
Chemical Search

C/D/N Isotopes Inc.

Country: Canada

C/D/N Isotopes Inc.
88 Leacock Street
Pointe-Claire, Quebec
Canada H9R 1H1

Phone: (800) 565-4696
Phone 2: (514) 697-6254
FAX: (514) 697-6148
E-Mail:E-Mail this Supplier

Since 1993, C/D/N Isotopes has been a leading manufacturer of deuterium stable labeled compounds, providing our customers with superior quality and exceptional service. Researchers in all branches of science and medicine, from around the world, depend on us as the company for deuterium labeled compounds.

We have more than 3000 products in stock. As a result, we are able to ship most products within 24 to 48 hours after receipt of order. In fact, 98% of our orders are filled from stock.

The majority of the products listed on our website are manufactured exclusively by C/D/N Isotopes. Over the years, we have developed and expanded our expertise in the preparation of deuterated compounds, and we are continuously adding new products.

Most new products are the direct result of inquiries from our customers. Our extensive Custom Synthesis capabilities allow us to develop the products that our customers need, in a timely manner and at a reasonable price. Our Quality Control ensures that the isotopic enrichment and chemical purity of our products meet the highest standards.

Our courteous and helpful Customer Service professionals are available to assist you with all your stable labeled product requirements.

Product List: 3,036

PON:Page:1 | 2 | 3 |


Products for C/D/N Isotopes Inc.

MW: 273.39
97 atom % D
MW: 270.37
96 atom % D
Formula: C6D4(CD2Br)2
MW: 272.01
98 atom % D
Formula: C6D5CCl3
MW: 200.51
99 atom % D
Formula: C6D5CF3
MW: 151.14
99 atom % D
Formula: C6Cl6D6
MW: 296.87
99 atom % D
Formula: (CD3)2C(NH2)COOH
MW: 109.16
99 atom % D
MW: 283.37
MW: 290.41
99 atom % D
Formula: C6D5C(CD3)=CD2
MW: 128.24
98 atom % D
MW: 157.27
98 atom % D
Formula: H2NCD2CD2COOH
MW: 93.12
98 atom % D
Formula: HN(CD2CD2COOH)2
MW: 169.21
98 atom % D
Formula: C6Cl6D6
MW: 296.87
99 atom % D
MW: 104.14
98 atom % D
MW: 123.22
98 atom % D
MW: 120.18
99 atom % D
Formula: C6H5CH(Br)CD3
MW: 188.08
98 atom % D
MW: 345.71
99 atom % D
Formula: HOC6H4CD(OH)CD2NH2
MW: 192.66
98 atom % D
Formula: CH3CH2CH(OH)CD3
MW: 77.14
99 atom % D
(±)-SEC-BUTYL-3,3,4,4,4-D5 ALCOHOL
Formula: CD3CD2CH(OH)CH3
MW: 79.15
99 atom % D
Formula: CD3CD2CD(OH)CD3
MW: 83.18
98 atom % D
MW: 345.71
99 atom % D
MW: 592.4
98 atom % D
Formula: CD3CD(Br)CD2Br
MW: 207.93
98 atom % D
Formula: CD3CDClCD2Cl
MW: 119.02
98 atom % D
MW: 137.19
98 atom % D
Formula: CH3CD(NH2)CD2NH2
MW: 77.14
99 atom % D
Formula: CD3CD(OH)CD2OH
MW: 82.13
98 atom % D
Formula: CH3CH(OD)CH2OD
MW: 78.11
98 atom % D
Formula: CD3CD(OD)CD2OD
MW: 84.14
98 atom % D
MW: 61.1
99 atom % D
MW: 108.13
98 atom % D
MW: 64.12
98 atom % D
MW: 160.27
98 atom % D
MW: 164.3
97 atom % D
MW: 144.26
98 atom % D
Formula: CD3CD(OH)CD2NH2
MW: 81.15
98 atom % D
Formula: (CD3)2CDCH(CH2CH3)CH2Br
MW: 186.14
99 atom % D
Formula: C6D5CH(OH)CH3
MW: 127.19
98 atom % D
Formula: C6H5CD(OH)CD3
MW: 126.19
98 atom % D
Formula: C6H5CD(OH)CH3
MW: 123.17
98 atom % D
Formula: C6H5CH(OH)CD3
MW: 125.18
98 atom % D
Formula: C6D5CD(OD)CD3
MW: 132.23
98 atom % D
Formula: CH3CH2CH(CD3)(CH2)16COOH
MW: 329.58
99 atom % D
MW: 238.08
98 atom % D
MW: 217.67
98 atom % D
Formula: C6H5COCH(CH3)NHCD2CD3•HCl
MW: 218.74
99 atom % D
Formula: CH3CH2CH2CD2CD(NH2)CD3
MW: 107.23
98 atom % D
Formula: CD3CD2CD(Br)CD3
MW: 146.07
99 atom % D
(±)-2-BROMOBUTYRIC-2,3,3,4,4,4-D6 ACID
Formula: CD3CD2CD(Br)COOH
MW: 173.04
98 atom % D
Formula: CD3CD(Br)COOH
MW: 157
98 atom % D
Formula: CD3CH(Br)COOH
MW: 155.99
98 atom % D
Formula: CD3CD2CD(Cl)CD3
MW: 101.62
98 atom % D
(±)-2-CHLOROBUTYRIC-2,3,3,4,4,4-D6 ACID
Formula: CD3CD2CD(Cl)COOH
MW: 128.59
98 atom % D
Formula: CD3CD(Cl)COCl
MW: 130.99
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)COOH
MW: 159.3
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2OCOCH3<
MW: 189.37
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2OH
MW: 147.33
98 atom % D
MW: 135.18
99 atom % D
Formula: CD3CD2CD(l)CD3
MW: 193.07
99 atom % D
Formula: CD3CD(OH)CD2C(CD3)2OH
MW: 130.25
98 atom % D
Formula: CH3CH2CH(CD3)COOH
MW: 105.15
99 atom % D
MW: 110.22
99 atom % D
MW: 138.15
98 atom % D
Formula: CD3CD2CD(CD3)COOH
MW: 111.19
98 atom % D
Formula: CD3CD2CD(CD3)COCl
MW: 129.63
98 atom % D
MW: 107.21
98 atom % D
(±)-2-PENTYL-1,1,1,3,3-D5 ALCOHOL
Formula: CH3CH2CD2CH(OH)CD3
MW: 93.18
98 atom % D
MW: 201.24
99 atom % D
MW: 258.4
98 atom % D
Formula: H2NCD2CD(CH3)COOH
MW: 106.14
98 atom % D
Formula: ClCD2CD(OH)CD2OH
MW: 115.57
98 atom % D
Formula: CD3(CD2)4CD(CD3)CD2CD3
MW: 148.38
98 atom % D
MW: 127.23
99 atom % D
MW: 92.15
97 atom % D
MW: 134.23
99 atom % D
MW: 201.19
99 atom % D
MW: 199.18
93 atom % D
MW: 311.81
MW: 318.85
99 atom % D
Formula: CH3CH2CH(CD3)(CH2)5COOH
MW: 175.29
99 atom % D
MW: 343.47
99 atom % D
MW: 242.33
98 atom % D
MW: 432.96
98 atom % D
MW: 381.45
99 atom % D
MW: 528.98
98 atom % D
MW: 273.38
98 atom % D
MW: 296.85
98 atom % D
MW: 292.39
99 atom % D
Formula: C6D5COCH(OH)C6D5
MW: 222.31
98 atom % D
MW: 350.94
99 atom % D
MW: 390.52
