HomeText SearchStructure Searche-Chemicals.comList Your CompanyContactAccountLogoff

Chem-Impex International

Country: USA

Chem-Impex International
935 Dillon Drive
Wood Dale, IL 60191 (USA)

Phone: (800) 869-9290
Phone 2: 630-766-2112
FAX: 630-766-2218
E-Mail:E-Mail this Supplier

Contact: Patrick Mehta


Chem-Impex International, Inc.(CII) started operations in 1981. With our continued success, we have expanded and now operate from two commercial establishments, manufacturing and distribution.

CII offers over 15,000 unique chemical entities. These chemicals range from amino acids , unnatural amino acids and their derivatives, peptide reagents, resins, nucleosides, diagnostic chemicals and tissue culture reagents, molecular bio chemicals etc.

CII has the capabilities to supply quantities based on customer requirements: from grams to kilograms.

We at CII have the infrastructure to produce any specific requirement on a customized basis. With the state of the art production facilities, excellently supported by a group of organic chemists, CII can boast of satisfying any customer need.

At CII our unbending and proud commitment to quality at every level ensures product consistency and transaction integrity at all times.

The President and staff at CII are proud that our products are the industry standards for the leading and cutting edge research and many expanding frontiers in chemistry. We are committed to accelerating the process of bringing exciting new compounds to market.

