ChemBuyersGuide.com

+1-212-348-5610

WeChat: chembuyersguide

Chemical Search
 
 


























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-50201702 (Direct)
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 |
 


Product List

2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE
CAS:56946-65-7
Formula: ClC1=NC2=C(CCC2)C(Cl)=C1
BD241728
98%
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE HYDROCHLORIDE
CAS:1187830-87-0
Formula: ClC1=C(CCC2)C2=NC(Cl)=C1.[H]Cl
BD224383
95+%
MFCD11846186
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:5466-43-3
Formula: C1(=NC(=NC2=C1CCC2)Cl)Cl
BD162915
97%
MFCD09750204
2,4-DICHLORO-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE
CAS:785775-01-1
Formula: ClC1=C2C(CNC2)=NC(Cl)=N1
BD222747
95+%
2,4-DICHLORO-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE HYDROCHLORIDE
CAS:1190927-74-2
Formula: ClC1=C2C(CNC2)=NC(Cl)=N1.[H]Cl
BD222748
97%
MFCD09835495
2,4-DICHLORO-6,7-DIHYDROTHIENO[3,2-D]PYRIMIDINE
CAS:74901-69-2
Formula: ClC1=C2C(CCS2)=NC(Cl)=N1
BD158271
98%
MFCD11109461
2,4-DICHLORO-6,7-DIMETHOXYQUINAZOLINE
CAS:27631-29-4
Formula: COC1=CC2=NC(Cl)=NC(Cl)=C2C=C1OC
BD0400
97%
MFCD00051733
2,4-DICHLORO-6,7-DIMETHOXYQUINOLINE
CAS:72407-17-1
Formula: COC1=C(OC)C=C2C(Cl)=CC(Cl)=NC2=C1
BD335185
95+%
MFCD18073200
2,4-DICHLORO-6,7-DIMETHYL-1,2,3,4-TETRAHYDROQUINAZOLINE
CAS:20197-84-6
Formula: CC1=CC2=C(C=C1C)C(Cl)NC(Cl)N2
BD286655
95+%
MFCD11520683
2,4-DICHLORO-6,8-DIHYDRO-5H-PYRANO[3,4-D]PYRIMIDINE
CAS:1269461-25-7
Formula: ClC1=C2C(COCC2)=NC(Cl)=N1
BD266300
95+%
2,4-DICHLORO-6,8-DIHYDRO-5H-THIOPYRANO[3,4-D]PYRIMIDINE
CAS:1434142-20-7
Formula: ClC1=C2C(CSCC2)=NC(Cl)=N1
BD266297
95+%
MFCD26403975
2,4-DICHLORO-6-((4-FLUOROPHENOXY)METHYL)BENZALDEHYDE
CAS:886362-88-5
Formula: O=CC1=C(COC2=CC=C(F)C=C2)C=C(Cl)C=C1Cl
BD36811
97%
MFCD03840194
2,4-DICHLORO-6-(2-METHOXYPHENYL)PYRIMIDINE
CAS:1353856-29-7
Formula: COC1=CC=CC=C1C2=CC(Cl)=NC(Cl)=N2
BD260070
95+%
MFCD21099887
2,4-DICHLORO-6-(3-FLUOROPHENOXY)-1,3,5-TRIAZINE
CAS:112748-45-5
Formula: FC1=CC(OC2=NC(Cl)=NC(Cl)=N2)=CC=C1
BD408004
95+%
MFCD05154988
2,4-DICHLORO-6-(3-METHOXYPHENYL)PYRIMIDINE
CAS:850250-73-6
Formula: COC1=CC(C2=CC(Cl)=NC(Cl)=N2)=CC=C1
BD259710
95+%
2,4-DICHLORO-6-(4-ETHOXYPHENYL)PYRIMIDINE
CAS:881194-50-9
Formula: CCOC1=CC=C(C2=CC(Cl)=NC(Cl)=N2)C=C1
BD259709
95+%
MFCD20848871
2,4-DICHLORO-6-(4-FLUOROPHENOXY)-1,3,5-TRIAZINE
CAS:112748-46-6
Formula: FC1=CC=C(OC2=NC(Cl)=NC(Cl)=N2)C=C1
BD417506
95+%
MFCD00117397
2,4-DICHLORO-6-(4-FLUOROPHENYL)QUINAZOLINE
CAS:1003042-27-0
Formula: FC1=CC=C(C2=CC3=C(Cl)N=C(Cl)N=C3C=C2)C=C1
BD270744
95+%
MFCD26392893
2,4-DICHLORO-6-(4-METHOXYPHENYL)PYRIMIDINE
CAS:163263-91-0
Formula: COC1=CC=C(C2=CC(Cl)=NC(Cl)=N2)C=C1
BD248101
97%
MFCD18074237
2,4-DICHLORO-6-(4-METHYLPENT-3-EN-1-YL)PYRIMIDINE
CAS:212650-38-9
Formula: CC(C)=CCCC1=CC(Cl)=NC(Cl)=N1
BD450109
97%
2,4-DICHLORO-6-(6-(TRIFLUOROMETHYL)PYRIDIN-2-YL)-1,3,5-TRIAZINE
CAS:1446507-40-9
Formula: FC(C1=CC=CC(C2=NC(Cl)=NC(Cl)=N2)=N1)(F)F
BD682926
97%
2,4-DICHLORO-6-(6-CHLOROOXAZOLO[5,4-B]PYRIDIN-2-YL)ANILINE
CAS:1354778-24-7
Formula: NC1=C(C2=NC3=CC(Cl)=CN=C3O2)C=C(Cl)C=C1Cl
BD612893
97%
2,4-DICHLORO-6-(6-CHLOROPYRIDIN-2-YL)-1,3,5-TRIAZINE
CAS:1446507-39-6
Formula: ClC1=CC=CC(C2=NC(Cl)=NC(Cl)=N2)=N1
BD632495
97%
2,4-DICHLORO-6-(CHLOROMETHYL)-5-METHYLPYRIMIDINE
CAS:430440-91-8
Formula: CC1=C(CCl)N=C(Cl)N=C1Cl
BD269989
95+%
MFCD24464048
2,4-DICHLORO-6-(CHLOROMETHYL)PYRIDINE
CAS:1256835-26-3
Formula: ClCC1N=C(Cl)C=C(Cl)C=1
BD00708292
95+%
n/a
2,4-DICHLORO-6-(DIFLUOROMETHYL)-5-IODOPYRIMIDINE
CAS:1706432-19-0
Formula: IC1=C(C(F)F)N=C(Cl)N=C1Cl
BD619034
97%
2,4-DICHLORO-6-(DIFLUOROMETHYL)-5-NITROPYRIMIDINE
CAS:1706444-57-6
Formula: O=[N+](C1=C(C(F)F)N=C(Cl)N=C1Cl)[O-]
BD619387
97%
2,4-DICHLORO-6-(DIFLUOROMETHYL)PYRIMIDINE
CAS:1706464-39-2
Formula: FC(C1=CC(Cl)=NC(Cl)=N1)F
BD620122
97%
2,4-DICHLORO-6-(METHOXYMETHYL)PYRIMIDINE
CAS:1037543-27-3
Formula: COCC1=NC(Cl)=NC(Cl)=C1
BD214317
95+%
MFCD18837152
2,4-DICHLORO-6-(METHYLAMINO)PYRIMIDINE-5-CARBALDEHYDE
CAS:1007197-30-9
Formula: O=CC1=C(NC)N=C(Cl)N=C1Cl
BD585775
97%
2,4-DICHLORO-6-(METHYLTHIO)-1,3,5-TRIAZINE
CAS:13705-05-0
Formula: CSC1=NC(Cl)=NC(Cl)=N1
BD223908
95+%
MFCD01679001
2,4-DICHLORO-6-(METHYLTHIO)-5-NITROPYRIMIDINE
CAS:1451885-60-1
Formula: O=[N+](C1=C(SC)N=C(Cl)N=C1Cl)[O-]
BD301420
95+%
2,4-DICHLORO-6-(METHYLTHIO)PYRIMIDIN-5-AMINE
CAS:1630906-59-0
Formula: NC1=C(SC)N=C(Cl)N=C1Cl
BD301421
95+%
2,4-DICHLORO-6-(PIPERIDIN-1-YL)PYRIMIDINE
CAS:213201-98-0
Formula: ClC1=NC(Cl)=NC(N2CCCCC2)=C1
BD252533
95+%
MFCD11520488
2,4-DICHLORO-6-(PYRROLIDIN-1-YL)PYRIMIDINE
CAS:154117-92-7
Formula: ClC1=NC(Cl)=NC(N2CCCC2)=C1
BD252534
95+%
MFCD11520487
2,4-DICHLORO-6-(TRIFLUOROMETHYL)ANILINE
CAS:62593-17-3
Formula: NC1=C(C(F)(F)F)C=C(Cl)C=C1Cl
BD4147
97%
MFCD00174313
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE
CAS:1060815-21-5
Formula: FC(C1=CC(Cl)=C(N)C(Cl)=N1)(F)F
BD559923
97%
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:39891-02-6
Formula: FC(C1=CC(Cl)=CC(Cl)=N1)(F)F
BD232355
97%
MFCD10698621
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDO[3,2-D]PYRIMIDINE
CAS:1260663-64-6
Formula: FC(C1=NC2=C(Cl)N=C(Cl)N=C2C=C1)(F)F
BD752010
97%
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDIN-5-AMINE
CAS:2925-96-4
Formula: NC1=C(C(F)(F)F)N=C(Cl)N=C1Cl
BD624548
97%
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:16097-64-6
Formula: C1=C(N=C(Cl)N=C1Cl)C(F)(F)F
BD66692
98%
MFCD09910264
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:864291-30-5
Formula: FC(C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)(F)F
BD162959
97%
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:852203-17-9
Formula: FC(C1=CC=C2N=C(Cl)C=C(Cl)C2=C1)(F)F
BD66693
98%
MFCD08234682
2,4-DICHLORO-6-CYCLOPROPYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1449117-31-0
Formula: ClC1=C(CN(C2CC2)CC3)C3=NC(Cl)=N1
BD266296
95+%
2,4-DICHLORO-6-ETHOXY-3-NITROQUINOLINE
CAS:1447953-60-7
Formula: O=[N+](C1=C(Cl)C2=CC(OCC)=CC=C2N=C1Cl)[O-]
BD617615
97%
2,4-DICHLORO-6-ETHOXYPYRIMIDINE
CAS:858447-32-2
Formula: CCOC1=CC(Cl)=NC(Cl)=N1
BD252535
95+%
MFCD22681695
2,4-DICHLORO-6-ETHOXYQUINAZOLINE
CAS:2206320-30-9
Formula: CCOC1C=CC2C(=C(N=C(N=2)Cl)Cl)C=1
BD00784831
95%
MFCD31416911
2,4-DICHLORO-6-ETHOXYQUINOLINE
CAS:1447960-17-9
Formula: CCOC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD617672
97%
2,4-DICHLORO-6-ETHYL-1,3,5-TRIAZINE
CAS:698-72-6
Formula: CCC1=NC(Cl)=NC(Cl)=N1
BD341710
95+%
MFCD15203623
2,4-DICHLORO-6-ETHYL-5-FLUOROPYRIMIDINE
CAS:137234-85-6
Formula: FC1=C(CC)N=C(Cl)N=C1Cl
BD254930
95+%
MFCD08458278
2,4-DICHLORO-6-ETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1275608-17-7
Formula: CCC1=CC2=C(Cl)N=C(Cl)N=C2N1
BD283796
95+%
MFCD21609285
2,4-DICHLORO-6-ETHYLPYRIMIDINE
CAS:6554-65-0
Formula: CCC1=CC(Cl)=NC(Cl)=N1
BD231767
95+%
2,4-DICHLORO-6-ETHYNYLANILINE
CAS:684250-09-7
Formula: NC1=C(C#C)C=C(Cl)C=C1Cl
BD262005
95+%
MFCD09029969
2,4-DICHLORO-6-FLUORO-3-NITROBENZOIC ACID
CAS:1823915-31-6
Formula: O=C(O)C1=C(F)C=C(Cl)C([N+]([O-])=O)=C1Cl
BD435516
97%
MFCD26960582
2,4-DICHLORO-6-FLUORO-QUINOLINE
CAS:406204-74-8
Formula: FC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD33606
97%
MFCD09261383
2,4-DICHLORO-6-FLUOROANILINE
CAS:3831-70-7
Formula: NC1=C(F)C=C(Cl)C=C1Cl
BD323718
95+%
MFCD20711026
2,4-DICHLORO-6-FLUOROBENZALDEHYDE
CAS:681435-09-6
Formula: FC1=CC(Cl)=CC(Cl)=C1C=O
BD216955
95+%
MFCD12404935
2,4-DICHLORO-6-FLUOROBENZENESULFONYL CHLORIDE
CAS:1242339-70-3
Formula: O=S(C1=C(F)C=C(Cl)C=C1Cl)(Cl)=O
BD322929
95+%
MFCD16817662
2,4-DICHLORO-6-FLUOROBENZENETHIOL
CAS:1242339-24-7
Formula: SC1=C(F)C=C(Cl)C=C1Cl
BD469200
97%
MFCD16817661
2,4-DICHLORO-6-FLUOROBENZOIC ACID
CAS:904285-09-2
Formula: O=C(O)C1=C(F)C=C(Cl)C=C1Cl
BD162122
95+%
MFCD12404936
2,4-DICHLORO-6-FLUOROBENZONITRILE
CAS:1349718-98-4
Formula: N#CC1=C(F)C=C(Cl)C=C1Cl
BD307285
95+%
MFCD19686188
2,4-DICHLORO-6-FLUOROIODOBENZENE
CAS:1214333-91-1
Formula: FC1=C(I)C(Cl)=CC(Cl)=C1
BD322658
95+%
MFCD13194303
2,4-DICHLORO-6-FLUOROPYRIMIDINE
CAS:3833-57-6
Formula: FC1=CC(Cl)=NC(Cl)=N1
BD66696
95%
MFCD16619134
2,4-DICHLORO-6-FLUOROQUINAZOLINE
CAS:134517-57-0
Formula: FC1=CC=C2N=C(Cl)N=C(Cl)C2=C1
BD66697
97+%
MFCD09954884
2,4-DICHLORO-6-FLUOROQUINOLINE-3-CARBONITRILE
CAS:881313-89-9
Formula: N#CC1=C(Cl)C2=CC(F)=CC=C2N=C1Cl
BD303095
95+%
MFCD26142690
2,4-DICHLORO-6-HYDROXYBENZALDEHYDE
CAS:78443-72-8
Formula: OC1=CC(Cl)=CC(Cl)=C1C=O
BD4156
98%
MFCD00016590
2,4-DICHLORO-6-HYDROXYBENZOIC ACID
CAS:99725-34-5
Formula: O=C(O)C1=C(O)C=C(Cl)C=C1Cl
BD324586
95+%
MFCD11203640
2,4-DICHLORO-6-IODO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638763-86-6
Formula: O=S(N1C(I)=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=CC=C3)=O
BD445789
97%
MFCD27987428
2,4-DICHLORO-6-IODO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638763-42-4
Formula: CN1C(I)=CC2=C(Cl)N=C(Cl)N=C21
BD445795
97%
MFCD27987435
2,4-DICHLORO-6-IODO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638760-47-0
Formula: IC1=CC2=C(Cl)N=C(Cl)N=C2N1
BD445792
97%
MFCD27987431
2,4-DICHLORO-6-IODOANILINE
CAS:697-90-5
Formula: NC1=C(Cl)C=C(Cl)C=C1I
BD227781
98%
MFCD08533279
2,4-DICHLORO-6-IODOPYRIDIN-3-AMINE
CAS:1239719-94-8
Formula: NC1=C(Cl)C=C(I)N=C1Cl
BD608061
97%
2,4-DICHLORO-6-IODOPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1313738-97-4
Formula: IC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD306622
95+%
MFCD19443923
2,4-DICHLORO-6-IODOQUINAZOLINE
CAS:74173-76-5
Formula: ClC1=NC2=C(C=C(I)C=C2)C(Cl)=N1
BD66701
95+%
MFCD08543451
2,4-DICHLORO-6-ISOPROPOXYPYRIMIDINE
CAS:1026787-89-2
Formula: CC(OC1=CC(Cl)=NC(Cl)=N1)C
BD252536
95+%
MFCD22681696
2,4-DICHLORO-6-ISOPROPYL-5H-PYRROLO[3,4-D]PYRIMIDIN-7(6H)-ONE
CAS:1079649-94-7
Formula: O=C1N(C(C)C)CC2=C(Cl)N=C(Cl)N=C21
BD247357
95+%
MFCD22571540
2,4-DICHLORO-6-ISOPROPYLPYRIMIDIN-5-AMINE
CAS:1523617-86-8
Formula: NC1=C(C(C)C)N=C(Cl)N=C1Cl
BD301410
95+%
2,4-DICHLORO-6-ISOPROPYLPYRIMIDINE
CAS:89938-05-6
Formula: CC(C1=CC(Cl)=NC(Cl)=N1)C
BD338671
95+%
2,4-DICHLORO-6-METHOXY-1,3,5-TRIAZINE
CAS:3638-04-8
Formula: COC1=NC(Cl)=NC(Cl)=N1
BD66702
97%
2,4-DICHLORO-6-METHOXY-1,5-NAPHTHYRIDINE
CAS:959990-35-3
Formula: COC1=CC=C2N=C(Cl)C=C(Cl)C2=N1
BD245547
95+%
MFCD18254964
2,4-DICHLORO-6-METHOXY-3-NITROQUINOLINE
CAS:259180-83-1
Formula: O=[N+](C1=C(Cl)C2=CC(OC)=CC=C2N=C1Cl)[O-]
BD624437
97%
2,4-DICHLORO-6-METHOXYANILINE
CAS:93839-14-6
Formula: COC1=CC(Cl)=CC(Cl)=C1N
BD228428
95+%
MFCD20693704
2,4-DICHLORO-6-METHOXYPYRIDINE
CAS:1227572-43-1
Formula: COC1=CC(Cl)=CC(Cl)=N1
BD228572
97%
2,4-DICHLORO-6-METHOXYPYRIMIDINE
CAS:43212-41-5
Formula: ClC1=NC(=CC(=N1)Cl)OC
BD169830
97%
MFCD00955635
2,4-DICHLORO-6-METHOXYQUINAZOLINE
CAS:105763-77-7
Formula: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD66703
97%
MFCD09954880
2,4-DICHLORO-6-METHOXYQUINOLINE
CAS:70049-46-6
Formula: COC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD36813
98%
2,4-DICHLORO-6-METHOXYQUINOLINE-3-CARBALDEHYDE
CAS:151772-24-6
Formula: O=CC1=C(Cl)C2=CC(OC)=CC=C2N=C1Cl
BD166895
95+%
MFCD11048980
2,4-DICHLORO-6-METHYL-3-NITROPYRIDINE
CAS:63897-12-1
Formula: O=[N+](C1=C(Cl)C=C(C)N=C1Cl)[O-]
BD66704
98%
MFCD00218548
2,4-DICHLORO-6-METHYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1350738-72-5
Formula: CN1CCC2=NC(Cl)=NC(Cl)=C2C1
BD266299
95+%
2,4-DICHLORO-6-METHYL-5-NITROPYRIMIDINE
CAS:13162-26-0
Formula: O=[N+](C1=C(C)N=C(Cl)N=C1Cl)[O-]
BD2536
98%
MFCD00023196
2,4-DICHLORO-6-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1196157-27-3
Formula: CC1=CC2=NC(Cl)=NC(Cl)=C2N1
BD252537
95+%
MFCD13190345
2,4-DICHLORO-6-METHYL-6H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1357086-92-0
Formula: CN1C=C2N=C(Cl)N=C(Cl)C2=C1
BD272180
95+%
MFCD23106215
2,4-DICHLORO-6-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1192711-71-9
Formula: CC1=CC2=C(Cl)N=C(Cl)N=C2N1
BD159753
98%
MFCD13193622
2,4-DICHLORO-6-METHYLANILINE
CAS:30273-00-8
Formula: NC1=C(C)C=C(Cl)C=C1Cl
BD4752
95+%
MFCD00044074
2,4-DICHLORO-6-METHYLBENZALDEHYDE
CAS:1416352-11-8
Formula: O=CC1=C(C)C=C(Cl)C=C1Cl
BD291511
95+%
2,4-DICHLORO-6-METHYLBENZAMIDE
CAS:175278-27-0
Formula: CC1=CC(Cl)=CC(Cl)=C1C(N)=O
BD6070
95+%
MFCD00205142
2,4-DICHLORO-6-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:175278-26-9
Formula: O=S(C1=C(C)C=C(Cl)C=C1Cl)(Cl)=O
BD66711
95+%
2,4-DICHLORO-6-METHYLBENZENESULPHONAMIDE
CAS:568577-80-0
Formula: O=S(C1=C(C)C=C(Cl)C=C1Cl)(N)=O
BD4755
95+%
2,4-DICHLORO-6-METHYLBENZENETHIOL
CAS:140131-93-7
Formula: SC1=C(C)C=C(Cl)C=C1Cl
BD469375
97%
MFCD12026228
2,4-DICHLORO-6-METHYLBENZOIC ACID
CAS:65410-80-2
Formula: O=C(O)C1=C(C)C=C(Cl)C=C1Cl
BD287827
95+%
2,4-DICHLORO-6-METHYLBENZONITRILE
CAS:175277-98-2
Formula: CC1=CC(Cl)=CC(Cl)=C1C#N
BD66712
97%
MFCD00052865
2,4-DICHLORO-6-METHYLNICOTINALDEHYDE
CAS:91591-72-9
Formula: O=CC1=C(Cl)N=C(C)C=C1Cl
BD66714
97%
2,4-DICHLORO-6-METHYLNICOTINAMIDE
CAS:70593-58-7
Formula: O=C(N)C1=C(Cl)N=C(C)C=C1Cl
BD241283
95+%
2,4-DICHLORO-6-METHYLNICOTINIC ACID
CAS:56022-07-2
Formula: CC1=CC(Cl)=C(C(O)=O)C(Cl)=N1
BD66715
95+%
2,4-DICHLORO-6-METHYLNICOTINONITRILE
CAS:38367-36-1
Formula: CC1=CC(Cl)=C(C#N)C(Cl)=N1
BD241284
98%
2,4-DICHLORO-6-METHYLPHENOL
CAS:1570-65-6
Formula: OC1=C(C)C=C(Cl)C=C1Cl
BD10429
97%
MFCD00019988
2,4-DICHLORO-6-METHYLPYRIDIN-3-AMINE
CAS:179056-98-5
Formula: CC1=CC(Cl)=C(N)C(Cl)=N1
BD120573
95+%
MFCD07774093
2,4-DICHLORO-6-METHYLPYRIDINE
CAS:42779-56-6
Formula: CC1=CC(Cl)=CC(Cl)=N1
BD66726
98%
MFCD08669834
2,4-DICHLORO-6-METHYLPYRIDO[3,2-D]PYRIMIDINE
CAS:30212-52-3
Formula: CC1=NC2=C(Cl)N=C(Cl)N=C2C=C1
BD331204
95+%
MFCD11878573
2,4-DICHLORO-6-METHYLPYRIMIDIN-5-AMINE
CAS:13162-27-1
Formula: CC1=NC(Cl)=NC(Cl)=C1N
BD66655
97%
MFCD08062586
2,4-DICHLORO-6-METHYLPYRIMIDINE
CAS:5424-21-5
Formula: CC1=CC(Cl)=NC(Cl)=N1
BD7917
98%
MFCD00006064
2,4-DICHLORO-6-METHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933686-24-9
Formula: CC1=NC(Cl)=NC(Cl)=C1C=O
BD241173
95+%
2,4-DICHLORO-6-METHYLPYRIMIDINE-5-CARBONITRILE
CAS:56035-64-4
Formula: CC1=NC(Cl)=NC(Cl)=C1C#N
BD174228
97%
2,4-DICHLORO-6-METHYLQUINAZOLINE
CAS:39576-82-4
Formula: CC1=CC=C2N=C(Cl)N=C(Cl)C2=C1
BD162894
97%
MFCD10697888
2,4-DICHLORO-6-METHYLQUINOLINE
CAS:102878-18-2
Formula: CC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD66719
97+%
2,4-DICHLORO-6-METHYLTHIENO[2,3-D]PYRIMIDINE
CAS:76872-23-6
Formula: CC1=CC2=C(Cl)N=C(Cl)N=C2S1
BD295223
95+%
MFCD15144570
2,4-DICHLORO-6-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-82-8
Formula: CC1=CC2=C(S1)C(Cl)=NC(Cl)=N2
BD222226
95+%
MFCD10000842
2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE
CAS:6601-22-5
Formula: C1(=NC(=NC(=N1)Cl)Cl)N2CCOCC2
BD66720
97%
MFCD00460178
2,4-DICHLORO-6-NITROANILINE
CAS:2683-43-4
Formula: NC1=C([N+]([O-])=O)C=C(Cl)C=C1Cl
BD3230
95+%
MFCD00007664
2,4-DICHLORO-6-NITROPHENOL
CAS:609-89-2
Formula: OC1=C([N+]([O-])=O)C=C(Cl)C=C1Cl
BD66723
97%
MFCD00007101
2,4-DICHLORO-6-NITROPYRIDINE
CAS:1379337-73-1
Formula: O=[N+](C1=CC(Cl)=CC(Cl)=N1)[O-]
BD208320
97%
MFCD19707599