99 atom % D
MW: 297.49
98 atom % D
MW: 285.26
99 atom % D
MW: 305.43
99 atom % D
MW: 341.89
99 atom % D
MW: 412.9
98 atom % D
MW: 410.5
99 atom % D
MW: 392.92
99 atom % D
MW: 378.85
99 atom % D
MW: 396.9
98 atom % D
MW: 409.33
98 atom % D
MW: 286.25
99 atom % D
(±)-COTININE-2,4,5,6-D4 (PYRIDINE-D4)
MW: 180.24
98 atom % D
MW: 179.24
98 atom % D
MW: 405.52
99 atom % D
MW: 419.98
99 atom % D
MW: 392.48
99 atom % D
MW: 93.53
98 atom % D
MW: 97.56
98 atom % D
MW: 189.24
98 atom % D
MW: 186.22
99 atom % D
(±)-ETODOLAC-D3 (1-ETHYL-2,2,2-D3)
MW: 290.38
99 atom % D
MW: 387.28
99 atom % D
MW: 341.85
99 atom % D
MW: 350.82
99 atom % D
MW: 404.4
99 atom % D
MW: 249.3
99 atom % D
(±)-GLYCERYL-1,1,2,3,3-D5 1-MONOOLEATE
MW: 361.58
98 atom % D
MW: 79.11
98 atom % D
MW: 209.3
99 atom % D
MW: 231.28
99 atom % D
MW: 400.29
98 atom % D
Formula: 97% chemical purity
MW: 415.38
99 atom % D
MW: 535.46
98 atom % D
MW: 257.3
98 atom % D
MW: 258.31
99 atom % D
MW: 157.27
99 atom % D
(±)-MANDELIC-2,3,4,5,6-D5 ACID
Formula: C6D5CH(OH)COOH
MW: 157.18
98 atom % D
MW: 236.71
98 atom % D
MW: 236.71
99 atom % D
MW: 244.26
99 atom % D
MW: 289.83
98 atom % D
MW: 310.87
99 atom % D
MW: 137.19
98 atom % D
MW: 134.17
98 atom % D
MW: 133.16
99 atom % D
MW: 303.85
99 atom % D
MW: 484.14
98 atom % D
MW: 297.83
99 atom % D
MW: 181.23
98 atom % D
MW: 281.45
99 atom % D
MW: 168.24
98 atom % D
MW: 161.2
98 atom % D
MW: 233.28
99 atom % D
(±)-NICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
MW: 166.26
98 atom % D
MW: 165.25
99 atom % D
MW: 169.28
98 atom % D
MW: 392.44
99 atom % D
(±)-NOREPINEPHRINE-2,5,6,α,β,β-D6 HCL
MW: 211.67
99 atom % D
MW: 336.8
98 atom % D
MW: 222.68
98 atom % D
MW: 152.23
98 atom % D
MW: 219.25
99 atom % D
MW: 298.4
97 atom % D
MW: 405.02
99 atom % D
MW: 333.43
99 atom % D
(±)-PENCONAZOLE-D7 (PENTYL-3,3,4,4,5,5,5-D7)
MW: 291.23
98 atom % D
MW: 345.32
99 atom % D
MW: 255.37
99 atom % D
MW: 360.46
98 atom % D
MW: 376.46
99 atom % D
MW: 324.9
98 atom % D
(±)-PROPAFENONE-D5 HCL (PROPYL-2,2,3,3,3-D5)
MW: 382.94
98 atom % D
MW: 384.95
99 atom % D
MW: 266.39
97 atom % D
MW: 325.4
99 atom % D
MW: 375.83
98 atom % D
MW: 340.86
97 atom % D
MW: 343.88
99 atom % D
MW: 508.51
98 atom % D
MW: 281.45
98 atom % D
MW: 418.59
98 atom % D
MW: 315.87
99 atom % D
MW: 152.1
98 atom % D
MW: 311.85
98 atom % D
MW: 536.49
98 atom % D
MW: 123.16
98 atom % D
MW: 262.26
98 atom % D
MW: 410.05
98 atom % D
MW: 489.67
98 atom % D
MW: 305.88
99 atom % D
MW: 174.68
98 atom % D
MW: 297.78
98 atom % D
MW: 413.53
99 atom % D
MW: 333.36
99 atom % D (also 12%-4,4-d2)
MW: 319.9
99 atom % D
MW: 494.09
99 atom % D
MW: 313.36
99 atom % D
MW: 454
99 atom % D
MW: 171.3
99 atom % D
MW: 333.5
99 atom % D
MW: 318.49
98 atom % D
MW: 437.52
99 atom % D
MW: 165.22
99 atom % D
MW: 134.23
98 atom % D
MW: 296.85
98 atom % D
MW: 285.37
99 atom % D
MW: 206.69
97 atom % D
MW: 165.6
96 atom % D
(RS)-MALIC-2,3,3-D3 ACID
MW: 137.11
98 atom % D
Formula: CD3CH(NH2)CH2OH
MW: 78.13
99 atom % D
MW: 163.25
98 atom % D
MW: 457.62
99 atom % D
Formula: (HO)2C6D3CH2C(CH3)(NHNH2)COOH
MW: 247.27
98 atom % D
(S)-(-)-MALIC-2,3,3-D3 ACID
MW: 137.11
98 atom % D
MW: 364.39
99 atom % D
MW: 443.57
98 atom % D
MW: 494.09
99 atom % D
MW: 165.6
94 atom % D
MW: 291.29
99 atom % D
(1S,3′R)-SOLIFENACIN-D7 HCL (2′,2′,3′,6′,6′,7′,7′-D7)
MW: 405.97
98 atom % D
MW: 259.51
99 atom % D
MW: 224.06
98 atom % D
MW: 226.07
98 atom % D
MW: 207.05
98 atom % D
Formula: C6D5CH2CH2Br
MW: 190.09
99 atom % D
MW: 299.81
99 atom % D
MW: 201.23
99 atom % D
MW: 253.32
99 atom % D
(2S,2′S)-ETHAMBUTOL-D10 (1,1,1′,1′,2,2′-D6; ETHYLENE-D4)
MW: 214.37
99 atom % D
MW: 208.34
99 atom % D
MW: 406.68
98 atom % D
Formula: (CH3O)3C6H2CD2COOH
MW: 228.24
97 atom % D
MW: 173.18
98 atom % D
Formula: (CH3O)2C6H3CD2COOH
MW: 198.21
98 atom % D
Formula: CH3(CH2)8C6H4OCD2COOH
MW: 280.4
98 atom % D
Formula: HOOCCH2(CD2)2CH2P(C6H5)3D-2192
MW: 447.34
98 atom % D
MW: 203.64
98 atom % D
Formula: FC6H4CD2COOH
MW: 156.15
98 atom % D (also 10% 3,5-d2)
Formula: HO(CH3O)C6H3CD2COOH
MW: 184.19
98 atom % D
Formula: HO(CH3O)C6D3CD2COOH
MW: 187.21
99 atom % D
Formula: HOOCCH2(CD23CH2P(C6H5)3Br
MW: 463.38
99 atom % D
MW: 392.43
99 atom % D
Formula: C6D11CH2Br
MW: 188.15
98 atom % D
MW: 139.03
99 atom % D
Formula: C3H4DCD2Br
MW: 138.02
98 atom % D
Formula: CHD=CHD
MW: 30.07
98 atom % D
Formula: CD3CD2CD(NH2)COOH
MW: 109.16
98 atom % D
MW: 185.22
99 atom % D
MW: 188.23
98 atom % D
MW: 183.2
99 atom % D
Formula: CD3CD(NH2)COOH
MW: 93.12
98 atom % D
Formula: CD3CD(NH-t-BOC)COOH
MW: 193.23
98 atom % D
MW: 315.36
98 atom % D
Formula: CH3CD(NH2)COOH
MW: 90.1
97 atom % D
Formula: CD3CH(NH2)COOH
MW: 92.11
99 atom % D
Formula: CD3CH(NH-t-BOC)COOH
MW: 192.23
99 atom % D
MW: 314.35
99 atom % D
Formula: CD3CD(ND2)COOD
MW: 96.14
98 atom % D
MW: 182.17
98 atom % D
D-GLUTAMIC-2,3,3,4,4-D5 ACID
MW: 152.16
98 atom % D
Formula: (CD3)2CDCD2CD(NH2)COOH
MW: 141.24
98 atom % D
D-LYSINE-3,3,4,4,5,5,6,6-D8 2HCL
Formula: H2N(CD2)4CH(NH2)COOH•2HCl
MW: 227.16
99 atom % D
D-LYSINE-4,4,5,5-D4 2HCL
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•2H
MW: 223.14
98 atom % D
D-LYSINE-4,4,5,5-D4 HCL
Formula: H2BCH2(CD2)2CH2CH(NH2)COOH•HC
