 326.64
(S)-ALPHA-(BENZO[B]THIOPHENYLMETHYL)PROLINE HCL
Formula: C14H15NO2S HCl
15853
MW: 297.8
(S)-ALPHA-ALLYLPROLINE HCL
CAS:129704-91-2
Formula: C8H13NO2 HCl
15885
MW: 191.66
= 98% (NMR)
(S)-ALPHA-BENZYLPROLINE HCL
CAS:637020-57-6
Formula: C12H15NO2 HCl
16869
MW: 241.71
= 98%
(S)-ALPHA-PROPYNYLPROLINE HCL
CAS:1217828-88-0
Formula: C8H11NO2 HCl
15889
MW: 189.64
(S)-BOC-1-ADAMANTYL-GLYCINE
CAS:361441-97-6
Trade Name: (S)-Boc-1-adamantyl-Gly-OH
Formula: C17H27NO4
22749
MW: 309.41
= 97% (HPLC)
(S)-BOC-2-AMINO-3,3-DIMETHYL-PENT-4-ENOIC ACID
CAS:676629-90-6
Formula: C12H21NO4
29624
MW: 243.3
= 99% (HPLC)
(S)-BOC-2-AMINO-3-ETHYL-PENTANOIC ACID
CAS:35264-04-1
Trade Name: N-Boc-3-ethyl-L-norvaline
Formula: C12H23NO4
29613
MW: 245.32
= 99% (HPLC)
(S)-BOC-2-AMINO-3-PROPARGYLOXY-PROPIONIC ACID DICYCLOHEXYL AMMONIUM SALT
Trade Name: Boc-L-Ser(propargyl)-OH DCHA
Formula: C11H17NO5 C12H23N
29590
MW: 424.58
= 97% (HPLC)
(S)-BOC-2-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
CAS:181128-25-6
Formula: C9H14F3NO4
29615
MW: 257.21
= 98% (HPLC)
(S)-BOC-2-AMINO-4-(3,4-DIMETHOXYPHENYL)-BUTYRIC ACID DICYCLOHEXYLAMMONIUM SALT
Trade Name: Boc-L-3,4-dimethoxy-homophenylalanine DCHA
Formula: C17H25NO6 C12H23N
29627
MW: 520.71
= 98% (HPLC)
(S)-BOC-2-AMINO-5-AZIDO-PENTANOIC ACID DICYCLOHEXYLAMMONIUM SALT
CAS:1485528-98-0
Trade Name: Boc-Orn(N3)-OH·DCHA
Formula: C10H18N4O4 C12H23N
29622
MW: 439.6
= 98% (HPLC)
(S)-Boc-2-amino-6-benzyloxy-hexanoic acid·DCHA
Formula: C18H27NO5 C12H23N
22739
MW: 518.74
= 97% (HPLC)
(S)-BOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C9H14F3NO4
29619
MW: 257.21
= 97% (HPLC)
(S)-BOC-3-BENZYL-PIPERIDINE-3-CARBOXYLIC ACID·DCHA
Formula: C18H25NO4 C12H23N
29629
MW: 500.72
= 99% (HPLC)
(S)-BOC-3-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C12H21NO4
31659
MW: 243.3
(S)-BOC-4-(4-PYRIDYL)-SS-HOMOALA-OH
CAS:219297-13-9
Trade Name: Boc-(4-pyridyl)-L-ß-homoalanine
Formula: C14H20N2O4
15251
MW: 280.32
= 95% (HPLC)
(S)-BOC-4-AMINO-PENTANOIC ACID
CAS:207924-92-3
Formula: C10H19NO4
14460
MW: 217.27
= 99% (HPLC)
(S)-BOC-5,5-DIMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (S)-Boc-5,5-dimethyl-Pro-OH
Formula: C12H21NO4
22757
MW: 243.3
= 99% (HPLC)
(S)-BOC-BETA2-HOMOALA-OH
CAS:190897-47-3
Trade Name: (S)-3-(Boc-amino)-2-methylpropionic acid
Formula: C9H17NO4
14283
MW: 203.3
= 99% (TLC)
(S)-BOC-N-(1-PHENYLETHYL)-GLYCINE DICYCLOHEXYLAMMONIUM SALT
Trade Name: Boc-Nspe-OH DCHA
Formula: C15H21NO4 C12H23N
29599
MW: 460.66
= 99% (HPLC)
(S)-BUTOXYCARBONYLAMINO-CYCLOPROPYL-ACETIC ACID
Formula: C10H17NO4
19658
MW: 215.25
(S)-CHROMAN-4-YLAMINE HYDROCHLORIDE
CAS:188198-38-1(net.)