2,4-DICHLORO-6-NITROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1160995-45-8
Formula: O=[N+](C1=CN2N=C(Cl)N=C(Cl)C2=C1)[O-]
BD224469
95+%
2,4-DICHLORO-6-NITROQUINAZOLINE
CAS:74173-77-6
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)[O-]
BD22451
95%
MFCD08460251
2,4-DICHLORO-6-NITROQUINOLINE
CAS:408523-59-1
Formula: O=[N+](C1=CC=C2N=C(Cl)C=C(Cl)C2=C1)[O-]
BD66724
97%
n/a
2,4-DICHLORO-6-NITROQUINOLINE-3-CARBONITRILE
CAS:113944-49-3
Formula: N#CC1=C(Cl)C2=CC([N+]([O-])=O)=CC=C2N=C1Cl
BD629293
97%
2,4-DICHLORO-6-PHENOXY-1,3,5-TRIAZINE
CAS:4682-78-4
Formula: ClC1=NC(OC2=CC=CC=C2)=NC(Cl)=N1
BD340496
95+%
MFCD00458967
2,4-DICHLORO-6-PHENYL-1,3,5-TRIAZINE
CAS:1700-02-3
Formula: ClC1=NC(C2=CC=CC=C2)=NC(Cl)=N1
BD18822
98%
2,4-DICHLORO-6-PHENYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:237435-80-2
Formula: ClC1=NC2=C(NC(=C2)C2=CC=CC=C2)C(Cl)=N1
BD234105
95+%
MFCD17011879
2,4-DICHLORO-6-PHENYLPYRIMIDINE
CAS:26032-72-4
Formula: ClC1=NC(Cl)=NC(C2=CC=CC=C2)=C1
BD243741
97%
MFCD00234591
2,4-DICHLORO-6-PHENYLTHIENO[2,3-D]PYRIMIDINE
CAS:902765-47-3
Formula: ClC1=C(C=C(C2=CC=CC=C2)S3)C3=NC(Cl)=N1
BD282233
95+%
MFCD11046676
2,4-DICHLORO-6-PROPYL-6H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1357086-93-1
Formula: CCCN1C=C2N=C(Cl)N=C(Cl)C2=C1
BD272187
95+%
2,4-DICHLORO-6-PROPYLPYRIMIDINE
CAS:89938-07-8
Formula: CCCC1=NC(Cl)=NC(Cl)=C1
BD237205
95+%
MFCD18803468
2,4-DICHLORO-6-PROPYLTHIENO[2,3-D]PYRIMIDINE
CAS:902765-62-2
Formula: CCCC1=CC2=C(Cl)N=C(Cl)N=C2S1
BD251920
95+%
2,4-DICHLORO-7,7-DIMETHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1260088-72-9
Formula: CC1(C)OCC2=C(Cl)N=C(Cl)N=C21
BD218612
97%
2,4-DICHLORO-7,7-DIMETHYL-7,8-DIHYDROQUINOLIN-5(6H)-ONE
CAS:1630096-70-6
Formula: O=C1C2=C(N=C(Cl)C=C2Cl)CC(C)(C)C1
BD603736
97%
2,4-DICHLORO-7,8-DIFLUORO-6-METHYLQUINOLINE
CAS:1422496-23-8
Formula: CC1=C(F)C(F)=C2N=C(Cl)C=C(Cl)C2=C1
BD440317
97%
MFCD26406912
2,4-DICHLORO-7,8-DIHYDRO-5H-PYRANO[4,3-D]PYRIMIDINE
CAS:944902-88-9
Formula: ClC1=C(COCC2)C2=NC(Cl)=N1
BD227892
95+%
MFCD10697126
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE
CAS:181374-43-6
Formula: ClC1=C(CSCC2)C2=NC(Cl)=N1
BD224377
95+%
MFCD11846185
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1187830-50-7
Formula: ClC1=C(CS2(=O)=O)C(CC2)=NC(Cl)=N1
BD224378
97%
MFCD12963841
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6-OXIDE
CAS:1312935-07-1
Formula: ClC1=C(CS2=O)C(CC2)=NC(Cl)=N1
BD264669
95+%
2,4-DICHLORO-7,8-DIHYDRO-6H-THIOPYRANO[3,2-D]PYRIMIDINE
CAS:87466-23-7
Formula: ClC1=C2C(CCCS2)=NC(Cl)=N1
BD162966
95+%
2,4-DICHLORO-7,8-DIHYDROPYRIDO[4,3-D]PYRIMIDIN-5(6H)-ONE
CAS:1393572-20-7
Formula: O=C1NCCC2=NC(Cl)=NC(Cl)=C21
BD266298
95+%
2,4-DICHLORO-7,8-DIHYDROQUINOLIN-5(6H)-ONE
CAS:1028330-50-8
Formula: O=C1C2=C(N=C(Cl)C=C2Cl)CCC1
BD556273
97%
MFCD18253894
2,4-DICHLORO-7,8-DIMETHOXYQUINOLINE
CAS:202824-49-5
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1OC
BD330772
95+%
MFCD26406913
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:442847-52-1
Formula: C[Si](CCOCN1C=CC2=C(Cl)N=C(Cl)N=C21)(C)C
BD217309
95+%
MFCD08689864
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:950661-85-5
Formula: O=C(C1=CN(COCC[Si](C)(C)C)C2=NC(Cl)=NC(Cl)=C21)O
BD316200
95+%
MFCD17214387
2,4-DICHLORO-7-(2,4-DIFLUOROPHENYL)-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263869-63-1
Formula: FC1=CC=C(C2CCC3=C(Cl)N=C(Cl)N=C32)C(F)=C1
BD436655
97%
MFCD21607366
2,4-DICHLORO-7-(2-FLUOROBENZYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1075205-27-4
Formula: FC1=CC=CC=C1CN2C=CC3=C(Cl)N=C(Cl)N=C32
BD284068
95+%
2,4-DICHLORO-7-(2-FLUOROETHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220517-99-6
Formula: FCCN1C=CC2=C(Cl)N=C(Cl)N=C21
BD283832
95+%
MFCD22575132
2,4-DICHLORO-7-(4-FLUOROPHENYL)-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263868-30-9
Formula: FC1=CC=C(C2CCC3=C(Cl)N=C(Cl)N=C32)C=C1
BD436654
97%
MFCD21607365
2,4-DICHLORO-7-(4-FLUOROPHENYL)-7-METHYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1356010-00-8
Formula: CC1(C2=CC=C(F)C=C2)CCC3=C(Cl)N=C(Cl)N=C31
BD436656
97%
MFCD21607367
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1131992-22-7
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=CC=C3)=O
BD220883
95+%
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638768-44-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1S(=O)(C3=CC=CC=C3)=O)O
BD445790
97%
MFCD27987429
2,4-DICHLORO-7-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:1160994-83-1
Formula: FC(F)(F)OC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD163043
95+%
MFCD12400771
2,4-DICHLORO-7-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:396-02-1
Formula: FC(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)(F)F
BD162895
95+%
MFCD09954878
2,4-DICHLORO-7-CYCLOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220518-04-6
Formula: ClC1=C2C(N(C3CC3)C=C2)=NC(Cl)=N1
BD283823
95+%
MFCD22575133
2,4-DICHLORO-7-FLUORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1379307-68-2
Formula: FC1=CNC2=C(Cl)N=C(Cl)N=C21
BD266707
95+%
2,4-DICHLORO-7-FLUORO-6-METHOXYQUINAZOLINE
CAS:864292-37-5
Formula: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1F
BD300177
95+%
2,4-DICHLORO-7-FLUORO-6-NITROQUINAZOLINE
CAS:1007308-75-9
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1F)[O-]
BD225307
95+%
2,4-DICHLORO-7-FLUORO-8-METHYLQUINAZOLINE
CAS:1039736-73-6
Formula: CC1=C(F)C=CC2=C(Cl)N=C(Cl)N=C12
BD270741
95+%
2,4-DICHLORO-7-FLUOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=N1
BD00791949
2,4-DICHLORO-7-FLUOROQUINAZOLINE
CAS:174566-15-5
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD66727
95%
MFCD09954885
2,4-DICHLORO-7-IODO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:928840-99-7
Formula: ClC1=NC2=C(NC=C2I)C(Cl)=N1
BD221825
95+%
MFCD11109825
2,4-DICHLORO-7-IODOQUINAZOLINE
CAS:959237-34-4
Formula: IC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD162996
95+%
2,4-DICHLORO-7-ISOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1227635-12-2
Formula: CC(N1C=CC2=C(Cl)N=C(Cl)N=C21)C
BD314449
95+%
MFCD23106265
2,4-DICHLORO-7-METHOXY-3-NITROQUINOLINE
CAS:1447961-41-2
Formula: O=[N+](C1=C(Cl)C2=CC=C(OC)C=C2N=C1Cl)[O-]
BD617702
97%
2,4-DICHLORO-7-METHOXY-6-NITROQUINAZOLINE
CAS:N/A
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1OC)[O-]
BD753521
97%
2,4-DICHLORO-7-METHOXYQUINAZOLINE
CAS:62484-31-5
Formula: ClC2=NC1=CC(=CC=C1C(=N2)Cl)OC
BD66729
95+%
MFCD09954881
2,4-DICHLORO-7-METHOXYQUINOLINE
CAS:55934-22-0
Formula: COC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD158272
95+%
MFCD09475797
2,4-DICHLORO-7-METHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1429309-52-3
Formula: CC1OCC2=C(Cl)N=C(Cl)N=C21
BD289880
95+%
MFCD22690768
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-67-5
Formula: CN1C=CC2=C(Cl)N=C(Cl)N=C21
BD219225
97%
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-84-5
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1C)O
BD445793
97%
MFCD27987432
2,4-DICHLORO-7-METHYLPYRIDO[2,3-D]PYRIMIDINE
CAS:92350-63-5
Formula: CC1=NC2=NC(Cl)=NC(Cl)=C2C=C1
BD449322
97%
MFCD11044118
2,4-DICHLORO-7-METHYLQUINAZOLINE
CAS:25171-19-1
Formula: CC1=CC=C2C(Cl)=NC(Cl)=NC2=C1
BD162864
97%
MFCD11858254
2,4-DICHLORO-7-METHYLQUINOLINE
CAS:102878-19-3
Formula: CC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD585828
95%
2,4-DICHLORO-7-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-83-9
Formula: ClC1=NC2=C(C(=N1)Cl)SC=C2C
BD170944
97+%
MFCD08061253
2,4-DICHLORO-7-NITROQUINAZOLINE
CAS:129112-65-8
Formula: O=[N+](C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)[O-]
BD219429
95+%
2,4-DICHLORO-7-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=CC=C2C(Cl)=CC(Cl)=NC2=C1)[O-]
BD00781605
97%
n/a
2,4-DICHLORO-7-PHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263868-24-1
Formula: ClC1=C(CCC2C3=CC=CC=C3)C2=NC(Cl)=N1
BD334242
95+%
MFCD21607364
2,4-DICHLORO-7-TOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:934524-10-4
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=C(C)C=C3)=O
BD166283
97+%
MFCD13193624
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-66-4
Formula: ClC1=C2C(NC=C2)=NC(Cl)=N1
BD29862
97%
MFCD08059278
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBALDEHYDE
CAS:1638767-57-3
Formula: O=CC1=CNC2=NC(Cl)=NC(Cl)=C21
BD330376
95+%
MFCD26516404
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBONITRILE
CAS:1379367-43-7
Formula: N#CC1=CNC2=NC(Cl)=NC(Cl)=C21
BD300930
95+%
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:1638768-02-1
Formula: O=C(C1=CNC2=NC(Cl)=NC(Cl)=C21)O
BD445796
97%
MFCD27987438
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-72-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1)O
BD445647
97%
MFCD25372087
2,4-DICHLORO-8-(4-FLUOROPHENYL)-6-METHYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1263870-59-2
Formula: CN1CC(C2=CC=C(F)C=C2)C3=NC(Cl)=NC(Cl)=C3C1
BD436657
97%
MFCD21607368
2,4-DICHLORO-8-(4-FLUOROPHENYL)-7,8-DIHYDRO-5H-PYRANO[4,3-D]PYRIMIDINE
CAS:1263868-84-3
Formula: FC1=CC=C(C2COCC3=C(Cl)N=C(Cl)N=C32)C=C1
BD436150
97%
MFCD21607138
2,4-DICHLORO-8-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:959237-48-0
Formula: FC(F)(F)OC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD260957
95+%
2,4-DICHLORO-8-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:959237-52-6
Formula: FC(C1=CC=CC2=C(Cl)N=C(Cl)N=C12)(F)F
BD260063
95+%
MFCD09954877
2,4-DICHLORO-8-ETHOXY-3-NITROQUINOLINE
CAS:1447958-14-6
Formula: O=[N+](C1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl)[O-]
BD617623
97%
2,4-DICHLORO-8-ETHOXYQUINOLIN-3-AMINE
CAS:1447962-17-5
Formula: NC1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl
BD617736
97%
2,4-DICHLORO-8-FLUOROQUINAZOLINE
CAS:959237-64-0
Formula: FC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD162997
97%
2,4-DICHLORO-8-FLUOROQUINOLIN-3-AMINE
CAS:1447960-18-0
Formula: NC1=C(Cl)C2=CC=CC(F)=C2N=C1Cl
BD617673
97%
2,4-DICHLORO-8-FLUOROQUINOLINE
CAS:1422498-86-9
Formula: FC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD587088
97%
MFCD22103408
2,4-DICHLORO-8-IODOQUINAZOLINE
CAS:959237-40-2
Formula: ClC1=NC2=C(I)C=CC=C2C(Cl)=N1
BD238490
95+%
MFCD09954873
2,4-DICHLORO-8-METHOXYQUINAZOLINE
CAS:61948-60-5
Formula: COC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD66730
97%
2,4-DICHLORO-8-METHOXYQUINOLINE
CAS:32608-29-0
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD33215
98%
MFCD07644554
2,4-DICHLORO-8-METHYL-3-NITROQUINOLINE
CAS:1026839-46-2
Formula: O=[N+](C1=C(Cl)C2=CC=CC(C)=C2N=C1Cl)[O-]
BD605844
97%
2,4-DICHLORO-8-METHYLBENZO[B]THIENO[3,2-F][1,4]OXAZEPINE
CAS:1418130-87-6
Formula: CC1=CC=C2C(OC3=C(C=C(Cl)S3)C(Cl)=N2)=C1
BD439485
97%
MFCD23703293
2,4-DICHLORO-8-METHYLQUINAZOLINE
CAS:39576-83-5
Formula: CC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD258788
97%
MFCD11849266
2,4-DICHLORO-8-METHYLQUINOLIN-3-AMINE
CAS:1447960-14-6
Formula: NC1=C(Cl)C2=CC=CC(C)=C2N=C1Cl
BD617670
97%
2,4-DICHLORO-8-METHYLQUINOLINE
CAS:102878-20-6
Formula: CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD304940
95+%
MFCD01108969
2,4-DICHLORO-8-NITROQUINAZOLINE
CAS:174566-19-9
Formula: O=[N+](C1=CC=CC2=C(Cl)N=C(Cl)N=C12)[O-]
BD587351
97%
2,4-DICHLORO-8-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=C2N=C(Cl)C=C(Cl)C2=CC=C1)[O-]
BD00784297
97%
n/a
2,4-DICHLORO-8-PHENYL-7,8-DIHYDRO-5H-PYRANO[4,3-D]PYRIMIDINE
CAS:1263868-77-4
Formula: ClC1=C(COCC2C3=CC=CC=C3)C2=NC(Cl)=N1
BD436149
97%
MFCD21607137
2,4-DICHLORO-D-PHENYLALANINE
CAS:114872-98-9
Formula: ClC1=C(C[C@@H](N)C(=O)O)C=CC(=C1)Cl
BD17624
97%
MFCD01860873
2,4-DICHLORO-N'-(2-CHLOROACETYL)BENZOHYDRAZIDE
CAS:184877-74-5
Formula: O=C(NNC(CCl)=O)C1=CC=C(Cl)C=C1Cl
BD201369
95+%
2,4-DICHLORO-N'-HYDROXYBENZIMIDAMIDE
CAS:22179-80-2
Formula: N/C(C1=CC=C(Cl)C=C1Cl)=N\O
BD66776
97%
MFCD00178762
2,4-DICHLORO-N-(2,6-DICHLOROPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-83-5
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(Cl)C=CC=C2Cl
BD268634
95+%
MFCD26400049
2,4-DICHLORO-N-(2,6-DIMETHYLPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-82-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(C)C=CC=C2C
BD268633
95+%
MFCD25953444
2,4-DICHLORO-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:20656-08-0
Formula: O=C(NCCO)C1=CC=C(Cl)C=C1Cl
BD11667
95+%
2,4-DICHLORO-N-(2-HYDROXYPROPYL)BENZAMIDE
CAS:947888-99-5
Formula: O=C(NCC(O)C)C1=CC=C(Cl)C=C1Cl
BD273504
97%
2,4-DICHLORO-N-(2-METHYLBENZYL)ANILINE
CAS:940367-72-6
Formula: CC1=CC=CC=C1CNC2=CC=C(Cl)C=C2Cl
BD193886
97%
MFCD10687636
2,4-DICHLORO-N-(4-(1-HYDROXYETHYL)PHENYL)BENZAMIDE
CAS:1156912-69-4
Formula: O=C(NC1=CC=C(C(O)C)C=C1)C2=CC=C(Cl)C=C2Cl
BD606794
97%
2,4-DICHLORO-N-(PIPERIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353948-07-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCCC2)=O.[H]Cl
BD288631
95+%
MFCD21098951
2,4-DICHLORO-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-62-9
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NC2CNCCC2)=O.[H]Cl
BD288807
95+%
MFCD21098921
2,4-DICHLORO-N-(PYRIDIN-3-YL)BENZAMIDE
CAS:197800-84-3
Formula: O=C(NC1=CC=CN=C1)C2=CC=C(Cl)C=C2Cl
BD417298
95+%
MFCD00160434
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177352-12-3
Formula: ClC1=CC=C(C(Cl)=C1)NCC2NCCC2.[H]Cl
BD562626
97%
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-35-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCC2)=O.[H]Cl
BD288654
95+%
MFCD21098898
2,4-DICHLORO-N-[4-(2,4-DICHLOROBENZOYLOXY)-2-METHYLPHENYL]BENZAMIDE
CAS:1363166-08-8
Formula: O=C(NC1=CC=C(OC(C2=CC=C(Cl)C=C2Cl)=O)C=C1C)C3=CC=C(Cl)C=C3Cl
BD317326
95+%
MFCD21641332
2,4-DICHLORO-N-CYCLOPROPYL-N-(PIPERIDIN-4-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353965-80-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C2CC2)CC3CCNCC3)=O.[H]Cl
BD289011
95+%
MFCD21098914
2,4-DICHLORO-N-CYCLOPROPYLPYRIMIDINE-5-CARBOXAMIDE
CAS:1017464-37-7
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2CC2
BD605533
97%
2,4-DICHLORO-N-ETHYLANILINE
CAS:35113-89-4
Formula: CCNC1=CC=C(Cl)C=C1Cl
BD28467
95+%
MFCD06658422
2,4-DICHLORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:29203-60-9
Formula: Cl/C(C1=CC=C(Cl)C=C1Cl)=N\O
BD66777
97%
2,4-DICHLORO-N-ISOPROPYL-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE
CAS:1353980-76-3
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CC2NCCC2)=O
BD289019
95+%
MFCD21098915
2,4-DICHLORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:646528-36-1
Formula: CON(C)C(=O)C1=C(Cl)C=C(Cl)C=C1
BD201460
95+%
MFCD08689759
2,4-DICHLORO-N-METHYL-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353947-18-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C)C2CNCCC2)=O.[H]Cl
BD289036
95+%
MFCD21098943
2,4-DICHLORO-N-METHYLANILINE
CAS:35113-88-3
Formula: CNC1=CC=C(Cl)C=C1Cl
BD142745
95+%
MFCD00052853
2,4-DICHLORO-N-METHYLBENZAMIDE
CAS:66896-64-8
Formula: O=C(NC)C1=CC=C(Cl)C=C1Cl
BD368215
95+%
MFCD00507353
2,4-DICHLORO-N-NEOPENTYLANILINE
CAS:1040690-09-2
Formula: CC(C)(C)CNC1=CC=C(Cl)C=C1Cl
BD193917
97%