MW: 186.67
98 atom % D
MW: 190.22
99 atom % D
MW: 152.23
98 atom % D
MW: 374.47
98 atom % D
Formula: C6D5CH2CH(NH2)COOH
MW: 170.22
99 atom % D
Formula: C6D5CD2CD(NH2)COOH
MW: 173.24
98 atom % D
Formula: C6D5CH2CH(NH-t-BOC)COOH
MW: 270.34
99 atom % D
MW: 392.46
99 atom % D
MW: 118.15
98 atom % D
MW: 340.39
98 atom % D
D-TRYPTOPHAN-2′,4′,5′,6′,7′-D5 (INDOLE-D5)
MW: 209.26
98 atom % D
Formula: (CD3)2CDCD(NH2)COOH
MW: 125.2
98 atom % D
Formula: C6D5CH(NH2)COOH
MW: 156.2
98 atom % D
MW: 226.28
98 atom % D
MW: 164.18
98 atom % D
Formula: CD3CD2CD(NH2)COOH
MW: 109.16
98 atom % D
MW: 138.21
98 atom % D
MW: 134.15
98 atom % D
MW: 184.21
98 atom % D
MW: 188.23
98 atom % D
MW: 183.2
98 atom % D
Formula: CD3CD(NH2)COOH
MW: 93.12
98 atom % D
Formula: CH3CD(NH2)COOH
MW: 90.1
98 atom % D
MW: 312.34
98 atom % D
Formula: CD3CH(NH2)COOH
MW: 92.11
99 atom % D
MW: 136.12
98 atom % D
Formula: HOOCCH2CH(OH)CH2N(CD3)3Cl
MW: 206.72
99 atom % D
Formula: [SCD2CD(NH2)COOH]2
MW: 246.33
98 atom % D
MW: 152.16
98 atom % D
MW: 150.15
98 atom % D
MW: 158.17
98 atom % D
MW: 205.22
98 atom % D
MW: 157.65
98 atom % D
MW: 139.21
98 atom % D
Formula: [HOOCCH(NH2)CD2CD2S]2
MW: 276.39
98 atom % D
Formula: (CD3)2CDCD2CD(NH2)COOH
MW: 141.24
98 atom % D
MW: 363.48
98 atom % D
Formula: (CD3)2CDCH2CH(NH2)COOH
MW: 138.22
98 atom % D
DL-LYSINE-2,3,3,4,4,5,5,6,6-D9 2HCL
Formula: H2N(CD2)4CD(NH2)COOH•2HCl
MW: 228.17
99 atom % D
DL-LYSINE-3,3,4,4,5,5,6,6-D8 2HCL
Formula: H2N(CD2)4CH(NH2)COOH•2HCl
MW: 227.16
98 atom % D
DL-LYSINE-4,4,5,5-D4 2HCL
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•2H
MW: 223.13
98 atom % D
MW: 150.21
98 atom % D
MW: 153.23
98 atom % D
MW: 152.23
98 atom % D
Formula: C6D5CH2CH(NH2)COOH
MW: 170.22
98 atom % D
Formula: C6D5CD2CD(NH2)COOH
MW: 173.24
98 atom % D
Formula: C6D5CD2CH(NH2)COOH
MW: 172.23
98 atom % D
Formula: C6H5CH2CD(NH2)COOH
MW: 166.2
98 atom % D
MW: 116.14
98 atom % D
MW: 258.35
99 atom % D
MW: 244.32
98 atom % D
MW: 241.3
99 atom % D
MW: 108.11
98 atom % D
MW: 207.25
98 atom % D
MW: 212.28
98 atom % D
Formula: (CH3)2CDCD(NH2)COOH
MW: 119.16
98 atom % D
Formula: (CH3)2CHCD(NH2)COOH
MW: 118.15
98 atom % D
Formula: (CH3)2CDCH(NH2)COOH
MW: 118.15
98 atom % D
Formula: (CD3)2CDCD(NH2)COOH
MW: 125.2
98 atom % D
Formula: HOC6D4COOCH2CH(CH3)2
MW: 198.25
98 atom % D
Formula: HOC6D4COOCH(CH3)2
MW: 184.23
98 atom % D
Formula: CD3COOCD(CD3)2
MW: 112.19
99 atom % D
Formula: (CD3)2CDOD
MW: 68.14
99 atom % D
Formula: (CH3)2CHOD
MW: 61.1
98 atom % D
Formula: (CD3)2CHOH
MW: 66.13
99 atom % D
Formula: (CD3)2CHNH2
MW: 65.15
99 atom % D
Formula: (CD3)2CHNH2•HCl
MW: 101.61
99 atom % D
Formula: (CH3)2CDOH
MW: 61.1
98 atom % D
Formula: (CD3)2CDOH
MW: 67.14
99 atom % D
Formula: (CD3)2CDNH2
MW: 66.15
99 atom % D
Formula: (CD3)2CDNH2•HCl
MW: 102.61
99 atom % D
Formula: (CD3)2CDND2
MW: 68.17
98 atom % D
Formula: (CD3)2CDND2•DCl
MW: 105.63
98 atom % D
Formula: CH3CD2CH(NH2)COOH
MW: 105.13
98 atom % D
Formula: CD3CD2CD(NH2)COOH
MW: 109.16
98 atom % D
MW: 122.18
98 atom % D
MW: 134.15
98 atom % D
MW: 214.24
99 atom % D
MW: 183.2
97 atom % D
MW: 184.2
98 atom % D
MW: 183.2
98 atom % D
MW: 185.22
98 atom % D
MW: 188.23
98 atom % D
MW: 186.22
98 atom % D
MW: 183.2
99 atom % D
Formula: CD3CD(NH2)COOH
MW: 93.12
98 atom % D
Formula: CD3CD(NH-t-BOC)COOH
MW: 193.24
98 atom % D
MW: 315.36
98 atom % D
Formula: CH3CD(NH2)COOH
MW: 90.1
98 atom % D
Formula: CH3CD(NH-t-BOC)COOH
MW: 190.22
98 atom % D
MW: 312.34
98 atom % D
Formula: CD3CH(NH2)COOH
MW: 92.11
99 atom % D
Formula: CD3CH(NH-t-BOC)COOH
MW: 192.23
99 atom % D
MW: 314.35
99 atom % D
Formula: CD3CD(ND2)COOD
MW: 96.14
98 atom % D
Formula: CH3CH(ND2)COOD
MW: 92.11
99 atom % D
MW: 136.12
98 atom % D
Formula: HOOCCH2CH(OH)CH2N(CH3)2(CD3)Cl
MW: 200.68
99 atom % D
MW: 182.23
98 atom % D
Formula: (HO)2C6D3CH2CH(NH2)COOH
MW: 200.21
98 atom % D
L-GLUTAMIC-2,3,3,4,4-D5 ACID
MW: 152.16
98 atom % D
MW: 151.18
98 atom % D
MW: 212.65
98 atom % D (also 18% deuterated on β,β-d2 positions)
Formula: [HOOCCH(NH2)CD2CD2S]2
MW: 276.39
98 atom % D
MW: 132.18
98 atom % D
Formula: (CH3)2CHCH2CD(NH2)COOH
MW: 132.18
98 atom % D
Formula: (CH3)2CHCD2CH(NH2)COOH
MW: 133.19
98 atom % D
Formula: (CD3)2CDCD2CD(NH2)COOH
MW: 141.24
98 atom % D
Formula: (CD3)2CDCD2CD(NH-t-BOC)COOH•H2O
MW: 259.36
98 atom % D
MW: 363.48
98 atom % D
MW: 134.19
99 atom % D
MW: 252.32
99 atom % D
MW: 356.44
99 atom % D
Formula: (CD3)2CDCH2CH(NH2)COOH
MW: 138.22
98 atom % D
Formula: (CD3)2CDCH2CH(NH-t-BOC)COOH•H2O
MW: 256.35
98 atom % D
L-LYSINE-2,3,3,4,4,5,5,6,6-D9 HCL
Formula: H2N(CD2)4CD(NH2)COOH•HCl
MW: 191.71
99 atom % D
Formula: H2NCD2(CH2)3CD(NH2)COOH•HCl
MW: 185.67
98 atom % D
L-LYSINE-3,3,4,4,5,5,6,6-D8 HCL
Formula: H2N(CD2)4CH(NH2)COOH•HCl
MW: 190.7
99 atom % D
L-LYSINE-4,4,5,5-D4 HCL
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•HC
MW: 186.67
98 atom % D
MW: 350.45
98 atom % D
MW: 153.23
98 atom % D
MW: 152.23
98 atom % D
Formula: (CD3)2SCH2CH2CH(NH2)COOH•Cl
MW: 205.73
98 atom % D
MW: 374.47
98 atom % D
L-ORNITHINE-2,3,3,4,4,5,5-D7 HCL
Formula: H2N(CD2)3CD(NH2)COOH•HCl
MW: 175.67
98 atom % D
Formula: C6D5CH2CH(NH2)COOH
MW: 170.22
98 atom % D
Formula: C6D5CD2CD(NH2)COOH