Trade Name: (S)-Chroman-4-amine hydrochloride
Formula: C9H11NO HCl
18346
MW: 185.65
= 98% (NMR)
(S)-FMOC-1-ADAMANTYL-GLYCINE
Trade Name: (S)-Fmoc-1-adamantyl-Gly-OH
Formula: C27H29NO4
22750
MW: 431.53
= 98% (HPLC)
(S)-FMOC-2-AMINO-2-METHYL-SUCCINIC ACID-4-TERT-BUTYL ESTER
CAS:1072845-47-6
Trade Name: Fmoc-alpha-Me-L-Asp(OtBu)-OH
Formula: C24H27NO6
29636
MW: 425.48
= 98% (HPLC)
(S)-FMOC-2-AMINO-3,3-DIMETHYL-PENT-4-ENOIC ACID
Formula: C22H23NO4
29708
MW: 365.43
= 99% (HPLC)
(S)-FMOC-2-AMINO-3-(N'-PBF-GUANIDINO)-PROPIONIC ACID
Trade Name: Fmoc-L-Agp(Pbf)-OH
Formula: C32H36N4O7S
29711
MW: 620.72
= 97% (HPLC)
(S)-FMOC-2-AMINO-3-DECYLOXY-PROPIONIC ACID
Formula: C28H37NO5
22740
MW: 467.6
= 99% (HPLC)
(S)-FMOC-2-AMINO-3-ETHYL-PENTANOIC ACID
Formula: C22H25NO4
29696
MW: 367.44
= 99% (HPLC)
(S)-FMOC-2-AMINO-3-PROPARGYLOXY-PROPIONIC ACID
Trade Name: Fmoc-L-Ser(Propargyl)-OH
Formula: C21H19NO5
29647
MW: 365.39
= 99% (HPLC)
(S)-FMOC-2-AMINO-3-TERT-BUTOXY-2-METHYL-PROPIONIC ACID
Trade Name: Fmoc-alpha-Me-L-Ser(tBu)-OH
Formula: C23H27NO5
29649
MW: 397.47
= 98% (HPLC)
(S)-FMOC-2-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
CAS:181128-48-3
Formula: C19H16F3NO4
29698
MW: 379.34
= 98% (HPLC)
(S)-FMOC-2-AMINO-4-(N'-PBF-GUANIDINO)-BUTYRIC ACID
Trade Name: Fmoc-L-Agb(Pbf)-OH
Formula: C33H38N4O7S
29712
MW: 634.75
= 97% (HPLC)
(S)-FMOC-2-AMINO-5-(2-METHYL-1,3-DIOXOLAN-2-YL)-PENTANOIC ACID
Formula: C24H27NO6
31670
MW: 425.48
= 99% (HPLC)
(S)-FMOC-2-AMINO-5-(N'-PBF-N''-TRIFLUOROETHYL-GUANIDINO)-PENTANOIC ACID
CAS:1060769-47-2
Trade Name: Fmoc-L-Arg(CF3CH2)(Pbf)-OH
Formula: C36H41F3N4O7S
29465
MW: 730.8
= 97% (HPLC)
(S)-FMOC-2-AMINO-5-(TRITYL-CARBAMOYL)-PENTANOIC ACID
Trade Name: Fmoc-L-Homogln(Trt)-OH
Formula: C40H36N2O5
29716
MW: 624.74
= 99% (HPLC)
(S)-FMOC-2-AMINO-5-(TRITYLTHIO)-PENTANOIC ACID
CAS:1417789-17-3
Trade Name: (S)-Fmoc-2-amino-5-tritylsulfanyl-pentanoic acid
Formula: C39H35NO4S
29777
MW: 613.77
= 99% (HPLC)
(S)-FMOC-2-AMINO-5-[(N'-PBF-N''-BOC-AMINO)-GUANIDINO]-PENTANOIC ACID
CAS:1060769-54-1
Trade Name: Fmoc-L-Arg(Boc-NH)(Pbf)-OH
Formula: C39H49N5O9S
29466
MW: 763.91
= 95% (HPLC)
(S)-FMOC-2-AMINO-5-[(N'-PBF-N''-TERT-BUTOXY)-GUANIDINO]-PENTANOIC ACID
CAS:1060769-55-2
Formula: C38H48N4O8S
29467
MW: 720.88