2,4-DICHLORO-N-PHENETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:927176-99-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NCCC2=CC=CC=C2
BD268636
95+%
2,4-DICHLORO-PYRIMIDINE-5-CARBOXYLIC ACID-TERT-BUTYLAMIDE
CAS:389606-35-3
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC(C)(C)C
BD268632
95+%
2,4-DICHLOROBENZAMIDE
CAS:2447-79-2
Formula: O=C(N)C1=CC=C(Cl)C=C1Cl
BD4330
95+%
MFCD00007974
2,4-DICHLOROBENZENE-1,3-DIOL
CAS:16606-61-4
Formula: OC1=CC=C(Cl)C(O)=C1Cl
BD328596
95+%
MFCD13152136
2,4-DICHLOROBENZENESULFONAMIDE
CAS:20532-15-4
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N)=O
BD323462
95+%
MFCD03094617
2,4-DICHLOROBENZIMIDAMIDE
CAS:63124-43-6
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl
BD66745
95+%
MFCD09745492
2,4-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:154505-50-7
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl.[H]Cl
BD27628
95+%
MFCD04114461
2,4-DICHLOROBENZO[D]OXAZOLE
CAS:656836-87-2
Formula: ClC1=C2N=C(Cl)OC2=CC=C1
BD459792
97%
2,4-DICHLOROBENZO[G]QUINAZOLINE
CAS:33987-01-8
Formula: ClC1=C2C=C3C(C=CC=C3)=CC2=NC(Cl)=N1
BD294223
95+%
2,4-DICHLOROBENZOHYDRAZIDE
CAS:5814-06-2
Formula: O=C(NN)C1=CC=C(Cl)C=C1Cl
BD4548
97%
2,4-DICHLOROBENZOIC ACID
CAS:50-84-0
Formula: C1=CC(=CC(=C1C(O)=O)Cl)Cl
BD21089
98%
MFCD00002414
2,4-DICHLOROBENZOTHIAZOLE
CAS:3622-30-8
Formula: C1=C(C2=C(C=C1)SC(=N2)Cl)Cl
BD20442
95+%
MFCD00127716
2,4-DICHLOROBENZOTHIOAMIDE
CAS:2775-38-4
Formula: NC(=S)C1=C(Cl)C=C(Cl)C=C1
BD4341
98%
MFCD00173930
2,4-DICHLOROBENZOYLACETONITRILE
CAS:39528-61-5
Formula: N#CCC(C1=CC=C(Cl)C=C1Cl)=O
BD79171
95+%
MFCD02657976
2,4-DICHLOROBENZYL CARBAMIMIDOTHIOATE HYDROCHLORIDE
CAS:131916-62-6
Formula: NC(SCC1=CC=C(Cl)C=C1Cl)=N.[H]Cl
BD590555
97%
2,4-DICHLOROCINNAMIC ACID
CAS:1201-99-6
Formula: O=C(O)/C=C/C1=CC=C(Cl)C=C1Cl
BD7236
97%
2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
CAS:1000577-84-3
Formula: ClC1=C2C(OC=C2)=NC(Cl)=N1
BD159768
95+%
MFCD09878674
2,4-DICHLOROFURO[3,2-D]PYRIMIDINE
CAS:956034-07-4
Formula: ClC1=NC2=C(C(=N1)Cl)OC=C2
BD158273
97%
MFCD11520866
2,4-DICHLOROFURO[3,4-D]PYRIMIDIN-7(5H)-ONE
CAS:15783-48-9
Formula: O=C1OCC2=C(Cl)N=C(Cl)N=C21
BD238980
95%
MFCD18072502
2,4-DICHLOROIMIDAZO[5,1-F][1,2,4]TRIAZINE
CAS:1086398-79-9
Formula: ClC1=NC(Cl)=NN2C1=CN=C2
BD160302
97%
MFCD11501352
2,4-DICHLOROISOPHTHALONITRILE
CAS:19846-21-0
Formula: N#CC1=CC=C(Cl)C(C#N)=C1Cl
BD284402
95+%
MFCD01656997
2,4-DICHLORONAPHTHALEN-1-AMINE
CAS:29242-87-3
Formula: NC1=C2C=CC=CC2=C(Cl)C=C1Cl
BD748533
97%
2,4-DICHLORONAPHTHALEN-1-OL
CAS:2050-76-2
Formula: OC1=C(Cl)C=C(Cl)C2=C1C=CC=C2
BD66618
95+%
MFCD00003931
2,4-DICHLORONICOTINALDEHYDE
CAS:134031-24-6
Formula: ClC1=C(C=O)C(=CC=N1)Cl
BD66802
98%
MFCD07437909
2,4-DICHLORONICOTINAMIDE
CAS:70593-56-5
Formula: O=C(N)C1=C(Cl)N=CC=C1Cl
BD219930
95+%
2,4-DICHLORONICOTINC ACID
CAS:262423-77-8
Formula: C1=CN=C(C(=C1Cl)C(=O)O)Cl
BD32940
98%
MFCD06796292
2,4-DICHLORONICOTINONITRILE
CAS:180995-12-4
Formula: N#CC1=C(Cl)N=CC=C1Cl
BD66629
98%
MFCD09750302
2,4-DICHLOROPHENETHYL ALCOHOL
CAS:81156-68-5
Formula: ClC1=CC=C(C(Cl)=C1)CCO
BD42039
98%
MFCD00192010
2,4-DICHLOROPHENYL 4-PHENYL-5-(TRIFLUOROMETHYL)THIOPHENE-2-CARBOXYLATE
CAS:256348-21-7
Formula: O=C(C1=CC(C2=CC=CC=C2)=C(C(F)(F)F)S1)OC3=CC=C(Cl)C=C3Cl
BD258320
95+%
MFCD00110255
2,4-DICHLOROPHENYL BUTYRATE
CAS:41022-54-2
Formula: CCCC(OC1=CC=C(Cl)C=C1Cl)=O
BD128071
97%
MFCD01566538
2,4-DICHLOROPHENYL ETHYL CARBONATE
CAS:22876-28-4
Formula: O=C(OC1=CC=C(Cl)C=C1Cl)OCC
BD66789
95+%
2,4-DICHLOROPHENYL ETHYL SULFIDE
CAS:101080-66-4
Formula: CCSC1=CC=C(Cl)C=C1Cl
BD322296
95+%
MFCD25976514
2,4-DICHLOROPHENYLACETIC ACID
CAS:19719-28-9
Formula: C1=C(C(=CC=C1Cl)CC(O)=O)Cl
BD10944
98%
MFCD00004318
2,4-DICHLOROPHENYLBORONIC ACID
CAS:68716-47-2
Formula: C1=CC(=CC(=C1B(O)O)Cl)Cl
BD22193
98%
MFCD00013930
2,4-DICHLOROPHENYLSULFONYLETHANOL
CAS:107737-90-6
Formula: OCCS(=O)(C1=CC=C(Cl)C=C1Cl)=O
BD322409
95+%
MFCD03789219
2,4-DICHLOROPHENYLTHIOETHANOL
CAS:73927-27-2
Formula: OCCSC1=CC=C(Cl)C=C1Cl
BD324142
95+%
MFCD01727971
2,4-DICHLOROPYRIDIN-3-OL
CAS:405141-76-6
Formula: OC1=C(Cl)C=CN=C1Cl
BD212863
95+%
MFCD14155863
2,4-DICHLOROPYRIDO[2,3-D]PYRIDAZIN-5(6H)-ONE
CAS:1390657-40-5
Formula: O=C1C2=C(Cl)C=C(Cl)N=C2C=NN1
BD329509
95+%
MFCD23163508
2,4-DICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:126728-20-9
Formula: ClC1=NC2=C(C=CC=N2)C(Cl)=N1
BD31684
98%
MFCD07644627
2,4-DICHLOROPYRIDO[3',2':4,5]FURO[3,2-D]PYRIMIDINE
CAS:1268241-74-2
Formula: ClC1=C(OC2=NC=CC=C23)C3=NC(Cl)=N1
BD748626
97%
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:39551-54-7
Formula: ClC1=NC2=C(C(=N1)Cl)N=CC=C2
BD66804
97%
MFCD11046863
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE-6-CARBALDEHYDE
CAS:1690866-69-3
Formula: O=CC1=NC2=C(Cl)N=C(Cl)N=C2C=C1
BD436423
97%
MFCD21607299
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1363405-45-1
Formula: O=C(C1=NC2=C(Cl)N=C(Cl)N=C2C=C1)O
BD436426
97%
MFCD21607302
2,4-DICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:908240-50-6
Formula: ClC1=NC2=C(C=CN=C2)C(Cl)=N1
BD158274
96%
MFCD10699461
2,4-DICHLOROPYRIMIDIN-5-OL
CAS:1395037-19-0
Formula: OC1=CN=C(Cl)N=C1Cl
BD587040
97%
MFCD22570332
2,4-DICHLOROPYRIMIDINE
CAS:3934-20-1
Formula: ClC1=NC(Cl)=NC=C1
BD9378
98%
MFCD00006061
2,4-DICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:871254-61-4
Formula: ClC1=NC(Cl)=C(C=O)C=N1
BD210578
97%
MFCD11112096
2,4-DICHLOROPYRIMIDINE-5-CARBOHYDRAZIDE
CAS:1379317-74-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NN
BD586969
97%
2,4-DICHLOROPYRIMIDINE-5-CARBONITRILE
CAS:3177-24-0
Formula: ClC1=NC=C(C(=N1)Cl)C#N
BD66656
95%
MFCD09746248
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID AMIDE
CAS:1240390-28-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)N
BD215188
97%
2,4-DICHLOROPYRIMIDO[4,5-B]QUINOLINE
CAS:118726-21-9
Formula: ClC1=C2C(N=C3C=CC=CC3=C2)=NC(Cl)=N1
BD437216
97%
MFCD22573689
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZIN-6-AMINE
CAS:1823364-13-1
Formula: NC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD441595
97%
MFCD27991657
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:918538-05-3
Formula: ClC1=NC(Cl)=NN2C1=CC=C2
BD149947
95+%
MFCD11044885
2,4-DICHLOROQUINAZOLIN-6-OL
CAS:464927-05-7
Formula: OC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD293673
95+%
2,4-DICHLOROQUINAZOLINE
CAS:607-68-1
Formula: C1=CC2=C(C=C1)N=C(N=C2Cl)Cl
BD41848
97+%
MFCD00091950
2,4-DICHLOROQUINAZOLINE-5-CARBONITRILE
CAS:1823921-32-9
Formula: N#CC1=CC=CC2=NC(Cl)=NC(Cl)=C12
BD260167
95+%
2,4-DICHLOROQUINAZOLINE-6-CARBONITRILE
CAS:150449-98-2
Formula: N#CC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD162841
95+%
MFCD12400768
2,4-DICHLOROQUINAZOLINE-7-CARBONITRILE
CAS:864292-40-0
Formula: ClC1=NC2=CC(=CC=C2C(Cl)=N1)C#N
BD162960
95+%
MFCD12400766
2,4-DICHLOROQUINOLIN-3-AMINE
CAS:1414786-90-5
Formula: NC1=C(Cl)C2=CC=CC=C2N=C1Cl
BD270986
95+%
2,4-DICHLOROQUINOLIN-5-AMINE
CAS:N/A
Formula: NC1=C2C(Cl)=CC(Cl)=NC2=CC=C1
BD00809070
97%
n/a
2,4-DICHLOROQUINOLIN-6-AMINE
CAS:N/A
Formula: NC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD00787899
97%
n/a
2,4-DICHLOROQUINOLIN-7-AMINE
CAS:N/A
Formula: NC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD00784800
97%
n/a
2,4-DICHLOROQUINOLIN-8-AMINE
CAS:N/A
Formula: NC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD00803737
97%
n/a
2,4-DICHLOROQUINOLINE
CAS:703-61-7
Formula: ClC1=NC2=C(C=CC=C2)C(Cl)=C1
BD11462
98%
MFCD00023939
2,4-DICHLOROQUINOLINE-3-CARBONITRILE
CAS:69875-54-3
Formula: N#CC1=C(Cl)C2=CC=CC=C2N=C1Cl
BD315817
95+%
MFCD00206427
2,4-DICHLOROTHIAZOLE
CAS:4175-76-2
Formula: ClC1=NC(=CS1)Cl
BD20754
97%
MFCD08691358
2,4-DICHLOROTHIAZOLE-5-CARBOXYLIC ACID
CAS:62019-56-1
Formula: O=C(C1=C(Cl)N=C(Cl)S1)O
BD107432
95+%
MFCD09909676
2,4-DICHLOROTHIENO[2,3-D]PYRIMIDINE
CAS:18740-39-1
Formula: ClC1=NC2=C(C(=N1)Cl)C=CS2
BD19044
98%
MFCD09743991
2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:16234-14-3
Formula: ClC1=C2C(C=CS2)=NC(Cl)=N1
BD25036
95%
MFCD08448158
2,4-DICHLOROTHIENO[3,4-D]PYRIMIDINE
CAS:36948-21-7
Formula: ClC1=NC(Cl)=NC2=CSC=C21
BD315579
95+%
MFCD10000792
2,4-DICYCLOPROPYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:1713462-67-9
Formula: C1(C2CC2)=NC(N3CCNCC3)=CC(C4CC4)=N1
BD623167
97%
2,4-DICYCLOPROPYLBENZALDEHYDE
CAS:1245645-99-1
Formula: O=CC1=CC=C(C2CC2)C=C1C3CC3
BD164927
95+%
MFCD17677327
2,4-DICYCLOPROPYLTHIAZOLE
CAS:1427014-71-8
Formula: C1(C2CC2)=NC(C3CC3)=CS1
BD616528
97%
2,4-DIETHOXY-1,3-DIFLUORO-5-IODOBENZENE
CAS:1208078-14-1
Formula: FC1=C(OCC)C(F)=C(OCC)C(I)=C1
BD589455
97%
MFCD12547869
2,4-DIETHOXY-1,3-DIFLUORO-5-NITROBENZENE
CAS:1208076-37-2
Formula: FC1=C(OCC)C(F)=C(OCC)C([N+]([O-])=O)=C1
BD589414
97%
MFCD12547870
2,4-DIETHOXY-1-FLUOROBENZENE
CAS:851089-61-7
Formula: CCOC1=CC=C(F)C(OCC)=C1
BD597802
97%
MFCD12547864
2,4-DIETHOXY-7-METHYLQUINOLINE
CAS:443687-61-4
Formula: CC1C=C2C(C(=CC(=N2)OCC)OCC)=CC=1
BD00773117
95+%
n/a
2,4-DIETHOXYBENZALDEHYDE
CAS:22924-16-9
Formula: O=CC1=CC=C(OCC)C=C1OCC
BD13270
97%
MFCD00995010
2,4-DIETHOXYBENZOIC ACID
CAS:19074-30-7
Formula: O=C(O)C1=CC=C(OCC)C=C1OCC
BD188555
97%
2,4-DIETHOXYPYRIMIDINE
CAS:20461-60-3
Formula: CCOC1=NC(OCC)=NC=C1
BD262697
95+%
MFCD00056029
2,4-DIETHYL-6-METHYLBENZENE-1,3-DIAMINE COMPOUND WITH 4,6-DIETHYL-2-METHYLBENZENE-1,3-DIAMINE
CAS:75389-89-8
Formula: NC1=C(CC)C=C(C)C(N)=C1CC.NC2=C(CC)C=C(CC)C(N)=C2C
BD491256
97%
2,4-DIETHYL-9H-THIOXANTHEN-9-ONE
CAS:82799-44-8
Formula: CCC1=CC(CC)=C2SC3=C(C=CC=C3)C(=O)C2=C1
BD17113
97%
MFCD00082910
2,4-DIETHYLBENZENE-1,3-DIAMINE
CAS:36394-50-0
Formula: CCC1=CC=C(N)C(CC)=C1N
BD233356
95+%
MFCD20712226
2,4-DIETHYLBENZENE-1,3-DIOL
CAS:52959-33-8
Formula: OC1=CC=C(CC)C(O)=C1CC
BD66824
95+%
MFCD06410806
2,4-DIETHYLBENZOIC ACID
CAS:104175-23-7
Formula: O=C(O)C1=CC=C(CC)C=C1CC
BD447977
97%
MFCD20641288
2,4-DIETHYLHEPTAN-1-OL
CAS:80192-55-8
Formula: CCCC(CC)CC(CC)CO
BD232821
95+%
MFCD00009709
2,4-DIETHYLPENTANEDIOIC ACID
CAS:27899-21-4
Formula: O=C(O)C(CC)CC(CC)C(O)=O
BD66829
97%
2,4-DIETHYLPYRIMIDINE
CAS:857990-28-4
Formula: CCC1=NC(CC)=NC=C1
BD317662
95+%
MFCD22423156
2,4-DIETHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:1306969-40-3
Formula: O=C(C1=CN=C(CC)N=C1CC)O
BD609898
97%
2,4-DIFLUORO-1,1'-BIPHENYL
CAS:37847-52-2
Formula: FC1=CC=C(C2=CC=CC=C2)C(F)=C1
BD41642
97%
2,4-DIFLUORO-1-(METHYLSULFONYL)BENZENE
CAS:236739-02-9
Formula: O=S(C1=CC=C(F)C=C1F)(C)=O
BD66898
95+%
MFCD03789188
2,4-DIFLUORO-1-(PROP-1-EN-2-YL)BENZENE
CAS:156570-11-5
Formula: C=C(C1=CC=C(F)C=C1F)C
BD252538
95+%
MFCD18825239
2,4-DIFLUORO-1-(TRIFLUOROMETHYL)BENZENE
CAS:64248-61-9
BD66866
97%
MFCD04972808
2,4-DIFLUORO-1-IODOBENZENE
CAS:2265-93-2
Formula: IC1=CC=C(F)C=C1F
BD9775
98%
MFCD00040151
2,4-DIFLUORO-1-METHOXYBENZENE
CAS:452-10-8
Formula: COC1=C(F)C=C(F)C=C1
BD66853
98%
MFCD00010731
2,4-DIFLUORO-1-NITROBENZENE
CAS:446-35-5
Formula: FC1=CC=C([N+]([O-])=O)C(F)=C1
BD3178
98%
MFCD00007050
2,4-DIFLUORO-1H-INDOLE
CAS:1934422-22-6
Formula: FC1=CC=CC2=C1C=C(F)N2
BD284583
95+%
MFCD24565868
2,4-DIFLUORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-13-8
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(F)C=C3F
BD309993
95+%
MFCD03842446
2,4-DIFLUORO-2'-NITRO-1,1'-BIPHENYL
CAS:52798-24-0
Formula: FC1=CC=C(C2=CC=CC=C2[N+]([O-])=O)C(F)=C1
BD438961
97%
MFCD28405047
2,4-DIFLUORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-75-6
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(F)C=C3F
BD311908
95+%
MFCD03842503
2,4-DIFLUORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898775-03-6
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(F)C=C3F
BD312005
95+%
MFCD03842560
2,4-DIFLUORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-41-7
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(F)C=C3F
BD312689
95+%
MFCD03842787
2,4-DIFLUORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-63-2
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(F)C=C3F
BD310684
95+%
MFCD07699989
2,4-DIFLUORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-28-4
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(F)C=C3F
BD313612
95+%
MFCD03841937
2,4-DIFLUORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-58-3
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(F)C=C3F
BD313742
95+%
MFCD03841994
2,4-DIFLUORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-86-0
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(F)C=C3F
BD311698
95+%
MFCD03842051
2,4-DIFLUORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-93-4
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(F)C=C3F
BD313200
95+%
MFCD03842276
2,4-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:1003709-80-5
Formula: COC1=CC(C(O)=O)=C(F)C(OC)=C1F
BD161247
95+%
MFCD09839225
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)ANILINE
CAS:153338-24-0
Formula: NC1=CC=C(F)C(OC(F)(F)F)=C1F
BD247186
95+%
MFCD19440811
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID
CAS:1119454-13-5
Formula: O=C(O)C1=CC=C(F)C(OC(F)(F)F)=C1F
BD257997
95+%
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-30-2
Formula: O=CC1=CC=C(F)C(C(F)(F)F)=C1F
BD294095
95+%
MFCD12404958
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:157337-81-0
Formula: OC(=O)C1=C(F)C(=C(F)C=C1)C(F)(F)F
BD238807
97%
MFCD12827981
2,4-DIFLUORO-3-FORMYLBENZONITRILE
CAS:149489-14-5
Formula: N#CC1=CC=C(F)C(C=O)=C1F
BD315311
95+%
MFCD09907858
2,4-DIFLUORO-3-HYDROXYBENZALDEHYDE
CAS:192927-69-8
Formula: O=CC1=CC=C(F)C(O)=C1F
BD223823
95+%
2,4-DIFLUORO-3-HYDROXYBENZOIC ACID
CAS:91659-08-4
Formula: OC(=O)C1=C(F)C(O)=C(F)C=C1
BD23387
95+%
MFCD06797839
2,4-DIFLUORO-3-IODOANILINE
CAS:1437316-91-0
Formula: NC1=CC=C(F)C(I)=C1F
BD468954
97%
MFCD28789174
2,4-DIFLUORO-3-IODOPYRIDINE
CAS:837364-88-2
Formula: IC1=C(F)C=CN=C1F
BD165748
98%
MFCD09029861
2,4-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC ACID
CAS:1451390-95-6
Formula: OB(C1=CC=C(F)C(OC(C)C)=C1F)O
BD326668
95+%
MFCD19981529
2,4-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:870837-66-4
Formula: COC1=C(F)C=CC(C=O)=C1F
BD235640
95+%
MFCD04115930
2,4-DIFLUORO-3-METHOXYBENZAMIDE
CAS:479091-06-0
Formula: O=C(N)C1=CC=C(F)C(OC)=C1F
BD308179
95+%
MFCD04115931
2,4-DIFLUORO-3-METHOXYBENZOIC ACID
CAS:178974-97-5
Formula: COC1=C(F)C=CC(C(O)=O)=C1F
BD5928
98%
MFCD02258905
2,4-DIFLUORO-3-METHOXYBENZONITRILE
CAS:220353-20-8
Formula: N#CC1=CC=C(F)C(OC)=C1F
BD10894
97%
MFCD04115932
2,4-DIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:221221-11-0
Formula: O=C(Cl)C1=CC=C(F)C(OC)=C1F
BD319678
95+%
MFCD04115933
2,4-DIFLUORO-3-METHOXYBENZYLAMINE
CAS:717094-51-4
Formula: NCC1=CC=C(F)C(OC)=C1F
BD308643
95+%
MFCD04115935
2,4-DIFLUORO-3-METHOXYCINNAMIC ACID
CAS:886499-22-5
Formula: O=C(O)/C=C/C1=CC=C(F)C(OC)=C1F
BD309526
95+%
MFCD04115937
2,4-DIFLUORO-3-METHOXYPHENOL
CAS:886499-27-0
Formula: OC1=CC=C(F)C(OC)=C1F
BD309527
95+%
MFCD04115938
2,4-DIFLUORO-3-METHYL-5-NITROANILINE
CAS:112822-77-2
Formula: NC1=CC([N+]([O-])=O)=C(F)C(C)=C1F
BD332902
95+%
MFCD16620287
2,4-DIFLUORO-3-METHYLANILINE
CAS:76350-70-4