MW: 173.24
98 atom % D
Formula: C6D5CD2CD(NH-t-BOC)COOH
MW: 273.36
98 atom % D
MW: 395.48
98 atom % D
Formula: C6D5CH2CH(NH-t-BOC)COOH
MW: 270.34
98 atom % D
MW: 392.46
98 atom % D
Formula: C6H5CD2CH(NH2)COOH
MW: 167.2
98 atom % D
MW: 117.17
98 atom % D
MW: 118.15
98 atom % D
MW: 340.39
98 atom % D
MW: 380.97
98 atom % D
MW: 108.11
98 atom % D
MW: 208.22
98 atom % D
MW: 330.35
98 atom % D
MW: 112.14
98 atom % D
MW: 179.23
99 atom % D
MW: 121.13
98 atom % D
L-TRYPTOPHAN-2′,4′,5′,6′,7′-D5 (INDOLE-D5)
MW: 209.26
98 atom % D
MW: 207.25
98 atom % D
Formula: (CH3)2CHCD(NH2)COOH
MW: 118.15
98 atom % D
Formula: (CD3)2CDCD(NH2)COOH
MW: 125.2
98 atom % D
Formula: (CD3)2CDCD(NH-t-BOC)COOH
MW: 225.31
98 atom % D
MW: 347.44
98 atom % D
Formula: CD3C6H4OH
MW: 111.16
98 atom % D
Formula: CD3C6D4OH
MW: 115.18
98 atom % D
Formula: CD3C6D4OD
MW: 116.19
98 atom % D
MW: 244.39
98 atom % D
Formula: CD3C6D4COOH
MW: 143.19
98 atom % D
Formula: CH3C6HD3NH2
MW: 110.17
98 atom % D
Formula: CD3C6D4ND2
MW: 116.21
98 atom % D
Formula: CD3C6D4CN
MW: 124.19
98 atom % D
Formula: C6H4(CD3)2
MW: 112.2
99 atom % D
Formula: C6D4(CD3)2
MW: 116.23
98 atom % D
Formula: C6D4(CH3)2
MW: 110.19
98 atom % D
Formula: (CDOH)6
MW: 186.19
98 atom % D
N-BUTANE-1,1,1,4,4,4-D6 (GAS)
Formula: CD3CH2CH2CD3
MW: 64.16
98 atom % D
N-BUTANE-1,1,1-D3 (GAS)
Formula: CH3CH2CH2CD3
MW: 61.14
98 atom % D
Formula: CH2DCH2CH2CH2D
MW: 60.14
98 atom % D
Formula: CH3CH2CH2CH2D
MW: 59.13
98 atom % D
N-BUTANE-2,2,3,3-D4 (GAS)
Formula: CH3CD2CD2CH3
MW: 62.14
98 atom % D
Formula: CD3CD2CD2CD3
MW: 68.18
98 atom % D
MW: 198.25
98 atom % D
MW: 128.23
98 atom % D
Formula: CD3CD2CD2CD2OD
MW: 84.18
99 atom % D
Formula: CH3CH2CH2CH2OD
MW: 75.13
98 atom % D
N-BUTYL-1,1,2,2,3,3-D6 ALCOHOL
Formula: CH3CD2CD2CD2OH
MW: 80.16
98 atom % D
Formula: CH3CH2CD2CD2OH
MW: 78.15
98 atom % D
Formula: CH3CH2CH2CD2OH
MW: 76.13
99 atom % D
N-BUTYL-2,2,3,3,4,4,4-D7 ALCOHOL
Formula: CD3CD2CD2CH2OH
MW: 81.17
98 atom % D
N-BUTYL-3,3,4,4,4-D5 ALCOHOL
Formula: CD3CD2CH2CH2OH
MW: 79.15
98 atom % D
Formula: CD3CH2CH2CH2OH
MW: 77.14
99 atom % D
Formula: C6H5(CH2)3CD3
MW: 137.24
98 atom % D
Formula: CD3CD2CD2CD2OH
MW: 83.18
99 atom % D
Formula: CD3CD2CD2CD2NH2
MW: 82.19
98 atom % D
Formula: CD3CD2CD2CD2NH2•HCl
MW: 118.65
98 atom % D
Formula: C6H5(CD2)3CD3
MW: 143.28
98 atom % D
Formula: CD3(CD2)3SnCl3
MW: 291.22
98 atom % D
Formula: CD3CD2CD2CD2ND2•DCl
MW: 121.67
98 atom % D
Formula: CH3CH2CH2CH2ND2•DCl
MW: 112.62
98 atom % D
Formula: C6D5(CH2)3CH3
MW: 139.25
98 atom % D
Formula: C6D5(CD2)3CD3
MW: 148.31
98 atom % D
Formula: CD3CD2CD2CHO
MW: 79.15
98 atom % D
Formula: CH3CH2CD2CHO
MW: 74.12
98 atom % D
Formula: CD3CD2CD2CDO
MW: 80.16
99 atom % D
Formula: CD3(CD2)8CD3
MW: 164.42
98 atom % D
Formula: CH3(CH2)7CD2CD2OH
MW: 162.31
99 atom % D
N-DECYL-9,9,10,10,10-D5 ALCOHOL
Formula: CD3CD2(CH2)8OH
MW: 163.31
98 atom % D
Formula: CD3(CD2)9OH
MW: 179.41
98 atom % D
Formula: CD3(CD2)20CD3
MW: 356.89
98 atom % D
Formula: CD3(CD2)10CD3
MW: 196.5
98 atom % D
Formula: CD3(CD2)11OH
MW: 211.49
98 atom % D
Formula: CD3(CD2)11NH2
MW: 210.5
98 atom % D
Formula: CD3(CD2)30CD3
MW: 517.28
98 atom % D
Formula: CD3(CD2)18CD3
MW: 324.81
98 atom % D
Formula: CD3(CD2)19OH
MW: 339.8
99 atom % D
Formula: CD3(CD2)19CD3
MW: 340.85
99 atom % D
Formula: CD3(CD2)15CD3
MW: 276.69
98 atom % D
Formula: CD3(CD2)5CD3
MW: 116.3
99 atom % D
Formula: HOC6D4COO(CH2)6CH3
MW: 240.33
98 atom % D
Formula: CH3(CH2)5CHDOH
MW: 117.21
99 atom % D
N-HEPTYL-5,5,6,6,7,7,7-D7 ALCOHOL
Formula: CD3CD2CD2(CH2)4OH
MW: 123.25
98 atom % D
Formula: CD3(CD2)6OH
MW: 131.29
98 atom % D
Formula: C6D5(CH2)6CH3
MW: 181.33
98 atom % D
Formula: C6D5(CD2)6CD3
MW: 196.42
98 atom % D
Formula: CD3(CD2)24CD3
MW: 421.04
98 atom % D
Formula: CD3(CD2)14CD3
MW: 260.65
98 atom % D
Formula: CH3(CH2)13(CD2)2OH
MW: 246.47
99 atom % D
Formula: CD3(CH2)14COOCD2CD2(CH2)13D-7369
MW: 487.9
99 atom % D
N-HEXADECYL-15,15,16,16,16-D5 ALCOHOL
Formula: CD3CD2(CH2)14OH
MW: 247.47
98 atom % D
Formula: CD3(CH2)15OH
MW: 245.46
99 atom % D
Formula: CD3(CH2)13CD2CH2OH
MW: 247.47
98 atom % D
N-HEXADECYL-2,2,3,3...16,16,16-D31 ALCOHOL
Formula: CD3(CD2)14CH2OH
MW: 273.63
98 atom % D
Formula: CD3(CD2)15OH
MW: 275.65
98 atom % D
Formula: CD3(CD2)15NH2
MW: 274.66
98 atom % D
Formula: CD3(CD2)15N(CH2CH3)3Br
MW: 439.73
98 atom % D
Formula: CD3(CD2)15N(CH3)3Br
MW: 397.65
98 atom % D
Formula: CD3(CD2)15N(CH3)3Cl
MW: 353.2
98 atom % D
MW: 389.47
98 atom % D
Formula: CH3(CH2)15N(CH3)2CD3Br
MW: 367.47
99 atom % D
Formula: CH3(CH2)15N(CD3)3Br
MW: 373.51
99 atom % D
Formula: CD3(CD2)15N(CD3)3Br
MW: 406.71
98 atom % D
Formula: CD3(CD2)15N(CD3)3Cl
MW: 362.26
98 atom % D
Formula: CH3(CH2)2CD2CD2CD3
MW: 93.22
99 atom % D
Formula: CD3(CD2)4CD3
MW: 100.26
99 atom % D
Formula: CD3(CD2)34CD3
MW: 581.43
98 atom % D
Formula: HOC6D4COO(CH2)5CH3
MW: 226.31
98 atom % D
Formula: CH3(CH2)5OCOCD3
MW: 147.23
99 atom % D
Formula: CH3(CH2)4CD2OH
MW: 104.19
99 atom % D
N-HEXYL-2,2,3,3,4,4,5,5,6,6,6-D11 ALCOHOL
Formula: CD3(CD2)4CH2OH
MW: 113.24
98 atom % D
Formula: CD3(CD2)4CH2P(C6H5)3Br
MW: 438.43
98 atom % D
N-HEXYL-5,5,6,6,6-D5 ALCOHOL
Formula: CD3CD2(CH2)4OH