Product List: 17,368

PON:Page:1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 |


Product List

Trade Name: Biotin caproic acid
Formula: C16H27N3O4S
MW: 357.47
= 98% (HPLC)
Trade Name: (+)-(1R,4S)-gamma-Homocycloleu-2-ene
Formula: C6H9NO2
MW: 127.14
= 99% (HPLC)
Trade Name: (+)-(1R,4S)-N-Boc-gamma-homocycloleu-2-ene
Formula: C11H17NO4
MW: 227.26
= 99% (HPLC)
Trade Name: (+)-(1S,3R)-b-Homocycloleucine
Formula: C6H11NO2
MW: 129.16
= 98% (HPLC)
Trade Name: (+)-(1S,3R)-N-Boc-beta-homocycloleucine
Formula: C11H19NO4
MW: 229.28
= 97% (HPLC)
Trade Name: (+)-(1S,3R)-N-Fmoc-beta-homocycloleucine
Formula: C21H21NO4
MW: 351.4
= 95%
Trade Name: 4,6-O-benzylidene methyl-alpha-D-glucopyranoside
Formula: C14H18O6
MW: 282.29
= 98% (HPLC)
Formula: C37H57NO7
MW: 627.86
= 99% (NMR)
Formula: C37H56NO10SNa
MW: 729.92
= 99% (NMR)
Formula: C10H18N4SO2
MW: 258.34
= 95% (NMR)
Trade Name: d-Biotin NHS ester
Formula: C14H19N3O5S
MW: 341.4
= 99%
Trade Name: N-Biotinyl-N'-(3-maleimidopropionyl)-3,6-dioxaoctane-1,8-diamine
Formula: C23H35N5SO7
MW: 525.63
= 99% (HPLC)
Formula: C36H40N4SO10
MW: 720.8
Formula: C18H31N4SO5I
MW: 542.44
= 98% (HPLC)
Formula: C20H30N4SO6
MW: 454.54
= 99% (NMR)
Formula: C18H34N4SO5
MW: 418.55
= 95% (NMR)
Formula: C25H40N4SO10
MW: 588.67
= 99% (NMR)
Formula: C21H39N5SO7
MW: 505.63
Formula: C33H44N4SO10
MW: 688.79
= 99% (NMR)
Formula: C25H33N7F4SO6
MW: 635.63
Formula: C32H56N6S2O9
MW: 732.92
= 96% (HPLC)
Formula: C32H41N6S2O4
MW: 652.96
Formula: C17H24N4S3O2
MW: 412.6
Formula: C16H15N2SO3F5
MW: 410.36
= 98% (HPLC)
Trade Name: Biotin-Sarcosine
Formula: C13H21N3SO4
MW: 315.39
= 97% (NMR)
Formula: C26H40N5S2O10Na
MW: 669.75
= 99% (NMR)
Trade Name: LC-(+)-Biotin hydrazide
Formula: C16H29N5SO3
MW: 371.47
= 99% (NMR)
Formula: C16H30N4SO2
MW: 342.51
= 95% (HPLC)
Trade Name: (+)-Abscisic acid
Formula: C15H20O4
MW: 264.32
= 95% (HPLC)
Formula: C16H25NO2?C8H8O3
MW: 415.53
Formula: C20H18O10
MW: 418.35
=99% by GC
Formula: C20H18O8 H2O
MW: 404.37
= 99% (HPLC)
Trade Name: (+)-2,3-Dibenzoyl-D-tartaric acid monohydrate
Formula: C18H14O8 H2O
MW: 376.32
= 99% (Assay)
Trade Name: L-(+)-Tartaric Acid Dibutyl Ester
Formula: C12H22O6
MW: 262.3
= 98% (GC)
Trade Name: L-(+)-Tartaric acid diethyl ester
Formula: C8H14O6
MW: 206.19
= 98% (GC)
Trade Name: L-(+)-Tartaric acid diisopropyl ester
Formula: C10H18O6
MW: 234.25
= 98% (GC)
Formula: C6H10O6
MW: 178.14
ee =99% (GC)
Trade Name: Di-p-toluyl-D-tartaric acid
Formula: C20H18O8
MW: 386.35
= 99% (HPLC)
Trade Name: L(+)-Ascorbic acid sodium salt
Formula: C6H7O6Na
MW: 198.1
99.0-101.0% (Assay, dried basis)
Trade Name: 2,6-Diacetyl-7,9-Dihydroxy-8,9B-Dimethyldibenzofuran-1,3(2H,9Bh)-Dione
Formula: C18H16O7
MW: 344.32
= 99% (HPLC)
Trade Name: alpha-Hydroxycapric acid
Formula: C10H20O3
MW: 188.27
= 97% (GC)
Trade Name: Fmoc-cis-Acpc
Formula: C21H21NO4
MW: 351.4
= 98% (HPLC)
Trade Name: (-)-(1R,3S)-b-Homocycloleucine
Formula: C6H11NO2
MW: 129.16
= 95% (HPLC)
Trade Name: (-)-(1R,3S)-N-Boc-beta-homocycloleucine
Formula: C11H19NO4
MW: 229.28
= 95% (HPLC)
Trade Name: (-)-(1R,3S)-N-Fmoc-beta-homocycloleucine
Formula: C21H21NO4
MW: 351.4
= 95%
Trade Name: (-)-(1S,4R)-gamma-Homocycloleu-2-ene
Formula: C6H9NO2
MW: 127.14
= 99% (HPLC)
Trade Name: (-)-(1S,4R)-N-Boc-gamma-homocycloleu-2-ene
Formula: C11H17NO4
MW: 227.26
= 98% (HPLC)
Formula: C17H19ClN2
MW: 286.8
= 99.5% (HPLC, Chiral purity)
Formula: C13H12ClN C4H6O6
MW: 367.78
Formula: C35H53NO6
MW: 583.81
= 99% (NMR)
Formula: C35H52NO9SNa
MW: 685.86
Formula: C22H25NO6
MW: 399.43
94.0 to 101.0% (HPLC)
Formula: C20H18O10
MW: 418.35
=99% by GC
Formula: C20H18O8
MW: 386.35
= 99% (HPLC)
Formula: C20H18O8 H2O
MW: 404.37
= 99% (HPLC)
Trade Name: (-)-O,O'-Dibenzoyl-L-tartaric acid
Formula: C18H14O8
MW: 358.3
= 99.0% (HPLC)
Trade Name: (-)-2,3-Dibenzoyl-L-tartaric acid monohydrate
Formula: C18H14O8 H2O
MW: 376.32
= 99% (HPLC)
Trade Name: D-(-)-Tartaric Acid Diethyl Ester
Formula: C8H14O6
MW: 206.19
= 99% (GC, Chiral purity)
Trade Name: D-(-)-Tartaric acid diisopropyl ester
Formula: C10H18O6
MW: 234.25
= 99% (GC)
Trade Name: (S)-(-)-2-Hydroxypropionic acid ethyl ester
Formula: C5H10O3
MW: 118.13
= 99% (GC)
Formula: C22H34O7
MW: 410.5
= 99% (HPLC)
Trade Name: Di-p-toluyl-L-tartaric acid
Formula: C20H18O8
MW: 386.35
= 99.9% (HPLC)
Formula: C51H55NO17
MW: 953.99
Trade Name: Vitamin B2
Formula: C17H20N4O6
MW: 376.4
98.0-102.0% (Assay)
Trade Name: 1,2-Dideoxy-3,4,6-tri-O-acetyl-D-arabino-1-hexenopyranose
Formula: C12H16O7
MW: 272.25
= 99% (Assay)
Trade Name: N-Methyl-2-(phenylsulfonyl)ethan-1-amine
Formula: C9H13NO2S
MW: 199.27
= 96% (HPLC)
Formula: C9H5ClF6O2S
MW: 326.64
= 97% (HPLC)
Formula: C18H19F3N2 2HCl
MW: 393.28
Trade Name: (±)-BINAP
Formula: C44H32P2
MW: 622.67
= 98% (HPLC)
Formula: C10H12O2
MW: 164.2
Trade Name: (±)-9-Methyl-5(10)-octaline-1,6-dione
Formula: C11H14O2
MW: 178.23
= 98.5% (GC)
Formula: C15H20O4
MW: 264.3
= 99% (HPLC)
Trade Name: (±)-Trimethyl-Boc-alpha-phosphonoglycinate
Formula: C10H20NO7P
MW: 297.24
= 98% (TLC)
Trade Name: 1-Chloro-2,3-epoxypropane
Formula: C3H5ClO
MW: 92.52
= 99.9% (GC)
Trade Name: DL-Mevalonic acid lactone
Formula: C6H10O3
MW: 130.14
= 98% (GC)
Trade Name: trans-DL-beta-Pro-4-(1-naphthyl)-OH HCl
Formula: C15H15NO2 HCl
MW: 277.75
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2,3-dichlorophenyl)-OH HCl
Formula: C11H12Cl3NO2
MW: 296.58
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2,3-dimethoxyphenyl)-OH HCl
Formula: C13H17NO4 HCl
MW: 287.74
Trade Name: trans-DL-beta-Pro-4-(2,5-dichlorophenyl)-OH
Formula: C11H12Cl3NO2
MW: 296.58
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
MW: 306.59
Trade Name: trans-DL-beta-Pro-4-(2-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
MW: 262.14
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
MW: 252.7
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(2-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
MW: 245.68
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-furanyl)-OH
Formula: C9H11NO3
MW: 181.19
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(2-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
MW: 243.69
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(2-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
MW: 257.72
= 98% (NMR)
Trade Name: trans-DL-beta-Pro-4-(2-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
MW: 241.72
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-naphthyl)-OH HCl
Formula: C15H15NO2 HCl
MW: 277.75
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-pyridinyl)-OH 2HCl
Formula: C10H12N2O2 2HCl
MW: 265.14
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(2-thienyl)-OH HCl
Formula: C9H11NO2S HCl
MW: 233.71
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(2-trifluoromethylphenyl)-OH
Formula: C12H13ClF3NO2
MW: 295.69
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
MW: 306.59
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
MW: 262.14
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(3-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
MW: 252.7
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
MW: 245.68
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(3-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
MW: 243.69
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
MW: 257.72
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
MW: 241.72
= 98% (TLC)
Trade Name: trans-DL-beta-Pro-4-(3-pyridinyl)-OH 2HCl
Formula: C10H14Cl2N2O2
MW: 265.14
= 99% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-thienyl)-OH HCl
Formula: C9H11NO2S HCl
MW: 233.71
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(3-trifluoromethylphenyl)-OH HCl
Formula: C12H12F3NO2 HCl
MW: 295.69
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-bromophenyl)-OH HCl
Formula: C11H12BrNO2 HCl
MW: 306.59
Trade Name: trans-DL-beta-Pro-4-(4-chlorophenyl)-OH HCl
Formula: C11H13Cl2NO2
MW: 262.14
= 98% (NMR)
Trade Name: trans-DL-beta-Pro-4-(4-cyanophenyl)-OH HCl
Formula: C12H12N2O2 HCl
MW: 252.7
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-fluorophenyl)-OH HCl
Formula: C11H12FNO2 HCl
MW: 245.68
= 98% (NMR)
Trade Name: trans-DL-beta-Pro-4-(4-hydroxyphenyl)-OH HCl
Formula: C11H13NO3 HCl
MW: 243.69
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-methoxyphenyl)-OH HCl
Formula: C12H15NO3 HCl
MW: 257.72
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-methylphenyl)-OH HCl
Formula: C12H15NO2 HCl
MW: 241.72
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-nitrophenyl)-OH HCl
Formula: C11H12N2O4 HCl
MW: 272.69
Trade Name: trans-DL-b-Pro-4-(4-pyridinyl)-OH·2HCl
Formula: C10H12N2O2 2HCl
MW: 265.14
= 98% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(4-trifluoromethylphenyl)-OH HCl
Formula: C12H13ClF3NO2
MW: 295.69
= 99% (HPLC)
Trade Name: trans-DL-beta-Pro-4-(6-methoxy-3-pyridinyl)-OH
Formula: C11H14N2O3
MW: 220.1
= 95% (NMR)
Trade Name: trans-DL-beta-Pro-4-(isopropyl)-OH HCl
Formula: C8H15NO2 HCl
MW: 193.67
= 98% (NMR)
Trade Name: trans-DL-beta-Pro-4-(phenyl)-OH HCl
Formula: C11H13NO2 HCl
MW: 227.69
= 98% (NMR)
Trade Name: (±)-Methyl 2-benzyloxycarbonylamino-2-(dimethoxyphosphinyl)acetate
Formula: C13H18NO7P
MW: 331.27
97.0 +%
Formula: C11H15N HCl
MW: 197.75
= 96% (Assay)
Trade Name: 1,2-Dibromo-1-phenylethane
Formula: C8H8Br2
MW: 263.96
= 98% (HPLC)
Trade Name: Dichloro[1,3-bis(diphenylphosphino)propane]palladium(II) Dichloromethane Adduct
Formula: C27H26P2 PdCl2
MW: 589.78
= 15% (Pd)
Trade Name: 1-(1,3-dimethyl-1H-pyrazol-4-yl)methanamine
Formula: C6H11N3
MW: 125.17
= 99% (Assay)
Formula: C16H13FN2O
MW: 268.29
Formula: C18H18N2OS
MW: 310.42
Trade Name: Methyl 2-(1-aminocyclohexyl)acetate hydrochloride
Formula: C9H17NO2 HCl
MW: 207.7
Formula: C15H15N3
MW: 237.31
Formula: C19H20FNO
MW: 297.37
Trade Name: 1-Benzyl-3-aminomethylpyrrolidine
Formula: C12H18N2
MW: 190.29
Trade Name: 1-(Phenylmethyl)-2-azetidinemethanamine
Formula: C11H16N2
MW: 176.26