= 98% (HPLC)
(S)-FMOC-2-AMINO-5-TERT-BUTOXYCARBONYL-HEXANEDIOIC ACID-6-TERT-BUTYL ESTER
Formula: C30H37NO8
29658
MW: 539.63
= 97% (HPLC)
(S)-FMOC-2-AMINO-6-(BOC-TERT-BUTOXYCARBONYLMETHYL-AMINO)-HEXANOIC ACID
Trade Name: Fmoc-CML(OtBu)(Boc)-OH
Formula: C32H42N2O8
29643
MW: 582.69
= 97% (HPLC)
(S)-FMOC-2-AMINO-6-TERT-BUTOXY-HEXANOIC ACID
Formula: C25H31NO5
29692
MW: 425.52
= 97% (HPLC)
(S)-FMOC-2-AMINO-6-TERT-BUTOXYCARBONYL-HEPTANEDIOIC ACID -7-TERT-BUTYL ESTER
Formula: C31H39NO8
29659
MW: 553.65
= 98% (HPLC)
(S)-FMOC-2-AMINO-HEPTANEDIOIC ACID-7-TERT-BUTYL ESTER
CAS:159751-46-9
Trade Name: (S)-Fmoc-2-amino-pimelic acid-7-tert-butyl ester
Formula: C26H31NO6
29657
MW: 453.54
= 98% (HPLC)
(S)-FMOC-3-AMINO-2-BENZYL-PROPIONIC ACID
CAS:203854-62-0
Trade Name: (S)-Fmoc-beta2-homophenylalanine
Formula: C25H23NO4
29684
MW: 401.46
= 98% (HPLC)
(S)-FMOC-3-AMINO-4,4,4-TRIFLUORO-BUTYRIC ACID
Formula: C19H16F3NO4
29702
MW: 379.34
= 99% (HPLC)
(S)-FMOC-3-AMINO-5-[(N'-PBF-PYRROLIDINE-1-CARBOXIMIDOYL)-AMINO]-PENTANOIC ACID
Formula: C38H46N4O7S
29634
MW: 702.87
= 99% (HPLC)
(S)-FMOC-3-BENZYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C28H27NO4
29722
MW: 441.53
= 97% (HPLC)
(S)-FMOC-3-METHYL-PIPERIDINE-3-CARBOXYLIC ACID
Formula: C22H23NO4
31677
MW: 365.43
(S)-FMOC-5,5-DIMETHYL-PYRROLIDINE-2-CARBOXYLIC ACID
Trade Name: (S)-Fmoc-5,5-dimethyl-Pro-OH
Formula: C22H23NO4
22759
MW: 365.43
= 98% (HPLC)
(S)-FMOC-B-HYDROXY-VALINE
CAS:1217603-41-2
Trade Name: (S)-Fmoc-2-amino-3-hydroxy-3-methyl-butyric acid
Formula: C20H21NO5
29718
MW: 355.39
= 99% (HPLC)
(S)-FMOC-N-(1-PHENYLETHYL)-GLYCINE
Trade Name: Fmoc-Nspe-OH
Formula: C25H23NO4
29671
MW: 401.46
= 99% (HPLC)
(S)-GAMMA-(2-THIENYLMETHYL)-L-PROLINE HCL
CAS:1049753-34-5
Formula: C10H13NO2S HCl
15965
MW: 247.74
(S)-HPHVSPH·HCL
Trade Name: Phenyl (E)-(3S)-3-amino-5-phenylpent-1-enyl sulfone hydrochloride
Formula: C17H19NO2S HCl
22700
MW: 337.86
= 99% (HPLC)
(S)-LEUVSME·HCL
CAS:890660-04-5
Trade Name: Methyl (E)-(3S)-3-amino-5-methylhex-1-enyl sulfone hydrochloride
Formula: C8H17NO2S HCl
31652
MW: 227.75
(S)-LEUVSPH·HCL
Trade Name: Phenyl (E)-(3S)-3-amino-5-methylhex-1-enyl sulfone hydrochloride
Formula: C13H19NO2S HCl
31651
MW: 289.82
(S)-METHYL 2-AMINO-3-(4'-(TRIFLUOROMETHYL)BIPHENYL-4-YL)PROPANOATE HYDROCHLORIDE