MW: 107.21
98 atom % D
Formula: CD3(CD2)5OH
MW: 115.26
98 atom % D
Formula: CD3(CD2)5OCOCl
MW: 177.71
98 atom % D
Formula: CD3(CD2)5NH2
MW: 114.27
98 atom % D
Formula: C6D5(CH2)5CH3
MW: 167.3
98 atom % D
Formula: CD3(CD2)17CD3
MW: 308.77
98 atom % D
Formula: CD3(CD2)7CD3
MW: 148.38
98 atom % D
Formula: HOC6D4COO(CH2)8CH3
MW: 268.39
98 atom % D
Formula: CH3CH2(CD2)2(CH2)5OH
MW: 148.28
98 atom % D
Formula: CD3(CD2)8OH
MW: 163.37
98 atom % D
Formula: C6D5(CH2)8CH3
MW: 209.39
98 atom % D
Formula: C6D5(CD2)8CD3
MW: 228.5
99 atom % D
Formula: CD3(CD2)26CD3
MW: 453.12
98 atom % D
Formula: CD3(CD2)16CD3
MW: 292.73
98 atom % D
Formula: CH3(CH2)16CD2OH
MW: 272.51
99 atom % D
Formula: CD3(CD2)17OH
MW: 307.72
98 atom % D
Formula: CD3(CD2)6CD3
MW: 132.34
99 atom % D
Formula: CD3(CD2)36CD3
MW: 613.51
98 atom % D
Formula: HOC6D4COO(CH2)7CH
MW: 254.36
98 atom % D
Formula: CH3(CH2)6CD2OH
MW: 132.24
99 atom % D
Formula: CD3(CD2)7OH
MW: 147.33
98 atom % D
Formula: CD3(CD2)7NH2
MW: 146.35
98 atom % D
Formula: C6D5(CH2)7CH3
MW: 195.36
98 atom % D
Formula: C6D5(CD2)7CD3
MW: 212.46
98 atom % D
Formula: CD3(CD2)23CD3
MW: 405
98 atom % D
Formula: CD3(CD2)13CD3
MW: 244.61
98 atom % D
Formula: CD3(CD2)14OH
MW: 259.61
98 atom % D
Formula: CD3(CD2)3CD3
MW: 84.22
98 atom % D
Formula: HOC6D4COO(CH2)4CH3
MW: 212.28
98 atom % D
Formula: CD3(CD2)4OD
MW: 100.22
98 atom % D
Formula: CH3(CH2)4OD
MW: 89.16
98 atom % D
N-PENTYL-2,2,3,3,4,4,5,5,5-D9 ALCOHOL
Formula: CD3(CD2)3CH2OH
MW: 97.2
98 atom % D
Formula: CD3(CH2)4OH
MW: 91.17
99 atom % D
Formula: CD3(CD2)4OH
MW: 99.22
98 atom % D
MW: 161.67
99 atom % D
Formula: C6D5(CH2)4CH3
MW: 153.28
98 atom % D
MW: 184.23
98 atom % D
Formula: CD3CD2CD2OD
MW: 68.14
98 atom % D
Formula: CH3CH2CH2OD
MW: 61.1
98 atom % D
Formula: DCOOCH2CH2CH3
MW: 89.11
98 atom % D
Formula: CH3CD2CD2OH
MW: 64.12
98 atom % D
Formula: CD3CH2CD2OH
MW: 65.13
98 atom % D
Formula: CH3CH2CD2OH
MW: 62.11
99 atom % D
Formula: CD3CD2CH2OH
MW: 65.13
98 atom % D
Formula: CD3CD2CH2NH2
MW: 64.14
98 atom % D
Formula: CD3CD2CH2NH2•HCl
MW: 100.6
98 atom % D
Formula: CD3CD2CH2P(C6H5)3Br
MW: 390.31
98 atom % D
Formula: CH3CD2CH2OH
MW: 62.11
98 atom % D
Formula: CH3CHDCH2OH
MW: 61.1
98 atom % D
Formula: CD3CH2CH2OH
MW: 63.11
99 atom % D
Formula: CD3CH2CH2NH2
MW: 62.13
99 atom % D
Formula: CD3CH2CH2NH2•HCl
MW: 98.59
99 atom % D
Formula: CD3CD2CD2OH
MW: 67.14
98 atom % D
Formula: CD3CD2CD2NH2
MW: 66.15
98 atom % D
Formula: CD3CD2CD2NH2•HCl
MW: 102.61
98 atom % D
Formula: C6H5CD2CD2CD3
MW: 127.24
98 atom % D
Formula: CD3(CD2)38CD3
MW: 645.59
98 atom % D
Formula: CD3(CD2)22CD3
MW: 388.96
98 atom % D
Formula: CD3(CD2)12CD3
MW: 228.57
98 atom % D
Formula: CH3(CH2)12CD2OH
MW: 216.4
98 atom % D
Formula: CD3(CD2)13OH
MW: 243.57
98 atom % D
Formula: CD3(CD2)13NH2
MW: 242.58
98 atom % D
Formula: CD3(CD2)32CD3
MW: 549.35
99 atom % D
Formula: CD3(CD2)28CD3
MW: 485.2
98 atom % D
Formula: CD3(CD2)21CD3
MW: 372.93
98 atom % D
Formula: CD3(CD2)11CD3
MW: 212.54
98 atom % D
Formula: CD3(CD2)12OH
MW: 227.53
98 atom % D
Formula: CD3(CD2)9CD3
MW: 180.46
98 atom % D
Formula: CH3(CH2)8CD2CD2OH
MW: 176.33
98 atom % D
Formula: CD3(CD2)10OH
MW: 195.45
98 atom % D
Formula: CD3(CD2)10NH2
MW: 194.47
98 atom % D
Formula: CH3C6D4OD
MW: 113.17
98 atom % D
Formula: CD3C6H4OH
MW: 111.16
99 atom % D
Formula: CD3C6D4OH
MW: 115.18
98 atom % D
Formula: CD3C6D4OD
MW: 116.19
98 atom % D
MW: 244.39
98 atom % D
Formula: CD3C6D4COOH
MW: 143.19
98 atom % D
Formula: CH3C6H2D2NH2
MW: 109.17
98 atom % D
Formula: CD3C6H4NH2
MW: 110.17
99 atom % D
Formula: CD3C6D4ND2
MW: 116.21
98 atom % D
Formula: CD3C6D4CN
MW: 124.19
98 atom % D
Formula: CD3C6D4NCO
MW: 140.19
98 atom % D
Formula: C6H4(CD3)2
MW: 112.2
99 atom % D
Formula: C6D4(CD3)2
MW: 116.23
99 atom % D
Formula: C6D4(CH3)2
MW: 110.19
98 atom % D
Formula: CD3OC6H4N=N(O)C6H4OCD3
MW: 264.31
98 atom % D
Formula: CH3C6D4OD
MW: 113.17
98 atom % D
Formula: CD3C6H4OH
MW: 111.16
99 atom % D
Formula: CD3C6D4OH
MW: 115.18
98 atom % D
Formula: CD3C6D4OD
MW: 116.19
98 atom % D
MW: 244.39
98 atom % D
Formula: CH3C6D4CHO
MW: 124.18
98 atom % D
Formula: CD3C6D4CHO
MW: 127.19
98 atom % D
Formula: CH3C6D4SO2NH2
MW: 175.24
98 atom % D
Formula: CD3C6D4SO3H•H2O
MW: 197.25
98 atom % D
Formula: CH3C6H4SO2NDND2
MW: 189.25
98 atom % D
P-TOLUIC-2,3,5,6-D4 ACID
Formula: CH3C6D4COOH
MW: 140.17
98 atom % D
Formula: CD3C6D4COOH
MW: 143.19
98 atom % D
Formula: CD3C6H4NH2
MW: 110.17
98 atom % D
Formula: CD3C6D4ND2
MW: 116.21
98 atom % D
Formula: CD3C6D4CN
MW: 124.19
98 atom % D
Formula: CD3C6D4NCO
MW: 140.19
98 atom % D
Formula: C6H4(CD3)2
MW: 112.2
99 atom % D
Formula: CH3C6H4CD3
MW: 109.19
99 atom % D
Formula: C6D4(CD3)2
MW: 116.23
98 atom % D
Formula: C6D4(CH3)2
MW: 110.19
98 atom % D
Formula: (CD3)3COD
MW: 84.18
98 atom % D
Formula: (CH3)3COD
MW: 75.13
98 atom % D
Formula: (CD3)3COCD3
MW: 100.22
99 atom % D
Formula: (CH3)3COCD3
MW: 91.17
99 atom % D
Formula: (CD3)2C(OH)CH3
MW: 80.16
99 atom % D
Formula: (CH3)2C(CD3)OH
MW: 77.14
99 atom % D
Formula: CH2=CHCOO(CD3)3
MW: 137.23
99 atom % D
Formula: (CD3)3COH
MW: 83.18
99 atom % D
Formula: (CD3)3COCH3
MW: 97.2
98 atom % D
Formula: (CD3)3CC6D5
MW: 148.31
99 atom % D