= 97% (GC)
Formula: C11H9BrO
MW: 237.1
= 96% (HPLC)
Trade Name: Triethyl N-butylammonium bromide
Formula: C10H24NBr
MW: 238.21
= 99% (Assay)
Trade Name: COMU
Formula: C12H19N4O4 F6P
MW: 428.27
= 99% (HPLC)
Trade Name: (1-Methyl-1H-[1,2,4]triazol-3-yl)methanol
Formula: C4H7N3O
MW: 113.12
= 99% (NMR)
Trade Name: 2-(Aminomethyl)-1-methyl-1H-benzimidazole
Formula: C9H11N3
MW: 161.21
= 98% (GC)
Formula: C5H8N2O
MW: 112.13
= 95% (NMR)
Trade Name: 1-(1-Methyl-1H-pyrazol-4-yl)methanamine hydrochloride
Formula: C5H9N3 HCl
MW: 147.65
= 95%
Formula: C10H10F3N3
MW: 229.2
= 95% (NMR)
Trade Name: Isopropylboronic acid
Formula: C3H9BO2
MW: 87.91
= 99% (GC)
Trade Name: (4-Methylnaphthalen-1-yl)methanol
Formula: C12H12O
MW: 172.23
= 96% (HPLC)
Trade Name: D-beta-HomoAla(1-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
MW: 265.74
= 98% (Chiral Purity)
Trade Name: 1-([(Isocyano)(phenyl)methyl]sulphonyl)-4-methylbenzene
Formula: C15H13NO2S
MW: 271.34
= 97% (NMR)
Formula: C13H20N2
MW: 204.32
Trade Name: 4-(1-Pyrenyl)butyric hydrazide
Formula: C20H18N2O
MW: 302.37
Formula: C21H19N5
MW: 341.42
Formula: C12H14N2O2
MW: 218.26
Formula: C9H8N2O2
MW: 176.17
Trade Name: (1H-1,3-Benzodiazol-2-ylmethyl)(methyl)amine
Formula: C9H11N3 2HCl
MW: 234.21
= 98% (NMR)
Trade Name: 5-Boc-amino-benzoimidazole
Formula: C12H15N3O2
MW: 233.27
= 96%
Trade Name: 1H-Imidazole-2-methanamine
Formula: C4H7N3
MW: 97.12
= 96% (HPLC)
Formula: C9H10N2 HCl
MW: 182.65
Formula: C9H10N2
MW: 146.19
= 95% (NMR)
Trade Name: 5-(Aminomethyl)indole
Formula: C9H10N2
MW: 146.19
= 97% (GC)
Trade Name: 6-Boc-amino-1H-indole
Formula: C13H16N2O2
MW: 232.28
Trade Name: 7-(Aminomethyl)indole oxalate
Formula: C9H10N2 C2H2O4
MW: 236.22
= 96% (Assay)
Trade Name: (1R,2R)-(+)-1,2-Diamino-1,2-diphenylethane
Formula: C14H16N2
MW: 212.29
= 99.5% (HPLC, Chiral purity)
Formula: C6H14N2
MW: 114.2
= 98% (GC)
Trade Name: D-(-)-threo-2-Amino-1-(p-nitrophenyl)-1,3-propanediol
Formula: C9H12N2O4
MW: 212.2
= 99% (Assay)
Formula: C21H22N2O2S
MW: 366.48
= 99% (Assay, Chiral purity)
Formula: C16H20N2O2
MW: 272.3
Formula: C11H22N2O2
MW: 214.31
= 98% (GC)
Formula: C10H20N2O2
MW: 200.28
= 98% (NMR)
Trade Name: (1R,2R)-Boc-Achc
Formula: C12H21NO4
MW: 243.3
= 98% (HPLC)
Trade Name: (1R,2R)-Boc-Acpc
Formula: C11H19NO4
MW: 229.28
= 98% (NMR)
Trade Name: (-)-Camphanoyl chloride
Formula: C10H13ClO3
MW: 216.66
Trade Name: (1S,2R)-Boc-Achc
Formula: C12H21NO4
MW: 243.3
= 97% (assay)
Trade Name: (1S,2R)-Fmoc-Achc
Formula: C22H23NO4
MW: 365.43
= 97% (HPLC)
Formula: C6H14N2
MW: 114.2
= 99% (GC, Chiral purity)
Formula: C21H22N2O2S
MW: 366.48
= 99% (Assay, Chiral purity)
Trade Name: (1S,2S)-(-)-1,2-Diamino-1,2-diphenylethane
Formula: C14H16N2
MW: 212.29
= 99.5% (HPLC, Chiral purity)
Formula: C11H22N2O2
MW: 214.31
= 97% (TLC)
Trade Name: (1S,2S)-Boc-Acpc
Formula: C11H19NO4
MW: 229.28
= 96% (HPLC)
Trade Name: (1S,2S)-Boc-1,2-diaminocyclopentane
Formula: C10H20N2O2
MW: 200.28
= 98% (Chiral Purity)
Trade Name: (-)-(1S,4R)-N-Fmoc-4-aminocyclopent-2-ene-1-carboxylic acid
Formula: C21H19NO4
MW: 349.39
= 98% (HPLC)
Formula: C7H7F3N2 2HCl
MW: 249.06
= 99% (Assay)
Trade Name: 2,3-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
MW: 190.07
= 96% (HPLC)
Trade Name: 2,3-Dihydro-1,4-benzodioxin-6-ylhydrazine
Formula: C8H10N2O2
MW: 166.18
= 95% (NMR)
Formula: C9H13BO4
MW: 196
= 95% (NMR)
Trade Name: 2,4-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
MW: 190.07
= 96% (HPLC)
Trade Name: 2,5-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
MW: 190.07
= 96% (HPLC)
Formula: C9H13BO4
MW: 196
= 95% (NMR)
Formula: C12H16BNO3
MW: 233.07
Trade Name: NHS-SS-(+)-Biotin
Formula: C19H28N4S3O6
MW: 504.65
Formula: C11H15F3N2 2HCl
MW: 305.17
Trade Name: N-(2-Dimethylamino-2-phenylethyl)amine
Formula: C10H16N2
MW: 164.25
= 98% (NMR)
Formula: C13H20N2O2
MW: 236.31
Trade Name: N2,N2-Dimethyl-1-phenyl-ethane-1,2-diamine
Formula: C10H16N2
MW: 164.25
= 95% (HPLC)
Formula: C5H9N3O
MW: 127.15
= 98% (HPLC)
Trade Name: 2-Amino-5-bromo-3-(hydroxymethyl)pyridine
Formula: C6H7BrN2O
MW: 203.04
= 98%
Formula: C12H18N2O2
MW: 222.29
Formula: C12H18N2O2
MW: 222.29
Trade Name: N-Boc-N-ethylethylenediamine
Formula: C9H20N2O2
MW: 188.27
> 96% (HPLC)
Formula: C13H20N2O2
MW: 236.31
= 90%
Formula: C12H18N2O2
MW: 222.29
Trade Name: 2-Amino-3-(hydroxymethyl)pyridine
Formula: C6H8N2O
MW: 124.14
= 99% (Assay)
Trade Name: 2-Amino-3-(4-bromobenzoyl)thiophene
Formula: C11H8BrNOS
MW: 282.16
= 98% (HPLC)
Trade Name: 2-(Cyanomethyl)benzimidazole
Formula: C9H7N3
MW: 157.18
Trade Name: 2-(1,3-Benzothiazol-2-ylsulfanyl)acetic acid
Formula: C9H7NO2S2
MW: 225.29
= 98% (Titration)
Formula: C11H12N2S
MW: 204.3
= 95% (NMR)
Formula: C11H12N2S 2HCl
MW: 277.22
Trade Name: 2-Bromo-4-(hydroxymethyl)-1,3-thiazole
Formula: C4H4BrNOS
MW: 194.05
= 95% (NMR)
Formula: C7H6ClNO3
MW: 187.58
Formula: C5H9ClO
MW: 120.58
= 95% (NMR)
Formula: C7H16ClO4P
MW: 230.63
= 98% (GC)
Trade Name: 2-Chloro-3-pyridine methylamine
Formula: C6H7ClN2
MW: 142.59
= 98% (HPLC)
Trade Name: Ethyl 2-(2-cyanophenyl)acetate
Formula: C11H11NO2
MW: 189.21
Trade Name: 2-Fluorobenzoyl cyanide
Formula: C8H4FNO
MW: 149.12
= 95% (NMR)
Trade Name: L-beta-HomoAla(2-furyl)-OH
Formula: C8H11NO3
MW: 169.18
= 98% (TLC)
Formula: C18H19NO4
MW: 313.35
Trade Name: 3-Butyn-1-ol
Formula: C4H6O
MW: 70.09
= 99% (GC)
Trade Name: tert-Butyl (2-hydroxyethyl)phenylcarbamate
Formula: C13H19NO3
MW: 237.3
Trade Name: 2-(N-Boc-propylamino)ethanol
Formula: C10H21NO3
MW: 203.28
> 96% (HPLC)
Trade Name: Benzyl trans-(2-hydroxymethyl)cyclohexylcarbamate
Formula: C15H21NO3
MW: 263.34
Formula: C11H12N2S
MW: 204.3
Trade Name: (Acetyloxy)(2-methoxy-4-nitrophenyl)methyl acetate
Formula: C12H13NO7
MW: 283.24
Formula: C21H22BrOP
MW: 401.28
= 98% (Assay)
Trade Name: 4-Methylcatecholdimethylacetate
Formula: C13H16O6
MW: 268.26
Formula: C9H11N3
MW: 161.21
= 96% (NMR)
Formula: C11H11NO
MW: 173.21
Trade Name: (2-Methyl-1,3-thiazol-4-yl)methylamine
Formula: C5H8N2S
MW: 128.2
= 95% (NMR)
Trade Name: N-Methyl-2-(4-morpholinyl)-1-phenylethanamine
Formula: C13H20N2O
MW: 220.31
= 95% (HPLC)
Trade Name: D-beta-HomoAla(2-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
MW: 265.74
= 99% (HPLC)
Trade Name: L-beta-HomoAla(2-naphthyl)-OH HCl
Formula: C14H15NO2 HCl
MW: 265.74
= 98%
Formula: C11H12N2S
MW: 204.3
= 95% (NMR)
Trade Name: 2-(2-Oxo-1,2-dihydropyrimidin-1-yl)acetic acid
Formula: C6H6N2O3
MW: 154.12
= 98% (HPLC)
Formula: C9H7NO3
MW: 177.2
= 95% (NMR)
Trade Name: 1-(Boc-amino)-3-pyridin-4-yl-propan-2-one
Formula: C13H18N2O3
MW: 250.3
= 96% (HPLC)
Trade Name: (2-(4-Methylphenyl)-1,3-thiazol-4-yl)methylamine
Formula: C11H12N2S
MW: 204.3
Formula: C10H10N2O HCl
MW: 210.66
= 95% (NMR)
Formula: C10H10N2S
MW: 190.27
Trade Name: (Pyridin-2-yl)methylsulfonyl chloride trifluoromethylsulphonic acid salt
Formula: C6H6ClNO2S CHF3O3S
MW: 341.71
Trade Name: D-beta-HomoAla(2-thienyl)-OH HCl
Formula: C8H11NO2S HCl
MW: 221.7
= 98% (HPLC)
Trade Name: L-beta-HomoAla(2-thienyl)-OH HCl
Formula: C8H11NO2S HCl
MW: 221.7
= 98% (HPLC)
Trade Name: 3,4-Dihydro-2H-1,4-benzothiazin-3-one
Formula: C8H7NOS
MW: 165.22
= 99% (HPLC)
Formula: C2H5N5
MW: 99.1
= 95% (NMR)
Trade Name: (R)-(-)-Oxirane-2-methanol p-toluenesulfonate
Formula: C10H12O4S
MW: 228.26
= 99% (HPLC, Chiral purity)
Trade Name: Fmoc-D-Abu(3R-Boc-Amino)-OH
Formula: C24H28N2O6
MW: 440.5
= 99% (HPLC)
Trade Name: Fmoc-D-Abu(3R-Alloc-amino)-OH
Formula: C23H24N2O6
MW: 424.4
= 98% (HPLC)
Trade Name: Fmoc-D-Abu(3R-N3)-OH
Formula: C19H18N4O4
MW: 366.4
= 98% (HPLC)
Formula: C9H11NO3
MW: 181.19
= 98% (TLC)
Formula: C10H13NO3
MW: 195.22
= 95% (HPLC)
Trade Name: Fmoc-D-Abu(3S-N3)-OH
Formula: C19H18N4O4
MW: 366.4
= 99% (HPLC)
Formula: C25H28N2O6
MW: 452.51
= 99% (HPLC)
Trade Name: (2R,4R)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
MW: 291.35
= 99% (HPLC)
Formula: C25H28N2O6
MW: 452.51
= 99% (HPLC)
Formula: C14H25NO5
MW: 287.35
= 95% (NMR)
Formula: C25H28N2O6
MW: 452.51
= 99% (HPLC)
Formula: C11H19NO5
MW: 245.28
= 97% (NMR)
Trade Name: (2R,4S)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
MW: 291.35
= 97% (HPLC)
Formula: C25H28N2O6
MW: 452.51
= 98% (HPLC)
Formula: C21H21NO5
MW: 367.4
= 97% (HPLC)
Trade Name: (3R)-Trichloromethyl-cis-tetrahydropyrrolo[1,2-c]oxazol-1-one
Formula: C7H8Cl3NO2
MW: 244.5
= 97%
Trade Name: (S)-(+)-Oxirane-2-methanol p-toluenesulfonate
Formula: C10H12O4S
MW: 228.26
= 99% (HPLC, Chiral purity)
Formula: C16H21NO2 HCl
MW: 295.81
= 95% (NMR)
Trade Name: (S)-2-Isobutyl-piperazine-1-carboxylic acid tert-butyl ester
Formula: C13H26N2O2
MW: 242.36
Formula: C9H16N4O3 C2H4O2
MW: 228.25
= 97% (HPLC)
Formula: C9H16N4O3
MW: 228.25
= 96% (HPLC)
Formula: C23H36N2O6
MW: 436.55
= 95% (HPLC)
Trade Name: Methyl-(S)-oxiranecarboxylate
Formula: C4H6O3
MW: 102.09
= 98% (GC)
Formula: C34H38N4O7S
MW: 646.76
= 98% (HPLC)
Formula: C34H38N4O7S
MW: 646.76
= 98% (HPLC)
Trade Name: (2S,4S)-Boc-4-trifluoromethyl-pyrrolidine-2-carboxylic acid
Formula: C11H16F3NO4
MW: 283.24
= 99% (HPLC)
Trade Name: Fmoc-PBD
Formula: C29H25N3O6
MW: 511.53
= 99% (HPLC)
Formula: C25H30N2O5
MW: 438.52
= 99% (HPLC)
Trade Name: Fmoc-L-Abu(3R-Alloc-amino)-OH
Formula: C23H24N2O6
MW: 424.4
= 98% (HPLC)
Trade Name: Fmoc-L-Abu(3R-N3)-OH
Formula: C19H18N4O4
MW: 366.4
= 99% (HPLC)
Formula: C7H13NO2
MW: 143.19
Trade Name: Boc-(2S,3R)-AHNPB-OH
Formula: C15H20N2O7
MW: 340.3
= 99% (TLC)
Trade Name: Fmoc-L-Abu(3S-Boc-Amino)-OH
Formula: C24H28N2O6
MW: 440.5
= 98% (HPLC)
Trade Name: Fmoc-L-Abu(3S-Alloc-amino)-OH
Formula: C23H24N2O6
MW: 424.4
= 99% (HPLC)
Trade Name: Fmoc-L-Abu(3S-N3)-OH
Formula: C19H18N4O4
MW: 366.4
= 99% (HPLC)
Formula: C22H23NO4
MW: 365.43
Formula: C7H13NO2
MW: 143.19
Formula: C6H12F3NO HCl
MW: 207.62
= 99% (TLC)
Formula: C9H11NO3
MW: 181.19
Trade Name: (2S,3S)-H-Apns-OH HCl
Formula: C10H13NO3 HCl
MW: 231.68
= 99% (HPLC)
Formula: C7H15NO3
MW: 161.2
= 99% (TLC)
Trade Name: Fmoc-(2S,3S)-3-amino-2-hydroxy-4-phenylbutyric acid