Formula: NC1=CC=C(F)C(C)=C1F
BD247187
96%
MFCD09261073
2,4-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:847502-88-9
Formula: O=CC1=CC=C(F)C(C)=C1F
BD66837
97%
MFCD07777152
2,4-DIFLUORO-3-METHYLBENZENETHIOL
CAS:1349719-15-8
Formula: SC1=CC=C(F)C(C)=C1F
BD460595
97%
MFCD20233354
2,4-DIFLUORO-3-METHYLBENZOIC ACID
CAS:112857-68-8
Formula: FC1=C(C(=O)O)C=CC(=C1C)F
BD41189
95%
MFCD03265223
2,4-DIFLUORO-3-METHYLBENZYLAMINE
CAS:847502-90-3
Formula: NCC1=CC=C(F)C(C)=C1F
BD309322
95+%
MFCD08275293
2,4-DIFLUORO-3-NITROBENZONITRILE
CAS:1186194-75-1
Formula: N#CC1=CC=C(F)C([N+]([O-])=O)=C1F
BD333191
95+%
MFCD11226536
2,4-DIFLUORO-3-NITROPYRIDINE
CAS:60186-14-3
Formula: O=[N+](C1=C(F)C=CN=C1F)[O-]
BD251137
95+%
2,4-DIFLUORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-76-4
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(F)C=C3F
BD310773
95+%
MFCD07700040
2,4-DIFLUORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-65-5
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(F)C=C3F
BD311677
95+%
MFCD03841425
2,4-DIFLUORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-63-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(F)C=C3F
BD312061
95+%
MFCD03841482
2,4-DIFLUORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-89-1
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(F)C=C3F
BD312181
95+%
MFCD03841539
2,4-DIFLUORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-20-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(F)C=C3F
BD312765
95+%
MFCD03841766
2,4-DIFLUORO-5-(TRIFLUOROMETHOXY)ANILINE
CAS:123572-59-8
Formula: NC1=CC(OC(F)(F)F)=C(F)C=C1F
BD227880
97%
2,4-DIFLUORO-5-FORMYLBENZONITRILE
CAS:633327-10-3
Formula: N#CC1=CC(C=O)=C(F)C=C1F
BD294806
95+%
MFCD19440211
2,4-DIFLUORO-5-IODOBENZOIC ACID
CAS:161531-51-7
Formula: OC(=O)C1=C(F)C=C(F)C(I)=C1
BD236566
95+%
MFCD11226506
2,4-DIFLUORO-5-IODOPYRIDINE
CAS:837364-89-3
Formula: IC1=CN=C(F)C=C1F
BD218292
95+%
MFCD09029864
2,4-DIFLUORO-5-METHOXYANILINE
CAS:98446-51-6
Formula: NC1=CC(OC)=C(F)C=C1F
BD196773
95+%
MFCD08689699
2,4-DIFLUORO-5-METHOXYBENZALDEHYDE
CAS:177034-25-2
Formula: O=CC1=CC(OC)=C(F)C=C1F
BD317437
95+%
MFCD24539280
2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID
CAS:1395417-65-8
Formula: OB(C1=CC(OC)=C(F)C=C1F)O
BD326378
95+%
MFCD21609510
2,4-DIFLUORO-5-METHYLANILINE
CAS:1378579-56-6
Formula: NC1=CC(C)=C(F)C=C1F
BD443392
97%
MFCD14583001
2,4-DIFLUORO-5-METHYLBENZALDEHYDE
CAS:315204-36-5
Formula: CC1=CC(C=O)=C(F)C=C1F
BD228204
95+%
MFCD12196967
2,4-DIFLUORO-5-METHYLBENZOIC ACID
CAS:367954-99-2
Formula: FC1=C(C(=O)O)C=C(C(=C1)F)C
BD42232
97%
MFCD09835285
2,4-DIFLUORO-5-METHYLPYRIMIDINE
CAS:96548-89-9
Formula: CC1=CN=C(F)N=C1F
BD553240
97%
2,4-DIFLUORO-5-NITROANILINE
CAS:123344-02-5
Formula: NC1=CC([N+]([O-])=O)=C(F)C=C1F
BD257853
98%
MFCD04038395
2,4-DIFLUORO-5-NITROBENZENESULFONYL CHLORIDE
CAS:1780-83-2
Formula: O=S(C1=CC([N+]([O-])=O)=C(F)C=C1F)(Cl)=O
BD326886
95+%
MFCD06655595
2,4-DIFLUORO-5-NITROBENZOIC ACID
CAS:153775-33-8
Formula: OC(=O)C1=C(F)C=C(F)C(=C1)[N+]([O-])=O
BD66843
97%
MFCD04115713
2,4-DIFLUORO-5-NITROBENZONITRILE
CAS:67152-20-9
Formula: [O-][N+](=O)C1=CC(C#N)=C(F)C=C1F
BD66845
98%
MFCD07772030
2,4-DIFLUORO-5-NITROPHENOL
CAS:113512-57-5
Formula: OC1=CC([N+]([O-])=O)=C(F)C=C1F
BD226145
97%
2,4-DIFLUORO-5-NITROPHENYL PROPIONATE
CAS:924868-80-4
Formula: CCC(OC1=CC([N+]([O-])=O)=C(F)C=C1F)=O
BD199664
97%
MFCD08443941
2,4-DIFLUORO-5-NITROPYRIDINE
CAS:60186-15-4
Formula: [O-][N+](=O)C1=CN=C(F)C=C1F
BD216512
95+%
MFCD18802741
2,4-DIFLUORO-6-((2-FLUORO-4-IODOPHENYL)AMINO)BENZOIC ACID
CAS:934665-14-2
Formula: O=C(O)C1=C(NC2=CC=C(I)C=C2F)C=C(F)C=C1F
BD269711
95+%
2,4-DIFLUORO-6-((TRIMETHYLSILYL)ETHYNYL)ANILINE
CAS:684250-21-3
Formula: NC1=C(C#C[Si](C)(C)C)C=C(F)C=C1F
BD241342
95+%
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1415568-78-3
Formula: NC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
BD329681
95+%
MFCD28291811
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1451391-16-4
Formula: OC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
BD326670
95+%
MFCD16996285
2,4-DIFLUORO-6-HYDROXYBENZALDEHYDE
CAS:136516-64-8
Formula: O=CC1=C(O)C=C(F)C=C1F
BD212993
97%
MFCD03701048
2,4-DIFLUORO-6-HYDROXYBENZOIC ACID
CAS:189283-54-3
Formula: O=C(O)C1=C(O)C=C(F)C=C1F
BD244177
95+%
MFCD06203215
2,4-DIFLUORO-6-HYDROXYBENZONITRILE
CAS:1261793-35-4
Formula: N#CC1=C(O)C=C(F)C=C1F
BD449811
97%
MFCD18394850
2,4-DIFLUORO-6-IODOANILINE
CAS:582319-15-1
Formula: NC1=C(F)C=C(F)C=C1I
BD238834
95+%
MFCD08059536
2,4-DIFLUORO-6-IODOPHENOL
CAS:551002-42-7
Formula: OC1=C(I)C=C(F)C=C1F
BD304200
95+%
2,4-DIFLUORO-6-METHOXYBENZALDEHYDE
CAS:608515-57-7
Formula: O=CC1=C(OC)C=C(F)C=C1F
BD334768
95+%
MFCD20486219
2,4-DIFLUORO-6-METHOXYBENZONITRILE
CAS:1240518-41-5
Formula: N#CC1=C(OC)C=C(F)C=C1F
BD469695
97%
MFCD20486220
2,4-DIFLUORO-6-METHYLPYRIDINE
CAS:83261-73-8
Formula: CC1=CC(F)=CC(F)=N1
BD241270
95+%
2,4-DIFLUORO-6-METHYLPYRIMIDINE
CAS:696-80-0
Formula: CC1N=C(F)N=C(F)C=1
BD00753248
95+%
n/a
2,4-DIFLUORO-6-NITROANILINE
CAS:364-30-7
Formula: NC1=C(F)C=C(F)C=C1[N+]([O-])=O
BD66847
98%
MFCD00034058
2,4-DIFLUORO-6-NITROPHENOL
CAS:364-31-8
Formula: OC1=C([N+]([O-])=O)C=C(F)C=C1F
BD3180
97%
MFCD03094186
2,4-DIFLUORO-N,N-DIMETHYLANILINE
CAS:78409-21-9
Formula: CN(C)C1=CC=C(F)C=C1F
BD66883
95+%
MFCD04116330
2,4-DIFLUORO-N-(2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDIN-3-YL)BENZENESULFONAMIDE
CAS:1083326-73-1
Formula: O=S(C1=CC=C(F)C=C1F)(NC2=CC(B3OC(C)(C)C(C)(C)O3)=CN=C2OC)=O
BD252539
95+%
MFCD12923393
2,4-DIFLUORO-N-(2-NITROPHENYL)ANILINE
CAS:500302-20-5
Formula: O=[N+](C1=CC=CC=C1NC2=CC=C(F)C=C2F)[O-]
BD334467
95+%
MFCD10567165
2,4-DIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:198967-25-8
Formula: CON(C)C(=O)C1=C(F)C=C(F)C=C1
BD66885
95+%
MFCD02684298
2,4-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-15-7
Formula: CNC1=CC=C(F)C=C1F.[H]Cl
BD255848
95+%
MFCD11110410
2,4-DIFLUORO-PHENYLTHIOACETIC ACID
CAS:773108-57-9
Formula: OC(CC1=CC=C(F)C=C1F)=S
BD324176
95+%
MFCD06208194
2,4-DIFLUOROBENZALDEHYDE OXIME
CAS:247092-11-1
Formula: FC1=CC=C(C(F)=C1)/C=N/O
BD66855
95+%
MFCD03265384
2,4-DIFLUOROBENZAMIDE
CAS:85118-02-1
Formula: O=C(N)C1=CC=C(F)C=C1F
BD10358
97%
MFCD00015547
2,4-DIFLUOROBENZAMIDOXIME
CAS:883022-90-0
Formula: N/C(C1=CC=C(F)C=C1F)=N\O
BD309438
95+%
MFCD05864461
2,4-DIFLUOROBENZENE-1,3-DIOL
CAS:195136-71-1
Formula: OC1=CC=C(F)C(O)=C1F
BD66903
97%
MFCD09836234
2,4-DIFLUOROBENZENESULFONAMIDE
CAS:13656-60-5
Formula: O=S(C1=CC=C(F)C=C1F)(N)=O
BD66858
97%
MFCD01320743
2,4-DIFLUOROBENZENETHIOL
CAS:1996-44-7
Formula: SC1=CC=C(F)C=C1F
BD32511
95+%
MFCD00203477
2,4-DIFLUOROBENZIMIDAMIDE
CAS:885957-21-1
Formula: N=C(N)C1=CC=C(F)C=C1F
BD259443
95+%
MFCD05662976
2,4-DIFLUOROBENZOHYDRAZIDE
CAS:118737-62-5
Formula: O=C(NN)C1=CC=C(F)C=C1F
BD4623
95+%
MFCD00173685
2,4-DIFLUOROBENZOIC ACID
CAS:1583-58-0
Formula: C1=CC(=CC(=C1C(O)=O)F)F
BD4216
98%
MFCD00011670
2,4-DIFLUOROBENZONITRILE
CAS:3939-09-1
Formula: FC1=CC(F)=C(C#N)C=C1
BD66862
98%
MFCD00009826
2,4-DIFLUOROBENZOTHIOAMIDE
CAS:175276-92-3
Formula: S=C(N)C1=CC=C(F)C=C1F
BD66904
95+%
MFCD00085011
2,4-DIFLUOROBENZOYL CHLORIDE
CAS:72482-64-5
Formula: O=C(Cl)C1=CC=C(F)C=C1F
BD34742
95+%
MFCD00000658
2,4-DIFLUOROBENZYLSULFONAMIDE
CAS:1001026-56-7
Formula: O=S(CC1=CC=C(F)C=C1F)(N)=O
BD322269
95+%
MFCD09800677
2,4-DIFLUORONICOTINALDEHYDE
CAS:1227564-60-4
Formula: O=CC1=C(F)N=CC=C1F
BD260322
95+%
MFCD16610838
2,4-DIFLUORONICOTINAMIDE
CAS:1823943-65-2
Formula: O=C(N)C1=C(F)N=CC=C1F
BD260325
95+%
2,4-DIFLUORONICOTINIC ACID
CAS:849937-90-2
Formula: O=C(O)C1=C(F)N=CC=C1F
BD261929
95+%
MFCD09031030
2,4-DIFLUORONICOTINONITRILE
CAS:1807275-54-2
Formula: N#CC1=C(F)N=CC=C1F
BD260326
95+%
2,4-DIFLUOROPHENOL
CAS:367-27-1
Formula: OC1=CC=C(F)C=C1F
BD33414
98%
MFCD00009715
2,4-DIFLUOROPHENYL 4-(CHLOROMETHYL)BENZOATE
CAS:219500-09-1
Formula: O=C(OC1=CC=C(F)C=C1F)C2=CC=C(CCl)C=C2
BD66889
97%
2,4-DIFLUOROPHENYL ACETATE
CAS:36914-77-9
Formula: FC1=CC=C(OC(C)=O)C(F)=C1
BD492008
97%
2,4-DIFLUOROPHENYLACETIC ACID
CAS:81228-09-3
Formula: O=C(O)CC1=CC=C(F)C=C1F
BD5919
95%
MFCD00009999
2,4-DIFLUOROPHENYLACETYL CHLORIDE
CAS:141060-00-6
Formula: O=C(Cl)CC1=CC=C(F)C=C1F
BD323214
95+%
MFCD08458139
2,4-DIFLUOROPHENYLBORONIC ACID
CAS:144025-03-6
Formula: C1=C(F)C=CC(=C1F)B(O)O
BD9873
97%
MFCD01318998
2,4-DIFLUOROPHENYLSULFONYLETHANOL
CAS:688763-15-7
Formula: OCCS(=O)(C1=CC=C(F)C=C1F)=O
BD324066
95+%
MFCD03789227
2,4-DIFLUOROPHENYLTHIOETHANOL
CAS:688762-79-0
Formula: OCCSC1=CC=C(F)C=C1F
BD324061
95+%
MFCD03789207
2,4-DIFLUOROPYRIDIN-3(4H)-IMINE
CAS:1211528-95-8
Formula: N=C1C(F)=NC=CC1F
BD586228
97%
2,4-DIHYDRO-5-(4-FLUOROPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:575455-54-8
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(F)C=C3)C1
BD163305
95+%
MFCD09749464
2,4-DIHYDRO-5-(4-METHOXYPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:454439-84-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(OC)C=C3)C1
BD163281
95+%
MFCD07809087
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE
CAS:74618-03-4
Formula: C12=NNC=C1COC3=C2C=CC=C3
BD200276
95+%
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID
CAS:909091-78-7
Formula: O=C(C1=C(COC2=C3C=CC=C2)C3=NN1)O
BD316082
95+%
MFCD27982009
2,4-DIHYDROXY-3,3-DIMETHYLBUTANAMIDE
CAS:4417-86-1
Formula: O=C(N)C(O)C(C)(C)CO
BD66916
95+%
2,4-DIHYDROXY-3,6-DIMETHYLBENZOIC ACID
CAS:4707-46-4
Formula: CC1=CC(O)=C(C)C(O)=C1C(O)=O
BD66917
95+%
MFCD00239340
2,4-DIHYDROXY-3-(MORPHOLINOMETHYL)BENZALDEHYDE
CAS:917514-52-4
Formula: O=CC1=CC=C(O)C(CN2CCOCC2)=C1O
BD604987
97%
MFCD19103280
2,4-DIHYDROXY-3-ISOPROPYLBENZALDEHYDE
CAS:1629140-42-6
Formula: O=CC1=CC=C(O)C(C(C)C)=C1O
BD440318
97%
MFCD26406914
2,4-DIHYDROXY-3-METHOXYBENZALDEHYDE
CAS:58922-29-5
Formula: O=CC1=CC=C(O)C(OC)=C1O
BD626366
97%
MFCD19301266
2,4-DIHYDROXY-3-METHYLBENZALDEHYDE
CAS:6248-20-0
Formula: C1=CC(=C(C(=C1C=O)O)C)O
BD21858
98%
MFCD00156883
2,4-DIHYDROXY-3-METHYLBENZOHYDRAZIDE
CAS:1142211-15-1
Formula: O=C(NN)C1=CC=C(O)C(C)=C1O
BD177224
95+%
2,4-DIHYDROXY-3-NITROPYRIDINE
CAS:89282-12-2
Formula: OC1=NC=CC(=C1[N+](=O)[O-])O
BD66923
98%
MFCD01075671
2,4-DIHYDROXY-5,6,7,8-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:5439-88-3
Formula: O=C(C1CC2=C(O)N=C(O)N=C2CC1)O
BD335741
95+%
MFCD23378423
2,4-DIHYDROXY-5,6-DIMETHYLPYRIMIDINE
CAS:26305-13-5
Formula: CC1=C(NC(=O)NC1=O)C
BD101766
97%
MFCD00010708
2,4-DIHYDROXY-5-IODOBENZALDEHYDE
CAS:131088-03-4
Formula: O=CC1=CC(I)=C(O)C=C1O
BD265339
95+%
2,4-DIHYDROXY-5-ISOPROPYLBENZODITHIOIC ACID
CAS:1046490-81-6
Formula: SC(C1=CC(C(C)C)=C(O)C=C1O)=S
BD450110
97%
MFCD27976457
2,4-DIHYDROXY-5-ISOPROPYLBENZOIC ACID
CAS:1184181-48-3
Formula: O=C(O)C1=CC(C(C)C)=C(O)C=C1O
BD304287
97%
MFCD16996083
2,4-DIHYDROXY-5-METHOXYBENZALDEHYDE
CAS:51061-83-7
Formula: O=CC1=CC(OC)=C(O)C=C1O
BD267132
95+%
2,4-DIHYDROXY-5-METHOXYPYRIMIDINE
CAS:6623-81-0
Formula: COC1=CNC(=O)NC1=O
BD2750
96%
MFCD00187903
2,4-DIHYDROXY-5-METHYLBENZALDEHYDE
CAS:39828-37-0
Formula: O=CC1=CC(C)=C(O)C=C1O
BD691876
95%
2,4-DIHYDROXY-5-NITROBENZALDEHYDE
CAS:53844-98-7
Formula: O=CC1=CC([N+]([O-])=O)=C(O)C=C1O
BD66931
97%
2,4-DIHYDROXY-5-NITROBENZOIC ACID
CAS:13722-96-8
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(O)C=C1O
BD233869
95+%
MFCD08693128
2,4-DIHYDROXY-6-METHOXYQUINOLINE
CAS:14300-45-9
Formula: OC2=NC1=CC=C(C=C1C(=C2)O)OC
BD31915
97%
MFCD01463812
2,4-DIHYDROXY-6-METHYLBENZALDEHYDE
CAS:487-69-4
Formula: O=CC1=C(C)C=C(O)C=C1O
BD227235
98%
2,4-DIHYDROXY-6-METHYLNICOTINAMIDE
CAS:68373-65-9
Formula: O=C(N)C1=C(O)N=C(C)C=C1O
BD248716
95+%
2,4-DIHYDROXY-6-METHYLNICOTINIC ACID
CAS:846557-80-0
Formula: O=C(O)C1=C(O)N=C(C)C=C1O
BD66938
95+%
MFCD06657553
2,4-DIHYDROXY-6-METHYLNICOTINONITRILE
CAS:67643-17-8
Formula: N#CC1=C(O)N=C(C)C=C1O
BD335015
95+%
MFCD11847535
2,4-DIHYDROXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:51622-67-4
Formula: O=C(C1=C(C)N=C(O)N=C1O)O
BD284687
95+%
MFCD18449364
2,4-DIHYDROXY-6-TRIFLUOROMETHYLPYRIMIDINE
CAS:672-45-7
Formula: O=C1NC(=CC(=O)N1)C(F)(F)F
BD2556
95+%
MFCD01011762
2,4-DIHYDROXY-7-METHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:N/A
Formula: O=C(O)C1C(O)=NC2C(=CC=C(C=2)C)C=1O
BD00761366
95%
2,4-DIHYDROXY-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:24207-41-8
Formula: O=C(NCCO)C1=CC=C(O)C=C1O
BD6856
95+%
MFCD00002835
2,4-DIHYDROXYACETOPHENONE
CAS:89-84-9
Formula: CC(C1=CC=C(O)C=C1O)=O
BD40444
98%
MFCD00002279
2,4-DIHYDROXYBENZALDEHYDE
CAS:95-01-2
Formula: O=CC1=CC=C(O)C=C1O
BD35500
98%
MFCD00011686
2,4-DIHYDROXYBENZALDEHYDE OXIME
CAS:5399-68-8
Formula: OC1=CC=C(C(O)=C1)/C=N/O
BD66945
97%
MFCD00016410
2,4-DIHYDROXYBENZAMIDE
CAS:3147-45-3
Formula: NC(=O)C1=C(O)C=C(O)C=C1
BD7921
97%
MFCD00064913
2,4-DIHYDROXYBENZOHYDRAZIDE
CAS:13221-86-8
Formula: O=C(NN)C1=CC=C(O)C=C1O
BD66948
95+%
MFCD00017053
2,4-DIHYDROXYBENZOIC ACID
CAS:89-86-1
Formula: O=C(O)C1=CC=C(O)C=C1O
BD23045
98%
MFCD00002451
2,4-DIHYDROXYBENZONITRILE
CAS:64419-24-5
Formula: N#CC1=CC=C(O)C=C1O
BD10392
98%
2,4-DIHYDROXYBUTANOIC ACID
CAS:1518-62-3
Formula: O=C(O)C(O)CCO
BD224160
95+%
2,4-DIHYDROXYISOPHTHALALDEHYDE
CAS:3328-71-0
Formula: O=CC1=CC=C(O)C(C=O)=C1O
BD66947
95+%
MFCD09032324
2,4-DIHYDROXYQUINAZOLINE-5-CARBONITRILE
CAS:1823958-91-3
Formula: N#CC1=CC=CC2=NC(O)=NC(O)=C12
BD260168
95+%
2,4-DIHYDROXYQUINAZOLINE-6-CARBONITRILE
CAS:1334331-27-9
Formula: N#CC1=CC2=C(O)N=C(O)N=C2C=C1
BD260506
95+%
2,4-DIHYDROXYQUINAZOLINE-7-CARBOXYLIC ACID
CAS:864293-00-5
Formula: O=C(C1=CC2=NC(O)=NC(O)=C2C=C1)O
BD167394
95+%
MFCD11868316
2,4-DIHYDROXYQUINOLINE-3-CARBALDEHYDE
CAS:529-89-5
Formula: O=CC1=C(O)C2=CC=CC=C2N=C1O
BD66918
97%
2,4-DIIODO-1-METHYL-1H-IMIDAZOLE
CAS:71794-53-1
Formula: CN1C=C(I)N=C1I
BD269512
95+%
2,4-DIIODO-1H-IMIDAZOLE
CAS:19198-80-2
Formula: IC1=CNC(I)=N1
BD66965
95+%
MFCD09800593
2,4-DIIODO-3-METHYLANILINE
CAS:860751-94-6
Formula: NC1=CC=C(I)C(C)=C1I
BD281774
95+%
2,4-DIIODO-5-METHOXYANILINE
CAS:117832-18-5
Formula: NC1=CC(OC)=C(I)C=C1I
BD296236
95+%
MFCD13186706
2,4-DIIODO-5-METHYLANILINE
CAS:117832-10-7
Formula: NC1=CC(C)=C(I)C=C1I
BD281773
95+%
2,4-DIIODO-6-METHYLANILINE
CAS:117832-09-4
Formula: NC1=C(C)C=C(I)C=C1I
BD66966
95+%
MFCD09033135
2,4-DIIODO-6-METHYLNICOTINONITRILE
CAS:1823894-28-5
Formula: N#CC1=C(I)N=C(C)C=C1I
BD279637
95+%
2,4-DIIODOANILINE
CAS:533-70-0
Formula: NC1=CC=C(I)C=C1I
BD33985
95+%
MFCD01851096
2,4-DIIODONICOTINONITRILE
CAS:827616-54-6
Formula: N#CC1=C(I)N=CC=C1I
BD66969
95+%
MFCD09037454
2,4-DIIODOOXAZOLE
CAS:1037597-73-1
Formula: IC1=COC(I)=N1
BD225793
97%
MFCD18785731
2,4-DIIODOPYRIDIN-3-OL
CAS:750638-97-2
Formula: OC1=C(I)C=CN=C1I
BD248539
95+%
2,4-DIIODOPYRIDINE
CAS:83674-71-9
Formula: IC1=CC(I)=NC=C1
BD66968
95+%
2,4-DIIODOPYRIMIDINE
CAS:262353-34-4
Formula: IC1=NC=CC(=N1)I
BD159560
95+%
MFCD09743716
2,4-DIISOPROPYLBENZENE-1,3-DIAMINE
CAS:133681-71-7
Formula: NC1=CC=C(C(C)C)C(N)=C1C(C)C
BD233318
95+%
MFCD20701825
2,4-DIISOPROPYLDIBENZO[B,D]FURAN-3-AMINE
CAS:1332881-95-4
Formula: NC1=C(C(C)C)C=C2C(OC3=CC=CC=C23)=C1C(C)C
BD262615