MW: 146.14
99 atom % D
MW: 134.15
99 atom % D
MW: 165.24
99 atom % D
Formula: CD3(CD2)4CH(OH)CH=CHCH(OCH3)2
MW: 213.36
98 atom % D
MW: 197.2
99 atom % D
MW: 170.2
99 atom % D
Formula: C6D5CH=CHCOOH
MW: 153.19
98 atom % D
Formula: C6D5CD=CDCOOH
MW: 155.2
98 atom % D
Formula: CHD=CHD
MW: 30.07
98 atom % D
Formula: C6H5CD=CDC6H5
MW: 182.26
98 atom % D
Formula: C6D5CH=CHC6D5
MW: 190.31
98 atom % D
Formula: C6D5CD=CDC6D5
MW: 192.32
98 atom % D
Formula: ClCD2CCl3
MW: 169.86
98 atom % D
Formula: (ClC6D4)2CHCCl3
MW: 362.54
99 atom % D (also 20% deuterated at the 2-position)
Formula: ClC6D4CH(CCl3)C6D4Cl
MW: 362.54
98 atom % D
Formula: CD3CCl3
MW: 136.42
98 atom % D
Formula: Cl2CDCDCl2
MW: 169.86
99.6 atom % D
Formula: ClCD2CDCl2
MW: 136.42
99 atom % D
MW: 134.12
99 atom % D
Formula: (ClC6D4)2CHCHCl2
MW: 328.09
99 atom % D
Formula: (ClC6D4)2C=CCl2
MW: 326.08
99 atom % D
Formula: CD3CHCl2
MW: 101.98
98 atom % D
Formula: CD2=CCl2
MW: 98.96
98 atom % D
Formula: (CD3)2NNH2•HCl
MW: 102.6
98 atom % D
Formula: H2NSO2N(CD3)2
MW: 130.19
99 atom % D
Formula: H2NCON(CD3)2
MW: 94.15
99 atom % D
Formula: (CD3)2NND2•DCl
MW: 105.61
98 atom % D
Formula: HO(CD2)10OH
MW: 194.4
98 atom % D
1,10-DECANEDIOIC-2,2,9,9-D4 ACID
MW: 206.27
98 atom % D
Formula: HOOC(CD2)8COOH
MW: 218.35
98 atom % D
Formula: Br(CD2)10Br
MW: 320.2
98 atom % D
MW: 188.26
97 atom % D
Formula: Br(CD2)12Br
MW: 352.28
98 atom % D
Formula: HO(CD2)12OH
MW: 226.48
98 atom % D
1,12-DODECANEDIOIC-2,2,11,11-D4 ACID
MW: 234.33
98 atom % D
Formula: HOOC(CD2)10COOH
MW: 250.43
98 atom % D
Formula: HOOC(CD2)12COOH
MW: 282.5
98 atom % D
Formula: HOOC(CD2)14COOH
MW: 314.58
99 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: ClCD2CD(Cl)CD2Cl
MW: 152.46
98 atom % D
MW: 260.19
98 atom % D
MW: 220.13
98 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CH3)4
MW: 136.23
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
MW: 72.08
98 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: (CD3)3C6D3
MW: 132.27
98 atom % D
Formula: C6D4(NH2)2
MW: 112.17
98 atom % D
Formula: C6D4(ND2)2
MW: 116.19
98 atom % D
MW: 124.25
98 atom % D
Formula: C6D4Cl2
MW: 151.03
99 atom % D
Formula: ClCD2CD2Cl
MW: 102.98
99 atom % D
Formula: CDCl=CDCl
MW: 98.96
98 atom % D
Formula: C6D4(OD)2
MW: 116.15
98 atom % D
Formula: C6H4(OCD3)2
MW: 144.2
99 atom % D
Formula: C6D4(OCH3)2
MW: 142.19
98 atom % D
Formula: C6H2D2(OCH3)2
MW: 140.18
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
99 atom % D
Formula: C6D5(CD2)2C6D5
MW: 196.35
98 atom % D
Formula: HSCD2CD2SH
MW: 98.21
99 atom % D
MW: 319.5
98 atom % D
Formula: C6D3(COOH)3
MW: 213.16
98 atom % D
Formula: C6D3Br3
MW: 317.82
99 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: (CH3)3C6D3
MW: 123.21
98 atom % D
Formula: (CD3)3C6D3
MW: 132.27
98 atom % D
Formula: C6D4(ND)2
MW: 116.19
97 atom % D
Formula: CD2=CHCH=CD2
MW: 58.11
98 atom % D
Formula: CH2=CDCD=CH2
MW: 56.1
98 atom % D
Formula: CD2=CDCD=CD2
MW: 60.13
98 atom % D
Formula: [(CD3)2CD]2C6D4
MW: 180.38
99 atom % D
Formula: Br2C6D3F
MW: 256.91
98 atom % D
Formula: BrCD2CH2CD2Br
MW: 205.91
98 atom % D
Formula: BrCD2CD2CD2Br
MW: 207.92
99 atom % D
Formula: ClCD2CD(OH)CD2Cl
MW: 134.02
98 atom % D
Formula: ClCD2COCD2Cl
MW: 130.99
98 atom % D
Formula: C6D4Cl2
MW: 151.03
98 atom % D
Formula: ClCD2CD=CDCl
MW: 115
98 atom % D
Formula: C6D4(CH2CH3)2
MW: 138.25
98 atom % D
Formula: C6D4(CD2CD3)2
MW: 148.31
98 atom % D
Formula: C6D4F2
MW: 118.18
98 atom % D
Formula: C6D4(OD)2
MW: 116.15
98 atom % D
Formula: C6H4(OCD3)2
MW: 144.2
99 atom % D
Formula: C6D4(OCH3)2
MW: 142.19
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
99 atom % D
Formula: C6D4(NO2)2
MW: 172.13
98 atom % D
Formula: (C6D5NH)2CO
MW: 222.31
99 atom % D
Formula: H2NCD2CH2CD2NH2
MW: 78.15
99 atom % D
Formula: H2NCD2CH2CD2NH2•2HCl
MW: 151.07
99 atom % D
Formula: H2NCH2CD2CH2NH2
MW: 76.14
98 atom % D
Formula: H2NCH2CD2CH2NH2•2HCl
MW: 149.06
99 atom % D
Formula: HOCH2CD2CH2OH
MW: 78.11
98 atom % D
Formula: H2NCD2CD2CD2NH2
MW: 80.16
98 atom % D
Formula: H2NCD2CD2CD2NH2•2HCl
MW: 153.08
98 atom % D
Formula: HOCD2CD2CD2OH
MW: 82.13
98 atom % D
Formula: HSCD2CD2CD2SH
MW: 114.25
98 atom % D
Formula: DOCD2CD2CD2OD
MW: 84.14
98 atom % D
MW: 122.22
98 atom % D
MW: 298.42
98 atom % D
Formula: C6D4(NH2)2
MW: 112.17
98 atom % D
Formula: C6D4(ND2)2
MW: 116.19
98 atom % D
MW: 112.12
98 atom % D
1,4-BUTANE-2,2,3,3-D4-DIAMINE 2HCL
Formula: H2NCH2CD2CD2CH2NH2•2HCl
MW: 165.1
98 atom % D
Formula: H2NCD2CD2CD2CD2NH2
MW: 96.2
98 atom % D
Formula: H2NCD2CD2CD2CD2NH2•2HCl
MW: 169.12
98 atom % D
Formula: HS(CD2)4SH
MW: 130.29
99 atom % D
MW: 124.25
98 atom % D
MW: 124.25
98 atom % D
Formula: C6D4Br2
MW: 239.93
99 atom % D
Formula: BrCD2(CH2)2CD2Br
MW: 219.94
98 atom % D
Formula: BrCH2(CD2)2CH2Br
MW: 219.94
98 atom % D
Formula: Br(CD2)4Br
MW: 223.96
99 atom % D
Formula: C6D4Cl2
MW: 151.03
98 atom % D
Formula: Cl(CD2)4Cl
MW: 135.06
99 atom % D
Formula: C6D4(CH2CH3)2
MW: 138.25
98 atom % D
Formula: C6D4(CD2CD3)2
MW: 148.31
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
98 atom % D
MW: 164.19
98 atom % D
MW: 366.48
98 atom % D
MW: 366.48
98 atom % D
MW: 376.49
95 atom % D