Formula: C25H23NO5
MW: 417.46
Trade Name: (2S,4S)-Fmoc-4-tritylmercapto-pyrrolidine-2-carboxylic acid
Formula: C39H33NO4S
MW: 611.76
= 99% (HPLC)
Formula: C23H27N3O3S
MW: 425.55
= 98% (HPLC)
Trade Name: [2S,3S,5S]-2-amino-3-hydroxy-5-tert-butyloxycarbonylamino-1,6-diphenylhexane succinate salt
Formula: (C23H32N2O3 C4H6O4
MW: 887.121
Formula: C14H18N2O4 HCl
MW: 314.77
Trade Name: Boc-(2S,4R)-Pro(N3)-OH DCHA
Formula: C22H39N5O4
MW: 437.6
= 98% (HPLC)
Trade Name: Fmoc-trans-4-fluoro-L-Pro-OH
Formula: C20H18FNO4
MW: 355.37
= 97% (HPLC, Chiral purity)
Trade Name: trans-4-Fluoro-L-Pro-OH
Formula: C5H8FNO2
MW: 133.12
= 97% (HPLC)
(2S,4R)-Boc- 4-azido-pyrrolidine-2-carboxylic acid·DCHA
Trade Name: Boc-trans-Pro(4-azido)-OH DCHA
Formula: C10H16N4O4 C12H23N
MW: 437.58
Trade Name: (2S,4R)-Boc-4-(2-naphthylmethoxy)-Pro-OH
Formula: C21H25NO5
MW: 371.43
= 99% (HPLC)
Trade Name: (2S,4R)-Boc-4-(2-naphthyloxy)-Pro-OH
Formula: C20H23NO5
MW: 357.41
= 97% (HPLC)
Formula: C25H28N2O6
MW: 452.51
= 97% (HPLC)
Formula: C16H27NO4
MW: 297.39
= 99% (HPLC)
Trade Name: (2S,4R)-Boc-4-phenoxy-Pro-OH
Formula: C16H21NO5
MW: 307.35
= 99% (HPLC)
Trade Name: (2S,4R)-Boc-4-phenyl-Pro-OH
Formula: C16H21NO4
MW: 291.35
= 97% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-(2-naphthylmethyl)-Pro-OH
Formula: C31H27NO4
MW: 477.56
= 98% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-(4-bromobenzyl)-Pro-OH
Formula: C27H24NO4Br
MW: 506.4
= 98% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-(4-fluorobenzyl)-Pro-OH
Formula: C27H24NO4F
MW: 445.49
= 97% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-(4-phenylbenzyl)-Pro-OH
Formula: C33H29NO4
MW: 503.6
= 99% (HPLC)
Trade Name: Boc-L-cis-Pro(4-CH2NH-Fmoc)-OH
Formula: C26H30N2O6
MW: 466.53
= 98% (HPLC)
Trade Name: Fmoc-(4R)-azido-L-Proline
Formula: C20H18N4O4
MW: 378.4
= 99% (HPLC)
Formula: C26H29NO4
MW: 419.52
= 99% (HPLC)
Formula: C26H23NO5
MW: 429.47
= 98% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-phenyl-Pro-OH
Formula: C26H23NO4
MW: 413.47
= 99% (HPLC)
Trade Name: (2S,4R)-Fmoc-4-tritylmercapto-pyrrolidine-2-carboxylic acid
Formula: C24H23NO2S
MW: 611.75
= 99% (HPLC)
Trade Name: (2S,4R)-gamma-Hydroxy-L-Glu-OH
Formula: C5H9NO5
MW: 163.1
= 98% (TLC)
Formula: C14H18N2O4 HCl
MW: 314.77
Trade Name: cis-4-Fluoro-L-Pro-OH
Formula: C5H8FNO2
MW: 133.12
= 97% (NMR)
Trade Name: Boc-cis-Pro(4-azido)-OH
Formula: C10H16N4O4
MW: 256.26
= 99% (HPLC)
Trade Name: (2S,4S)-Boc-4-(2-naphthyloxy)-Pro-OH
Formula: C20H23NO5
MW: 357.41
= 98% (HPLC)
Trade Name: (2S,4S)-Boc-4-cyclohexyl-Pro-OH
Formula: C16H27NO4
MW: 297.39
= 97% (assay)
Trade Name: (2S,4S)-Boc-4-phenoxy-Pro-OH
Formula: C16H21NO5
MW: 307.35
= 99% (HPLC)
Trade Name: Fmoc-HoPro(Fmoc)-OH
Formula: C36H32N2O6
MW: 588.66
Trade Name: Boc-L-trans-Pro(4-CH2NH-Fmoc)-OH
Formula: C26H30N2O6
MW: 466.53
= 97% (HPLC)
Trade Name: Fmoc-cis-Pro(4-azido)-OH
Formula: C20H18N4O4
MW: 378.39
= 99% (HPLC)
Trade Name: (2S,4S)-Fmoc-4-cyclohexyl-Pro-OH
Formula: C26H29NO4
MW: 419.52
= 99% (HPLC)
Trade Name: Fmoc-cis-4-fluoro-Pro-OH
Formula: C20H18NO4F
MW: 355.36
= 99% (HPLC)
Trade Name: Fmoc-L-cis-4-phenoxyproline
Formula: C26H23NO5
MW: 429.47
= 98% (HPLC)
Formula: C21H18F3NO4
MW: 405.37
= 98% (HPLC)
Trade Name: (2S,4S)-gamma-Hydroxy-L-Glu-OH
Formula: C5H9NO5
MW: 163.1
= 96% (TLC)
Formula: C11H13NO2
MW: 191.26
Trade Name: Boc-cis-5-methyl-Pro-OH
Formula: C11H19NO4
MW: 229.28
Trade Name: Fmoc-cis-5-methyl-Pro-OH
Formula: C21H21NO4
MW: 351.4
Formula: C7H14O3
MW: 146.19
Trade Name: [(3,4-Dichlorophenyl)methyl]sulfonyl chloride
Formula: C7H5Cl3O2S
MW: 259.54
= 95% (HPLC)
Trade Name: 3,4-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
MW: 190.07
= 96% (HPLC)
Trade Name: 3,5-Dichloro-N-ethylbenzenamine
Formula: C8H9Cl2N
MW: 190.07
= 96% (HPLC)
Trade Name: 3,5-Dichloro-alpha-toluenesulfonyl chloride
Formula: C7H5Cl3O2S
MW: 259.54
= 95% (NMR)
Formula: C6H9N3O2
MW: 155.16
Formula: C7H13N3 2HCl
MW: 211.06
= 98%
Trade Name: 2-(3,5-Dimethyl-1,2-oxazol-4-yl)acetic acid
Formula: C7H9NO3
MW: 155.15
= 99% (HPLC)
Formula: C7H10N2O2
MW: 154.17
= 95% (NMR)
Formula: C16H12BrClN2O
MW: 363.64
Formula: C16H13ClN2O
MW: 284.75
= 99% (HPLC)
Formula: C16H13FN2O
MW: 268.29
= 98% (HPLC)
Formula: C14H7ClF6O3S
MW: 404.71
Trade Name: 3-[3,5-Bis(trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C14H7ClF6O2S
MW: 388.71
Formula: C13H8ClF3O3S
MW: 336.72
Formula: C13H8ClF3O2S
MW: 320.72
= 95% (Assay)
Trade Name: 3-Boc-aminobutylamine
Formula: C9H20N2O2
MW: 188.27
= 98% (NMR)
Trade Name: tert-Butyl 3-amino-2-methylphenylcarbamate
Formula: C12H18N2O2
MW: 222.29
Formula: C11H15ClN2O2
MW: 242.7
Trade Name: tert-Butyl 3-amino-4-fluorophenylcarbamate
Formula: C11H15FN2O2
MW: 226.25
Formula: C15H24N2O2
MW: 264.37
Formula: C6H12N2O2
MW: 144.17
Trade Name: 3-Amb-OH HCl
Formula: C8H9NO2 HCl
MW: 187.64
Trade Name: 3-Amino-4-hydroxymethylpyridine
Formula: C6H8N2O
MW: 124.14
= 95% (NMR)
Trade Name: D-beta-HomoAla(3-benzothienyl)-OH HCl
Formula: C12H13NO2S HCl
MW: 271.76
= 98% (HPLC)
Formula: C15H14O3
MW: 242.27
= 99% (HPLC)
Trade Name: N'-(3-Benzyloxyphenyl)-hydrazinium chloride
Formula: C13H14N2O HCl
MW: 250.73
= 98% (HPLC)
Formula: C18H23N3O4
MW: 345.4
Formula: C15H21N3O4
MW: 307.35
Formula: C15H21N3O4
MW: 307.35
Formula: C22H28N2O4
MW: 384.47
Trade Name: tert-Butyl 3-bromopyridin-4-ylcarbamate
Formula: C10H13BrN2O2
MW: 273.13
= 95% (HPLC)
Trade Name: 3-Bromobenzoyl cyanide
Formula: C8H4BrNO
MW: 210.03
= 95% (NMR)
Formula: C6H7ClN2 2HCl
MW: 215.51
= 99% (Assay)
Formula: C9H9ClO2
MW: 184.62
= 96% (Assay)
Trade Name: 3-Chlorobenzoyl cyanide
Formula: C8H4ClNO
MW: 165.58
= 96% (HPLC)
Formula: C12H10ClNO
MW: 219.67
Trade Name: (1-Ethyl-1H-imidazol-5-yl)methanol
Formula: C6H10N2O
MW: 126.16
= 95% (NMR)
Trade Name: 1-(Carboxymethyl)indole-3-carboxaldehyde
Formula: C11H9NO3
MW: 203.19
= 97% (HPLC)
Formula: C11H8N2O
MW: 184.2
= 99% (HPLC)
Trade Name: 3-(2,3-Epoxypropyloxy)propyltriethoxysilane
Formula: C12H26O5Si
MW: 278.42
= 98% (GC)
Trade Name: tert-Butyl 3-hydroxycyclohexyl carbamate
Formula: C11H21NO3
MW: 215.29
= 98% (NMR)
Formula: C6H11NO3
MW: 145.16
= 97% (HPLC)
Trade Name: tert-Butyl 3-(hydroxymethyl)-1H-indol-4-ylcarbamate
Formula: C14H18N2O3
MW: 262.31
Trade Name: Ethyl 3-hydroxyphenylacetate
Formula: C10H12O3
MW: 180.2
= 99% (GC)
Trade Name: 4-(Boc-amino)-3-iodopyridine
Formula: C10H13IN2O2
MW: 320.13
= 95% (HPLC)
Trade Name: 3-(Trimethoxysilyl)-1-propanethiol
Formula: C6H16O3SSi
MW: 196.34
= 98.5% (TIPT)
Trade Name: 3-Methoxybenzoyl cyanide
Formula: C9H7NO2
MW: 161.16
= 96% (HPLC)
Trade Name: 1-(3-Methoxybenzoyl)piperazine
Formula: C12H16N2O2
MW: 220.27
= 95% (NMR)
Formula: C5H7N3O3
MW: 157.13
= 95% (NMR)
Formula: C5H8N2O HCl
MW: 148.59
= 98% (NMR)
Formula: C6H8N2O2
MW: 140.14
Formula: C11H12N2O
MW: 188.23
Trade Name: N'-(3-Phenoxyphenyl)hydrazinium chloride
Formula: C12H12N2O HCl
MW: 236.7
= 95% (HPLC)
Trade Name: 1-(3-Phenyl-1H-pyrazol-4-yl)methanamine
Formula: C10H11N3
MW: 173.22
= 95% (NMR)
Trade Name: 5-(Aminomethyl)-3-phenylisoxazole
Formula: C10H10N2O
MW: 174.2
= 99%
Trade Name: Methyl-(3-phenyl-propyl)amine
Formula: C10H15N
MW: 149.24
= 95%
Trade Name: (3-Pyridyl)-D-beta-homoalanine dihydrochloride
Formula: C9H12N2O2 2HCl
MW: 253.13
= 98% (HPLC)
Trade Name: Pyridin-3-yl(2-thienyl)methanol
Formula: C10H9NOS
MW: 191.25
Formula: C6H6ClNO2S CHF3O3S
MW: 341.71
= 95% (NMR)
Trade Name: D-beta-HomoAla(3-thienyl)-OH HCl
Formula: C8H11NO2S HCl
MW: 221.7
= 99%
Trade Name: L-beta-HomoAla(3-thienyl)-OH
Formula: C8H12ClNO2S
MW: 221.7
= 98% (TLC)
Formula: C3H6ClNO HCl
MW: 144
Formula: C7H6F3NO HCl
MW: 213.59
= 98.0% (HPLC)
Formula: C7H7F3N2 HCl
MW: 212.6
= 90% (NMR)
Trade Name: D-Tic-OH
Formula: C10H11NO2
MW: 177.2
= 99% (Assay)
Trade Name: D-Tic-OtBu HCl
Formula: C14H19NO2 HCl
MW: 269.7
= 98% (HPLC)
Trade Name: D-Tic(OH)-OH
Formula: C10H11NO3
MW: 193.2
= 98% (HPLC)
Formula: C16H28N2O4 H3O4P
MW: 410.4
Trade Name: Tic-OH
Formula: C10H11NO2
MW: 177.2
= 98% (HPLC)
Trade Name: Tic(OH)-OH·2 H2O
Formula: C10H11NO3 2H2O
MW: 229.2
= 99% (HPLC)
Formula: C18H24N2O5
MW: 348.4
= 95% (HPLC)
Formula: C15H26N2O5
MW: 314.38
= 98% (HPLC)
Trade Name: (S)-4-Carboxymethyl-2-methyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester
Formula: C12H20N2O5
MW: 272.3
= 97% (HPLC)
Formula: C28H26N2O5
MW: 470.52
= 99% (HPLC)
Formula: C25H28N2O5
MW: 436.51
= 97% (HPLC)
Formula: C22H22N2O5
MW: 394.43
= 97% (HPLC)
Formula: C7H8Cl3NO2
MW: 244.5
= 97% (NMR)
Trade Name: AHPPA-OH
Formula: C11H15NO3
MW: 209.3
= 97%
Trade Name: 2-[4-(4-fluorophenyl)phenyl]acetic acid
Formula: C14H11FO2
MW: 230.24
= 95% (HPLC)
Formula: C19H23ClN2O 2HCl
MW: 403.78
Trade Name: 4-(2-Pyridyloxy)benzenesulfonyl chloride hydrochloride
Formula: C11H8ClNO3S HCl
MW: 306.17
= 95% (NMR)
Trade Name: trans-DL-(4-(4-Methylphenyl)pyrrolidin-3-yl)carbamic acid tert-butyl ester
Formula: C16H24N2O2
MW: 276.38
Trade Name: 4-(4-Pyridyloxy)benzenesulfonyl chloride hydrochloride
Formula: C11H8ClNO3S HCl
MW: 306.17
Formula: C13H8ClF3O3S
MW: 336.72
Formula: C15H11F6NO
MW: 335.25
Formula: C14H7ClF6O3S
MW: 404.71
Formula: C15H11F6N HCl
MW: 355.71
Trade Name: 4-[3,5-Bis(trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C14H7ClF6O2S
MW: 388.71
Formula: C13H8ClF3O3S
MW: 336.72
= 99% (HPLC)
Formula: C14H12F3N HCl
MW: 287.71
= 95% (NMR)
Trade Name: 4-[4-(Trifluoromethyl)phenyl]benzenesulfonyl chloride
Formula: C13H8ClF3O2S
MW: 320.72
= 99% (GC)
Trade Name: tert-Butyl 4-amino-2-methylphenylcarbamate
Formula: C12H18N2O2
MW: 222.29
Trade Name: tert-Butyl 4-amino-3-methylphenylcarbamate
Formula: C12H18N2O2
MW: 222.29
Trade Name: 4-(Aminomethyl)benzyl alcohol hydrochloride
Formula: C8H11NO HCl
MW: 173.64
= 95% (NMR)
Formula: C12H18BNO2
MW: 219.09
= 99% (GC)
Trade Name: N3-PhAc-OH
Formula: C8H7N3O2
MW: 177.2
= 98% (HPLC)
Trade Name: N-[(4-Benzylmorpholin-2-yl)methyl]-N-ethylethanamine
Formula: C16H26N2O
MW: 262.39
= 96% (HPLC)