95+%
2,4-DIISOPROPYLPHENOL
CAS:2934-05-6
Formula: OC1=CC=C(C(C)C)C=C1C(C)C
BD66971
95+%
MFCD01707536
2,4-DIMETHOXY-1,3,5-TRIAZINE
CAS:1898-72-2
Formula: COC1=NC=NC(OC)=N1
BD582437
97%
MFCD20257908
2,4-DIMETHOXY-1-(2-NITROVINYL)BENZENE
CAS:1891-10-7
Formula: O=[N+](/C=C/C1=CC=C(OC)C=C1OC)[O-]
BD0115
95+%
MFCD00015922
2,4-DIMETHOXY-1-FLUOROBENZENE
CAS:17715-70-7
Formula: FC1=CC=C(OC)C=C1OC
BD66973
97%
MFCD00042265
2,4-DIMETHOXY-1-METHYLBENZENE
CAS:38064-90-3
Formula: CC1=CC=C(OC)C=C1OC
BD67024
97%
2,4-DIMETHOXY-1-NAPHTHALDEHYDE
CAS:75965-84-3
Formula: O=CC1=C2C=CC=CC2=C(OC)C=C1OC
BD571483
97%
2,4-DIMETHOXY-1-NITROBENZENE
CAS:4920-84-7
Formula: COC1=CC(OC)=C(C=C1)[N+]([O-])=O
BD66974
95%
MFCD00024210
2,4-DIMETHOXY-3-METHYL-5-NITROANILINE
CAS:704877-30-5
Formula: NC1=CC([N+]([O-])=O)=C(OC)C(C)=C1OC
BD177225
97%
MFCD05858391
2,4-DIMETHOXY-3-METHYLBENZALDEHYDE
CAS:7149-92-0
Formula: O=CC1=CC=C(OC)C(C)=C1OC
BD12038
97%
2,4-DIMETHOXY-3-NITROPYRIDINE
CAS:18677-44-6
Formula: O=[N+](C1=C(OC)C=CN=C1OC)[O-]
BD483830
97%
MFCD00971984
2,4-DIMETHOXY-3-OXO-N-PHENYLBUTANAMIDE
CAS:16715-79-0
Formula: O=C(NC1=CC=CC=C1)C(OC)C(COC)=O
BD66989
97%
2,4-DIMETHOXY-5,6-DIMETHYLPYRIMIDINE
CAS:120129-83-1
Formula: COC1=NC(OC)=C(C)C(C)=N1
BD232674
95+%
2,4-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIMIDINE
CAS:936250-17-8
Formula: CC1(C)C(C)(C)OB(C2=CN=C(OC)N=C2OC)O1
BD66982
95+%
MFCD06795654
2,4-DIMETHOXY-5-METHYLPYRIMIDINE
CAS:5151-34-8
Formula: CC1=CN=C(OC)N=C1OC
BD60588
95+%
MFCD03424272
2,4-DIMETHOXY-5-NITROBENZOIC ACID
CAS:90564-41-3
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(OC)C=C1OC
BD262474
95+%
MFCD12173036
2,4-DIMETHOXY-5-NITROPYRIDINE
CAS:607373-84-2
Formula: O=[N+](C1=CN=C(OC)C=C1OC)[O-]
BD220993
95+%
MFCD09907962
2,4-DIMETHOXY-5-NITROPYRIMIDINE
CAS:30561-07-0
Formula: O=[N+](C1=CN=C(OC)N=C1OC)[O-]
BD517154
97%
MFCD00726922
2,4-DIMETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:84538-40-9
Formula: COC1=NC2=C(NC=C2)C(OC)=N1
BD218317
98%
MFCD12406107
2,4-DIMETHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:1265360-45-9
Formula: O=CC1=C(B2OC(C)(C)C(C)(C)O2)C=C(OC)C=C1OC
BD239700
95+%
MFCD22192538
2,4-DIMETHOXY-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:38539-75-2
Formula: COC1=NC(OC)=NC(N2CCNCC2)=C1
BD625108
97%
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1227588-22-8
Formula: FC(C1=CC(OC)=CC(OC)=N1)(F)F
BD480186
97%
MFCD16610905
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:76513-87-6
Formula: FC(C1=CC(OC)=NC(OC)=N1)(F)F
BD260009
95+%
2,4-DIMETHOXY-6-METHYL-5-NITROPYRIMIDINE
CAS:30561-09-2
Formula: O=[N+]([O-])C1C(OC)=NC(OC)=NC=1C
BD00702549
95+%
n/a
2,4-DIMETHOXY-6-METHYLBENZALDEHYDE
CAS:7149-90-8
Formula: O=CC1=C(C)C=C(OC)C=C1OC
BD12039
97%
2,4-DIMETHOXY-6-METHYLNICOTINONITRILE
CAS:1450662-05-1
Formula: N#CC1=C(OC)N=C(C)C=C1OC
BD442995
97%
MFCD28359302
2,4-DIMETHOXY-6-METHYLPYRIDINE
CAS:40334-96-1
Formula: CC1=CC(OC)=CC(OC)=N1
BD452938
97%
MFCD16610898
2,4-DIMETHOXY-6-METHYLPYRIMIDIN-5-AMINE
CAS:84538-45-4
Formula: NC1C(OC)=NC(OC)=NC=1C
BD00773233
95+%
n/a
2,4-DIMETHOXY-6-METHYLPYRIMIDINE
CAS:7781-23-9
Formula: CC1=CC(OC)=NC(OC)=N1
BD247735
95+%
MFCD00458122
2,4-DIMETHOXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:106852-32-8
Formula: O=C(C1=C(C)N=C(OC)N=C1OC)O
BD284689
95+%
MFCD20644919
2,4-DIMETHOXY-7-METHYLQUINOLINE
CAS:406205-07-0
Formula: CC1C=C2C(C(=CC(=N2)OC)OC)=CC=1
BD00746635
95+%
n/a
2,4-DIMETHOXY-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90057-09-3
Formula: COC1=C2C(NC=C2)=NC(OC)=N1
BD218318
95+%
2,4-DIMETHOXYANILINE
CAS:2735-04-8
Formula: NC1=CC=C(OC)C=C1OC
BD66991
97%
MFCD00008371
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
Formula: O=CC1=CC=C(OC)C=C1OC
BD21781
98%
MFCD00003311
2,4-DIMETHOXYBENZALDEHYDE OXIME
CAS:31874-34-7
Formula: O/N=C/C1=CC=C(OC)C=C1OC
BD66993
95+%
MFCD00082783
2,4-DIMETHOXYBENZENESULFONAMIDE
CAS:51770-71-9
Formula: O=S(C1=CC=C(OC)C=C1OC)(N)=O
BD66996
95+%
MFCD06147001
2,4-DIMETHOXYBENZENESULFONOHYDRAZIDE
CAS:73737-06-1
Formula: O=S(C1=CC=C(OC)C=C1OC)(NN)=O
BD177226
97%
MFCD03423367
2,4-DIMETHOXYBENZIMIDAMIDE
CAS:32048-19-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC
BD66994
95+%
MFCD05663022
2,4-DIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:131947-81-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC.[H]Cl
BD66995
95+%
2,4-DIMETHOXYBENZO[D]THIAZOLE
CAS:858635-78-6
Formula: COC1=C2N=C(OC)SC2=CC=C1
BD471892
97%
MFCD18416414
2,4-DIMETHOXYBENZOHYDRAZIDE
CAS:103956-10-1
Formula: O=C(NN)C1=CC=C(OC)C=C1OC
BD275167
95+%
2,4-DIMETHOXYBENZOIC ACID
CAS:91-52-1
Formula: C1=C(OC)C=CC(=C1OC)C(O)=O
BD6714
97%
MFCD00002434
2,4-DIMETHOXYBENZONITRILE
CAS:4107-65-7
Formula: COC1=CC(OC)=C(C=C1)C#N
BD7784
98%
MFCD00001786
2,4-DIMETHOXYBENZOTHIOAMIDE
CAS:23822-07-3
Formula: S=C(N)C1=CC=C(OC)C=C1OC
BD11295
95+%
MFCD04973328
2,4-DIMETHOXYBENZOYL CHLORIDE
CAS:39828-35-8
Formula: O=C(Cl)C1=CC=C(OC)C=C1OC
BD33549
95+%
MFCD00017527
2,4-DIMETHOXYPHENETHYL ACETATE
CAS:13372-46-8
Formula: CC(OCCC1=CC=C(OC)C=C1OC)=O
BD590588
97%
2,4-DIMETHOXYPHENETHYL ETHYL OXALATE
CAS:1443353-34-1
Formula: O=C(OCCC1=CC=C(OC)C=C1OC)C(OCC)=O
BD510405
97%
MFCD15145521
2,4-DIMETHOXYPHENOL
CAS:13330-65-9
Formula: COC1=C(C=CC(=C1)OC)O
BD67011
97%
MFCD00060637
2,4-DIMETHOXYPHENYLBORONIC ACID
CAS:133730-34-4
Formula: OB(C1=CC=C(OC)C=C1OC)O
BD5277
98%
MFCD01074590
2,4-DIMETHOXYPYRIDIN-3-AMINE
CAS:217096-31-6
Formula: NC1=C(OC)C=CN=C1OC
BD330900
95+%
MFCD18255875
2,4-DIMETHOXYPYRIDINE
CAS:18677-43-5
Formula: COC1=CC(OC)=NC=C1
BD27883
98%
MFCD01646187
2,4-DIMETHOXYPYRIMIDIN-5-AMINE
CAS:14048-15-8
Formula: NC1=CN=C(OC)N=C1OC
BD262574
95+%
MFCD12546337
2,4-DIMETHOXYPYRIMIDINE
CAS:3551-55-1
Formula: C1=NC(=NC(=C1)OC)OC
BD3698
97%
MFCD00056028
2,4-DIMETHOXYPYRIMIDINE-5-BORONIC ACID
CAS:89641-18-9
Formula: COC1=NC(OC)=C(C=N1)B(O)O
BD3728
97%
MFCD01318985
2,4-DIMETHOXYPYRIMIDINE-5-CARBALDEHYDE
CAS:52606-02-7
Formula: O=CC1=CN=C(OC)N=C1OC
BD104119
97%
MFCD00132992
2,4-DIMETHOXYPYRIMIDINE-5-CARBONITRILE
CAS:14445-57-9
Formula: N#CC1=CN=C(OC)N=C1OC
BD326643
95+%
MFCD24448829
2,4-DIMETHOXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:110821-07-3
Formula: O=C(C1=CN=C(OC)N=C1OC)O
BD211290
95+%
MFCD03232921
2,4-DIMETHOXYQUINAZOLINE-6-CARBONITRILE
CAS:1823776-39-1
Formula: N#CC1=CC2=C(OC)N=C(OC)N=C2C=C1
BD272304
95+%
2,4-DIMETHOXYQUINOLINE
CAS:40335-00-0
Formula: COC1=CC(OC)=NC2=CC=CC=C12
BD328548
95+%
MFCD27950422
2,4-DIMETHYL 3-AMINO-1H-PYRROLE-2,4-DICARBOXYLATE
CAS:180059-04-5
Formula: O=C(C1=C(N)C(C(OC)=O)=CN1)OC
BD315403
95+%
MFCD10566520
2,4-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-33-6
Formula: CC1=CC=C(CC2OCCO2)C(C)=C1
BD310655
95+%
MFCD04117664
2,4-DIMETHYL-[1,1'-BIPHENYL]-3-AMINE
CAS:83011-75-0
Formula: NC1=C(C)C(C2=CC=CC=C2)=CC=C1C
BD318424
95+%
n/a
2,4-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:20666-00-6
Formula: CC1CN(C)CC2=C1C=CC=C2
BD764268
97%
2,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE
CAS:19343-79-4
Formula: CC1CC(C)NC2=C1C=CC=C2
BD270444
95+%
2,4-DIMETHYL-1-((3-NITROBENZYL)OXY)BENZENE
CAS:712344-65-5
Formula: O=[N+](C1=CC(COC2=CC=C(C)C=C2C)=CC=C1)[O-]
BD597191
97%
MFCD04969866
2,4-DIMETHYL-1-(METHYLSULFONYL)BENZENE
CAS:6462-28-8
Formula: O=S(C1=CC=C(C)C=C1C)(C)=O
BD215983
95+%
MFCD03789175
2,4-DIMETHYL-1-(TRIMETHOXYMETHYL)BENZENE
CAS:133473-80-0
Formula: COC(C1=CC=C(C)C=C1C)(OC)OC
BD269390
95+%
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE
CAS:27802-66-0
Formula: NC1=C(C)N=C(C)N1
BD587549
97%
MFCD18800973
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE HYDROCHLORIDE
CAS:50774-58-8
Formula: NC1=C(C)N=C(C)N1.[H]Cl
BD587751
97%
2,4-DIMETHYL-1H-IMIDAZOLE-5-CARBALDEHYDE
CAS:68282-52-0
Formula: CC1=NC(C)=C(N1)C=O
BD237074
95+%
MFCD19300742
2,4-DIMETHYL-1H-INDOLE
CAS:10299-61-3
Formula: CC1=CC=CC2=C1C=C(C)N2
BD263176
95+%
MFCD09701270
2,4-DIMETHYL-1H-PYRROLE
CAS:625-82-1
Formula: CC1=CNC(C)=C1
BD41881
97%
MFCD00192088
2,4-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:26187-28-0
Formula: N#CC1=C(C)NC=C1C
BD218796
95+%
2,4-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190313-73-5
Formula: CC1=CC=NC2=C1C=C(C)N2
BD333254
95+%
MFCD03425552
2,4-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190313-94-0
Formula: CC1=NC=CC2=C1C=C(C)N2
BD561449
97%
2,4-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-50-2
Formula: O=C(C1=CC=CC=C1OC)C2=CC=C(C)C=C2C
BD309061
95+%
MFCD01311510
2,4-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-47-5
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(C)C=C3C
BD309949
95+%
MFCD03842424
2,4-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-24-5
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(C)C=C3C
BD311878
95+%
MFCD03842481
2,4-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-59-9
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(C)C=C3C
BD311962
95+%
MFCD03842538
2,4-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-84-5
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(C)C=C3C
BD312649
95+%
MFCD03842765
2,4-DIMETHYL-2,3-DIHYDROTHIENO[3,2-C]QUINOLINE-8-CARBOXYLIC ACID
CAS:364338-44-3
Formula: O=C(C1=CC=C2N=C(C)C(CC(C)S3)=C3C2=C1)O
BD554253
97%
MFCD01143285
2,4-DIMETHYL-2,5-DIHYDROTHIOPHENE 1,1-DIOXIDE
CAS:10033-92-8
Formula: O=S1(C(C)C=C(C)C1)=O
BD427336
95+%
MFCD00656685
2,4-DIMETHYL-2H-1,2,3-TRIAZOLE
CAS:60166-44-1
Formula: CC1=NN(C)N=C1
BD256567
95+%
2,4-DIMETHYL-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE
CAS:13338-03-9
Formula: O=C(N(C)C1=CC=CC=C12)N(C)S2(=O)=O
BD331762
95+%
MFCD09878050
2,4-DIMETHYL-2H-PYRAZOLO[3,4-B]PYRIDIN-6(7H)-ONE
CAS:73810-75-0
Formula: O=C1C=C(C)C2=CN(C)N=C2N1
BD516419
97%
MFCD09834156
2,4-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-33-4
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(C)C=C3C
BD312408
95+%
MFCD07699967
2,4-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-70-6
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC=C(C)C=C2C
BD309079
95+%
MFCD01311542
2,4-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-56-5
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(C)C=C3C
BD311189
95+%
MFCD03841915
2,4-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-11-8
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(C)C=C3C
BD313695
95+%
MFCD03841972
2,4-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-37-1
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(C)C=C3C
BD311649
95+%
MFCD03842029
2,4-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-13-8
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(C)C=C3C
BD310947
95+%
MFCD03842254
2,4-DIMETHYL-3-(1H-TETRAZOL-1-YL)BENZENESULFONAMIDE
CAS:704875-75-2
Formula: O=S(C1=CC=C(C)C(N2N=NN=C2)=C1C)(N)=O
BD507457
97%
MFCD05857993
2,4-DIMETHYL-3-(2-OXOPYRROLIDIN-1-YL)BENZENE-1-SULFONYL CHLORIDE
CAS:331256-61-2
Formula: O=S(C1=CC=C(C)C(N2C(CCC2)=O)=C1C)(Cl)=O
BD318123
95+%
2,4-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1421252-89-2
Formula: CC1(C)C(C)(C)OB(C2=C(C)C=CN=C2C)O1
BD290349
95+%
n/a
2,4-DIMETHYL-3-NITROBENZOIC ACID
CAS:39053-47-9
Formula: O=C(O)C1=CC=C(C)C([N+]([O-])=O)=C1C
BD449860
97%
MFCD08693503
2,4-DIMETHYL-3-NITROBENZONITRILE
CAS:39053-46-8
Formula: N#CC1=CC=C(C)C([N+]([O-])=O)=C1C
BD449861
97%
MFCD08693500
2,4-DIMETHYL-3-NITROPYRIDINE
CAS:1074-76-6
Formula: CC1=NC=CC(C)=C1[N+]([O-])=O
BD67061
95+%
MFCD08235269
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-6-CARBOXYLIC ACID
CAS:1092352-74-3
Formula: O=C(C1=CC=C(C(N2C)=C1)OC(C)C2=O)O
BD201747
95+%
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-CARBOXYLIC ACID
CAS:1092352-50-5
Formula: O=C(C1=CC=C(N2C)C(OC(C)C2=O)=C1)O
BD201630
95+%
2,4-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-19-5
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(C)C=C3C
BD310738
95+%
MFCD07700018
2,4-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:57800-66-5
Formula: O=C(C1=CC=C(OC)C=C1)C2=CC=C(C)C=C2C
BD308395
95+%
MFCD01311572
2,4-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-05-3
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(C)C=C3C
BD311617
95+%
MFCD03841403
2,4-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898771-49-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(C)C=C3C
BD311760
95+%
MFCD03841460
2,4-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-44-8
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(C)C=C3C
BD312140
95+%
MFCD03841517
2,4-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-73-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(C)C=C3C
BD312718
95+%
MFCD03841744
2,4-DIMETHYL-4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDINE
CAS:1017174-32-1
Formula: CC1C(SC(C)=N2)=C2CCN1
BD605426
97%
2,4-DIMETHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:88268-23-9
Formula: CC1=C2CCCCC2=NC(C)=N1
BD748670
97%
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1622217-32-6
Formula: CC1(C)C(C)(C)OB(C2=CN=C(C)C=C2C)O1
BD625947
97%
MFCD18719934
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIAZOLE
CAS:859833-13-9
Formula: CC1(C)C(C)(C)OB(C2=C(C)N=C(C)S2)O1
BD165401
97%
MFCD07783649
2,4-DIMETHYL-5-(METHYLSULFONYL)ANILINE
CAS:849035-63-8
Formula: NC1=CC(S(=O)(C)=O)=C(C)C=C1C
BD11381
95+%
MFCD04037922
2,4-DIMETHYL-5-NITROANILINE
CAS:2124-47-2
Formula: NC1=CC([N+]([O-])=O)=C(C)C=C1C
BD67072
97%
MFCD00025199
2,4-DIMETHYL-5-NITROBENZOIC ACID
CAS:220504-75-6
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(C)C=C1C
BD215982
98%
MFCD01463419
2,4-DIMETHYL-5-NITROBENZONITRILE
CAS:625112-44-9
Formula: N#CC1=CC([N+]([O-])=O)=C(C)C=C1C
BD455172
97%
MFCD16875749
2,4-DIMETHYL-5-NITROBENZOTRIFLUORIDE
CAS:261945-82-8
Formula: CC1=CC(C)=C(C=C1[N+]([O-])=O)C(F)(F)F
BD67073
95+%
MFCD01631630
2,4-DIMETHYL-5-NITROPHENOL
CAS:14969-00-7
Formula: OC1=CC([N+]([O-])=O)=C(C)C=C1C
BD330087
95+%
MFCD00667776
2,4-DIMETHYL-5-NITROPYRIDINE
CAS:1074-99-3
Formula: O=[N+](C1=CN=C(C)C=C1C)[O-]
BD92882
97%
2,4-DIMETHYL-5-VINYLTHIAZOLE
CAS:65505-18-2
Formula: C=CC1=C(C)N=C(C)S1
BD246245
95+%
MFCD00792504
2,4-DIMETHYL-6,7,8,9-TETRAHYDRO-5H-CYCLOHEPTA[D]PYRIMIDINE
CAS:138722-72-2
Formula: CC1=C(CCCCC2)C2=NC(C)=N1
BD748672
97%
2,4-DIMETHYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:88268-24-0
Formula: CC1=C(CCC2)C2=NC(C)=N1
BD551167
97%
2,4-DIMETHYL-6-((2-METHYLALLYL)OXY)BENZALDEHYDE
CAS:1708169-96-3
Formula: O=CC1=C(OCC(C)=C)C=C(C)C=C1C
BD621936
97%
2,4-DIMETHYL-6-((3-METHYLCYCLOBUTYL)METHOXY)BENZALDEHYDE
CAS:1707393-26-7
Formula: O=CC1=C(OCC2CC(C)C2)C=C(C)C=C1C
BD620626
97%
2,4-DIMETHYL-6-((TETRAHYDROFURAN-2-YL)METHOXY)BENZALDEHYDE
CAS:1710853-45-4
Formula: O=CC1=C(OCC2OCCC2)C=C(C)C=C1C
BD623090
97%
2,4-DIMETHYL-6-(1H-PYRAZOL-3-YL)PHENOL
CAS:288401-54-7
Formula: OC1=C(C)C=C(C)C=C1C2=NNC=C2
BD0530
97%
2,4-DIMETHYL-6-(2-MORPHOLINOETHOXY)BENZALDEHYDE
CAS:1215903-35-7
Formula: O=CC1=C(OCCN2CCOCC2)C=C(C)C=C1C
BD607622
97%
2,4-DIMETHYL-6-(2-PIPERIDINYLMETHYL)PYRIDINE
CAS:526183-28-8
Formula: CC1=CC(C)=NC(CC2NCCCC2)=C1
BD327409
95+%
MFCD05190116
2,4-DIMETHYL-6-(2-PYRROLIDINYLMETHYL)PYRIDINE