Formula: BrCD2(CH2)3CD2Br
MW: 233.97
99 atom % D
Formula: Br(CD2)5Br
MW: 240
98 atom % D
MW: 224.21
99 atom % D
Formula: H2NCD2(CH2)3CD2NH2
MW: 106.2
98 atom % D
Formula: HO(CD2)5OH
MW: 114.21
98 atom % D
Formula: Br(CD2)6Br
MW: 256.04
98 atom % D
Formula: H2NCD2(CH2)4CD2NH2
MW: 120.23
98 atom % D
Formula: HOCD2(CH2)4CD2OH
MW: 122.2
98 atom % D
MW: 168.3
98 atom % D
MW: 178.22
98 atom % D
Formula: HOOC(CD2)6COOH
MW: 186.27
98 atom % D
Formula: Br(CD2)9Br
MW: 304.16
98 atom % D
Formula: HOCH2(CD2)7CH2OH
MW: 174.34
98 atom % D
Formula: HOOC(CD2)7COOH
MW: 202.31
98 atom % D
MW: 281.33
99 atom % D
MW: 157.29
98 atom % D (also 9% 3,3',3''-d3 and 17% 4,4,4',4',4'',4''-d6)
MW: 105.13
98 atom % D
MW: 150.23
98 atom % D
MW: 152.24
98 atom % D
MW: 234.33
99 atom % D
Formula: C6D2BrCl3
MW: 262.36
98 atom % D
Formula: BrC6D3Cl2
MW: 228.92
99 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: ClCD2CD2Br
MW: 147.44
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2Br
MW: 210.23
98 atom % D
Formula: (CD3)2CDCH2Br
MW: 144.06
98 atom % D
Formula: CD3CH(CH3)CH2Br
MW: 140.04
99 atom % D
Formula: (CD3)2CDCD2Br
MW: 146.07
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3Cl2
MW: 228.92
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3(Cl)F
MW: 212.46
98 atom % D
Formula: Cl(CD2)3Br
MW: 163.47
98 atom % D
Formula: Cl(CD2)4Br
MW: 179.51
99 atom % D
Formula: CH3CH2CD2CD2Br
MW: 141.04
99 atom % D
Formula: CD3CD2CD2CH2Br
MW: 144.06
98 atom % D
Formula: CH3CH2CD2CH2Br
MW: 139.03
99 atom % D
Formula: CD3CD2CH2CH2Br
MW: 142.05
98 atom % D
Formula: CD3CH2CH2CH2Br
MW: 140.04
99 atom % D
Formula: CD3CD2CD2CD2Br
MW: 146.07
98 atom % D
Formula: CH3(CH2)7CD2CD2Br
MW: 225.2
98 atom % D
Formula: CD3(CH2)9Br
MW: 224.2
99 atom % D
Formula: CD3CD2(CH2)8Br
MW: 226.21
98 atom % D
Formula: CD3(CD2)9Br
MW: 242.31
98 atom % D
Formula: CD3(CH2)11Br
MW: 252.25
99 atom % D
Formula: CD3(CD2)11Br
MW: 274.39
98 atom % D
Formula: CD3(CH2)19Br
MW: 364.47
99 atom % D
Formula: CD3(CD2)19Br
MW: 402.7
98 atom % D
Formula: CH3(CH2)5CHDBr
MW: 180.11
99 atom % D
Formula: CD3(CD2)2(CH2)4Br
MW: 186.14
98 atom % D
Formula: CD3CD2(CH2)5Br
MW: 184.13
99 atom % D
Formula: CD3(CH2)6Br
MW: 182.12
99 atom % D
Formula: CD3(CD2)6Br
MW: 194.19
98 atom % D
Formula: CH3(CH2)13CD2CD2Br
MW: 309.37
98 atom % D
Formula: CD3(CH2)15Br
MW: 308.36
99 atom % D
Formula: CD3(CD2)15Br
MW: 338.54
98 atom % D
Formula: CH3(CH2)3CD2CD2Br
MW: 169.1
98 atom % D
Formula: CH3(CH2)4CD2Br
MW: 167.08
99 atom % D
Formula: CD3(CD2)4CH2Br
MW: 176.14
98 atom % D
Formula: CD3CD2CD2(CH2)3Br
MW: 172.12
98 atom % D
Formula: CD3(CH2)5Br
MW: 168.09
99 atom % D
Formula: CD3(CD2)5Br
MW: 178.15
98 atom % D
MW: 214.11
99 atom % D
Formula: CH3CH2(CD2)2(CH2)5Br
MW: 211.18
98 atom % D
Formula: CD3(CH2)8Br
MW: 210.17
99 atom % D
Formula: CD3(CD2)8Br
MW: 226.27
98 atom % D
Formula: CD3(CH2)17Br
MW: 336.41
99 atom % D
Formula: CD3(CD2)17Br
MW: 370.62
98 atom % D
Formula: CH3(CH2)6CD2Br
MW: 195.14
99 atom % D
Formula: CH3(CH2)3(CD2)2(CH2)2Br
MW: 197.15
98 atom % D
Formula: CD3(CH2)7Br
MW: 196.14
99 atom % D
Formula: CD3(CD2)7Br
MW: 210.23
98 atom % D
Formula: CH3(CH2)12CD2CD2Br
MW: 295.34
98 atom % D
Formula: CD3(CH2)14Br
MW: 294.33
99 atom % D
Formula: CD3(CD2)14Br
MW: 322.5
98 atom % D
Formula: CH3(CH2)2(CD2)2Br
MW: 155.07
99 atom % D
Formula: CH3(CH2)3CD2Br
MW: 153.06
99 atom % D
Formula: CH3(CH2)3CHDBr
MW: 152.05
98 atom % D
Formula: CD3(CD2)3CH2Br
MW: 160.1
98 atom % D
Formula: CD3CD2(CH2)3Br
MW: 156.07
99 atom % D
Formula: CD3(CH2)4Br
MW: 154.06
99 atom % D
Formula: CD3(CD2)4Br
MW: 162.11
98 atom % D
Formula: CH3CD2CD2Br
MW: 127.02
98 atom % D
Formula: CD3CH2CD2Br
MW: 128.02
98 atom % D
Formula: CH3CH2CD2Br
MW: 125
99 atom % D
Formula: CH3CH2CDHBr
MW: 124
99 atom % D
Formula: CD3CD2CH2Br
MW: 128.02
98 atom % D
Formula: CH3CD2CH2Br
MW: 125
98 atom % D
Formula: CD3CH2CH2Br
MW: 126.01
99 atom % D
Formula: CD3CD2CD2Br
MW: 130.03
98 atom % D
Formula: CH3(CH2)11CD2CD2Br
MW: 281.31
98 atom % D
Formula: CD3(CH2)13Br
MW: 280.31
99 atom % D
Formula: CD3(CD2)13Br
MW: 306.46
98 atom % D
Formula: CH3(CH2)10CD2CD2Br
MW: 267.28
98 atom % D
Formula: CD3(CD2)12Br
MW: 290.43
98 atom % D
Formula: CH3(CH2)8(CD2)2Br
MW: 239.23
98 atom % D
Formula: CD3(CH2)10Br
MW: 238.23
98 atom % D
Formula: CD3(CD2)10Br
MW: 258.35
98 atom % D
Formula: CD3(CD2)3SO2Cl
MW: 165.68
98 atom % D
Formula: CD3(CD2)3SH
MW: 99.24
98 atom % D
1-BUTENE-1,1-D2 (GAS)
Formula: CH3CH2CH=CD2
MW: 58.12
98 atom % D
1-BUTENE-4,4,4-D3 (GAS)
Formula: CD3CH2CH=CH2
MW: 59.13
99 atom % D
1-BUTYNE-3,3,4,4,4-D5 (GAS)
Formula: CD3CD2C≡CH
MW: 59.12
99 atom % D
Formula: ClC6D3(NO2)2
MW: 205.57
98 atom % D
MW: 185.77
98 atom % D
Formula: CD3CD2CD2CD2Cl
MW: 101.62
98 atom % D
Formula: CD3(CD2)15Cl
MW: 294.09
98 atom % D
Formula: CD3(CD2)5Cl
MW: 133.7
98 atom % D
Formula: CD3(CD2)7Cl
MW: 165.78
98 atom % D
Formula: CH3CH2CD2Cl
MW: 80.55
98 atom % D
Formula: CD3CD2CD2Cl
MW: 85.58
98 atom % D
Formula: CD3(CD2)11SH
MW: 227.55
98 atom % D
Formula: CD3CD2CH2CH2CH2C≡CH
MW: 101.2
99 atom % D
Formula: CD3(CD2)15SH
MW: 291.71
98 atom % D
Formula: CD3(CD2)5SH
MW: 131.32
98 atom % D
MW: 227.31
98 atom % D
Formula: CD3CD2CD2CH2I