Trade Name: (4-Benzylmorpholin-2-yl)-N,N-dimethylmethanamine
Formula: C14H22N2O
MW: 234.34
= 96% (HPLC)
Trade Name: N-((4-Benzylmorpholin-2-yl)methyl)ethanamine
Formula: C14H22N2O
MW: 234.34
= 96% (HPLC)
Trade Name: (4-Benzylmorpholin-2-yl)-N-methyl methanamine
Formula: C13H20N2O
MW: 220.31
= 96% (HPLC)
Formula: C12H18N2O
MW: 206.29
= 95% (NMR)
Formula: C12H21NO5
MW: 259.3
= 97% (HPLC)
Formula: C12H21NO4S
MW: 275.36
= 99% (HPLC)
Formula: C17H25N3O4
MW: 335.4
Trade Name: 2-(4-Bromo-2-nitrophenyl)acetic acid
Formula: C8H6BrNO4
MW: 260.04
= 98% (HPLC)
Formula: C7H9BrN2
MW: 201.07
= 95% (NMR)
Formula: C10H19Br
MW: 219.16
= 95% (NMR)
Formula: C9H10N2O2
MW: 178.19
= 96%
Trade Name: 2-(4-Chlorophenyl)acetaldehyde
Formula: C8H7ClO
MW: 154.6
= 95% (NMR)
Trade Name: 4-Chlorobenzoyl cyanide
Formula: C8H4ClNO
MW: 165.58
= 99% (GC)
Trade Name: 4-Chlorobenzhydrylamine
Formula: C13H12ClN
MW: 217.7
= 97% (HPLC)
Formula: C10H10O3 H2O
MW: 196.2
= 99% (HPLC)
Trade Name: 2-(4-Ethoxyphenyl)-2-oxoacetonitrile
Formula: C10H9NO2
MW: 175.19
= 96% (HPLC)
Trade Name: tert-Butyl 4-fluoro-3-nitrobenzylcarbamate
Formula: C12H15FN2O4
MW: 270.26
= 97% (assay)
Formula: C15H16FNO
MW: 245.3
Trade Name: 2-(4-fluorophenyl)acetaldehyde
Formula: C8H7FO
MW: 138.14
= 95% (GC)
Trade Name: (4-Fluorobenzyl)sulfonyl chloride
Formula: C7H6ClFO2S
MW: 208.64
= 95% (NMR)
Trade Name: 4-Fluorobenzoyl cyanide
Formula: C8H4FNO
MW: 149.12
> 96% (HPLC)
Formula: C27H32N2O6
MW: 480.56
= 98% (HPLC)
Formula: C22H23NO5
MW: 381.43
= 97% (HPLC)
Formula: C22H23NO4S
MW: 397.49
= 99% (HPLC)
Formula: C9H13N3O3
MW: 211.22
= 99% (HPLC)
Trade Name: N-tert-Butoxycarbonyl-3-amino-4-iodo-pyridine
Formula: C10H13IN2O2
MW: 320.13
= 95% (HPLC)
Formula: C11H11BO3
MW: 202
= 95% (NMR)
Formula: C5H7NOS
MW: 129.18
= 95% (GC)
Trade Name: 2-(Aminomethyl)-4-methylpyridine hydrochloride
Formula: C7H10N2 HCl
MW: 158.63
= 95% (HPLC)
Trade Name: Ethyl (4-methyl-1,3-thiazol-2-yl)acetate
Formula: C8H11NO2S
MW: 185.25
= 99% (HPLC)
Trade Name: Tos-Gly-OH
Formula: C9H11NO4S
MW: 229.26
= 98% (HPLC)
Formula: C9H8N2O3
MW: 192.17
Formula: C11H16N2O
MW: 192.26
= 99% (HPLC)
Trade Name: 2-Cyanomethyl-4-phenylthiazole
Formula: C11H8N2S
MW: 200.26
= 98% (HPLC)
Trade Name: 2-Hydrazino-4-phenyl-1,3-thiazole hydrochloride
Formula: C9H9N3S HCl
MW: 227.72
= 97% (HPLC)
Trade Name: (4-phenyl-1,3-thiazol-2-yl)methanamine
Formula: C10H10N2S
MW: 190.27
= 94% (HPLC)
Trade Name: Methyl-(4-phenylbutyl)-amine hydrochloride
Formula: C11H17N HCl
MW: 199.72
= 95% (NMR)
Trade Name: trans-DL-(4-Phenylpyrrolidin-3-yl)carbamic acid tert-butyl ester
Formula: C15H22N2O2
MW: 262.35
= 98% (HPLC)
Formula: C12H17NO HCl
MW: 227.73
= 96% (Assay)
Trade Name: 4-(2'-Pyridyl)phenylacetic acid
Formula: C13H11NO2
MW: 213.24
= 96% (HPLC)
Trade Name: 4-(4'-Pyridyl)phenylacetic acid
Formula: C13H11NO2
MW: 213.24
= 97% (HPLC)
Trade Name: D-beta-HomoAla(4-pyridyl)-OH 2HCl
Formula: C9H14Cl2N2O2
MW: 253.13
= 98% (HPLC)
Formula: C6H6ClNO2S CHF3O3S
MW: 341.71
= 90% (NMR)
Trade Name: [4-[(tert-Butoxycarbonyl)amino]-1H-indol-1-yl]acetic acid
Formula: C15H18N2O4
MW: 290.32
Formula: C16H23NO HCl
MW: 281.83
Formula: C7H7F3N2 HCl
MW: 212.6
= 99%
Formula: C7H7F3N2 HCl
MW: 212.6
= 98% (HPLC)
Trade Name: Fmoc-L-Thz(Me2)-OH
Formula: C21H21NO4S
MW: 383.5
= 99% (HPLC)
Formula: C25H31NO5
MW: 425.52
= 98% (HPLC)
Trade Name: N-tert-Butoxycarbonyl-gamma-L-isoleucine
Formula: C13H25NO4
MW: 259.35
= 98% (Assay)
Trade Name: N-(9-Fluorenylmethoxycarbonyl)-gamma-L-isoleucine
Formula: C23H27NO4
MW: 381.47
= 99% (HPLC)
Formula: C20H18FNO4
MW: 355.36
= 98% (Assay)
Trade Name: Fmoc-2,2-dimethyl-D-thiaproline
Formula: C21H21NO4S
MW: 383.5
= 99% (HPLC)
Trade Name: H-L-Pro(4S-N3)-OH HCl
Formula: C5H9ClN4O2
MW: 192.6
= 99% (HPLC)
Formula: C12H11NO4
MW: 233.22
= 99% (HPLC)
Formula: C10H8ClNO2
MW: 209.63
= 98% (HPLC)
Formula: C11H11NO3
MW: 205.21
= 98% (HPLC)
Formula: C11H11NO2
MW: 189.21
= 98% (HPLC)
Formula: C7H7F3N2 HCl
MW: 212.6
= 95% (HPLC)
Formula: C11H15ClN2O2
MW: 242.7
Trade Name: tert-Butyl 5-amino-2-fluorophenylcarbamate
Formula: C11H15FN2O2
MW: 226.25
Trade Name: tert-Butyl 5-amino-2-methoxyphenylcarbamate
Formula: C12H18N2O3
MW: 238.29
Trade Name: tert-Butyl 5-aminopyridin-2-ylcarbamate
Formula: C10H15N3O2
MW: 209.25
= 95% (HPLC)
Trade Name: 5-Benzyloxyindole-3-acetonitrile
Formula: C17H14N2O
MW: 262.31
= 97% (HPLC)
Trade Name: 2,2-Dimethylpropyl-4'-bromobenzoate-2'-boronic acid
Formula: C12H16BBrO4
MW: 314.97
Formula: C16H11BrN2O2
MW: 343.18
Formula: C9H7ClN2O2
MW: 210.62
= 98%
Trade Name: 2,2-Dimethylpropyl-4'-chlorobenzoate-2'-boronic acid
Formula: C12H16BClO4
MW: 270.52
Formula: C6H7BClNO3
MW: 187.39
= 99% (HPLC)
Trade Name: 5-Chloro-2-methylindole-3-acetic acid
Formula: C11H10ClNO2
MW: 223.66
Formula: C10H13ClN2
MW: 196.68
= 99% (HPLC)
Formula: C9H7FN2O2
MW: 194.16
= 96% (HPLC)
Formula: C11H11FN2O2
MW: 222.22
= 95% (NMR)
Formula: C9H9NO5
MW: 211.17
Formula: C4H7N3O HCl
MW: 249.58
= 95% (NMR)
Formula: C12H14N2O
MW: 202.26
Formula: C5H7N3O2
MW: 141.13
= 97%
Trade Name: (5-Methyl-1H-pyrazol-1-yl)acetic acid
Formula: C6H8N2O2
MW: 140.14
= 96% (NMR)
Trade Name: 1-(5-phenyl-1,3,4-oxadiazol-2-yl)methanamine
Formula: C9H9N3O
MW: 175.19
= 97%
Formula: C10H11N3
MW: 173.22
Trade Name: 5-Phenyl-3-isoxazolemethanol
Formula: C10H9NO2
MW: 175.19
= 98% (HPLC)
Formula: C10H10N2O HCl
MW: 210.66
= 99% (HPLC)
Formula: C7H6F3NO
MW: 177.12
= 92% (HPLC)
Formula: C7H7F3N2 HCl
MW: 212.6
Trade Name: (6-Pyrazol-1-yl-pyridin-3-yl)methanol
Formula: C9H9N3O
MW: 175.19
= 96% (Assay)
Formula: C11H10BrNO
MW: 252.11
= 96% (Assay)
Formula: C6H7BrN2
MW: 187.04
Trade Name: (2-Bromopyridin-5-yl)methanol
Formula: C6H6BrNO
MW: 188.02
= 98% (HPLC)
Trade Name: 6-Bromo-2-(hydroxymethyl)pyridine
Formula: C6H6BrNO
MW: 188.02
= 98% (HPLC)
Trade Name: 2-Amino-6-bromoquinoline
Formula: C9H7BrN2
MW: 223.07
= 97% (HPLC)
Formula: C9H7ClN2O2
MW: 210.62
= 99%
Formula: C13H16O3
MW: 220.27
= 95% (NMR)
Formula: C11H11NO4
MW: 221.21
= 95% (NMR)
Trade Name: 2-Hydrazino-6-methoxy-1,3-benzothiazole
Formula: C8H9N3OS
MW: 195.25
= 99% (HPLC)
Formula: C9H10N2O
MW: 162.19
= 95% (NMR)
Trade Name: 6-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine-3-acetonitrile
Formula: C17H15N3
MW: 261.33
Formula: C10H10BNO2
MW: 187
= 95% (NMR)
Trade Name: 2-(Boc-amino)-6-picoline
Formula: C11H16N2O2
MW: 208.26
= 95% (HPLC)
Formula: C32H38N2O5
MW: 530.66
Formula: C7H7F3N2 HCl
MW: 212.6
= 97% (HPLC)
Trade Name: Tris(dimethylamino)(3H-1,2,3-triazolo[4,5-b]pyridin-3-yloxy)phosphonium hexafluorophosphate
Formula: C11H21F6N7OP2
MW: 443.27
= 98%(HPLC)
Trade Name: Mca-OH
Formula: C12H10O5
MW: 234.21
= 95% (NMR)
(7-Methyl-imidazo[1,2-a]pyridin-2-yl)acetic acid Hydrochloride
Formula: C10H10N2O2 HCl
MW: 226.66
= 96% (NMR)
Formula: C10H12O2
MW: 164.2
Formula: C10H10BNO3
MW: 203
= 95% (NMR)
Trade Name: N,N'-Diacetyl-L-cystine
Formula: C10H16N2O6S2
MW: 324.38
= 99.5% (GC, Chiral purity)
Trade Name: Dicarbonylacetylacetonato rhodium(I)
Formula: Rh(CO)2(C5H7O2)
MW: 258.04
=99.5%, (40% Rhodium content min)
Trade Name: 2-(Aminomethyl)azetidine dihydrochloride
Formula: C4H12Cl2N2
MW: 159.06
= 97% (HPLC)
Trade Name: BOPP
Formula: C18H28N6OP F6P
MW: 520.34
= 99% (HPLC)
Formula: C10H23N2O2Cl3
MW: 309.66
Trade Name: Piperidin-4-ylmethyl-carbamic acid tert-butyl ester hydrochloride
Formula: C11H24N2O2Cl2
MW: 287.23
= 99% (TLC)
Trade Name: Boc-Lys-Pro-Tyr-Ile-Leu-OMe HCl
Formula: C38H62N6O9 HCl
MW: 783.44
= 97% (HPLC)
Trade Name: Bromodifluoro(trimethylsilyl)methane
Formula: C4H9BrF2S
MW: 203.1
= 98%
Trade Name: Cyclopropylmethyl bromide
Formula: C4H7Br
MW: 135
= 97% (GC)
Formula: C3H7ClNCl
MW: 128
Formula: C21H20Cl2N2O5S
MW: 483.37
Trade Name: Iodosobenzene I,I-diacetate
Formula: C10H11IO4
MW: 322.09
= 99% (HPLC)
Formula: C17H21O3P
MW: 304.32
= 95% (HPLC)
Formula: C4H10F2Si
MW: 124.21
= 98%
Formula: C14H12N2O2
MW: 240.26
Formula: C10H12FNO2
MW: 197.21
Formula: C16H17NO2
MW: 255.32
Formula: C15H15NO
MW: 225.29
Formula: C14H17NO3
MW: 247.29
Formula: C15H9Cl2FO2S
MW: 343.2
Formula: C16H10FNO2S
MW: 299.32
Formula: C16H14O3S
MW: 286.35
Trade Name: 3-(Dimethylamino)-1-(4-pyridinyl)-2-propen-1-one
Formula: C10H12N2O
MW: 176.22
= 99% (HPLC)
Trade Name: Brivudine
Formula: C11H13BrN2O5
MW: 333.14
= 99% (Assay)
Formula: C13H16N4O2
MW: 260.3
Formula: C10H9ClO2
MW: 196.63
Trade Name: PYOXIM
Formula: C17H29N5O3P F6P
MW: 527.38
= 99% (HPLC)
Formula: C21H24N2O2 HCl
MW: 372.89
= 99% (HPLC)
Trade Name: 2-(N-Phenethylmethylsulfonamido)acetic acid
Formula: C11H15NO4S
MW: 257.31
Trade Name: N-Methyl-1-(2-pyrazinyl)methanamine
Formula: C6H9N3
MW: 123.16
= 95% (NMR)
Trade Name: 1,2-Bis(2-aminoethoxy)ethane
Formula: C6H16N2O2
MW: 148.21
= 99% (GC)
Trade Name: 2-[2-(2-aminoethoxy)ethoxy]ethanol
Formula: C6H15NO3
MW: 149.19
= 99% (GC)
Trade Name: Tetraethylene glycol alpha-amino-omega-propionic acid
Formula: C11H23NO6
MW: 265.3
= 98% (HPLC)
Formula: C8H20N2O3
MW: 192.25
= 99% (HPLC)
Formula: C8H19NO4
MW: 193.24
= 95% (NMR)
Formula: C7H13NO3
MW: 159.18
Formula: C8H15NO3 HCl
MW: 209.67
= 96% (Assay)
Trade Name: (+)-2,2'-Dihydroxy-1,1'-binaphthyl
Formula: C20H14O2
MW: 286.32
= 99.5% (HPLC, Chiral purity)
Trade Name: (R)-(+)-1,1'-Bi(2-naphthylamine)
Formula: C20H16N2
MW: 284.36
= 99% (HPLC)
Trade Name: (R)-(+)-alpha-Methyl-1-naphthalenemethylamine
Formula: C12H13N
MW: 171.24
= 99% (HPLC, Chiral purity)
Trade Name: (R)-(+)-BINAP
Formula: C44H32P2
MW: 622.67
= 98% (HPLC, Chiral purity)
Trade Name: (R)-(+)-tert-Butyl sulfinamide
Formula: C11H11NO2
MW: 121.2
= 99% (HPLC, Chiral purity)
Formula: C5H11NO HCl
MW: 137.61
= 99% (HPLC, Chiral purity)
Trade Name: (4R)-4-Benzyl-1,3-Oxazolidin-2-one
Formula: C10H11NO2
MW: 177.2
= 99.5% (HPLC, Chiral purity)
Trade Name: (4R)-4-Isopropyl-1,3-oxazolidin-2-one
Formula: C6H11NO2
MW: 129.16
= 99% (HPLC)
Trade Name: (R)-(+)-1-Phenylethylamine
Formula: C8H11N
MW: 121.18
= 98% (GC, Chiral purity)
Trade Name: (R)-(+)-2-(Diphenylhydroxymethyl)pyrrolidine
Formula: C17H19NO