CAS:524674-46-2
Formula: CC1=CC(C)=NC(CC2NCCC2)=C1
BD327406
95+%
MFCD05189306
2,4-DIMETHYL-6-(3-METHYL-1H-PYRAZOL-5-YL)ANILINE
CAS:1030618-76-8
Formula: NC1=C(C2=CC(C)=NN2)C=C(C)C=C1C
BD588357
97%
MFCD07186463
2,4-DIMETHYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:887686-65-9
Formula: CC1=NC(C)=NC(N2CCNCC2)=C1
BD506561
97%
MFCD07365286
2,4-DIMETHYL-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:749256-94-8
Formula: FC(C1=CC(C)=CC(C)=N1)(F)F
BD765567
97%
2,4-DIMETHYL-6-NITROANILINE
CAS:1635-84-3
Formula: NC1=C([N+]([O-])=O)C=C(C)C=C1C
BD5187
97%
MFCD00007739
2,4-DIMETHYL-6-NITROPHENOL
CAS:14452-34-7
Formula: OC1=C([N+]([O-])=O)C=C(C)C=C1C
BD6532
98%
MFCD00191633
2,4-DIMETHYL-6-PHENYLPYRIMIDINE
CAS:64571-30-8
Formula: CC1=NC(C)=NC(C2=CC=CC=C2)=C1
BD541869
97%
2,4-DIMETHYL-6-PROPOXYBENZALDEHYDE
CAS:1710301-86-2
Formula: O=CC1=C(OCCC)C=C(C)C=C1C
BD622748
97%
2,4-DIMETHYL-6-PROPOXYBENZONITRILE
CAS:1708037-50-6
Formula: N#CC1=C(OCCC)C=C(C)C=C1C
BD621765
97%
2,4-DIMETHYL-7,8,9,10-TETRAHYDROPYRIDO[4',3':3,4]PYRAZOLO[1,5-A]PYRIMIDINE
CAS:1706464-23-4
Formula: CC1=CC(C)=NC2=C3CNCCC3=NN12
BD620116
97%
2,4-DIMETHYL-8-HYDROXYQUINOLINE
CAS:115310-98-0
Formula: CC1=NC2=C(C=CC=C2O)C(C)=C1
BD41197
97%
MFCD09743812
2,4-DIMETHYL-8-NITROQUINOLIN-7-OL
CAS:1378259-98-3
Formula: OC1=CC=C2C(C)=CC(C)=NC2=C1[N+]([O-])=O
BD614806
97%
2,4-DIMETHYL-N,N-DIPHENYLANILINE
CAS:1228-80-4
Formula: CC1=CC(C)=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1
BD67146
95+%
MFCD09030600
2,4-DIMETHYL-N-(2-PHENOXYETHYL)ANILINE
CAS:327070-55-3
Formula: CC1=CC=C(NCCOC2=CC=CC=C2)C(C)=C1
BD594300
97%
MFCD02578880
2,4-DIMETHYL-N-(3-METHYLTHIAZOL-2(3H)-YLIDENE)ANILINE
CAS:61676-87-7
Formula: CN1/C(SC=C1)=N/C2=CC=C(C)C=C2C
BD21804
95+%
MFCD01311800
2,4-DIMETHYL-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177348-08-1
Formula: CC1=CC=C(NCC2NCCC2)C(C)=C1.[H]Cl
BD562605
97%
2,4-DIMETHYL-N-PHENYL-N-(P-TOLYL)ANILINE
CAS:1071935-18-6
Formula: CC1=CC=C(N(C2=CC=CC=C2)C3=CC=C(C)C=C3C)C=C1
BD247630
95+%
MFCD17015627
2,4-DIMETHYL-N-PHENYLANILINE
CAS:25078-04-0
Formula: CC1=CC=C(C(C)=C1)NC2=CC=CC=C2
BD67108
98%
MFCD08275461
2,4-DIMETHYL-PYRIMIDINE-5-CARBOXYLIC ACID
CAS:74356-36-8
Formula: CC1=NC(C)=C(C=N1)C(O)=O
BD34803
98%
MFCD07391755
2,4-DIMETHYLANILINE HYDROCHLORIDE
CAS:21436-96-4
Formula: NC1=CC=C(C)C=C1C.[H]Cl
BD5291
95+%
MFCD00060209
2,4-DIMETHYLBENZALDEHYDE
CAS:15764-16-6
Formula: O=CC1=CC=C(C)C=C1C
BD67092
95+%
MFCD00003340
2,4-DIMETHYLBENZAMIDE
CAS:73258-94-3
Formula: O=C(N)C1=CC=C(C)C=C1C
BD324135
95+%
MFCD11643208
2,4-DIMETHYLBENZENE-1,3-DIAMINE
CAS:13438-26-1
Formula: CC1=C(N)C(C)=C(N)C=C1
BD233319
95+%
MFCD00130059
2,4-DIMETHYLBENZENE-1,3-DIOL
CAS:634-65-1
Formula: CC1=C(O)C(C)=C(O)C=C1
BD41899
95+%
MFCD06410805
2,4-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:609-60-9
Formula: O=S(C1=CC=C(C)C=C1C)(Cl)=O
BD11171
97%
MFCD00156143
2,4-DIMETHYLBENZENESULFONAMIDE
CAS:7467-12-1
Formula: O=S(C1=CC=C(C)C=C1C)(N)=O
BD188688
97%
2,4-DIMETHYLBENZENESULFONIC ACID
CAS:88-61-9
Formula: O=S(C1=CC=C(C)C=C1C)(O)=O
BD140560
95+%
2,4-DIMETHYLBENZENESULFONOHYDRAZIDE
CAS:18626-10-3
Formula: O=S(C1=CC=C(C)C=C1C)(NN)=O
BD177229
97%
MFCD03423366
2,4-DIMETHYLBENZIMIDAMIDE
CAS:885957-73-3
Formula: N=C(N)C1=CC=C(C)C=C1C
BD285924
95+%
MFCD05662999
2,4-DIMETHYLBENZO[D]OXAZOLE
CAS:72692-90-1
Formula: CC1=C2N=C(C)OC2=CC=C1
BD273822
97%
2,4-DIMETHYLBENZO[D]THIAZOLE
CAS:5262-63-5
Formula: CC1=NC2=C(S1)C=CC=C2C
BD236614
95+%
MFCD03161856
2,4-DIMETHYLBENZOIC ACID
CAS:611-01-8
Formula: C1=CC(=CC(=C1C(O)=O)C)C
BD6659
95+%
MFCD00002480
2,4-DIMETHYLBENZONITRILE
CAS:21789-36-6
Formula: N#CC1=CC=C(C)C=C1C
BD67098
98%
MFCD00016377
2,4-DIMETHYLBENZOTHIOAMIDE
CAS:57182-70-4
Formula: S=C(C1=CC=C(C)C=C1C)N
BD67093
97%
2,4-DIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:15058-72-7
Formula: O=C(C1=C(C)OC=C1C)O
BD558268
97%
MFCD08692087
2,4-DIMETHYLHEPTAN-3-ONE
CAS:18641-71-9
Formula: CC(C)C(C(C)CCC)=O
BD67057
95+%
MFCD00027146
2,4-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:59256-84-7
Formula: CN1CC(C)OCC1.[H]Cl
BD283924
95+%
2,4-DIMETHYLNAPHTHALEN-1-AMINE
CAS:51671-03-5
Formula: NC1=C2C=CC=CC2=C(C)C=C1C
BD272457
95+%
MFCD20691448
2,4-DIMETHYLNICOTINALDEHYDE
CAS:168072-32-0
Formula: O=CC1=C(C)N=CC=C1C
BD157660
95+%
MFCD11100698
2,4-DIMETHYLNICOTINAMIDE
CAS:72692-96-7
Formula: O=C(N)C1=C(C)N=CC=C1C
BD250804
95+%
MFCD09752319
2,4-DIMETHYLNICOTINIC ACID HYDROCHLORIDE
CAS:133897-06-0
Formula: O=C(O)C1=C(C)N=CC=C1C.[H]Cl
BD67065
95+%
MFCD04972426
2,4-DIMETHYLOXAZOLE-5-CARBALDEHYDE
CAS:69062-86-8
Formula: CC1=NC(C)=C(O1)C=O
BD29426
95+%
MFCD06738688
2,4-DIMETHYLOXAZOLE-5-CARBOHYDRAZIDE
CAS:89598-65-2
Formula: O=C(C1=C(C)N=C(C)O1)NN
BD173257
95+%
2,4-DIMETHYLOXAZOLE-5-CARBONITRILE
CAS:59720-59-1
Formula: N#CC1=C(C)N=C(C)O1
BD435688
97%
MFCD16989998
2,4-DIMETHYLOXAZOLE-5-CARBOXYLIC ACID
CAS:2510-37-4
Formula: CC1=NC(C)=C(O1)C(O)=O
BD167638
95+%
MFCD06011090
2,4-DIMETHYLPENT-2-ENOIC ACID
CAS:66634-97-7
Formula: CC(C)/C=C(C)/C(O)=O
BD67044
97%
2,4-DIMETHYLPENTAN-3-AMINE HYDROCHLORIDE
CAS:4083-58-3
Formula: CC(C)C(N)C(C)C.[H]Cl
BD297822
97%
MFCD22392217
2,4-DIMETHYLPHENETHYL ACETATE
CAS:22532-58-7
Formula: CC(OCCC1=CC=C(C)C=C1C)=O
BD593743
97%
2,4-DIMETHYLPHENYLBORONIC ACID
CAS:55499-44-0
Formula: CC1=C(C=CC(=C1)C)B(O)O
BD5258
98%
MFCD02683101
2,4-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:60480-83-3
Formula: [H]Cl.NNC1=CC=C(C)C=C1C
BD5367
97%
MFCD00013381
2,4-DIMETHYLPIPERIDINE HYDROCHLORIDE
CAS:91846-47-8
Formula: CC1CC(C)NCC1.[H]Cl
BD67251
95+%
MFCD10687193
2,4-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE
CAS:N/A
Formula: O=C1N(C)C2=CC(C)=NN2C=C1
BD753992
97%
2,4-DIMETHYLPYRIDIN-3-AMINE
CAS:1073-21-8
Formula: CC1=NC=CC(C)=C1N
BD83730
95+%
MFCD08235192
2,4-DIMETHYLPYRIDIN-3-OL
CAS:27296-76-0
Formula: OC1=C(C)C=CN=C1C
BD67060
95+%
MFCD08235268
2,4-DIMETHYLPYRIDINE-3-BORONIC ACID
CAS:1029654-16-7
Formula: OB(C1=C(C)C=CN=C1C)O
BD168616
95+%
2,4-DIMETHYLPYRIDINE-3-CARBOXYLIC ACID
CAS:55314-30-2
Formula: O=C(C1=C(C)C=CN=C1C)O
BD29038
95+%
MFCD03265250
2,4-DIMETHYLPYRIMIDIN-5-AMINE
CAS:35733-53-0
Formula: NC1=CN=C(C)N=C1C
BD20416
98%
MFCD09608073
2,4-DIMETHYLPYRIMIDIN-5-OL
CAS:412003-95-3
Formula: OC1=CN=C(C)N=C1C
BD227081
98%
MFCD18072447
2,4-DIMETHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933702-51-3
Formula: O=CC1=CN=C(C)N=C1C
BD584922
97%
2,4-DIMETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:53554-30-6
Formula: O=C(C1=CN=C(C)N=C1C)N
BD587773
97%
2,4-DIMETHYLPYRROLE-3-CARBOXYLIC ACID
CAS:17106-13-7
Formula: O=C(C1=C(C)NC=C1C)O
BD67133
95+%
MFCD09750426
2,4-DIMETHYLPYRROLIDINE HYDROCHLORIDE
CAS:1333946-75-0
Formula: CC1CC(C)NC1.[H]Cl
BD440319
97%
MFCD19982526
2,4-DIMETHYLQUINAZOLIN-8-OL
CAS:17056-97-2
Formula: OC1=CC=CC2=C(C)N=C(C)N=C12
BD330467
95+%
MFCD24715406
2,4-DIMETHYLQUINAZOLINE
CAS:703-63-9
Formula: C1=CC=CC2=C1N=C(N=C2C)C
BD210603
95+%
MFCD18449069
2,4-DIMETHYLQUINOLINE
CAS:1198-37-4
Formula: CC1=CC(C)=NC2=CC=CC=C12
BD0480
98%
MFCD00006760
2,4-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:104785-55-9
Formula: O=C(C1=C(C)C2=CC=CC=C2N=C1C)O
BD67135
95+%
MFCD07324847
2,4-DIMETHYLQUINOLINE-7-CARBOXYLIC ACID
CAS:936074-38-3
Formula: O=C(C1=CC=C2C(C)=CC(C)=NC2=C1)O
BD173430
95+%
n/a
2,4-DIMETHYLTHIAZOL-5-AMINE
CAS:856568-04-2
Formula: NC1=C(C)N=C(C)S1
BD251214
95+%
MFCD16669939
2,4-DIMETHYLTHIAZOLE-5-CARBALDEHYDE
CAS:95453-54-6
Formula: O=CC1=C(C)N=C(C)S1
BD67030
97%
2,4-DIMETHYLTHIAZOLE-5-CARBOHYDRAZIDE
CAS:99357-25-2
Formula: O=C(C1=C(C)N=C(C)S1)NN
BD67141
97%
2,4-DIMETHYLTHIAZOLE-5-CARBONITRILE
CAS:1215959-36-6
Formula: N#CC1=C(C)N=C(C)S1
BD471300
97%
2,4-DIMETHYLTHIAZOLE-5-CARBOXYLIC ACID
CAS:53137-27-2
Formula: O=C(C1=C(C)N=C(C)S1)O
BD10000
98%
MFCD00052943
2,4-DIMETHYLTHIAZOLE-5-SULFONAMIDE
CAS:80466-90-6
Formula: O=S(C1=C(C)N=C(C)S1)(N)=O
BD549023
97%
2,4-DIMETHYLTHIOPHENE
CAS:638-00-6
Formula: CC1=CSC(C)=C1
BD67142
95+%
MFCD00130082
2,4-DIMORPHOLINOANILINE
CAS:436088-92-5
Formula: NC1=CC=C(N2CCOCC2)C=C1N3CCOCC3
BD188188
95+%
MFCD03274726
2,4-DIMORPHOLINONITROBENZENE
CAS:133387-34-5
Formula: O=[N+](C1=CC=C(N2CCOCC2)C=C1N3CCOCC3)[O-]
BD317311
95+%
MFCD00546019
2,4-DINITROBENZENESULFONAMIDE
CAS:73901-01-6
Formula: NS(=O)(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O
BD236897
98%
MFCD09733471
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBALDEHYDE
CAS:1195-08-0
Formula: O=CC1=CNC(=O)NC1=O
BD2615
97%
MFCD00192185
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:4425-56-3
Formula: N#CC1=CNC(NC1=O)=O
BD41691
98%
MFCD00051958
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:23945-44-0
Formula: O=C(N1)NC=C(C(O)=O)C1=O
BD19584
98%
n/a
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE
CAS:28485-18-9
Formula: O=S(C1=CNC(NC1=O)=O)(Cl)=O
BD67196
95+%
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDO[4,5-B]QUINOLINE-5-CARBOXYLIC ACID
CAS:500300-26-5
Formula: O=C(C1=C(C(N2)=O)C(NC2=O)=NC3=CC=CC=C13)O
BD625472
97%
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-5-CARBOXYLIC ACID
CAS:5715-10-6
Formula: OC(=O)C1=C2C(=O)NC(=O)NC2=CC=C1
BD239478
95+%
MFCD16622795
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXAMIDE
CAS:263010-13-5
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)N
BD260170
95+%
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:1821028-80-1
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)O
BD435270
97%
MFCD20039830
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-SULFONYL CHLORIDE
CAS:56044-12-3
Formula: O=S(C1=CC2=C(NC(NC2=O)=O)C=C1)(Cl)=O
BD183804
95+%
MFCD07186482
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-7-CARBONITRILE
CAS:864292-20-6
Formula: N#CC1=CC(NC(N2)=O)=C(C=C1)C2=O
BD247375
95+%
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-8-CARBONITRILE
CAS:1150617-69-8
Formula: O=C1NC(=O)C2=CC=CC(C#N)=C2N1
BD227924
95+%
MFCD12024545
2,4-DIOXO-1,3-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID
CAS:26629-10-7
Formula: O=C(C(CCC1)CC1(NC(N2)=O)C2=O)O
BD624460
97%
2,4-DIOXO-1-(3-(TRIFLUOROMETHYL)PHENYL)-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:75838-24-3
Formula: O=C(N1)N(C2=CC=CC(C(F)(F)F)=C2)C=C(C#N)C1=O
BD103726
95+%
MFCD00203322
2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:6275-84-9
Formula: O=C1NC(=O)C(=CN1C1=CC=CC=C1)C#N
BD67197
95+%
MFCD00172909
2,4-DIOXO-1-PROPYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:1242282-11-6
Formula: O=C(C1=CN(CCC)C(NC1=O)=O)O
BD608200
97%
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-6-CARBOXYLIC ACID
CAS:77423-13-3
Formula: OC(=O)C1=CC2=C(NC(=O)OC2=O)C=C1
BD42012
95+%
MFCD08704695
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-7-CARBOXYLIC ACID
CAS:77423-14-4
Formula: OC(=O)C1=CC2=C(C=C1)C(=O)OC(=O)N2
BD11477
95+%
MFCD00798181
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-8-CARBOXYLIC ACID
CAS:167902-99-0
Formula: OC(=O)C1=CC=CC2=C1NC(=O)OC2=O
BD201982
95+%
MFCD09865033
2,4-DIOXO-4-(4-(PIPERIDIN-1-YL)PHENYL)BUTANOIC ACID
CAS:394655-15-3
Formula: O=C(O)C(CC(C1=CC=C(N2CCCCC2)C=C1)=O)=O
BD67200
97%
2,4-DIOXO-4-PHENYLBUTANOIC ACID
CAS:5817-92-5
Formula: O=C(O)C(CC(C1=CC=CC=C1)=O)=O
BD319079
95+%
MFCD00456054
2,4-DIOXO-6-PHENYLHEXANOIC ACID
CAS:64165-16-8
Formula: O=C(O)C(CC(CCC1=CC=CC=C1)=O)=O
BD249644
95+%
2,4-DIOXO-N-PHENYLPENTANAMIDE
CAS:503300-35-4
Formula: CC(=O)CC(=O)C(=O)NC1=CC=CC=C1
BD219439
95+%
2,4-DIPHENYL-1H-PYRROLE
CAS:3274-56-4
Formula: C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CN1
BD67218
95+%
2,4-DIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:59009-62-0
Formula: N#CC1=C(C2=CC=CC=C2)NC=C1C3=CC=CC=C3
BD269130
95+%
MFCD02380383
2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULFONATE
CAS:81128-01-0
Formula: O=S(C(F)(F)F)([O-])=O.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=C4CCCCC4=[O+]1
BD67212
97%
2,4-DIPHENYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:20954-93-2
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C4CCCCC4=N1
BD748671
97%
2,4-DIPHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:138722-71-1
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C(CCC4)C4=N1
BD748669
97%
2,4-DIPHENYLCYCLOBUTANE-1,3-DIAMINE
CAS:101288-28-2
Formula: NC1C(C2=CC=CC=C2)C(N)C1C3=CC=CC=C3
BD605377
97%
2,4-DIPHENYLOXAZOL-5(4H)-ONE
CAS:28687-81-2
Formula: O=C1C(C2=CC=CC=C2)N=C(C3=CC=CC=C3)O1
BD492928
97%
2,4-DIPHENYLOXAZOLE
CAS:838-41-5
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CO1
BD67216
97%
MFCD00016890
2,4-DIPHENYLPHTHALAZIN-1(2H)-ONE
CAS:36503-83-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=CC=C3)C4=C1C=CC=C4
BD625001
97%
2,4-DIPHENYLPYRIDINE
CAS:26274-35-1
Formula: C1(C2=CC=CC=C2)=NC=CC(C3=CC=CC=C3)=C1
BD67217
98%
MFCD00972966
2,4-DIPHENYLTHIAZOLE
CAS:1826-14-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CS1
BD257419
95+%
2,4-PENTANEDIONE LITHIUM SALT
CAS:18115-70-3
Formula: CC([C-]C(C)=O)=O.[Li+]
BD306209
95+%
MFCD00013496
2,4-PIPERIDINEDICARBOXYLIC ACID
CAS:85819-03-0
Formula: O=C(C1NCCC(C(O)=O)C1)O
BD306875
95+%
MFCD12026391
2,4-PTERIDINEDIOL
CAS:487-21-8
Formula: C1=CN=C2C(=N1)C(NC(N2)=O)=O
BD164356
98%
MFCD00066250
2,4-PYRIMIDINEDIAMINE WITH LINKER
CAS:1430089-64-7
Formula: NCCCNC1=CC=C(NC2=NC=CC(NC3=NNC(C4CC4)=C3)=N2)C=C1
BD449969
98+%
MFCD28385887
2,4-THIAZOLIDINEDIONE
CAS:2295-31-0
Formula: O=C1SCC(N1)=O
BD9326
97%
MFCD00005478
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE
CAS:1004-75-7
Formula: O=C1NC(N)=NC(N)=C1N
BD220079
95+%
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE DIHYDROCHLORIDE
CAS:51324-37-9
Formula: Cl.Cl.NC1C(=O)N=C(N)N=C1N
BD223096
95+%
MFCD00142115
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE
CAS:35011-47-3
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
BD220080
95+%
MFCD00012785
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE(1:X)
CAS:39267-74-8
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
BD220087
97%
n/a
2,5,6-TRIAMINOPYRIMIDIN-4-OL
CAS:N/A
Formula: OC1=NC(N)=NC(N)=C1N
BD109297
95+%
2,5,6-TRIAMINOPYRIMIDIN-4-YL HYDROGEN SULFATE
CAS:1603-02-7
Formula: NC1=NC(OS(O)(=O)=O)=C(N)C(N)=N1
BD220088
95%
MFCD00039040
2,5,6-TRIAMINOPYRIMIDINE-4(3H)-THIONE
CAS:54-19-3
Formula: S=C1NC(N)=NC(N)=C1N
BD282734
95+%
2,5,6-TRICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:16865-11-5
Formula: ClC1=C(Cl)C=C2C(NC(Cl)=N2)=C1
BD67291
98%
MFCD09835289
2,5,6-TRICHLORO-4-METHYLNICOTINIC ACID
CAS:294876-53-2
Formula: O=C(O)C1=C(Cl)N=C(Cl)C(Cl)=C1C
BD260749
95+%
2,5,6-TRICHLORO-4-METHYLNICOTINONITRILE
CAS:63195-39-1
Formula: ClC1=NC(=C(C(=C1C#N)C)Cl)Cl
BD163315
98%
MFCD09754021
2,5,6-TRICHLORO-4-PROPYLNICOTINONITRILE
CAS:63195-40-4
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1CCC
BD284535
95+%
2,5,6-TRICHLORO-N,N-DIMETHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)N(C)C
BD00772280
95%
2,5,6-TRICHLORO-N-METHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NC
BD00803764
95%
2,5,6-TRICHLOROBENZO[D]THIAZOLE
CAS:120258-61-9
Formula: ClC1C=C2C(N=C(S2)Cl)=CC=1Cl
BD00765347
95+%
n/a
2,5,6-TRICHLORONICOTINALDEHYDE