CAS:191426-23-0
Formula: C17H16F3NO2 HCl
24412
MW: 359.77
(S)-METHYL 2-AMINO-3-BENZAMIDOPROPANOATE HYDROCHLORIDE
CAS:264275-33-4
Formula: C11H14N2O3 HCl
24109
MW: 258.7
= 96% (HPLC)
(S)-METHYL 3-(3'-ACETYLBIPHENYL-4-YL)-2-AMINOPROPANOATE HYDROCHLORIDE
Formula: C18H19NO3 HCl
24409
MW: 333.81
(S)-METHYL 3-(4'-ACETYLBIPHENYL-4-YL)-2-AMINOPROPANOATE HYDROCHLORIDE
Formula: C18H19NO3 HCl
24408
MW: 333.81
(S)-MORPHOLINE-3-CARBOXYLIC ACID
CAS:106825-79-0
Trade Name: (S)-3-Morpholinecarboxylic acid
Formula: C5H9NO3
17394
MW: 131.13
(S)-N-4-FMOC-N-8-BOC-DIAMINOOCTANOIC ACID
CAS:268542-17-2
Formula: C28H36N2O6
07333
MW: 496.59
= 99% (HPLC)
(S)-N-A-FMOC-N'-BOC-HOMOLYSINE
CAS:194718-17-7
Trade Name: Fmoc-L-Holys(Boc)-OH
Formula: C27H34N2O6
28557
MW: 482.57
= 97% (HPLC)
(S)-N-BOC-PHENYLALANINE-NITRILE
CAS:99281-90-0
Trade Name: Boc-L-Phe-nitrile
Formula: C14H18N2O2
15026
MW: 246.31
= 99% (HPLC)
(S)-NALPHA-FMOC-NBETA-BOC-2,3-DIAMINOPROPAN-1-OL
CAS:915714-21-5
Trade Name: Fmoc-L-Dap(Boc)-ol
Formula: C23H28N2O5
16181
MW: 412.5
= 99% (HPLC)
(S)-NALPHA-Z-NBETA-BOC-2,3-DIAMINOPROPAN-1-OL
CAS:199005-69-1
Trade Name: Z-L-Dap(Boc)-ol
Formula: C16H24N2O5
16241
MW: 324.4
= 99% (HPLC)
(S)-PHEVSME·HCL
Trade Name: Methyl (E)-(3S)-3-amino-4-phenylbut-1-enyl sulfone hydrochloride
31650
MW:
(S)-PHEVSPH·HCL
CAS:170111-34-9
Trade Name: Phenyl (E)-(3S)-3-amino-4-phenylbut-1-enyl sulfone hydrochloride
Formula: C16H17NO2S HCl
31649
MW: 323.84
(S)-PYRROLIDINE-2-CARBOXYLIC ACID 2-BUTOXYETHYL ESTER TRIFLUROACETATE
Trade Name: L-Pro-OBg TFA
Formula: C11H21NO3 C2HF3O2
14442
MW: 452.4
= 99% (HPLC)
(S)-TERT-BUTYL 2-(PIPERIDINE-4-CARBOXAMIDO)PROPANOATE
CAS:845907-19-9
Formula: C13H24N2O3
23925
MW: 256.34
(S)-Z-OXAPROLINE
CAS:97534-82-2
Trade Name: (S)-(-)-3-Z-4-oxazolidinecarboxylic acid
Formula: C12H13NO5
16631
MW: 251.24
= 97% (HPLC)
(S,Z)-5-AMINO-2-(DIBENZYLAMINO)-1,6-DIPHENYLHEX-4-EN-3-ONE
CAS:156732-13-7
Formula: C32H32N2O
29198
MW: 460.62
(SUCCINIMIDYL 6-[3-(2-PYRIDYLDITHIO)PROPIONAMIDO]HEXANOATE)
CAS:158913-22-5
Trade Name: LC-SPDP
Formula: C18H23N3S2O5
23088
MW: 425.52
= 97% (HPLC)


e-Chemicals.com


Chemical Suppliers

Policy & Agreement | Privacy Policy © 2000-2017 ChemBuyersGuide.com All rights reserved