MW: 253.34
Trade Name: (R)-(+)-Oxirane-2-Methanol
Formula: C3H6O2
MW: 74.08
= 99% (GC)
Trade Name: (R)-(+)-2,3-Dihydroindole-2-carboxylic acid
Formula: C9H9NO2
MW: 163.17
= 98% (HPLC)
Formula: C5H8O3
MW: 116.12
= 99% (GC, Chiral purity)
Trade Name: (R)-4-Hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-oxide
Formula: C20H13O4P
MW: 348.29
= 99% (HPLC)
Trade Name: (R)-1-Benzyl-3-piperidinol
Formula: C12H17NO
MW: 191.27
= 99% (GC, Chiral purity)
Trade Name: (-)-Styrene glycol
Formula: C8H10O2
MW: 138.17
Trade Name: L-2,3-O-isopropylidene-sn-glycerol
Formula: C6H12O3
MW: 132.2
= 99% (GC, Chiral purity)
Trade Name: O-Methyl-D-Prolinol
Formula: C6H13NO
MW: 115.16
= 99.5% (GC, Chiral purity)
Formula: C8H7ClO3
MW: 186.59
Trade Name: (R)-a-(Methoxymethyl)benzylamine
Formula: C9H13NO
MW: 151.21
= 98% (HPLC)
Formula: C5H12N2
MW: 100.16
= 99% (GC)
Trade Name: (R)-(-)-Hexylmethylcarbinol
Formula: C8H18O
MW: 130.23
= 99% (Assay)
Trade Name: (R)-(-)-alpha-Methylphenylacetic acid
Formula: C9H10O2
MW: 150.18
= 98% (HPLC)
Trade Name: (R)-Wieland-miescher ketone
Formula: C11H14O2
MW: 178.23
Trade Name: N-3-Propionyl-(4R)-benzyl-2-oxazolidinone
Formula: C13H15NO3
MW: 233.26
= 99% (HPLC)
Trade Name: (4R)-4-Phenyl-1,3-oxazolidin-2-one
Formula: C9H9NO2
MW: 163.18
= 99% (HPLC)
Trade Name: (R)-Phenyl superquat
Formula: C11H13NO2
MW: 191.23
= 99.5% (HPLC, Chiral purity)
Trade Name: O-Methyl-(R)-mandelic acid
Formula: C9H10O3
MW: 166.17
= 99% (HPLC)
Trade Name: (R)-(-)-1-Boc-3-hydroxypyrrolidine
Formula: C9H17NO3
MW: 187.24
= 99.5% (GC, Chiral purity)
Trade Name: (R)-(-)-2-(Chloromethyl)oxirane
Formula: C3H5ClO
MW: 92.52
= 99% (Assay)
Trade Name: (R)-alpha-Hydroxyphenylacetic acid
Formula: C8H8O3
MW: 152.15
= 99.75% (HPLC, Chiral purity)
Trade Name: (R)-(–)-3-Piperidinecarboxylic acid
Formula: C6H11NO2
MW: 129.16
= 98% (assay by titration)
Trade Name: (R)-1-Boc-2-piperidineacetic acid
Formula: C12H21NO4
MW: 243.3
= 99% (NMR)
Trade Name: (R)-Boc-(3-carboxymethyl)piperidine
Formula: C12H21NO4
MW: 243.3
= 98% (HPLC)
Trade Name: (R)-Fmoc-(2-carboxymethyl)piperidine
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: (R)-Fmoc-(3-carboxymethyl)piperidine
Formula: C22H23NO4
MW: 365.43
= 98% (HPLC)
Trade Name: (R)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid methyl ester
Formula: C11H13NO2
MW: 191.23
Formula: C11H13NO2 HCl
MW: 227.69
Formula: C11H12O2
MW: 176.2
Trade Name: D-1,2,3,4-Tetrahydroquinoline-2-carboxylic acid hydrochloride
Formula: C10H11NO2 HCl
MW: 213.66
= 96% (Assay)
Trade Name: (-)-Isopropanolamine
Formula: C3H9NO
MW: 75.11
= 98%
Formula: C12H15NO2 HCl
MW: 241.72
= 99% (Assay)
Trade Name: (R)-1-Boc-2-piperidinemethanol
Formula: C11H21NO3
MW: 215.3
= 95% (NMR)
Trade Name: (R)-(+)-1-(tert-Butoxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone
Formula: C13H24N2O3
MW: 256.35
= 99% (Titration)
Trade Name: (R)-3-Aminomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
MW: 200.28
= 98%
Trade Name: (R)-3-Aminopiperidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
MW: 200.28
= 99% (HPLC, Chiral purity)
Trade Name: 3(R)-Aminomethyl-piperidine-1-carboxylic acid tert-butyl ester
Formula: C11H22N2O2
MW: 214.31
= 98% (HPLC, Chiral purity)
Formula: C16H22N2O3
MW: 290.36
= 98% (HPLC)
Trade Name: (R)-Amino-(2-methoxyphenyl)acetic acid
Formula: C9H11NO3
MW: 181.19
= 99% (HPLC, Chiral purity)
Trade Name: (R)-Benzyl 2-methylpiperazine-1-carboxylate
Formula: C13H18N2O2
MW: 234.3
= 98%
Trade Name: D-Tqa-OH HCl
Formula: C11H13NO2 HCl
MW: 227.69
= 98% (HPLC)
Trade Name: L-2-(2-Thienyl)glycine
Formula: C6H7NO2S
MW: 157.19
= 98%
Formula: C15H19NO3
MW: 261.32
Trade Name: (R)-3-amino-3-(4-bromophenyl)propan-1-ol
Formula: C9H12BrNO
MW: 230.1
= 97% (HPLC)
Formula: C11H18N2O5
MW: 258.3
= 99% (NMR)
Trade Name: Fmoc-(R)-ampa-OH
Formula: C19H19NO4
MW: 325.36
= 98% (HPLC)
Trade Name: D-beta-Ala(1-naphthyl)-OH
Formula: C13H13NO2
MW: 215.25
= 99% (HPLC)
Trade Name: D-beta-Phe(2,3-dimethoxy)-OH
Formula: C11H15NO4
MW: 225.24
= 99% (TLC)
Trade Name: D-beta-Phe(2,4-DiCl)-OH
Formula: C9H9Cl2NO2
MW: 234.08
= 99% (HPLC, Chiral purity)
Trade Name: D-beta-Phe(2-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 98% (NMR)
Trade Name: D-beta-Phe(2-Cl)-OH
Formula: C9H10ClNO2
MW: 199.64
Trade Name: D-beta-Phe(2-F)-OH
Formula: C9H10FNO2
MW: 183.18
= 99% (HPLC)
Trade Name: D-beta-Phe(2-OH)-OH
Formula: C9H11NO3
MW: 181.19
= 98% (TLC)
Trade Name: D-beta-Phe(2-Me)-OH
Formula: C10H13NO2
MW: 179.22
= 98%
Trade Name: D-beta-Ala-(2-naphthyl)-OH
Formula: C13H13NO2
MW: 215.25
= 98% (HPLC)
Trade Name: L-beta-Ala-(2-thienyl)-OH
Formula: C7H9NO2S
MW: 171.21
= 99% (Chiral purity)
Trade Name: D-beta-Phe(3,5-dimethoxy)-OH
Formula: C11H15NO4
MW: 225.24
= 98% (TLC)
Trade Name: D-beta-Phe(3-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 99% (HPLC, Chiral purity)
Trade Name: D-beta-Phe(3-Cl)-OH
Formula: C9H10ClNO2
MW: 199.64
= 98% (HPLC)
Trade Name: D-beta-Phe(3-CN)-OH
Formula: C10H10N2O2
MW: 190.2
= 99% (Chiral purity)
Trade Name: D-beta-Phe(3-OMe)-OH
Formula: C10H13NO3
MW: 195.22
= 99% (HPLC)
Trade Name: D-beta-Phe(3-Me)-OH
Formula: C10H13NO2
MW: 179.22
= 98% (HPLC)
Trade Name: D-beta-Ala-(3-pyridyl)-OH
Formula: C8H10N2O2
MW: 166.18
= 98%
Trade Name: D-beta-Phe(4-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 98%
Trade Name: D-beta-Phe(4-Cl)-OH
Formula: C9H10ClNO2
MW: 199.64
= 99% (HPLC)
Trade Name: D-beta-Phe(4-CN)-OH
Formula: C10H10N2O2
MW: 190.2
= 95%
Trade Name: D-beta-Phe(4-F)-OH
Formula: C9H10FNO2
MW: 183.18
= 98% (Assay)
Trade Name: D-beta-Phe(4-OH)-OH
Formula: C9H11NO3
MW: 181.19
= 99% (HPLC)
Trade Name: D-beta-Phe(4-Me)-OH
Formula: C10H13NO2
MW: 179.22
= 98% (HPLC)
Trade Name: D-beta-Phe(4-CF3)-OH
Formula: C10H10F3NO2
MW: 233.19
= 99% (HPLC)
Trade Name: D-beta-Ala-(6-methoxy-3-pyridyl)-OH
Formula: C9H12N2O3
MW: 196.21
= 97% (HPLC)
Trade Name: D-beta-Phe-OH
Formula: C9H11NO2
MW: 165.19
= 99% (Assay)
Trade Name: D-beta-Nva(5-phenyl)-OH HCl
Formula: C11H15NO2 HCl
MW: 229.71
= 98%
Formula: C16H20NO5S
MW: 352.4
Formula: C9H20N2O2
MW: 188.27
= 98% (NMR)
Formula: C4H9ClFN
MW: 125.57
= 98% (NMR)
Formula: C26H22N2O5S
MW: 474.53
= 99% (HPLC)
Trade Name: (R)-N-Boc-pyrrolidine-3-methanol
Formula: C10H19NO3
MW: 201.26
= 98% (HPLC)
Trade Name: (R)-Pyrrolidin-3-ol
Formula: C4H9NO
MW: 87.12
= 98% (GC)
Trade Name: (R)-(-)-3-Pyrrolidinol hydrochloride
Formula: C4H9NO HCl
MW: 123.58
= 98% (Assay)
Formula: C6H15NO2
MW: 133.19
= 99% (TLC)
Trade Name: H-D-(3-Thienyl)gly-OH
Formula: C6H7NO4S
MW: 157.19
= 98%
Formula: C8H11NO
MW: 137.18
= 99% (HPLC, Chiral purity)
Trade Name: Fmoc-L-Dbu(Boc)-OH
Formula: C24H28N2O6
MW: 440.5
= 99% (HPLC)
Trade Name: Z-D-Dbu(Boc)-OH
Formula: C17H24N2O6
MW: 352.4
= 98% (HPLC)
Trade Name: Nbeta-Boc-Ngamma-Fmoc-L-Diaminobutyric acid
Formula: C24H28N2O6
MW: 440.5
= 98% (HPLC)
Trade Name: Z-L-Dbu(Fmoc)-OH
Formula: C27H26N2O6
MW: 474.5
= 99% (HPLC)
Trade Name: Z-L-Dbu-OMe HCl
Formula: C13H18N2O4 HCl
MW: 302.8
= 99% (HPLC)
Trade Name: (R)-4-(tert-Butoxycarbonyl)-thiomorpholine-3-carboxylic acid
Formula: C10H17NO4S
MW: 247.31
= 97% (assay)
Trade Name: D-4-Fluorophenylglycine hydrochloride
Formula: C8H8FNO2 HCl
MW: 205.62
= 97% (assay)
Formula: C13H15NO4S
MW: 281.33
= 99%
Trade Name: (R)-Dtc-OH
Formula: C6H11NO2S
MW: 161.22
= 99% (HPLC)
Formula: C16H20N2O
MW: 256.35
Formula: C8H11NO2 HCl
MW: 189.64
= 98% (HPLC)
Formula: C16H17NO2 HCl
MW: 291.82
= 98%
Formula: C12H15Cl2NO2
MW: 276.16
= 98% (HPLC)
Formula: C14H19NO2 HCl
MW: 269.77
= 98% (HPLC)
Formula: C18H19NO2 HCl
MW: 317.81
Formula: C12H14BrNO2 HCl
MW: 320.61
Formula: C12H15Cl2NO2
MW: 276.16
Formula: C12H14FNO2 HCl
MW: 259.71
Formula: C13H17NO2 HCl
MW: 255.74
Formula: C13H14F3NO2 HCl
MW: 309.72
= 98% (HPLC)
Formula: C10H12BrNO2S HCl
MW: 326.64
Formula: C8H13NO2 HCl
MW: 191.66
= 98% (HPLC)
Formula: C12H15NO2 HCl
MW: 241.71
= 99% (HPLC)
Formula: C13H17NO2 HCl
MW: 255.74
= 98% (TLC)
Formula: C12H21NO4
MW: 243.3
= 99% (HPLC)
Formula: C12H23NO4
MW: 245.32
= 99% (HPLC)
Trade Name: Boc-L-Cys(phenyl)-OH
Formula: C14H19NO4S
MW: 297.37
= 99% (HPLC)
Trade Name: Boc-L-Cys(propargyl)-OH DCHA
Formula: C11H17NO4S C12H23N
MW: 440.64
= 98% (HPLC)
(R)-Boc-2-amino-6-benzyloxy-hexanoic acid·DCHA
Formula: C18H27NO5 C12H23N
MW: 518.74
= 97% (HPLC)
Formula: C9H14F3NO4
MW: 257.21
= 98% (HPLC)
Formula: C16H20N2O5S
MW: 352.41
= 97% (HPLC)
Formula: C18H25NO4 C12H23N
MW: 500.72
= 99% (HPLC)
Formula: C12H21NO4
MW: 243.3
Formula: C17H22N2O4
MW: 318.37
= 97% (HPLC)
Trade Name: Boc-gamma-L-Val-OH
Formula: C12H23NO4
MW: 245.32
= 97% (HPLC)
Formula: C12H23NO4S
MW: 277.38
= 97% (HPLC)
Trade Name: (R)-Boc-5,5-dimethyl-Pro-OH
Formula: C12H21NO4
MW: 243.3
= 99% (HPLC)
Trade Name: (R)-3-(Boc-amino)-2-methylpropionic acid
Formula: C9H17NO4
MW: 203.3
= 98%
Formula: C9H11NO HCl
MW: 185.65
= 98% (HPLC)
Trade Name: Fmoc-alpha-Me-L-Cys(Trt)-OH
Formula: C38H33NO4S
MW: 599.74
Trade Name: Fmoc-alpha-Me-D-Asp(OtBu)-OH
Formula: C24H27NO6
MW: 425.48
= 98% (HPLC)
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: Fmoc-L-Cys(tert-butoxycarbonylethyl)-OH
Formula: C25H29NO6S
MW: 471.57
= 98% (HPLC)
Trade Name: Fmoc-L-Cys(3-(Boc-amino)-propyl)-OH
Formula: C26H32N2O6S
MW: 500.61
= 98% (HPLC)
Trade Name: Fmoc-L-Cys(tert-butoxycarbonylpropyl)-OH
Formula: C26H31NO6S
MW: 485.6
= 99% (HPLC)
Trade Name: Fmoc-L-Cys(dodecyl)-OH
Formula: C30H41NO4S
MW: 511.72
= 99% (HPLC)
Formula: C22H25NO4
MW: 367.44
= 99% (HPLC)
Trade Name: Fmoc-L-Cys(phenyl)-OH
Formula: C24H21NO4S
MW: 419.5
= 98% (HPLC)
Trade Name: Fmoc-L-Cys(Propargyl)-OH
Formula: C21H19NO4S
MW: 381.45
= 99% (HPLC)
Trade Name: Fmoc-alpha-Me-D-Ser(tBu)-OH
Formula: C23H27NO5
MW: 397.47
= 99% (HPLC)
Trade Name: (R)-Fmoc-beta2-homovaline
Formula: C21H23NO4
MW: 353.42
= 99% (HPLC)
Trade Name: (R)-Fmoc-beta2-homophenylalanine
Formula: C25H23NO4
MW: 401.46
= 98% (HPLC)
Formula: C19H16F3NO4
MW: 379.34
= 99% (HPLC)
Formula: C28H27NO4
MW: 441.53
= 99% (HPLC)
Formula: C20H19NO4S