CAS:55304-74-0
Formula: O=CC1=C(Cl)N=C(Cl)C(Cl)=C1
BD754078
97%
2,5,6-TRICHLORONICOTINAMIDE
CAS:142266-62-4
Formula: O=C(N)C1=C(Cl)N=C(Cl)C(Cl)=C1
BD237000
97%
2,5,6-TRICHLORONICOTINIC ACID
CAS:54718-39-7
Formula: OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl
BD236969
97%
MFCD02070018
2,5,6-TRICHLORONICOTINOHYDRAZIDE
CAS:58584-91-1
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NN
BD00741972
95+%
n/a
2,5,6-TRICHLORONICOTINONITRILE
CAS:40381-92-8
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1
BD218290
95+%
MFCD17392884
2,5,6-TRICHLOROPYRIDIN-3-AMINE
CAS:55304-76-2
Formula: NC1=CC(Cl)=C(Cl)N=C1Cl
BD248792
95+%
MFCD20714285
2,5,6-TRICHLOROPYRIMIDIN-4-AMINE
CAS:28969-60-0
Formula: NC1=NC(Cl)=NC(Cl)=C1Cl
BD93616
98%
MFCD09744035
2,5,6-TRICHLOROQUINAZOLINE
CAS:67092-21-1
Formula: ClC1=C(Cl)C2=CN=C(Cl)N=C2C=C1
BD633828
97%
2,5,6-TRIFLUORONICOTINIC ACID
CAS:773109-19-6
Formula: O=C(O)C1=C(F)N=C(F)C(F)=C1
BD67294
97%
2,5,6-TRIFLUORONICOTINONITRILE
CAS:870065-73-9
Formula: N#CC1=C(F)N=C(F)C(F)=C1
BD67295
98%
MFCD04973023
2,5,6-TRIFLUOROPYRIDINE-3,4-DIAMINE
CAS:6256-96-8
Formula: NC1=C(N)C(F)=C(F)N=C1F
BD216517
95+%
MFCD18803121
2,5,6-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:89044-51-9
Formula: O=C1C(C)CC2=C1C=C(C)C(C)=C2
BD272737
95+%
2,5,6-TRIMETHYLBENZO[D]OXAZOLE
CAS:19219-98-8
Formula: CC1=C(C)C=C2N=C(C)OC2=C1
BD0091
98%
MFCD00022849
2,5,6-TRIMETHYLBENZO[D]THIAZOLE
CAS:5683-41-0
Formula: CC1=C(C)C=C2N=C(C)SC2=C1
BD67299
95+%
MFCD00128832
2,5,6-TRIMETHYLPYRIMIDIN-4-OL
CAS:89943-15-7
Formula: OC1=NC(C)=NC(C)=C1C
BD279371
95+%
2,5,6-TRIMETHYLTHIENO[2,3-D]PYRIMIDINE-4-THIOL
CAS:743452-19-9
Formula: SC1=C(C(C)=C(C)S2)C2=NC(C)=N1
BD496843
97%
MFCD05263743
2,5,7-TRIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1392210-92-2
Formula: O=C(NC1)NC21CNC2
BD329520
95+%
MFCD22372582
2,5,7-TRIAZASPIRO[3.4]OCTAN-8-ONE HYDROCHLORIDE
CAS:686344-68-3
Formula: O=C1NCNC21CNC2.[H]Cl
BD163807
95+%
MFCD12755759
2,5,7-TRIAZASPIRO[3.4]OCTANE-6,8-DIONE HYDROCHLORIDE
CAS:1026796-27-9
Formula: O=C(NC1=O)NC21CNC2.[H]Cl
BD314075
95+%
MFCD20688617
2,5,7-TRICHLOROBENZO[D]THIAZOLE
CAS:898747-75-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC(Cl)=C2
BD236620
95+%
MFCD08459005
2,5,7-TRICHLOROTHIAZOLO[4,5-D]PYRIMIDINE
CAS:122970-50-7
Formula: ClC1=C(SC(Cl)=N2)C2=NC(Cl)=N1
BD281276
95+%
2,5,7-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:88611-38-5
Formula: O=CC1=C(C)NC2=C1C=C(C)C=C2C
BD195290
97%
MFCD07643235
2,5,7-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:65001-59-4
Formula: CC1CC2=CC(C)=CC(C)=C2C1=O
BD67304
95+%
MFCD09030781
2,5,7-TRIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:138628-46-3
Formula: CC1=CC(C)=NC2=C(C3=CC=CC=C3)C(C)=NN12
BD584231
97%
2,5,7-TRIMETHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:N/A
Formula: CC1C=C(C)N=C2NC(=NC=12)C
BD00735449
95%
2,5,7-TRIMETHYL-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:174469-70-6
Formula: CC1CC(C)NC2=CC(C)=NN12
BD264147
95+%
MFCD09332629
2,5,7-TRIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1158269-53-4
Formula: O=C(C1=C2N=C(C)C=C(C)N2N=C1C)O
BD279010
95+%
2,5,7-TRIMETHYLQUINOLIN-8-OL
CAS:6759-80-4
Formula: CC1=NC2=C(C=C1)C(C)=CC(C)=C2O
BD225848
95+%
MFCD00168977
2,5,8,11,14,17,20,23,26,29,32,35-DODECAOXAHEPTATRIACONTAN-37-AMINE
CAS:80506-64-5
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
BD434646
95+%
n/a
2,5,8,11,14,17,20,23,26,29,32-UNDECAOXATETRATRIACONTAN-34-AMINE
CAS:854601-60-8
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
BD434644
95+%
2,5,8,11,14,17,20,23,26,29-DECAOXAHENTRIACONTAN-31-OL
CAS:27425-92-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
BD262364
97%
MFCD06797087
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-AMINE
CAS:211859-73-3
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCN
BD434549
95+%
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-OL
CAS:6048-68-6
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCO
BD262363
98%
MFCD06797148
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-AMINE
CAS:869718-81-0
Formula: COCCOCCOCCOCCOCCOCCOCCOCCN
BD434645
95+%
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-OL
CAS:25990-96-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCO
BD212984
98%
MFCD06797152
2,5,8,11,14,17,20-HEPTAOXADOCOSAN-22-AMINE
CAS:170572-38-0
Formula: COCCOCCOCCOCCOCCOCCOCCN
BD434538
95+%
2,5,8,11,14,17,20-HEPTAOXATRICOSAN-23-OIC ACID
CAS:874208-91-0
Formula: COCCOCCOCCOCCOCCOCCOCCC(O)=O
BD434649
95+%
2,5,8,11,14,17-HEXAOXANONADECAN-19-AMINE
CAS:184357-46-8
Formula: COCCOCCOCCOCCOCCOCCN
BD434540
95+%
2,5,8,11,14,17-HEXAOXANONADECAN-19-OL
CAS:23601-40-3
Formula: COCCOCCOCCOCCOCCOCCO
BD133156
98%
MFCD00045996
2,5,8,11,14,17-HEXAOXANONADECANE-19-THIOL
CAS:441771-60-4
Formula: COCCOCCOCCOCCOCCOCCS
BD434581
95+%
2,5,8,11,14,17-HEXAOXAOCTADECANE
CAS:1191-87-3
Formula: COCCOCCOCCOCCOCCOC
BD304163
95+%
n/a
2,5,8,11,14-PENTAOXAHEPTADECAN-17-OIC ACID
CAS:81836-43-3
Formula: COCCOCCOCCOCCOCCC(O)=O
BD434637
95+%
2,5,8,11,14-PENTAOXAHEXADECAN-16-AMINE
CAS:5498-83-9
Formula: COCCOCCOCCOCCOCCN
BD434599
95+%
2,5,8,11,14-PENTAOXAHEXADECAN-16-OL
CAS:23778-52-1
Formula: COCCOCCOCCOCCOCCO
BD147003
98%
MFCD00045995
2,5,8,11,14-PENTAOXAHEXADECANE-16-THIOL
CAS:524030-00-0
Formula: COCCOCCOCCOCCOCCS
BD434594
95+%
2,5,8,11,14-PENTAOXAPENTADECANE
CAS:143-24-8
Formula: COCCOCCOCCOCCOC
BD153379
97%
MFCD00008505
2,5,8,11-TETRAMETHYL-1,4,7,10-TETRAAZACYCLODODECANE
CAS:494751-27-8
Formula: CC1NCC(C)NCC(C)NCC(C)NC1
BD226538
95+%
2,5,8,11-TETRAOXATETRADECAN-14-OIC ACID
CAS:67319-28-2
Formula: COCCOCCOCCOCCC(O)=O
BD434617
95+%
n/a
2,5,8,11-TETRAOXATRIDECAN-13-AMINE
CAS:85030-56-4
Formula: COCCOCCOCCOCCN
BD434639
95+%
2,5,8,11-TETRAOXATRIDECAN-13-OL
CAS:23783-42-8
Formula: COCCOCCOCCOCCO
BD7139
98%
MFCD00041756
2,5,8,11-TETRAOXATRIDECAN-13-YL 4-METHYLBENZENESULFONATE
CAS:62921-76-0
Formula: O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOC)=O
BD768012
95%
MFCD11041134
2,5,8,11-TETRAOXATRIDECANE-13-THIOL
CAS:52190-55-3
Formula: COCCOCCOCCOCCS
BD67308
95+%
2,5,8-TRICHLOROQUINAZOLINE
CAS:67092-22-2
Formula: ClC1=CC=C(Cl)C2=CN=C(Cl)N=C12
BD633830
97%
2,5,8-TRIMETHOXY-4-METHYLQUINOLIN-6-AMINE
CAS:49584-51-2
Formula: NC1=CC(OC)=C2N=C(OC)C=C(C)C2=C1OC
BD625444
97%
2,5,8-TRIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:54410-76-3
Formula: CC1=NC=C(C)N2C1=NC(C)=N2
BD249597
95+%
MFCD18971092
2,5,8-TRIMETHYLQUINOLINE
CAS:102871-69-2
Formula: CC1=C2N=C(C)C=CC2=C(C)C=C1
BD282757
95+%
MFCD09787532
2,5-ANHYDRO-D-GLUCITOL 1,6-DIPHOSPHATE
CAS:4429-47-4
Formula: O[C@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1COP(O)(O)=O
BD67312
97%
MFCD01863342
2,5-BIS((2-HYDROXYETHYL)AMINO)CYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:5557-53-9
Formula: O=C(C(NCCO)=C1)C=C(NCCO)C1=O
BD596671
97%
MFCD00721337
2,5-BIS(2,2,2-TRIFLUOROETHOXY)ANILINE
CAS:66300-37-6
Formula: NC1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
BD334971
95+%
MFCD28291791
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOHYDRAZIDE
CAS:50778-75-1
Formula: O=C(NN)C1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
BD12936
95+%
MFCD00221192
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOIC ACID
CAS:35480-52-5
Formula: OC(=O)C1=C(OCC(F)(F)F)C=CC(OCC(F)(F)F)=C1
BD20400
98%
MFCD00221424
2,5-BIS(2,4,4-TRIMETHYLPENTAN-2-YL)BENZENE-1,4-DIOL
CAS:903-19-5
Formula: OC1=CC(C(CC(C)(C)C)(C)C)=C(O)C=C1C(CC(C)(C)C)(C)C
BD67320
95+%
MFCD00128797
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5''-HEXYL-[2,2':5',2''-TERTHIOPHEN]-5-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1093468-95-1
BD449023
97%
MFCD16621139
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1269004-46-7
BD262608
95+%
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(TRIMETHYLSTANNYL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1392422-47-7
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C([Sn](C)(C)C)S2)=C3C1=C(C4=CC=C([Sn](C)(C)C)S4)N(CC(CC)CCCC)C3=O
BD293567
95+%
n/a
2,5-BIS(2-ETHYLHEXYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1185885-86-2
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CC)CCCC)C3=O
BD254710
95+%
MFCD22200076
2,5-BIS(2-OCTYLDODECYL)-3,6-BIS(5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1351986-34-9
BD585740
97%
2,5-BIS(2-OCTYLDODECYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1267540-02-2
Formula: O=C1N(CC(CCCCCCCC)CCCCCCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CCCCCCCC)CCCCCCCCCC)C3=O
BD318473
95+%
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:924894-85-9
Formula: CC1(C)C(C)(C)OB(C(S2)=CC3=C2C=C(B4OC(C)(C)C(C)(C)O4)S3)O1
BD226625
97%
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHENE
CAS:175361-81-6
Formula: CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)O1
BD273711
97%
MFCD09800563
2,5-BIS(4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)-1,3,4-OXADIAZOLE
CAS:1116122-85-0
Formula: CC1(C)C(C)(C)OB(C2=CC=C(C3=NN=C(C4=CC=C(B5OC(C)(C)C(C)(C)O5)C=C4)O3)C=C2)O1
BD303076
95+%
MFCD25460334
2,5-BIS(4-BROMOPHENYL)-1,3,4-OXADIAZOLE
CAS:19542-05-3
Formula: BrC1=CC=C(C2=NN=C(C3=CC=C(Br)C=C3)O2)C=C1
BD303060
95+%
MFCD00020715
2,5-BIS(4-CHLOROPHENYL)-1,3,4-OXADIAZOLE
CAS:2491-90-9
Formula: ClC1=CC=C(C2=NN=C(C3=CC=C(Cl)C=C3)O2)C=C1
BD67340
95+%
MFCD00050998
2,5-BIS(4-DIETHYLAMINOPHENYL)-1,3,4-OXADIAZOLE
CAS:1679-98-7
Formula: CCN(C1=CC=C(C2=NN=C(C3=CC=C(N(CC)CC)C=C3)O2)C=C1)CC
BD306194
95+%
MFCD00010070
2,5-BIS(5-(TERT-BUTYL)BENZO[D]OXAZOL-2-YL)THIOPHENE
CAS:7128-64-5
Formula: CC(C)(C)C1=CC2=C(OC(=N2)C2=CC=C(S2)C2=NC3=C(O2)C=CC(=C3)C(C)(C)C)C=C1
BD22336
98%
MFCD00005774
2,5-BIS(BENZYLOXY)BENZALDEHYDE
CAS:6109-54-2
Formula: O=CC1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
BD182530
95+%
MFCD02380367
2,5-BIS(BENZYLOXY)BENZOIC ACID
CAS:67127-91-7
Formula: O=C(O)C1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
BD34573
98%
MFCD00156981
2,5-BIS(ETHYLAMINO)NICOTINONITRILE
CAS:1346809-31-1
Formula: N#CC1=C(NCC)N=CC(NCC)=C1
BD252541
95+%
MFCD19688662
2,5-BIS(METHYLSULFONYL)BENZONITRILE
CAS:1820608-13-6
Formula: N#CC1=CC(S(=O)(C)=O)=CC=C1S(=O)(C)=O
BD452469
97%
MFCD28096642
2,5-BIS(MORPHOLINOMETHYL)-1,4-PHENYLENE DIACETATE
CAS:1865-04-9
Formula: CC(OC1=CC(CN2CCOCC2)=C(OC(C)=O)C=C1CN3CCOCC3)=O
BD240885
95+%
MFCD03413579
2,5-BIS(TRI-N-BUTYLSTANNYL)FURAN
CAS:193361-76-1
Formula: CCCC[Sn](C1=CC=C([Sn](CCCC)(CCCC)CCCC)O1)(CCCC)CCCC
BD306744
95+%
MFCD09833740
2,5-BIS(TRIETHOXYSILYL)THIOPHENE
CAS:40190-22-5
Formula: CCO[Si](C1=CC=C([Si](OCC)(OCC)OCC)S1)(OCC)OCC
BD251995
95+%
2,5-BIS(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:399-69-9
Formula: FC(C1=CC=C2NC(C(F)(F)F)=NC2=C1)(F)F
BD248475
95+%
2,5-BIS(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE-6-CARBOXYLIC ACID
CAS:1309602-77-4
Formula: O=C(C1=C(C(F)(F)F)C=C2N=C(C(F)(F)F)NC2=C1)O
BD492938
97%
2,5-BIS(TRIFLUOROMETHYL)ANILINE
CAS:328-93-8
Formula: C1=C(C(=CC=C1C(F)(F)F)C(F)(F)F)N
BD5773
98%
MFCD00074940
2,5-BIS(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:395-64-2
Formula: O=CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD7165
95+%
MFCD00674087
2,5-BIS(TRIFLUOROMETHYL)BENZAMIDE
CAS:53130-46-4
Formula: O=C(N)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD483225
97%
MFCD04973747
2,5-BIS(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
CAS:351003-22-0
Formula: O=S(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)(Cl)=O
BD67361
97%
MFCD03094042
2,5-BIS(TRIFLUOROMETHYL)BENZENEBORONIC ACID
CAS:196083-18-8
Formula: OB(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)O
BD67360
95+%
MFCD04038223
2,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:42580-42-7
Formula: O=C(O)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD7168
98%
MFCD00013249
2,5-BIS(TRIFLUOROMETHYL)BENZONITRILE
CAS:51012-27-2
Formula: N#CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD67363
95+%
MFCD03094423
2,5-BIS(TRIFLUOROMETHYL)CHLOROBENZENE
CAS:328-91-6
Formula: FC(F)(F)C1=CC(Cl)=C(C=C1)C(F)(F)F
BD215213
97%
MFCD00632388
2,5-BIS(TRIFLUOROMETHYL)CINNAMIC ACID
CAS:312619-48-0
Formula: O=C(O)/C=C/C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD307869
95+%
MFCD00799486
2,5-BIS(TRIFLUOROMETHYL)PHENOL
CAS:779-88-4
Formula: OC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD10847
97%
MFCD04973414
2,5-BIS(TRIFLUOROMETHYL)PYRIDINE
CAS:20857-44-7
Formula: FC(C1=CN=C(C(F)(F)F)C=C1)(F)F
BD318972
95+%
MFCD00128906
2,5-BIS(TRIMETHYLSILYL)THIAZOLE
CAS:79265-34-2
Formula: C[Si](C1=CN=C([Si](C)(C)C)S1)(C)C
BD67378
97%
MFCD09800395
2,5-BIS-(TRIFLUOROMETHYL)PYRAZINE
CAS:1365988-35-7
Formula: FC(C1=CN=C(C(F)(F)F)C=N1)(F)F
BD323148
95+%
MFCD21602144
2,5-BIS[(DIMETHYLAMINO)METHYL]CYCLOPENTANONE
CAS:13290-51-2
Formula: O=C1C(CN(C)C)CCC1CN(C)C
BD171263
95+%
MFCD01210808
2,5-BISPIPERIDIN-1-YLMETHYLBENZENE-1,4-DIOL
CAS:1753-68-0
Formula: OC1=CC(N2CCCCC2)=C(O)C(C)=C1N3CCCCC3
BD323388
95+%
MFCD00185950
2,5-DI([1,1'-BIPHENYL]-4-YL)THIOPHENE
CAS:56316-86-0
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2)=CC=C(C4=CC=C(C5=CC=CC=C5)C=C4)S1
BD331654
95+%
2,5-DI(2-THIENYL)-1H-PYRROLE
CAS:89814-62-0
Formula: C1(C2=CC=CS2)=CC=C(C3=CC=CS3)N1
BD322191
95+%
2,5-DI(NAPHTHALEN-1-YL)-1,3,4-OXADIAZOLE
CAS:905-62-4
Formula: C1(C2=C3C=CC=CC3=CC=C2)=NN=C(C4=C5C=CC=CC5=CC=C4)O1
BD67325
95+%
MFCD00045582
2,5-DI(THIOPHEN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:21210-90-2
Formula: C1(C=C(C2=CC=CS2)S3)=C3C=C(C4=CC=CS4)S1
BD262634
95+%
MFCD11114556
2,5-DI-TERT-BUTYL PYRIDINE-2,5-DICARBOXYLATE
CAS:1414029-44-9
Formula: O=C(C1=NC=C(C(OC(C)(C)C)=O)C=C1)OC(C)(C)C
BD326476
95+%
MFCD22574962
2,5-DI-TERT-BUTYL-1H-PYRROLE
CAS:3760-56-3
Formula: CC(C1=CC=C(C(C)(C)C)N1)(C)C
BD67895
95+%
2,5-DI-TERT-BUTYLANILINE
CAS:21860-03-7
Formula: NC1=CC(C(C)(C)C)=CC=C1C(C)(C)C
BD67897
97%
2,5-DI-TERT-BUTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:2460-77-7
Formula: O=C(C(C(C)(C)C)=C1)C=C(C(C)(C)C)C1=O
BD67900
98%
2,5-DI-TERT-BUTYLFURAN
CAS:4789-40-6
Formula: CC(C1=CC=C(C(C)(C)C)O1)(C)C
BD268849
95+%
2,5-DI-TERT-BUTYLHYDROQUINONE
CAS:88-58-4
Formula: C1=C(O)C(=CC(=C1C(C)(C)C)O)C(C)(C)C
BD22988
97%
MFCD00008825
2,5-DI-TERT-BUTYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:626223-27-6
Formula: NC1=CC(C(C)(C)C)=NC2=CC(C(C)(C)C)=NN12
BD494569
97%
MFCD04035547
2,5-DI-TERT-PENTYLBENZENE-1,4-DIOL
CAS:79-74-3
Formula: OC1=CC(C(C)(C)CC)=C(O)C=C1C(C)(C)CC
BD67894
95+%
MFCD00027029
2,5-DI-TERT-PENTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4584-63-8
Formula: O=C1C(C(C)(C)CC)=CC(C(C(C)(C)CC)=C1)=O
BD67893
95+%
MFCD00142843
2,5-DIAMINEPYRIMIDINE
CAS:22715-27-1
Formula: C1=C(N)C=NC(=N1)N
BD41477
95%
MFCD00129726
2,5-DIAMINO-2-METHYLPENTANOIC ACID HYDROCHLORIDE
CAS:52372-32-4
Formula: O=C(O)C(C)(N)CCCN.[H]Cl
BD67386
97%
2,5-DIAMINO-3-BROMOBENZONITRILE
CAS:82997-65-7
Formula: N#CC1=CC(N)=CC(Br)=C1N
BD327776
95+%
MFCD22205744
2,5-DIAMINO-3-CHLOROBENZONITRILE
CAS:82997-64-6
Formula: N#CC1=CC(N)=CC(Cl)=C1N
BD67387
97%
MFCD08704820
2,5-DIAMINO-4,6-DICHLOROPYRIMIDINE
CAS:55583-59-0