MW: 191.06
98 atom % D
Formula: CD3(CD2)3I
MW: 193.07
98 atom % D
Formula: CH3(CH2)6CD2I
MW: 242.14
98 atom % D
Formula: CD3(CD2)7I
MW: 257.23
98 atom % D
Formula: CD3(CH2)4I
MW: 201.06
98 atom % D
Formula: CH3CD2CD2l
MW: 174.02
98 atom % D
Formula: CD3CH2CD2I
MW: 175.02
98 atom % D
Formula: CH3CH2CD2I
MW: 172.01
99 atom % D
Formula: CD3CD2CH2l
MW: 175.02
98 atom % D
Formula: CH3CD2CH2I
MW: 172.01
98 atom % D
Formula: CD3CH2CH2I
MW: 173.01
99 atom % D
Formula: CD3(CD2)2I
MW: 177.04
98 atom % D
MW: 221.27
99 atom % D
MW: 119.16
99 atom % D
MW: 85.12
99 atom % D
MW: 85.12
98 atom % D
MW: 88.14
98 atom % D
MW: 152.26
98 atom % D
Formula: C10D7OH
MW: 151.22
98 atom % D
Formula: C10D7OD
MW: 152.22
98 atom % D
MW: 180.21
98 atom % D
MW: 256.31
98 atom % D
MW: 309.48
98 atom % D
Formula: CD3(CD2)17SH
MW: 323.78
98 atom % D
Formula: CD3(CD2)7SH
MW: 163.39
98 atom % D
Formula: CD3CD2CH2CH=CH2
MW: 75.16
99 atom % D
Formula: C6H5C≡CCD2CD3
MW: 135.22
99 atom % D
MW: 253.31
98 atom % D
Formula: C6D5(CD2)11CD3
MW: 276.62
98 atom % D
Formula: C6D5(CD2)14CD3
MW: 324.74
98 atom % D
Formula: CD3CD2CD2SH
MW: 83.2
98 atom % D
Formula: CH3CH2CH2SD
MW: 77.16
98 atom % D
MW: 291.4
98 atom % D
MW: 290.4
98 atom % D
MW: 290.4
98 atom % D
MW: 276.45
98 atom % D
MW: 291.4
95 atom % D
MW: 274.4
98 atom % D
MW: 298.43
99 atom % 13C
MW: 312.45
97 atom % D
MW: 300.43
98 atom % D
MW: 314.46
98 atom % D
MW: 335.5
97 atom % D
MW: 271.37
96 atom % D
MW: 273.4
98 atom % D
MW: 275.4
98 atom % D
MW: 274.39
98 atom % D
MW: 275.4
98 atom % D
17β-ESTRADIOL-16,16,17-D3 3-BENZOATE
MW: 379.51
98 atom % D
MW: 274.4
98 atom % D
MW: 277.42
98 atom % D
MW: 276.41
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4 17-PENTANOATE
MW: 360.53
98 atom % D
MW: 274.4
98 atom % D
MW: 123.15
99 atom % D
MW: 261.57
98 atom % D
MW: 261.57
98 atom % D
MW: 230.22
98 atom % D
MW: 248.21
98 atom % D
MW: 363.9
99 atom % D
MW: 329.45
98 atom % D
MW: 329.45
98 atom % D
Formula: C6D3Cl2C6H3Cl2
MW: 295.01
98 atom % D
MW: 262.58
98 atom % D
MW: 268.42
99 atom % D
MW: 164.24
98 atom % D
Formula: (CD3)3CCD2CD(CD3)2
MW: 132.34
98 atom % D
MW: 174.36
98 atom % D
Formula: (HOCD2)2C(CD3)COOH
MW: 141.17
99 atom % D
Formula: CD3CD2C(CD3)2COOH
MW: 127.23
98 atom % D
Formula: (CD3)4C
MW: 84.22
98 atom % D
Formula: Cl2C6D3C6H3Cl2
MW: 295.01
98 atom % D
MW: 263.58
99 atom % D
MW: 363.9
98 atom % D
MW: 363.9
98 atom % D
MW: 261.57
98 atom % D
MW: 330.46
98 atom % D
Formula: C6Cl5C6D5
MW: 331.47
98 atom % D
MW: 262.58
99 atom % D
Formula: (HO)3C6H2COC6D5
MW: 235.25
98 atom % D
Formula: Cl4C6DND2
MW: 233.93
99 atom % D
Formula: C6HCl4C6D5
MW: 297.02
98 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: Cl3C6H2OCD3
MW: 214.49
99 atom % D
Formula: Cl3C6D2OH
MW: 199.46
97 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: CD3CH(OH)CH(OH)CD3
MW: 96.16
98 atom % D
Formula: CD3CD(OH)CD(OH)CD3
MW: 98.17
98 atom % D
Formula: CD3COCOCD3
MW: 92.13
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: CD3CD2CD(CD3)CD(CD3)2
MW: 116.3
99 atom % D
MW: 116.21
98 atom % D
Formula: CH3CD2COCOCD3
MW: 105.15
98 atom % D
Formula: Cl2C6H3C6ClD4
MW: 261.57
98 atom % D
MW: 231.15
98 atom % D
MW: 261.57
98 atom % D
Formula: Cl3C6D2ND2
MW: 200.49
98 atom % D
MW: 262.58
99 atom % D
Formula: Cl3C6D2OH
MW: 199.46
98 atom % D
Formula: Br3C6D2OCD3
MW: 349.86
99 atom % D
Formula: Br3C6D2OH
MW: 332.81
99 atom % D
Formula: Cl3C6D2OCD3
MW: 216.51
98 atom % D
Formula: Cl3C6H2C6D5
MW: 262.58
98 atom % D
Formula: Cl3C6D2OH
MW: 199.46
98 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: (CD3)3C5D2N
MW: 132.25
98 atom % D
Formula: CD3C6H3(NH2)2
MW: 125.19
98 atom % D
Formula: Br2C6D3OH
MW: 254.92
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
Formula: Cl2C6D3OH
MW: 166.02
98 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
Formula: CH3C6D3F2
MW: 131.14
99 atom % D
Formula: (HO)2C6H3COC6D5
MW: 219.25
98 atom % D
Formula: (CD3)2C6H3NH2
MW: 127.22
98 atom % D
Formula: (CD3)2C6H3NH2•HCl
MW: 163.68
99 atom % D
Formula: (CD3)2C6H3NO2
MW: 157.2
98 atom % D
Formula: (CD3)2C6D3ND2
MW: 132.25
99 atom % D
Formula: (CH3)2C6D3OH
MW: 125.18
98 atom % D
Formula: (CD3)2C6D3OD
MW: 132.23
98 atom % D
Formula: (NO2)2C6H3CD3
MW: 185.15
98 atom % D
Formula: (NO2)2C6D3CH3
MW: 185.15
98 atom % D
MW: 256.48
98 atom % D
Formula: Cl2C6D3NH2
MW: 165.04
98 atom % D
Formula: Cl2C6H3C6D5
MW: 228.13
99 atom % D
Formula: Cl2C6D3OH
MW: 166.02
98 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
MW: 124.2
98 atom % D
Formula: C19D40
MW: 308.77
98 atom % D
Formula: C30D62
MW: 485.2
98 atom % D
MW: 227.4
95 atom % D
MW: 256.48
98 atom % D
MW: 241.48
98 atom % D
Formula: [(CD3)2CD]2C6D3OD
MW: 196.38
98 atom % D
MW: 244.5
98 atom % D
Formula: CD3C6H3(NH2)2
MW: 125.19
97 atom % D
Formula: Br2C6D3OH
MW: 254.92
98 atom % D
Formula: Cl2C6D3NH2
MW: 165.04
98 atom % D
MW: 193.05
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
MW: 228.13
99 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: (CD3CD2)2C6D3ND2
MW: 164.33
97 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
Formula: (CD3)2C6H3NH2
MW: 127.22
98 atom % D
Formula: (CD3)2C6H3NO2
MW: 157.2
98 atom % D