MW: 369.44
= 99% (HPLC)
Formula: C22H23NO4
MW: 365.43
Formula: C27H24N2O4
MW: 454.52
= 97% (HPLC)
Formula: C30H33NO5
MW: 487.6
= 98% (HPLC)
Trade Name: (R)-Fmoc-5,5-dimethyl-Pro-OH
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: (R)-Fmoc-2-amino-3-hydroxy-3-methyl-butyric acid
Formula: C20H21NO5
MW: 355.39
= 99% (HPLC)
Formula: C11H14N2O2 2HCl
MW: 279.17
= 98% (TLC)
Formula: C16H17NO2 HCl
MW: 291.78
Formula: C16H17NO2 HCl
MW: 291.78
Formula: C13H14F3NO2 HCl
MW: 309.72
= 98% (TLC)
Formula: C12H14Cl3NO2
MW: 310.61
Formula: C12H14BrNO2 HCl
MW: 320.61
Formula: C13H17NO2 HCl
MW: 255.74
= 98% (TLC)
Formula: C12H14N2O4 HCl
MW: 286.71
= 99% (HPLC)
Formula: C14H17NO2 HCl
MW: 267.75
Formula: C11H14N2O2 2HCl
MW: 279.17
= 98% (TLC)
Formula: C18H19NO2 HCl
MW: 317.81
= 98% (TLC)
Formula: C12H14BrNO2 HCl
MW: 320.61
Formula: C12H15Cl2NO2
MW: 276.16
= 95% (HPLC)
Formula: C12H14FNO2 HCl
MW: 259.71
Formula: C12H14INO2 HCl
MW: 367.61
Formula: C13H17NO2 HCl
MW: 255.74
= 98% (HPLC)
Formula: C13H14F3NO2 HCl
MW: 309.72
= 98% (HPLC)
Formula: C8H13NO2 HCl
MW: 191.66
Formula: C12H15NO2 HCl
MW: 241.72
= 99% (TLC)
Formula: C8H11NO2 HCl
MW: 189.64
= 98% (TLC)
Formula: C7H10N2O2
MW: 154.17
Formula: C16H15Cl2NO2 HCl
MW: 360.67
Formula: C16H16FNO2 HCl
MW: 309.77
Formula: C18H19NO3 HCl
MW: 333.81
Formula: C18H19NO3 HCl
MW: 333.81
Trade Name: (R)-3-Morpholinecarboxylic acid
Formula: C5H9NO3
MW: 131.13
Trade Name: (R)-3-Morpholinecarboxylic acid hydrochloride
Formula: C5H9NO3 HCl
MW: 167.59
= 99% (Chiral purity based on starting material)
Trade Name: (2R)-2-[(4-Nitrophenyl)amino]propanoic acid
Formula: C9H10N2O4
MW: 210.19
= 96% (Assay)
Trade Name: (R)-tert-Butyl 3-hydroxypiperidine-1-carboxylate
Formula: C10H19NO3
MW: 201.26
= 99% (Chiral purity)
Trade Name: Boc-D-Dap(Z)-ol
Formula: C16H24N2O5
MW: 324.4
= 99% (HPLC)
Trade Name: Fmoc-D-Dap(Boc)-ol
Formula: C23H28N2O5
MW: 412.5
= 99% (HPLC)
Trade Name: Z-D-Dap(Boc)-ol
Formula: C16H24N2O5
MW: 324.4
= 99% (HPLC)
Formula: C23H27N3O4
MW: 409.48
Trade Name: (3R)-Thiomorpholinecarboxylic acid
Formula: C5H9NO2S HCl
MW: 183.7
= 99% (Assay)
Trade Name: (R)-(+)-3-Z-4-oxazolidinecarboxylic acid
Formula: C12H13NO5
MW: 251.24
= 98% (NMR)
Trade Name: DL-Tic-OH
Formula: C10H11NO2
MW: 177.2
= 99% (HPLC)
Formula: C11H22N2O2
MW: 214.31
Formula: C15H14N2O HCl
MW: 274.72
= 98% (HPLC)
Trade Name: DL-Disc-OH HCl
Formula: C9H9NO2 HCl
MW: 199.65
Trade Name: (R,S)-PheP(OPh)2 HCl
Formula: C20H20NO3P HCl
MW: 389.82
= 99% (HPLC)
Formula: C11H22N2O2 HCI
MW: 354.23
= 98% (HPLC)
Trade Name: (R,S)-Cop-OH HCl
Formula: C5H9NO3 HCl
MW: 167.13
Formula: C8H10N2O2
MW: 166.18
= 98%
Trade Name: 2-Carboxymethyl-3-oxo-piperazine-1-carboxylic acid tert-butyl ester
Formula: C11H18N2O5
MW: 258.27
= 99% (HPLC)
Formula: C21H20N2O5
MW: 380.4
= 98% (HPLC)
Trade Name: (R,S)-Boc-beta, beta-dimethyl-phenylalanine DCHA
Formula: C16H23NO4 C12H23N
MW: 474.68
= 98% (HPLC)
Formula: C9H14F3NO4
MW: 257.21
= 99% (HPLC)
Formula: C9H15F2NO4
MW: 239.22
= 97% (HPLC)
Formula: C19H37NO4
MW: 343.51
= 99% (HPLC)
Trade Name: (R,S)-Boc-3,3-dimethyl-pyrrolidine-2-carboxylic acid
Formula: C12H21NO4
MW: 243.3
= 99.9% (HPLC)
Formula: C17H25NO6
MW: 339.39
= 97% (HPLC)
Formula: C18H21NO4
MW: 315.37
= 99% (HPLC)
Formula: C19H23NO4
MW: 329.4
= 97% (HPLC)
Formula: C18H21NO4
MW: 315.37
= 97% (HPLC)
Formula: C19H23NO4
MW: 329.4
= 98% (HPLC)
Trade Name: (R,S)-Boc-3-(tert-butyl)-beta-Ala-OH
Formula: C12H23NO4
MW: 245.32
= 98% (HPLC)
Formula: C9H14F3NO4
MW: 257.21
= 99% (HPLC)
Trade Name: (R,S)-3-Boc-amino-9-Boc-1,2,3,4-tetrahydro-carbazole-3-carboxylic acid
Formula: C23H30N2O6
MW: 430.5
= 98% (HPLC)
Formula: C28H23N07
MW: 485.5
= 97%
Trade Name: (R,S)-Fmoc-beta, beta-dimethyl-phenylalanine
Formula: C26H25NO4
MW: 415.49
= 98% (HPLC)
Formula: C19H16F3NO4
MW: 379.34
= 98% (HPLC)
Formula: C19H17F2NO4
MW: 361.35
= 97% (HPLC)
Formula: C29H39NO4
MW: 465.63
= 98% (HPLC)
Trade Name: (R,S)-Fmoc-3,3-dimethyl-proline
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Formula: C27H27NO6
MW: 461.51
= 97% (HPLC)
Formula: C26H25NO5
MW: 431.49
= 99% (HPLC)
Formula: C28H23NO4
MW: 437.49
= 98% (HPLC)
Formula: C29H25NO4
MW: 451.52
= 98% (HPLC)
Formula: C28H23NO4
MW: 437.49
= 99% (HPLC)
Formula: C29H25NO4
MW: 451.52
= 97% (HPLC)
Formula: C25H23NO4
MW: 401.46
= 99% (HPLC)
Trade Name: (R,S)-Fmoc-3-(tert-butyl)-beta-Ala-OH
Formula: C22H25NO4
MW: 367.44
= 98% (HPLC)
Formula: C19H16F3NO4
MW: 379.34
= 99% (HPLC)
Formula: C33H32N2O6
MW: 552.63
= 97% (HPLC)
Trade Name: (R,S)-1-amino-3-methylbutyl-phosphonic acid diphenyl ester hydrochloride
Formula: C17H22NO3P HCl
MW: 355.8
= 98% (HPLC)
Formula: C8H9NO3
MW: 167.16
= 95% (HPLC)
Trade Name: (S)-4-Hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-oxide
Formula: C20H13O4P
MW: 348.29
= 99% (HPLC)
Trade Name: (S)-Phenylglycinol methyl ether
Formula: C9H13NO
MW: 151.21
= 98%
Trade Name: (S)-1-Benzyl-3-piperidinol
Formula: C12H17NO
MW: 191.27
= 98% (HPLC, Chiral purity)
Trade Name: (S)-(+)-1,2-O-Isopropylidene-sn-glycerol
Formula: C6H12O3
MW: 132.16
= 97% (GC, Chiral purity)
Trade Name: (S)-(+)-Hajos-Parrish diketone
Formula: C10H12O2
MW: 164.2
= 99% (HPLC)
Formula: C5H12N2
MW: 100.16
= 99% (GC)
Formula: C11H11NO4
MW: 221.21
Trade Name: L-(+)-Phenylglycine amide
Formula: C8H10N2O
MW: 150.18
= 99%
Trade Name: (S)-(+)-alpha-Methylphenylacetic acid
Formula: C9H10O2
MW: 150.18
= 98% (HPLC)
Trade Name: (S)-(+)-9-Methyl-5(10)-octaline-1,6-dione
Formula: C11H14O2
MW: 178.23
= 99% (GC)
Formula: C4H9ClFN
MW: 125.57
= 99% (HPLC)
Trade Name: (S)-(+)-4-Phenyloxazolidin-2-one
Formula: C9H9NO2
MW: 163.17
= 99.5% (GC, Chiral purity)
Trade Name: (S)-Phenyl superquat
Formula: C11H13NO2
MW: 191.23
= 99.5% (HPLC, Chiral purity)
Trade Name: (S)-(+)-N-Boc-3-hydroxypyrrolidine
Formula: C9H17NO3
MW: 187.24
= 98%
Trade Name: (+)-Camphor-10-sulfonic acid
Formula: C10H16O4S
MW: 232.3
= 99% (Assay)
Formula: C20H16N2O4
MW: 348.35
= 99% (Assay)
Trade Name: (S)-(+)-2-(Chloromethyl)oxirane
Formula: C3H5ClO
MW: 92.52
= 99.5% (GC, Chiral purity)
Trade Name: O-Methyl-(S)-mandelic acid
Formula: C9H10O3
MW: 166.17
= 99% (HPLC)
Trade Name: (S)-(+)-3-piperidinecarboxylic acid
Formula: C6H11NO2
MW: 129.16
= 99% (Titration)
Trade Name: (-)-2,2'-Dihydroxy-1,1'-dinaphthyl
Formula: C20H14O2
MW: 286.32
= 99% (Chiral HPLC)
Trade Name: (S)-(-)-1,1'-Bi(2-naphthylamine)
Formula: C20H16N2
MW: 284.36
= 99% (HPLC)
Trade Name: (S)-(-)-alpha-Methyl-1-naphthalenemethylamine
Formula: C12H13N
MW: 171.24
= 98% (HPLC, Chiral purity)
Trade Name: (S)-(-)-tert-Butyl sulfinamide
Formula: C4H11NOS
MW: 121.2
= 99%
Trade Name: D(-)S-Acetyl-beta-mercapto isobutyric acid
Formula: C6H10O3S
MW: 162.2
= 99% ee (GC)
Formula: C4H9NO3
MW: 119.12
= 99% (Assay, Chiral purity)
Trade Name: (4S)-4-Benzyl-1,3-oxazolidin-2-one
Formula: C10H11NO2
MW: 177.2
= 99% (HPLC)
Trade Name: (4S)-4-Isopropyl-1,3-oxazolidin-2-one
Formula: C6H11NO2
MW: 129.16
= 99% (GC, Chiral purity)
Trade Name: Boc-L-homoserine lactone
Formula: C9H15NO4
MW: 201.22
= 99% (HPLC)
Trade Name: (S)-(-)-1-Phenylethylamine
Formula: C8H11N
MW: 121.18
= 99% (GC)
Trade Name: (S)-(-)-2-(Diphenylhydroxymethyl)pyrrolidine
Formula: C17H19NO
MW: 253.34
= 98% (GC)
Formula: C5H8O3
MW: 116.12
= 99% (HPLC, Chiral purity)
Trade Name: (S)-3-Boc-aminomethyl-1,2,3,4-tetrahydroisoquinoline
Formula: C15H22N2O2
MW: 262.35
Trade Name: (S)-Boc-(3-carboxymethyl)piperidine
Formula: C12H21NO4
MW: 243.3
= 96%
Trade Name: (S)-Fmoc-(2-carboxymethyl)piperidine
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: (S)-Fmoc-(3-carboxymethyl)piperidine
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Formula: C29H24NO3P
MW: 465.49
Formula: C10H11NO2 HBr
MW: 258.11
= 95% (NMR)
Trade Name: (S)-tert-Butyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate
Formula: C14H19NO2
MW: 233.31
Trade Name: (S)-1,2,3,4-Tetrahydro-1-isoquinoline carboxylic acid
Formula: C10H11NO2
MW: 177.2
= 98%
Trade Name: (S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid methyl ester
Formula: C11H13NO2
MW: 191.23
Formula: C11H12O2
MW: 176.2
Trade Name: (+)-Isopropanolamine
Formula: C3H9NO
MW: 75.11
= 98% (GC, Chiral purity)
Trade Name: (S)-1-Benzyl-piperidin-3-ylamine
Formula: C12H18N2
MW: 190.29
= 99%
Formula: C12H15NO2
MW: 205.26
= 98%
Trade Name: (S)-2-Benzylpiperazine-1-carboxylic acid tert-butyl ester
Formula: C16H24N2O2
MW: 276.38
= 95%
Trade Name: (S)-N-Boc-(2-carboxymethyl)piperidine
Formula: C12H21NO4
MW: 243.3
= 98% (Assay)
Trade Name: (S)-Boc-Pip-ol
Formula: C11H21NO3
MW: 215.3
= 99% (HPLC)
Formula: C13H24N2O3
MW: 256.35
= 95% (NMR)
Trade Name: (S)-tert-Butyl-3-(aminomethyl)pyrrolidine-1-carboxylate
Formula: C10H20N2O2
MW: 200.28
= 96% (HPLC)
Trade Name: 3-(S)-N-Boc-piperidine methanol
Formula: C11H21NO3
MW: 215.29
= 99% (GC)
Trade Name: (S)-3-Aminopiperidine-1-carboxylic acid tert-butyl ester
Formula: C10H20N2O2
MW: 200.28
= 98%
Trade Name: (S)-tert-Butyl 3-hydroxypiperidine-1-carboxylate
Formula: C10H19NO3
MW: 201.26
= 99% (Chiral purity)
Trade Name: tert-Butyl (S)-3-methyl-1-piperazinecarboxylate
Formula: C10H20N2O2
MW: 200.28
= 99% (Chiral purity by GC)
Trade Name: (2S)-2-Ethyl-1-piperazinecarboxylic acid 1,1-dimethylethyl ester
Formula: C11H22N2O2
MW: 214.31
= 96% (GC)
Trade Name: 3(S)-Aminomethyl-piperidine-1-carboxylic acid tert-butyl ester
Formula: C11H22N2O2
MW: 214.31
= 98% (HPLC, Chiral purity)
Trade Name: (S)-(-)-1-(Benzyloxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone
Formula: C16H22N2O3
MW: 290.36
= 98% (HPLC)
Formula: C26H20N2O6
MW: 456.45
= 95% (NMR)
Formula: C14H23N3O3S
MW: 313.42
= 99% (HPLC)
Formula: C19H17F2NO4
MW: 361.34
= 98% (HPLC)
Trade Name: Boc-Dab(Z)-ol
Formula: C17H26N2O5
MW: 338.4
= 99% (HPLC)
Formula: C28H27NO6
MW: 473.53
= 98% (HPLC)
Trade Name: (S)-tert-Butyl 2-formylpiperidine-1-carboxylate
Formula: C11H19NO3
MW: 213.28
= 96% (GC)
Trade Name: (S)-alpha-Hydroxybutyric acid
Formula: C4H8O3
MW: 104.1
= 96% (Titration)