Formula: ClC1=C(N)C(Cl)=NC(N)=N1
BD9440
98%
MFCD00792652
2,5-DIAMINO-4,6-DIHYDROXYPYRIMIDINE HYDROCHLORIDE
CAS:56830-58-1
Formula: Cl.NC1=NC(O)=C(N)C(O)=N1
BD2319
95+%
MFCD00082893
2,5-DIAMINO-6-NITROQUINAZOLIN-4(3H)-ONE
CAS:103884-20-4
Formula: OC1=C2C(N)=C([N+]([O-])=O)C=CC2=NC(N)=N1
BD633821
97%
2,5-DIAMINO-9H-FLUOREN-9-ONE
CAS:46487-37-0
Formula: O=C1C2=C(C3=C1C=CC=C3N)C=CC(N)=C2
BD625387
97%
2,5-DIAMINOADIPIC ACID DIHYDROCHLORIDE
CAS:52408-04-5
Formula: O=C(O)C(N)CCC(N)C(O)=O.[H]Cl.[H]Cl
BD33920
95+%
MFCD09836090
2,5-DIAMINOBENZENE-1,3-DISULFONIC ACID
CAS:6409-48-9
Formula: O=S(C1=CC(N)=CC(S(=O)(O)=O)=C1N)(O)=O
BD67382
95+%
MFCD06200774
2,5-DIAMINOBENZENE-1,4-DIOL DIHYDROCHLORIDE
CAS:24171-03-7
Formula: OC1=CC(N)=C(O)C=C1N.[H]Cl.[H]Cl
BD67384
95+%
MFCD00239416
2,5-DIAMINOBENZENE-1,4-DISULFONIC ACID
CAS:7139-89-1
Formula: O=S(C1=CC(N)=C(S(=O)(O)=O)C=C1N)(O)=O
BD54804
97%
MFCD00272406
2,5-DIAMINOBENZENE-1,4-DITHIOL DIHYDROCHLORIDE
CAS:75464-52-7
Formula: SC1=CC(N)=C(S)C=C1N.[H]Cl.[H]Cl
BD3716
97%
MFCD00142835
2,5-DIAMINOBENZENESULFONAMIDE
CAS:20896-44-0
Formula: O=S(C1=CC(N)=CC=C1N)(N)=O
BD261177
97%
MFCD16618593
2,5-DIAMINOBENZOIC ACID
CAS:610-74-2
Formula: NC1=CC(C(O)=O)=C(N)C=C1
BD4954
95+%
MFCD00127689
2,5-DIAMINOBENZOIC ACID DIHYDROCHLORIDE
CAS:1158259-09-6
Formula: O=C(O)C1=CC(N)=CC=C1N.[H]Cl.[H]Cl
BD408546
95+%
MFCD01596222
2,5-DIAMINOBENZONITRILE
CAS:14346-13-5
Formula: N#CC1=CC(N)=CC=C1N
BD4803
97%
2,5-DIAMINONICOTINONITRILE
CAS:1184645-19-9
Formula: N#CC1=C(N)N=CC(N)=C1
BD586087
97%
2,5-DIAMINOPYRIDINE DIHYDROCHLORIDE
CAS:26878-35-3
Formula: NC1=CN=C(N)C=C1.[H]Cl.[H]Cl
BD19851
98%
MFCD00040818
2,5-DIAMINOPYRIDINE HYDROCHLORIDE
CAS:119261-84-6
Formula: NC1=CN=C(N)C=C1.[H]Cl
BD216688
95+%
2,5-DIAMINOPYRIMIDIN-4(3H)-ONE
CAS:77994-12-8
Formula: O=C1NC(N)=NC=C1N
BD271107
95+%
2,5-DIAMINOPYRIMIDINE-4,6-DIOL
CAS:40769-69-5
Formula: NC1=NC(O)=C(N)C(O)=N1
BD5435
95+%
MFCD02094729
2,5-DIAMINOPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1260859-20-8
Formula: O=C(C1=NC(N)=NC=C1N)O
BD222354
95+%
MFCD13193549
2,5-DIAMINOTEREPHTHALIC ACID
CAS:945-30-2
Formula: O=C(O)C1=CC(N)=C(C(O)=O)C=C1N
BD221961
95+%
MFCD00464161
2,5-DIAMINOTHIAZOLO[4,5-D]PYRIMIDIN-7(6H)-ONE
CAS:22288-77-3
Formula: NC1=NC2=C(S1)C(=O)NC(N)=N2
BD237686
95+%
MFCD09753539
2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROCHLORIDE
CAS:89487-38-7
Formula: [H]Cl.[H]Cl.C1(C2)NCC2NC1
BD33927
97%
n/a
2,5-DIAZABICYCLO[2.2.2]OCTANE
CAS:658-24-2
Formula: C1(CC2)NCC2NC1
BD225959
95+%
MFCD08694643
2,5-DIAZABICYCLO[2.2.2]OCTANE DIHYDROCHLORIDE
CAS:1192-92-3
Formula: C1(CC2)NCC2NC1.[H]Cl.[H]Cl
BD268704
95+%
MFCD11506237
2,5-DIAZABICYCLO[2.2.2]OCTANE-3,6-DIONE
CAS:1004-98-4
Formula: O=C(C1N2)NC(CC1)C2=O
BD317197
95+%
MFCD18086974
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1373028-77-3
Formula: O=C(CC1)NC21CNC2
BD570341
97%
MFCD22209694
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1630906-86-3
Formula: O=C(CC1)NC21CNC2.[H]Cl
BD300631
95+%
2,5-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-64-7
Formula: [H]Cl.[H]Cl.C1NCC12NCCCC2
BD328994
95+%
MFCD20261444
2,5-DIBENZYLOCTAHYDROPYRROLO[3,4-C]PYRROLE
CAS:165894-00-8
Formula: N1(CC2=CC=CC=C2)CC(CN(CC3=CC=CC=C3)C4)C4C1
BD249386
95+%
2,5-DIBENZYLTETRAHYDROPYRROLO[3,4-C]PYRROLE-1,3(2H,3AH)-DIONE
CAS:165893-99-2
Formula: O=C(C1C2CN(CC3=CC=CC=C3)C1)N(CC4=CC=CC=C4)C2=O
BD27701
95+%
MFCD09037882
2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1214901-64-0
Formula: BrC1=CC=CC2=NC(Br)=NN12
BD245331
95+%
MFCD20527883
2,5-DIBROMO-1,3,4-THIADIAZOLE
CAS:55981-29-8
Formula: BrC1=NN=C(Br)S1
BD223435
98%
MFCD00466397
2,5-DIBROMO-1,3-DICHLOROBENZENE
CAS:19393-97-6
Formula: ClC1=C(Br)C(Cl)=CC(Br)=C1
BD254348
95+%
2,5-DIBROMO-1,3-DIETHYLBENZENE
CAS:314084-64-5
Formula: CCC1=C(Br)C(CC)=CC(Br)=C1
BD496006
97%
MFCD09743753
2,5-DIBROMO-1,3-DIFLUOROBENZENE
CAS:128259-71-2
Formula: FC1=C(Br)C(F)=CC(Br)=C1
BD260769
95+%
2,5-DIBROMO-1,3-DIMETHYLBENZENE
CAS:100189-84-2
Formula: CC1=CC(Br)=CC(C)=C1Br
BD67458
98%
MFCD00079745
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE
CAS:850429-58-2
Formula: CC1=C(Br)N(C)C(Br)=N1
BD67419
95+%
MFCD06659900
2,5-DIBROMO-1-CHLORO-3-FLUOROBENZENE
CAS:1000572-88-2
Formula: FC1=C(Br)C(Cl)=CC(Br)=C1
BD224247
97%
2,5-DIBROMO-1-CHLORO-3-METHYLBENZENE
CAS:1000573-82-9
Formula: CC1=CC(Br)=CC(Cl)=C1Br
BD587971
97%
MFCD09878184
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-59-3
Formula: CN1C(Br)=CN=C1Br
BD67420
95+%
MFCD01632217
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE-4-CARBONITRILE
CAS:1799420-96-4
Formula: N#CC1=C(Br)N(C)C(Br)=N1
BD297513
95+%
2,5-DIBROMO-1-METHYL-3-NITROBENZENE
CAS:408340-39-6
Formula: CC1=CC(Br)=CC([N+]([O-])=O)=C1Br
BD483297
97%
MFCD11846032
2,5-DIBROMO-1-TRITYL-1H-IMIDAZOLE
CAS:850429-53-7
Formula: BrC1=CN=C(Br)N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
BD67421
95+%
MFCD04115731
2,5-DIBROMO-1H-IMIDAZOL-4-AMINE
CAS:1029720-13-5
Formula: NC1N=C(Br)NC=1Br
BD00752178
95+%
n/a
2,5-DIBROMO-1H-IMIDAZOLE
CAS:64591-03-3
Formula: BrC1=CN=C(Br)N1
BD66598
95+%
MFCD02179517
2,5-DIBROMO-3,4,6-TRIFLUOROANILINE
CAS:232267-32-2
Formula: NC1=C(F)C(Br)=C(F)C(F)=C1Br
BD67422
95+%
MFCD01862003
2,5-DIBROMO-3,4,6-TRIFLUOROPHENOL
CAS:5510-39-4
Formula: OC1=C(F)C(Br)=C(F)C(F)=C1Br
BD257972
95+%
MFCD01861999
2,5-DIBROMO-3,4-DIHYDROXYBENZALDEHYDE
CAS:70625-28-4
Formula: O=CC1=CC(Br)=C(O)C(O)=C1Br
BD583903
97%
2,5-DIBROMO-3,4-DIMETHOXYBENZALDEHYDE
CAS:854660-03-0
Formula: O=CC1=CC(Br)=C(OC)C(OC)=C1Br
BD583905
97%
2,5-DIBROMO-3,6-DIFLUOROANILINE
CAS:702640-60-6
Formula: NC1=C(F)C(Br)=CC(F)=C1Br
BD462962
97%
MFCD20484398
2,5-DIBROMO-3,6-DIFLUOROBENZALDEHYDE
CAS:1263377-10-1
Formula: O=CC1=C(F)C(Br)=CC(F)=C1Br
BD460671
97%
MFCD18379858
2,5-DIBROMO-3,6-DIFLUOROBENZAMIDE
CAS:1803713-73-6
Formula: O=C(N)C1=C(F)C(Br)=CC(F)=C1Br
BD485600
97%
MFCD28783322
2,5-DIBROMO-3,6-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:207853-66-5
Formula: O=S(C1=C(F)C(Br)=CC(F)=C1Br)(Cl)=O
BD67425
95+%
MFCD00052364
2,5-DIBROMO-3,6-DIFLUOROBENZOIC ACID
CAS:1263376-61-9
Formula: O=C(O)C1=C(F)C(Br)=CC(F)=C1Br
BD468846
97%
MFCD18379859
2,5-DIBROMO-3,6-DIFLUOROBENZONITRILE
CAS:1806347-47-6
Formula: N#CC1=C(F)C(Br)=CC(F)=C1Br
BD461374
97%
MFCD28783420
2,5-DIBROMO-3,6-DIHYDROXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4370-59-6
Formula: O=C1C(Br)=C(O)C(C(Br)=C1O)=O
BD118722
95+%
MFCD00058956
2,5-DIBROMO-3,6-DIMETHYLPYRIDINE
CAS:38749-93-8
Formula: CC1=C(Br)C=C(C)C(Br)=N1
BD248787
98%
MFCD00234281
2,5-DIBROMO-3-(2-ETHYLHEXYL)THIOPHENE
CAS:444177-63-3
Formula: CCCCC(CC)CC1=C(Br)SC(Br)=C1
BD254712
95+%
2,5-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:852228-17-2
Formula: BrC1=CN=C(Br)C(B(OC2(C)C)OC2(C)C)=C1
BD161577
95+%
MFCD08689613
2,5-DIBROMO-3-(BROMOMETHYL)PYRIDINE
CAS:61686-65-5
Formula: BrCC1=CC(Br)=CN=C1Br
BD284420
95+%
2,5-DIBROMO-3-(CHLOROMETHYL)PYRIDINE
CAS:N/A
Formula: ClCC1C(Br)=NC=C(Br)C=1
BD00738094
95%
2,5-DIBROMO-3-(DIFLUOROMETHYL)PYRIDIN-4-OL
CAS:1806838-73-2
Formula: OC1=C(C(F)F)C(Br)=NC=C1Br
BD489288
97%
MFCD25486085
2,5-DIBROMO-3-(ETHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OCC)C=C(Br)C=1)O
BD00750158
95%
2,5-DIBROMO-3-(METHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OC)C=C(Br)C=1)O
BD00770270
95%
2,5-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:79623-39-5
Formula: FC(C1=CC(Br)=CN=C1Br)(F)F
BD168963
97%
MFCD13185530
2,5-DIBROMO-3-BUTYLTHIOPHENE
CAS:116971-10-9
Formula: CCCCC1=C(Br)SC(Br)=C1
BD10624
97%
2,5-DIBROMO-3-CHLORO-4-METHYLPYRIDINE
CAS:1335050-94-6
Formula: CC1=C(Cl)C(Br)=NC=C1Br
BD258885
95+%
2,5-DIBROMO-3-CHLOROANILINE
CAS:1449688-58-7
Formula: NC1=CC(Br)=CC(Cl)=C1Br
BD617779
97%
2,5-DIBROMO-3-CHLOROPYRAZINE
CAS:21943-16-8
Formula: ClC1=NC(Br)=CN=C1Br
BD215437
95+%
MFCD18250179
2,5-DIBROMO-3-CHLOROPYRIDINE
CAS:160599-70-2
Formula: ClC1=CC(Br)=CN=C1Br
BD32147
98%
MFCD08277306
2,5-DIBROMO-3-DECYLTHIOPHENE
CAS:158956-23-1
Formula: CCCCCCCCCCC1=C(Br)SC(Br)=C1
BD5693
97%
2,5-DIBROMO-3-DODECYLTHIOPHENE
CAS:148256-63-7
Formula: CCCCCCCCCCCCC1=C(Br)SC(Br)=C1
BD8819
98%
2,5-DIBROMO-3-ETHYLTHIOPHENE
CAS:53119-57-6
Formula: CCC1=C(Br)SC(Br)=C1
BD247025
95+%
MFCD20486051
2,5-DIBROMO-3-FLUOROPYRIDINE
CAS:156772-60-0
Formula: FC1=CC(Br)=CN=C1Br
BD18605
98%
MFCD06659497
2,5-DIBROMO-3-HEXYLTHIOPHENE
CAS:116971-11-0
Formula: CCCCCCC1=C(Br)SC(Br)=C1
BD0220
98%
2,5-DIBROMO-3-IODOPYRAZINE
CAS:1447607-44-4
Formula: IC1=NC(Br)=CN=C1Br
BD439844
97%
MFCD25542083
2,5-DIBROMO-3-IODOPYRIDINE
CAS:1214383-63-7
Formula: IC1=CC(Br)=CN=C1Br
BD260510
95+%
MFCD13185519
2,5-DIBROMO-3-METHOXYPYRAZINE
CAS:489431-66-5
Formula: COC1=NC(Br)=CN=C1Br
BD158276
95+%
MFCD09909711
2,5-DIBROMO-3-METHOXYPYRIDINE
CAS:1142191-57-8
Formula: COC1=CC(Br)=CN=C1Br
BD197172
95+%
2,5-DIBROMO-3-METHYLBENZOIC ACID
CAS:908597-09-1
Formula: O=C(O)C1=CC(Br)=CC(C)=C1Br
BD598710
97%
MFCD18379818
2,5-DIBROMO-3-METHYLFURAN
CAS:89284-16-2
Formula: CC1=C(Br)OC(Br)=C1
BD238751
97%
MFCD11870160
2,5-DIBROMO-3-METHYLPYRAZINE
CAS:1260672-37-4
Formula: CC1=NC(Br)=CN=C1Br
BD302144
95+%
MFCD18250173
2,5-DIBROMO-3-METHYLPYRIDINE
CAS:3430-18-0
Formula: C1=C(Br)C=NC(=C1C)Br
BD3321
98%
MFCD02093085
2,5-DIBROMO-3-NITROPYRAZINE
CAS:1245645-88-8
Formula: O=[N+](C1=NC(Br)=CN=C1Br)[O-]
BD163047
95+%
MFCD18072686
2,5-DIBROMO-3-NITROTHIOPHENE
CAS:2160-51-2
Formula: O=[N+](C1=C(Br)SC(Br)=C1)[O-]
BD67436
95+%
MFCD06660778
2,5-DIBROMO-3-OCTYLTHIOPHENE
CAS:149703-84-4
Formula: CCCCCCCCC1=C(Br)SC(Br)=C1
BD0905
98%
2,5-DIBROMO-4-(4-METHOXYPHENOXY)PYRIMIDINE
CAS:1298101-41-3
Formula: COC1=CC=C(OC2=NC(Br)=NC=C2Br)C=C1
BD269037
95+%
2,5-DIBROMO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1806878-60-3
Formula: OC1=C(C(F)F)C(Br)=CN=C1Br
BD469848
97%
MFCD25486087
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099597-94-0
Formula: FC(C1=CC(Br)=NC=C1Br)(F)F
BD194601
97%
MFCD10699123
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785777-91-5
Formula: FC(C1=NC(Br)=NC=C1Br)(F)F
BD474578
95%
MFCD13176602
2,5-DIBROMO-4-CHLOROPYRIDINE
CAS:1033203-47-2
Formula: ClC1=CC(Br)=NC=C1Br
BD324714
95+%
MFCD11100661
2,5-DIBROMO-4-ETHOXYPYRIDINE
CAS:52311-22-5
Formula: CCOC1=CC(Br)=NC=C1Br
BD583883
97%
2,5-DIBROMO-4-FLUORO-1-METHYL-1H-IMIDAZOLE
CAS:1824064-07-4
Formula: CN1C(Br)=C(F)N=C1Br
BD337384
95+%
MFCD28119174
2,5-DIBROMO-4-FLUOROANILINE
CAS:172377-05-8
Formula: NC1=CC(Br)=C(F)C=C1Br
BD245033
98%
MFCD18089317
2,5-DIBROMO-4-FLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:1123306-72-8
Formula: O=S(C1=CC(Br)=C(F)C=C1Br)(Cl)=O
BD496879
97%
MFCD18089320
2,5-DIBROMO-4-FLUOROBENZENESULFONAMIDE
CAS:1263377-19-0
Formula: O=S(C1=CC(Br)=C(F)C=C1Br)(N)=O
BD455936
97%
MFCD18089322
2,5-DIBROMO-4-FLUOROBENZENETHIOL
CAS:1263376-15-3
Formula: SC1=CC(Br)=C(F)C=C1Br
BD458424
97%
MFCD18089321
2,5-DIBROMO-4-FLUOROBENZONITRILE
CAS:1379326-67-6
Formula: N#CC1=CC(Br)=C(F)C=C1Br
BD303696
97%
MFCD18906828
2,5-DIBROMO-4-FLUOROIODOBENZENE
CAS:1263376-83-5
Formula: FC1=C(Br)C=C(I)C(Br)=C1
BD322983
95+%
MFCD18089319
2,5-DIBROMO-4-FLUOROPYRIDINE
CAS:1033203-46-1
Formula: FC1=CC(Br)=NC=C1Br
BD220036
95+%
2,5-DIBROMO-4-HYDROXYBENZOIC ACID
CAS:101421-19-6
Formula: O=C(O)C1=CC(Br)=C(O)C=C1Br
BD332326
95+%
MFCD10574704
2,5-DIBROMO-4-HYDROXYBENZONITRILE
CAS:1824055-68-6
Formula: N#CC1=CC(Br)=C(O)C=C1Br
BD443691
97%
MFCD28053778
2,5-DIBROMO-4-IODOPYRIDINE
CAS:1061357-86-5
Formula: IC1=CC(Br)=NC=C1Br
BD217782
95+%
2,5-DIBROMO-4-METHOXYPYRIDINE
CAS:1211520-71-6
Formula: COC1=CC(Br)=NC=C1Br
BD563577
97%
MFCD18255776
2,5-DIBROMO-4-METHOXYPYRIMIDINE
CAS:89284-12-8
Formula: COC1=NC(Br)=NC=C1Br
BD269031
95+%
2,5-DIBROMO-4-METHYL-3-NITROPYRIDINE
CAS:947534-69-2
Formula: O=[N+](C1=C(C)C(Br)=CN=C1Br)[O-]
BD67438
98%
MFCD09839233
2,5-DIBROMO-4-METHYLANILINE
CAS:140373-62-2
Formula: NC1=CC(Br)=C(C)C=C1Br
BD220652
95+%
2,5-DIBROMO-4-METHYLBENZALDEHYDE
CAS:706820-09-9
Formula: O=CC1=CC(Br)=C(C)C=C1Br
BD763462
97%
2,5-DIBROMO-4-METHYLBENZOIC ACID
CAS:20871-01-6
Formula: O=C(O)C1=CC(Br)=C(C)C=C1Br
BD748077
97%
2,5-DIBROMO-4-METHYLIMIDAZOLE
CAS:219814-29-6
Formula: CC1=C(N=C([NH]1)Br)Br
BD41463
97+%
MFCD02179519
2,5-DIBROMO-4-METHYLPYRIDINE
CAS:3430-26-0
Formula: CC1=CC(Br)=NC=C1Br
BD20330
98%
MFCD00234955
2,5-DIBROMO-4-METHYLPYRIMIDINE
CAS:171408-73-4
Formula: CC1=NC(Br)=NC=C1Br
BD242293
97%
MFCD13193658
2,5-DIBROMO-4-NITRO-1H-IMIDAZOLE
CAS:6154-30-9
Formula: [O-][N+](=O)C1=C(Br)NC(Br)=N1
BD67443
97%
MFCD11877989
2,5-DIBROMO-4-NITROANILINE
CAS:25462-68-4
Formula: NC1=CC(Br)=C([N+]([O-])=O)C=C1Br
BD331065
95+%
MFCD14582986
2,5-DIBROMO-4-NITROPYRIDINE
CAS:221241-31-2
Formula: O=[N+](C1=CC(Br)=NC=C1Br)[O-]
BD225985
95+%
MFCD16876007
2,5-DIBROMO-6-METHYLPYRIDINE
CAS:39919-65-8
Formula: BrC1=NC(=C(C=C1)Br)C
BD33555
97%
MFCD06254589
2,5-DIBROMO-8-FLUOROQUINOLINE
CAS:1597291-48-9
Formula: FC1=C2N=C(Br)C=CC2=C(Br)C=C1
BD752633
97%
2,5-DIBROMO-N-HYDROXYNICOTINIMIDAMIDE
CAS:N/A
Formula: N=C(C1C=C(Br)C=NC=1Br)NO
BD00747837
95%
2,5-DIBROMO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:1394291-26-9
Formula: O=C(C1=CC(Br)=CN=C1Br)N(OC)C
BD563804
97%
MFCD22543728
2,5-DIBROMOANISOLE
CAS:95970-08-4
Formula: COC1=CC(Br)=CC=C1Br
BD161265
98%
MFCD07780698
2,5-DIBROMOBENZALDEHYDE
CAS:74553-29-0
Formula: BrC1=C(C=O)C=C(C=C1)Br
BD0016
98+%
MFCD00462864
2,5-DIBROMOBENZENE-1,4-DIAMINE
CAS:25462-61-7
Formula: NC1=CC(Br)=C(N)C=C1Br
BD625834
97%
MFCD19441210
2,5-DIBROMOBENZENE-1,4-DIOL
CAS:14753-51-6
Formula: OC1=CC(Br)=C(O)C=C1Br
BD67457
98%
MFCD00192664
2,5-DIBROMOBENZENE-1-SULFONYL CHLORIDE
CAS:23886-64-8
Formula: O=S(C1=CC(Br)=CC=C1Br)(Cl)=O
BD3098
98%
MFCD00060685
2,5-DIBROMOBENZENESULFONAMIDE
CAS:7467-11-0
Formula: O=S(C1=CC(Br)=CC=C1Br)(N)=O
BD67450
95+%
MFCD00460436
2,5-DIBROMOBENZO[D]OXAZOLE
CAS:1520623-36-2
Formula: BrC1C=C2N=C(Br)OC2=CC=1
BD00747040
95+%
n/a
2,5-DIBROMOBENZOIC ACID
CAS:610-71-9
Formula: C1=C(Br)C=CC(=C1C(O)=O)Br
BD4113
98%
MFCD00016494
2,5-DIBROMOBENZONITRILE
CAS:57381-41-6
Formula: N#CC1=CC(Br)=CC=C1Br
BD323915
95+%
MFCD00672994
2,5-DIBROMOBENZOTHIAZOLE
CAS:1019111-64-8
Formula: BrC1=NC2=C(S1)C=CC(=C2)Br
BD161928
95+%
MFCD09749228
2,5-DIBROMOCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:1633-14-3
Formula: O=C1C(Br)=CC(C(Br)=C1)=O
BD67418
95+%
2,5-DIBROMOFURAN-3-CARBOXYLIC ACID
CAS:32460-22-3
Formula: OC(=O)C1=C(Br)OC(Br)=C1
BD216476
95+%
MFCD21603840
2,5-DIBROMOHEXANEDIAMIDE
CAS:99584-96-0
Formula: O=C(N)C(Br)CCC(Br)C(N)=O
BD389324
95+%
MFCD27976335
2,5-DIBROMOHEXANEDIOIC ACID
CAS:3479-85-4
Formula: O=C(O)C(Br)CCC(Br)C(O)=O
BD67447
95+%
MFCD00046516
2,5-DIBROMOISONICOTINIC ACID
CAS:942473-59-8
Formula: BrC1=NC=C(C(=C1)C(=O)O)Br
BD168839
97%
MFCD08741485
2,5-DIBROMOISOPHTHALIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)O)C=C(Br)C=1)O
BD00753772
95%
2,5-DIBROMONICOTINALDEHYDE
CAS:852181-11-4
Formula: O=CC1=C(Br)N=CC(Br)=C1
BD67459
95+%
MFCD07368560
2,5-DIBROMONICOTINAMIDE
CAS:1394291-40-7
Formula: O=C(N)C1=C(Br)N=CC(Br)=C1
BD563812
97%
MFCD22543724
2,5-DIBROMONICOTINIC ACID
CAS:29312-99-0
Formula: BrC1=C(C(=O)O)C=C(C=N1)Br
BD67460
97%
MFCD06254512