Trade Name: (S)-2-(Hydroxymethyl)indoline
Formula: C9H11NO
MW: 149.19
= 98% (HPLC)
Trade Name: (S)-Amino-(2-methoxyphenyl)acetic acid
Formula: C9H11NO3
MW: 181.19
= 98%
Trade Name: (S)-2-Tetrahydroisoquinoline acetic acid hydrochloride
Formula: C11H13NO2 HCl
MW: 227.69
= 99% (HPLC, Chiral purity)
Trade Name: H-D-(2-Thienyl)gly-OH
Formula: C6H7NO2S
MW: 157.19
= 99% (HPLC)
(S)-3-(1-Boc-pyrrolidin-2-yl)propionic acid·DCHA
Formula: C12H12NO4 C12H23N
MW: 424.62
= 99% (HPLC)
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: Fmoc-beta-(1-piperazinyl)-L-Ala(Boc)-OH
Formula: C27H33N3O6
MW: 495.58
= 98% (HPLC)
Formula: C15H14N2O7S
MW: 366.35
Trade Name: tert-Butyl (S)-3-pyrrolidinylcarbamate
Formula: C9H18N2O2
MW: 186.25
Formula: C10H16N2O
MW: 180.25
= 95% (NMR)
Trade Name: L-beta-Ala-(1-naphthyl)-OH
Formula: C13H13NO2
MW: 215.25
= 99% (TLC)
Trade Name: L-beta-Phe(2,3-DiCl)-OH
Formula: C9H9Cl2NO2
MW: 234.08
= 98% (HPLC)
Trade Name: L-beta-Phe(2,3-dimethoxy)-OH
Formula: C11H15NO4
MW: 225.24
= 98% (HPLC)
Trade Name: L-beta-Phe(2,4-DiCl)-OH
Formula: C9H9Cl2NO2
MW: 234.08
= 98% (HPLC, Chiral purity)
Trade Name: L-beta-Phe(2-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 98% (TLC)
Trade Name: L-beta-Phe(2-Cl)-OH
Formula: C9H10ClNO2
MW: 199.64
= 99% (HPLC)
Trade Name: L-beta-Phe(2-F)-OH
Formula: C9H10FNO2
MW: 183.18
= 98% (HPLC)
Trade Name: D-beta-Ala-(2-furyl)-OH
Formula: C7H9NO3
MW: 155.15
= 99% (HPLC)
Trade Name: (S)-3-Amino-3-(2-methoxyphenyl)propionic acid
Formula: C10H13NO3
MW: 195.22
= 99% (TLC)
Trade Name: L-beta-Phe(2-Me)-OH
Formula: C10H13NO2
MW: 179.22
= 98% (HPLC)
Trade Name: L-beta-Ala-(2-naphthyl)-OH
Formula: C13H13NO2
MW: 215.25
= 98% (TLC)
Trade Name: L-beta-Phe(2-CF3)-OH
Formula: C10H10F3NO2
MW: 233.19
= 99% (HPLC)
Trade Name: L-beta-Phe(3-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 99% (HPLC, Chiral purity)
Trade Name: L-beta-Phe(3-CN)-OH
Formula: C10H10N2O2
MW: 190.2
= 98% (HPLC)
Trade Name: L-beta-Phe(3-F)-OH
Formula: C9H10FNO2
MW: 183.18
= 95% (HPLC)
Trade Name: L-beta-Phe(3-OMe)-OH
Formula: C10H13NO3
MW: 195.22
= 98% (TLC)
Trade Name: L-beta-Phe(3-Me)-OH
Formula: C10H13NO2
MW: 179.22
= 98% (HPLC)
Trade Name: L-beta-Phe(3-NO2)-OH
Formula: C9H10N2O4
MW: 210.19
= 98% (HPLC)
Trade Name: L-beta-Ala-(3-pyridyl)-OH
Formula: C8H10N2O2
MW: 166.18
= 98% (TLC)
Trade Name: (S)-3-Amino-3-(3-thienyl)propionic acid
Formula: C7H9NO2S
MW: 171.21
= 98% (HPLC)
Trade Name: L-beta-Phe(3-CF3)-OH
Formula: C10H10F3NO2
MW: 233.19
= 98% (TLC)
Trade Name: L-beta-Phe(4-Br)-OH
Formula: C9H10BrNO2
MW: 244.09
= 99%
Trade Name: L-beta-Phe(4-Cl)-OH
Formula: C9H10ClNO2
MW: 199.64
= 98% (HPLC, Chiral purity)
Trade Name: L-beta-Phe(4-CN)-OH
Formula: C10H10N2O2
MW: 190.2
= 99% (HPLC)
Trade Name: L-beta-Phe(4-F)-OH
Formula: C9H10FNO2
MW: 183
= 98% (HPLC)
Trade Name: L-beta-Phe(4-OH)-OH
Formula: C9H11NO3
MW: 181.19
= 98% (HPLC, Chiral purity)
Trade Name: L-beta-Phe(4-CF3)-OH
Formula: C10H10F3NO2
MW: 233.19
Trade Name: L-beta-Ala-(6-methoxy-3-pyridyl)-OH
Formula: C9H12N2O3
MW: 196.21
= 99% (HPLC)
Trade Name: L-beta-Phe-OH
Formula: C9H11NO2
MW: 165.19
= 99% (HPLC)
Formula: C10H10F3NO2 HCl
MW: 269.65
= 98% (HPLC)
Trade Name: beta-HomoGlu-OH HCl
Formula: C6H11NO4 HCl
MW: 197.62
= 98% (NMR)
Trade Name: L-3-Aminobutyric acid
Formula: C4H9NO2
MW: 103.12
= 95% (NMR)
Trade Name: Boc-(S)-3-amino-2,3-dihydro-4-oxo-1,5-benzoxazepine-5(2H)-acetic acid
Formula: C16H20N2O6
MW: 336.34
= 98% (HPLC)
Formula: C10H20N2O2
MW: 200.28
= 99.6% (GC, Chiral purity)
Trade Name: (S)-1-Boc-3-(hydroxymethyl)pyrrolidine
Formula: C10H19NO3
MW: 201.26
= 95% (HPLC)
Trade Name: (S)-3-Piperidinol
Formula: C5H11NO
MW: 101.15
Trade Name: (S)-1-Isopropylaminopropanediol
Formula: C6H15NO2
MW: 133.19
= 95% (TLC)
Trade Name: (S)-3-Hydroxypyrrolidine
Formula: C4H9NO
MW: 87.12
= 99% (GC)
Trade Name: L-2-(3-Thienyl)glycine
Formula: C6H7NO2S
MW: 157.19
= 98%
Formula: C8H11NO
MW: 137.18
= 97% (HPLC)
Formula: C11H17NO
MW: 179.26
Trade Name: Z-D-ß-Dbu(Boc)-OH
Formula: C17H24N2O6
MW: 352.4
= 99% (HPLC)
Trade Name: Z-D-Dbu(Fmoc)-OH
Formula: C27H26N2O6
MW: 474.5
= 99% (HPLC)
Trade Name: N-3-Propionyl-(4S)-benzyl-2-oxazolidinone
Formula: C13H15NO3
MW: 233.26
= 99% (HPLC)
Trade Name: (S)-Morpholine-3,4-dicarboxylic acid 4-tert-butyl ester
Formula: C10H17NO5
MW: 231.25
= 95% (NMR)
Formula: C20H19NO5
MW: 353.37
= 99% (HPLC)
Trade Name: Boc-4-oxo-L-proline methyl ester
Formula: C11H17NO5
MW: 243.26
= 99% (GC, Chiral purity)
Formula: C7H13NO2
MW: 143.18
Trade Name: (S)-Dtc-OH
Formula: C6H11NO2S
MW: 161.22
= 99% (HPLC)
Trade Name: D-Pen(Acm)-OH HCl
Formula: C8H16N2O3S HCl
MW: 256.9
= 99%
Trade Name: L-Pen(Acm)-OH HCl
Formula: C8H16N2O3S HCl
MW: 256.9
= 98% (TLC)
Formula: C13H14N2O2 HCl
MW: 266.73
Formula: C16H17NO2 HCl
MW: 291.78
= 99% (TLC)
Formula: C13H14F3NO2 HCl
MW: 309.71
Formula: C11H14N2O2 2HCl
MW: 279.17
Formula: C18H19NO2 HCl
MW: 317.81
Formula: C12H15Cl2NO2
MW: 276.16
Formula: C12H14FNO2 HCl
MW: 259.71
Formula: C13H14F3NO2 HCl
MW: 309.72
= 98% (HPLC)
Formula: C10H12BrNO2S HCl
MW: 326.64
Formula: C14H15NO2S HCl
MW: 297.8
Formula: C8H13NO2 HCl
MW: 191.66
= 98% (NMR)
Formula: C12H15NO2 HCl
MW: 241.71
= 98%
Formula: C8H11NO2 HCl
MW: 189.64
Trade Name: (S)-Boc-1-adamantyl-Gly-OH
Formula: C17H27NO4
MW: 309.41
= 97% (HPLC)
Formula: C12H21NO4
MW: 243.3
= 99% (HPLC)
Trade Name: N-Boc-3-ethyl-L-norvaline
Formula: C12H23NO4
MW: 245.32
= 99% (HPLC)
Trade Name: Boc-L-Ser(propargyl)-OH DCHA
Formula: C11H17NO5 C12H23N
MW: 424.58
= 97% (HPLC)
Formula: C9H14F3NO4
MW: 257.21
= 98% (HPLC)
Trade Name: Boc-L-3,4-dimethoxy-homophenylalanine DCHA
Formula: C17H25NO6 C12H23N
MW: 520.71
= 98% (HPLC)
Trade Name: Boc-Orn(N3)-OH·DCHA
Formula: C10H18N4O4 C12H23N
MW: 439.6
= 98% (HPLC)
(S)-Boc-2-amino-6-benzyloxy-hexanoic acid·DCHA
Formula: C18H27NO5 C12H23N
MW: 518.74
= 97% (HPLC)
Formula: C9H14F3NO4
MW: 257.21
= 97% (HPLC)
Formula: C18H25NO4 C12H23N
MW: 500.72
= 99% (HPLC)
Formula: C12H21NO4
MW: 243.3
Trade Name: Boc-(4-pyridyl)-L-ß-homoalanine
Formula: C14H20N2O4
MW: 280.32
= 95% (HPLC)
Formula: C10H19NO4
MW: 217.27
= 99% (HPLC)
Trade Name: (S)-Boc-5,5-dimethyl-Pro-OH
Formula: C12H21NO4
MW: 243.3
= 99% (HPLC)
Trade Name: (S)-3-(Boc-amino)-2-methylpropionic acid
Formula: C9H17NO4
MW: 203.3
= 99% (TLC)
Trade Name: Boc-Nspe-OH DCHA
Formula: C15H21NO4 C12H23N
MW: 460.66
= 99% (HPLC)
Formula: C10H17NO4
MW: 215.25
Trade Name: (S)-Chroman-4-amine hydrochloride
Formula: C9H11NO HCl
MW: 185.65
= 98% (NMR)
Trade Name: (S)-Fmoc-1-adamantyl-Gly-OH
Formula: C27H29NO4
MW: 431.53
= 98% (HPLC)
Trade Name: Fmoc-alpha-Me-L-Asp(OtBu)-OH
Formula: C24H27NO6
MW: 425.48
= 98% (HPLC)
Formula: C22H23NO4
MW: 365.43
= 99% (HPLC)
Trade Name: Fmoc-L-Agp(Pbf)-OH
Formula: C32H36N4O7S
MW: 620.72
= 97% (HPLC)
Formula: C28H37NO5
MW: 467.6
= 99% (HPLC)
Formula: C22H25NO4
MW: 367.44
= 99% (HPLC)
Trade Name: Fmoc-L-Ser(Propargyl)-OH
Formula: C21H19NO5
MW: 365.39
= 99% (HPLC)
Trade Name: Fmoc-alpha-Me-L-Ser(tBu)-OH
Formula: C23H27NO5
MW: 397.47
= 98% (HPLC)
Formula: C19H16F3NO4
MW: 379.34
= 98% (HPLC)
Trade Name: Fmoc-L-Agb(Pbf)-OH
Formula: C33H38N4O7S
MW: 634.75
= 97% (HPLC)
Formula: C24H27NO6
MW: 425.48
= 99% (HPLC)
Trade Name: Fmoc-L-Arg(CF3CH2)(Pbf)-OH
Formula: C36H41F3N4O7S
MW: 730.8
= 97% (HPLC)
Trade Name: Fmoc-L-Homogln(Trt)-OH
Formula: C40H36N2O5
MW: 624.74
= 99% (HPLC)
Trade Name: (S)-Fmoc-2-amino-5-tritylsulfanyl-pentanoic acid
Formula: C39H35NO4S
MW: 613.77
= 99% (HPLC)
Trade Name: Fmoc-L-Arg(Boc-NH)(Pbf)-OH
Formula: C39H49N5O9S
MW: 763.91
= 95% (HPLC)
Formula: C38H48N4O8S
MW: 720.88
= 98% (HPLC)
Formula: C30H37NO8
MW: 539.63
= 97% (HPLC)
Trade Name: Fmoc-CML(OtBu)(Boc)-OH
Formula: C32H42N2O8
MW: 582.69
= 97% (HPLC)
Formula: C25H31NO5
MW: 425.52
= 97% (HPLC)
Formula: C31H39NO8
MW: 553.65
= 98% (HPLC)
Trade Name: (S)-Fmoc-2-amino-pimelic acid-7-tert-butyl ester
Formula: C26H31NO6
MW: 453.54
= 98% (HPLC)
Trade Name: (S)-Fmoc-beta2-homophenylalanine
Formula: C25H23NO4
MW: 401.46
= 98% (HPLC)
Formula: C19H16F3NO4
MW: 379.34
= 99% (HPLC)
Formula: C38H46N4O7S
MW: 702.87
= 99% (HPLC)
Formula: C28H27NO4
MW: 441.53
= 97% (HPLC)
Formula: C22H23NO4
MW: 365.43
Trade Name: (S)-Fmoc-5,5-dimethyl-Pro-OH
Formula: C22H23NO4
MW: 365.43
= 98% (HPLC)
Trade Name: (S)-Fmoc-2-amino-3-hydroxy-3-methyl-butyric acid
Formula: C20H21NO5
MW: 355.39
= 99% (HPLC)
Trade Name: Fmoc-Nspe-OH
Formula: C25H23NO4
MW: 401.46
= 99% (HPLC)
Formula: C10H13NO2S HCl
MW: 247.74
Trade Name: Phenyl (E)-(3S)-3-amino-5-phenylpent-1-enyl sulfone hydrochloride
Formula: C17H19NO2S HCl
MW: 337.86
= 99% (HPLC)
Trade Name: Methyl (E)-(3S)-3-amino-5-methylhex-1-enyl sulfone hydrochloride
Formula: C8H17NO2S HCl
MW: 227.75
Trade Name: Phenyl (E)-(3S)-3-amino-5-methylhex-1-enyl sulfone hydrochloride
Formula: C13H19NO2S HCl
MW: 289.82
Formula: C17H16F3NO2 HCl
MW: 359.77
Formula: C11H14N2O3 HCl
MW: 258.7
= 96% (HPLC)
Formula: C18H19NO3 HCl
MW: 333.81
Formula: C18H19NO3 HCl
MW: 333.81
Trade Name: (S)-3-Morpholinecarboxylic acid
Formula: C5H9NO3
MW: 131.13
Formula: C28H36N2O6
MW: 496.59
= 99% (HPLC)
Trade Name: Fmoc-L-Holys(Boc)-OH
Formula: C27H34N2O6
MW: 482.57
= 97% (HPLC)
Trade Name: Boc-L-Phe-nitrile
Formula: C14H18N2O2
MW: 246.31
= 99% (HPLC)
Trade Name: Fmoc-L-Dap(Boc)-ol
Formula: C23H28N2O5
MW: 412.5
= 99% (HPLC)
Trade Name: Z-L-Dap(Boc)-ol
Formula: C16H24N2O5
MW: 324.4
= 99% (HPLC)
Trade Name: Methyl (E)-(3S)-3-amino-4-phenylbut-1-enyl sulfone hydrochloride
Trade Name: Phenyl (E)-(3S)-3-amino-4-phenylbut-1-enyl sulfone hydrochloride
Formula: C16H17NO2S HCl
MW: 323.84
Trade Name: L-Pro-OBg TFA
Formula: C11H21NO3 C2HF3O2
MW: 452.4
= 99% (HPLC)
Formula: C13H24N2O3
MW: 256.34
Trade Name: (S)-(-)-3-Z-4-oxazolidinecarboxylic acid
Formula: C12H13NO5
MW: 251.24
= 97% (HPLC)
Formula: C32H32N2O
MW: 460.62
Trade Name: LC-SPDP
Formula: C18H23N3S2O5
MW: 425.52
= 97% (HPLC)


Chemical Suppliers

Policy & Agreement | Privacy Policy © 2000-2018 ChemBuyersGuide.com All rights reserved